-!function(e){var t={};function n(r){if(t[r])return t[r].exports;var i=t[r]={i:r,l:!1,exports:{}};return e[r].call(i.exports,i,i.exports,n),i.l=!0,i.exports}n.m=e,n.c=t,n.d=function(e,t,r){n.o(e,t)||Object.defineProperty(e,t,{enumerable:!0,get:r})},n.r=function(e){"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(e,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(e,"__esModule",{value:!0})},n.t=function(e,t){if(1&t&&(e=n(e)),8&t)return e;if(4&t&&"object"==typeof e&&e&&e.__esModule)return e;var r=Object.create(null);if(n.r(r),Object.defineProperty(r,"default",{enumerable:!0,value:e}),2&t&&"string"!=typeof e)for(var i in e)n.d(r,i,function(t){return e[t]}.bind(null,i));return r},n.n=function(e){var t=e&&e.__esModule?function(){return e.default}:function(){return e};return n.d(t,"a",t),t},n.o=function(e,t){return Object.prototype.hasOwnProperty.call(e,t)},n.p="/",n(n.s=11)}([function(e,t,n){"use strict";var r=n(5),i=n(19),o=Object.prototype.toString;function a(e){return"[object Array]"===o.call(e)}function s(e){return null!==e&&"object"==typeof e}function u(e){return"[object Function]"===o.call(e)}function c(e,t){if(null!=e)if("object"!=typeof e&&(e=[e]),a(e))for(var n=0,r=e.length;n<r;n++)t.call(null,e[n],n,e);else for(var i in e)Object.prototype.hasOwnProperty.call(e,i)&&t.call(null,e[i],i,e)}e.exports={isArray:a,isArrayBuffer:function(e){return"[object ArrayBuffer]"===o.call(e)},isBuffer:i,isFormData:function(e){return"undefined"!=typeof FormData&&e instanceof FormData},isArrayBufferView:function(e){return"undefined"!=typeof ArrayBuffer&&ArrayBuffer.isView?ArrayBuffer.isView(e):e&&e.buffer&&e.buffer instanceof ArrayBuffer},isString:function(e){return"string"==typeof e},isNumber:function(e){return"number"==typeof e},isObject:s,isUndefined:function(e){return void 0===e},isDate:function(e){return"[object Date]"===o.call(e)},isFile:function(e){return"[object File]"===o.call(e)},isBlob:function(e){return"[object Blob]"===o.call(e)},isFunction:u,isStream:function(e){return s(e)&&u(e.pipe)},isURLSearchParams:function(e){return"undefined"!=typeof URLSearchParams&&e instanceof URLSearchParams},isStandardBrowserEnv:function(){return("undefined"==typeof navigator||"ReactNative"!==navigator.product)&&"undefined"!=typeof window&&"undefined"!=typeof document},forEach:c,merge:function e(){var t={};function n(n,r){"object"==typeof t[r]&&"object"==typeof n?t[r]=e(t[r],n):t[r]=n}for(var r=0,i=arguments.length;r<i;r++)c(arguments[r],n);return t},extend:function(e,t,n){return c(t,function(t,i){e[i]=n&&"function"==typeof t?r(t,n):t}),e},trim:function(e){return e.replace(/^\s*/,"").replace(/\s*$/,"")}}},function(e,t){var n;n=function(){return this}();try{n=n||new Function("return this")()}catch(e){"object"==typeof window&&(n=window)}e.exports=n},function(e,t,n){"use strict";(function(t){var r=n(0),i=n(21),o={"Content-Type":"application/x-www-form-urlencoded"};function a(e,t){!r.isUndefined(e)&&r.isUndefined(e["Content-Type"])&&(e["Content-Type"]=t)}var s,u={adapter:("undefined"!=typeof XMLHttpRequest?s=n(7):void 0!==t&&(s=n(7)),s),transformRequest:[function(e,t){return i(t,"Content-Type"),r.isFormData(e)||r.isArrayBuffer(e)||r.isBuffer(e)||r.isStream(e)||r.isFile(e)||r.isBlob(e)?e:r.isArrayBufferView(e)?e.buffer:r.isURLSearchParams(e)?(a(t,"application/x-www-form-urlencoded;charset=utf-8"),e.toString()):r.isObject(e)?(a(t,"application/json;charset=utf-8"),JSON.stringify(e)):e}],transformResponse:[function(e){if("string"==typeof e)try{e=JSON.parse(e)}catch(e){}return e}],timeout:0,xsrfCookieName:"XSRF-TOKEN",xsrfHeaderName:"X-XSRF-TOKEN",maxContentLength:-1,validateStatus:function(e){return e>=200&&e<300}};u.headers={common:{Accept:"application/json, text/plain, */*"}},r.forEach(["delete","get","head"],function(e){u.headers[e]={}}),r.forEach(["post","put","patch"],function(e){u.headers[e]=r.merge(o)}),e.exports=u}).call(this,n(6))},function(e,t,n){"use strict";n.r(t),function(e){for(var n="undefined"!=typeof window&&"undefined"!=typeof document,r=["Edge","Trident","Firefox"],i=0,o=0;o<r.length;o+=1)if(n&&navigator.userAgent.indexOf(r[o])>=0){i=1;break}var a=n&&window.Promise?function(e){var t=!1;return function(){t||(t=!0,window.Promise.resolve().then(function(){t=!1,e()}))}}:function(e){var t=!1;return function(){t||(t=!0,setTimeout(function(){t=!1,e()},i))}};function s(e){return e&&"[object Function]"==={}.toString.call(e)}function u(e,t){if(1!==e.nodeType)return[];var n=e.ownerDocument.defaultView.getComputedStyle(e,null);return t?n[t]:n}function c(e){return"HTML"===e.nodeName?e:e.parentNode||e.host}function l(e){if(!e)return document.body;switch(e.nodeName){case"HTML":case"BODY":return e.ownerDocument.body;case"#document":return e.body}var t=u(e),n=t.overflow,r=t.overflowX,i=t.overflowY;return/(auto|scroll|overlay)/.test(n+i+r)?e:l(c(e))}var f=n&&!(!window.MSInputMethodContext||!document.documentMode),p=n&&/MSIE 10/.test(navigator.userAgent);function d(e){return 11===e?f:10===e?p:f||p}function h(e){if(!e)return document.documentElement;for(var t=d(10)?document.body:null,n=e.offsetParent||null;n===t&&e.nextElementSibling;)n=(e=e.nextElementSibling).offsetParent;var r=n&&n.nodeName;return r&&"BODY"!==r&&"HTML"!==r?-1!==["TH","TD","TABLE"].indexOf(n.nodeName)&&"static"===u(n,"position")?h(n):n:e?e.ownerDocument.documentElement:document.documentElement}function v(e){return null!==e.parentNode?v(e.parentNode):e}function g(e,t){if(!(e&&e.nodeType&&t&&t.nodeType))return document.documentElement;var n=e.compareDocumentPosition(t)&Node.DOCUMENT_POSITION_FOLLOWING,r=n?e:t,i=n?t:e,o=document.createRange();o.setStart(r,0),o.setEnd(i,0);var a,s,u=o.commonAncestorContainer;if(e!==u&&t!==u||r.contains(i))return"BODY"===(s=(a=u).nodeName)||"HTML"!==s&&h(a.firstElementChild)!==a?h(u):u;var c=v(e);return c.host?g(c.host,t):g(e,v(t).host)}function m(e){var t="top"===(arguments.length>1&&void 0!==arguments[1]?arguments[1]:"top")?"scrollTop":"scrollLeft",n=e.nodeName;if("BODY"===n||"HTML"===n){var r=e.ownerDocument.documentElement;return(e.ownerDocument.scrollingElement||r)[t]}return e[t]}function y(e,t){var n="x"===t?"Left":"Top",r="Left"===n?"Right":"Bottom";return parseFloat(e["border"+n+"Width"],10)+parseFloat(e["border"+r+"Width"],10)}function _(e,t,n,r){return Math.max(t["offset"+e],t["scroll"+e],n["client"+e],n["offset"+e],n["scroll"+e],d(10)?parseInt(n["offset"+e])+parseInt(r["margin"+("Height"===e?"Top":"Left")])+parseInt(r["margin"+("Height"===e?"Bottom":"Right")]):0)}function b(e){var t=e.body,n=e.documentElement,r=d(10)&&getComputedStyle(n);return{height:_("Height",t,n,r),width:_("Width",t,n,r)}}var w=function(e,t){if(!(e instanceof t))throw new TypeError("Cannot call a class as a function")},E=function(){function e(e,t){for(var n=0;n<t.length;n++){var r=t[n];r.enumerable=r.enumerable||!1,r.configurable=!0,"value"in r&&(r.writable=!0),Object.defineProperty(e,r.key,r)}}return function(t,n,r){return n&&e(t.prototype,n),r&&e(t,r),t}}(),T=function(e,t,n){return t in e?Object.defineProperty(e,t,{value:n,enumerable:!0,configurable:!0,writable:!0}):e[t]=n,e},C=Object.assign||function(e){for(var t=1;t<arguments.length;t++){var n=arguments[t];for(var r in n)Object.prototype.hasOwnProperty.call(n,r)&&(e[r]=n[r])}return e};function x(e){return C({},e,{right:e.left+e.width,bottom:e.top+e.height})}function A(e){var t={};try{if(d(10)){t=e.getBoundingClientRect();var n=m(e,"top"),r=m(e,"left");t.top+=n,t.left+=r,t.bottom+=n,t.right+=r}else t=e.getBoundingClientRect()}catch(e){}var i={left:t.left,top:t.top,width:t.right-t.left,height:t.bottom-t.top},o="HTML"===e.nodeName?b(e.ownerDocument):{},a=o.width||e.clientWidth||i.right-i.left,s=o.height||e.clientHeight||i.bottom-i.top,c=e.offsetWidth-a,l=e.offsetHeight-s;if(c||l){var f=u(e);c-=y(f,"x"),l-=y(f,"y"),i.width-=c,i.height-=l}return x(i)}function S(e,t){var n=arguments.length>2&&void 0!==arguments[2]&&arguments[2],r=d(10),i="HTML"===t.nodeName,o=A(e),a=A(t),s=l(e),c=u(t),f=parseFloat(c.borderTopWidth,10),p=parseFloat(c.borderLeftWidth,10);n&&i&&(a.top=Math.max(a.top,0),a.left=Math.max(a.left,0));var h=x({top:o.top-a.top-f,left:o.left-a.left-p,width:o.width,height:o.height});if(h.marginTop=0,h.marginLeft=0,!r&&i){var v=parseFloat(c.marginTop,10),g=parseFloat(c.marginLeft,10);h.top-=f-v,h.bottom-=f-v,h.left-=p-g,h.right-=p-g,h.marginTop=v,h.marginLeft=g}return(r&&!n?t.contains(s):t===s&&"BODY"!==s.nodeName)&&(h=function(e,t){var n=arguments.length>2&&void 0!==arguments[2]&&arguments[2],r=m(t,"top"),i=m(t,"left"),o=n?-1:1;return e.top+=r*o,e.bottom+=r*o,e.left+=i*o,e.right+=i*o,e}(h,t)),h}function O(e){if(!e||!e.parentElement||d())return document.documentElement;for(var t=e.parentElement;t&&"none"===u(t,"transform");)t=t.parentElement;return t||document.documentElement}function D(e,t,n,r){var i=arguments.length>4&&void 0!==arguments[4]&&arguments[4],o={top:0,left:0},a=i?O(e):g(e,t);if("viewport"===r)o=function(e){var t=arguments.length>1&&void 0!==arguments[1]&&arguments[1],n=e.ownerDocument.documentElement,r=S(e,n),i=Math.max(n.clientWidth,window.innerWidth||0),o=Math.max(n.clientHeight,window.innerHeight||0),a=t?0:m(n),s=t?0:m(n,"left");return x({top:a-r.top+r.marginTop,left:s-r.left+r.marginLeft,width:i,height:o})}(a,i);else{var s=void 0;"scrollParent"===r?"BODY"===(s=l(c(t))).nodeName&&(s=e.ownerDocument.documentElement):s="window"===r?e.ownerDocument.documentElement:r;var f=S(s,a,i);if("HTML"!==s.nodeName||function e(t){var n=t.nodeName;if("BODY"===n||"HTML"===n)return!1;if("fixed"===u(t,"position"))return!0;var r=c(t);return!!r&&e(r)}(a))o=f;else{var p=b(e.ownerDocument),d=p.height,h=p.width;o.top+=f.top-f.marginTop,o.bottom=d+f.top,o.left+=f.left-f.marginLeft,o.right=h+f.left}}var v="number"==typeof(n=n||0);return o.left+=v?n:n.left||0,o.top+=v?n:n.top||0,o.right-=v?n:n.right||0,o.bottom-=v?n:n.bottom||0,o}function I(e,t,n,r,i){var o=arguments.length>5&&void 0!==arguments[5]?arguments[5]:0;if(-1===e.indexOf("auto"))return e;var a=D(n,r,o,i),s={top:{width:a.width,height:t.top-a.top},right:{width:a.right-t.right,height:a.height},bottom:{width:a.width,height:a.bottom-t.bottom},left:{width:t.left-a.left,height:a.height}},u=Object.keys(s).map(function(e){return C({key:e},s[e],{area:(t=s[e],t.width*t.height)});var t}).sort(function(e,t){return t.area-e.area}),c=u.filter(function(e){var t=e.width,r=e.height;return t>=n.clientWidth&&r>=n.clientHeight}),l=c.length>0?c[0].key:u[0].key,f=e.split("-")[1];return l+(f?"-"+f:"")}function N(e,t,n){var r=arguments.length>3&&void 0!==arguments[3]?arguments[3]:null;return S(n,r?O(t):g(t,n),r)}function k(e){var t=e.ownerDocument.defaultView.getComputedStyle(e),n=parseFloat(t.marginTop||0)+parseFloat(t.marginBottom||0),r=parseFloat(t.marginLeft||0)+parseFloat(t.marginRight||0);return{width:e.offsetWidth+r,height:e.offsetHeight+n}}function L(e){var t={left:"right",right:"left",bottom:"top",top:"bottom"};return e.replace(/left|right|bottom|top/g,function(e){return t[e]})}function j(e,t,n){n=n.split("-")[0];var r=k(e),i={width:r.width,height:r.height},o=-1!==["right","left"].indexOf(n),a=o?"top":"left",s=o?"left":"top",u=o?"height":"width",c=o?"width":"height";return i[a]=t[a]+t[u]/2-r[u]/2,i[s]=n===s?t[s]-r[c]:t[L(s)],i}function R(e,t){return Array.prototype.find?e.find(t):e.filter(t)[0]}function P(e,t,n){return(void 0===n?e:e.slice(0,function(e,t,n){if(Array.prototype.findIndex)return e.findIndex(function(e){return e[t]===n});var r=R(e,function(e){return e[t]===n});return e.indexOf(r)}(e,"name",n))).forEach(function(e){e.function&&console.warn("`modifier.function` is deprecated, use `modifier.fn`!");var n=e.function||e.fn;e.enabled&&s(n)&&(t.offsets.popper=x(t.offsets.popper),t.offsets.reference=x(t.offsets.reference),t=n(t,e))}),t}function $(e,t){return e.some(function(e){var n=e.name;return e.enabled&&n===t})}function H(e){for(var t=[!1,"ms","Webkit","Moz","O"],n=e.charAt(0).toUpperCase()+e.slice(1),r=0;r<t.length;r++){var i=t[r],o=i?""+i+n:e;if(void 0!==document.body.style[o])return o}return null}function M(e){var t=e.ownerDocument;return t?t.defaultView:window}function F(e,t,n,r){n.updateBound=r,M(e).addEventListener("resize",n.updateBound,{passive:!0});var i=l(e);return function e(t,n,r,i){var o="BODY"===t.nodeName,a=o?t.ownerDocument.defaultView:t;a.addEventListener(n,r,{passive:!0}),o||e(l(a.parentNode),n,r,i),i.push(a)}(i,"scroll",n.updateBound,n.scrollParents),n.scrollElement=i,n.eventsEnabled=!0,n}function W(){var e,t;this.state.eventsEnabled&&(cancelAnimationFrame(this.scheduleUpdate),this.state=(e=this.reference,t=this.state,M(e).removeEventListener("resize",t.updateBound),t.scrollParents.forEach(function(e){e.removeEventListener("scroll",t.updateBound)}),t.updateBound=null,t.scrollParents=[],t.scrollElement=null,t.eventsEnabled=!1,t))}function U(e){return""!==e&&!isNaN(parseFloat(e))&&isFinite(e)}function B(e,t){Object.keys(t).forEach(function(n){var r="";-1!==["width","height","top","right","bottom","left"].indexOf(n)&&U(t[n])&&(r="px"),e.style[n]=t[n]+r})}var q=n&&/Firefox/i.test(navigator.userAgent);function V(e,t,n){var r=R(e,function(e){return e.name===t}),i=!!r&&e.some(function(e){return e.name===n&&e.enabled&&e.order<r.order});if(!i){var o="`"+t+"`",a="`"+n+"`";console.warn(a+" modifier is required by "+o+" modifier in order to work, be sure to include it before "+o+"!")}return i}var z=["auto-start","auto","auto-end","top-start","top","top-end","right-start","right","right-end","bottom-end","bottom","bottom-start","left-end","left","left-start"],G=z.slice(3);function K(e){var t=arguments.length>1&&void 0!==arguments[1]&&arguments[1],n=G.indexOf(e),r=G.slice(n+1).concat(G.slice(0,n));return t?r.reverse():r}var X={FLIP:"flip",CLOCKWISE:"clockwise",COUNTERCLOCKWISE:"counterclockwise"};function Q(e,t,n,r){var i=[0,0],o=-1!==["right","left"].indexOf(r),a=e.split(/(\+|\-)/).map(function(e){return e.trim()}),s=a.indexOf(R(a,function(e){return-1!==e.search(/,|\s/)}));a[s]&&-1===a[s].indexOf(",")&&console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");var u=/\s*,\s*|\s+/,c=-1!==s?[a.slice(0,s).concat([a[s].split(u)[0]]),[a[s].split(u)[1]].concat(a.slice(s+1))]:[a];return(c=c.map(function(e,r){var i=(1===r?!o:o)?"height":"width",a=!1;return e.reduce(function(e,t){return""===e[e.length-1]&&-1!==["+","-"].indexOf(t)?(e[e.length-1]=t,a=!0,e):a?(e[e.length-1]+=t,a=!1,e):e.concat(t)},[]).map(function(e){return function(e,t,n,r){var i=e.match(/((?:\-|\+)?\d*\.?\d*)(.*)/),o=+i[1],a=i[2];if(!o)return e;if(0===a.indexOf("%")){var s=void 0;switch(a){case"%p":s=n;break;case"%":case"%r":default:s=r}return x(s)[t]/100*o}if("vh"===a||"vw"===a)return("vh"===a?Math.max(document.documentElement.clientHeight,window.innerHeight||0):Math.max(document.documentElement.clientWidth,window.innerWidth||0))/100*o;return o}(e,i,t,n)})})).forEach(function(e,t){e.forEach(function(n,r){U(n)&&(i[t]+=n*("-"===e[r-1]?-1:1))})}),i}var Y={placement:"bottom",positionFixed:!1,eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(e){var t=e.placement,n=t.split("-")[0],r=t.split("-")[1];if(r){var i=e.offsets,o=i.reference,a=i.popper,s=-1!==["bottom","top"].indexOf(n),u=s?"left":"top",c=s?"width":"height",l={start:T({},u,o[u]),end:T({},u,o[u]+o[c]-a[c])};e.offsets.popper=C({},a,l[r])}return e}},offset:{order:200,enabled:!0,fn:function(e,t){var n=t.offset,r=e.placement,i=e.offsets,o=i.popper,a=i.reference,s=r.split("-")[0],u=void 0;return u=U(+n)?[+n,0]:Q(n,o,a,s),"left"===s?(o.top+=u[0],o.left-=u[1]):"right"===s?(o.top+=u[0],o.left+=u[1]):"top"===s?(o.left+=u[0],o.top-=u[1]):"bottom"===s&&(o.left+=u[0],o.top+=u[1]),e.popper=o,e},offset:0},preventOverflow:{order:300,enabled:!0,fn:function(e,t){var n=t.boundariesElement||h(e.instance.popper);e.instance.reference===n&&(n=h(n));var r=H("transform"),i=e.instance.popper.style,o=i.top,a=i.left,s=i[r];i.top="",i.left="",i[r]="";var u=D(e.instance.popper,e.instance.reference,t.padding,n,e.positionFixed);i.top=o,i.left=a,i[r]=s,t.boundaries=u;var c=t.priority,l=e.offsets.popper,f={primary:function(e){var n=l[e];return l[e]<u[e]&&!t.escapeWithReference&&(n=Math.max(l[e],u[e])),T({},e,n)},secondary:function(e){var n="right"===e?"left":"top",r=l[n];return l[e]>u[e]&&!t.escapeWithReference&&(r=Math.min(l[n],u[e]-("right"===e?l.width:l.height))),T({},n,r)}};return c.forEach(function(e){var t=-1!==["left","top"].indexOf(e)?"primary":"secondary";l=C({},l,f[t](e))}),e.offsets.popper=l,e},priority:["left","right","top","bottom"],padding:5,boundariesElement:"scrollParent"},keepTogether:{order:400,enabled:!0,fn:function(e){var t=e.offsets,n=t.popper,r=t.reference,i=e.placement.split("-")[0],o=Math.floor,a=-1!==["top","bottom"].indexOf(i),s=a?"right":"bottom",u=a?"left":"top",c=a?"width":"height";return n[s]<o(r[u])&&(e.offsets.popper[u]=o(r[u])-n[c]),n[u]>o(r[s])&&(e.offsets.popper[u]=o(r[s])),e}},arrow:{order:500,enabled:!0,fn:function(e,t){var n;if(!V(e.instance.modifiers,"arrow","keepTogether"))return e;var r=t.element;if("string"==typeof r){if(!(r=e.instance.popper.querySelector(r)))return e}else if(!e.instance.popper.contains(r))return console.warn("WARNING: `arrow.element` must be child of its popper element!"),e;var i=e.placement.split("-")[0],o=e.offsets,a=o.popper,s=o.reference,c=-1!==["left","right"].indexOf(i),l=c?"height":"width",f=c?"Top":"Left",p=f.toLowerCase(),d=c?"left":"top",h=c?"bottom":"right",v=k(r)[l];s[h]-v<a[p]&&(e.offsets.popper[p]-=a[p]-(s[h]-v)),s[p]+v>a[h]&&(e.offsets.popper[p]+=s[p]+v-a[h]),e.offsets.popper=x(e.offsets.popper);var g=s[p]+s[l]/2-v/2,m=u(e.instance.popper),y=parseFloat(m["margin"+f],10),_=parseFloat(m["border"+f+"Width"],10),b=g-e.offsets.popper[p]-y-_;return b=Math.max(Math.min(a[l]-v,b),0),e.arrowElement=r,e.offsets.arrow=(T(n={},p,Math.round(b)),T(n,d,""),n),e},element:"[x-arrow]"},flip:{order:600,enabled:!0,fn:function(e,t){if($(e.instance.modifiers,"inner"))return e;if(e.flipped&&e.placement===e.originalPlacement)return e;var n=D(e.instance.popper,e.instance.reference,t.padding,t.boundariesElement,e.positionFixed),r=e.placement.split("-")[0],i=L(r),o=e.placement.split("-")[1]||"",a=[];switch(t.behavior){case X.FLIP:a=[r,i];break;case X.CLOCKWISE:a=K(r);break;case X.COUNTERCLOCKWISE:a=K(r,!0);break;default:a=t.behavior}return a.forEach(function(s,u){if(r!==s||a.length===u+1)return e;r=e.placement.split("-")[0],i=L(r);var c=e.offsets.popper,l=e.offsets.reference,f=Math.floor,p="left"===r&&f(c.right)>f(l.left)||"right"===r&&f(c.left)<f(l.right)||"top"===r&&f(c.bottom)>f(l.top)||"bottom"===r&&f(c.top)<f(l.bottom),d=f(c.left)<f(n.left),h=f(c.right)>f(n.right),v=f(c.top)<f(n.top),g=f(c.bottom)>f(n.bottom),m="left"===r&&d||"right"===r&&h||"top"===r&&v||"bottom"===r&&g,y=-1!==["top","bottom"].indexOf(r),_=!!t.flipVariations&&(y&&"start"===o&&d||y&&"end"===o&&h||!y&&"start"===o&&v||!y&&"end"===o&&g);(p||m||_)&&(e.flipped=!0,(p||m)&&(r=a[u+1]),_&&(o=function(e){return"end"===e?"start":"start"===e?"end":e}(o)),e.placement=r+(o?"-"+o:""),e.offsets.popper=C({},e.offsets.popper,j(e.instance.popper,e.offsets.reference,e.placement)),e=P(e.instance.modifiers,e,"flip"))}),e},behavior:"flip",padding:5,boundariesElement:"viewport"},inner:{order:700,enabled:!1,fn:function(e){var t=e.placement,n=t.split("-")[0],r=e.offsets,i=r.popper,o=r.reference,a=-1!==["left","right"].indexOf(n),s=-1===["top","left"].indexOf(n);return i[a?"left":"top"]=o[n]-(s?i[a?"width":"height"]:0),e.placement=L(t),e.offsets.popper=x(i),e}},hide:{order:800,enabled:!0,fn:function(e){if(!V(e.instance.modifiers,"hide","preventOverflow"))return e;var t=e.offsets.reference,n=R(e.instance.modifiers,function(e){return"preventOverflow"===e.name}).boundaries;if(t.bottom<n.top||t.left>n.right||t.top>n.bottom||t.right<n.left){if(!0===e.hide)return e;e.hide=!0,e.attributes["x-out-of-boundaries"]=""}else{if(!1===e.hide)return e;e.hide=!1,e.attributes["x-out-of-boundaries"]=!1}return e}},computeStyle:{order:850,enabled:!0,fn:function(e,t){var n=t.x,r=t.y,i=e.offsets.popper,o=R(e.instance.modifiers,function(e){return"applyStyle"===e.name}).gpuAcceleration;void 0!==o&&console.warn("WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!");var a=void 0!==o?o:t.gpuAcceleration,s=h(e.instance.popper),u=A(s),c={position:i.position},l=function(e,t){var n=e.offsets,r=n.popper,i=n.reference,o=Math.round,a=Math.floor,s=function(e){return e},u=o(i.width),c=o(r.width),l=-1!==["left","right"].indexOf(e.placement),f=-1!==e.placement.indexOf("-"),p=t?l||f||u%2==c%2?o:a:s,d=t?o:s;return{left:p(u%2==1&&c%2==1&&!f&&t?r.left-1:r.left),top:d(r.top),bottom:d(r.bottom),right:p(r.right)}}(e,window.devicePixelRatio<2||!q),f="bottom"===n?"top":"bottom",p="right"===r?"left":"right",d=H("transform"),v=void 0,g=void 0;if(g="bottom"===f?"HTML"===s.nodeName?-s.clientHeight+l.bottom:-u.height+l.bottom:l.top,v="right"===p?"HTML"===s.nodeName?-s.clientWidth+l.right:-u.width+l.right:l.left,a&&d)c[d]="translate3d("+v+"px, "+g+"px, 0)",c[f]=0,c[p]=0,c.willChange="transform";else{var m="bottom"===f?-1:1,y="right"===p?-1:1;c[f]=g*m,c[p]=v*y,c.willChange=f+", "+p}var _={"x-placement":e.placement};return e.attributes=C({},_,e.attributes),e.styles=C({},c,e.styles),e.arrowStyles=C({},e.offsets.arrow,e.arrowStyles),e},gpuAcceleration:!0,x:"bottom",y:"right"},applyStyle:{order:900,enabled:!0,fn:function(e){var t,n;return B(e.instance.popper,e.styles),t=e.instance.popper,n=e.attributes,Object.keys(n).forEach(function(e){!1!==n[e]?t.setAttribute(e,n[e]):t.removeAttribute(e)}),e.arrowElement&&Object.keys(e.arrowStyles).length&&B(e.arrowElement,e.arrowStyles),e},onLoad:function(e,t,n,r,i){var o=N(i,t,e,n.positionFixed),a=I(n.placement,o,t,e,n.modifiers.flip.boundariesElement,n.modifiers.flip.padding);return t.setAttribute("x-placement",a),B(t,{position:n.positionFixed?"fixed":"absolute"}),n},gpuAcceleration:void 0}}},J=function(){function e(t,n){var r=this,i=arguments.length>2&&void 0!==arguments[2]?arguments[2]:{};w(this,e),this.scheduleUpdate=function(){return requestAnimationFrame(r.update)},this.update=a(this.update.bind(this)),this.options=C({},e.Defaults,i),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=t&&t.jquery?t[0]:t,this.popper=n&&n.jquery?n[0]:n,this.options.modifiers={},Object.keys(C({},e.Defaults.modifiers,i.modifiers)).forEach(function(t){r.options.modifiers[t]=C({},e.Defaults.modifiers[t]||{},i.modifiers?i.modifiers[t]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(e){return C({name:e},r.options.modifiers[e])}).sort(function(e,t){return e.order-t.order}),this.modifiers.forEach(function(e){e.enabled&&s(e.onLoad)&&e.onLoad(r.reference,r.popper,r.options,e,r.state)}),this.update();var o=this.options.eventsEnabled;o&&this.enableEventListeners(),this.state.eventsEnabled=o}return E(e,[{key:"update",value:function(){return function(){if(!this.state.isDestroyed){var e={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};e.offsets.reference=N(this.state,this.popper,this.reference,this.options.positionFixed),e.placement=I(this.options.placement,e.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),e.originalPlacement=e.placement,e.positionFixed=this.options.positionFixed,e.offsets.popper=j(this.popper,e.offsets.reference,e.placement),e.offsets.popper.position=this.options.positionFixed?"fixed":"absolute",e=P(this.modifiers,e),this.state.isCreated?this.options.onUpdate(e):(this.state.isCreated=!0,this.options.onCreate(e))}}.call(this)}},{key:"destroy",value:function(){return function(){return this.state.isDestroyed=!0,$(this.modifiers,"applyStyle")&&(this.popper.removeAttribute("x-placement"),this.popper.style.position="",this.popper.style.top="",this.popper.style.left="",this.popper.style.right="",this.popper.style.bottom="",this.popper.style.willChange="",this.popper.style[H("transform")]=""),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}.call(this)}},{key:"enableEventListeners",value:function(){return function(){this.state.eventsEnabled||(this.state=F(this.reference,this.options,this.state,this.scheduleUpdate))}.call(this)}},{key:"disableEventListeners",value:function(){return W.call(this)}}]),e}();J.Utils=("undefined"!=typeof window?window:e).PopperUtils,J.placements=z,J.Defaults=Y,t.default=J}.call(this,n(1))},function(e,t,n){var r;!function(t,n){"use strict";"object"==typeof e.exports?e.exports=t.document?n(t,!0):function(e){if(!e.document)throw new Error("jQuery requires a window with a document");return n(e)}:n(t)}("undefined"!=typeof window?window:this,function(n,i){"use strict";var o=[],a=n.document,s=Object.getPrototypeOf,u=o.slice,c=o.concat,l=o.push,f=o.indexOf,p={},d=p.toString,h=p.hasOwnProperty,v=h.toString,g=v.call(Object),m={},y=function(e){return"function"==typeof e&&"number"!=typeof e.nodeType},_=function(e){return null!=e&&e===e.window},b={type:!0,src:!0,noModule:!0};function w(e,t,n){var r,i=(t=t||a).createElement("script");if(i.text=e,n)for(r in b)n[r]&&(i[r]=n[r]);t.head.appendChild(i).parentNode.removeChild(i)}function E(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?p[d.call(e)]||"object":typeof e}var T=function(e,t){return new T.fn.init(e,t)},C=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g;function x(e){var t=!!e&&"length"in e&&e.length,n=E(e);return!y(e)&&!_(e)&&("array"===n||0===t||"number"==typeof t&&t>0&&t-1 in e)}T.fn=T.prototype={jquery:"3.3.1",constructor:T,length:0,toArray:function(){return u.call(this)},get:function(e){return null==e?u.call(this):e<0?this[e+this.length]:this[e]},pushStack:function(e){var t=T.merge(this.constructor(),e);return t.prevObject=this,t},each:function(e){return T.each(this,e)},map:function(e){return this.pushStack(T.map(this,function(t,n){return e.call(t,n,t)}))},slice:function(){return this.pushStack(u.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(e){var t=this.length,n=+e+(e<0?t:0);return this.pushStack(n>=0&&n<t?[this[n]]:[])},end:function(){return this.prevObject||this.constructor()},push:l,sort:o.sort,splice:o.splice},T.extend=T.fn.extend=function(){var e,t,n,r,i,o,a=arguments[0]||{},s=1,u=arguments.length,c=!1;for("boolean"==typeof a&&(c=a,a=arguments[s]||{},s++),"object"==typeof a||y(a)||(a={}),s===u&&(a=this,s--);s<u;s++)if(null!=(e=arguments[s]))for(t in e)n=a[t],a!==(r=e[t])&&(c&&r&&(T.isPlainObject(r)||(i=Array.isArray(r)))?(i?(i=!1,o=n&&Array.isArray(n)?n:[]):o=n&&T.isPlainObject(n)?n:{},a[t]=T.extend(c,o,r)):void 0!==r&&(a[t]=r));return a},T.extend({expando:"jQuery"+("3.3.1"+Math.random()).replace(/\D/g,""),isReady:!0,error:function(e){throw new Error(e)},noop:function(){},isPlainObject:function(e){var t,n;return!(!e||"[object Object]"!==d.call(e))&&(!(t=s(e))||"function"==typeof(n=h.call(t,"constructor")&&t.constructor)&&v.call(n)===g)},isEmptyObject:function(e){var t;for(t in e)return!1;return!0},globalEval:function(e){w(e)},each:function(e,t){var n,r=0;if(x(e))for(n=e.length;r<n&&!1!==t.call(e[r],r,e[r]);r++);else for(r in e)if(!1===t.call(e[r],r,e[r]))break;return e},trim:function(e){return null==e?"":(e+"").replace(C,"")},makeArray:function(e,t){var n=t||[];return null!=e&&(x(Object(e))?T.merge(n,"string"==typeof e?[e]:e):l.call(n,e)),n},inArray:function(e,t,n){return null==t?-1:f.call(t,e,n)},merge:function(e,t){for(var n=+t.length,r=0,i=e.length;r<n;r++)e[i++]=t[r];return e.length=i,e},grep:function(e,t,n){for(var r=[],i=0,o=e.length,a=!n;i<o;i++)!t(e[i],i)!==a&&r.push(e[i]);return r},map:function(e,t,n){var r,i,o=0,a=[];if(x(e))for(r=e.length;o<r;o++)null!=(i=t(e[o],o,n))&&a.push(i);else for(o in e)null!=(i=t(e[o],o,n))&&a.push(i);return c.apply([],a)},guid:1,support:m}),"function"==typeof Symbol&&(T.fn[Symbol.iterator]=o[Symbol.iterator]),T.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),function(e,t){p["[object "+t+"]"]=t.toLowerCase()});var A=function(e){var t,n,r,i,o,a,s,u,c,l,f,p,d,h,v,g,m,y,_,b="sizzle"+1*new Date,w=e.document,E=0,T=0,C=ae(),x=ae(),A=ae(),S=function(e,t){return e===t&&(f=!0),0},O={}.hasOwnProperty,D=[],I=D.pop,N=D.push,k=D.push,L=D.slice,j=function(e,t){for(var n=0,r=e.length;n<r;n++)if(e[n]===t)return n;return-1},R="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",P="[\\x20\\t\\r\\n\\f]",$="(?:\\\\.|[\\w-]|[^\0-\\xa0])+",H="\\["+P+"*("+$+")(?:"+P+"*([*^$|!~]?=)"+P+"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|("+$+"))|)"+P+"*\\]",M=":("+$+")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|"+H+")*)|.*)\\)|)",F=new RegExp(P+"+","g"),W=new RegExp("^"+P+"+|((?:^|[^\\\\])(?:\\\\.)*)"+P+"+$","g"),U=new RegExp("^"+P+"*,"+P+"*"),B=new RegExp("^"+P+"*([>+~]|"+P+")"+P+"*"),q=new RegExp("="+P+"*([^\\]'\"]*?)"+P+"*\\]","g"),V=new RegExp(M),z=new RegExp("^"+$+"$"),G={ID:new RegExp("^#("+$+")"),CLASS:new RegExp("^\\.("+$+")"),TAG:new RegExp("^("+$+"|[*])"),ATTR:new RegExp("^"+H),PSEUDO:new RegExp("^"+M),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+P+"*(even|odd|(([+-]|)(\\d*)n|)"+P+"*(?:([+-]|)"+P+"*(\\d+)|))"+P+"*\\)|)","i"),bool:new RegExp("^(?:"+R+")$","i"),needsContext:new RegExp("^"+P+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+P+"*((?:-\\d)?\\d*)"+P+"*\\)|)(?=[^-]|$)","i")},K=/^(?:input|select|textarea|button)$/i,X=/^h\d$/i,Q=/^[^{]+\{\s*\[native \w/,Y=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,J=/[+~]/,Z=new RegExp("\\\\([\\da-f]{1,6}"+P+"?|("+P+")|.)","ig"),ee=function(e,t,n){var r="0x"+t-65536;return r!=r||n?t:r<0?String.fromCharCode(r+65536):String.fromCharCode(r>>10|55296,1023&r|56320)},te=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,ne=function(e,t){return t?"\0"===e?"�":e.slice(0,-1)+"\\"+e.charCodeAt(e.length-1).toString(16)+" ":"\\"+e},re=function(){p()},ie=ye(function(e){return!0===e.disabled&&("form"in e||"label"in e)},{dir:"parentNode",next:"legend"});try{k.apply(D=L.call(w.childNodes),w.childNodes),D[w.childNodes.length].nodeType}catch(e){k={apply:D.length?function(e,t){N.apply(e,L.call(t))}:function(e,t){for(var n=e.length,r=0;e[n++]=t[r++];);e.length=n-1}}}function oe(e,t,r,i){var o,s,c,l,f,h,m,y=t&&t.ownerDocument,E=t?t.nodeType:9;if(r=r||[],"string"!=typeof e||!e||1!==E&&9!==E&&11!==E)return r;if(!i&&((t?t.ownerDocument||t:w)!==d&&p(t),t=t||d,v)){if(11!==E&&(f=Y.exec(e)))if(o=f[1]){if(9===E){if(!(c=t.getElementById(o)))return r;if(c.id===o)return r.push(c),r}else if(y&&(c=y.getElementById(o))&&_(t,c)&&c.id===o)return r.push(c),r}else{if(f[2])return k.apply(r,t.getElementsByTagName(e)),r;if((o=f[3])&&n.getElementsByClassName&&t.getElementsByClassName)return k.apply(r,t.getElementsByClassName(o)),r}if(n.qsa&&!A[e+" "]&&(!g||!g.test(e))){if(1!==E)y=t,m=e;else if("object"!==t.nodeName.toLowerCase()){for((l=t.getAttribute("id"))?l=l.replace(te,ne):t.setAttribute("id",l=b),s=(h=a(e)).length;s--;)h[s]="#"+l+" "+me(h[s]);m=h.join(","),y=J.test(e)&&ve(t.parentNode)||t}if(m)try{return k.apply(r,y.querySelectorAll(m)),r}catch(e){}finally{l===b&&t.removeAttribute("id")}}}return u(e.replace(W,"$1"),t,r,i)}function ae(){var e=[];return function t(n,i){return e.push(n+" ")>r.cacheLength&&delete t[e.shift()],t[n+" "]=i}}function se(e){return e[b]=!0,e}function ue(e){var t=d.createElement("fieldset");try{return!!e(t)}catch(e){return!1}finally{t.parentNode&&t.parentNode.removeChild(t),t=null}}function ce(e,t){for(var n=e.split("|"),i=n.length;i--;)r.attrHandle[n[i]]=t}function le(e,t){var n=t&&e,r=n&&1===e.nodeType&&1===t.nodeType&&e.sourceIndex-t.sourceIndex;if(r)return r;if(n)for(;n=n.nextSibling;)if(n===t)return-1;return e?1:-1}function fe(e){return function(t){return"input"===t.nodeName.toLowerCase()&&t.type===e}}function pe(e){return function(t){var n=t.nodeName.toLowerCase();return("input"===n||"button"===n)&&t.type===e}}function de(e){return function(t){return"form"in t?t.parentNode&&!1===t.disabled?"label"in t?"label"in t.parentNode?t.parentNode.disabled===e:t.disabled===e:t.isDisabled===e||t.isDisabled!==!e&&ie(t)===e:t.disabled===e:"label"in t&&t.disabled===e}}function he(e){return se(function(t){return t=+t,se(function(n,r){for(var i,o=e([],n.length,t),a=o.length;a--;)n[i=o[a]]&&(n[i]=!(r[i]=n[i]))})})}function ve(e){return e&&void 0!==e.getElementsByTagName&&e}for(t in n=oe.support={},o=oe.isXML=function(e){var t=e&&(e.ownerDocument||e).documentElement;return!!t&&"HTML"!==t.nodeName},p=oe.setDocument=function(e){var t,i,a=e?e.ownerDocument||e:w;return a!==d&&9===a.nodeType&&a.documentElement?(h=(d=a).documentElement,v=!o(d),w!==d&&(i=d.defaultView)&&i.top!==i&&(i.addEventListener?i.addEventListener("unload",re,!1):i.attachEvent&&i.attachEvent("onunload",re)),n.attributes=ue(function(e){return e.className="i",!e.getAttribute("className")}),n.getElementsByTagName=ue(function(e){return e.appendChild(d.createComment("")),!e.getElementsByTagName("*").length}),n.getElementsByClassName=Q.test(d.getElementsByClassName),n.getById=ue(function(e){return h.appendChild(e).id=b,!d.getElementsByName||!d.getElementsByName(b).length}),n.getById?(r.filter.ID=function(e){var t=e.replace(Z,ee);return function(e){return e.getAttribute("id")===t}},r.find.ID=function(e,t){if(void 0!==t.getElementById&&v){var n=t.getElementById(e);return n?[n]:[]}}):(r.filter.ID=function(e){var t=e.replace(Z,ee);return function(e){var n=void 0!==e.getAttributeNode&&e.getAttributeNode("id");return n&&n.value===t}},r.find.ID=function(e,t){if(void 0!==t.getElementById&&v){var n,r,i,o=t.getElementById(e);if(o){if((n=o.getAttributeNode("id"))&&n.value===e)return[o];for(i=t.getElementsByName(e),r=0;o=i[r++];)if((n=o.getAttributeNode("id"))&&n.value===e)return[o]}return[]}}),r.find.TAG=n.getElementsByTagName?function(e,t){return void 0!==t.getElementsByTagName?t.getElementsByTagName(e):n.qsa?t.querySelectorAll(e):void 0}:function(e,t){var n,r=[],i=0,o=t.getElementsByTagName(e);if("*"===e){for(;n=o[i++];)1===n.nodeType&&r.push(n);return r}return o},r.find.CLASS=n.getElementsByClassName&&function(e,t){if(void 0!==t.getElementsByClassName&&v)return t.getElementsByClassName(e)},m=[],g=[],(n.qsa=Q.test(d.querySelectorAll))&&(ue(function(e){h.appendChild(e).innerHTML="<a id='"+b+"'></a><select id='"+b+"-\r\\' msallowcapture=''><option selected=''></option></select>",e.querySelectorAll("[msallowcapture^='']").length&&g.push("[*^$]="+P+"*(?:''|\"\")"),e.querySelectorAll("[selected]").length||g.push("\\["+P+"*(?:value|"+R+")"),e.querySelectorAll("[id~="+b+"-]").length||g.push("~="),e.querySelectorAll(":checked").length||g.push(":checked"),e.querySelectorAll("a#"+b+"+*").length||g.push(".#.+[+~]")}),ue(function(e){e.innerHTML="<a href='' disabled='disabled'></a><select disabled='disabled'><option/></select>";var t=d.createElement("input");t.setAttribute("type","hidden"),e.appendChild(t).setAttribute("name","D"),e.querySelectorAll("[name=d]").length&&g.push("name"+P+"*[*^$|!~]?="),2!==e.querySelectorAll(":enabled").length&&g.push(":enabled",":disabled"),h.appendChild(e).disabled=!0,2!==e.querySelectorAll(":disabled").length&&g.push(":enabled",":disabled"),e.querySelectorAll("*,:x"),g.push(",.*:")})),(n.matchesSelector=Q.test(y=h.matches||h.webkitMatchesSelector||h.mozMatchesSelector||h.oMatchesSelector||h.msMatchesSelector))&&ue(function(e){n.disconnectedMatch=y.call(e,"*"),y.call(e,"[s!='']:x"),m.push("!=",M)}),g=g.length&&new RegExp(g.join("|")),m=m.length&&new RegExp(m.join("|")),t=Q.test(h.compareDocumentPosition),_=t||Q.test(h.contains)?function(e,t){var n=9===e.nodeType?e.documentElement:e,r=t&&t.parentNode;return e===r||!(!r||1!==r.nodeType||!(n.contains?n.contains(r):e.compareDocumentPosition&&16&e.compareDocumentPosition(r)))}:function(e,t){if(t)for(;t=t.parentNode;)if(t===e)return!0;return!1},S=t?function(e,t){if(e===t)return f=!0,0;var r=!e.compareDocumentPosition-!t.compareDocumentPosition;return r||(1&(r=(e.ownerDocument||e)===(t.ownerDocument||t)?e.compareDocumentPosition(t):1)||!n.sortDetached&&t.compareDocumentPosition(e)===r?e===d||e.ownerDocument===w&&_(w,e)?-1:t===d||t.ownerDocument===w&&_(w,t)?1:l?j(l,e)-j(l,t):0:4&r?-1:1)}:function(e,t){if(e===t)return f=!0,0;var n,r=0,i=e.parentNode,o=t.parentNode,a=[e],s=[t];if(!i||!o)return e===d?-1:t===d?1:i?-1:o?1:l?j(l,e)-j(l,t):0;if(i===o)return le(e,t);for(n=e;n=n.parentNode;)a.unshift(n);for(n=t;n=n.parentNode;)s.unshift(n);for(;a[r]===s[r];)r++;return r?le(a[r],s[r]):a[r]===w?-1:s[r]===w?1:0},d):d},oe.matches=function(e,t){return oe(e,null,null,t)},oe.matchesSelector=function(e,t){if((e.ownerDocument||e)!==d&&p(e),t=t.replace(q,"='$1']"),n.matchesSelector&&v&&!A[t+" "]&&(!m||!m.test(t))&&(!g||!g.test(t)))try{var r=y.call(e,t);if(r||n.disconnectedMatch||e.document&&11!==e.document.nodeType)return r}catch(e){}return oe(t,d,null,[e]).length>0},oe.contains=function(e,t){return(e.ownerDocument||e)!==d&&p(e),_(e,t)},oe.attr=function(e,t){(e.ownerDocument||e)!==d&&p(e);var i=r.attrHandle[t.toLowerCase()],o=i&&O.call(r.attrHandle,t.toLowerCase())?i(e,t,!v):void 0;return void 0!==o?o:n.attributes||!v?e.getAttribute(t):(o=e.getAttributeNode(t))&&o.specified?o.value:null},oe.escape=function(e){return(e+"").replace(te,ne)},oe.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)},oe.uniqueSort=function(e){var t,r=[],i=0,o=0;if(f=!n.detectDuplicates,l=!n.sortStable&&e.slice(0),e.sort(S),f){for(;t=e[o++];)t===e[o]&&(i=r.push(o));for(;i--;)e.splice(r[i],1)}return l=null,e},i=oe.getText=function(e){var t,n="",r=0,o=e.nodeType;if(o){if(1===o||9===o||11===o){if("string"==typeof e.textContent)return e.textContent;for(e=e.firstChild;e;e=e.nextSibling)n+=i(e)}else if(3===o||4===o)return e.nodeValue}else for(;t=e[r++];)n+=i(t);return n},(r=oe.selectors={cacheLength:50,createPseudo:se,match:G,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(Z,ee),e[3]=(e[3]||e[4]||e[5]||"").replace(Z,ee),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1].slice(0,3)?(e[3]||oe.error(e[0]),e[4]=+(e[4]?e[5]+(e[6]||1):2*("even"===e[3]||"odd"===e[3])),e[5]=+(e[7]+e[8]||"odd"===e[3])):e[3]&&oe.error(e[0]),e},PSEUDO:function(e){var t,n=!e[6]&&e[2];return G.CHILD.test(e[0])?null:(e[3]?e[2]=e[4]||e[5]||"":n&&V.test(n)&&(t=a(n,!0))&&(t=n.indexOf(")",n.length-t)-n.length)&&(e[0]=e[0].slice(0,t),e[2]=n.slice(0,t)),e.slice(0,3))}},filter:{TAG:function(e){var t=e.replace(Z,ee).toLowerCase();return"*"===e?function(){return!0}:function(e){return e.nodeName&&e.nodeName.toLowerCase()===t}},CLASS:function(e){var t=C[e+" "];return t||(t=new RegExp("(^|"+P+")"+e+"("+P+"|$)"))&&C(e,function(e){return t.test("string"==typeof e.className&&e.className||void 0!==e.getAttribute&&e.getAttribute("class")||"")})},ATTR:function(e,t,n){return function(r){var i=oe.attr(r,e);return null==i?"!="===t:!t||(i+="","="===t?i===n:"!="===t?i!==n:"^="===t?n&&0===i.indexOf(n):"*="===t?n&&i.indexOf(n)>-1:"$="===t?n&&i.slice(-n.length)===n:"~="===t?(" "+i.replace(F," ")+" ").indexOf(n)>-1:"|="===t&&(i===n||i.slice(0,n.length+1)===n+"-"))}},CHILD:function(e,t,n,r,i){var o="nth"!==e.slice(0,3),a="last"!==e.slice(-4),s="of-type"===t;return 1===r&&0===i?function(e){return!!e.parentNode}:function(t,n,u){var c,l,f,p,d,h,v=o!==a?"nextSibling":"previousSibling",g=t.parentNode,m=s&&t.nodeName.toLowerCase(),y=!u&&!s,_=!1;if(g){if(o){for(;v;){for(p=t;p=p[v];)if(s?p.nodeName.toLowerCase()===m:1===p.nodeType)return!1;h=v="only"===e&&!h&&"nextSibling"}return!0}if(h=[a?g.firstChild:g.lastChild],a&&y){for(_=(d=(c=(l=(f=(p=g)[b]||(p[b]={}))[p.uniqueID]||(f[p.uniqueID]={}))[e]||[])[0]===E&&c[1])&&c[2],p=d&&g.childNodes[d];p=++d&&p&&p[v]||(_=d=0)||h.pop();)if(1===p.nodeType&&++_&&p===t){l[e]=[E,d,_];break}}else if(y&&(_=d=(c=(l=(f=(p=t)[b]||(p[b]={}))[p.uniqueID]||(f[p.uniqueID]={}))[e]||[])[0]===E&&c[1]),!1===_)for(;(p=++d&&p&&p[v]||(_=d=0)||h.pop())&&((s?p.nodeName.toLowerCase()!==m:1!==p.nodeType)||!++_||(y&&((l=(f=p[b]||(p[b]={}))[p.uniqueID]||(f[p.uniqueID]={}))[e]=[E,_]),p!==t)););return(_-=i)===r||_%r==0&&_/r>=0}}},PSEUDO:function(e,t){var n,i=r.pseudos[e]||r.setFilters[e.toLowerCase()]||oe.error("unsupported pseudo: "+e);return i[b]?i(t):i.length>1?(n=[e,e,"",t],r.setFilters.hasOwnProperty(e.toLowerCase())?se(function(e,n){for(var r,o=i(e,t),a=o.length;a--;)e[r=j(e,o[a])]=!(n[r]=o[a])}):function(e){return i(e,0,n)}):i}},pseudos:{not:se(function(e){var t=[],n=[],r=s(e.replace(W,"$1"));return r[b]?se(function(e,t,n,i){for(var o,a=r(e,null,i,[]),s=e.length;s--;)(o=a[s])&&(e[s]=!(t[s]=o))}):function(e,i,o){return t[0]=e,r(t,null,o,n),t[0]=null,!n.pop()}}),has:se(function(e){return function(t){return oe(e,t).length>0}}),contains:se(function(e){return e=e.replace(Z,ee),function(t){return(t.textContent||t.innerText||i(t)).indexOf(e)>-1}}),lang:se(function(e){return z.test(e||"")||oe.error("unsupported lang: "+e),e=e.replace(Z,ee).toLowerCase(),function(t){var n;do{if(n=v?t.lang:t.getAttribute("xml:lang")||t.getAttribute("lang"))return(n=n.toLowerCase())===e||0===n.indexOf(e+"-")}while((t=t.parentNode)&&1===t.nodeType);return!1}}),target:function(t){var n=e.location&&e.location.hash;return n&&n.slice(1)===t.id},root:function(e){return e===h},focus:function(e){return e===d.activeElement&&(!d.hasFocus||d.hasFocus())&&!!(e.type||e.href||~e.tabIndex)},enabled:de(!1),disabled:de(!0),checked:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&!!e.checked||"option"===t&&!!e.selected},selected:function(e){return e.parentNode&&e.parentNode.selectedIndex,!0===e.selected},empty:function(e){for(e=e.firstChild;e;e=e.nextSibling)if(e.nodeType<6)return!1;return!0},parent:function(e){return!r.pseudos.empty(e)},header:function(e){return X.test(e.nodeName)},input:function(e){return K.test(e.nodeName)},button:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&"button"===e.type||"button"===t},text:function(e){var t;return"input"===e.nodeName.toLowerCase()&&"text"===e.type&&(null==(t=e.getAttribute("type"))||"text"===t.toLowerCase())},first:he(function(){return[0]}),last:he(function(e,t){return[t-1]}),eq:he(function(e,t,n){return[n<0?n+t:n]}),even:he(function(e,t){for(var n=0;n<t;n+=2)e.push(n);return e}),odd:he(function(e,t){for(var n=1;n<t;n+=2)e.push(n);return e}),lt:he(function(e,t,n){for(var r=n<0?n+t:n;--r>=0;)e.push(r);return e}),gt:he(function(e,t,n){for(var r=n<0?n+t:n;++r<t;)e.push(r);return e})}}).pseudos.nth=r.pseudos.eq,{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})r.pseudos[t]=fe(t);for(t in{submit:!0,reset:!0})r.pseudos[t]=pe(t);function ge(){}function me(e){for(var t=0,n=e.length,r="";t<n;t++)r+=e[t].value;return r}function ye(e,t,n){var r=t.dir,i=t.next,o=i||r,a=n&&"parentNode"===o,s=T++;return t.first?function(t,n,i){for(;t=t[r];)if(1===t.nodeType||a)return e(t,n,i);return!1}:function(t,n,u){var c,l,f,p=[E,s];if(u){for(;t=t[r];)if((1===t.nodeType||a)&&e(t,n,u))return!0}else for(;t=t[r];)if(1===t.nodeType||a)if(l=(f=t[b]||(t[b]={}))[t.uniqueID]||(f[t.uniqueID]={}),i&&i===t.nodeName.toLowerCase())t=t[r]||t;else{if((c=l[o])&&c[0]===E&&c[1]===s)return p[2]=c[2];if(l[o]=p,p[2]=e(t,n,u))return!0}return!1}}function _e(e){return e.length>1?function(t,n,r){for(var i=e.length;i--;)if(!e[i](t,n,r))return!1;return!0}:e[0]}function be(e,t,n,r,i){for(var o,a=[],s=0,u=e.length,c=null!=t;s<u;s++)(o=e[s])&&(n&&!n(o,r,i)||(a.push(o),c&&t.push(s)));return a}function we(e,t,n,r,i,o){return r&&!r[b]&&(r=we(r)),i&&!i[b]&&(i=we(i,o)),se(function(o,a,s,u){var c,l,f,p=[],d=[],h=a.length,v=o||function(e,t,n){for(var r=0,i=t.length;r<i;r++)oe(e,t[r],n);return n}(t||"*",s.nodeType?[s]:s,[]),g=!e||!o&&t?v:be(v,p,e,s,u),m=n?i||(o?e:h||r)?[]:a:g;if(n&&n(g,m,s,u),r)for(c=be(m,d),r(c,[],s,u),l=c.length;l--;)(f=c[l])&&(m[d[l]]=!(g[d[l]]=f));if(o){if(i||e){if(i){for(c=[],l=m.length;l--;)(f=m[l])&&c.push(g[l]=f);i(null,m=[],c,u)}for(l=m.length;l--;)(f=m[l])&&(c=i?j(o,f):p[l])>-1&&(o[c]=!(a[c]=f))}}else m=be(m===a?m.splice(h,m.length):m),i?i(null,a,m,u):k.apply(a,m)})}function Ee(e){for(var t,n,i,o=e.length,a=r.relative[e[0].type],s=a||r.relative[" "],u=a?1:0,l=ye(function(e){return e===t},s,!0),f=ye(function(e){return j(t,e)>-1},s,!0),p=[function(e,n,r){var i=!a&&(r||n!==c)||((t=n).nodeType?l(e,n,r):f(e,n,r));return t=null,i}];u<o;u++)if(n=r.relative[e[u].type])p=[ye(_e(p),n)];else{if((n=r.filter[e[u].type].apply(null,e[u].matches))[b]){for(i=++u;i<o&&!r.relative[e[i].type];i++);return we(u>1&&_e(p),u>1&&me(e.slice(0,u-1).concat({value:" "===e[u-2].type?"*":""})).replace(W,"$1"),n,u<i&&Ee(e.slice(u,i)),i<o&&Ee(e=e.slice(i)),i<o&&me(e))}p.push(n)}return _e(p)}return ge.prototype=r.filters=r.pseudos,r.setFilters=new ge,a=oe.tokenize=function(e,t){var n,i,o,a,s,u,c,l=x[e+" "];if(l)return t?0:l.slice(0);for(s=e,u=[],c=r.preFilter;s;){for(a in n&&!(i=U.exec(s))||(i&&(s=s.slice(i[0].length)||s),u.push(o=[])),n=!1,(i=B.exec(s))&&(n=i.shift(),o.push({value:n,type:i[0].replace(W," ")}),s=s.slice(n.length)),r.filter)!(i=G[a].exec(s))||c[a]&&!(i=c[a](i))||(n=i.shift(),o.push({value:n,type:a,matches:i}),s=s.slice(n.length));if(!n)break}return t?s.length:s?oe.error(e):x(e,u).slice(0)},s=oe.compile=function(e,t){var n,i=[],o=[],s=A[e+" "];if(!s){for(t||(t=a(e)),n=t.length;n--;)(s=Ee(t[n]))[b]?i.push(s):o.push(s);(s=A(e,function(e,t){var n=t.length>0,i=e.length>0,o=function(o,a,s,u,l){var f,h,g,m=0,y="0",_=o&&[],b=[],w=c,T=o||i&&r.find.TAG("*",l),C=E+=null==w?1:Math.random()||.1,x=T.length;for(l&&(c=a===d||a||l);y!==x&&null!=(f=T[y]);y++){if(i&&f){for(h=0,a||f.ownerDocument===d||(p(f),s=!v);g=e[h++];)if(g(f,a||d,s)){u.push(f);break}l&&(E=C)}n&&((f=!g&&f)&&m--,o&&_.push(f))}if(m+=y,n&&y!==m){for(h=0;g=t[h++];)g(_,b,a,s);if(o){if(m>0)for(;y--;)_[y]||b[y]||(b[y]=I.call(u));b=be(b)}k.apply(u,b),l&&!o&&b.length>0&&m+t.length>1&&oe.uniqueSort(u)}return l&&(E=C,c=w),_};return n?se(o):o}(o,i))).selector=e}return s},u=oe.select=function(e,t,n,i){var o,u,c,l,f,p="function"==typeof e&&e,d=!i&&a(e=p.selector||e);if(n=n||[],1===d.length){if((u=d[0]=d[0].slice(0)).length>2&&"ID"===(c=u[0]).type&&9===t.nodeType&&v&&r.relative[u[1].type]){if(!(t=(r.find.ID(c.matches[0].replace(Z,ee),t)||[])[0]))return n;p&&(t=t.parentNode),e=e.slice(u.shift().value.length)}for(o=G.needsContext.test(e)?0:u.length;o--&&(c=u[o],!r.relative[l=c.type]);)if((f=r.find[l])&&(i=f(c.matches[0].replace(Z,ee),J.test(u[0].type)&&ve(t.parentNode)||t))){if(u.splice(o,1),!(e=i.length&&me(u)))return k.apply(n,i),n;break}}return(p||s(e,d))(i,t,!v,n,!t||J.test(e)&&ve(t.parentNode)||t),n},n.sortStable=b.split("").sort(S).join("")===b,n.detectDuplicates=!!f,p(),n.sortDetached=ue(function(e){return 1&e.compareDocumentPosition(d.createElement("fieldset"))}),ue(function(e){return e.innerHTML="<a href='#'></a>","#"===e.firstChild.getAttribute("href")})||ce("type|href|height|width",function(e,t,n){if(!n)return e.getAttribute(t,"type"===t.toLowerCase()?1:2)}),n.attributes&&ue(function(e){return e.innerHTML="<input/>",e.firstChild.setAttribute("value",""),""===e.firstChild.getAttribute("value")})||ce("value",function(e,t,n){if(!n&&"input"===e.nodeName.toLowerCase())return e.defaultValue}),ue(function(e){return null==e.getAttribute("disabled")})||ce(R,function(e,t,n){var r;if(!n)return!0===e[t]?t.toLowerCase():(r=e.getAttributeNode(t))&&r.specified?r.value:null}),oe}(n);T.find=A,T.expr=A.selectors,T.expr[":"]=T.expr.pseudos,T.uniqueSort=T.unique=A.uniqueSort,T.text=A.getText,T.isXMLDoc=A.isXML,T.contains=A.contains,T.escapeSelector=A.escape;var S=function(e,t,n){for(var r=[],i=void 0!==n;(e=e[t])&&9!==e.nodeType;)if(1===e.nodeType){if(i&&T(e).is(n))break;r.push(e)}return r},O=function(e,t){for(var n=[];e;e=e.nextSibling)1===e.nodeType&&e!==t&&n.push(e);return n},D=T.expr.match.needsContext;function I(e,t){return e.nodeName&&e.nodeName.toLowerCase()===t.toLowerCase()}var N=/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i;function k(e,t,n){return y(t)?T.grep(e,function(e,r){return!!t.call(e,r,e)!==n}):t.nodeType?T.grep(e,function(e){return e===t!==n}):"string"!=typeof t?T.grep(e,function(e){return f.call(t,e)>-1!==n}):T.filter(t,e,n)}T.filter=function(e,t,n){var r=t[0];return n&&(e=":not("+e+")"),1===t.length&&1===r.nodeType?T.find.matchesSelector(r,e)?[r]:[]:T.find.matches(e,T.grep(t,function(e){return 1===e.nodeType}))},T.fn.extend({find:function(e){var t,n,r=this.length,i=this;if("string"!=typeof e)return this.pushStack(T(e).filter(function(){for(t=0;t<r;t++)if(T.contains(i[t],this))return!0}));for(n=this.pushStack([]),t=0;t<r;t++)T.find(e,i[t],n);return r>1?T.uniqueSort(n):n},filter:function(e){return this.pushStack(k(this,e||[],!1))},not:function(e){return this.pushStack(k(this,e||[],!0))},is:function(e){return!!k(this,"string"==typeof e&&D.test(e)?T(e):e||[],!1).length}});var L,j=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/;(T.fn.init=function(e,t,n){var r,i;if(!e)return this;if(n=n||L,"string"==typeof e){if(!(r="<"===e[0]&&">"===e[e.length-1]&&e.length>=3?[null,e,null]:j.exec(e))||!r[1]&&t)return!t||t.jquery?(t||n).find(e):this.constructor(t).find(e);if(r[1]){if(t=t instanceof T?t[0]:t,T.merge(this,T.parseHTML(r[1],t&&t.nodeType?t.ownerDocument||t:a,!0)),N.test(r[1])&&T.isPlainObject(t))for(r in t)y(this[r])?this[r](t[r]):this.attr(r,t[r]);return this}return(i=a.getElementById(r[2]))&&(this[0]=i,this.length=1),this}return e.nodeType?(this[0]=e,this.length=1,this):y(e)?void 0!==n.ready?n.ready(e):e(T):T.makeArray(e,this)}).prototype=T.fn,L=T(a);var R=/^(?:parents|prev(?:Until|All))/,P={children:!0,contents:!0,next:!0,prev:!0};function $(e,t){for(;(e=e[t])&&1!==e.nodeType;);return e}T.fn.extend({has:function(e){var t=T(e,this),n=t.length;return this.filter(function(){for(var e=0;e<n;e++)if(T.contains(this,t[e]))return!0})},closest:function(e,t){var n,r=0,i=this.length,o=[],a="string"!=typeof e&&T(e);if(!D.test(e))for(;r<i;r++)for(n=this[r];n&&n!==t;n=n.parentNode)if(n.nodeType<11&&(a?a.index(n)>-1:1===n.nodeType&&T.find.matchesSelector(n,e))){o.push(n);break}return this.pushStack(o.length>1?T.uniqueSort(o):o)},index:function(e){return e?"string"==typeof e?f.call(T(e),this[0]):f.call(this,e.jquery?e[0]:e):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(e,t){return this.pushStack(T.uniqueSort(T.merge(this.get(),T(e,t))))},addBack:function(e){return this.add(null==e?this.prevObject:this.prevObject.filter(e))}}),T.each({parent:function(e){var t=e.parentNode;return t&&11!==t.nodeType?t:null},parents:function(e){return S(e,"parentNode")},parentsUntil:function(e,t,n){return S(e,"parentNode",n)},next:function(e){return $(e,"nextSibling")},prev:function(e){return $(e,"previousSibling")},nextAll:function(e){return S(e,"nextSibling")},prevAll:function(e){return S(e,"previousSibling")},nextUntil:function(e,t,n){return S(e,"nextSibling",n)},prevUntil:function(e,t,n){return S(e,"previousSibling",n)},siblings:function(e){return O((e.parentNode||{}).firstChild,e)},children:function(e){return O(e.firstChild)},contents:function(e){return I(e,"iframe")?e.contentDocument:(I(e,"template")&&(e=e.content||e),T.merge([],e.childNodes))}},function(e,t){T.fn[e]=function(n,r){var i=T.map(this,t,n);return"Until"!==e.slice(-5)&&(r=n),r&&"string"==typeof r&&(i=T.filter(r,i)),this.length>1&&(P[e]||T.uniqueSort(i),R.test(e)&&i.reverse()),this.pushStack(i)}});var H=/[^\x20\t\r\n\f]+/g;function M(e){return e}function F(e){throw e}function W(e,t,n,r){var i;try{e&&y(i=e.promise)?i.call(e).done(t).fail(n):e&&y(i=e.then)?i.call(e,t,n):t.apply(void 0,[e].slice(r))}catch(e){n.apply(void 0,[e])}}T.Callbacks=function(e){e="string"==typeof e?function(e){var t={};return T.each(e.match(H)||[],function(e,n){t[n]=!0}),t}(e):T.extend({},e);var t,n,r,i,o=[],a=[],s=-1,u=function(){for(i=i||e.once,r=t=!0;a.length;s=-1)for(n=a.shift();++s<o.length;)!1===o[s].apply(n[0],n[1])&&e.stopOnFalse&&(s=o.length,n=!1);e.memory||(n=!1),t=!1,i&&(o=n?[]:"")},c={add:function(){return o&&(n&&!t&&(s=o.length-1,a.push(n)),function t(n){T.each(n,function(n,r){y(r)?e.unique&&c.has(r)||o.push(r):r&&r.length&&"string"!==E(r)&&t(r)})}(arguments),n&&!t&&u()),this},remove:function(){return T.each(arguments,function(e,t){for(var n;(n=T.inArray(t,o,n))>-1;)o.splice(n,1),n<=s&&s--}),this},has:function(e){return e?T.inArray(e,o)>-1:o.length>0},empty:function(){return o&&(o=[]),this},disable:function(){return i=a=[],o=n="",this},disabled:function(){return!o},lock:function(){return i=a=[],n||t||(o=n=""),this},locked:function(){return!!i},fireWith:function(e,n){return i||(n=[e,(n=n||[]).slice?n.slice():n],a.push(n),t||u()),this},fire:function(){return c.fireWith(this,arguments),this},fired:function(){return!!r}};return c},T.extend({Deferred:function(e){var t=[["notify","progress",T.Callbacks("memory"),T.Callbacks("memory"),2],["resolve","done",T.Callbacks("once memory"),T.Callbacks("once memory"),0,"resolved"],["reject","fail",T.Callbacks("once memory"),T.Callbacks("once memory"),1,"rejected"]],r="pending",i={state:function(){return r},always:function(){return o.done(arguments).fail(arguments),this},catch:function(e){return i.then(null,e)},pipe:function(){var e=arguments;return T.Deferred(function(n){T.each(t,function(t,r){var i=y(e[r[4]])&&e[r[4]];o[r[1]](function(){var e=i&&i.apply(this,arguments);e&&y(e.promise)?e.promise().progress(n.notify).done(n.resolve).fail(n.reject):n[r[0]+"With"](this,i?[e]:arguments)})}),e=null}).promise()},then:function(e,r,i){var o=0;function a(e,t,r,i){return function(){var s=this,u=arguments,c=function(){var n,c;if(!(e<o)){if((n=r.apply(s,u))===t.promise())throw new TypeError("Thenable self-resolution");c=n&&("object"==typeof n||"function"==typeof n)&&n.then,y(c)?i?c.call(n,a(o,t,M,i),a(o,t,F,i)):(o++,c.call(n,a(o,t,M,i),a(o,t,F,i),a(o,t,M,t.notifyWith))):(r!==M&&(s=void 0,u=[n]),(i||t.resolveWith)(s,u))}},l=i?c:function(){try{c()}catch(n){T.Deferred.exceptionHook&&T.Deferred.exceptionHook(n,l.stackTrace),e+1>=o&&(r!==F&&(s=void 0,u=[n]),t.rejectWith(s,u))}};e?l():(T.Deferred.getStackHook&&(l.stackTrace=T.Deferred.getStackHook()),n.setTimeout(l))}}return T.Deferred(function(n){t[0][3].add(a(0,n,y(i)?i:M,n.notifyWith)),t[1][3].add(a(0,n,y(e)?e:M)),t[2][3].add(a(0,n,y(r)?r:F))}).promise()},promise:function(e){return null!=e?T.extend(e,i):i}},o={};return T.each(t,function(e,n){var a=n[2],s=n[5];i[n[1]]=a.add,s&&a.add(function(){r=s},t[3-e][2].disable,t[3-e][3].disable,t[0][2].lock,t[0][3].lock),a.add(n[3].fire),o[n[0]]=function(){return o[n[0]+"With"](this===o?void 0:this,arguments),this},o[n[0]+"With"]=a.fireWith}),i.promise(o),e&&e.call(o,o),o},when:function(e){var t=arguments.length,n=t,r=Array(n),i=u.call(arguments),o=T.Deferred(),a=function(e){return function(n){r[e]=this,i[e]=arguments.length>1?u.call(arguments):n,--t||o.resolveWith(r,i)}};if(t<=1&&(W(e,o.done(a(n)).resolve,o.reject,!t),"pending"===o.state()||y(i[n]&&i[n].then)))return o.then();for(;n--;)W(i[n],a(n),o.reject);return o.promise()}});var U=/^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;T.Deferred.exceptionHook=function(e,t){n.console&&n.console.warn&&e&&U.test(e.name)&&n.console.warn("jQuery.Deferred exception: "+e.message,e.stack,t)},T.readyException=function(e){n.setTimeout(function(){throw e})};var B=T.Deferred();function q(){a.removeEventListener("DOMContentLoaded",q),n.removeEventListener("load",q),T.ready()}T.fn.ready=function(e){return B.then(e).catch(function(e){T.readyException(e)}),this},T.extend({isReady:!1,readyWait:1,ready:function(e){(!0===e?--T.readyWait:T.isReady)||(T.isReady=!0,!0!==e&&--T.readyWait>0||B.resolveWith(a,[T]))}}),T.ready.then=B.then,"complete"===a.readyState||"loading"!==a.readyState&&!a.documentElement.doScroll?n.setTimeout(T.ready):(a.addEventListener("DOMContentLoaded",q),n.addEventListener("load",q));var V=function(e,t,n,r,i,o,a){var s=0,u=e.length,c=null==n;if("object"===E(n))for(s in i=!0,n)V(e,t,s,n[s],!0,o,a);else if(void 0!==r&&(i=!0,y(r)||(a=!0),c&&(a?(t.call(e,r),t=null):(c=t,t=function(e,t,n){return c.call(T(e),n)})),t))for(;s<u;s++)t(e[s],n,a?r:r.call(e[s],s,t(e[s],n)));return i?e:c?t.call(e):u?t(e[0],n):o},z=/^-ms-/,G=/-([a-z])/g;function K(e,t){return t.toUpperCase()}function X(e){return e.replace(z,"ms-").replace(G,K)}var Q=function(e){return 1===e.nodeType||9===e.nodeType||!+e.nodeType};function Y(){this.expando=T.expando+Y.uid++}Y.uid=1,Y.prototype={cache:function(e){var t=e[this.expando];return t||(t={},Q(e)&&(e.nodeType?e[this.expando]=t:Object.defineProperty(e,this.expando,{value:t,configurable:!0}))),t},set:function(e,t,n){var r,i=this.cache(e);if("string"==typeof t)i[X(t)]=n;else for(r in t)i[X(r)]=t[r];return i},get:function(e,t){return void 0===t?this.cache(e):e[this.expando]&&e[this.expando][X(t)]},access:function(e,t,n){return void 0===t||t&&"string"==typeof t&&void 0===n?this.get(e,t):(this.set(e,t,n),void 0!==n?n:t)},remove:function(e,t){var n,r=e[this.expando];if(void 0!==r){if(void 0!==t){n=(t=Array.isArray(t)?t.map(X):(t=X(t))in r?[t]:t.match(H)||[]).length;for(;n--;)delete r[t[n]]}(void 0===t||T.isEmptyObject(r))&&(e.nodeType?e[this.expando]=void 0:delete e[this.expando])}},hasData:function(e){var t=e[this.expando];return void 0!==t&&!T.isEmptyObject(t)}};var J=new Y,Z=new Y,ee=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,te=/[A-Z]/g;function ne(e,t,n){var r;if(void 0===n&&1===e.nodeType)if(r="data-"+t.replace(te,"-$&").toLowerCase(),"string"==typeof(n=e.getAttribute(r))){try{n=function(e){return"true"===e||"false"!==e&&("null"===e?null:e===+e+""?+e:ee.test(e)?JSON.parse(e):e)}(n)}catch(e){}Z.set(e,t,n)}else n=void 0;return n}T.extend({hasData:function(e){return Z.hasData(e)||J.hasData(e)},data:function(e,t,n){return Z.access(e,t,n)},removeData:function(e,t){Z.remove(e,t)},_data:function(e,t,n){return J.access(e,t,n)},_removeData:function(e,t){J.remove(e,t)}}),T.fn.extend({data:function(e,t){var n,r,i,o=this[0],a=o&&o.attributes;if(void 0===e){if(this.length&&(i=Z.get(o),1===o.nodeType&&!J.get(o,"hasDataAttrs"))){for(n=a.length;n--;)a[n]&&0===(r=a[n].name).indexOf("data-")&&(r=X(r.slice(5)),ne(o,r,i[r]));J.set(o,"hasDataAttrs",!0)}return i}return"object"==typeof e?this.each(function(){Z.set(this,e)}):V(this,function(t){var n;if(o&&void 0===t)return void 0!==(n=Z.get(o,e))?n:void 0!==(n=ne(o,e))?n:void 0;this.each(function(){Z.set(this,e,t)})},null,t,arguments.length>1,null,!0)},removeData:function(e){return this.each(function(){Z.remove(this,e)})}}),T.extend({queue:function(e,t,n){var r;if(e)return t=(t||"fx")+"queue",r=J.get(e,t),n&&(!r||Array.isArray(n)?r=J.access(e,t,T.makeArray(n)):r.push(n)),r||[]},dequeue:function(e,t){t=t||"fx";var n=T.queue(e,t),r=n.length,i=n.shift(),o=T._queueHooks(e,t);"inprogress"===i&&(i=n.shift(),r--),i&&("fx"===t&&n.unshift("inprogress"),delete o.stop,i.call(e,function(){T.dequeue(e,t)},o)),!r&&o&&o.empty.fire()},_queueHooks:function(e,t){var n=t+"queueHooks";return J.get(e,n)||J.access(e,n,{empty:T.Callbacks("once memory").add(function(){J.remove(e,[t+"queue",n])})})}}),T.fn.extend({queue:function(e,t){var n=2;return"string"!=typeof e&&(t=e,e="fx",n--),arguments.length<n?T.queue(this[0],e):void 0===t?this:this.each(function(){var n=T.queue(this,e,t);T._queueHooks(this,e),"fx"===e&&"inprogress"!==n[0]&&T.dequeue(this,e)})},dequeue:function(e){return this.each(function(){T.dequeue(this,e)})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(e,t){var n,r=1,i=T.Deferred(),o=this,a=this.length,s=function(){--r||i.resolveWith(o,[o])};for("string"!=typeof e&&(t=e,e=void 0),e=e||"fx";a--;)(n=J.get(o[a],e+"queueHooks"))&&n.empty&&(r++,n.empty.add(s));return s(),i.promise(t)}});var re=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,ie=new RegExp("^(?:([+-])=|)("+re+")([a-z%]*)$","i"),oe=["Top","Right","Bottom","Left"],ae=function(e,t){return"none"===(e=t||e).style.display||""===e.style.display&&T.contains(e.ownerDocument,e)&&"none"===T.css(e,"display")},se=function(e,t,n,r){var i,o,a={};for(o in t)a[o]=e.style[o],e.style[o]=t[o];for(o in i=n.apply(e,r||[]),t)e.style[o]=a[o];return i};function ue(e,t,n,r){var i,o,a=20,s=r?function(){return r.cur()}:function(){return T.css(e,t,"")},u=s(),c=n&&n[3]||(T.cssNumber[t]?"":"px"),l=(T.cssNumber[t]||"px"!==c&&+u)&&ie.exec(T.css(e,t));if(l&&l[3]!==c){for(u/=2,c=c||l[3],l=+u||1;a--;)T.style(e,t,l+c),(1-o)*(1-(o=s()/u||.5))<=0&&(a=0),l/=o;l*=2,T.style(e,t,l+c),n=n||[]}return n&&(l=+l||+u||0,i=n[1]?l+(n[1]+1)*n[2]:+n[2],r&&(r.unit=c,r.start=l,r.end=i)),i}var ce={};function le(e){var t,n=e.ownerDocument,r=e.nodeName,i=ce[r];return i||(t=n.body.appendChild(n.createElement(r)),i=T.css(t,"display"),t.parentNode.removeChild(t),"none"===i&&(i="block"),ce[r]=i,i)}function fe(e,t){for(var n,r,i=[],o=0,a=e.length;o<a;o++)(r=e[o]).style&&(n=r.style.display,t?("none"===n&&(i[o]=J.get(r,"display")||null,i[o]||(r.style.display="")),""===r.style.display&&ae(r)&&(i[o]=le(r))):"none"!==n&&(i[o]="none",J.set(r,"display",n)));for(o=0;o<a;o++)null!=i[o]&&(e[o].style.display=i[o]);return e}T.fn.extend({show:function(){return fe(this,!0)},hide:function(){return fe(this)},toggle:function(e){return"boolean"==typeof e?e?this.show():this.hide():this.each(function(){ae(this)?T(this).show():T(this).hide()})}});var pe=/^(?:checkbox|radio)$/i,de=/<([a-z][^\/\0>\x20\t\r\n\f]+)/i,he=/^$|^module$|\/(?:java|ecma)script/i,ve={option:[1,"<select multiple='multiple'>","</select>"],thead:[1,"<table>","</table>"],col:[2,"<table><colgroup>","</colgroup></table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],_default:[0,"",""]};function ge(e,t){var n;return n=void 0!==e.getElementsByTagName?e.getElementsByTagName(t||"*"):void 0!==e.querySelectorAll?e.querySelectorAll(t||"*"):[],void 0===t||t&&I(e,t)?T.merge([e],n):n}function me(e,t){for(var n=0,r=e.length;n<r;n++)J.set(e[n],"globalEval",!t||J.get(t[n],"globalEval"))}ve.optgroup=ve.option,ve.tbody=ve.tfoot=ve.colgroup=ve.caption=ve.thead,ve.th=ve.td;var ye,_e,be=/<|&#?\w+;/;function we(e,t,n,r,i){for(var o,a,s,u,c,l,f=t.createDocumentFragment(),p=[],d=0,h=e.length;d<h;d++)if((o=e[d])||0===o)if("object"===E(o))T.merge(p,o.nodeType?[o]:o);else if(be.test(o)){for(a=a||f.appendChild(t.createElement("div")),s=(de.exec(o)||["",""])[1].toLowerCase(),u=ve[s]||ve._default,a.innerHTML=u[1]+T.htmlPrefilter(o)+u[2],l=u[0];l--;)a=a.lastChild;T.merge(p,a.childNodes),(a=f.firstChild).textContent=""}else p.push(t.createTextNode(o));for(f.textContent="",d=0;o=p[d++];)if(r&&T.inArray(o,r)>-1)i&&i.push(o);else if(c=T.contains(o.ownerDocument,o),a=ge(f.appendChild(o),"script"),c&&me(a),n)for(l=0;o=a[l++];)he.test(o.type||"")&&n.push(o);return f}ye=a.createDocumentFragment().appendChild(a.createElement("div")),(_e=a.createElement("input")).setAttribute("type","radio"),_e.setAttribute("checked","checked"),_e.setAttribute("name","t"),ye.appendChild(_e),m.checkClone=ye.cloneNode(!0).cloneNode(!0).lastChild.checked,ye.innerHTML="<textarea>x</textarea>",m.noCloneChecked=!!ye.cloneNode(!0).lastChild.defaultValue;var Ee=a.documentElement,Te=/^key/,Ce=/^(?:mouse|pointer|contextmenu|drag|drop)|click/,xe=/^([^.]*)(?:\.(.+)|)/;function Ae(){return!0}function Se(){return!1}function Oe(){try{return a.activeElement}catch(e){}}function De(e,t,n,r,i,o){var a,s;if("object"==typeof t){for(s in"string"!=typeof n&&(r=r||n,n=void 0),t)De(e,s,n,r,t[s],o);return e}if(null==r&&null==i?(i=n,r=n=void 0):null==i&&("string"==typeof n?(i=r,r=void 0):(i=r,r=n,n=void 0)),!1===i)i=Se;else if(!i)return e;return 1===o&&(a=i,(i=function(e){return T().off(e),a.apply(this,arguments)}).guid=a.guid||(a.guid=T.guid++)),e.each(function(){T.event.add(this,t,i,r,n)})}T.event={global:{},add:function(e,t,n,r,i){var o,a,s,u,c,l,f,p,d,h,v,g=J.get(e);if(g)for(n.handler&&(n=(o=n).handler,i=o.selector),i&&T.find.matchesSelector(Ee,i),n.guid||(n.guid=T.guid++),(u=g.events)||(u=g.events={}),(a=g.handle)||(a=g.handle=function(t){return void 0!==T&&T.event.triggered!==t.type?T.event.dispatch.apply(e,arguments):void 0}),c=(t=(t||"").match(H)||[""]).length;c--;)d=v=(s=xe.exec(t[c])||[])[1],h=(s[2]||"").split(".").sort(),d&&(f=T.event.special[d]||{},d=(i?f.delegateType:f.bindType)||d,f=T.event.special[d]||{},l=T.extend({type:d,origType:v,data:r,handler:n,guid:n.guid,selector:i,needsContext:i&&T.expr.match.needsContext.test(i),namespace:h.join(".")},o),(p=u[d])||((p=u[d]=[]).delegateCount=0,f.setup&&!1!==f.setup.call(e,r,h,a)||e.addEventListener&&e.addEventListener(d,a)),f.add&&(f.add.call(e,l),l.handler.guid||(l.handler.guid=n.guid)),i?p.splice(p.delegateCount++,0,l):p.push(l),T.event.global[d]=!0)},remove:function(e,t,n,r,i){var o,a,s,u,c,l,f,p,d,h,v,g=J.hasData(e)&&J.get(e);if(g&&(u=g.events)){for(c=(t=(t||"").match(H)||[""]).length;c--;)if(d=v=(s=xe.exec(t[c])||[])[1],h=(s[2]||"").split(".").sort(),d){for(f=T.event.special[d]||{},p=u[d=(r?f.delegateType:f.bindType)||d]||[],s=s[2]&&new RegExp("(^|\\.)"+h.join("\\.(?:.*\\.|)")+"(\\.|$)"),a=o=p.length;o--;)l=p[o],!i&&v!==l.origType||n&&n.guid!==l.guid||s&&!s.test(l.namespace)||r&&r!==l.selector&&("**"!==r||!l.selector)||(p.splice(o,1),l.selector&&p.delegateCount--,f.remove&&f.remove.call(e,l));a&&!p.length&&(f.teardown&&!1!==f.teardown.call(e,h,g.handle)||T.removeEvent(e,d,g.handle),delete u[d])}else for(d in u)T.event.remove(e,d+t[c],n,r,!0);T.isEmptyObject(u)&&J.remove(e,"handle events")}},dispatch:function(e){var t,n,r,i,o,a,s=T.event.fix(e),u=new Array(arguments.length),c=(J.get(this,"events")||{})[s.type]||[],l=T.event.special[s.type]||{};for(u[0]=s,t=1;t<arguments.length;t++)u[t]=arguments[t];if(s.delegateTarget=this,!l.preDispatch||!1!==l.preDispatch.call(this,s)){for(a=T.event.handlers.call(this,s,c),t=0;(i=a[t++])&&!s.isPropagationStopped();)for(s.currentTarget=i.elem,n=0;(o=i.handlers[n++])&&!s.isImmediatePropagationStopped();)s.rnamespace&&!s.rnamespace.test(o.namespace)||(s.handleObj=o,s.data=o.data,void 0!==(r=((T.event.special[o.origType]||{}).handle||o.handler).apply(i.elem,u))&&!1===(s.result=r)&&(s.preventDefault(),s.stopPropagation()));return l.postDispatch&&l.postDispatch.call(this,s),s.result}},handlers:function(e,t){var n,r,i,o,a,s=[],u=t.delegateCount,c=e.target;if(u&&c.nodeType&&!("click"===e.type&&e.button>=1))for(;c!==this;c=c.parentNode||this)if(1===c.nodeType&&("click"!==e.type||!0!==c.disabled)){for(o=[],a={},n=0;n<u;n++)void 0===a[i=(r=t[n]).selector+" "]&&(a[i]=r.needsContext?T(i,this).index(c)>-1:T.find(i,this,null,[c]).length),a[i]&&o.push(r);o.length&&s.push({elem:c,handlers:o})}return c=this,u<t.length&&s.push({elem:c,handlers:t.slice(u)}),s},addProp:function(e,t){Object.defineProperty(T.Event.prototype,e,{enumerable:!0,configurable:!0,get:y(t)?function(){if(this.originalEvent)return t(this.originalEvent)}:function(){if(this.originalEvent)return this.originalEvent[e]},set:function(t){Object.defineProperty(this,e,{enumerable:!0,configurable:!0,writable:!0,value:t})}})},fix:function(e){return e[T.expando]?e:new T.Event(e)},special:{load:{noBubble:!0},focus:{trigger:function(){if(this!==Oe()&&this.focus)return this.focus(),!1},delegateType:"focusin"},blur:{trigger:function(){if(this===Oe()&&this.blur)return this.blur(),!1},delegateType:"focusout"},click:{trigger:function(){if("checkbox"===this.type&&this.click&&I(this,"input"))return this.click(),!1},_default:function(e){return I(e.target,"a")}},beforeunload:{postDispatch:function(e){void 0!==e.result&&e.originalEvent&&(e.originalEvent.returnValue=e.result)}}}},T.removeEvent=function(e,t,n){e.removeEventListener&&e.removeEventListener(t,n)},T.Event=function(e,t){if(!(this instanceof T.Event))return new T.Event(e,t);e&&e.type?(this.originalEvent=e,this.type=e.type,this.isDefaultPrevented=e.defaultPrevented||void 0===e.defaultPrevented&&!1===e.returnValue?Ae:Se,this.target=e.target&&3===e.target.nodeType?e.target.parentNode:e.target,this.currentTarget=e.currentTarget,this.relatedTarget=e.relatedTarget):this.type=e,t&&T.extend(this,t),this.timeStamp=e&&e.timeStamp||Date.now(),this[T.expando]=!0},T.Event.prototype={constructor:T.Event,isDefaultPrevented:Se,isPropagationStopped:Se,isImmediatePropagationStopped:Se,isSimulated:!1,preventDefault:function(){var e=this.originalEvent;this.isDefaultPrevented=Ae,e&&!this.isSimulated&&e.preventDefault()},stopPropagation:function(){var e=this.originalEvent;this.isPropagationStopped=Ae,e&&!this.isSimulated&&e.stopPropagation()},stopImmediatePropagation:function(){var e=this.originalEvent;this.isImmediatePropagationStopped=Ae,e&&!this.isSimulated&&e.stopImmediatePropagation(),this.stopPropagation()}},T.each({altKey:!0,bubbles:!0,cancelable:!0,changedTouches:!0,ctrlKey:!0,detail:!0,eventPhase:!0,metaKey:!0,pageX:!0,pageY:!0,shiftKey:!0,view:!0,char:!0,charCode:!0,key:!0,keyCode:!0,button:!0,buttons:!0,clientX:!0,clientY:!0,offsetX:!0,offsetY:!0,pointerId:!0,pointerType:!0,screenX:!0,screenY:!0,targetTouches:!0,toElement:!0,touches:!0,which:function(e){var t=e.button;return null==e.which&&Te.test(e.type)?null!=e.charCode?e.charCode:e.keyCode:!e.which&&void 0!==t&&Ce.test(e.type)?1&t?1:2&t?3:4&t?2:0:e.which}},T.event.addProp),T.each({mouseenter:"mouseover",mouseleave:"mouseout",pointerenter:"pointerover",pointerleave:"pointerout"},function(e,t){T.event.special[e]={delegateType:t,bindType:t,handle:function(e){var n,r=e.relatedTarget,i=e.handleObj;return r&&(r===this||T.contains(this,r))||(e.type=i.origType,n=i.handler.apply(this,arguments),e.type=t),n}}}),T.fn.extend({on:function(e,t,n,r){return De(this,e,t,n,r)},one:function(e,t,n,r){return De(this,e,t,n,r,1)},off:function(e,t,n){var r,i;if(e&&e.preventDefault&&e.handleObj)return r=e.handleObj,T(e.delegateTarget).off(r.namespace?r.origType+"."+r.namespace:r.origType,r.selector,r.handler),this;if("object"==typeof e){for(i in e)this.off(i,t,e[i]);return this}return!1!==t&&"function"!=typeof t||(n=t,t=void 0),!1===n&&(n=Se),this.each(function(){T.event.remove(this,e,n,t)})}});var Ie=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi,Ne=/<script|<style|<link/i,ke=/checked\s*(?:[^=]|=\s*.checked.)/i,Le=/^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g;function je(e,t){return I(e,"table")&&I(11!==t.nodeType?t:t.firstChild,"tr")&&T(e).children("tbody")[0]||e}function Re(e){return e.type=(null!==e.getAttribute("type"))+"/"+e.type,e}function Pe(e){return"true/"===(e.type||"").slice(0,5)?e.type=e.type.slice(5):e.removeAttribute("type"),e}function $e(e,t){var n,r,i,o,a,s,u,c;if(1===t.nodeType){if(J.hasData(e)&&(o=J.access(e),a=J.set(t,o),c=o.events))for(i in delete a.handle,a.events={},c)for(n=0,r=c[i].length;n<r;n++)T.event.add(t,i,c[i][n]);Z.hasData(e)&&(s=Z.access(e),u=T.extend({},s),Z.set(t,u))}}function He(e,t,n,r){t=c.apply([],t);var i,o,a,s,u,l,f=0,p=e.length,d=p-1,h=t[0],v=y(h);if(v||p>1&&"string"==typeof h&&!m.checkClone&&ke.test(h))return e.each(function(i){var o=e.eq(i);v&&(t[0]=h.call(this,i,o.html())),He(o,t,n,r)});if(p&&(o=(i=we(t,e[0].ownerDocument,!1,e,r)).firstChild,1===i.childNodes.length&&(i=o),o||r)){for(s=(a=T.map(ge(i,"script"),Re)).length;f<p;f++)u=i,f!==d&&(u=T.clone(u,!0,!0),s&&T.merge(a,ge(u,"script"))),n.call(e[f],u,f);if(s)for(l=a[a.length-1].ownerDocument,T.map(a,Pe),f=0;f<s;f++)u=a[f],he.test(u.type||"")&&!J.access(u,"globalEval")&&T.contains(l,u)&&(u.src&&"module"!==(u.type||"").toLowerCase()?T._evalUrl&&T._evalUrl(u.src):w(u.textContent.replace(Le,""),l,u))}return e}function Me(e,t,n){for(var r,i=t?T.filter(t,e):e,o=0;null!=(r=i[o]);o++)n||1!==r.nodeType||T.cleanData(ge(r)),r.parentNode&&(n&&T.contains(r.ownerDocument,r)&&me(ge(r,"script")),r.parentNode.removeChild(r));return e}T.extend({htmlPrefilter:function(e){return e.replace(Ie,"<$1></$2>")},clone:function(e,t,n){var r,i,o,a,s,u,c,l=e.cloneNode(!0),f=T.contains(e.ownerDocument,e);if(!(m.noCloneChecked||1!==e.nodeType&&11!==e.nodeType||T.isXMLDoc(e)))for(a=ge(l),r=0,i=(o=ge(e)).length;r<i;r++)s=o[r],u=a[r],c=void 0,"input"===(c=u.nodeName.toLowerCase())&&pe.test(s.type)?u.checked=s.checked:"input"!==c&&"textarea"!==c||(u.defaultValue=s.defaultValue);if(t)if(n)for(o=o||ge(e),a=a||ge(l),r=0,i=o.length;r<i;r++)$e(o[r],a[r]);else $e(e,l);return(a=ge(l,"script")).length>0&&me(a,!f&&ge(e,"script")),l},cleanData:function(e){for(var t,n,r,i=T.event.special,o=0;void 0!==(n=e[o]);o++)if(Q(n)){if(t=n[J.expando]){if(t.events)for(r in t.events)i[r]?T.event.remove(n,r):T.removeEvent(n,r,t.handle);n[J.expando]=void 0}n[Z.expando]&&(n[Z.expando]=void 0)}}}),T.fn.extend({detach:function(e){return Me(this,e,!0)},remove:function(e){return Me(this,e)},text:function(e){return V(this,function(e){return void 0===e?T.text(this):this.empty().each(function(){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||(this.textContent=e)})},null,e,arguments.length)},append:function(){return He(this,arguments,function(e){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||je(this,e).appendChild(e)})},prepend:function(){return He(this,arguments,function(e){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var t=je(this,e);t.insertBefore(e,t.firstChild)}})},before:function(){return He(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this)})},after:function(){return He(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this.nextSibling)})},empty:function(){for(var e,t=0;null!=(e=this[t]);t++)1===e.nodeType&&(T.cleanData(ge(e,!1)),e.textContent="");return this},clone:function(e,t){return e=null!=e&&e,t=null==t?e:t,this.map(function(){return T.clone(this,e,t)})},html:function(e){return V(this,function(e){var t=this[0]||{},n=0,r=this.length;if(void 0===e&&1===t.nodeType)return t.innerHTML;if("string"==typeof e&&!Ne.test(e)&&!ve[(de.exec(e)||["",""])[1].toLowerCase()]){e=T.htmlPrefilter(e);try{for(;n<r;n++)1===(t=this[n]||{}).nodeType&&(T.cleanData(ge(t,!1)),t.innerHTML=e);t=0}catch(e){}}t&&this.empty().append(e)},null,e,arguments.length)},replaceWith:function(){var e=[];return He(this,arguments,function(t){var n=this.parentNode;T.inArray(this,e)<0&&(T.cleanData(ge(this)),n&&n.replaceChild(t,this))},e)}}),T.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,t){T.fn[e]=function(e){for(var n,r=[],i=T(e),o=i.length-1,a=0;a<=o;a++)n=a===o?this:this.clone(!0),T(i[a])[t](n),l.apply(r,n.get());return this.pushStack(r)}});var Fe=new RegExp("^("+re+")(?!px)[a-z%]+$","i"),We=function(e){var t=e.ownerDocument.defaultView;return t&&t.opener||(t=n),t.getComputedStyle(e)},Ue=new RegExp(oe.join("|"),"i");function Be(e,t,n){var r,i,o,a,s=e.style;return(n=n||We(e))&&(""!==(a=n.getPropertyValue(t)||n[t])||T.contains(e.ownerDocument,e)||(a=T.style(e,t)),!m.pixelBoxStyles()&&Fe.test(a)&&Ue.test(t)&&(r=s.width,i=s.minWidth,o=s.maxWidth,s.minWidth=s.maxWidth=s.width=a,a=n.width,s.width=r,s.minWidth=i,s.maxWidth=o)),void 0!==a?a+"":a}function qe(e,t){return{get:function(){if(!e())return(this.get=t).apply(this,arguments);delete this.get}}}!function(){function e(){if(l){c.style.cssText="position:absolute;left:-11111px;width:60px;margin-top:1px;padding:0;border:0",l.style.cssText="position:relative;display:block;box-sizing:border-box;overflow:scroll;margin:auto;border:1px;padding:1px;width:60%;top:1%",Ee.appendChild(c).appendChild(l);var e=n.getComputedStyle(l);r="1%"!==e.top,u=12===t(e.marginLeft),l.style.right="60%",s=36===t(e.right),i=36===t(e.width),l.style.position="absolute",o=36===l.offsetWidth||"absolute",Ee.removeChild(c),l=null}}function t(e){return Math.round(parseFloat(e))}var r,i,o,s,u,c=a.createElement("div"),l=a.createElement("div");l.style&&(l.style.backgroundClip="content-box",l.cloneNode(!0).style.backgroundClip="",m.clearCloneStyle="content-box"===l.style.backgroundClip,T.extend(m,{boxSizingReliable:function(){return e(),i},pixelBoxStyles:function(){return e(),s},pixelPosition:function(){return e(),r},reliableMarginLeft:function(){return e(),u},scrollboxSize:function(){return e(),o}}))}();var Ve=/^(none|table(?!-c[ea]).+)/,ze=/^--/,Ge={position:"absolute",visibility:"hidden",display:"block"},Ke={letterSpacing:"0",fontWeight:"400"},Xe=["Webkit","Moz","ms"],Qe=a.createElement("div").style;function Ye(e){var t=T.cssProps[e];return t||(t=T.cssProps[e]=function(e){if(e in Qe)return e;for(var t=e[0].toUpperCase()+e.slice(1),n=Xe.length;n--;)if((e=Xe[n]+t)in Qe)return e}(e)||e),t}function Je(e,t,n){var r=ie.exec(t);return r?Math.max(0,r[2]-(n||0))+(r[3]||"px"):t}function Ze(e,t,n,r,i,o){var a="width"===t?1:0,s=0,u=0;if(n===(r?"border":"content"))return 0;for(;a<4;a+=2)"margin"===n&&(u+=T.css(e,n+oe[a],!0,i)),r?("content"===n&&(u-=T.css(e,"padding"+oe[a],!0,i)),"margin"!==n&&(u-=T.css(e,"border"+oe[a]+"Width",!0,i))):(u+=T.css(e,"padding"+oe[a],!0,i),"padding"!==n?u+=T.css(e,"border"+oe[a]+"Width",!0,i):s+=T.css(e,"border"+oe[a]+"Width",!0,i));return!r&&o>=0&&(u+=Math.max(0,Math.ceil(e["offset"+t[0].toUpperCase()+t.slice(1)]-o-u-s-.5))),u}function et(e,t,n){var r=We(e),i=Be(e,t,r),o="border-box"===T.css(e,"boxSizing",!1,r),a=o;if(Fe.test(i)){if(!n)return i;i="auto"}return a=a&&(m.boxSizingReliable()||i===e.style[t]),("auto"===i||!parseFloat(i)&&"inline"===T.css(e,"display",!1,r))&&(i=e["offset"+t[0].toUpperCase()+t.slice(1)],a=!0),(i=parseFloat(i)||0)+Ze(e,t,n||(o?"border":"content"),a,r,i)+"px"}function tt(e,t,n,r,i){return new tt.prototype.init(e,t,n,r,i)}T.extend({cssHooks:{opacity:{get:function(e,t){if(t){var n=Be(e,"opacity");return""===n?"1":n}}}},cssNumber:{animationIterationCount:!0,columnCount:!0,fillOpacity:!0,flexGrow:!0,flexShrink:!0,fontWeight:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{},style:function(e,t,n,r){if(e&&3!==e.nodeType&&8!==e.nodeType&&e.style){var i,o,a,s=X(t),u=ze.test(t),c=e.style;if(u||(t=Ye(s)),a=T.cssHooks[t]||T.cssHooks[s],void 0===n)return a&&"get"in a&&void 0!==(i=a.get(e,!1,r))?i:c[t];"string"===(o=typeof n)&&(i=ie.exec(n))&&i[1]&&(n=ue(e,t,i),o="number"),null!=n&&n==n&&("number"===o&&(n+=i&&i[3]||(T.cssNumber[s]?"":"px")),m.clearCloneStyle||""!==n||0!==t.indexOf("background")||(c[t]="inherit"),a&&"set"in a&&void 0===(n=a.set(e,n,r))||(u?c.setProperty(t,n):c[t]=n))}},css:function(e,t,n,r){var i,o,a,s=X(t);return ze.test(t)||(t=Ye(s)),(a=T.cssHooks[t]||T.cssHooks[s])&&"get"in a&&(i=a.get(e,!0,n)),void 0===i&&(i=Be(e,t,r)),"normal"===i&&t in Ke&&(i=Ke[t]),""===n||n?(o=parseFloat(i),!0===n||isFinite(o)?o||0:i):i}}),T.each(["height","width"],function(e,t){T.cssHooks[t]={get:function(e,n,r){if(n)return!Ve.test(T.css(e,"display"))||e.getClientRects().length&&e.getBoundingClientRect().width?et(e,t,r):se(e,Ge,function(){return et(e,t,r)})},set:function(e,n,r){var i,o=We(e),a="border-box"===T.css(e,"boxSizing",!1,o),s=r&&Ze(e,t,r,a,o);return a&&m.scrollboxSize()===o.position&&(s-=Math.ceil(e["offset"+t[0].toUpperCase()+t.slice(1)]-parseFloat(o[t])-Ze(e,t,"border",!1,o)-.5)),s&&(i=ie.exec(n))&&"px"!==(i[3]||"px")&&(e.style[t]=n,n=T.css(e,t)),Je(0,n,s)}}}),T.cssHooks.marginLeft=qe(m.reliableMarginLeft,function(e,t){if(t)return(parseFloat(Be(e,"marginLeft"))||e.getBoundingClientRect().left-se(e,{marginLeft:0},function(){return e.getBoundingClientRect().left}))+"px"}),T.each({margin:"",padding:"",border:"Width"},function(e,t){T.cssHooks[e+t]={expand:function(n){for(var r=0,i={},o="string"==typeof n?n.split(" "):[n];r<4;r++)i[e+oe[r]+t]=o[r]||o[r-2]||o[0];return i}},"margin"!==e&&(T.cssHooks[e+t].set=Je)}),T.fn.extend({css:function(e,t){return V(this,function(e,t,n){var r,i,o={},a=0;if(Array.isArray(t)){for(r=We(e),i=t.length;a<i;a++)o[t[a]]=T.css(e,t[a],!1,r);return o}return void 0!==n?T.style(e,t,n):T.css(e,t)},e,t,arguments.length>1)}}),T.Tween=tt,tt.prototype={constructor:tt,init:function(e,t,n,r,i,o){this.elem=e,this.prop=n,this.easing=i||T.easing._default,this.options=t,this.start=this.now=this.cur(),this.end=r,this.unit=o||(T.cssNumber[n]?"":"px")},cur:function(){var e=tt.propHooks[this.prop];return e&&e.get?e.get(this):tt.propHooks._default.get(this)},run:function(e){var t,n=tt.propHooks[this.prop];return this.options.duration?this.pos=t=T.easing[this.easing](e,this.options.duration*e,0,1,this.options.duration):this.pos=t=e,this.now=(this.end-this.start)*t+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),n&&n.set?n.set(this):tt.propHooks._default.set(this),this}},tt.prototype.init.prototype=tt.prototype,tt.propHooks={_default:{get:function(e){var t;return 1!==e.elem.nodeType||null!=e.elem[e.prop]&&null==e.elem.style[e.prop]?e.elem[e.prop]:(t=T.css(e.elem,e.prop,""))&&"auto"!==t?t:0},set:function(e){T.fx.step[e.prop]?T.fx.step[e.prop](e):1!==e.elem.nodeType||null==e.elem.style[T.cssProps[e.prop]]&&!T.cssHooks[e.prop]?e.elem[e.prop]=e.now:T.style(e.elem,e.prop,e.now+e.unit)}}},tt.propHooks.scrollTop=tt.propHooks.scrollLeft={set:function(e){e.elem.nodeType&&e.elem.parentNode&&(e.elem[e.prop]=e.now)}},T.easing={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},_default:"swing"},T.fx=tt.prototype.init,T.fx.step={};var nt,rt,it=/^(?:toggle|show|hide)$/,ot=/queueHooks$/;function at(){rt&&(!1===a.hidden&&n.requestAnimationFrame?n.requestAnimationFrame(at):n.setTimeout(at,T.fx.interval),T.fx.tick())}function st(){return n.setTimeout(function(){nt=void 0}),nt=Date.now()}function ut(e,t){var n,r=0,i={height:e};for(t=t?1:0;r<4;r+=2-t)i["margin"+(n=oe[r])]=i["padding"+n]=e;return t&&(i.opacity=i.width=e),i}function ct(e,t,n){for(var r,i=(lt.tweeners[t]||[]).concat(lt.tweeners["*"]),o=0,a=i.length;o<a;o++)if(r=i[o].call(n,t,e))return r}function lt(e,t,n){var r,i,o=0,a=lt.prefilters.length,s=T.Deferred().always(function(){delete u.elem}),u=function(){if(i)return!1;for(var t=nt||st(),n=Math.max(0,c.startTime+c.duration-t),r=1-(n/c.duration||0),o=0,a=c.tweens.length;o<a;o++)c.tweens[o].run(r);return s.notifyWith(e,[c,r,n]),r<1&&a?n:(a||s.notifyWith(e,[c,1,0]),s.resolveWith(e,[c]),!1)},c=s.promise({elem:e,props:T.extend({},t),opts:T.extend(!0,{specialEasing:{},easing:T.easing._default},n),originalProperties:t,originalOptions:n,startTime:nt||st(),duration:n.duration,tweens:[],createTween:function(t,n){var r=T.Tween(e,c.opts,t,n,c.opts.specialEasing[t]||c.opts.easing);return c.tweens.push(r),r},stop:function(t){var n=0,r=t?c.tweens.length:0;if(i)return this;for(i=!0;n<r;n++)c.tweens[n].run(1);return t?(s.notifyWith(e,[c,1,0]),s.resolveWith(e,[c,t])):s.rejectWith(e,[c,t]),this}}),l=c.props;for(!function(e,t){var n,r,i,o,a;for(n in e)if(i=t[r=X(n)],o=e[n],Array.isArray(o)&&(i=o[1],o=e[n]=o[0]),n!==r&&(e[r]=o,delete e[n]),(a=T.cssHooks[r])&&"expand"in a)for(n in o=a.expand(o),delete e[r],o)n in e||(e[n]=o[n],t[n]=i);else t[r]=i}(l,c.opts.specialEasing);o<a;o++)if(r=lt.prefilters[o].call(c,e,l,c.opts))return y(r.stop)&&(T._queueHooks(c.elem,c.opts.queue).stop=r.stop.bind(r)),r;return T.map(l,ct,c),y(c.opts.start)&&c.opts.start.call(e,c),c.progress(c.opts.progress).done(c.opts.done,c.opts.complete).fail(c.opts.fail).always(c.opts.always),T.fx.timer(T.extend(u,{elem:e,anim:c,queue:c.opts.queue})),c}T.Animation=T.extend(lt,{tweeners:{"*":[function(e,t){var n=this.createTween(e,t);return ue(n.elem,e,ie.exec(t),n),n}]},tweener:function(e,t){y(e)?(t=e,e=["*"]):e=e.match(H);for(var n,r=0,i=e.length;r<i;r++)n=e[r],lt.tweeners[n]=lt.tweeners[n]||[],lt.tweeners[n].unshift(t)},prefilters:[function(e,t,n){var r,i,o,a,s,u,c,l,f="width"in t||"height"in t,p=this,d={},h=e.style,v=e.nodeType&&ae(e),g=J.get(e,"fxshow");for(r in n.queue||(null==(a=T._queueHooks(e,"fx")).unqueued&&(a.unqueued=0,s=a.empty.fire,a.empty.fire=function(){a.unqueued||s()}),a.unqueued++,p.always(function(){p.always(function(){a.unqueued--,T.queue(e,"fx").length||a.empty.fire()})})),t)if(i=t[r],it.test(i)){if(delete t[r],o=o||"toggle"===i,i===(v?"hide":"show")){if("show"!==i||!g||void 0===g[r])continue;v=!0}d[r]=g&&g[r]||T.style(e,r)}if((u=!T.isEmptyObject(t))||!T.isEmptyObject(d))for(r in f&&1===e.nodeType&&(n.overflow=[h.overflow,h.overflowX,h.overflowY],null==(c=g&&g.display)&&(c=J.get(e,"display")),"none"===(l=T.css(e,"display"))&&(c?l=c:(fe([e],!0),c=e.style.display||c,l=T.css(e,"display"),fe([e]))),("inline"===l||"inline-block"===l&&null!=c)&&"none"===T.css(e,"float")&&(u||(p.done(function(){h.display=c}),null==c&&(l=h.display,c="none"===l?"":l)),h.display="inline-block")),n.overflow&&(h.overflow="hidden",p.always(function(){h.overflow=n.overflow[0],h.overflowX=n.overflow[1],h.overflowY=n.overflow[2]})),u=!1,d)u||(g?"hidden"in g&&(v=g.hidden):g=J.access(e,"fxshow",{display:c}),o&&(g.hidden=!v),v&&fe([e],!0),p.done(function(){for(r in v||fe([e]),J.remove(e,"fxshow"),d)T.style(e,r,d[r])})),u=ct(v?g[r]:0,r,p),r in g||(g[r]=u.start,v&&(u.end=u.start,u.start=0))}],prefilter:function(e,t){t?lt.prefilters.unshift(e):lt.prefilters.push(e)}}),T.speed=function(e,t,n){var r=e&&"object"==typeof e?T.extend({},e):{complete:n||!n&&t||y(e)&&e,duration:e,easing:n&&t||t&&!y(t)&&t};return T.fx.off?r.duration=0:"number"!=typeof r.duration&&(r.duration in T.fx.speeds?r.duration=T.fx.speeds[r.duration]:r.duration=T.fx.speeds._default),null!=r.queue&&!0!==r.queue||(r.queue="fx"),r.old=r.complete,r.complete=function(){y(r.old)&&r.old.call(this),r.queue&&T.dequeue(this,r.queue)},r},T.fn.extend({fadeTo:function(e,t,n,r){return this.filter(ae).css("opacity",0).show().end().animate({opacity:t},e,n,r)},animate:function(e,t,n,r){var i=T.isEmptyObject(e),o=T.speed(t,n,r),a=function(){var t=lt(this,T.extend({},e),o);(i||J.get(this,"finish"))&&t.stop(!0)};return a.finish=a,i||!1===o.queue?this.each(a):this.queue(o.queue,a)},stop:function(e,t,n){var r=function(e){var t=e.stop;delete e.stop,t(n)};return"string"!=typeof e&&(n=t,t=e,e=void 0),t&&!1!==e&&this.queue(e||"fx",[]),this.each(function(){var t=!0,i=null!=e&&e+"queueHooks",o=T.timers,a=J.get(this);if(i)a[i]&&a[i].stop&&r(a[i]);else for(i in a)a[i]&&a[i].stop&&ot.test(i)&&r(a[i]);for(i=o.length;i--;)o[i].elem!==this||null!=e&&o[i].queue!==e||(o[i].anim.stop(n),t=!1,o.splice(i,1));!t&&n||T.dequeue(this,e)})},finish:function(e){return!1!==e&&(e=e||"fx"),this.each(function(){var t,n=J.get(this),r=n[e+"queue"],i=n[e+"queueHooks"],o=T.timers,a=r?r.length:0;for(n.finish=!0,T.queue(this,e,[]),i&&i.stop&&i.stop.call(this,!0),t=o.length;t--;)o[t].elem===this&&o[t].queue===e&&(o[t].anim.stop(!0),o.splice(t,1));for(t=0;t<a;t++)r[t]&&r[t].finish&&r[t].finish.call(this);delete n.finish})}}),T.each(["toggle","show","hide"],function(e,t){var n=T.fn[t];T.fn[t]=function(e,r,i){return null==e||"boolean"==typeof e?n.apply(this,arguments):this.animate(ut(t,!0),e,r,i)}}),T.each({slideDown:ut("show"),slideUp:ut("hide"),slideToggle:ut("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,t){T.fn[e]=function(e,n,r){return this.animate(t,e,n,r)}}),T.timers=[],T.fx.tick=function(){var e,t=0,n=T.timers;for(nt=Date.now();t<n.length;t++)(e=n[t])()||n[t]!==e||n.splice(t--,1);n.length||T.fx.stop(),nt=void 0},T.fx.timer=function(e){T.timers.push(e),T.fx.start()},T.fx.interval=13,T.fx.start=function(){rt||(rt=!0,at())},T.fx.stop=function(){rt=null},T.fx.speeds={slow:600,fast:200,_default:400},T.fn.delay=function(e,t){return e=T.fx&&T.fx.speeds[e]||e,t=t||"fx",this.queue(t,function(t,r){var i=n.setTimeout(t,e);r.stop=function(){n.clearTimeout(i)}})},function(){var e=a.createElement("input"),t=a.createElement("select").appendChild(a.createElement("option"));e.type="checkbox",m.checkOn=""!==e.value,m.optSelected=t.selected,(e=a.createElement("input")).value="t",e.type="radio",m.radioValue="t"===e.value}();var ft,pt=T.expr.attrHandle;T.fn.extend({attr:function(e,t){return V(this,T.attr,e,t,arguments.length>1)},removeAttr:function(e){return this.each(function(){T.removeAttr(this,e)})}}),T.extend({attr:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return void 0===e.getAttribute?T.prop(e,t,n):(1===o&&T.isXMLDoc(e)||(i=T.attrHooks[t.toLowerCase()]||(T.expr.match.bool.test(t)?ft:void 0)),void 0!==n?null===n?void T.removeAttr(e,t):i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:(e.setAttribute(t,n+""),n):i&&"get"in i&&null!==(r=i.get(e,t))?r:null==(r=T.find.attr(e,t))?void 0:r)},attrHooks:{type:{set:function(e,t){if(!m.radioValue&&"radio"===t&&I(e,"input")){var n=e.value;return e.setAttribute("type",t),n&&(e.value=n),t}}}},removeAttr:function(e,t){var n,r=0,i=t&&t.match(H);if(i&&1===e.nodeType)for(;n=i[r++];)e.removeAttribute(n)}}),ft={set:function(e,t,n){return!1===t?T.removeAttr(e,n):e.setAttribute(n,n),n}},T.each(T.expr.match.bool.source.match(/\w+/g),function(e,t){var n=pt[t]||T.find.attr;pt[t]=function(e,t,r){var i,o,a=t.toLowerCase();return r||(o=pt[a],pt[a]=i,i=null!=n(e,t,r)?a:null,pt[a]=o),i}});var dt=/^(?:input|select|textarea|button)$/i,ht=/^(?:a|area)$/i;function vt(e){return(e.match(H)||[]).join(" ")}function gt(e){return e.getAttribute&&e.getAttribute("class")||""}function mt(e){return Array.isArray(e)?e:"string"==typeof e&&e.match(H)||[]}T.fn.extend({prop:function(e,t){return V(this,T.prop,e,t,arguments.length>1)},removeProp:function(e){return this.each(function(){delete this[T.propFix[e]||e]})}}),T.extend({prop:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return 1===o&&T.isXMLDoc(e)||(t=T.propFix[t]||t,i=T.propHooks[t]),void 0!==n?i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:e[t]=n:i&&"get"in i&&null!==(r=i.get(e,t))?r:e[t]},propHooks:{tabIndex:{get:function(e){var t=T.find.attr(e,"tabindex");return t?parseInt(t,10):dt.test(e.nodeName)||ht.test(e.nodeName)&&e.href?0:-1}}},propFix:{for:"htmlFor",class:"className"}}),m.optSelected||(T.propHooks.selected={get:function(e){var t=e.parentNode;return t&&t.parentNode&&t.parentNode.selectedIndex,null},set:function(e){var t=e.parentNode;t&&(t.selectedIndex,t.parentNode&&t.parentNode.selectedIndex)}}),T.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){T.propFix[this.toLowerCase()]=this}),T.fn.extend({addClass:function(e){var t,n,r,i,o,a,s,u=0;if(y(e))return this.each(function(t){T(this).addClass(e.call(this,t,gt(this)))});if((t=mt(e)).length)for(;n=this[u++];)if(i=gt(n),r=1===n.nodeType&&" "+vt(i)+" "){for(a=0;o=t[a++];)r.indexOf(" "+o+" ")<0&&(r+=o+" ");i!==(s=vt(r))&&n.setAttribute("class",s)}return this},removeClass:function(e){var t,n,r,i,o,a,s,u=0;if(y(e))return this.each(function(t){T(this).removeClass(e.call(this,t,gt(this)))});if(!arguments.length)return this.attr("class","");if((t=mt(e)).length)for(;n=this[u++];)if(i=gt(n),r=1===n.nodeType&&" "+vt(i)+" "){for(a=0;o=t[a++];)for(;r.indexOf(" "+o+" ")>-1;)r=r.replace(" "+o+" "," ");i!==(s=vt(r))&&n.setAttribute("class",s)}return this},toggleClass:function(e,t){var n=typeof e,r="string"===n||Array.isArray(e);return"boolean"==typeof t&&r?t?this.addClass(e):this.removeClass(e):y(e)?this.each(function(n){T(this).toggleClass(e.call(this,n,gt(this),t),t)}):this.each(function(){var t,i,o,a;if(r)for(i=0,o=T(this),a=mt(e);t=a[i++];)o.hasClass(t)?o.removeClass(t):o.addClass(t);else void 0!==e&&"boolean"!==n||((t=gt(this))&&J.set(this,"__className__",t),this.setAttribute&&this.setAttribute("class",t||!1===e?"":J.get(this,"__className__")||""))})},hasClass:function(e){var t,n,r=0;for(t=" "+e+" ";n=this[r++];)if(1===n.nodeType&&(" "+vt(gt(n))+" ").indexOf(t)>-1)return!0;return!1}});var yt=/\r/g;T.fn.extend({val:function(e){var t,n,r,i=this[0];return arguments.length?(r=y(e),this.each(function(n){var i;1===this.nodeType&&(null==(i=r?e.call(this,n,T(this).val()):e)?i="":"number"==typeof i?i+="":Array.isArray(i)&&(i=T.map(i,function(e){return null==e?"":e+""})),(t=T.valHooks[this.type]||T.valHooks[this.nodeName.toLowerCase()])&&"set"in t&&void 0!==t.set(this,i,"value")||(this.value=i))})):i?(t=T.valHooks[i.type]||T.valHooks[i.nodeName.toLowerCase()])&&"get"in t&&void 0!==(n=t.get(i,"value"))?n:"string"==typeof(n=i.value)?n.replace(yt,""):null==n?"":n:void 0}}),T.extend({valHooks:{option:{get:function(e){var t=T.find.attr(e,"value");return null!=t?t:vt(T.text(e))}},select:{get:function(e){var t,n,r,i=e.options,o=e.selectedIndex,a="select-one"===e.type,s=a?null:[],u=a?o+1:i.length;for(r=o<0?u:a?o:0;r<u;r++)if(((n=i[r]).selected||r===o)&&!n.disabled&&(!n.parentNode.disabled||!I(n.parentNode,"optgroup"))){if(t=T(n).val(),a)return t;s.push(t)}return s},set:function(e,t){for(var n,r,i=e.options,o=T.makeArray(t),a=i.length;a--;)((r=i[a]).selected=T.inArray(T.valHooks.option.get(r),o)>-1)&&(n=!0);return n||(e.selectedIndex=-1),o}}}}),T.each(["radio","checkbox"],function(){T.valHooks[this]={set:function(e,t){if(Array.isArray(t))return e.checked=T.inArray(T(e).val(),t)>-1}},m.checkOn||(T.valHooks[this].get=function(e){return null===e.getAttribute("value")?"on":e.value})}),m.focusin="onfocusin"in n;var _t=/^(?:focusinfocus|focusoutblur)$/,bt=function(e){e.stopPropagation()};T.extend(T.event,{trigger:function(e,t,r,i){var o,s,u,c,l,f,p,d,v=[r||a],g=h.call(e,"type")?e.type:e,m=h.call(e,"namespace")?e.namespace.split("."):[];if(s=d=u=r=r||a,3!==r.nodeType&&8!==r.nodeType&&!_t.test(g+T.event.triggered)&&(g.indexOf(".")>-1&&(m=g.split("."),g=m.shift(),m.sort()),l=g.indexOf(":")<0&&"on"+g,(e=e[T.expando]?e:new T.Event(g,"object"==typeof e&&e)).isTrigger=i?2:3,e.namespace=m.join("."),e.rnamespace=e.namespace?new RegExp("(^|\\.)"+m.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,e.result=void 0,e.target||(e.target=r),t=null==t?[e]:T.makeArray(t,[e]),p=T.event.special[g]||{},i||!p.trigger||!1!==p.trigger.apply(r,t))){if(!i&&!p.noBubble&&!_(r)){for(c=p.delegateType||g,_t.test(c+g)||(s=s.parentNode);s;s=s.parentNode)v.push(s),u=s;u===(r.ownerDocument||a)&&v.push(u.defaultView||u.parentWindow||n)}for(o=0;(s=v[o++])&&!e.isPropagationStopped();)d=s,e.type=o>1?c:p.bindType||g,(f=(J.get(s,"events")||{})[e.type]&&J.get(s,"handle"))&&f.apply(s,t),(f=l&&s[l])&&f.apply&&Q(s)&&(e.result=f.apply(s,t),!1===e.result&&e.preventDefault());return e.type=g,i||e.isDefaultPrevented()||p._default&&!1!==p._default.apply(v.pop(),t)||!Q(r)||l&&y(r[g])&&!_(r)&&((u=r[l])&&(r[l]=null),T.event.triggered=g,e.isPropagationStopped()&&d.addEventListener(g,bt),r[g](),e.isPropagationStopped()&&d.removeEventListener(g,bt),T.event.triggered=void 0,u&&(r[l]=u)),e.result}},simulate:function(e,t,n){var r=T.extend(new T.Event,n,{type:e,isSimulated:!0});T.event.trigger(r,null,t)}}),T.fn.extend({trigger:function(e,t){return this.each(function(){T.event.trigger(e,t,this)})},triggerHandler:function(e,t){var n=this[0];if(n)return T.event.trigger(e,t,n,!0)}}),m.focusin||T.each({focus:"focusin",blur:"focusout"},function(e,t){var n=function(e){T.event.simulate(t,e.target,T.event.fix(e))};T.event.special[t]={setup:function(){var r=this.ownerDocument||this,i=J.access(r,t);i||r.addEventListener(e,n,!0),J.access(r,t,(i||0)+1)},teardown:function(){var r=this.ownerDocument||this,i=J.access(r,t)-1;i?J.access(r,t,i):(r.removeEventListener(e,n,!0),J.remove(r,t))}}});var wt=n.location,Et=Date.now(),Tt=/\?/;T.parseXML=function(e){var t;if(!e||"string"!=typeof e)return null;try{t=(new n.DOMParser).parseFromString(e,"text/xml")}catch(e){t=void 0}return t&&!t.getElementsByTagName("parsererror").length||T.error("Invalid XML: "+e),t};var Ct=/\[\]$/,xt=/\r?\n/g,At=/^(?:submit|button|image|reset|file)$/i,St=/^(?:input|select|textarea|keygen)/i;function Ot(e,t,n,r){var i;if(Array.isArray(t))T.each(t,function(t,i){n||Ct.test(e)?r(e,i):Ot(e+"["+("object"==typeof i&&null!=i?t:"")+"]",i,n,r)});else if(n||"object"!==E(t))r(e,t);else for(i in t)Ot(e+"["+i+"]",t[i],n,r)}T.param=function(e,t){var n,r=[],i=function(e,t){var n=y(t)?t():t;r[r.length]=encodeURIComponent(e)+"="+encodeURIComponent(null==n?"":n)};if(Array.isArray(e)||e.jquery&&!T.isPlainObject(e))T.each(e,function(){i(this.name,this.value)});else for(n in e)Ot(n,e[n],t,i);return r.join("&")},T.fn.extend({serialize:function(){return T.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var e=T.prop(this,"elements");return e?T.makeArray(e):this}).filter(function(){var e=this.type;return this.name&&!T(this).is(":disabled")&&St.test(this.nodeName)&&!At.test(e)&&(this.checked||!pe.test(e))}).map(function(e,t){var n=T(this).val();return null==n?null:Array.isArray(n)?T.map(n,function(e){return{name:t.name,value:e.replace(xt,"\r\n")}}):{name:t.name,value:n.replace(xt,"\r\n")}}).get()}});var Dt=/%20/g,It=/#.*$/,Nt=/([?&])_=[^&]*/,kt=/^(.*?):[ \t]*([^\r\n]*)$/gm,Lt=/^(?:GET|HEAD)$/,jt=/^\/\//,Rt={},Pt={},$t="*/".concat("*"),Ht=a.createElement("a");function Mt(e){return function(t,n){"string"!=typeof t&&(n=t,t="*");var r,i=0,o=t.toLowerCase().match(H)||[];if(y(n))for(;r=o[i++];)"+"===r[0]?(r=r.slice(1)||"*",(e[r]=e[r]||[]).unshift(n)):(e[r]=e[r]||[]).push(n)}}function Ft(e,t,n,r){var i={},o=e===Pt;function a(s){var u;return i[s]=!0,T.each(e[s]||[],function(e,s){var c=s(t,n,r);return"string"!=typeof c||o||i[c]?o?!(u=c):void 0:(t.dataTypes.unshift(c),a(c),!1)}),u}return a(t.dataTypes[0])||!i["*"]&&a("*")}function Wt(e,t){var n,r,i=T.ajaxSettings.flatOptions||{};for(n in t)void 0!==t[n]&&((i[n]?e:r||(r={}))[n]=t[n]);return r&&T.extend(!0,e,r),e}Ht.href=wt.href,T.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:wt.href,type:"GET",isLocal:/^(?:about|app|app-storage|.+-extension|file|res|widget):$/.test(wt.protocol),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":$t,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":JSON.parse,"text xml":T.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(e,t){return t?Wt(Wt(e,T.ajaxSettings),t):Wt(T.ajaxSettings,e)},ajaxPrefilter:Mt(Rt),ajaxTransport:Mt(Pt),ajax:function(e,t){"object"==typeof e&&(t=e,e=void 0),t=t||{};var r,i,o,s,u,c,l,f,p,d,h=T.ajaxSetup({},t),v=h.context||h,g=h.context&&(v.nodeType||v.jquery)?T(v):T.event,m=T.Deferred(),y=T.Callbacks("once memory"),_=h.statusCode||{},b={},w={},E="canceled",C={readyState:0,getResponseHeader:function(e){var t;if(l){if(!s)for(s={};t=kt.exec(o);)s[t[1].toLowerCase()]=t[2];t=s[e.toLowerCase()]}return null==t?null:t},getAllResponseHeaders:function(){return l?o:null},setRequestHeader:function(e,t){return null==l&&(e=w[e.toLowerCase()]=w[e.toLowerCase()]||e,b[e]=t),this},overrideMimeType:function(e){return null==l&&(h.mimeType=e),this},statusCode:function(e){var t;if(e)if(l)C.always(e[C.status]);else for(t in e)_[t]=[_[t],e[t]];return this},abort:function(e){var t=e||E;return r&&r.abort(t),x(0,t),this}};if(m.promise(C),h.url=((e||h.url||wt.href)+"").replace(jt,wt.protocol+"//"),h.type=t.method||t.type||h.method||h.type,h.dataTypes=(h.dataType||"*").toLowerCase().match(H)||[""],null==h.crossDomain){c=a.createElement("a");try{c.href=h.url,c.href=c.href,h.crossDomain=Ht.protocol+"//"+Ht.host!=c.protocol+"//"+c.host}catch(e){h.crossDomain=!0}}if(h.data&&h.processData&&"string"!=typeof h.data&&(h.data=T.param(h.data,h.traditional)),Ft(Rt,h,t,C),l)return C;for(p in(f=T.event&&h.global)&&0==T.active++&&T.event.trigger("ajaxStart"),h.type=h.type.toUpperCase(),h.hasContent=!Lt.test(h.type),i=h.url.replace(It,""),h.hasContent?h.data&&h.processData&&0===(h.contentType||"").indexOf("application/x-www-form-urlencoded")&&(h.data=h.data.replace(Dt,"+")):(d=h.url.slice(i.length),h.data&&(h.processData||"string"==typeof h.data)&&(i+=(Tt.test(i)?"&":"?")+h.data,delete h.data),!1===h.cache&&(i=i.replace(Nt,"$1"),d=(Tt.test(i)?"&":"?")+"_="+Et+++d),h.url=i+d),h.ifModified&&(T.lastModified[i]&&C.setRequestHeader("If-Modified-Since",T.lastModified[i]),T.etag[i]&&C.setRequestHeader("If-None-Match",T.etag[i])),(h.data&&h.hasContent&&!1!==h.contentType||t.contentType)&&C.setRequestHeader("Content-Type",h.contentType),C.setRequestHeader("Accept",h.dataTypes[0]&&h.accepts[h.dataTypes[0]]?h.accepts[h.dataTypes[0]]+("*"!==h.dataTypes[0]?", "+$t+"; q=0.01":""):h.accepts["*"]),h.headers)C.setRequestHeader(p,h.headers[p]);if(h.beforeSend&&(!1===h.beforeSend.call(v,C,h)||l))return C.abort();if(E="abort",y.add(h.complete),C.done(h.success),C.fail(h.error),r=Ft(Pt,h,t,C)){if(C.readyState=1,f&&g.trigger("ajaxSend",[C,h]),l)return C;h.async&&h.timeout>0&&(u=n.setTimeout(function(){C.abort("timeout")},h.timeout));try{l=!1,r.send(b,x)}catch(e){if(l)throw e;x(-1,e)}}else x(-1,"No Transport");function x(e,t,a,s){var c,p,d,b,w,E=t;l||(l=!0,u&&n.clearTimeout(u),r=void 0,o=s||"",C.readyState=e>0?4:0,c=e>=200&&e<300||304===e,a&&(b=function(e,t,n){for(var r,i,o,a,s=e.contents,u=e.dataTypes;"*"===u[0];)u.shift(),void 0===r&&(r=e.mimeType||t.getResponseHeader("Content-Type"));if(r)for(i in s)if(s[i]&&s[i].test(r)){u.unshift(i);break}if(u[0]in n)o=u[0];else{for(i in n){if(!u[0]||e.converters[i+" "+u[0]]){o=i;break}a||(a=i)}o=o||a}if(o)return o!==u[0]&&u.unshift(o),n[o]}(h,C,a)),b=function(e,t,n,r){var i,o,a,s,u,c={},l=e.dataTypes.slice();if(l[1])for(a in e.converters)c[a.toLowerCase()]=e.converters[a];for(o=l.shift();o;)if(e.responseFields[o]&&(n[e.responseFields[o]]=t),!u&&r&&e.dataFilter&&(t=e.dataFilter(t,e.dataType)),u=o,o=l.shift())if("*"===o)o=u;else if("*"!==u&&u!==o){if(!(a=c[u+" "+o]||c["* "+o]))for(i in c)if((s=i.split(" "))[1]===o&&(a=c[u+" "+s[0]]||c["* "+s[0]])){!0===a?a=c[i]:!0!==c[i]&&(o=s[0],l.unshift(s[1]));break}if(!0!==a)if(a&&e.throws)t=a(t);else try{t=a(t)}catch(e){return{state:"parsererror",error:a?e:"No conversion from "+u+" to "+o}}}return{state:"success",data:t}}(h,b,C,c),c?(h.ifModified&&((w=C.getResponseHeader("Last-Modified"))&&(T.lastModified[i]=w),(w=C.getResponseHeader("etag"))&&(T.etag[i]=w)),204===e||"HEAD"===h.type?E="nocontent":304===e?E="notmodified":(E=b.state,p=b.data,c=!(d=b.error))):(d=E,!e&&E||(E="error",e<0&&(e=0))),C.status=e,C.statusText=(t||E)+"",c?m.resolveWith(v,[p,E,C]):m.rejectWith(v,[C,E,d]),C.statusCode(_),_=void 0,f&&g.trigger(c?"ajaxSuccess":"ajaxError",[C,h,c?p:d]),y.fireWith(v,[C,E]),f&&(g.trigger("ajaxComplete",[C,h]),--T.active||T.event.trigger("ajaxStop")))}return C},getJSON:function(e,t,n){return T.get(e,t,n,"json")},getScript:function(e,t){return T.get(e,void 0,t,"script")}}),T.each(["get","post"],function(e,t){T[t]=function(e,n,r,i){return y(n)&&(i=i||r,r=n,n=void 0),T.ajax(T.extend({url:e,type:t,dataType:i,data:n,success:r},T.isPlainObject(e)&&e))}}),T._evalUrl=function(e){return T.ajax({url:e,type:"GET",dataType:"script",cache:!0,async:!1,global:!1,throws:!0})},T.fn.extend({wrapAll:function(e){var t;return this[0]&&(y(e)&&(e=e.call(this[0])),t=T(e,this[0].ownerDocument).eq(0).clone(!0),this[0].parentNode&&t.insertBefore(this[0]),t.map(function(){for(var e=this;e.firstElementChild;)e=e.firstElementChild;return e}).append(this)),this},wrapInner:function(e){return y(e)?this.each(function(t){T(this).wrapInner(e.call(this,t))}):this.each(function(){var t=T(this),n=t.contents();n.length?n.wrapAll(e):t.append(e)})},wrap:function(e){var t=y(e);return this.each(function(n){T(this).wrapAll(t?e.call(this,n):e)})},unwrap:function(e){return this.parent(e).not("body").each(function(){T(this).replaceWith(this.childNodes)}),this}}),T.expr.pseudos.hidden=function(e){return!T.expr.pseudos.visible(e)},T.expr.pseudos.visible=function(e){return!!(e.offsetWidth||e.offsetHeight||e.getClientRects().length)},T.ajaxSettings.xhr=function(){try{return new n.XMLHttpRequest}catch(e){}};var Ut={0:200,1223:204},Bt=T.ajaxSettings.xhr();m.cors=!!Bt&&"withCredentials"in Bt,m.ajax=Bt=!!Bt,T.ajaxTransport(function(e){var t,r;if(m.cors||Bt&&!e.crossDomain)return{send:function(i,o){var a,s=e.xhr();if(s.open(e.type,e.url,e.async,e.username,e.password),e.xhrFields)for(a in e.xhrFields)s[a]=e.xhrFields[a];for(a in e.mimeType&&s.overrideMimeType&&s.overrideMimeType(e.mimeType),e.crossDomain||i["X-Requested-With"]||(i["X-Requested-With"]="XMLHttpRequest"),i)s.setRequestHeader(a,i[a]);t=function(e){return function(){t&&(t=r=s.onload=s.onerror=s.onabort=s.ontimeout=s.onreadystatechange=null,"abort"===e?s.abort():"error"===e?"number"!=typeof s.status?o(0,"error"):o(s.status,s.statusText):o(Ut[s.status]||s.status,s.statusText,"text"!==(s.responseType||"text")||"string"!=typeof s.responseText?{binary:s.response}:{text:s.responseText},s.getAllResponseHeaders()))}},s.onload=t(),r=s.onerror=s.ontimeout=t("error"),void 0!==s.onabort?s.onabort=r:s.onreadystatechange=function(){4===s.readyState&&n.setTimeout(function(){t&&r()})},t=t("abort");try{s.send(e.hasContent&&e.data||null)}catch(e){if(t)throw e}},abort:function(){t&&t()}}}),T.ajaxPrefilter(function(e){e.crossDomain&&(e.contents.script=!1)}),T.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(e){return T.globalEval(e),e}}}),T.ajaxPrefilter("script",function(e){void 0===e.cache&&(e.cache=!1),e.crossDomain&&(e.type="GET")}),T.ajaxTransport("script",function(e){var t,n;if(e.crossDomain)return{send:function(r,i){t=T("<script>").prop({charset:e.scriptCharset,src:e.url}).on("load error",n=function(e){t.remove(),n=null,e&&i("error"===e.type?404:200,e.type)}),a.head.appendChild(t[0])},abort:function(){n&&n()}}});var qt,Vt=[],zt=/(=)\?(?=&|$)|\?\?/;T.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var e=Vt.pop()||T.expando+"_"+Et++;return this[e]=!0,e}}),T.ajaxPrefilter("json jsonp",function(e,t,r){var i,o,a,s=!1!==e.jsonp&&(zt.test(e.url)?"url":"string"==typeof e.data&&0===(e.contentType||"").indexOf("application/x-www-form-urlencoded")&&zt.test(e.data)&&"data");if(s||"jsonp"===e.dataTypes[0])return i=e.jsonpCallback=y(e.jsonpCallback)?e.jsonpCallback():e.jsonpCallback,s?e[s]=e[s].replace(zt,"$1"+i):!1!==e.jsonp&&(e.url+=(Tt.test(e.url)?"&":"?")+e.jsonp+"="+i),e.converters["script json"]=function(){return a||T.error(i+" was not called"),a[0]},e.dataTypes[0]="json",o=n[i],n[i]=function(){a=arguments},r.always(function(){void 0===o?T(n).removeProp(i):n[i]=o,e[i]&&(e.jsonpCallback=t.jsonpCallback,Vt.push(i)),a&&y(o)&&o(a[0]),a=o=void 0}),"script"}),m.createHTMLDocument=((qt=a.implementation.createHTMLDocument("").body).innerHTML="<form></form><form></form>",2===qt.childNodes.length),T.parseHTML=function(e,t,n){return"string"!=typeof e?[]:("boolean"==typeof t&&(n=t,t=!1),t||(m.createHTMLDocument?((r=(t=a.implementation.createHTMLDocument("")).createElement("base")).href=a.location.href,t.head.appendChild(r)):t=a),o=!n&&[],(i=N.exec(e))?[t.createElement(i[1])]:(i=we([e],t,o),o&&o.length&&T(o).remove(),T.merge([],i.childNodes)));var r,i,o},T.fn.load=function(e,t,n){var r,i,o,a=this,s=e.indexOf(" ");return s>-1&&(r=vt(e.slice(s)),e=e.slice(0,s)),y(t)?(n=t,t=void 0):t&&"object"==typeof t&&(i="POST"),a.length>0&&T.ajax({url:e,type:i||"GET",dataType:"html",data:t}).done(function(e){o=arguments,a.html(r?T("<div>").append(T.parseHTML(e)).find(r):e)}).always(n&&function(e,t){a.each(function(){n.apply(this,o||[e.responseText,t,e])})}),this},T.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(e,t){T.fn[t]=function(e){return this.on(t,e)}}),T.expr.pseudos.animated=function(e){return T.grep(T.timers,function(t){return e===t.elem}).length},T.offset={setOffset:function(e,t,n){var r,i,o,a,s,u,c=T.css(e,"position"),l=T(e),f={};"static"===c&&(e.style.position="relative"),s=l.offset(),o=T.css(e,"top"),u=T.css(e,"left"),("absolute"===c||"fixed"===c)&&(o+u).indexOf("auto")>-1?(a=(r=l.position()).top,i=r.left):(a=parseFloat(o)||0,i=parseFloat(u)||0),y(t)&&(t=t.call(e,n,T.extend({},s))),null!=t.top&&(f.top=t.top-s.top+a),null!=t.left&&(f.left=t.left-s.left+i),"using"in t?t.using.call(e,f):l.css(f)}},T.fn.extend({offset:function(e){if(arguments.length)return void 0===e?this:this.each(function(t){T.offset.setOffset(this,e,t)});var t,n,r=this[0];return r?r.getClientRects().length?(t=r.getBoundingClientRect(),n=r.ownerDocument.defaultView,{top:t.top+n.pageYOffset,left:t.left+n.pageXOffset}):{top:0,left:0}:void 0},position:function(){if(this[0]){var e,t,n,r=this[0],i={top:0,left:0};if("fixed"===T.css(r,"position"))t=r.getBoundingClientRect();else{for(t=this.offset(),n=r.ownerDocument,e=r.offsetParent||n.documentElement;e&&(e===n.body||e===n.documentElement)&&"static"===T.css(e,"position");)e=e.parentNode;e&&e!==r&&1===e.nodeType&&((i=T(e).offset()).top+=T.css(e,"borderTopWidth",!0),i.left+=T.css(e,"borderLeftWidth",!0))}return{top:t.top-i.top-T.css(r,"marginTop",!0),left:t.left-i.left-T.css(r,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){for(var e=this.offsetParent;e&&"static"===T.css(e,"position");)e=e.offsetParent;return e||Ee})}}),T.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(e,t){var n="pageYOffset"===t;T.fn[e]=function(r){return V(this,function(e,r,i){var o;if(_(e)?o=e:9===e.nodeType&&(o=e.defaultView),void 0===i)return o?o[t]:e[r];o?o.scrollTo(n?o.pageXOffset:i,n?i:o.pageYOffset):e[r]=i},e,r,arguments.length)}}),T.each(["top","left"],function(e,t){T.cssHooks[t]=qe(m.pixelPosition,function(e,n){if(n)return n=Be(e,t),Fe.test(n)?T(e).position()[t]+"px":n})}),T.each({Height:"height",Width:"width"},function(e,t){T.each({padding:"inner"+e,content:t,"":"outer"+e},function(n,r){T.fn[r]=function(i,o){var a=arguments.length&&(n||"boolean"!=typeof i),s=n||(!0===i||!0===o?"margin":"border");return V(this,function(t,n,i){var o;return _(t)?0===r.indexOf("outer")?t["inner"+e]:t.document.documentElement["client"+e]:9===t.nodeType?(o=t.documentElement,Math.max(t.body["scroll"+e],o["scroll"+e],t.body["offset"+e],o["offset"+e],o["client"+e])):void 0===i?T.css(t,n,s):T.style(t,n,i,s)},t,a?i:void 0,a)}})}),T.each("blur focus focusin focusout resize scroll click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup contextmenu".split(" "),function(e,t){T.fn[t]=function(e,n){return arguments.length>0?this.on(t,null,e,n):this.trigger(t)}}),T.fn.extend({hover:function(e,t){return this.mouseenter(e).mouseleave(t||e)}}),T.fn.extend({bind:function(e,t,n){return this.on(e,null,t,n)},unbind:function(e,t){return this.off(e,null,t)},delegate:function(e,t,n,r){return this.on(t,e,n,r)},undelegate:function(e,t,n){return 1===arguments.length?this.off(e,"**"):this.off(t,e||"**",n)}}),T.proxy=function(e,t){var n,r,i;if("string"==typeof t&&(n=e[t],t=e,e=n),y(e))return r=u.call(arguments,2),(i=function(){return e.apply(t||this,r.concat(u.call(arguments)))}).guid=e.guid=e.guid||T.guid++,i},T.holdReady=function(e){e?T.readyWait++:T.ready(!0)},T.isArray=Array.isArray,T.parseJSON=JSON.parse,T.nodeName=I,T.isFunction=y,T.isWindow=_,T.camelCase=X,T.type=E,T.now=Date.now,T.isNumeric=function(e){var t=T.type(e);return("number"===t||"string"===t)&&!isNaN(e-parseFloat(e))},void 0===(r=function(){return T}.apply(t,[]))||(e.exports=r);var Gt=n.jQuery,Kt=n.$;return T.noConflict=function(e){return n.$===T&&(n.$=Kt),e&&n.jQuery===T&&(n.jQuery=Gt),T},i||(n.jQuery=n.$=T),T})},function(e,t,n){"use strict";e.exports=function(e,t){return function(){for(var n=new Array(arguments.length),r=0;r<n.length;r++)n[r]=arguments[r];return e.apply(t,n)}}},function(e,t){var n,r,i=e.exports={};function o(){throw new Error("setTimeout has not been defined")}function a(){throw new Error("clearTimeout has not been defined")}function s(e){if(n===setTimeout)return setTimeout(e,0);if((n===o||!n)&&setTimeout)return n=setTimeout,setTimeout(e,0);try{return n(e,0)}catch(t){try{return n.call(null,e,0)}catch(t){return n.call(this,e,0)}}}!function(){try{n="function"==typeof setTimeout?setTimeout:o}catch(e){n=o}try{r="function"==typeof clearTimeout?clearTimeout:a}catch(e){r=a}}();var u,c=[],l=!1,f=-1;function p(){l&&u&&(l=!1,u.length?c=u.concat(c):f=-1,c.length&&d())}function d(){if(!l){var e=s(p);l=!0;for(var t=c.length;t;){for(u=c,c=[];++f<t;)u&&u[f].run();f=-1,t=c.length}u=null,l=!1,function(e){if(r===clearTimeout)return clearTimeout(e);if((r===a||!r)&&clearTimeout)return r=clearTimeout,clearTimeout(e);try{r(e)}catch(t){try{return r.call(null,e)}catch(t){return r.call(this,e)}}}(e)}}function h(e,t){this.fun=e,this.array=t}function v(){}i.nextTick=function(e){var t=new Array(arguments.length-1);if(arguments.length>1)for(var n=1;n<arguments.length;n++)t[n-1]=arguments[n];c.push(new h(e,t)),1!==c.length||l||s(d)},h.prototype.run=function(){this.fun.apply(null,this.array)},i.title="browser",i.browser=!0,i.env={},i.argv=[],i.version="",i.versions={},i.on=v,i.addListener=v,i.once=v,i.off=v,i.removeListener=v,i.removeAllListeners=v,i.emit=v,i.prependListener=v,i.prependOnceListener=v,i.listeners=function(e){return[]},i.binding=function(e){throw new Error("process.binding is not supported")},i.cwd=function(){return"/"},i.chdir=function(e){throw new Error("process.chdir is not supported")},i.umask=function(){return 0}},function(e,t,n){"use strict";var r=n(0),i=n(22),o=n(24),a=n(25),s=n(26),u=n(8),c="undefined"!=typeof window&&window.btoa&&window.btoa.bind(window)||n(27);e.exports=function(e){return new Promise(function(t,l){var f=e.data,p=e.headers;r.isFormData(f)&&delete p["Content-Type"];var d=new XMLHttpRequest,h="onreadystatechange",v=!1;if("undefined"==typeof window||!window.XDomainRequest||"withCredentials"in d||s(e.url)||(d=new window.XDomainRequest,h="onload",v=!0,d.onprogress=function(){},d.ontimeout=function(){}),e.auth){var g=e.auth.username||"",m=e.auth.password||"";p.Authorization="Basic "+c(g+":"+m)}if(d.open(e.method.toUpperCase(),o(e.url,e.params,e.paramsSerializer),!0),d.timeout=e.timeout,d[h]=function(){if(d&&(4===d.readyState||v)&&(0!==d.status||d.responseURL&&0===d.responseURL.indexOf("file:"))){var n="getAllResponseHeaders"in d?a(d.getAllResponseHeaders()):null,r={data:e.responseType&&"text"!==e.responseType?d.response:d.responseText,status:1223===d.status?204:d.status,statusText:1223===d.status?"No Content":d.statusText,headers:n,config:e,request:d};i(t,l,r),d=null}},d.onerror=function(){l(u("Network Error",e,null,d)),d=null},d.ontimeout=function(){l(u("timeout of "+e.timeout+"ms exceeded",e,"ECONNABORTED",d)),d=null},r.isStandardBrowserEnv()){var y=n(28),_=(e.withCredentials||s(e.url))&&e.xsrfCookieName?y.read(e.xsrfCookieName):void 0;_&&(p[e.xsrfHeaderName]=_)}if("setRequestHeader"in d&&r.forEach(p,function(e,t){void 0===f&&"content-type"===t.toLowerCase()?delete p[t]:d.setRequestHeader(t,e)}),e.withCredentials&&(d.withCredentials=!0),e.responseType)try{d.responseType=e.responseType}catch(t){if("json"!==e.responseType)throw t}"function"==typeof e.onDownloadProgress&&d.addEventListener("progress",e.onDownloadProgress),"function"==typeof e.onUploadProgress&&d.upload&&d.upload.addEventListener("progress",e.onUploadProgress),e.cancelToken&&e.cancelToken.promise.then(function(e){d&&(d.abort(),l(e),d=null)}),void 0===f&&(f=null),d.send(f)})}},function(e,t,n){"use strict";var r=n(23);e.exports=function(e,t,n,i,o){var a=new Error(e);return r(a,t,n,i,o)}},function(e,t,n){"use strict";e.exports=function(e){return!(!e||!e.__CANCEL__)}},function(e,t,n){"use strict";function r(e){this.message=e}r.prototype.toString=function(){return"Cancel"+(this.message?": "+this.message:"")},r.prototype.__CANCEL__=!0,e.exports=r},function(e,t,n){n(12),e.exports=n(41)},function(e,t,n){n(13),window.Vue=n(36),Vue.component("example-component",n(40).default);new Vue({el:"#app"})},function(e,t,n){window._=n(14);try{window.Popper=n(3).default,window.$=window.jQuery=n(4),n(16)}catch(e){}window.axios=n(17),window.axios.defaults.headers.common["X-Requested-With"]="XMLHttpRequest";var r=document.head.querySelector('meta[name="csrf-token"]');r?window.axios.defaults.headers.common["X-CSRF-TOKEN"]=r.content:console.error("CSRF token not found: https://laravel.com/docs/csrf#csrf-x-csrf-token")},function(e,t,n){(function(e,r){var i;(function(){var o,a=200,s="Unsupported core-js use. Try https://npms.io/search?q=ponyfill.",u="Expected a function",c="__lodash_hash_undefined__",l=500,f="__lodash_placeholder__",p=1,d=2,h=4,v=1,g=2,m=1,y=2,_=4,b=8,w=16,E=32,T=64,C=128,x=256,A=512,S=30,O="...",D=800,I=16,N=1,k=2,L=1/0,j=9007199254740991,R=1.7976931348623157e308,P=NaN,$=4294967295,H=$-1,M=$>>>1,F=[["ary",C],["bind",m],["bindKey",y],["curry",b],["curryRight",w],["flip",A],["partial",E],["partialRight",T],["rearg",x]],W="[object Arguments]",U="[object Array]",B="[object AsyncFunction]",q="[object Boolean]",V="[object Date]",z="[object DOMException]",G="[object Error]",K="[object Function]",X="[object GeneratorFunction]",Q="[object Map]",Y="[object Number]",J="[object Null]",Z="[object Object]",ee="[object Proxy]",te="[object RegExp]",ne="[object Set]",re="[object String]",ie="[object Symbol]",oe="[object Undefined]",ae="[object WeakMap]",se="[object WeakSet]",ue="[object ArrayBuffer]",ce="[object DataView]",le="[object Float32Array]",fe="[object Float64Array]",pe="[object Int8Array]",de="[object Int16Array]",he="[object Int32Array]",ve="[object Uint8Array]",ge="[object Uint8ClampedArray]",me="[object Uint16Array]",ye="[object Uint32Array]",_e=/\b__p \+= '';/g,be=/\b(__p \+=) '' \+/g,we=/(__e\(.*?\)|\b__t\)) \+\n'';/g,Ee=/&(?:amp|lt|gt|quot|#39);/g,Te=/[&<>"']/g,Ce=RegExp(Ee.source),xe=RegExp(Te.source),Ae=/<%-([\s\S]+?)%>/g,Se=/<%([\s\S]+?)%>/g,Oe=/<%=([\s\S]+?)%>/g,De=/\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/,Ie=/^\w*$/,Ne=/[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g,ke=/[\\^$.*+?()[\]{}|]/g,Le=RegExp(ke.source),je=/^\s+|\s+$/g,Re=/^\s+/,Pe=/\s+$/,$e=/\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/,He=/\{\n\/\* \[wrapped with (.+)\] \*/,Me=/,? & /,Fe=/[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g,We=/\\(\\)?/g,Ue=/\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g,Be=/\w*$/,qe=/^[-+]0x[0-9a-f]+$/i,Ve=/^0b[01]+$/i,ze=/^\[object .+?Constructor\]$/,Ge=/^0o[0-7]+$/i,Ke=/^(?:0|[1-9]\d*)$/,Xe=/[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g,Qe=/($^)/,Ye=/['\n\r\u2028\u2029\\]/g,Je="\\u0300-\\u036f\\ufe20-\\ufe2f\\u20d0-\\u20ff",Ze="\\xac\\xb1\\xd7\\xf7\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf\\u2000-\\u206f \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000",et="[\\ud800-\\udfff]",tt="["+Ze+"]",nt="["+Je+"]",rt="\\d+",it="[\\u2700-\\u27bf]",ot="[a-z\\xdf-\\xf6\\xf8-\\xff]",at="[^\\ud800-\\udfff"+Ze+rt+"\\u2700-\\u27bfa-z\\xdf-\\xf6\\xf8-\\xffA-Z\\xc0-\\xd6\\xd8-\\xde]",st="\\ud83c[\\udffb-\\udfff]",ut="[^\\ud800-\\udfff]",ct="(?:\\ud83c[\\udde6-\\uddff]){2}",lt="[\\ud800-\\udbff][\\udc00-\\udfff]",ft="[A-Z\\xc0-\\xd6\\xd8-\\xde]",pt="(?:"+ot+"|"+at+")",dt="(?:"+ft+"|"+at+")",ht="(?:"+nt+"|"+st+")"+"?",vt="[\\ufe0e\\ufe0f]?"+ht+("(?:\\u200d(?:"+[ut,ct,lt].join("|")+")[\\ufe0e\\ufe0f]?"+ht+")*"),gt="(?:"+[it,ct,lt].join("|")+")"+vt,mt="(?:"+[ut+nt+"?",nt,ct,lt,et].join("|")+")",yt=RegExp("['’]","g"),_t=RegExp(nt,"g"),bt=RegExp(st+"(?="+st+")|"+mt+vt,"g"),wt=RegExp([ft+"?"+ot+"+(?:['’](?:d|ll|m|re|s|t|ve))?(?="+[tt,ft,"$"].join("|")+")",dt+"+(?:['’](?:D|LL|M|RE|S|T|VE))?(?="+[tt,ft+pt,"$"].join("|")+")",ft+"?"+pt+"+(?:['’](?:d|ll|m|re|s|t|ve))?",ft+"+(?:['’](?:D|LL|M|RE|S|T|VE))?","\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])","\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])",rt,gt].join("|"),"g"),Et=RegExp("[\\u200d\\ud800-\\udfff"+Je+"\\ufe0e\\ufe0f]"),Tt=/[a-z][A-Z]|[A-Z]{2}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/,Ct=["Array","Buffer","DataView","Date","Error","Float32Array","Float64Array","Function","Int8Array","Int16Array","Int32Array","Map","Math","Object","Promise","RegExp","Set","String","Symbol","TypeError","Uint8Array","Uint8ClampedArray","Uint16Array","Uint32Array","WeakMap","_","clearTimeout","isFinite","parseInt","setTimeout"],xt=-1,At={};At[le]=At[fe]=At[pe]=At[de]=At[he]=At[ve]=At[ge]=At[me]=At[ye]=!0,At[W]=At[U]=At[ue]=At[q]=At[ce]=At[V]=At[G]=At[K]=At[Q]=At[Y]=At[Z]=At[te]=At[ne]=At[re]=At[ae]=!1;var St={};St[W]=St[U]=St[ue]=St[ce]=St[q]=St[V]=St[le]=St[fe]=St[pe]=St[de]=St[he]=St[Q]=St[Y]=St[Z]=St[te]=St[ne]=St[re]=St[ie]=St[ve]=St[ge]=St[me]=St[ye]=!0,St[G]=St[K]=St[ae]=!1;var Ot={"\\":"\\","'":"'","\n":"n","\r":"r","\u2028":"u2028","\u2029":"u2029"},Dt=parseFloat,It=parseInt,Nt="object"==typeof e&&e&&e.Object===Object&&e,kt="object"==typeof self&&self&&self.Object===Object&&self,Lt=Nt||kt||Function("return this")(),jt=t&&!t.nodeType&&t,Rt=jt&&"object"==typeof r&&r&&!r.nodeType&&r,Pt=Rt&&Rt.exports===jt,$t=Pt&&Nt.process,Ht=function(){try{var e=Rt&&Rt.require&&Rt.require("util").types;return e||$t&&$t.binding&&$t.binding("util")}catch(e){}}(),Mt=Ht&&Ht.isArrayBuffer,Ft=Ht&&Ht.isDate,Wt=Ht&&Ht.isMap,Ut=Ht&&Ht.isRegExp,Bt=Ht&&Ht.isSet,qt=Ht&&Ht.isTypedArray;function Vt(e,t,n){switch(n.length){case 0:return e.call(t);case 1:return e.call(t,n[0]);case 2:return e.call(t,n[0],n[1]);case 3:return e.call(t,n[0],n[1],n[2])}return e.apply(t,n)}function zt(e,t,n,r){for(var i=-1,o=null==e?0:e.length;++i<o;){var a=e[i];t(r,a,n(a),e)}return r}function Gt(e,t){for(var n=-1,r=null==e?0:e.length;++n<r&&!1!==t(e[n],n,e););return e}function Kt(e,t){for(var n=null==e?0:e.length;n--&&!1!==t(e[n],n,e););return e}function Xt(e,t){for(var n=-1,r=null==e?0:e.length;++n<r;)if(!t(e[n],n,e))return!1;return!0}function Qt(e,t){for(var n=-1,r=null==e?0:e.length,i=0,o=[];++n<r;){var a=e[n];t(a,n,e)&&(o[i++]=a)}return o}function Yt(e,t){return!!(null==e?0:e.length)&&un(e,t,0)>-1}function Jt(e,t,n){for(var r=-1,i=null==e?0:e.length;++r<i;)if(n(t,e[r]))return!0;return!1}function Zt(e,t){for(var n=-1,r=null==e?0:e.length,i=Array(r);++n<r;)i[n]=t(e[n],n,e);return i}function en(e,t){for(var n=-1,r=t.length,i=e.length;++n<r;)e[i+n]=t[n];return e}function tn(e,t,n,r){var i=-1,o=null==e?0:e.length;for(r&&o&&(n=e[++i]);++i<o;)n=t(n,e[i],i,e);return n}function nn(e,t,n,r){var i=null==e?0:e.length;for(r&&i&&(n=e[--i]);i--;)n=t(n,e[i],i,e);return n}function rn(e,t){for(var n=-1,r=null==e?0:e.length;++n<r;)if(t(e[n],n,e))return!0;return!1}var on=pn("length");function an(e,t,n){var r;return n(e,function(e,n,i){if(t(e,n,i))return r=n,!1}),r}function sn(e,t,n,r){for(var i=e.length,o=n+(r?1:-1);r?o--:++o<i;)if(t(e[o],o,e))return o;return-1}function un(e,t,n){return t==t?function(e,t,n){var r=n-1,i=e.length;for(;++r<i;)if(e[r]===t)return r;return-1}(e,t,n):sn(e,ln,n)}function cn(e,t,n,r){for(var i=n-1,o=e.length;++i<o;)if(r(e[i],t))return i;return-1}function ln(e){return e!=e}function fn(e,t){var n=null==e?0:e.length;return n?vn(e,t)/n:P}function pn(e){return function(t){return null==t?o:t[e]}}function dn(e){return function(t){return null==e?o:e[t]}}function hn(e,t,n,r,i){return i(e,function(e,i,o){n=r?(r=!1,e):t(n,e,i,o)}),n}function vn(e,t){for(var n,r=-1,i=e.length;++r<i;){var a=t(e[r]);a!==o&&(n=n===o?a:n+a)}return n}function gn(e,t){for(var n=-1,r=Array(e);++n<e;)r[n]=t(n);return r}function mn(e){return function(t){return e(t)}}function yn(e,t){return Zt(t,function(t){return e[t]})}function _n(e,t){return e.has(t)}function bn(e,t){for(var n=-1,r=e.length;++n<r&&un(t,e[n],0)>-1;);return n}function wn(e,t){for(var n=e.length;n--&&un(t,e[n],0)>-1;);return n}var En=dn({"À":"A","Á":"A","Â":"A","Ã":"A","Ä":"A","Å":"A","à":"a","á":"a","â":"a","ã":"a","ä":"a","å":"a","Ç":"C","ç":"c","Ð":"D","ð":"d","È":"E","É":"E","Ê":"E","Ë":"E","è":"e","é":"e","ê":"e","ë":"e","Ì":"I","Í":"I","Î":"I","Ï":"I","ì":"i","í":"i","î":"i","ï":"i","Ñ":"N","ñ":"n","Ò":"O","Ó":"O","Ô":"O","Õ":"O","Ö":"O","Ø":"O","ò":"o","ó":"o","ô":"o","õ":"o","ö":"o","ø":"o","Ù":"U","Ú":"U","Û":"U","Ü":"U","ù":"u","ú":"u","û":"u","ü":"u","Ý":"Y","ý":"y","ÿ":"y","Æ":"Ae","æ":"ae","Þ":"Th","þ":"th","ß":"ss","Ā":"A","Ă":"A","Ą":"A","ā":"a","ă":"a","ą":"a","Ć":"C","Ĉ":"C","Ċ":"C","Č":"C","ć":"c","ĉ":"c","ċ":"c","č":"c","Ď":"D","Đ":"D","ď":"d","đ":"d","Ē":"E","Ĕ":"E","Ė":"E","Ę":"E","Ě":"E","ē":"e","ĕ":"e","ė":"e","ę":"e","ě":"e","Ĝ":"G","Ğ":"G","Ġ":"G","Ģ":"G","ĝ":"g","ğ":"g","ġ":"g","ģ":"g","Ĥ":"H","Ħ":"H","ĥ":"h","ħ":"h","Ĩ":"I","Ī":"I","Ĭ":"I","Į":"I","İ":"I","ĩ":"i","ī":"i","ĭ":"i","į":"i","ı":"i","Ĵ":"J","ĵ":"j","Ķ":"K","ķ":"k","ĸ":"k","Ĺ":"L","Ļ":"L","Ľ":"L","Ŀ":"L","Ł":"L","ĺ":"l","ļ":"l","ľ":"l","ŀ":"l","ł":"l","Ń":"N","Ņ":"N","Ň":"N","Ŋ":"N","ń":"n","ņ":"n","ň":"n","ŋ":"n","Ō":"O","Ŏ":"O","Ő":"O","ō":"o","ŏ":"o","ő":"o","Ŕ":"R","Ŗ":"R","Ř":"R","ŕ":"r","ŗ":"r","ř":"r","Ś":"S","Ŝ":"S","Ş":"S","Š":"S","ś":"s","ŝ":"s","ş":"s","š":"s","Ţ":"T","Ť":"T","Ŧ":"T","ţ":"t","ť":"t","ŧ":"t","Ũ":"U","Ū":"U","Ŭ":"U","Ů":"U","Ű":"U","Ų":"U","ũ":"u","ū":"u","ŭ":"u","ů":"u","ű":"u","ų":"u","Ŵ":"W","ŵ":"w","Ŷ":"Y","ŷ":"y","Ÿ":"Y","Ź":"Z","Ż":"Z","Ž":"Z","ź":"z","ż":"z","ž":"z","IJ":"IJ","ij":"ij","Œ":"Oe","œ":"oe","ʼn":"'n","ſ":"s"}),Tn=dn({"&":"&","<":"<",">":">",'"':""","'":"'"});function Cn(e){return"\\"+Ot[e]}function xn(e){return Et.test(e)}function An(e){var t=-1,n=Array(e.size);return e.forEach(function(e,r){n[++t]=[r,e]}),n}function Sn(e,t){return function(n){return e(t(n))}}function On(e,t){for(var n=-1,r=e.length,i=0,o=[];++n<r;){var a=e[n];a!==t&&a!==f||(e[n]=f,o[i++]=n)}return o}function Dn(e){var t=-1,n=Array(e.size);return e.forEach(function(e){n[++t]=e}),n}function In(e){var t=-1,n=Array(e.size);return e.forEach(function(e){n[++t]=[e,e]}),n}function Nn(e){return xn(e)?function(e){var t=bt.lastIndex=0;for(;bt.test(e);)++t;return t}(e):on(e)}function kn(e){return xn(e)?function(e){return e.match(bt)||[]}(e):function(e){return e.split("")}(e)}var Ln=dn({"&":"&","<":"<",">":">",""":'"',"'":"'"});var jn=function e(t){var n,r=(t=null==t?Lt:jn.defaults(Lt.Object(),t,jn.pick(Lt,Ct))).Array,i=t.Date,Je=t.Error,Ze=t.Function,et=t.Math,tt=t.Object,nt=t.RegExp,rt=t.String,it=t.TypeError,ot=r.prototype,at=Ze.prototype,st=tt.prototype,ut=t["__core-js_shared__"],ct=at.toString,lt=st.hasOwnProperty,ft=0,pt=(n=/[^.]+$/.exec(ut&&ut.keys&&ut.keys.IE_PROTO||""))?"Symbol(src)_1."+n:"",dt=st.toString,ht=ct.call(tt),vt=Lt._,gt=nt("^"+ct.call(lt).replace(ke,"\\$&").replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g,"$1.*?")+"$"),mt=Pt?t.Buffer:o,bt=t.Symbol,Et=t.Uint8Array,Ot=mt?mt.allocUnsafe:o,Nt=Sn(tt.getPrototypeOf,tt),kt=tt.create,jt=st.propertyIsEnumerable,Rt=ot.splice,$t=bt?bt.isConcatSpreadable:o,Ht=bt?bt.iterator:o,on=bt?bt.toStringTag:o,dn=function(){try{var e=Mo(tt,"defineProperty");return e({},"",{}),e}catch(e){}}(),Rn=t.clearTimeout!==Lt.clearTimeout&&t.clearTimeout,Pn=i&&i.now!==Lt.Date.now&&i.now,$n=t.setTimeout!==Lt.setTimeout&&t.setTimeout,Hn=et.ceil,Mn=et.floor,Fn=tt.getOwnPropertySymbols,Wn=mt?mt.isBuffer:o,Un=t.isFinite,Bn=ot.join,qn=Sn(tt.keys,tt),Vn=et.max,zn=et.min,Gn=i.now,Kn=t.parseInt,Xn=et.random,Qn=ot.reverse,Yn=Mo(t,"DataView"),Jn=Mo(t,"Map"),Zn=Mo(t,"Promise"),er=Mo(t,"Set"),tr=Mo(t,"WeakMap"),nr=Mo(tt,"create"),rr=tr&&new tr,ir={},or=fa(Yn),ar=fa(Jn),sr=fa(Zn),ur=fa(er),cr=fa(tr),lr=bt?bt.prototype:o,fr=lr?lr.valueOf:o,pr=lr?lr.toString:o;function dr(e){if(Os(e)&&!ms(e)&&!(e instanceof mr)){if(e instanceof gr)return e;if(lt.call(e,"__wrapped__"))return pa(e)}return new gr(e)}var hr=function(){function e(){}return function(t){if(!Ss(t))return{};if(kt)return kt(t);e.prototype=t;var n=new e;return e.prototype=o,n}}();function vr(){}function gr(e,t){this.__wrapped__=e,this.__actions__=[],this.__chain__=!!t,this.__index__=0,this.__values__=o}function mr(e){this.__wrapped__=e,this.__actions__=[],this.__dir__=1,this.__filtered__=!1,this.__iteratees__=[],this.__takeCount__=$,this.__views__=[]}function yr(e){var t=-1,n=null==e?0:e.length;for(this.clear();++t<n;){var r=e[t];this.set(r[0],r[1])}}function _r(e){var t=-1,n=null==e?0:e.length;for(this.clear();++t<n;){var r=e[t];this.set(r[0],r[1])}}function br(e){var t=-1,n=null==e?0:e.length;for(this.clear();++t<n;){var r=e[t];this.set(r[0],r[1])}}function wr(e){var t=-1,n=null==e?0:e.length;for(this.__data__=new br;++t<n;)this.add(e[t])}function Er(e){var t=this.__data__=new _r(e);this.size=t.size}function Tr(e,t){var n=ms(e),r=!n&&gs(e),i=!n&&!r&&ws(e),o=!n&&!r&&!i&&Ps(e),a=n||r||i||o,s=a?gn(e.length,rt):[],u=s.length;for(var c in e)!t&&!lt.call(e,c)||a&&("length"==c||i&&("offset"==c||"parent"==c)||o&&("buffer"==c||"byteLength"==c||"byteOffset"==c)||zo(c,u))||s.push(c);return s}function Cr(e){var t=e.length;return t?e[wi(0,t-1)]:o}function xr(e,t){return ua(no(e),jr(t,0,e.length))}function Ar(e){return ua(no(e))}function Sr(e,t,n){(n===o||ds(e[t],n))&&(n!==o||t in e)||kr(e,t,n)}function Or(e,t,n){var r=e[t];lt.call(e,t)&&ds(r,n)&&(n!==o||t in e)||kr(e,t,n)}function Dr(e,t){for(var n=e.length;n--;)if(ds(e[n][0],t))return n;return-1}function Ir(e,t,n,r){return Mr(e,function(e,i,o){t(r,e,n(e),o)}),r}function Nr(e,t){return e&&ro(t,iu(t),e)}function kr(e,t,n){"__proto__"==t&&dn?dn(e,t,{configurable:!0,enumerable:!0,value:n,writable:!0}):e[t]=n}function Lr(e,t){for(var n=-1,i=t.length,a=r(i),s=null==e;++n<i;)a[n]=s?o:Zs(e,t[n]);return a}function jr(e,t,n){return e==e&&(n!==o&&(e=e<=n?e:n),t!==o&&(e=e>=t?e:t)),e}function Rr(e,t,n,r,i,a){var s,u=t&p,c=t&d,l=t&h;if(n&&(s=i?n(e,r,i,a):n(e)),s!==o)return s;if(!Ss(e))return e;var f=ms(e);if(f){if(s=function(e){var t=e.length,n=new e.constructor(t);return t&&"string"==typeof e[0]&<.call(e,"index")&&(n.index=e.index,n.input=e.input),n}(e),!u)return no(e,s)}else{var v=Uo(e),g=v==K||v==X;if(ws(e))return Qi(e,u);if(v==Z||v==W||g&&!i){if(s=c||g?{}:qo(e),!u)return c?function(e,t){return ro(e,Wo(e),t)}(e,function(e,t){return e&&ro(t,ou(t),e)}(s,e)):function(e,t){return ro(e,Fo(e),t)}(e,Nr(s,e))}else{if(!St[v])return i?e:{};s=function(e,t,n){var r,i,o,a=e.constructor;switch(t){case ue:return Yi(e);case q:case V:return new a(+e);case ce:return function(e,t){var n=t?Yi(e.buffer):e.buffer;return new e.constructor(n,e.byteOffset,e.byteLength)}(e,n);case le:case fe:case pe:case de:case he:case ve:case ge:case me:case ye:return Ji(e,n);case Q:return new a;case Y:case re:return new a(e);case te:return(o=new(i=e).constructor(i.source,Be.exec(i))).lastIndex=i.lastIndex,o;case ne:return new a;case ie:return r=e,fr?tt(fr.call(r)):{}}}(e,v,u)}}a||(a=new Er);var m=a.get(e);if(m)return m;if(a.set(e,s),Ls(e))return e.forEach(function(r){s.add(Rr(r,t,n,r,e,a))}),s;if(Ds(e))return e.forEach(function(r,i){s.set(i,Rr(r,t,n,i,e,a))}),s;var y=f?o:(l?c?ko:No:c?ou:iu)(e);return Gt(y||e,function(r,i){y&&(r=e[i=r]),Or(s,i,Rr(r,t,n,i,e,a))}),s}function Pr(e,t,n){var r=n.length;if(null==e)return!r;for(e=tt(e);r--;){var i=n[r],a=t[i],s=e[i];if(s===o&&!(i in e)||!a(s))return!1}return!0}function $r(e,t,n){if("function"!=typeof e)throw new it(u);return ia(function(){e.apply(o,n)},t)}function Hr(e,t,n,r){var i=-1,o=Yt,s=!0,u=e.length,c=[],l=t.length;if(!u)return c;n&&(t=Zt(t,mn(n))),r?(o=Jt,s=!1):t.length>=a&&(o=_n,s=!1,t=new wr(t));e:for(;++i<u;){var f=e[i],p=null==n?f:n(f);if(f=r||0!==f?f:0,s&&p==p){for(var d=l;d--;)if(t[d]===p)continue e;c.push(f)}else o(t,p,r)||c.push(f)}return c}dr.templateSettings={escape:Ae,evaluate:Se,interpolate:Oe,variable:"",imports:{_:dr}},dr.prototype=vr.prototype,dr.prototype.constructor=dr,gr.prototype=hr(vr.prototype),gr.prototype.constructor=gr,mr.prototype=hr(vr.prototype),mr.prototype.constructor=mr,yr.prototype.clear=function(){this.__data__=nr?nr(null):{},this.size=0},yr.prototype.delete=function(e){var t=this.has(e)&&delete this.__data__[e];return this.size-=t?1:0,t},yr.prototype.get=function(e){var t=this.__data__;if(nr){var n=t[e];return n===c?o:n}return lt.call(t,e)?t[e]:o},yr.prototype.has=function(e){var t=this.__data__;return nr?t[e]!==o:lt.call(t,e)},yr.prototype.set=function(e,t){var n=this.__data__;return this.size+=this.has(e)?0:1,n[e]=nr&&t===o?c:t,this},_r.prototype.clear=function(){this.__data__=[],this.size=0},_r.prototype.delete=function(e){var t=this.__data__,n=Dr(t,e);return!(n<0||(n==t.length-1?t.pop():Rt.call(t,n,1),--this.size,0))},_r.prototype.get=function(e){var t=this.__data__,n=Dr(t,e);return n<0?o:t[n][1]},_r.prototype.has=function(e){return Dr(this.__data__,e)>-1},_r.prototype.set=function(e,t){var n=this.__data__,r=Dr(n,e);return r<0?(++this.size,n.push([e,t])):n[r][1]=t,this},br.prototype.clear=function(){this.size=0,this.__data__={hash:new yr,map:new(Jn||_r),string:new yr}},br.prototype.delete=function(e){var t=$o(this,e).delete(e);return this.size-=t?1:0,t},br.prototype.get=function(e){return $o(this,e).get(e)},br.prototype.has=function(e){return $o(this,e).has(e)},br.prototype.set=function(e,t){var n=$o(this,e),r=n.size;return n.set(e,t),this.size+=n.size==r?0:1,this},wr.prototype.add=wr.prototype.push=function(e){return this.__data__.set(e,c),this},wr.prototype.has=function(e){return this.__data__.has(e)},Er.prototype.clear=function(){this.__data__=new _r,this.size=0},Er.prototype.delete=function(e){var t=this.__data__,n=t.delete(e);return this.size=t.size,n},Er.prototype.get=function(e){return this.__data__.get(e)},Er.prototype.has=function(e){return this.__data__.has(e)},Er.prototype.set=function(e,t){var n=this.__data__;if(n instanceof _r){var r=n.__data__;if(!Jn||r.length<a-1)return r.push([e,t]),this.size=++n.size,this;n=this.__data__=new br(r)}return n.set(e,t),this.size=n.size,this};var Mr=ao(Gr),Fr=ao(Kr,!0);function Wr(e,t){var n=!0;return Mr(e,function(e,r,i){return n=!!t(e,r,i)}),n}function Ur(e,t,n){for(var r=-1,i=e.length;++r<i;){var a=e[r],s=t(a);if(null!=s&&(u===o?s==s&&!Rs(s):n(s,u)))var u=s,c=a}return c}function Br(e,t){var n=[];return Mr(e,function(e,r,i){t(e,r,i)&&n.push(e)}),n}function qr(e,t,n,r,i){var o=-1,a=e.length;for(n||(n=Vo),i||(i=[]);++o<a;){var s=e[o];t>0&&n(s)?t>1?qr(s,t-1,n,r,i):en(i,s):r||(i[i.length]=s)}return i}var Vr=so(),zr=so(!0);function Gr(e,t){return e&&Vr(e,t,iu)}function Kr(e,t){return e&&zr(e,t,iu)}function Xr(e,t){return Qt(t,function(t){return Cs(e[t])})}function Qr(e,t){for(var n=0,r=(t=zi(t,e)).length;null!=e&&n<r;)e=e[la(t[n++])];return n&&n==r?e:o}function Yr(e,t,n){var r=t(e);return ms(e)?r:en(r,n(e))}function Jr(e){return null==e?e===o?oe:J:on&&on in tt(e)?function(e){var t=lt.call(e,on),n=e[on];try{e[on]=o;var r=!0}catch(e){}var i=dt.call(e);return r&&(t?e[on]=n:delete e[on]),i}(e):function(e){return dt.call(e)}(e)}function Zr(e,t){return e>t}function ei(e,t){return null!=e&<.call(e,t)}function ti(e,t){return null!=e&&t in tt(e)}function ni(e,t,n){for(var i=n?Jt:Yt,a=e[0].length,s=e.length,u=s,c=r(s),l=1/0,f=[];u--;){var p=e[u];u&&t&&(p=Zt(p,mn(t))),l=zn(p.length,l),c[u]=!n&&(t||a>=120&&p.length>=120)?new wr(u&&p):o}p=e[0];var d=-1,h=c[0];e:for(;++d<a&&f.length<l;){var v=p[d],g=t?t(v):v;if(v=n||0!==v?v:0,!(h?_n(h,g):i(f,g,n))){for(u=s;--u;){var m=c[u];if(!(m?_n(m,g):i(e[u],g,n)))continue e}h&&h.push(g),f.push(v)}}return f}function ri(e,t,n){var r=null==(e=ta(e,t=zi(t,e)))?e:e[la(Ta(t))];return null==r?o:Vt(r,e,n)}function ii(e){return Os(e)&&Jr(e)==W}function oi(e,t,n,r,i){return e===t||(null==e||null==t||!Os(e)&&!Os(t)?e!=e&&t!=t:function(e,t,n,r,i,a){var s=ms(e),u=ms(t),c=s?U:Uo(e),l=u?U:Uo(t),f=(c=c==W?Z:c)==Z,p=(l=l==W?Z:l)==Z,d=c==l;if(d&&ws(e)){if(!ws(t))return!1;s=!0,f=!1}if(d&&!f)return a||(a=new Er),s||Ps(e)?Do(e,t,n,r,i,a):function(e,t,n,r,i,o,a){switch(n){case ce:if(e.byteLength!=t.byteLength||e.byteOffset!=t.byteOffset)return!1;e=e.buffer,t=t.buffer;case ue:return!(e.byteLength!=t.byteLength||!o(new Et(e),new Et(t)));case q:case V:case Y:return ds(+e,+t);case G:return e.name==t.name&&e.message==t.message;case te:case re:return e==t+"";case Q:var s=An;case ne:var u=r&v;if(s||(s=Dn),e.size!=t.size&&!u)return!1;var c=a.get(e);if(c)return c==t;r|=g,a.set(e,t);var l=Do(s(e),s(t),r,i,o,a);return a.delete(e),l;case ie:if(fr)return fr.call(e)==fr.call(t)}return!1}(e,t,c,n,r,i,a);if(!(n&v)){var h=f&<.call(e,"__wrapped__"),m=p&<.call(t,"__wrapped__");if(h||m){var y=h?e.value():e,_=m?t.value():t;return a||(a=new Er),i(y,_,n,r,a)}}return!!d&&(a||(a=new Er),function(e,t,n,r,i,a){var s=n&v,u=No(e),c=u.length,l=No(t).length;if(c!=l&&!s)return!1;for(var f=c;f--;){var p=u[f];if(!(s?p in t:lt.call(t,p)))return!1}var d=a.get(e);if(d&&a.get(t))return d==t;var h=!0;a.set(e,t),a.set(t,e);for(var g=s;++f<c;){p=u[f];var m=e[p],y=t[p];if(r)var _=s?r(y,m,p,t,e,a):r(m,y,p,e,t,a);if(!(_===o?m===y||i(m,y,n,r,a):_)){h=!1;break}g||(g="constructor"==p)}if(h&&!g){var b=e.constructor,w=t.constructor;b!=w&&"constructor"in e&&"constructor"in t&&!("function"==typeof b&&b instanceof b&&"function"==typeof w&&w instanceof w)&&(h=!1)}return a.delete(e),a.delete(t),h}(e,t,n,r,i,a))}(e,t,n,r,oi,i))}function ai(e,t,n,r){var i=n.length,a=i,s=!r;if(null==e)return!a;for(e=tt(e);i--;){var u=n[i];if(s&&u[2]?u[1]!==e[u[0]]:!(u[0]in e))return!1}for(;++i<a;){var c=(u=n[i])[0],l=e[c],f=u[1];if(s&&u[2]){if(l===o&&!(c in e))return!1}else{var p=new Er;if(r)var d=r(l,f,c,e,t,p);if(!(d===o?oi(f,l,v|g,r,p):d))return!1}}return!0}function si(e){return!(!Ss(e)||(t=e,pt&&pt in t))&&(Cs(e)?gt:ze).test(fa(e));var t}function ui(e){return"function"==typeof e?e:null==e?Iu:"object"==typeof e?ms(e)?hi(e[0],e[1]):di(e):Mu(e)}function ci(e){if(!Yo(e))return qn(e);var t=[];for(var n in tt(e))lt.call(e,n)&&"constructor"!=n&&t.push(n);return t}function li(e){if(!Ss(e))return function(e){var t=[];if(null!=e)for(var n in tt(e))t.push(n);return t}(e);var t=Yo(e),n=[];for(var r in e)("constructor"!=r||!t&<.call(e,r))&&n.push(r);return n}function fi(e,t){return e<t}function pi(e,t){var n=-1,i=_s(e)?r(e.length):[];return Mr(e,function(e,r,o){i[++n]=t(e,r,o)}),i}function di(e){var t=Ho(e);return 1==t.length&&t[0][2]?Zo(t[0][0],t[0][1]):function(n){return n===e||ai(n,e,t)}}function hi(e,t){return Ko(e)&&Jo(t)?Zo(la(e),t):function(n){var r=Zs(n,e);return r===o&&r===t?eu(n,e):oi(t,r,v|g)}}function vi(e,t,n,r,i){e!==t&&Vr(t,function(a,s){if(Ss(a))i||(i=new Er),function(e,t,n,r,i,a,s){var u=na(e,n),c=na(t,n),l=s.get(c);if(l)Sr(e,n,l);else{var f=a?a(u,c,n+"",e,t,s):o,p=f===o;if(p){var d=ms(c),h=!d&&ws(c),v=!d&&!h&&Ps(c);f=c,d||h||v?ms(u)?f=u:bs(u)?f=no(u):h?(p=!1,f=Qi(c,!0)):v?(p=!1,f=Ji(c,!0)):f=[]:Ns(c)||gs(c)?(f=u,gs(u)?f=qs(u):Ss(u)&&!Cs(u)||(f=qo(c))):p=!1}p&&(s.set(c,f),i(f,c,r,a,s),s.delete(c)),Sr(e,n,f)}}(e,t,s,n,vi,r,i);else{var u=r?r(na(e,s),a,s+"",e,t,i):o;u===o&&(u=a),Sr(e,s,u)}},ou)}function gi(e,t){var n=e.length;if(n)return zo(t+=t<0?n:0,n)?e[t]:o}function mi(e,t,n){var r=-1;return t=Zt(t.length?t:[Iu],mn(Po())),function(e,t){var n=e.length;for(e.sort(t);n--;)e[n]=e[n].value;return e}(pi(e,function(e,n,i){return{criteria:Zt(t,function(t){return t(e)}),index:++r,value:e}}),function(e,t){return function(e,t,n){for(var r=-1,i=e.criteria,o=t.criteria,a=i.length,s=n.length;++r<a;){var u=Zi(i[r],o[r]);if(u){if(r>=s)return u;var c=n[r];return u*("desc"==c?-1:1)}}return e.index-t.index}(e,t,n)})}function yi(e,t,n){for(var r=-1,i=t.length,o={};++r<i;){var a=t[r],s=Qr(e,a);n(s,a)&&Ai(o,zi(a,e),s)}return o}function _i(e,t,n,r){var i=r?cn:un,o=-1,a=t.length,s=e;for(e===t&&(t=no(t)),n&&(s=Zt(e,mn(n)));++o<a;)for(var u=0,c=t[o],l=n?n(c):c;(u=i(s,l,u,r))>-1;)s!==e&&Rt.call(s,u,1),Rt.call(e,u,1);return e}function bi(e,t){for(var n=e?t.length:0,r=n-1;n--;){var i=t[n];if(n==r||i!==o){var o=i;zo(i)?Rt.call(e,i,1):Hi(e,i)}}return e}function wi(e,t){return e+Mn(Xn()*(t-e+1))}function Ei(e,t){var n="";if(!e||t<1||t>j)return n;do{t%2&&(n+=e),(t=Mn(t/2))&&(e+=e)}while(t);return n}function Ti(e,t){return oa(ea(e,t,Iu),e+"")}function Ci(e){return Cr(du(e))}function xi(e,t){var n=du(e);return ua(n,jr(t,0,n.length))}function Ai(e,t,n,r){if(!Ss(e))return e;for(var i=-1,a=(t=zi(t,e)).length,s=a-1,u=e;null!=u&&++i<a;){var c=la(t[i]),l=n;if(i!=s){var f=u[c];(l=r?r(f,c,u):o)===o&&(l=Ss(f)?f:zo(t[i+1])?[]:{})}Or(u,c,l),u=u[c]}return e}var Si=rr?function(e,t){return rr.set(e,t),e}:Iu,Oi=dn?function(e,t){return dn(e,"toString",{configurable:!0,enumerable:!1,value:Su(t),writable:!0})}:Iu;function Di(e){return ua(du(e))}function Ii(e,t,n){var i=-1,o=e.length;t<0&&(t=-t>o?0:o+t),(n=n>o?o:n)<0&&(n+=o),o=t>n?0:n-t>>>0,t>>>=0;for(var a=r(o);++i<o;)a[i]=e[i+t];return a}function Ni(e,t){var n;return Mr(e,function(e,r,i){return!(n=t(e,r,i))}),!!n}function ki(e,t,n){var r=0,i=null==e?r:e.length;if("number"==typeof t&&t==t&&i<=M){for(;r<i;){var o=r+i>>>1,a=e[o];null!==a&&!Rs(a)&&(n?a<=t:a<t)?r=o+1:i=o}return i}return Li(e,t,Iu,n)}function Li(e,t,n,r){t=n(t);for(var i=0,a=null==e?0:e.length,s=t!=t,u=null===t,c=Rs(t),l=t===o;i<a;){var f=Mn((i+a)/2),p=n(e[f]),d=p!==o,h=null===p,v=p==p,g=Rs(p);if(s)var m=r||v;else m=l?v&&(r||d):u?v&&d&&(r||!h):c?v&&d&&!h&&(r||!g):!h&&!g&&(r?p<=t:p<t);m?i=f+1:a=f}return zn(a,H)}function ji(e,t){for(var n=-1,r=e.length,i=0,o=[];++n<r;){var a=e[n],s=t?t(a):a;if(!n||!ds(s,u)){var u=s;o[i++]=0===a?0:a}}return o}function Ri(e){return"number"==typeof e?e:Rs(e)?P:+e}function Pi(e){if("string"==typeof e)return e;if(ms(e))return Zt(e,Pi)+"";if(Rs(e))return pr?pr.call(e):"";var t=e+"";return"0"==t&&1/e==-L?"-0":t}function $i(e,t,n){var r=-1,i=Yt,o=e.length,s=!0,u=[],c=u;if(n)s=!1,i=Jt;else if(o>=a){var l=t?null:To(e);if(l)return Dn(l);s=!1,i=_n,c=new wr}else c=t?[]:u;e:for(;++r<o;){var f=e[r],p=t?t(f):f;if(f=n||0!==f?f:0,s&&p==p){for(var d=c.length;d--;)if(c[d]===p)continue e;t&&c.push(p),u.push(f)}else i(c,p,n)||(c!==u&&c.push(p),u.push(f))}return u}function Hi(e,t){return null==(e=ta(e,t=zi(t,e)))||delete e[la(Ta(t))]}function Mi(e,t,n,r){return Ai(e,t,n(Qr(e,t)),r)}function Fi(e,t,n,r){for(var i=e.length,o=r?i:-1;(r?o--:++o<i)&&t(e[o],o,e););return n?Ii(e,r?0:o,r?o+1:i):Ii(e,r?o+1:0,r?i:o)}function Wi(e,t){var n=e;return n instanceof mr&&(n=n.value()),tn(t,function(e,t){return t.func.apply(t.thisArg,en([e],t.args))},n)}function Ui(e,t,n){var i=e.length;if(i<2)return i?$i(e[0]):[];for(var o=-1,a=r(i);++o<i;)for(var s=e[o],u=-1;++u<i;)u!=o&&(a[o]=Hr(a[o]||s,e[u],t,n));return $i(qr(a,1),t,n)}function Bi(e,t,n){for(var r=-1,i=e.length,a=t.length,s={};++r<i;){var u=r<a?t[r]:o;n(s,e[r],u)}return s}function qi(e){return bs(e)?e:[]}function Vi(e){return"function"==typeof e?e:Iu}function zi(e,t){return ms(e)?e:Ko(e,t)?[e]:ca(Vs(e))}var Gi=Ti;function Ki(e,t,n){var r=e.length;return n=n===o?r:n,!t&&n>=r?e:Ii(e,t,n)}var Xi=Rn||function(e){return Lt.clearTimeout(e)};function Qi(e,t){if(t)return e.slice();var n=e.length,r=Ot?Ot(n):new e.constructor(n);return e.copy(r),r}function Yi(e){var t=new e.constructor(e.byteLength);return new Et(t).set(new Et(e)),t}function Ji(e,t){var n=t?Yi(e.buffer):e.buffer;return new e.constructor(n,e.byteOffset,e.length)}function Zi(e,t){if(e!==t){var n=e!==o,r=null===e,i=e==e,a=Rs(e),s=t!==o,u=null===t,c=t==t,l=Rs(t);if(!u&&!l&&!a&&e>t||a&&s&&c&&!u&&!l||r&&s&&c||!n&&c||!i)return 1;if(!r&&!a&&!l&&e<t||l&&n&&i&&!r&&!a||u&&n&&i||!s&&i||!c)return-1}return 0}function eo(e,t,n,i){for(var o=-1,a=e.length,s=n.length,u=-1,c=t.length,l=Vn(a-s,0),f=r(c+l),p=!i;++u<c;)f[u]=t[u];for(;++o<s;)(p||o<a)&&(f[n[o]]=e[o]);for(;l--;)f[u++]=e[o++];return f}function to(e,t,n,i){for(var o=-1,a=e.length,s=-1,u=n.length,c=-1,l=t.length,f=Vn(a-u,0),p=r(f+l),d=!i;++o<f;)p[o]=e[o];for(var h=o;++c<l;)p[h+c]=t[c];for(;++s<u;)(d||o<a)&&(p[h+n[s]]=e[o++]);return p}function no(e,t){var n=-1,i=e.length;for(t||(t=r(i));++n<i;)t[n]=e[n];return t}function ro(e,t,n,r){var i=!n;n||(n={});for(var a=-1,s=t.length;++a<s;){var u=t[a],c=r?r(n[u],e[u],u,n,e):o;c===o&&(c=e[u]),i?kr(n,u,c):Or(n,u,c)}return n}function io(e,t){return function(n,r){var i=ms(n)?zt:Ir,o=t?t():{};return i(n,e,Po(r,2),o)}}function oo(e){return Ti(function(t,n){var r=-1,i=n.length,a=i>1?n[i-1]:o,s=i>2?n[2]:o;for(a=e.length>3&&"function"==typeof a?(i--,a):o,s&&Go(n[0],n[1],s)&&(a=i<3?o:a,i=1),t=tt(t);++r<i;){var u=n[r];u&&e(t,u,r,a)}return t})}function ao(e,t){return function(n,r){if(null==n)return n;if(!_s(n))return e(n,r);for(var i=n.length,o=t?i:-1,a=tt(n);(t?o--:++o<i)&&!1!==r(a[o],o,a););return n}}function so(e){return function(t,n,r){for(var i=-1,o=tt(t),a=r(t),s=a.length;s--;){var u=a[e?s:++i];if(!1===n(o[u],u,o))break}return t}}function uo(e){return function(t){var n=xn(t=Vs(t))?kn(t):o,r=n?n[0]:t.charAt(0),i=n?Ki(n,1).join(""):t.slice(1);return r[e]()+i}}function co(e){return function(t){return tn(Cu(gu(t).replace(yt,"")),e,"")}}function lo(e){return function(){var t=arguments;switch(t.length){case 0:return new e;case 1:return new e(t[0]);case 2:return new e(t[0],t[1]);case 3:return new e(t[0],t[1],t[2]);case 4:return new e(t[0],t[1],t[2],t[3]);case 5:return new e(t[0],t[1],t[2],t[3],t[4]);case 6:return new e(t[0],t[1],t[2],t[3],t[4],t[5]);case 7:return new e(t[0],t[1],t[2],t[3],t[4],t[5],t[6])}var n=hr(e.prototype),r=e.apply(n,t);return Ss(r)?r:n}}function fo(e){return function(t,n,r){var i=tt(t);if(!_s(t)){var a=Po(n,3);t=iu(t),n=function(e){return a(i[e],e,i)}}var s=e(t,n,r);return s>-1?i[a?t[s]:s]:o}}function po(e){return Io(function(t){var n=t.length,r=n,i=gr.prototype.thru;for(e&&t.reverse();r--;){var a=t[r];if("function"!=typeof a)throw new it(u);if(i&&!s&&"wrapper"==jo(a))var s=new gr([],!0)}for(r=s?r:n;++r<n;){var c=jo(a=t[r]),l="wrapper"==c?Lo(a):o;s=l&&Xo(l[0])&&l[1]==(C|b|E|x)&&!l[4].length&&1==l[9]?s[jo(l[0])].apply(s,l[3]):1==a.length&&Xo(a)?s[c]():s.thru(a)}return function(){var e=arguments,r=e[0];if(s&&1==e.length&&ms(r))return s.plant(r).value();for(var i=0,o=n?t[i].apply(this,e):r;++i<n;)o=t[i].call(this,o);return o}})}function ho(e,t,n,i,a,s,u,c,l,f){var p=t&C,d=t&m,h=t&y,v=t&(b|w),g=t&A,_=h?o:lo(e);return function m(){for(var y=arguments.length,b=r(y),w=y;w--;)b[w]=arguments[w];if(v)var E=Ro(m),T=function(e,t){for(var n=e.length,r=0;n--;)e[n]===t&&++r;return r}(b,E);if(i&&(b=eo(b,i,a,v)),s&&(b=to(b,s,u,v)),y-=T,v&&y<f){var C=On(b,E);return wo(e,t,ho,m.placeholder,n,b,C,c,l,f-y)}var x=d?n:this,A=h?x[e]:e;return y=b.length,c?b=function(e,t){for(var n=e.length,r=zn(t.length,n),i=no(e);r--;){var a=t[r];e[r]=zo(a,n)?i[a]:o}return e}(b,c):g&&y>1&&b.reverse(),p&&l<y&&(b.length=l),this&&this!==Lt&&this instanceof m&&(A=_||lo(A)),A.apply(x,b)}}function vo(e,t){return function(n,r){return function(e,t,n,r){return Gr(e,function(e,i,o){t(r,n(e),i,o)}),r}(n,e,t(r),{})}}function go(e,t){return function(n,r){var i;if(n===o&&r===o)return t;if(n!==o&&(i=n),r!==o){if(i===o)return r;"string"==typeof n||"string"==typeof r?(n=Pi(n),r=Pi(r)):(n=Ri(n),r=Ri(r)),i=e(n,r)}return i}}function mo(e){return Io(function(t){return t=Zt(t,mn(Po())),Ti(function(n){var r=this;return e(t,function(e){return Vt(e,r,n)})})})}function yo(e,t){var n=(t=t===o?" ":Pi(t)).length;if(n<2)return n?Ei(t,e):t;var r=Ei(t,Hn(e/Nn(t)));return xn(t)?Ki(kn(r),0,e).join(""):r.slice(0,e)}function _o(e){return function(t,n,i){return i&&"number"!=typeof i&&Go(t,n,i)&&(n=i=o),t=Fs(t),n===o?(n=t,t=0):n=Fs(n),function(e,t,n,i){for(var o=-1,a=Vn(Hn((t-e)/(n||1)),0),s=r(a);a--;)s[i?a:++o]=e,e+=n;return s}(t,n,i=i===o?t<n?1:-1:Fs(i),e)}}function bo(e){return function(t,n){return"string"==typeof t&&"string"==typeof n||(t=Bs(t),n=Bs(n)),e(t,n)}}function wo(e,t,n,r,i,a,s,u,c,l){var f=t&b;t|=f?E:T,(t&=~(f?T:E))&_||(t&=~(m|y));var p=[e,t,i,f?a:o,f?s:o,f?o:a,f?o:s,u,c,l],d=n.apply(o,p);return Xo(e)&&ra(d,p),d.placeholder=r,aa(d,e,t)}function Eo(e){var t=et[e];return function(e,n){if(e=Bs(e),n=null==n?0:zn(Ws(n),292)){var r=(Vs(e)+"e").split("e");return+((r=(Vs(t(r[0]+"e"+(+r[1]+n)))+"e").split("e"))[0]+"e"+(+r[1]-n))}return t(e)}}var To=er&&1/Dn(new er([,-0]))[1]==L?function(e){return new er(e)}:Ru;function Co(e){return function(t){var n=Uo(t);return n==Q?An(t):n==ne?In(t):function(e,t){return Zt(t,function(t){return[t,e[t]]})}(t,e(t))}}function xo(e,t,n,i,a,s,c,l){var p=t&y;if(!p&&"function"!=typeof e)throw new it(u);var d=i?i.length:0;if(d||(t&=~(E|T),i=a=o),c=c===o?c:Vn(Ws(c),0),l=l===o?l:Ws(l),d-=a?a.length:0,t&T){var h=i,v=a;i=a=o}var g=p?o:Lo(e),A=[e,t,n,i,a,h,v,s,c,l];if(g&&function(e,t){var n=e[1],r=t[1],i=n|r,o=i<(m|y|C),a=r==C&&n==b||r==C&&n==x&&e[7].length<=t[8]||r==(C|x)&&t[7].length<=t[8]&&n==b;if(!o&&!a)return e;r&m&&(e[2]=t[2],i|=n&m?0:_);var s=t[3];if(s){var u=e[3];e[3]=u?eo(u,s,t[4]):s,e[4]=u?On(e[3],f):t[4]}(s=t[5])&&(u=e[5],e[5]=u?to(u,s,t[6]):s,e[6]=u?On(e[5],f):t[6]),(s=t[7])&&(e[7]=s),r&C&&(e[8]=null==e[8]?t[8]:zn(e[8],t[8])),null==e[9]&&(e[9]=t[9]),e[0]=t[0],e[1]=i}(A,g),e=A[0],t=A[1],n=A[2],i=A[3],a=A[4],!(l=A[9]=A[9]===o?p?0:e.length:Vn(A[9]-d,0))&&t&(b|w)&&(t&=~(b|w)),t&&t!=m)S=t==b||t==w?function(e,t,n){var i=lo(e);return function a(){for(var s=arguments.length,u=r(s),c=s,l=Ro(a);c--;)u[c]=arguments[c];var f=s<3&&u[0]!==l&&u[s-1]!==l?[]:On(u,l);return(s-=f.length)<n?wo(e,t,ho,a.placeholder,o,u,f,o,o,n-s):Vt(this&&this!==Lt&&this instanceof a?i:e,this,u)}}(e,t,l):t!=E&&t!=(m|E)||a.length?ho.apply(o,A):function(e,t,n,i){var o=t&m,a=lo(e);return function t(){for(var s=-1,u=arguments.length,c=-1,l=i.length,f=r(l+u),p=this&&this!==Lt&&this instanceof t?a:e;++c<l;)f[c]=i[c];for(;u--;)f[c++]=arguments[++s];return Vt(p,o?n:this,f)}}(e,t,n,i);else var S=function(e,t,n){var r=t&m,i=lo(e);return function t(){return(this&&this!==Lt&&this instanceof t?i:e).apply(r?n:this,arguments)}}(e,t,n);return aa((g?Si:ra)(S,A),e,t)}function Ao(e,t,n,r){return e===o||ds(e,st[n])&&!lt.call(r,n)?t:e}function So(e,t,n,r,i,a){return Ss(e)&&Ss(t)&&(a.set(t,e),vi(e,t,o,So,a),a.delete(t)),e}function Oo(e){return Ns(e)?o:e}function Do(e,t,n,r,i,a){var s=n&v,u=e.length,c=t.length;if(u!=c&&!(s&&c>u))return!1;var l=a.get(e);if(l&&a.get(t))return l==t;var f=-1,p=!0,d=n&g?new wr:o;for(a.set(e,t),a.set(t,e);++f<u;){var h=e[f],m=t[f];if(r)var y=s?r(m,h,f,t,e,a):r(h,m,f,e,t,a);if(y!==o){if(y)continue;p=!1;break}if(d){if(!rn(t,function(e,t){if(!_n(d,t)&&(h===e||i(h,e,n,r,a)))return d.push(t)})){p=!1;break}}else if(h!==m&&!i(h,m,n,r,a)){p=!1;break}}return a.delete(e),a.delete(t),p}function Io(e){return oa(ea(e,o,ya),e+"")}function No(e){return Yr(e,iu,Fo)}function ko(e){return Yr(e,ou,Wo)}var Lo=rr?function(e){return rr.get(e)}:Ru;function jo(e){for(var t=e.name+"",n=ir[t],r=lt.call(ir,t)?n.length:0;r--;){var i=n[r],o=i.func;if(null==o||o==e)return i.name}return t}function Ro(e){return(lt.call(dr,"placeholder")?dr:e).placeholder}function Po(){var e=dr.iteratee||Nu;return e=e===Nu?ui:e,arguments.length?e(arguments[0],arguments[1]):e}function $o(e,t){var n,r,i=e.__data__;return("string"==(r=typeof(n=t))||"number"==r||"symbol"==r||"boolean"==r?"__proto__"!==n:null===n)?i["string"==typeof t?"string":"hash"]:i.map}function Ho(e){for(var t=iu(e),n=t.length;n--;){var r=t[n],i=e[r];t[n]=[r,i,Jo(i)]}return t}function Mo(e,t){var n=function(e,t){return null==e?o:e[t]}(e,t);return si(n)?n:o}var Fo=Fn?function(e){return null==e?[]:(e=tt(e),Qt(Fn(e),function(t){return jt.call(e,t)}))}:Uu,Wo=Fn?function(e){for(var t=[];e;)en(t,Fo(e)),e=Nt(e);return t}:Uu,Uo=Jr;function Bo(e,t,n){for(var r=-1,i=(t=zi(t,e)).length,o=!1;++r<i;){var a=la(t[r]);if(!(o=null!=e&&n(e,a)))break;e=e[a]}return o||++r!=i?o:!!(i=null==e?0:e.length)&&As(i)&&zo(a,i)&&(ms(e)||gs(e))}function qo(e){return"function"!=typeof e.constructor||Yo(e)?{}:hr(Nt(e))}function Vo(e){return ms(e)||gs(e)||!!($t&&e&&e[$t])}function zo(e,t){var n=typeof e;return!!(t=null==t?j:t)&&("number"==n||"symbol"!=n&&Ke.test(e))&&e>-1&&e%1==0&&e<t}function Go(e,t,n){if(!Ss(n))return!1;var r=typeof t;return!!("number"==r?_s(n)&&zo(t,n.length):"string"==r&&t in n)&&ds(n[t],e)}function Ko(e,t){if(ms(e))return!1;var n=typeof e;return!("number"!=n&&"symbol"!=n&&"boolean"!=n&&null!=e&&!Rs(e))||Ie.test(e)||!De.test(e)||null!=t&&e in tt(t)}function Xo(e){var t=jo(e),n=dr[t];if("function"!=typeof n||!(t in mr.prototype))return!1;if(e===n)return!0;var r=Lo(n);return!!r&&e===r[0]}(Yn&&Uo(new Yn(new ArrayBuffer(1)))!=ce||Jn&&Uo(new Jn)!=Q||Zn&&"[object Promise]"!=Uo(Zn.resolve())||er&&Uo(new er)!=ne||tr&&Uo(new tr)!=ae)&&(Uo=function(e){var t=Jr(e),n=t==Z?e.constructor:o,r=n?fa(n):"";if(r)switch(r){case or:return ce;case ar:return Q;case sr:return"[object Promise]";case ur:return ne;case cr:return ae}return t});var Qo=ut?Cs:Bu;function Yo(e){var t=e&&e.constructor;return e===("function"==typeof t&&t.prototype||st)}function Jo(e){return e==e&&!Ss(e)}function Zo(e,t){return function(n){return null!=n&&n[e]===t&&(t!==o||e in tt(n))}}function ea(e,t,n){return t=Vn(t===o?e.length-1:t,0),function(){for(var i=arguments,o=-1,a=Vn(i.length-t,0),s=r(a);++o<a;)s[o]=i[t+o];o=-1;for(var u=r(t+1);++o<t;)u[o]=i[o];return u[t]=n(s),Vt(e,this,u)}}function ta(e,t){return t.length<2?e:Qr(e,Ii(t,0,-1))}function na(e,t){if("__proto__"!=t)return e[t]}var ra=sa(Si),ia=$n||function(e,t){return Lt.setTimeout(e,t)},oa=sa(Oi);function aa(e,t,n){var r=t+"";return oa(e,function(e,t){var n=t.length;if(!n)return e;var r=n-1;return t[r]=(n>1?"& ":"")+t[r],t=t.join(n>2?", ":" "),e.replace($e,"{\n/* [wrapped with "+t+"] */\n")}(r,function(e,t){return Gt(F,function(n){var r="_."+n[0];t&n[1]&&!Yt(e,r)&&e.push(r)}),e.sort()}(function(e){var t=e.match(He);return t?t[1].split(Me):[]}(r),n)))}function sa(e){var t=0,n=0;return function(){var r=Gn(),i=I-(r-n);if(n=r,i>0){if(++t>=D)return arguments[0]}else t=0;return e.apply(o,arguments)}}function ua(e,t){var n=-1,r=e.length,i=r-1;for(t=t===o?r:t;++n<t;){var a=wi(n,i),s=e[a];e[a]=e[n],e[n]=s}return e.length=t,e}var ca=function(e){var t=ss(e,function(e){return n.size===l&&n.clear(),e}),n=t.cache;return t}(function(e){var t=[];return 46===e.charCodeAt(0)&&t.push(""),e.replace(Ne,function(e,n,r,i){t.push(r?i.replace(We,"$1"):n||e)}),t});function la(e){if("string"==typeof e||Rs(e))return e;var t=e+"";return"0"==t&&1/e==-L?"-0":t}function fa(e){if(null!=e){try{return ct.call(e)}catch(e){}try{return e+""}catch(e){}}return""}function pa(e){if(e instanceof mr)return e.clone();var t=new gr(e.__wrapped__,e.__chain__);return t.__actions__=no(e.__actions__),t.__index__=e.__index__,t.__values__=e.__values__,t}var da=Ti(function(e,t){return bs(e)?Hr(e,qr(t,1,bs,!0)):[]}),ha=Ti(function(e,t){var n=Ta(t);return bs(n)&&(n=o),bs(e)?Hr(e,qr(t,1,bs,!0),Po(n,2)):[]}),va=Ti(function(e,t){var n=Ta(t);return bs(n)&&(n=o),bs(e)?Hr(e,qr(t,1,bs,!0),o,n):[]});function ga(e,t,n){var r=null==e?0:e.length;if(!r)return-1;var i=null==n?0:Ws(n);return i<0&&(i=Vn(r+i,0)),sn(e,Po(t,3),i)}function ma(e,t,n){var r=null==e?0:e.length;if(!r)return-1;var i=r-1;return n!==o&&(i=Ws(n),i=n<0?Vn(r+i,0):zn(i,r-1)),sn(e,Po(t,3),i,!0)}function ya(e){return null!=e&&e.length?qr(e,1):[]}function _a(e){return e&&e.length?e[0]:o}var ba=Ti(function(e){var t=Zt(e,qi);return t.length&&t[0]===e[0]?ni(t):[]}),wa=Ti(function(e){var t=Ta(e),n=Zt(e,qi);return t===Ta(n)?t=o:n.pop(),n.length&&n[0]===e[0]?ni(n,Po(t,2)):[]}),Ea=Ti(function(e){var t=Ta(e),n=Zt(e,qi);return(t="function"==typeof t?t:o)&&n.pop(),n.length&&n[0]===e[0]?ni(n,o,t):[]});function Ta(e){var t=null==e?0:e.length;return t?e[t-1]:o}var Ca=Ti(xa);function xa(e,t){return e&&e.length&&t&&t.length?_i(e,t):e}var Aa=Io(function(e,t){var n=null==e?0:e.length,r=Lr(e,t);return bi(e,Zt(t,function(e){return zo(e,n)?+e:e}).sort(Zi)),r});function Sa(e){return null==e?e:Qn.call(e)}var Oa=Ti(function(e){return $i(qr(e,1,bs,!0))}),Da=Ti(function(e){var t=Ta(e);return bs(t)&&(t=o),$i(qr(e,1,bs,!0),Po(t,2))}),Ia=Ti(function(e){var t=Ta(e);return t="function"==typeof t?t:o,$i(qr(e,1,bs,!0),o,t)});function Na(e){if(!e||!e.length)return[];var t=0;return e=Qt(e,function(e){if(bs(e))return t=Vn(e.length,t),!0}),gn(t,function(t){return Zt(e,pn(t))})}function ka(e,t){if(!e||!e.length)return[];var n=Na(e);return null==t?n:Zt(n,function(e){return Vt(t,o,e)})}var La=Ti(function(e,t){return bs(e)?Hr(e,t):[]}),ja=Ti(function(e){return Ui(Qt(e,bs))}),Ra=Ti(function(e){var t=Ta(e);return bs(t)&&(t=o),Ui(Qt(e,bs),Po(t,2))}),Pa=Ti(function(e){var t=Ta(e);return t="function"==typeof t?t:o,Ui(Qt(e,bs),o,t)}),$a=Ti(Na);var Ha=Ti(function(e){var t=e.length,n=t>1?e[t-1]:o;return n="function"==typeof n?(e.pop(),n):o,ka(e,n)});function Ma(e){var t=dr(e);return t.__chain__=!0,t}function Fa(e,t){return t(e)}var Wa=Io(function(e){var t=e.length,n=t?e[0]:0,r=this.__wrapped__,i=function(t){return Lr(t,e)};return!(t>1||this.__actions__.length)&&r instanceof mr&&zo(n)?((r=r.slice(n,+n+(t?1:0))).__actions__.push({func:Fa,args:[i],thisArg:o}),new gr(r,this.__chain__).thru(function(e){return t&&!e.length&&e.push(o),e})):this.thru(i)});var Ua=io(function(e,t,n){lt.call(e,n)?++e[n]:kr(e,n,1)});var Ba=fo(ga),qa=fo(ma);function Va(e,t){return(ms(e)?Gt:Mr)(e,Po(t,3))}function za(e,t){return(ms(e)?Kt:Fr)(e,Po(t,3))}var Ga=io(function(e,t,n){lt.call(e,n)?e[n].push(t):kr(e,n,[t])});var Ka=Ti(function(e,t,n){var i=-1,o="function"==typeof t,a=_s(e)?r(e.length):[];return Mr(e,function(e){a[++i]=o?Vt(t,e,n):ri(e,t,n)}),a}),Xa=io(function(e,t,n){kr(e,n,t)});function Qa(e,t){return(ms(e)?Zt:pi)(e,Po(t,3))}var Ya=io(function(e,t,n){e[n?0:1].push(t)},function(){return[[],[]]});var Ja=Ti(function(e,t){if(null==e)return[];var n=t.length;return n>1&&Go(e,t[0],t[1])?t=[]:n>2&&Go(t[0],t[1],t[2])&&(t=[t[0]]),mi(e,qr(t,1),[])}),Za=Pn||function(){return Lt.Date.now()};function es(e,t,n){return t=n?o:t,t=e&&null==t?e.length:t,xo(e,C,o,o,o,o,t)}function ts(e,t){var n;if("function"!=typeof t)throw new it(u);return e=Ws(e),function(){return--e>0&&(n=t.apply(this,arguments)),e<=1&&(t=o),n}}var ns=Ti(function(e,t,n){var r=m;if(n.length){var i=On(n,Ro(ns));r|=E}return xo(e,r,t,n,i)}),rs=Ti(function(e,t,n){var r=m|y;if(n.length){var i=On(n,Ro(rs));r|=E}return xo(t,r,e,n,i)});function is(e,t,n){var r,i,a,s,c,l,f=0,p=!1,d=!1,h=!0;if("function"!=typeof e)throw new it(u);function v(t){var n=r,a=i;return r=i=o,f=t,s=e.apply(a,n)}function g(e){var n=e-l;return l===o||n>=t||n<0||d&&e-f>=a}function m(){var e=Za();if(g(e))return y(e);c=ia(m,function(e){var n=t-(e-l);return d?zn(n,a-(e-f)):n}(e))}function y(e){return c=o,h&&r?v(e):(r=i=o,s)}function _(){var e=Za(),n=g(e);if(r=arguments,i=this,l=e,n){if(c===o)return function(e){return f=e,c=ia(m,t),p?v(e):s}(l);if(d)return c=ia(m,t),v(l)}return c===o&&(c=ia(m,t)),s}return t=Bs(t)||0,Ss(n)&&(p=!!n.leading,a=(d="maxWait"in n)?Vn(Bs(n.maxWait)||0,t):a,h="trailing"in n?!!n.trailing:h),_.cancel=function(){c!==o&&Xi(c),f=0,r=l=i=c=o},_.flush=function(){return c===o?s:y(Za())},_}var os=Ti(function(e,t){return $r(e,1,t)}),as=Ti(function(e,t,n){return $r(e,Bs(t)||0,n)});function ss(e,t){if("function"!=typeof e||null!=t&&"function"!=typeof t)throw new it(u);var n=function(){var r=arguments,i=t?t.apply(this,r):r[0],o=n.cache;if(o.has(i))return o.get(i);var a=e.apply(this,r);return n.cache=o.set(i,a)||o,a};return n.cache=new(ss.Cache||br),n}function us(e){if("function"!=typeof e)throw new it(u);return function(){var t=arguments;switch(t.length){case 0:return!e.call(this);case 1:return!e.call(this,t[0]);case 2:return!e.call(this,t[0],t[1]);case 3:return!e.call(this,t[0],t[1],t[2])}return!e.apply(this,t)}}ss.Cache=br;var cs=Gi(function(e,t){var n=(t=1==t.length&&ms(t[0])?Zt(t[0],mn(Po())):Zt(qr(t,1),mn(Po()))).length;return Ti(function(r){for(var i=-1,o=zn(r.length,n);++i<o;)r[i]=t[i].call(this,r[i]);return Vt(e,this,r)})}),ls=Ti(function(e,t){var n=On(t,Ro(ls));return xo(e,E,o,t,n)}),fs=Ti(function(e,t){var n=On(t,Ro(fs));return xo(e,T,o,t,n)}),ps=Io(function(e,t){return xo(e,x,o,o,o,t)});function ds(e,t){return e===t||e!=e&&t!=t}var hs=bo(Zr),vs=bo(function(e,t){return e>=t}),gs=ii(function(){return arguments}())?ii:function(e){return Os(e)&<.call(e,"callee")&&!jt.call(e,"callee")},ms=r.isArray,ys=Mt?mn(Mt):function(e){return Os(e)&&Jr(e)==ue};function _s(e){return null!=e&&As(e.length)&&!Cs(e)}function bs(e){return Os(e)&&_s(e)}var ws=Wn||Bu,Es=Ft?mn(Ft):function(e){return Os(e)&&Jr(e)==V};function Ts(e){if(!Os(e))return!1;var t=Jr(e);return t==G||t==z||"string"==typeof e.message&&"string"==typeof e.name&&!Ns(e)}function Cs(e){if(!Ss(e))return!1;var t=Jr(e);return t==K||t==X||t==B||t==ee}function xs(e){return"number"==typeof e&&e==Ws(e)}function As(e){return"number"==typeof e&&e>-1&&e%1==0&&e<=j}function Ss(e){var t=typeof e;return null!=e&&("object"==t||"function"==t)}function Os(e){return null!=e&&"object"==typeof e}var Ds=Wt?mn(Wt):function(e){return Os(e)&&Uo(e)==Q};function Is(e){return"number"==typeof e||Os(e)&&Jr(e)==Y}function Ns(e){if(!Os(e)||Jr(e)!=Z)return!1;var t=Nt(e);if(null===t)return!0;var n=lt.call(t,"constructor")&&t.constructor;return"function"==typeof n&&n instanceof n&&ct.call(n)==ht}var ks=Ut?mn(Ut):function(e){return Os(e)&&Jr(e)==te};var Ls=Bt?mn(Bt):function(e){return Os(e)&&Uo(e)==ne};function js(e){return"string"==typeof e||!ms(e)&&Os(e)&&Jr(e)==re}function Rs(e){return"symbol"==typeof e||Os(e)&&Jr(e)==ie}var Ps=qt?mn(qt):function(e){return Os(e)&&As(e.length)&&!!At[Jr(e)]};var $s=bo(fi),Hs=bo(function(e,t){return e<=t});function Ms(e){if(!e)return[];if(_s(e))return js(e)?kn(e):no(e);if(Ht&&e[Ht])return function(e){for(var t,n=[];!(t=e.next()).done;)n.push(t.value);return n}(e[Ht]());var t=Uo(e);return(t==Q?An:t==ne?Dn:du)(e)}function Fs(e){return e?(e=Bs(e))===L||e===-L?(e<0?-1:1)*R:e==e?e:0:0===e?e:0}function Ws(e){var t=Fs(e),n=t%1;return t==t?n?t-n:t:0}function Us(e){return e?jr(Ws(e),0,$):0}function Bs(e){if("number"==typeof e)return e;if(Rs(e))return P;if(Ss(e)){var t="function"==typeof e.valueOf?e.valueOf():e;e=Ss(t)?t+"":t}if("string"!=typeof e)return 0===e?e:+e;e=e.replace(je,"");var n=Ve.test(e);return n||Ge.test(e)?It(e.slice(2),n?2:8):qe.test(e)?P:+e}function qs(e){return ro(e,ou(e))}function Vs(e){return null==e?"":Pi(e)}var zs=oo(function(e,t){if(Yo(t)||_s(t))ro(t,iu(t),e);else for(var n in t)lt.call(t,n)&&Or(e,n,t[n])}),Gs=oo(function(e,t){ro(t,ou(t),e)}),Ks=oo(function(e,t,n,r){ro(t,ou(t),e,r)}),Xs=oo(function(e,t,n,r){ro(t,iu(t),e,r)}),Qs=Io(Lr);var Ys=Ti(function(e,t){e=tt(e);var n=-1,r=t.length,i=r>2?t[2]:o;for(i&&Go(t[0],t[1],i)&&(r=1);++n<r;)for(var a=t[n],s=ou(a),u=-1,c=s.length;++u<c;){var l=s[u],f=e[l];(f===o||ds(f,st[l])&&!lt.call(e,l))&&(e[l]=a[l])}return e}),Js=Ti(function(e){return e.push(o,So),Vt(su,o,e)});function Zs(e,t,n){var r=null==e?o:Qr(e,t);return r===o?n:r}function eu(e,t){return null!=e&&Bo(e,t,ti)}var tu=vo(function(e,t,n){null!=t&&"function"!=typeof t.toString&&(t=dt.call(t)),e[t]=n},Su(Iu)),nu=vo(function(e,t,n){null!=t&&"function"!=typeof t.toString&&(t=dt.call(t)),lt.call(e,t)?e[t].push(n):e[t]=[n]},Po),ru=Ti(ri);function iu(e){return _s(e)?Tr(e):ci(e)}function ou(e){return _s(e)?Tr(e,!0):li(e)}var au=oo(function(e,t,n){vi(e,t,n)}),su=oo(function(e,t,n,r){vi(e,t,n,r)}),uu=Io(function(e,t){var n={};if(null==e)return n;var r=!1;t=Zt(t,function(t){return t=zi(t,e),r||(r=t.length>1),t}),ro(e,ko(e),n),r&&(n=Rr(n,p|d|h,Oo));for(var i=t.length;i--;)Hi(n,t[i]);return n});var cu=Io(function(e,t){return null==e?{}:function(e,t){return yi(e,t,function(t,n){return eu(e,n)})}(e,t)});function lu(e,t){if(null==e)return{};var n=Zt(ko(e),function(e){return[e]});return t=Po(t),yi(e,n,function(e,n){return t(e,n[0])})}var fu=Co(iu),pu=Co(ou);function du(e){return null==e?[]:yn(e,iu(e))}var hu=co(function(e,t,n){return t=t.toLowerCase(),e+(n?vu(t):t)});function vu(e){return Tu(Vs(e).toLowerCase())}function gu(e){return(e=Vs(e))&&e.replace(Xe,En).replace(_t,"")}var mu=co(function(e,t,n){return e+(n?"-":"")+t.toLowerCase()}),yu=co(function(e,t,n){return e+(n?" ":"")+t.toLowerCase()}),_u=uo("toLowerCase");var bu=co(function(e,t,n){return e+(n?"_":"")+t.toLowerCase()});var wu=co(function(e,t,n){return e+(n?" ":"")+Tu(t)});var Eu=co(function(e,t,n){return e+(n?" ":"")+t.toUpperCase()}),Tu=uo("toUpperCase");function Cu(e,t,n){return e=Vs(e),(t=n?o:t)===o?function(e){return Tt.test(e)}(e)?function(e){return e.match(wt)||[]}(e):function(e){return e.match(Fe)||[]}(e):e.match(t)||[]}var xu=Ti(function(e,t){try{return Vt(e,o,t)}catch(e){return Ts(e)?e:new Je(e)}}),Au=Io(function(e,t){return Gt(t,function(t){t=la(t),kr(e,t,ns(e[t],e))}),e});function Su(e){return function(){return e}}var Ou=po(),Du=po(!0);function Iu(e){return e}function Nu(e){return ui("function"==typeof e?e:Rr(e,p))}var ku=Ti(function(e,t){return function(n){return ri(n,e,t)}}),Lu=Ti(function(e,t){return function(n){return ri(e,n,t)}});function ju(e,t,n){var r=iu(t),i=Xr(t,r);null!=n||Ss(t)&&(i.length||!r.length)||(n=t,t=e,e=this,i=Xr(t,iu(t)));var o=!(Ss(n)&&"chain"in n&&!n.chain),a=Cs(e);return Gt(i,function(n){var r=t[n];e[n]=r,a&&(e.prototype[n]=function(){var t=this.__chain__;if(o||t){var n=e(this.__wrapped__);return(n.__actions__=no(this.__actions__)).push({func:r,args:arguments,thisArg:e}),n.__chain__=t,n}return r.apply(e,en([this.value()],arguments))})}),e}function Ru(){}var Pu=mo(Zt),$u=mo(Xt),Hu=mo(rn);function Mu(e){return Ko(e)?pn(la(e)):function(e){return function(t){return Qr(t,e)}}(e)}var Fu=_o(),Wu=_o(!0);function Uu(){return[]}function Bu(){return!1}var qu=go(function(e,t){return e+t},0),Vu=Eo("ceil"),zu=go(function(e,t){return e/t},1),Gu=Eo("floor");var Ku,Xu=go(function(e,t){return e*t},1),Qu=Eo("round"),Yu=go(function(e,t){return e-t},0);return dr.after=function(e,t){if("function"!=typeof t)throw new it(u);return e=Ws(e),function(){if(--e<1)return t.apply(this,arguments)}},dr.ary=es,dr.assign=zs,dr.assignIn=Gs,dr.assignInWith=Ks,dr.assignWith=Xs,dr.at=Qs,dr.before=ts,dr.bind=ns,dr.bindAll=Au,dr.bindKey=rs,dr.castArray=function(){if(!arguments.length)return[];var e=arguments[0];return ms(e)?e:[e]},dr.chain=Ma,dr.chunk=function(e,t,n){t=(n?Go(e,t,n):t===o)?1:Vn(Ws(t),0);var i=null==e?0:e.length;if(!i||t<1)return[];for(var a=0,s=0,u=r(Hn(i/t));a<i;)u[s++]=Ii(e,a,a+=t);return u},dr.compact=function(e){for(var t=-1,n=null==e?0:e.length,r=0,i=[];++t<n;){var o=e[t];o&&(i[r++]=o)}return i},dr.concat=function(){var e=arguments.length;if(!e)return[];for(var t=r(e-1),n=arguments[0],i=e;i--;)t[i-1]=arguments[i];return en(ms(n)?no(n):[n],qr(t,1))},dr.cond=function(e){var t=null==e?0:e.length,n=Po();return e=t?Zt(e,function(e){if("function"!=typeof e[1])throw new it(u);return[n(e[0]),e[1]]}):[],Ti(function(n){for(var r=-1;++r<t;){var i=e[r];if(Vt(i[0],this,n))return Vt(i[1],this,n)}})},dr.conforms=function(e){return function(e){var t=iu(e);return function(n){return Pr(n,e,t)}}(Rr(e,p))},dr.constant=Su,dr.countBy=Ua,dr.create=function(e,t){var n=hr(e);return null==t?n:Nr(n,t)},dr.curry=function e(t,n,r){var i=xo(t,b,o,o,o,o,o,n=r?o:n);return i.placeholder=e.placeholder,i},dr.curryRight=function e(t,n,r){var i=xo(t,w,o,o,o,o,o,n=r?o:n);return i.placeholder=e.placeholder,i},dr.debounce=is,dr.defaults=Ys,dr.defaultsDeep=Js,dr.defer=os,dr.delay=as,dr.difference=da,dr.differenceBy=ha,dr.differenceWith=va,dr.drop=function(e,t,n){var r=null==e?0:e.length;return r?Ii(e,(t=n||t===o?1:Ws(t))<0?0:t,r):[]},dr.dropRight=function(e,t,n){var r=null==e?0:e.length;return r?Ii(e,0,(t=r-(t=n||t===o?1:Ws(t)))<0?0:t):[]},dr.dropRightWhile=function(e,t){return e&&e.length?Fi(e,Po(t,3),!0,!0):[]},dr.dropWhile=function(e,t){return e&&e.length?Fi(e,Po(t,3),!0):[]},dr.fill=function(e,t,n,r){var i=null==e?0:e.length;return i?(n&&"number"!=typeof n&&Go(e,t,n)&&(n=0,r=i),function(e,t,n,r){var i=e.length;for((n=Ws(n))<0&&(n=-n>i?0:i+n),(r=r===o||r>i?i:Ws(r))<0&&(r+=i),r=n>r?0:Us(r);n<r;)e[n++]=t;return e}(e,t,n,r)):[]},dr.filter=function(e,t){return(ms(e)?Qt:Br)(e,Po(t,3))},dr.flatMap=function(e,t){return qr(Qa(e,t),1)},dr.flatMapDeep=function(e,t){return qr(Qa(e,t),L)},dr.flatMapDepth=function(e,t,n){return n=n===o?1:Ws(n),qr(Qa(e,t),n)},dr.flatten=ya,dr.flattenDeep=function(e){return null!=e&&e.length?qr(e,L):[]},dr.flattenDepth=function(e,t){return null!=e&&e.length?qr(e,t=t===o?1:Ws(t)):[]},dr.flip=function(e){return xo(e,A)},dr.flow=Ou,dr.flowRight=Du,dr.fromPairs=function(e){for(var t=-1,n=null==e?0:e.length,r={};++t<n;){var i=e[t];r[i[0]]=i[1]}return r},dr.functions=function(e){return null==e?[]:Xr(e,iu(e))},dr.functionsIn=function(e){return null==e?[]:Xr(e,ou(e))},dr.groupBy=Ga,dr.initial=function(e){return null!=e&&e.length?Ii(e,0,-1):[]},dr.intersection=ba,dr.intersectionBy=wa,dr.intersectionWith=Ea,dr.invert=tu,dr.invertBy=nu,dr.invokeMap=Ka,dr.iteratee=Nu,dr.keyBy=Xa,dr.keys=iu,dr.keysIn=ou,dr.map=Qa,dr.mapKeys=function(e,t){var n={};return t=Po(t,3),Gr(e,function(e,r,i){kr(n,t(e,r,i),e)}),n},dr.mapValues=function(e,t){var n={};return t=Po(t,3),Gr(e,function(e,r,i){kr(n,r,t(e,r,i))}),n},dr.matches=function(e){return di(Rr(e,p))},dr.matchesProperty=function(e,t){return hi(e,Rr(t,p))},dr.memoize=ss,dr.merge=au,dr.mergeWith=su,dr.method=ku,dr.methodOf=Lu,dr.mixin=ju,dr.negate=us,dr.nthArg=function(e){return e=Ws(e),Ti(function(t){return gi(t,e)})},dr.omit=uu,dr.omitBy=function(e,t){return lu(e,us(Po(t)))},dr.once=function(e){return ts(2,e)},dr.orderBy=function(e,t,n,r){return null==e?[]:(ms(t)||(t=null==t?[]:[t]),ms(n=r?o:n)||(n=null==n?[]:[n]),mi(e,t,n))},dr.over=Pu,dr.overArgs=cs,dr.overEvery=$u,dr.overSome=Hu,dr.partial=ls,dr.partialRight=fs,dr.partition=Ya,dr.pick=cu,dr.pickBy=lu,dr.property=Mu,dr.propertyOf=function(e){return function(t){return null==e?o:Qr(e,t)}},dr.pull=Ca,dr.pullAll=xa,dr.pullAllBy=function(e,t,n){return e&&e.length&&t&&t.length?_i(e,t,Po(n,2)):e},dr.pullAllWith=function(e,t,n){return e&&e.length&&t&&t.length?_i(e,t,o,n):e},dr.pullAt=Aa,dr.range=Fu,dr.rangeRight=Wu,dr.rearg=ps,dr.reject=function(e,t){return(ms(e)?Qt:Br)(e,us(Po(t,3)))},dr.remove=function(e,t){var n=[];if(!e||!e.length)return n;var r=-1,i=[],o=e.length;for(t=Po(t,3);++r<o;){var a=e[r];t(a,r,e)&&(n.push(a),i.push(r))}return bi(e,i),n},dr.rest=function(e,t){if("function"!=typeof e)throw new it(u);return Ti(e,t=t===o?t:Ws(t))},dr.reverse=Sa,dr.sampleSize=function(e,t,n){return t=(n?Go(e,t,n):t===o)?1:Ws(t),(ms(e)?xr:xi)(e,t)},dr.set=function(e,t,n){return null==e?e:Ai(e,t,n)},dr.setWith=function(e,t,n,r){return r="function"==typeof r?r:o,null==e?e:Ai(e,t,n,r)},dr.shuffle=function(e){return(ms(e)?Ar:Di)(e)},dr.slice=function(e,t,n){var r=null==e?0:e.length;return r?(n&&"number"!=typeof n&&Go(e,t,n)?(t=0,n=r):(t=null==t?0:Ws(t),n=n===o?r:Ws(n)),Ii(e,t,n)):[]},dr.sortBy=Ja,dr.sortedUniq=function(e){return e&&e.length?ji(e):[]},dr.sortedUniqBy=function(e,t){return e&&e.length?ji(e,Po(t,2)):[]},dr.split=function(e,t,n){return n&&"number"!=typeof n&&Go(e,t,n)&&(t=n=o),(n=n===o?$:n>>>0)?(e=Vs(e))&&("string"==typeof t||null!=t&&!ks(t))&&!(t=Pi(t))&&xn(e)?Ki(kn(e),0,n):e.split(t,n):[]},dr.spread=function(e,t){if("function"!=typeof e)throw new it(u);return t=null==t?0:Vn(Ws(t),0),Ti(function(n){var r=n[t],i=Ki(n,0,t);return r&&en(i,r),Vt(e,this,i)})},dr.tail=function(e){var t=null==e?0:e.length;return t?Ii(e,1,t):[]},dr.take=function(e,t,n){return e&&e.length?Ii(e,0,(t=n||t===o?1:Ws(t))<0?0:t):[]},dr.takeRight=function(e,t,n){var r=null==e?0:e.length;return r?Ii(e,(t=r-(t=n||t===o?1:Ws(t)))<0?0:t,r):[]},dr.takeRightWhile=function(e,t){return e&&e.length?Fi(e,Po(t,3),!1,!0):[]},dr.takeWhile=function(e,t){return e&&e.length?Fi(e,Po(t,3)):[]},dr.tap=function(e,t){return t(e),e},dr.throttle=function(e,t,n){var r=!0,i=!0;if("function"!=typeof e)throw new it(u);return Ss(n)&&(r="leading"in n?!!n.leading:r,i="trailing"in n?!!n.trailing:i),is(e,t,{leading:r,maxWait:t,trailing:i})},dr.thru=Fa,dr.toArray=Ms,dr.toPairs=fu,dr.toPairsIn=pu,dr.toPath=function(e){return ms(e)?Zt(e,la):Rs(e)?[e]:no(ca(Vs(e)))},dr.toPlainObject=qs,dr.transform=function(e,t,n){var r=ms(e),i=r||ws(e)||Ps(e);if(t=Po(t,4),null==n){var o=e&&e.constructor;n=i?r?new o:[]:Ss(e)&&Cs(o)?hr(Nt(e)):{}}return(i?Gt:Gr)(e,function(e,r,i){return t(n,e,r,i)}),n},dr.unary=function(e){return es(e,1)},dr.union=Oa,dr.unionBy=Da,dr.unionWith=Ia,dr.uniq=function(e){return e&&e.length?$i(e):[]},dr.uniqBy=function(e,t){return e&&e.length?$i(e,Po(t,2)):[]},dr.uniqWith=function(e,t){return t="function"==typeof t?t:o,e&&e.length?$i(e,o,t):[]},dr.unset=function(e,t){return null==e||Hi(e,t)},dr.unzip=Na,dr.unzipWith=ka,dr.update=function(e,t,n){return null==e?e:Mi(e,t,Vi(n))},dr.updateWith=function(e,t,n,r){return r="function"==typeof r?r:o,null==e?e:Mi(e,t,Vi(n),r)},dr.values=du,dr.valuesIn=function(e){return null==e?[]:yn(e,ou(e))},dr.without=La,dr.words=Cu,dr.wrap=function(e,t){return ls(Vi(t),e)},dr.xor=ja,dr.xorBy=Ra,dr.xorWith=Pa,dr.zip=$a,dr.zipObject=function(e,t){return Bi(e||[],t||[],Or)},dr.zipObjectDeep=function(e,t){return Bi(e||[],t||[],Ai)},dr.zipWith=Ha,dr.entries=fu,dr.entriesIn=pu,dr.extend=Gs,dr.extendWith=Ks,ju(dr,dr),dr.add=qu,dr.attempt=xu,dr.camelCase=hu,dr.capitalize=vu,dr.ceil=Vu,dr.clamp=function(e,t,n){return n===o&&(n=t,t=o),n!==o&&(n=(n=Bs(n))==n?n:0),t!==o&&(t=(t=Bs(t))==t?t:0),jr(Bs(e),t,n)},dr.clone=function(e){return Rr(e,h)},dr.cloneDeep=function(e){return Rr(e,p|h)},dr.cloneDeepWith=function(e,t){return Rr(e,p|h,t="function"==typeof t?t:o)},dr.cloneWith=function(e,t){return Rr(e,h,t="function"==typeof t?t:o)},dr.conformsTo=function(e,t){return null==t||Pr(e,t,iu(t))},dr.deburr=gu,dr.defaultTo=function(e,t){return null==e||e!=e?t:e},dr.divide=zu,dr.endsWith=function(e,t,n){e=Vs(e),t=Pi(t);var r=e.length,i=n=n===o?r:jr(Ws(n),0,r);return(n-=t.length)>=0&&e.slice(n,i)==t},dr.eq=ds,dr.escape=function(e){return(e=Vs(e))&&xe.test(e)?e.replace(Te,Tn):e},dr.escapeRegExp=function(e){return(e=Vs(e))&&Le.test(e)?e.replace(ke,"\\$&"):e},dr.every=function(e,t,n){var r=ms(e)?Xt:Wr;return n&&Go(e,t,n)&&(t=o),r(e,Po(t,3))},dr.find=Ba,dr.findIndex=ga,dr.findKey=function(e,t){return an(e,Po(t,3),Gr)},dr.findLast=qa,dr.findLastIndex=ma,dr.findLastKey=function(e,t){return an(e,Po(t,3),Kr)},dr.floor=Gu,dr.forEach=Va,dr.forEachRight=za,dr.forIn=function(e,t){return null==e?e:Vr(e,Po(t,3),ou)},dr.forInRight=function(e,t){return null==e?e:zr(e,Po(t,3),ou)},dr.forOwn=function(e,t){return e&&Gr(e,Po(t,3))},dr.forOwnRight=function(e,t){return e&&Kr(e,Po(t,3))},dr.get=Zs,dr.gt=hs,dr.gte=vs,dr.has=function(e,t){return null!=e&&Bo(e,t,ei)},dr.hasIn=eu,dr.head=_a,dr.identity=Iu,dr.includes=function(e,t,n,r){e=_s(e)?e:du(e),n=n&&!r?Ws(n):0;var i=e.length;return n<0&&(n=Vn(i+n,0)),js(e)?n<=i&&e.indexOf(t,n)>-1:!!i&&un(e,t,n)>-1},dr.indexOf=function(e,t,n){var r=null==e?0:e.length;if(!r)return-1;var i=null==n?0:Ws(n);return i<0&&(i=Vn(r+i,0)),un(e,t,i)},dr.inRange=function(e,t,n){return t=Fs(t),n===o?(n=t,t=0):n=Fs(n),function(e,t,n){return e>=zn(t,n)&&e<Vn(t,n)}(e=Bs(e),t,n)},dr.invoke=ru,dr.isArguments=gs,dr.isArray=ms,dr.isArrayBuffer=ys,dr.isArrayLike=_s,dr.isArrayLikeObject=bs,dr.isBoolean=function(e){return!0===e||!1===e||Os(e)&&Jr(e)==q},dr.isBuffer=ws,dr.isDate=Es,dr.isElement=function(e){return Os(e)&&1===e.nodeType&&!Ns(e)},dr.isEmpty=function(e){if(null==e)return!0;if(_s(e)&&(ms(e)||"string"==typeof e||"function"==typeof e.splice||ws(e)||Ps(e)||gs(e)))return!e.length;var t=Uo(e);if(t==Q||t==ne)return!e.size;if(Yo(e))return!ci(e).length;for(var n in e)if(lt.call(e,n))return!1;return!0},dr.isEqual=function(e,t){return oi(e,t)},dr.isEqualWith=function(e,t,n){var r=(n="function"==typeof n?n:o)?n(e,t):o;return r===o?oi(e,t,o,n):!!r},dr.isError=Ts,dr.isFinite=function(e){return"number"==typeof e&&Un(e)},dr.isFunction=Cs,dr.isInteger=xs,dr.isLength=As,dr.isMap=Ds,dr.isMatch=function(e,t){return e===t||ai(e,t,Ho(t))},dr.isMatchWith=function(e,t,n){return n="function"==typeof n?n:o,ai(e,t,Ho(t),n)},dr.isNaN=function(e){return Is(e)&&e!=+e},dr.isNative=function(e){if(Qo(e))throw new Je(s);return si(e)},dr.isNil=function(e){return null==e},dr.isNull=function(e){return null===e},dr.isNumber=Is,dr.isObject=Ss,dr.isObjectLike=Os,dr.isPlainObject=Ns,dr.isRegExp=ks,dr.isSafeInteger=function(e){return xs(e)&&e>=-j&&e<=j},dr.isSet=Ls,dr.isString=js,dr.isSymbol=Rs,dr.isTypedArray=Ps,dr.isUndefined=function(e){return e===o},dr.isWeakMap=function(e){return Os(e)&&Uo(e)==ae},dr.isWeakSet=function(e){return Os(e)&&Jr(e)==se},dr.join=function(e,t){return null==e?"":Bn.call(e,t)},dr.kebabCase=mu,dr.last=Ta,dr.lastIndexOf=function(e,t,n){var r=null==e?0:e.length;if(!r)return-1;var i=r;return n!==o&&(i=(i=Ws(n))<0?Vn(r+i,0):zn(i,r-1)),t==t?function(e,t,n){for(var r=n+1;r--;)if(e[r]===t)return r;return r}(e,t,i):sn(e,ln,i,!0)},dr.lowerCase=yu,dr.lowerFirst=_u,dr.lt=$s,dr.lte=Hs,dr.max=function(e){return e&&e.length?Ur(e,Iu,Zr):o},dr.maxBy=function(e,t){return e&&e.length?Ur(e,Po(t,2),Zr):o},dr.mean=function(e){return fn(e,Iu)},dr.meanBy=function(e,t){return fn(e,Po(t,2))},dr.min=function(e){return e&&e.length?Ur(e,Iu,fi):o},dr.minBy=function(e,t){return e&&e.length?Ur(e,Po(t,2),fi):o},dr.stubArray=Uu,dr.stubFalse=Bu,dr.stubObject=function(){return{}},dr.stubString=function(){return""},dr.stubTrue=function(){return!0},dr.multiply=Xu,dr.nth=function(e,t){return e&&e.length?gi(e,Ws(t)):o},dr.noConflict=function(){return Lt._===this&&(Lt._=vt),this},dr.noop=Ru,dr.now=Za,dr.pad=function(e,t,n){e=Vs(e);var r=(t=Ws(t))?Nn(e):0;if(!t||r>=t)return e;var i=(t-r)/2;return yo(Mn(i),n)+e+yo(Hn(i),n)},dr.padEnd=function(e,t,n){e=Vs(e);var r=(t=Ws(t))?Nn(e):0;return t&&r<t?e+yo(t-r,n):e},dr.padStart=function(e,t,n){e=Vs(e);var r=(t=Ws(t))?Nn(e):0;return t&&r<t?yo(t-r,n)+e:e},dr.parseInt=function(e,t,n){return n||null==t?t=0:t&&(t=+t),Kn(Vs(e).replace(Re,""),t||0)},dr.random=function(e,t,n){if(n&&"boolean"!=typeof n&&Go(e,t,n)&&(t=n=o),n===o&&("boolean"==typeof t?(n=t,t=o):"boolean"==typeof e&&(n=e,e=o)),e===o&&t===o?(e=0,t=1):(e=Fs(e),t===o?(t=e,e=0):t=Fs(t)),e>t){var r=e;e=t,t=r}if(n||e%1||t%1){var i=Xn();return zn(e+i*(t-e+Dt("1e-"+((i+"").length-1))),t)}return wi(e,t)},dr.reduce=function(e,t,n){var r=ms(e)?tn:hn,i=arguments.length<3;return r(e,Po(t,4),n,i,Mr)},dr.reduceRight=function(e,t,n){var r=ms(e)?nn:hn,i=arguments.length<3;return r(e,Po(t,4),n,i,Fr)},dr.repeat=function(e,t,n){return t=(n?Go(e,t,n):t===o)?1:Ws(t),Ei(Vs(e),t)},dr.replace=function(){var e=arguments,t=Vs(e[0]);return e.length<3?t:t.replace(e[1],e[2])},dr.result=function(e,t,n){var r=-1,i=(t=zi(t,e)).length;for(i||(i=1,e=o);++r<i;){var a=null==e?o:e[la(t[r])];a===o&&(r=i,a=n),e=Cs(a)?a.call(e):a}return e},dr.round=Qu,dr.runInContext=e,dr.sample=function(e){return(ms(e)?Cr:Ci)(e)},dr.size=function(e){if(null==e)return 0;if(_s(e))return js(e)?Nn(e):e.length;var t=Uo(e);return t==Q||t==ne?e.size:ci(e).length},dr.snakeCase=bu,dr.some=function(e,t,n){var r=ms(e)?rn:Ni;return n&&Go(e,t,n)&&(t=o),r(e,Po(t,3))},dr.sortedIndex=function(e,t){return ki(e,t)},dr.sortedIndexBy=function(e,t,n){return Li(e,t,Po(n,2))},dr.sortedIndexOf=function(e,t){var n=null==e?0:e.length;if(n){var r=ki(e,t);if(r<n&&ds(e[r],t))return r}return-1},dr.sortedLastIndex=function(e,t){return ki(e,t,!0)},dr.sortedLastIndexBy=function(e,t,n){return Li(e,t,Po(n,2),!0)},dr.sortedLastIndexOf=function(e,t){if(null!=e&&e.length){var n=ki(e,t,!0)-1;if(ds(e[n],t))return n}return-1},dr.startCase=wu,dr.startsWith=function(e,t,n){return e=Vs(e),n=null==n?0:jr(Ws(n),0,e.length),t=Pi(t),e.slice(n,n+t.length)==t},dr.subtract=Yu,dr.sum=function(e){return e&&e.length?vn(e,Iu):0},dr.sumBy=function(e,t){return e&&e.length?vn(e,Po(t,2)):0},dr.template=function(e,t,n){var r=dr.templateSettings;n&&Go(e,t,n)&&(t=o),e=Vs(e),t=Ks({},t,r,Ao);var i,a,s=Ks({},t.imports,r.imports,Ao),u=iu(s),c=yn(s,u),l=0,f=t.interpolate||Qe,p="__p += '",d=nt((t.escape||Qe).source+"|"+f.source+"|"+(f===Oe?Ue:Qe).source+"|"+(t.evaluate||Qe).source+"|$","g"),h="//# sourceURL="+("sourceURL"in t?t.sourceURL:"lodash.templateSources["+ ++xt+"]")+"\n";e.replace(d,function(t,n,r,o,s,u){return r||(r=o),p+=e.slice(l,u).replace(Ye,Cn),n&&(i=!0,p+="' +\n__e("+n+") +\n'"),s&&(a=!0,p+="';\n"+s+";\n__p += '"),r&&(p+="' +\n((__t = ("+r+")) == null ? '' : __t) +\n'"),l=u+t.length,t}),p+="';\n";var v=t.variable;v||(p="with (obj) {\n"+p+"\n}\n"),p=(a?p.replace(_e,""):p).replace(be,"$1").replace(we,"$1;"),p="function("+(v||"obj")+") {\n"+(v?"":"obj || (obj = {});\n")+"var __t, __p = ''"+(i?", __e = _.escape":"")+(a?", __j = Array.prototype.join;\nfunction print() { __p += __j.call(arguments, '') }\n":";\n")+p+"return __p\n}";var g=xu(function(){return Ze(u,h+"return "+p).apply(o,c)});if(g.source=p,Ts(g))throw g;return g},dr.times=function(e,t){if((e=Ws(e))<1||e>j)return[];var n=$,r=zn(e,$);t=Po(t),e-=$;for(var i=gn(r,t);++n<e;)t(n);return i},dr.toFinite=Fs,dr.toInteger=Ws,dr.toLength=Us,dr.toLower=function(e){return Vs(e).toLowerCase()},dr.toNumber=Bs,dr.toSafeInteger=function(e){return e?jr(Ws(e),-j,j):0===e?e:0},dr.toString=Vs,dr.toUpper=function(e){return Vs(e).toUpperCase()},dr.trim=function(e,t,n){if((e=Vs(e))&&(n||t===o))return e.replace(je,"");if(!e||!(t=Pi(t)))return e;var r=kn(e),i=kn(t);return Ki(r,bn(r,i),wn(r,i)+1).join("")},dr.trimEnd=function(e,t,n){if((e=Vs(e))&&(n||t===o))return e.replace(Pe,"");if(!e||!(t=Pi(t)))return e;var r=kn(e);return Ki(r,0,wn(r,kn(t))+1).join("")},dr.trimStart=function(e,t,n){if((e=Vs(e))&&(n||t===o))return e.replace(Re,"");if(!e||!(t=Pi(t)))return e;var r=kn(e);return Ki(r,bn(r,kn(t))).join("")},dr.truncate=function(e,t){var n=S,r=O;if(Ss(t)){var i="separator"in t?t.separator:i;n="length"in t?Ws(t.length):n,r="omission"in t?Pi(t.omission):r}var a=(e=Vs(e)).length;if(xn(e)){var s=kn(e);a=s.length}if(n>=a)return e;var u=n-Nn(r);if(u<1)return r;var c=s?Ki(s,0,u).join(""):e.slice(0,u);if(i===o)return c+r;if(s&&(u+=c.length-u),ks(i)){if(e.slice(u).search(i)){var l,f=c;for(i.global||(i=nt(i.source,Vs(Be.exec(i))+"g")),i.lastIndex=0;l=i.exec(f);)var p=l.index;c=c.slice(0,p===o?u:p)}}else if(e.indexOf(Pi(i),u)!=u){var d=c.lastIndexOf(i);d>-1&&(c=c.slice(0,d))}return c+r},dr.unescape=function(e){return(e=Vs(e))&&Ce.test(e)?e.replace(Ee,Ln):e},dr.uniqueId=function(e){var t=++ft;return Vs(e)+t},dr.upperCase=Eu,dr.upperFirst=Tu,dr.each=Va,dr.eachRight=za,dr.first=_a,ju(dr,(Ku={},Gr(dr,function(e,t){lt.call(dr.prototype,t)||(Ku[t]=e)}),Ku),{chain:!1}),dr.VERSION="4.17.11",Gt(["bind","bindKey","curry","curryRight","partial","partialRight"],function(e){dr[e].placeholder=dr}),Gt(["drop","take"],function(e,t){mr.prototype[e]=function(n){n=n===o?1:Vn(Ws(n),0);var r=this.__filtered__&&!t?new mr(this):this.clone();return r.__filtered__?r.__takeCount__=zn(n,r.__takeCount__):r.__views__.push({size:zn(n,$),type:e+(r.__dir__<0?"Right":"")}),r},mr.prototype[e+"Right"]=function(t){return this.reverse()[e](t).reverse()}}),Gt(["filter","map","takeWhile"],function(e,t){var n=t+1,r=n==N||3==n;mr.prototype[e]=function(e){var t=this.clone();return t.__iteratees__.push({iteratee:Po(e,3),type:n}),t.__filtered__=t.__filtered__||r,t}}),Gt(["head","last"],function(e,t){var n="take"+(t?"Right":"");mr.prototype[e]=function(){return this[n](1).value()[0]}}),Gt(["initial","tail"],function(e,t){var n="drop"+(t?"":"Right");mr.prototype[e]=function(){return this.__filtered__?new mr(this):this[n](1)}}),mr.prototype.compact=function(){return this.filter(Iu)},mr.prototype.find=function(e){return this.filter(e).head()},mr.prototype.findLast=function(e){return this.reverse().find(e)},mr.prototype.invokeMap=Ti(function(e,t){return"function"==typeof e?new mr(this):this.map(function(n){return ri(n,e,t)})}),mr.prototype.reject=function(e){return this.filter(us(Po(e)))},mr.prototype.slice=function(e,t){e=Ws(e);var n=this;return n.__filtered__&&(e>0||t<0)?new mr(n):(e<0?n=n.takeRight(-e):e&&(n=n.drop(e)),t!==o&&(n=(t=Ws(t))<0?n.dropRight(-t):n.take(t-e)),n)},mr.prototype.takeRightWhile=function(e){return this.reverse().takeWhile(e).reverse()},mr.prototype.toArray=function(){return this.take($)},Gr(mr.prototype,function(e,t){var n=/^(?:filter|find|map|reject)|While$/.test(t),r=/^(?:head|last)$/.test(t),i=dr[r?"take"+("last"==t?"Right":""):t],a=r||/^find/.test(t);i&&(dr.prototype[t]=function(){var t=this.__wrapped__,s=r?[1]:arguments,u=t instanceof mr,c=s[0],l=u||ms(t),f=function(e){var t=i.apply(dr,en([e],s));return r&&p?t[0]:t};l&&n&&"function"==typeof c&&1!=c.length&&(u=l=!1);var p=this.__chain__,d=!!this.__actions__.length,h=a&&!p,v=u&&!d;if(!a&&l){t=v?t:new mr(this);var g=e.apply(t,s);return g.__actions__.push({func:Fa,args:[f],thisArg:o}),new gr(g,p)}return h&&v?e.apply(this,s):(g=this.thru(f),h?r?g.value()[0]:g.value():g)})}),Gt(["pop","push","shift","sort","splice","unshift"],function(e){var t=ot[e],n=/^(?:push|sort|unshift)$/.test(e)?"tap":"thru",r=/^(?:pop|shift)$/.test(e);dr.prototype[e]=function(){var e=arguments;if(r&&!this.__chain__){var i=this.value();return t.apply(ms(i)?i:[],e)}return this[n](function(n){return t.apply(ms(n)?n:[],e)})}}),Gr(mr.prototype,function(e,t){var n=dr[t];if(n){var r=n.name+"";(ir[r]||(ir[r]=[])).push({name:t,func:n})}}),ir[ho(o,y).name]=[{name:"wrapper",func:o}],mr.prototype.clone=function(){var e=new mr(this.__wrapped__);return e.__actions__=no(this.__actions__),e.__dir__=this.__dir__,e.__filtered__=this.__filtered__,e.__iteratees__=no(this.__iteratees__),e.__takeCount__=this.__takeCount__,e.__views__=no(this.__views__),e},mr.prototype.reverse=function(){if(this.__filtered__){var e=new mr(this);e.__dir__=-1,e.__filtered__=!0}else(e=this.clone()).__dir__*=-1;return e},mr.prototype.value=function(){var e=this.__wrapped__.value(),t=this.__dir__,n=ms(e),r=t<0,i=n?e.length:0,o=function(e,t,n){for(var r=-1,i=n.length;++r<i;){var o=n[r],a=o.size;switch(o.type){case"drop":e+=a;break;case"dropRight":t-=a;break;case"take":t=zn(t,e+a);break;case"takeRight":e=Vn(e,t-a)}}return{start:e,end:t}}(0,i,this.__views__),a=o.start,s=o.end,u=s-a,c=r?s:a-1,l=this.__iteratees__,f=l.length,p=0,d=zn(u,this.__takeCount__);if(!n||!r&&i==u&&d==u)return Wi(e,this.__actions__);var h=[];e:for(;u--&&p<d;){for(var v=-1,g=e[c+=t];++v<f;){var m=l[v],y=m.iteratee,_=m.type,b=y(g);if(_==k)g=b;else if(!b){if(_==N)continue e;break e}}h[p++]=g}return h},dr.prototype.at=Wa,dr.prototype.chain=function(){return Ma(this)},dr.prototype.commit=function(){return new gr(this.value(),this.__chain__)},dr.prototype.next=function(){this.__values__===o&&(this.__values__=Ms(this.value()));var e=this.__index__>=this.__values__.length;return{done:e,value:e?o:this.__values__[this.__index__++]}},dr.prototype.plant=function(e){for(var t,n=this;n instanceof vr;){var r=pa(n);r.__index__=0,r.__values__=o,t?i.__wrapped__=r:t=r;var i=r;n=n.__wrapped__}return i.__wrapped__=e,t},dr.prototype.reverse=function(){var e=this.__wrapped__;if(e instanceof mr){var t=e;return this.__actions__.length&&(t=new mr(this)),(t=t.reverse()).__actions__.push({func:Fa,args:[Sa],thisArg:o}),new gr(t,this.__chain__)}return this.thru(Sa)},dr.prototype.toJSON=dr.prototype.valueOf=dr.prototype.value=function(){return Wi(this.__wrapped__,this.__actions__)},dr.prototype.first=dr.prototype.head,Ht&&(dr.prototype[Ht]=function(){return this}),dr}();Lt._=jn,(i=function(){return jn}.call(t,n,t,r))===o||(r.exports=i)}).call(this)}).call(this,n(1),n(15)(e))},function(e,t){e.exports=function(e){return e.webpackPolyfill||(e.deprecate=function(){},e.paths=[],e.children||(e.children=[]),Object.defineProperty(e,"loaded",{enumerable:!0,get:function(){return e.l}}),Object.defineProperty(e,"id",{enumerable:!0,get:function(){return e.i}}),e.webpackPolyfill=1),e}},function(e,t,n){!function(e,t,n){"use strict";function r(e,t){for(var n=0;n<t.length;n++){var r=t[n];r.enumerable=r.enumerable||!1,r.configurable=!0,"value"in r&&(r.writable=!0),Object.defineProperty(e,r.key,r)}}function i(e,t,n){return t&&r(e.prototype,t),n&&r(e,n),e}function o(e,t,n){return t in e?Object.defineProperty(e,t,{value:n,enumerable:!0,configurable:!0,writable:!0}):e[t]=n,e}function a(e){for(var t=1;t<arguments.length;t++){var n=null!=arguments[t]?arguments[t]:{},r=Object.keys(n);"function"==typeof Object.getOwnPropertySymbols&&(r=r.concat(Object.getOwnPropertySymbols(n).filter(function(e){return Object.getOwnPropertyDescriptor(n,e).enumerable}))),r.forEach(function(t){o(e,t,n[t])})}return e}t=t&&t.hasOwnProperty("default")?t.default:t,n=n&&n.hasOwnProperty("default")?n.default:n;var s="transitionend";function u(e){var t=this,r=!1;return n(this).one(c.TRANSITION_END,function(){r=!0}),setTimeout(function(){r||c.triggerTransitionEnd(t)},e),this}var c={TRANSITION_END:"bsTransitionEnd",getUID:function(e){do{e+=~~(1e6*Math.random())}while(document.getElementById(e));return e},getSelectorFromElement:function(e){var t=e.getAttribute("data-target");if(!t||"#"===t){var n=e.getAttribute("href");t=n&&"#"!==n?n.trim():""}return t&&document.querySelector(t)?t:null},getTransitionDurationFromElement:function(e){if(!e)return 0;var t=n(e).css("transition-duration"),r=n(e).css("transition-delay"),i=parseFloat(t),o=parseFloat(r);return i||o?(t=t.split(",")[0],r=r.split(",")[0],1e3*(parseFloat(t)+parseFloat(r))):0},reflow:function(e){return e.offsetHeight},triggerTransitionEnd:function(e){n(e).trigger(s)},supportsTransitionEnd:function(){return Boolean(s)},isElement:function(e){return(e[0]||e).nodeType},typeCheckConfig:function(e,t,n){for(var r in n)if(Object.prototype.hasOwnProperty.call(n,r)){var i=n[r],o=t[r],a=o&&c.isElement(o)?"element":(s=o,{}.toString.call(s).match(/\s([a-z]+)/i)[1].toLowerCase());if(!new RegExp(i).test(a))throw new Error(e.toUpperCase()+': Option "'+r+'" provided type "'+a+'" but expected type "'+i+'".')}var s},findShadowRoot:function(e){if(!document.documentElement.attachShadow)return null;if("function"==typeof e.getRootNode){var t=e.getRootNode();return t instanceof ShadowRoot?t:null}return e instanceof ShadowRoot?e:e.parentNode?c.findShadowRoot(e.parentNode):null}};n.fn.emulateTransitionEnd=u,n.event.special[c.TRANSITION_END]={bindType:s,delegateType:s,handle:function(e){if(n(e.target).is(this))return e.handleObj.handler.apply(this,arguments)}};var l=n.fn.alert,f={CLOSE:"close.bs.alert",CLOSED:"closed.bs.alert",CLICK_DATA_API:"click.bs.alert.data-api"},p={ALERT:"alert",FADE:"fade",SHOW:"show"},d=function(){function e(e){this._element=e}var t=e.prototype;return t.close=function(e){var t=this._element;e&&(t=this._getRootElement(e));var n=this._triggerCloseEvent(t);n.isDefaultPrevented()||this._removeElement(t)},t.dispose=function(){n.removeData(this._element,"bs.alert"),this._element=null},t._getRootElement=function(e){var t=c.getSelectorFromElement(e),r=!1;return t&&(r=document.querySelector(t)),r||(r=n(e).closest("."+p.ALERT)[0]),r},t._triggerCloseEvent=function(e){var t=n.Event(f.CLOSE);return n(e).trigger(t),t},t._removeElement=function(e){var t=this;if(n(e).removeClass(p.SHOW),n(e).hasClass(p.FADE)){var r=c.getTransitionDurationFromElement(e);n(e).one(c.TRANSITION_END,function(n){return t._destroyElement(e,n)}).emulateTransitionEnd(r)}else this._destroyElement(e)},t._destroyElement=function(e){n(e).detach().trigger(f.CLOSED).remove()},e._jQueryInterface=function(t){return this.each(function(){var r=n(this),i=r.data("bs.alert");i||(i=new e(this),r.data("bs.alert",i)),"close"===t&&i[t](this)})},e._handleDismiss=function(e){return function(t){t&&t.preventDefault(),e.close(this)}},i(e,null,[{key:"VERSION",get:function(){return"4.2.1"}}]),e}();n(document).on(f.CLICK_DATA_API,'[data-dismiss="alert"]',d._handleDismiss(new d)),n.fn.alert=d._jQueryInterface,n.fn.alert.Constructor=d,n.fn.alert.noConflict=function(){return n.fn.alert=l,d._jQueryInterface};var h=n.fn.button,v={ACTIVE:"active",BUTTON:"btn",FOCUS:"focus"},g={DATA_TOGGLE_CARROT:'[data-toggle^="button"]',DATA_TOGGLE:'[data-toggle="buttons"]',INPUT:'input:not([type="hidden"])',ACTIVE:".active",BUTTON:".btn"},m={CLICK_DATA_API:"click.bs.button.data-api",FOCUS_BLUR_DATA_API:"focus.bs.button.data-api blur.bs.button.data-api"},y=function(){function e(e){this._element=e}var t=e.prototype;return t.toggle=function(){var e=!0,t=!0,r=n(this._element).closest(g.DATA_TOGGLE)[0];if(r){var i=this._element.querySelector(g.INPUT);if(i){if("radio"===i.type)if(i.checked&&this._element.classList.contains(v.ACTIVE))e=!1;else{var o=r.querySelector(g.ACTIVE);o&&n(o).removeClass(v.ACTIVE)}if(e){if(i.hasAttribute("disabled")||r.hasAttribute("disabled")||i.classList.contains("disabled")||r.classList.contains("disabled"))return;i.checked=!this._element.classList.contains(v.ACTIVE),n(i).trigger("change")}i.focus(),t=!1}}t&&this._element.setAttribute("aria-pressed",!this._element.classList.contains(v.ACTIVE)),e&&n(this._element).toggleClass(v.ACTIVE)},t.dispose=function(){n.removeData(this._element,"bs.button"),this._element=null},e._jQueryInterface=function(t){return this.each(function(){var r=n(this).data("bs.button");r||(r=new e(this),n(this).data("bs.button",r)),"toggle"===t&&r[t]()})},i(e,null,[{key:"VERSION",get:function(){return"4.2.1"}}]),e}();n(document).on(m.CLICK_DATA_API,g.DATA_TOGGLE_CARROT,function(e){e.preventDefault();var t=e.target;n(t).hasClass(v.BUTTON)||(t=n(t).closest(g.BUTTON)),y._jQueryInterface.call(n(t),"toggle")}).on(m.FOCUS_BLUR_DATA_API,g.DATA_TOGGLE_CARROT,function(e){var t=n(e.target).closest(g.BUTTON)[0];n(t).toggleClass(v.FOCUS,/^focus(in)?$/.test(e.type))}),n.fn.button=y._jQueryInterface,n.fn.button.Constructor=y,n.fn.button.noConflict=function(){return n.fn.button=h,y._jQueryInterface};var _="carousel",b=".bs.carousel",w=n.fn[_],E={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0,touch:!0},T={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean",touch:"boolean"},C={NEXT:"next",PREV:"prev",LEFT:"left",RIGHT:"right"},x={SLIDE:"slide.bs.carousel",SLID:"slid.bs.carousel",KEYDOWN:"keydown.bs.carousel",MOUSEENTER:"mouseenter.bs.carousel",MOUSELEAVE:"mouseleave.bs.carousel",TOUCHSTART:"touchstart.bs.carousel",TOUCHMOVE:"touchmove.bs.carousel",TOUCHEND:"touchend.bs.carousel",POINTERDOWN:"pointerdown.bs.carousel",POINTERUP:"pointerup.bs.carousel",DRAG_START:"dragstart.bs.carousel",LOAD_DATA_API:"load.bs.carousel.data-api",CLICK_DATA_API:"click.bs.carousel.data-api"},A={CAROUSEL:"carousel",ACTIVE:"active",SLIDE:"slide",RIGHT:"carousel-item-right",LEFT:"carousel-item-left",NEXT:"carousel-item-next",PREV:"carousel-item-prev",ITEM:"carousel-item",POINTER_EVENT:"pointer-event"},S={ACTIVE:".active",ACTIVE_ITEM:".active.carousel-item",ITEM:".carousel-item",ITEM_IMG:".carousel-item img",NEXT_PREV:".carousel-item-next, .carousel-item-prev",INDICATORS:".carousel-indicators",DATA_SLIDE:"[data-slide], [data-slide-to]",DATA_RIDE:'[data-ride="carousel"]'},O={TOUCH:"touch",PEN:"pen"},D=function(){function e(e,t){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this.touchStartX=0,this.touchDeltaX=0,this._config=this._getConfig(t),this._element=e,this._indicatorsElement=this._element.querySelector(S.INDICATORS),this._touchSupported="ontouchstart"in document.documentElement||navigator.maxTouchPoints>0,this._pointerEvent=Boolean(window.PointerEvent||window.MSPointerEvent),this._addEventListeners()}var t=e.prototype;return t.next=function(){this._isSliding||this._slide(C.NEXT)},t.nextWhenVisible=function(){!document.hidden&&n(this._element).is(":visible")&&"hidden"!==n(this._element).css("visibility")&&this.next()},t.prev=function(){this._isSliding||this._slide(C.PREV)},t.pause=function(e){e||(this._isPaused=!0),this._element.querySelector(S.NEXT_PREV)&&(c.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},t.cycle=function(e){e||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},t.to=function(e){var t=this;this._activeElement=this._element.querySelector(S.ACTIVE_ITEM);var r=this._getItemIndex(this._activeElement);if(!(e>this._items.length-1||e<0))if(this._isSliding)n(this._element).one(x.SLID,function(){return t.to(e)});else{if(r===e)return this.pause(),void this.cycle();var i=e>r?C.NEXT:C.PREV;this._slide(i,this._items[e])}},t.dispose=function(){n(this._element).off(b),n.removeData(this._element,"bs.carousel"),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},t._getConfig=function(e){return e=a({},E,e),c.typeCheckConfig(_,e,T),e},t._handleSwipe=function(){var e=Math.abs(this.touchDeltaX);if(!(e<=40)){var t=e/this.touchDeltaX;t>0&&this.prev(),t<0&&this.next()}},t._addEventListeners=function(){var e=this;this._config.keyboard&&n(this._element).on(x.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&n(this._element).on(x.MOUSEENTER,function(t){return e.pause(t)}).on(x.MOUSELEAVE,function(t){return e.cycle(t)}),this._addTouchEventListeners()},t._addTouchEventListeners=function(){var e=this;if(this._touchSupported){var t=function(t){e._pointerEvent&&O[t.originalEvent.pointerType.toUpperCase()]?e.touchStartX=t.originalEvent.clientX:e._pointerEvent||(e.touchStartX=t.originalEvent.touches[0].clientX)},r=function(t){e._pointerEvent&&O[t.originalEvent.pointerType.toUpperCase()]&&(e.touchDeltaX=t.originalEvent.clientX-e.touchStartX),e._handleSwipe(),"hover"===e._config.pause&&(e.pause(),e.touchTimeout&&clearTimeout(e.touchTimeout),e.touchTimeout=setTimeout(function(t){return e.cycle(t)},500+e._config.interval))};n(this._element.querySelectorAll(S.ITEM_IMG)).on(x.DRAG_START,function(e){return e.preventDefault()}),this._pointerEvent?(n(this._element).on(x.POINTERDOWN,function(e){return t(e)}),n(this._element).on(x.POINTERUP,function(e){return r(e)}),this._element.classList.add(A.POINTER_EVENT)):(n(this._element).on(x.TOUCHSTART,function(e){return t(e)}),n(this._element).on(x.TOUCHMOVE,function(t){return function(t){t.originalEvent.touches&&t.originalEvent.touches.length>1?e.touchDeltaX=0:e.touchDeltaX=t.originalEvent.touches[0].clientX-e.touchStartX}(t)}),n(this._element).on(x.TOUCHEND,function(e){return r(e)}))}},t._keydown=function(e){if(!/input|textarea/i.test(e.target.tagName))switch(e.which){case 37:e.preventDefault(),this.prev();break;case 39:e.preventDefault(),this.next()}},t._getItemIndex=function(e){return this._items=e&&e.parentNode?[].slice.call(e.parentNode.querySelectorAll(S.ITEM)):[],this._items.indexOf(e)},t._getItemByDirection=function(e,t){var n=e===C.NEXT,r=e===C.PREV,i=this._getItemIndex(t),o=this._items.length-1,a=r&&0===i||n&&i===o;if(a&&!this._config.wrap)return t;var s=e===C.PREV?-1:1,u=(i+s)%this._items.length;return-1===u?this._items[this._items.length-1]:this._items[u]},t._triggerSlideEvent=function(e,t){var r=this._getItemIndex(e),i=this._getItemIndex(this._element.querySelector(S.ACTIVE_ITEM)),o=n.Event(x.SLIDE,{relatedTarget:e,direction:t,from:i,to:r});return n(this._element).trigger(o),o},t._setActiveIndicatorElement=function(e){if(this._indicatorsElement){var t=[].slice.call(this._indicatorsElement.querySelectorAll(S.ACTIVE));n(t).removeClass(A.ACTIVE);var r=this._indicatorsElement.children[this._getItemIndex(e)];r&&n(r).addClass(A.ACTIVE)}},t._slide=function(e,t){var r,i,o,a=this,s=this._element.querySelector(S.ACTIVE_ITEM),u=this._getItemIndex(s),l=t||s&&this._getItemByDirection(e,s),f=this._getItemIndex(l),p=Boolean(this._interval);if(e===C.NEXT?(r=A.LEFT,i=A.NEXT,o=C.LEFT):(r=A.RIGHT,i=A.PREV,o=C.RIGHT),l&&n(l).hasClass(A.ACTIVE))this._isSliding=!1;else{var d=this._triggerSlideEvent(l,o);if(!d.isDefaultPrevented()&&s&&l){this._isSliding=!0,p&&this.pause(),this._setActiveIndicatorElement(l);var h=n.Event(x.SLID,{relatedTarget:l,direction:o,from:u,to:f});if(n(this._element).hasClass(A.SLIDE)){n(l).addClass(i),c.reflow(l),n(s).addClass(r),n(l).addClass(r);var v=parseInt(l.getAttribute("data-interval"),10);v?(this._config.defaultInterval=this._config.defaultInterval||this._config.interval,this._config.interval=v):this._config.interval=this._config.defaultInterval||this._config.interval;var g=c.getTransitionDurationFromElement(s);n(s).one(c.TRANSITION_END,function(){n(l).removeClass(r+" "+i).addClass(A.ACTIVE),n(s).removeClass(A.ACTIVE+" "+i+" "+r),a._isSliding=!1,setTimeout(function(){return n(a._element).trigger(h)},0)}).emulateTransitionEnd(g)}else n(s).removeClass(A.ACTIVE),n(l).addClass(A.ACTIVE),this._isSliding=!1,n(this._element).trigger(h);p&&this.cycle()}}},e._jQueryInterface=function(t){return this.each(function(){var r=n(this).data("bs.carousel"),i=a({},E,n(this).data());"object"==typeof t&&(i=a({},i,t));var o="string"==typeof t?t:i.slide;if(r||(r=new e(this,i),n(this).data("bs.carousel",r)),"number"==typeof t)r.to(t);else if("string"==typeof o){if(void 0===r[o])throw new TypeError('No method named "'+o+'"');r[o]()}else i.interval&&(r.pause(),r.cycle())})},e._dataApiClickHandler=function(t){var r=c.getSelectorFromElement(this);if(r){var i=n(r)[0];if(i&&n(i).hasClass(A.CAROUSEL)){var o=a({},n(i).data(),n(this).data()),s=this.getAttribute("data-slide-to");s&&(o.interval=!1),e._jQueryInterface.call(n(i),o),s&&n(i).data("bs.carousel").to(s),t.preventDefault()}}},i(e,null,[{key:"VERSION",get:function(){return"4.2.1"}},{key:"Default",get:function(){return E}}]),e}();n(document).on(x.CLICK_DATA_API,S.DATA_SLIDE,D._dataApiClickHandler),n(window).on(x.LOAD_DATA_API,function(){for(var e=[].slice.call(document.querySelectorAll(S.DATA_RIDE)),t=0,r=e.length;t<r;t++){var i=n(e[t]);D._jQueryInterface.call(i,i.data())}}),n.fn[_]=D._jQueryInterface,n.fn[_].Constructor=D,n.fn[_].noConflict=function(){return n.fn[_]=w,D._jQueryInterface};var I="collapse",N=n.fn[I],k={toggle:!0,parent:""},L={toggle:"boolean",parent:"(string|element)"},j={SHOW:"show.bs.collapse",SHOWN:"shown.bs.collapse",HIDE:"hide.bs.collapse",HIDDEN:"hidden.bs.collapse",CLICK_DATA_API:"click.bs.collapse.data-api"},R={SHOW:"show",COLLAPSE:"collapse",COLLAPSING:"collapsing",COLLAPSED:"collapsed"},P={WIDTH:"width",HEIGHT:"height"},$={ACTIVES:".show, .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},H=function(){function e(e,t){this._isTransitioning=!1,this._element=e,this._config=this._getConfig(t),this._triggerArray=[].slice.call(document.querySelectorAll('[data-toggle="collapse"][href="#'+e.id+'"],[data-toggle="collapse"][data-target="#'+e.id+'"]'));for(var n=[].slice.call(document.querySelectorAll($.DATA_TOGGLE)),r=0,i=n.length;r<i;r++){var o=n[r],a=c.getSelectorFromElement(o),s=[].slice.call(document.querySelectorAll(a)).filter(function(t){return t===e});null!==a&&s.length>0&&(this._selector=a,this._triggerArray.push(o))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var t=e.prototype;return t.toggle=function(){n(this._element).hasClass(R.SHOW)?this.hide():this.show()},t.show=function(){var t,r,i=this;if(!(this._isTransitioning||n(this._element).hasClass(R.SHOW)||(this._parent&&0===(t=[].slice.call(this._parent.querySelectorAll($.ACTIVES)).filter(function(e){return"string"==typeof i._config.parent?e.getAttribute("data-parent")===i._config.parent:e.classList.contains(R.COLLAPSE)})).length&&(t=null),t&&(r=n(t).not(this._selector).data("bs.collapse"))&&r._isTransitioning))){var o=n.Event(j.SHOW);if(n(this._element).trigger(o),!o.isDefaultPrevented()){t&&(e._jQueryInterface.call(n(t).not(this._selector),"hide"),r||n(t).data("bs.collapse",null));var a=this._getDimension();n(this._element).removeClass(R.COLLAPSE).addClass(R.COLLAPSING),this._element.style[a]=0,this._triggerArray.length&&n(this._triggerArray).removeClass(R.COLLAPSED).attr("aria-expanded",!0),this.setTransitioning(!0);var s=a[0].toUpperCase()+a.slice(1),u="scroll"+s,l=c.getTransitionDurationFromElement(this._element);n(this._element).one(c.TRANSITION_END,function(){n(i._element).removeClass(R.COLLAPSING).addClass(R.COLLAPSE).addClass(R.SHOW),i._element.style[a]="",i.setTransitioning(!1),n(i._element).trigger(j.SHOWN)}).emulateTransitionEnd(l),this._element.style[a]=this._element[u]+"px"}}},t.hide=function(){var e=this;if(!this._isTransitioning&&n(this._element).hasClass(R.SHOW)){var t=n.Event(j.HIDE);if(n(this._element).trigger(t),!t.isDefaultPrevented()){var r=this._getDimension();this._element.style[r]=this._element.getBoundingClientRect()[r]+"px",c.reflow(this._element),n(this._element).addClass(R.COLLAPSING).removeClass(R.COLLAPSE).removeClass(R.SHOW);var i=this._triggerArray.length;if(i>0)for(var o=0;o<i;o++){var a=this._triggerArray[o],s=c.getSelectorFromElement(a);if(null!==s){var u=n([].slice.call(document.querySelectorAll(s)));u.hasClass(R.SHOW)||n(a).addClass(R.COLLAPSED).attr("aria-expanded",!1)}}this.setTransitioning(!0),this._element.style[r]="";var l=c.getTransitionDurationFromElement(this._element);n(this._element).one(c.TRANSITION_END,function(){e.setTransitioning(!1),n(e._element).removeClass(R.COLLAPSING).addClass(R.COLLAPSE).trigger(j.HIDDEN)}).emulateTransitionEnd(l)}}},t.setTransitioning=function(e){this._isTransitioning=e},t.dispose=function(){n.removeData(this._element,"bs.collapse"),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},t._getConfig=function(e){return(e=a({},k,e)).toggle=Boolean(e.toggle),c.typeCheckConfig(I,e,L),e},t._getDimension=function(){var e=n(this._element).hasClass(P.WIDTH);return e?P.WIDTH:P.HEIGHT},t._getParent=function(){var t,r=this;c.isElement(this._config.parent)?(t=this._config.parent,void 0!==this._config.parent.jquery&&(t=this._config.parent[0])):t=document.querySelector(this._config.parent);var i='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]',o=[].slice.call(t.querySelectorAll(i));return n(o).each(function(t,n){r._addAriaAndCollapsedClass(e._getTargetFromElement(n),[n])}),t},t._addAriaAndCollapsedClass=function(e,t){var r=n(e).hasClass(R.SHOW);t.length&&n(t).toggleClass(R.COLLAPSED,!r).attr("aria-expanded",r)},e._getTargetFromElement=function(e){var t=c.getSelectorFromElement(e);return t?document.querySelector(t):null},e._jQueryInterface=function(t){return this.each(function(){var r=n(this),i=r.data("bs.collapse"),o=a({},k,r.data(),"object"==typeof t&&t?t:{});if(!i&&o.toggle&&/show|hide/.test(t)&&(o.toggle=!1),i||(i=new e(this,o),r.data("bs.collapse",i)),"string"==typeof t){if(void 0===i[t])throw new TypeError('No method named "'+t+'"');i[t]()}})},i(e,null,[{key:"VERSION",get:function(){return"4.2.1"}},{key:"Default",get:function(){return k}}]),e}();n(document).on(j.CLICK_DATA_API,$.DATA_TOGGLE,function(e){"A"===e.currentTarget.tagName&&e.preventDefault();var t=n(this),r=c.getSelectorFromElement(this),i=[].slice.call(document.querySelectorAll(r));n(i).each(function(){var e=n(this),r=e.data("bs.collapse"),i=r?"toggle":t.data();H._jQueryInterface.call(e,i)})}),n.fn[I]=H._jQueryInterface,n.fn[I].Constructor=H,n.fn[I].noConflict=function(){return n.fn[I]=N,H._jQueryInterface};var M="dropdown",F=n.fn[M],W=new RegExp("38|40|27"),U={HIDE:"hide.bs.dropdown",HIDDEN:"hidden.bs.dropdown",SHOW:"show.bs.dropdown",SHOWN:"shown.bs.dropdown",CLICK:"click.bs.dropdown",CLICK_DATA_API:"click.bs.dropdown.data-api",KEYDOWN_DATA_API:"keydown.bs.dropdown.data-api",KEYUP_DATA_API:"keyup.bs.dropdown.data-api"},B={DISABLED:"disabled",SHOW:"show",DROPUP:"dropup",DROPRIGHT:"dropright",DROPLEFT:"dropleft",MENURIGHT:"dropdown-menu-right",MENULEFT:"dropdown-menu-left",POSITION_STATIC:"position-static"},q={DATA_TOGGLE:'[data-toggle="dropdown"]',FORM_CHILD:".dropdown form",MENU:".dropdown-menu",NAVBAR_NAV:".navbar-nav",VISIBLE_ITEMS:".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)"},V={TOP:"top-start",TOPEND:"top-end",BOTTOM:"bottom-start",BOTTOMEND:"bottom-end",RIGHT:"right-start",RIGHTEND:"right-end",LEFT:"left-start",LEFTEND:"left-end"},z={offset:0,flip:!0,boundary:"scrollParent",reference:"toggle",display:"dynamic"},G={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)",reference:"(string|element)",display:"string"},K=function(){function e(e,t){this._element=e,this._popper=null,this._config=this._getConfig(t),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var r=e.prototype;return r.toggle=function(){if(!this._element.disabled&&!n(this._element).hasClass(B.DISABLED)){var r=e._getParentFromElement(this._element),i=n(this._menu).hasClass(B.SHOW);if(e._clearMenus(),!i){var o={relatedTarget:this._element},a=n.Event(U.SHOW,o);if(n(r).trigger(a),!a.isDefaultPrevented()){if(!this._inNavbar){if(void 0===t)throw new TypeError("Bootstrap's dropdowns require Popper.js (https://popper.js.org/)");var s=this._element;"parent"===this._config.reference?s=r:c.isElement(this._config.reference)&&(s=this._config.reference,void 0!==this._config.reference.jquery&&(s=this._config.reference[0])),"scrollParent"!==this._config.boundary&&n(r).addClass(B.POSITION_STATIC),this._popper=new t(s,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===n(r).closest(q.NAVBAR_NAV).length&&n(document.body).children().on("mouseover",null,n.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),n(this._menu).toggleClass(B.SHOW),n(r).toggleClass(B.SHOW).trigger(n.Event(U.SHOWN,o))}}}},r.show=function(){if(!(this._element.disabled||n(this._element).hasClass(B.DISABLED)||n(this._menu).hasClass(B.SHOW))){var t={relatedTarget:this._element},r=n.Event(U.SHOW,t),i=e._getParentFromElement(this._element);n(i).trigger(r),r.isDefaultPrevented()||(n(this._menu).toggleClass(B.SHOW),n(i).toggleClass(B.SHOW).trigger(n.Event(U.SHOWN,t)))}},r.hide=function(){if(!this._element.disabled&&!n(this._element).hasClass(B.DISABLED)&&n(this._menu).hasClass(B.SHOW)){var t={relatedTarget:this._element},r=n.Event(U.HIDE,t),i=e._getParentFromElement(this._element);n(i).trigger(r),r.isDefaultPrevented()||(n(this._menu).toggleClass(B.SHOW),n(i).toggleClass(B.SHOW).trigger(n.Event(U.HIDDEN,t)))}},r.dispose=function(){n.removeData(this._element,"bs.dropdown"),n(this._element).off(".bs.dropdown"),this._element=null,this._menu=null,null!==this._popper&&(this._popper.destroy(),this._popper=null)},r.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},r._addEventListeners=function(){var e=this;n(this._element).on(U.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},r._getConfig=function(e){return e=a({},this.constructor.Default,n(this._element).data(),e),c.typeCheckConfig(M,e,this.constructor.DefaultType),e},r._getMenuElement=function(){if(!this._menu){var t=e._getParentFromElement(this._element);t&&(this._menu=t.querySelector(q.MENU))}return this._menu},r._getPlacement=function(){var e=n(this._element.parentNode),t=V.BOTTOM;return e.hasClass(B.DROPUP)?(t=V.TOP,n(this._menu).hasClass(B.MENURIGHT)&&(t=V.TOPEND)):e.hasClass(B.DROPRIGHT)?t=V.RIGHT:e.hasClass(B.DROPLEFT)?t=V.LEFT:n(this._menu).hasClass(B.MENURIGHT)&&(t=V.BOTTOMEND),t},r._detectNavbar=function(){return n(this._element).closest(".navbar").length>0},r._getPopperConfig=function(){var e=this,t={};"function"==typeof this._config.offset?t.fn=function(t){return t.offsets=a({},t.offsets,e._config.offset(t.offsets)||{}),t}:t.offset=this._config.offset;var n={placement:this._getPlacement(),modifiers:{offset:t,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}};return"static"===this._config.display&&(n.modifiers.applyStyle={enabled:!1}),n},e._jQueryInterface=function(t){return this.each(function(){var r=n(this).data("bs.dropdown"),i="object"==typeof t?t:null;if(r||(r=new e(this,i),n(this).data("bs.dropdown",r)),"string"==typeof t){if(void 0===r[t])throw new TypeError('No method named "'+t+'"');r[t]()}})},e._clearMenus=function(t){if(!t||3!==t.which&&("keyup"!==t.type||9===t.which))for(var r=[].slice.call(document.querySelectorAll(q.DATA_TOGGLE)),i=0,o=r.length;i<o;i++){var a=e._getParentFromElement(r[i]),s=n(r[i]).data("bs.dropdown"),u={relatedTarget:r[i]};if(t&&"click"===t.type&&(u.clickEvent=t),s){var c=s._menu;if(n(a).hasClass(B.SHOW)&&!(t&&("click"===t.type&&/input|textarea/i.test(t.target.tagName)||"keyup"===t.type&&9===t.which)&&n.contains(a,t.target))){var l=n.Event(U.HIDE,u);n(a).trigger(l),l.isDefaultPrevented()||("ontouchstart"in document.documentElement&&n(document.body).children().off("mouseover",null,n.noop),r[i].setAttribute("aria-expanded","false"),n(c).removeClass(B.SHOW),n(a).removeClass(B.SHOW).trigger(n.Event(U.HIDDEN,u)))}}}},e._getParentFromElement=function(e){var t,n=c.getSelectorFromElement(e);return n&&(t=document.querySelector(n)),t||e.parentNode},e._dataApiKeydownHandler=function(t){if((/input|textarea/i.test(t.target.tagName)?!(32===t.which||27!==t.which&&(40!==t.which&&38!==t.which||n(t.target).closest(q.MENU).length)):W.test(t.which))&&(t.preventDefault(),t.stopPropagation(),!this.disabled&&!n(this).hasClass(B.DISABLED))){var r=e._getParentFromElement(this),i=n(r).hasClass(B.SHOW);if(i&&(!i||27!==t.which&&32!==t.which)){var o=[].slice.call(r.querySelectorAll(q.VISIBLE_ITEMS));if(0!==o.length){var a=o.indexOf(t.target);38===t.which&&a>0&&a--,40===t.which&&a<o.length-1&&a++,a<0&&(a=0),o[a].focus()}}else{if(27===t.which){var s=r.querySelector(q.DATA_TOGGLE);n(s).trigger("focus")}n(this).trigger("click")}}},i(e,null,[{key:"VERSION",get:function(){return"4.2.1"}},{key:"Default",get:function(){return z}},{key:"DefaultType",get:function(){return G}}]),e}();n(document).on(U.KEYDOWN_DATA_API,q.DATA_TOGGLE,K._dataApiKeydownHandler).on(U.KEYDOWN_DATA_API,q.MENU,K._dataApiKeydownHandler).on(U.CLICK_DATA_API+" "+U.KEYUP_DATA_API,K._clearMenus).on(U.CLICK_DATA_API,q.DATA_TOGGLE,function(e){e.preventDefault(),e.stopPropagation(),K._jQueryInterface.call(n(this),"toggle")}).on(U.CLICK_DATA_API,q.FORM_CHILD,function(e){e.stopPropagation()}),n.fn[M]=K._jQueryInterface,n.fn[M].Constructor=K,n.fn[M].noConflict=function(){return n.fn[M]=F,K._jQueryInterface};var X=n.fn.modal,Q={backdrop:!0,keyboard:!0,focus:!0,show:!0},Y={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},J={HIDE:"hide.bs.modal",HIDDEN:"hidden.bs.modal",SHOW:"show.bs.modal",SHOWN:"shown.bs.modal",FOCUSIN:"focusin.bs.modal",RESIZE:"resize.bs.modal",CLICK_DISMISS:"click.dismiss.bs.modal",KEYDOWN_DISMISS:"keydown.dismiss.bs.modal",MOUSEUP_DISMISS:"mouseup.dismiss.bs.modal",MOUSEDOWN_DISMISS:"mousedown.dismiss.bs.modal",CLICK_DATA_API:"click.bs.modal.data-api"},Z={SCROLLBAR_MEASURER:"modal-scrollbar-measure",BACKDROP:"modal-backdrop",OPEN:"modal-open",FADE:"fade",SHOW:"show"},ee={DIALOG:".modal-dialog",DATA_TOGGLE:'[data-toggle="modal"]',DATA_DISMISS:'[data-dismiss="modal"]',FIXED_CONTENT:".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",STICKY_CONTENT:".sticky-top"},te=function(){function e(e,t){this._config=this._getConfig(t),this._element=e,this._dialog=e.querySelector(ee.DIALOG),this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._isTransitioning=!1,this._scrollbarWidth=0}var t=e.prototype;return t.toggle=function(e){return this._isShown?this.hide():this.show(e)},t.show=function(e){var t=this;if(!this._isShown&&!this._isTransitioning){n(this._element).hasClass(Z.FADE)&&(this._isTransitioning=!0);var r=n.Event(J.SHOW,{relatedTarget:e});n(this._element).trigger(r),this._isShown||r.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),this._setEscapeEvent(),this._setResizeEvent(),n(this._element).on(J.CLICK_DISMISS,ee.DATA_DISMISS,function(e){return t.hide(e)}),n(this._dialog).on(J.MOUSEDOWN_DISMISS,function(){n(t._element).one(J.MOUSEUP_DISMISS,function(e){n(e.target).is(t._element)&&(t._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return t._showElement(e)}))}},t.hide=function(e){var t=this;if(e&&e.preventDefault(),this._isShown&&!this._isTransitioning){var r=n.Event(J.HIDE);if(n(this._element).trigger(r),this._isShown&&!r.isDefaultPrevented()){this._isShown=!1;var i=n(this._element).hasClass(Z.FADE);if(i&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),n(document).off(J.FOCUSIN),n(this._element).removeClass(Z.SHOW),n(this._element).off(J.CLICK_DISMISS),n(this._dialog).off(J.MOUSEDOWN_DISMISS),i){var o=c.getTransitionDurationFromElement(this._element);n(this._element).one(c.TRANSITION_END,function(e){return t._hideModal(e)}).emulateTransitionEnd(o)}else this._hideModal()}}},t.dispose=function(){[window,this._element,this._dialog].forEach(function(e){return n(e).off(".bs.modal")}),n(document).off(J.FOCUSIN),n.removeData(this._element,"bs.modal"),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._isTransitioning=null,this._scrollbarWidth=null},t.handleUpdate=function(){this._adjustDialog()},t._getConfig=function(e){return e=a({},Q,e),c.typeCheckConfig("modal",e,Y),e},t._showElement=function(e){var t=this,r=n(this._element).hasClass(Z.FADE);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),this._element.scrollTop=0,r&&c.reflow(this._element),n(this._element).addClass(Z.SHOW),this._config.focus&&this._enforceFocus();var i=n.Event(J.SHOWN,{relatedTarget:e}),o=function(){t._config.focus&&t._element.focus(),t._isTransitioning=!1,n(t._element).trigger(i)};if(r){var a=c.getTransitionDurationFromElement(this._dialog);n(this._dialog).one(c.TRANSITION_END,o).emulateTransitionEnd(a)}else o()},t._enforceFocus=function(){var e=this;n(document).off(J.FOCUSIN).on(J.FOCUSIN,function(t){document!==t.target&&e._element!==t.target&&0===n(e._element).has(t.target).length&&e._element.focus()})},t._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?n(this._element).on(J.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown||n(this._element).off(J.KEYDOWN_DISMISS)},t._setResizeEvent=function(){var e=this;this._isShown?n(window).on(J.RESIZE,function(t){return e.handleUpdate(t)}):n(window).off(J.RESIZE)},t._hideModal=function(){var e=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._isTransitioning=!1,this._showBackdrop(function(){n(document.body).removeClass(Z.OPEN),e._resetAdjustments(),e._resetScrollbar(),n(e._element).trigger(J.HIDDEN)})},t._removeBackdrop=function(){this._backdrop&&(n(this._backdrop).remove(),this._backdrop=null)},t._showBackdrop=function(e){var t=this,r=n(this._element).hasClass(Z.FADE)?Z.FADE:"";if(this._isShown&&this._config.backdrop){if(this._backdrop=document.createElement("div"),this._backdrop.className=Z.BACKDROP,r&&this._backdrop.classList.add(r),n(this._backdrop).appendTo(document.body),n(this._element).on(J.CLICK_DISMISS,function(e){t._ignoreBackdropClick?t._ignoreBackdropClick=!1:e.target===e.currentTarget&&("static"===t._config.backdrop?t._element.focus():t.hide())}),r&&c.reflow(this._backdrop),n(this._backdrop).addClass(Z.SHOW),!e)return;if(!r)return void e();var i=c.getTransitionDurationFromElement(this._backdrop);n(this._backdrop).one(c.TRANSITION_END,e).emulateTransitionEnd(i)}else if(!this._isShown&&this._backdrop){n(this._backdrop).removeClass(Z.SHOW);var o=function(){t._removeBackdrop(),e&&e()};if(n(this._element).hasClass(Z.FADE)){var a=c.getTransitionDurationFromElement(this._backdrop);n(this._backdrop).one(c.TRANSITION_END,o).emulateTransitionEnd(a)}else o()}else e&&e()},t._adjustDialog=function(){var e=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&e&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!e&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},t._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},t._checkScrollbar=function(){var e=document.body.getBoundingClientRect();this._isBodyOverflowing=e.left+e.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},t._setScrollbar=function(){var e=this;if(this._isBodyOverflowing){var t=[].slice.call(document.querySelectorAll(ee.FIXED_CONTENT)),r=[].slice.call(document.querySelectorAll(ee.STICKY_CONTENT));n(t).each(function(t,r){var i=r.style.paddingRight,o=n(r).css("padding-right");n(r).data("padding-right",i).css("padding-right",parseFloat(o)+e._scrollbarWidth+"px")}),n(r).each(function(t,r){var i=r.style.marginRight,o=n(r).css("margin-right");n(r).data("margin-right",i).css("margin-right",parseFloat(o)-e._scrollbarWidth+"px")});var i=document.body.style.paddingRight,o=n(document.body).css("padding-right");n(document.body).data("padding-right",i).css("padding-right",parseFloat(o)+this._scrollbarWidth+"px")}n(document.body).addClass(Z.OPEN)},t._resetScrollbar=function(){var e=[].slice.call(document.querySelectorAll(ee.FIXED_CONTENT));n(e).each(function(e,t){var r=n(t).data("padding-right");n(t).removeData("padding-right"),t.style.paddingRight=r||""});var t=[].slice.call(document.querySelectorAll(""+ee.STICKY_CONTENT));n(t).each(function(e,t){var r=n(t).data("margin-right");void 0!==r&&n(t).css("margin-right",r).removeData("margin-right")});var r=n(document.body).data("padding-right");n(document.body).removeData("padding-right"),document.body.style.paddingRight=r||""},t._getScrollbarWidth=function(){var e=document.createElement("div");e.className=Z.SCROLLBAR_MEASURER,document.body.appendChild(e);var t=e.getBoundingClientRect().width-e.clientWidth;return document.body.removeChild(e),t},e._jQueryInterface=function(t,r){return this.each(function(){var i=n(this).data("bs.modal"),o=a({},Q,n(this).data(),"object"==typeof t&&t?t:{});if(i||(i=new e(this,o),n(this).data("bs.modal",i)),"string"==typeof t){if(void 0===i[t])throw new TypeError('No method named "'+t+'"');i[t](r)}else o.show&&i.show(r)})},i(e,null,[{key:"VERSION",get:function(){return"4.2.1"}},{key:"Default",get:function(){return Q}}]),e}();n(document).on(J.CLICK_DATA_API,ee.DATA_TOGGLE,function(e){var t,r=this,i=c.getSelectorFromElement(this);i&&(t=document.querySelector(i));var o=n(t).data("bs.modal")?"toggle":a({},n(t).data(),n(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||e.preventDefault();var s=n(t).one(J.SHOW,function(e){e.isDefaultPrevented()||s.one(J.HIDDEN,function(){n(r).is(":visible")&&r.focus()})});te._jQueryInterface.call(n(t),o,this)}),n.fn.modal=te._jQueryInterface,n.fn.modal.Constructor=te,n.fn.modal.noConflict=function(){return n.fn.modal=X,te._jQueryInterface};var ne="tooltip",re=n.fn.tooltip,ie=new RegExp("(^|\\s)bs-tooltip\\S+","g"),oe={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)"},ae={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"},se={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,selector:!1,placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},ue={SHOW:"show",OUT:"out"},ce={HIDE:"hide.bs.tooltip",HIDDEN:"hidden.bs.tooltip",SHOW:"show.bs.tooltip",SHOWN:"shown.bs.tooltip",INSERTED:"inserted.bs.tooltip",CLICK:"click.bs.tooltip",FOCUSIN:"focusin.bs.tooltip",FOCUSOUT:"focusout.bs.tooltip",MOUSEENTER:"mouseenter.bs.tooltip",MOUSELEAVE:"mouseleave.bs.tooltip"},le={FADE:"fade",SHOW:"show"},fe={TOOLTIP:".tooltip",TOOLTIP_INNER:".tooltip-inner",ARROW:".arrow"},pe={HOVER:"hover",FOCUS:"focus",CLICK:"click",MANUAL:"manual"},de=function(){function e(e,n){if(void 0===t)throw new TypeError("Bootstrap's tooltips require Popper.js (https://popper.js.org/)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=e,this.config=this._getConfig(n),this.tip=null,this._setListeners()}var r=e.prototype;return r.enable=function(){this._isEnabled=!0},r.disable=function(){this._isEnabled=!1},r.toggleEnabled=function(){this._isEnabled=!this._isEnabled},r.toggle=function(e){if(this._isEnabled)if(e){var t=this.constructor.DATA_KEY,r=n(e.currentTarget).data(t);r||(r=new this.constructor(e.currentTarget,this._getDelegateConfig()),n(e.currentTarget).data(t,r)),r._activeTrigger.click=!r._activeTrigger.click,r._isWithActiveTrigger()?r._enter(null,r):r._leave(null,r)}else{if(n(this.getTipElement()).hasClass(le.SHOW))return void this._leave(null,this);this._enter(null,this)}},r.dispose=function(){clearTimeout(this._timeout),n.removeData(this.element,this.constructor.DATA_KEY),n(this.element).off(this.constructor.EVENT_KEY),n(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&n(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,this._activeTrigger=null,null!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},r.show=function(){var e=this;if("none"===n(this.element).css("display"))throw new Error("Please use show on visible elements");var r=n.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){n(this.element).trigger(r);var i=c.findShadowRoot(this.element),o=n.contains(null!==i?i:this.element.ownerDocument.documentElement,this.element);if(r.isDefaultPrevented()||!o)return;var a=this.getTipElement(),s=c.getUID(this.constructor.NAME);a.setAttribute("id",s),this.element.setAttribute("aria-describedby",s),this.setContent(),this.config.animation&&n(a).addClass(le.FADE);var u="function"==typeof this.config.placement?this.config.placement.call(this,a,this.element):this.config.placement,l=this._getAttachment(u);this.addAttachmentClass(l);var f=this._getContainer();n(a).data(this.constructor.DATA_KEY,this),n.contains(this.element.ownerDocument.documentElement,this.tip)||n(a).appendTo(f),n(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new t(this.element,a,{placement:l,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:fe.ARROW},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){return e._handlePopperPlacementChange(t)}}),n(a).addClass(le.SHOW),"ontouchstart"in document.documentElement&&n(document.body).children().on("mouseover",null,n.noop);var p=function(){e.config.animation&&e._fixTransition();var t=e._hoverState;e._hoverState=null,n(e.element).trigger(e.constructor.Event.SHOWN),t===ue.OUT&&e._leave(null,e)};if(n(this.tip).hasClass(le.FADE)){var d=c.getTransitionDurationFromElement(this.tip);n(this.tip).one(c.TRANSITION_END,p).emulateTransitionEnd(d)}else p()}},r.hide=function(e){var t=this,r=this.getTipElement(),i=n.Event(this.constructor.Event.HIDE),o=function(){t._hoverState!==ue.SHOW&&r.parentNode&&r.parentNode.removeChild(r),t._cleanTipClass(),t.element.removeAttribute("aria-describedby"),n(t.element).trigger(t.constructor.Event.HIDDEN),null!==t._popper&&t._popper.destroy(),e&&e()};if(n(this.element).trigger(i),!i.isDefaultPrevented()){if(n(r).removeClass(le.SHOW),"ontouchstart"in document.documentElement&&n(document.body).children().off("mouseover",null,n.noop),this._activeTrigger[pe.CLICK]=!1,this._activeTrigger[pe.FOCUS]=!1,this._activeTrigger[pe.HOVER]=!1,n(this.tip).hasClass(le.FADE)){var a=c.getTransitionDurationFromElement(r);n(r).one(c.TRANSITION_END,o).emulateTransitionEnd(a)}else o();this._hoverState=""}},r.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},r.isWithContent=function(){return Boolean(this.getTitle())},r.addAttachmentClass=function(e){n(this.getTipElement()).addClass("bs-tooltip-"+e)},r.getTipElement=function(){return this.tip=this.tip||n(this.config.template)[0],this.tip},r.setContent=function(){var e=this.getTipElement();this.setElementContent(n(e.querySelectorAll(fe.TOOLTIP_INNER)),this.getTitle()),n(e).removeClass(le.FADE+" "+le.SHOW)},r.setElementContent=function(e,t){var r=this.config.html;"object"==typeof t&&(t.nodeType||t.jquery)?r?n(t).parent().is(e)||e.empty().append(t):e.text(n(t).text()):e[r?"html":"text"](t)},r.getTitle=function(){var e=this.element.getAttribute("data-original-title");return e||(e="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),e},r._getContainer=function(){return!1===this.config.container?document.body:c.isElement(this.config.container)?n(this.config.container):n(document).find(this.config.container)},r._getAttachment=function(e){return ae[e.toUpperCase()]},r._setListeners=function(){var e=this,t=this.config.trigger.split(" ");t.forEach(function(t){if("click"===t)n(e.element).on(e.constructor.Event.CLICK,e.config.selector,function(t){return e.toggle(t)});else if(t!==pe.MANUAL){var r=t===pe.HOVER?e.constructor.Event.MOUSEENTER:e.constructor.Event.FOCUSIN,i=t===pe.HOVER?e.constructor.Event.MOUSELEAVE:e.constructor.Event.FOCUSOUT;n(e.element).on(r,e.config.selector,function(t){return e._enter(t)}).on(i,e.config.selector,function(t){return e._leave(t)})}}),n(this.element).closest(".modal").on("hide.bs.modal",function(){e.element&&e.hide()}),this.config.selector?this.config=a({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},r._fixTitle=function(){var e=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==e)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},r._enter=function(e,t){var r=this.constructor.DATA_KEY;(t=t||n(e.currentTarget).data(r))||(t=new this.constructor(e.currentTarget,this._getDelegateConfig()),n(e.currentTarget).data(r,t)),e&&(t._activeTrigger["focusin"===e.type?pe.FOCUS:pe.HOVER]=!0),n(t.getTipElement()).hasClass(le.SHOW)||t._hoverState===ue.SHOW?t._hoverState=ue.SHOW:(clearTimeout(t._timeout),t._hoverState=ue.SHOW,t.config.delay&&t.config.delay.show?t._timeout=setTimeout(function(){t._hoverState===ue.SHOW&&t.show()},t.config.delay.show):t.show())},r._leave=function(e,t){var r=this.constructor.DATA_KEY;(t=t||n(e.currentTarget).data(r))||(t=new this.constructor(e.currentTarget,this._getDelegateConfig()),n(e.currentTarget).data(r,t)),e&&(t._activeTrigger["focusout"===e.type?pe.FOCUS:pe.HOVER]=!1),t._isWithActiveTrigger()||(clearTimeout(t._timeout),t._hoverState=ue.OUT,t.config.delay&&t.config.delay.hide?t._timeout=setTimeout(function(){t._hoverState===ue.OUT&&t.hide()},t.config.delay.hide):t.hide())},r._isWithActiveTrigger=function(){for(var e in this._activeTrigger)if(this._activeTrigger[e])return!0;return!1},r._getConfig=function(e){return"number"==typeof(e=a({},this.constructor.Default,n(this.element).data(),"object"==typeof e&&e?e:{})).delay&&(e.delay={show:e.delay,hide:e.delay}),"number"==typeof e.title&&(e.title=e.title.toString()),"number"==typeof e.content&&(e.content=e.content.toString()),c.typeCheckConfig(ne,e,this.constructor.DefaultType),e},r._getDelegateConfig=function(){var e={};if(this.config)for(var t in this.config)this.constructor.Default[t]!==this.config[t]&&(e[t]=this.config[t]);return e},r._cleanTipClass=function(){var e=n(this.getTipElement()),t=e.attr("class").match(ie);null!==t&&t.length&&e.removeClass(t.join(""))},r._handlePopperPlacementChange=function(e){var t=e.instance;this.tip=t.popper,this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(e.placement))},r._fixTransition=function(){var e=this.getTipElement(),t=this.config.animation;null===e.getAttribute("x-placement")&&(n(e).removeClass(le.FADE),this.config.animation=!1,this.hide(),this.show(),this.config.animation=t)},e._jQueryInterface=function(t){return this.each(function(){var r=n(this).data("bs.tooltip"),i="object"==typeof t&&t;if((r||!/dispose|hide/.test(t))&&(r||(r=new e(this,i),n(this).data("bs.tooltip",r)),"string"==typeof t)){if(void 0===r[t])throw new TypeError('No method named "'+t+'"');r[t]()}})},i(e,null,[{key:"VERSION",get:function(){return"4.2.1"}},{key:"Default",get:function(){return se}},{key:"NAME",get:function(){return ne}},{key:"DATA_KEY",get:function(){return"bs.tooltip"}},{key:"Event",get:function(){return ce}},{key:"EVENT_KEY",get:function(){return".bs.tooltip"}},{key:"DefaultType",get:function(){return oe}}]),e}();n.fn.tooltip=de._jQueryInterface,n.fn.tooltip.Constructor=de,n.fn.tooltip.noConflict=function(){return n.fn.tooltip=re,de._jQueryInterface};var he="popover",ve=n.fn.popover,ge=new RegExp("(^|\\s)bs-popover\\S+","g"),me=a({},de.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),ye=a({},de.DefaultType,{content:"(string|element|function)"}),_e={FADE:"fade",SHOW:"show"},be={TITLE:".popover-header",CONTENT:".popover-body"},we={HIDE:"hide.bs.popover",HIDDEN:"hidden.bs.popover",SHOW:"show.bs.popover",SHOWN:"shown.bs.popover",INSERTED:"inserted.bs.popover",CLICK:"click.bs.popover",FOCUSIN:"focusin.bs.popover",FOCUSOUT:"focusout.bs.popover",MOUSEENTER:"mouseenter.bs.popover",MOUSELEAVE:"mouseleave.bs.popover"},Ee=function(e){var t,r;function o(){return e.apply(this,arguments)||this}r=e,(t=o).prototype=Object.create(r.prototype),t.prototype.constructor=t,t.__proto__=r;var a=o.prototype;return a.isWithContent=function(){return this.getTitle()||this._getContent()},a.addAttachmentClass=function(e){n(this.getTipElement()).addClass("bs-popover-"+e)},a.getTipElement=function(){return this.tip=this.tip||n(this.config.template)[0],this.tip},a.setContent=function(){var e=n(this.getTipElement());this.setElementContent(e.find(be.TITLE),this.getTitle());var t=this._getContent();"function"==typeof t&&(t=t.call(this.element)),this.setElementContent(e.find(be.CONTENT),t),e.removeClass(_e.FADE+" "+_e.SHOW)},a._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},a._cleanTipClass=function(){var e=n(this.getTipElement()),t=e.attr("class").match(ge);null!==t&&t.length>0&&e.removeClass(t.join(""))},o._jQueryInterface=function(e){return this.each(function(){var t=n(this).data("bs.popover"),r="object"==typeof e?e:null;if((t||!/dispose|hide/.test(e))&&(t||(t=new o(this,r),n(this).data("bs.popover",t)),"string"==typeof e)){if(void 0===t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},i(o,null,[{key:"VERSION",get:function(){return"4.2.1"}},{key:"Default",get:function(){return me}},{key:"NAME",get:function(){return he}},{key:"DATA_KEY",get:function(){return"bs.popover"}},{key:"Event",get:function(){return we}},{key:"EVENT_KEY",get:function(){return".bs.popover"}},{key:"DefaultType",get:function(){return ye}}]),o}(de);n.fn.popover=Ee._jQueryInterface,n.fn.popover.Constructor=Ee,n.fn.popover.noConflict=function(){return n.fn.popover=ve,Ee._jQueryInterface};var Te="scrollspy",Ce=n.fn[Te],xe={offset:10,method:"auto",target:""},Ae={offset:"number",method:"string",target:"(string|element)"},Se={ACTIVATE:"activate.bs.scrollspy",SCROLL:"scroll.bs.scrollspy",LOAD_DATA_API:"load.bs.scrollspy.data-api"},Oe={DROPDOWN_ITEM:"dropdown-item",DROPDOWN_MENU:"dropdown-menu",ACTIVE:"active"},De={DATA_SPY:'[data-spy="scroll"]',ACTIVE:".active",NAV_LIST_GROUP:".nav, .list-group",NAV_LINKS:".nav-link",NAV_ITEMS:".nav-item",LIST_ITEMS:".list-group-item",DROPDOWN:".dropdown",DROPDOWN_ITEMS:".dropdown-item",DROPDOWN_TOGGLE:".dropdown-toggle"},Ie={OFFSET:"offset",POSITION:"position"},Ne=function(){function e(e,t){var r=this;this._element=e,this._scrollElement="BODY"===e.tagName?window:e,this._config=this._getConfig(t),this._selector=this._config.target+" "+De.NAV_LINKS+","+this._config.target+" "+De.LIST_ITEMS+","+this._config.target+" "+De.DROPDOWN_ITEMS,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,n(this._scrollElement).on(Se.SCROLL,function(e){return r._process(e)}),this.refresh(),this._process()}var t=e.prototype;return t.refresh=function(){var e=this,t=this._scrollElement===this._scrollElement.window?Ie.OFFSET:Ie.POSITION,r="auto"===this._config.method?t:this._config.method,i=r===Ie.POSITION?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight();var o=[].slice.call(document.querySelectorAll(this._selector));o.map(function(e){var t,o=c.getSelectorFromElement(e);if(o&&(t=document.querySelector(o)),t){var a=t.getBoundingClientRect();if(a.width||a.height)return[n(t)[r]().top+i,o]}return null}).filter(function(e){return e}).sort(function(e,t){return e[0]-t[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},t.dispose=function(){n.removeData(this._element,"bs.scrollspy"),n(this._scrollElement).off(".bs.scrollspy"),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},t._getConfig=function(e){if("string"!=typeof(e=a({},xe,"object"==typeof e&&e?e:{})).target){var t=n(e.target).attr("id");t||(t=c.getUID(Te),n(e.target).attr("id",t)),e.target="#"+t}return c.typeCheckConfig(Te,e,Ae),e},t._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},t._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},t._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},t._process=function(){var e=this._getScrollTop()+this._config.offset,t=this._getScrollHeight(),n=this._config.offset+t-this._getOffsetHeight();if(this._scrollHeight!==t&&this.refresh(),e>=n){var r=this._targets[this._targets.length-1];this._activeTarget!==r&&this._activate(r)}else{if(this._activeTarget&&e<this._offsets[0]&&this._offsets[0]>0)return this._activeTarget=null,void this._clear();for(var i=this._offsets.length,o=i;o--;){var a=this._activeTarget!==this._targets[o]&&e>=this._offsets[o]&&(void 0===this._offsets[o+1]||e<this._offsets[o+1]);a&&this._activate(this._targets[o])}}},t._activate=function(e){this._activeTarget=e,this._clear();var t=this._selector.split(",").map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'}),r=n([].slice.call(document.querySelectorAll(t.join(","))));r.hasClass(Oe.DROPDOWN_ITEM)?(r.closest(De.DROPDOWN).find(De.DROPDOWN_TOGGLE).addClass(Oe.ACTIVE),r.addClass(Oe.ACTIVE)):(r.addClass(Oe.ACTIVE),r.parents(De.NAV_LIST_GROUP).prev(De.NAV_LINKS+", "+De.LIST_ITEMS).addClass(Oe.ACTIVE),r.parents(De.NAV_LIST_GROUP).prev(De.NAV_ITEMS).children(De.NAV_LINKS).addClass(Oe.ACTIVE)),n(this._scrollElement).trigger(Se.ACTIVATE,{relatedTarget:e})},t._clear=function(){[].slice.call(document.querySelectorAll(this._selector)).filter(function(e){return e.classList.contains(Oe.ACTIVE)}).forEach(function(e){return e.classList.remove(Oe.ACTIVE)})},e._jQueryInterface=function(t){return this.each(function(){var r=n(this).data("bs.scrollspy"),i="object"==typeof t&&t;if(r||(r=new e(this,i),n(this).data("bs.scrollspy",r)),"string"==typeof t){if(void 0===r[t])throw new TypeError('No method named "'+t+'"');r[t]()}})},i(e,null,[{key:"VERSION",get:function(){return"4.2.1"}},{key:"Default",get:function(){return xe}}]),e}();n(window).on(Se.LOAD_DATA_API,function(){for(var e=[].slice.call(document.querySelectorAll(De.DATA_SPY)),t=e.length,r=t;r--;){var i=n(e[r]);Ne._jQueryInterface.call(i,i.data())}}),n.fn[Te]=Ne._jQueryInterface,n.fn[Te].Constructor=Ne,n.fn[Te].noConflict=function(){return n.fn[Te]=Ce,Ne._jQueryInterface};var ke=n.fn.tab,Le={HIDE:"hide.bs.tab",HIDDEN:"hidden.bs.tab",SHOW:"show.bs.tab",SHOWN:"shown.bs.tab",CLICK_DATA_API:"click.bs.tab.data-api"},je={DROPDOWN_MENU:"dropdown-menu",ACTIVE:"active",DISABLED:"disabled",FADE:"fade",SHOW:"show"},Re={DROPDOWN:".dropdown",NAV_LIST_GROUP:".nav, .list-group",ACTIVE:".active",ACTIVE_UL:"> li > .active",DATA_TOGGLE:'[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',DROPDOWN_TOGGLE:".dropdown-toggle",DROPDOWN_ACTIVE_CHILD:"> .dropdown-menu .active"},Pe=function(){function e(e){this._element=e}var t=e.prototype;return t.show=function(){var e=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&n(this._element).hasClass(je.ACTIVE)||n(this._element).hasClass(je.DISABLED))){var t,r,i=n(this._element).closest(Re.NAV_LIST_GROUP)[0],o=c.getSelectorFromElement(this._element);if(i){var a="UL"===i.nodeName||"OL"===i.nodeName?Re.ACTIVE_UL:Re.ACTIVE;r=(r=n.makeArray(n(i).find(a)))[r.length-1]}var s=n.Event(Le.HIDE,{relatedTarget:this._element}),u=n.Event(Le.SHOW,{relatedTarget:r});if(r&&n(r).trigger(s),n(this._element).trigger(u),!u.isDefaultPrevented()&&!s.isDefaultPrevented()){o&&(t=document.querySelector(o)),this._activate(this._element,i);var l=function(){var t=n.Event(Le.HIDDEN,{relatedTarget:e._element}),i=n.Event(Le.SHOWN,{relatedTarget:r});n(r).trigger(t),n(e._element).trigger(i)};t?this._activate(t,t.parentNode,l):l()}}},t.dispose=function(){n.removeData(this._element,"bs.tab"),this._element=null},t._activate=function(e,t,r){var i=this,o=!t||"UL"!==t.nodeName&&"OL"!==t.nodeName?n(t).children(Re.ACTIVE):n(t).find(Re.ACTIVE_UL),a=o[0],s=r&&a&&n(a).hasClass(je.FADE),u=function(){return i._transitionComplete(e,a,r)};if(a&&s){var l=c.getTransitionDurationFromElement(a);n(a).removeClass(je.SHOW).one(c.TRANSITION_END,u).emulateTransitionEnd(l)}else u()},t._transitionComplete=function(e,t,r){if(t){n(t).removeClass(je.ACTIVE);var i=n(t.parentNode).find(Re.DROPDOWN_ACTIVE_CHILD)[0];i&&n(i).removeClass(je.ACTIVE),"tab"===t.getAttribute("role")&&t.setAttribute("aria-selected",!1)}if(n(e).addClass(je.ACTIVE),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!0),c.reflow(e),n(e).addClass(je.SHOW),e.parentNode&&n(e.parentNode).hasClass(je.DROPDOWN_MENU)){var o=n(e).closest(Re.DROPDOWN)[0];if(o){var a=[].slice.call(o.querySelectorAll(Re.DROPDOWN_TOGGLE));n(a).addClass(je.ACTIVE)}e.setAttribute("aria-expanded",!0)}r&&r()},e._jQueryInterface=function(t){return this.each(function(){var r=n(this),i=r.data("bs.tab");if(i||(i=new e(this),r.data("bs.tab",i)),"string"==typeof t){if(void 0===i[t])throw new TypeError('No method named "'+t+'"');i[t]()}})},i(e,null,[{key:"VERSION",get:function(){return"4.2.1"}}]),e}();n(document).on(Le.CLICK_DATA_API,Re.DATA_TOGGLE,function(e){e.preventDefault(),Pe._jQueryInterface.call(n(this),"show")}),n.fn.tab=Pe._jQueryInterface,n.fn.tab.Constructor=Pe,n.fn.tab.noConflict=function(){return n.fn.tab=ke,Pe._jQueryInterface};var $e=n.fn.toast,He={CLICK_DISMISS:"click.dismiss.bs.toast",HIDE:"hide.bs.toast",HIDDEN:"hidden.bs.toast",SHOW:"show.bs.toast",SHOWN:"shown.bs.toast"},Me={FADE:"fade",HIDE:"hide",SHOW:"show",SHOWING:"showing"},Fe={animation:"boolean",autohide:"boolean",delay:"number"},We={animation:!0,autohide:!0,delay:500},Ue={DATA_DISMISS:'[data-dismiss="toast"]'},Be=function(){function e(e,t){this._element=e,this._config=this._getConfig(t),this._timeout=null,this._setListeners()}var t=e.prototype;return t.show=function(){var e=this;n(this._element).trigger(He.SHOW),this._config.animation&&this._element.classList.add(Me.FADE);var t=function(){e._element.classList.remove(Me.SHOWING),e._element.classList.add(Me.SHOW),n(e._element).trigger(He.SHOWN),e._config.autohide&&e.hide()};if(this._element.classList.remove(Me.HIDE),this._element.classList.add(Me.SHOWING),this._config.animation){var r=c.getTransitionDurationFromElement(this._element);n(this._element).one(c.TRANSITION_END,t).emulateTransitionEnd(r)}else t()},t.hide=function(e){var t=this;this._element.classList.contains(Me.SHOW)&&(n(this._element).trigger(He.HIDE),e?this._close():this._timeout=setTimeout(function(){t._close()},this._config.delay))},t.dispose=function(){clearTimeout(this._timeout),this._timeout=null,this._element.classList.contains(Me.SHOW)&&this._element.classList.remove(Me.SHOW),n(this._element).off(He.CLICK_DISMISS),n.removeData(this._element,"bs.toast"),this._element=null,this._config=null},t._getConfig=function(e){return e=a({},We,n(this._element).data(),"object"==typeof e&&e?e:{}),c.typeCheckConfig("toast",e,this.constructor.DefaultType),e},t._setListeners=function(){var e=this;n(this._element).on(He.CLICK_DISMISS,Ue.DATA_DISMISS,function(){return e.hide(!0)})},t._close=function(){var e=this,t=function(){e._element.classList.add(Me.HIDE),n(e._element).trigger(He.HIDDEN)};if(this._element.classList.remove(Me.SHOW),this._config.animation){var r=c.getTransitionDurationFromElement(this._element);n(this._element).one(c.TRANSITION_END,t).emulateTransitionEnd(r)}else t()},e._jQueryInterface=function(t){return this.each(function(){var r=n(this),i=r.data("bs.toast"),o="object"==typeof t&&t;if(i||(i=new e(this,o),r.data("bs.toast",i)),"string"==typeof t){if(void 0===i[t])throw new TypeError('No method named "'+t+'"');i[t](this)}})},i(e,null,[{key:"VERSION",get:function(){return"4.2.1"}},{key:"DefaultType",get:function(){return Fe}}]),e}();n.fn.toast=Be._jQueryInterface,n.fn.toast.Constructor=Be,n.fn.toast.noConflict=function(){return n.fn.toast=$e,Be._jQueryInterface},function(){if(void 0===n)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var e=n.fn.jquery.split(" ")[0].split(".");if(e[0]<2&&e[1]<9||1===e[0]&&9===e[1]&&e[2]<1||e[0]>=4)throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(),e.Util=c,e.Alert=d,e.Button=y,e.Carousel=D,e.Collapse=H,e.Dropdown=K,e.Modal=te,e.Popover=Ee,e.Scrollspy=Ne,e.Tab=Pe,e.Toast=Be,e.Tooltip=de,Object.defineProperty(e,"__esModule",{value:!0})}(t,n(3),n(4))},function(e,t,n){e.exports=n(18)},function(e,t,n){"use strict";var r=n(0),i=n(5),o=n(20),a=n(2);function s(e){var t=new o(e),n=i(o.prototype.request,t);return r.extend(n,o.prototype,t),r.extend(n,t),n}var u=s(a);u.Axios=o,u.create=function(e){return s(r.merge(a,e))},u.Cancel=n(10),u.CancelToken=n(34),u.isCancel=n(9),u.all=function(e){return Promise.all(e)},u.spread=n(35),e.exports=u,e.exports.default=u},function(e,t){function n(e){return!!e.constructor&&"function"==typeof e.constructor.isBuffer&&e.constructor.isBuffer(e)}e.exports=function(e){return null!=e&&(n(e)||function(e){return"function"==typeof e.readFloatLE&&"function"==typeof e.slice&&n(e.slice(0,0))}(e)||!!e._isBuffer)}},function(e,t,n){"use strict";var r=n(2),i=n(0),o=n(29),a=n(30);function s(e){this.defaults=e,this.interceptors={request:new o,response:new o}}s.prototype.request=function(e){"string"==typeof e&&(e=i.merge({url:arguments[0]},arguments[1])),(e=i.merge(r,{method:"get"},this.defaults,e)).method=e.method.toLowerCase();var t=[a,void 0],n=Promise.resolve(e);for(this.interceptors.request.forEach(function(e){t.unshift(e.fulfilled,e.rejected)}),this.interceptors.response.forEach(function(e){t.push(e.fulfilled,e.rejected)});t.length;)n=n.then(t.shift(),t.shift());return n},i.forEach(["delete","get","head","options"],function(e){s.prototype[e]=function(t,n){return this.request(i.merge(n||{},{method:e,url:t}))}}),i.forEach(["post","put","patch"],function(e){s.prototype[e]=function(t,n,r){return this.request(i.merge(r||{},{method:e,url:t,data:n}))}}),e.exports=s},function(e,t,n){"use strict";var r=n(0);e.exports=function(e,t){r.forEach(e,function(n,r){r!==t&&r.toUpperCase()===t.toUpperCase()&&(e[t]=n,delete e[r])})}},function(e,t,n){"use strict";var r=n(8);e.exports=function(e,t,n){var i=n.config.validateStatus;n.status&&i&&!i(n.status)?t(r("Request failed with status code "+n.status,n.config,null,n.request,n)):e(n)}},function(e,t,n){"use strict";e.exports=function(e,t,n,r,i){return e.config=t,n&&(e.code=n),e.request=r,e.response=i,e}},function(e,t,n){"use strict";var r=n(0);function i(e){return encodeURIComponent(e).replace(/%40/gi,"@").replace(/%3A/gi,":").replace(/%24/g,"$").replace(/%2C/gi,",").replace(/%20/g,"+").replace(/%5B/gi,"[").replace(/%5D/gi,"]")}e.exports=function(e,t,n){if(!t)return e;var o;if(n)o=n(t);else if(r.isURLSearchParams(t))o=t.toString();else{var a=[];r.forEach(t,function(e,t){null!=e&&(r.isArray(e)?t+="[]":e=[e],r.forEach(e,function(e){r.isDate(e)?e=e.toISOString():r.isObject(e)&&(e=JSON.stringify(e)),a.push(i(t)+"="+i(e))}))}),o=a.join("&")}return o&&(e+=(-1===e.indexOf("?")?"?":"&")+o),e}},function(e,t,n){"use strict";var r=n(0),i=["age","authorization","content-length","content-type","etag","expires","from","host","if-modified-since","if-unmodified-since","last-modified","location","max-forwards","proxy-authorization","referer","retry-after","user-agent"];e.exports=function(e){var t,n,o,a={};return e?(r.forEach(e.split("\n"),function(e){if(o=e.indexOf(":"),t=r.trim(e.substr(0,o)).toLowerCase(),n=r.trim(e.substr(o+1)),t){if(a[t]&&i.indexOf(t)>=0)return;a[t]="set-cookie"===t?(a[t]?a[t]:[]).concat([n]):a[t]?a[t]+", "+n:n}}),a):a}},function(e,t,n){"use strict";var r=n(0);e.exports=r.isStandardBrowserEnv()?function(){var e,t=/(msie|trident)/i.test(navigator.userAgent),n=document.createElement("a");function i(e){var r=e;return t&&(n.setAttribute("href",r),r=n.href),n.setAttribute("href",r),{href:n.href,protocol:n.protocol?n.protocol.replace(/:$/,""):"",host:n.host,search:n.search?n.search.replace(/^\?/,""):"",hash:n.hash?n.hash.replace(/^#/,""):"",hostname:n.hostname,port:n.port,pathname:"/"===n.pathname.charAt(0)?n.pathname:"/"+n.pathname}}return e=i(window.location.href),function(t){var n=r.isString(t)?i(t):t;return n.protocol===e.protocol&&n.host===e.host}}():function(){return!0}},function(e,t,n){"use strict";var r="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=";function i(){this.message="String contains an invalid character"}i.prototype=new Error,i.prototype.code=5,i.prototype.name="InvalidCharacterError",e.exports=function(e){for(var t,n,o=String(e),a="",s=0,u=r;o.charAt(0|s)||(u="=",s%1);a+=u.charAt(63&t>>8-s%1*8)){if((n=o.charCodeAt(s+=.75))>255)throw new i;t=t<<8|n}return a}},function(e,t,n){"use strict";var r=n(0);e.exports=r.isStandardBrowserEnv()?{write:function(e,t,n,i,o,a){var s=[];s.push(e+"="+encodeURIComponent(t)),r.isNumber(n)&&s.push("expires="+new Date(n).toGMTString()),r.isString(i)&&s.push("path="+i),r.isString(o)&&s.push("domain="+o),!0===a&&s.push("secure"),document.cookie=s.join("; ")},read:function(e){var t=document.cookie.match(new RegExp("(^|;\\s*)("+e+")=([^;]*)"));return t?decodeURIComponent(t[3]):null},remove:function(e){this.write(e,"",Date.now()-864e5)}}:{write:function(){},read:function(){return null},remove:function(){}}},function(e,t,n){"use strict";var r=n(0);function i(){this.handlers=[]}i.prototype.use=function(e,t){return this.handlers.push({fulfilled:e,rejected:t}),this.handlers.length-1},i.prototype.eject=function(e){this.handlers[e]&&(this.handlers[e]=null)},i.prototype.forEach=function(e){r.forEach(this.handlers,function(t){null!==t&&e(t)})},e.exports=i},function(e,t,n){"use strict";var r=n(0),i=n(31),o=n(9),a=n(2),s=n(32),u=n(33);function c(e){e.cancelToken&&e.cancelToken.throwIfRequested()}e.exports=function(e){return c(e),e.baseURL&&!s(e.url)&&(e.url=u(e.baseURL,e.url)),e.headers=e.headers||{},e.data=i(e.data,e.headers,e.transformRequest),e.headers=r.merge(e.headers.common||{},e.headers[e.method]||{},e.headers||{}),r.forEach(["delete","get","head","post","put","patch","common"],function(t){delete e.headers[t]}),(e.adapter||a.adapter)(e).then(function(t){return c(e),t.data=i(t.data,t.headers,e.transformResponse),t},function(t){return o(t)||(c(e),t&&t.response&&(t.response.data=i(t.response.data,t.response.headers,e.transformResponse))),Promise.reject(t)})}},function(e,t,n){"use strict";var r=n(0);e.exports=function(e,t,n){return r.forEach(n,function(n){e=n(e,t)}),e}},function(e,t,n){"use strict";e.exports=function(e){return/^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(e)}},function(e,t,n){"use strict";e.exports=function(e,t){return t?e.replace(/\/+$/,"")+"/"+t.replace(/^\/+/,""):e}},function(e,t,n){"use strict";var r=n(10);function i(e){if("function"!=typeof e)throw new TypeError("executor must be a function.");var t;this.promise=new Promise(function(e){t=e});var n=this;e(function(e){n.reason||(n.reason=new r(e),t(n.reason))})}i.prototype.throwIfRequested=function(){if(this.reason)throw this.reason},i.source=function(){var e;return{token:new i(function(t){e=t}),cancel:e}},e.exports=i},function(e,t,n){"use strict";e.exports=function(e){return function(t){return e.apply(null,t)}}},function(e,t,n){e.exports=n(37)},function(e,t,n){"use strict";(function(t,n){var r=Object.freeze({});function i(e){return null==e}function o(e){return null!=e}function a(e){return!0===e}function s(e){return"string"==typeof e||"number"==typeof e||"symbol"==typeof e||"boolean"==typeof e}function u(e){return null!==e&&"object"==typeof e}var c=Object.prototype.toString;function l(e){return"[object Object]"===c.call(e)}function f(e){var t=parseFloat(String(e));return t>=0&&Math.floor(t)===t&&isFinite(e)}function p(e){return o(e)&&"function"==typeof e.then&&"function"==typeof e.catch}function d(e){return null==e?"":Array.isArray(e)||l(e)&&e.toString===c?JSON.stringify(e,null,2):String(e)}function h(e){var t=parseFloat(e);return isNaN(t)?e:t}function v(e,t){for(var n=Object.create(null),r=e.split(","),i=0;i<r.length;i++)n[r[i]]=!0;return t?function(e){return n[e.toLowerCase()]}:function(e){return n[e]}}var g=v("slot,component",!0),m=v("key,ref,slot,slot-scope,is");function y(e,t){if(e.length){var n=e.indexOf(t);if(n>-1)return e.splice(n,1)}}var _=Object.prototype.hasOwnProperty;function b(e,t){return _.call(e,t)}function w(e){var t=Object.create(null);return function(n){return t[n]||(t[n]=e(n))}}var E=/-(\w)/g,T=w(function(e){return e.replace(E,function(e,t){return t?t.toUpperCase():""})}),C=w(function(e){return e.charAt(0).toUpperCase()+e.slice(1)}),x=/\B([A-Z])/g,A=w(function(e){return e.replace(x,"-$1").toLowerCase()}),S=Function.prototype.bind?function(e,t){return e.bind(t)}:function(e,t){function n(n){var r=arguments.length;return r?r>1?e.apply(t,arguments):e.call(t,n):e.call(t)}return n._length=e.length,n};function O(e,t){t=t||0;for(var n=e.length-t,r=new Array(n);n--;)r[n]=e[n+t];return r}function D(e,t){for(var n in t)e[n]=t[n];return e}function I(e){for(var t={},n=0;n<e.length;n++)e[n]&&D(t,e[n]);return t}function N(e,t,n){}var k=function(e,t,n){return!1},L=function(e){return e};function j(e,t){if(e===t)return!0;var n=u(e),r=u(t);if(!n||!r)return!n&&!r&&String(e)===String(t);try{var i=Array.isArray(e),o=Array.isArray(t);if(i&&o)return e.length===t.length&&e.every(function(e,n){return j(e,t[n])});if(e instanceof Date&&t instanceof Date)return e.getTime()===t.getTime();if(i||o)return!1;var a=Object.keys(e),s=Object.keys(t);return a.length===s.length&&a.every(function(n){return j(e[n],t[n])})}catch(e){return!1}}function R(e,t){for(var n=0;n<e.length;n++)if(j(e[n],t))return n;return-1}function P(e){var t=!1;return function(){t||(t=!0,e.apply(this,arguments))}}var $="data-server-rendered",H=["component","directive","filter"],M=["beforeCreate","created","beforeMount","mounted","beforeUpdate","updated","beforeDestroy","destroyed","activated","deactivated","errorCaptured","serverPrefetch"],F={optionMergeStrategies:Object.create(null),silent:!1,productionTip:!1,devtools:!1,performance:!1,errorHandler:null,warnHandler:null,ignoredElements:[],keyCodes:Object.create(null),isReservedTag:k,isReservedAttr:k,isUnknownElement:k,getTagNamespace:N,parsePlatformTagName:L,mustUseProp:k,async:!0,_lifecycleHooks:M},W=/a-zA-Z\u00B7\u00C0-\u00D6\u00D8-\u00F6\u00F8-\u037D\u037F-\u1FFF\u200C-\u200D\u203F-\u2040\u2070-\u218F\u2C00-\u2FEF\u3001-\uD7FF\uF900-\uFDCF\uFDF0-\uFFFD/;function U(e,t,n,r){Object.defineProperty(e,t,{value:n,enumerable:!!r,writable:!0,configurable:!0})}var B,q=new RegExp("[^"+W.source+".$_\\d]"),V="__proto__"in{},z="undefined"!=typeof window,G="undefined"!=typeof WXEnvironment&&!!WXEnvironment.platform,K=G&&WXEnvironment.platform.toLowerCase(),X=z&&window.navigator.userAgent.toLowerCase(),Q=X&&/msie|trident/.test(X),Y=X&&X.indexOf("msie 9.0")>0,J=X&&X.indexOf("edge/")>0,Z=(X&&X.indexOf("android"),X&&/iphone|ipad|ipod|ios/.test(X)||"ios"===K),ee=(X&&/chrome\/\d+/.test(X),X&&/phantomjs/.test(X),X&&X.match(/firefox\/(\d+)/)),te={}.watch,ne=!1;if(z)try{var re={};Object.defineProperty(re,"passive",{get:function(){ne=!0}}),window.addEventListener("test-passive",null,re)}catch(r){}var ie=function(){return void 0===B&&(B=!z&&!G&&void 0!==t&&t.process&&"server"===t.process.env.VUE_ENV),B},oe=z&&window.__VUE_DEVTOOLS_GLOBAL_HOOK__;function ae(e){return"function"==typeof e&&/native code/.test(e.toString())}var se,ue="undefined"!=typeof Symbol&&ae(Symbol)&&"undefined"!=typeof Reflect&&ae(Reflect.ownKeys);se="undefined"!=typeof Set&&ae(Set)?Set:function(){function e(){this.set=Object.create(null)}return e.prototype.has=function(e){return!0===this.set[e]},e.prototype.add=function(e){this.set[e]=!0},e.prototype.clear=function(){this.set=Object.create(null)},e}();var ce=N,le=0,fe=function(){this.id=le++,this.subs=[]};fe.prototype.addSub=function(e){this.subs.push(e)},fe.prototype.removeSub=function(e){y(this.subs,e)},fe.prototype.depend=function(){fe.target&&fe.target.addDep(this)},fe.prototype.notify=function(){for(var e=this.subs.slice(),t=0,n=e.length;t<n;t++)e[t].update()},fe.target=null;var pe=[];function de(e){pe.push(e),fe.target=e}function he(){pe.pop(),fe.target=pe[pe.length-1]}var ve=function(e,t,n,r,i,o,a,s){this.tag=e,this.data=t,this.children=n,this.text=r,this.elm=i,this.ns=void 0,this.context=o,this.fnContext=void 0,this.fnOptions=void 0,this.fnScopeId=void 0,this.key=t&&t.key,this.componentOptions=a,this.componentInstance=void 0,this.parent=void 0,this.raw=!1,this.isStatic=!1,this.isRootInsert=!0,this.isComment=!1,this.isCloned=!1,this.isOnce=!1,this.asyncFactory=s,this.asyncMeta=void 0,this.isAsyncPlaceholder=!1},ge={child:{configurable:!0}};ge.child.get=function(){return this.componentInstance},Object.defineProperties(ve.prototype,ge);var me=function(e){void 0===e&&(e="");var t=new ve;return t.text=e,t.isComment=!0,t};function ye(e){return new ve(void 0,void 0,void 0,String(e))}function _e(e){var t=new ve(e.tag,e.data,e.children&&e.children.slice(),e.text,e.elm,e.context,e.componentOptions,e.asyncFactory);return t.ns=e.ns,t.isStatic=e.isStatic,t.key=e.key,t.isComment=e.isComment,t.fnContext=e.fnContext,t.fnOptions=e.fnOptions,t.fnScopeId=e.fnScopeId,t.asyncMeta=e.asyncMeta,t.isCloned=!0,t}var be=Array.prototype,we=Object.create(be);["push","pop","shift","unshift","splice","sort","reverse"].forEach(function(e){var t=be[e];U(we,e,function(){for(var n=[],r=arguments.length;r--;)n[r]=arguments[r];var i,o=t.apply(this,n),a=this.__ob__;switch(e){case"push":case"unshift":i=n;break;case"splice":i=n.slice(2)}return i&&a.observeArray(i),a.dep.notify(),o})});var Ee=Object.getOwnPropertyNames(we),Te=!0;function Ce(e){Te=e}var xe=function(e){var t;this.value=e,this.dep=new fe,this.vmCount=0,U(e,"__ob__",this),Array.isArray(e)?(V?(t=we,e.__proto__=t):function(e,t,n){for(var r=0,i=n.length;r<i;r++){var o=n[r];U(e,o,t[o])}}(e,we,Ee),this.observeArray(e)):this.walk(e)};function Ae(e,t){var n;if(u(e)&&!(e instanceof ve))return b(e,"__ob__")&&e.__ob__ instanceof xe?n=e.__ob__:Te&&!ie()&&(Array.isArray(e)||l(e))&&Object.isExtensible(e)&&!e._isVue&&(n=new xe(e)),t&&n&&n.vmCount++,n}function Se(e,t,n,r,i){var o=new fe,a=Object.getOwnPropertyDescriptor(e,t);if(!a||!1!==a.configurable){var s=a&&a.get,u=a&&a.set;s&&!u||2!==arguments.length||(n=e[t]);var c=!i&&Ae(n);Object.defineProperty(e,t,{enumerable:!0,configurable:!0,get:function(){var t=s?s.call(e):n;return fe.target&&(o.depend(),c&&(c.dep.depend(),Array.isArray(t)&&function e(t){for(var n=void 0,r=0,i=t.length;r<i;r++)(n=t[r])&&n.__ob__&&n.__ob__.dep.depend(),Array.isArray(n)&&e(n)}(t))),t},set:function(t){var r=s?s.call(e):n;t===r||t!=t&&r!=r||s&&!u||(u?u.call(e,t):n=t,c=!i&&Ae(t),o.notify())}})}}function Oe(e,t,n){if(Array.isArray(e)&&f(t))return e.length=Math.max(e.length,t),e.splice(t,1,n),n;if(t in e&&!(t in Object.prototype))return e[t]=n,n;var r=e.__ob__;return e._isVue||r&&r.vmCount?n:r?(Se(r.value,t,n),r.dep.notify(),n):(e[t]=n,n)}function De(e,t){if(Array.isArray(e)&&f(t))e.splice(t,1);else{var n=e.__ob__;e._isVue||n&&n.vmCount||b(e,t)&&(delete e[t],n&&n.dep.notify())}}xe.prototype.walk=function(e){for(var t=Object.keys(e),n=0;n<t.length;n++)Se(e,t[n])},xe.prototype.observeArray=function(e){for(var t=0,n=e.length;t<n;t++)Ae(e[t])};var Ie=F.optionMergeStrategies;function Ne(e,t){if(!t)return e;for(var n,r,i,o=ue?Reflect.ownKeys(t):Object.keys(t),a=0;a<o.length;a++)"__ob__"!==(n=o[a])&&(r=e[n],i=t[n],b(e,n)?r!==i&&l(r)&&l(i)&&Ne(r,i):Oe(e,n,i));return e}function ke(e,t,n){return n?function(){var r="function"==typeof t?t.call(n,n):t,i="function"==typeof e?e.call(n,n):e;return r?Ne(r,i):i}:t?e?function(){return Ne("function"==typeof t?t.call(this,this):t,"function"==typeof e?e.call(this,this):e)}:t:e}function Le(e,t){var n=t?e?e.concat(t):Array.isArray(t)?t:[t]:e;return n?function(e){for(var t=[],n=0;n<e.length;n++)-1===t.indexOf(e[n])&&t.push(e[n]);return t}(n):n}function je(e,t,n,r){var i=Object.create(e||null);return t?D(i,t):i}Ie.data=function(e,t,n){return n?ke(e,t,n):t&&"function"!=typeof t?e:ke(e,t)},M.forEach(function(e){Ie[e]=Le}),H.forEach(function(e){Ie[e+"s"]=je}),Ie.watch=function(e,t,n,r){if(e===te&&(e=void 0),t===te&&(t=void 0),!t)return Object.create(e||null);if(!e)return t;var i={};for(var o in D(i,e),t){var a=i[o],s=t[o];a&&!Array.isArray(a)&&(a=[a]),i[o]=a?a.concat(s):Array.isArray(s)?s:[s]}return i},Ie.props=Ie.methods=Ie.inject=Ie.computed=function(e,t,n,r){if(!e)return t;var i=Object.create(null);return D(i,e),t&&D(i,t),i},Ie.provide=ke;var Re=function(e,t){return void 0===t?e:t};function Pe(e,t,n){if("function"==typeof t&&(t=t.options),function(e,t){var n=e.props;if(n){var r,i,o={};if(Array.isArray(n))for(r=n.length;r--;)"string"==typeof(i=n[r])&&(o[T(i)]={type:null});else if(l(n))for(var a in n)i=n[a],o[T(a)]=l(i)?i:{type:i};e.props=o}}(t),function(e,t){var n=e.inject;if(n){var r=e.inject={};if(Array.isArray(n))for(var i=0;i<n.length;i++)r[n[i]]={from:n[i]};else if(l(n))for(var o in n){var a=n[o];r[o]=l(a)?D({from:o},a):{from:a}}}}(t),function(e){var t=e.directives;if(t)for(var n in t){var r=t[n];"function"==typeof r&&(t[n]={bind:r,update:r})}}(t),!t._base&&(t.extends&&(e=Pe(e,t.extends,n)),t.mixins))for(var r=0,i=t.mixins.length;r<i;r++)e=Pe(e,t.mixins[r],n);var o,a={};for(o in e)s(o);for(o in t)b(e,o)||s(o);function s(r){var i=Ie[r]||Re;a[r]=i(e[r],t[r],n,r)}return a}function $e(e,t,n,r){if("string"==typeof n){var i=e[t];if(b(i,n))return i[n];var o=T(n);if(b(i,o))return i[o];var a=C(o);return b(i,a)?i[a]:i[n]||i[o]||i[a]}}function He(e,t,n,r){var i=t[e],o=!b(n,e),a=n[e],s=We(Boolean,i.type);if(s>-1)if(o&&!b(i,"default"))a=!1;else if(""===a||a===A(e)){var u=We(String,i.type);(u<0||s<u)&&(a=!0)}if(void 0===a){a=function(e,t,n){if(b(t,"default")){var r=t.default;return e&&e.$options.propsData&&void 0===e.$options.propsData[n]&&void 0!==e._props[n]?e._props[n]:"function"==typeof r&&"Function"!==Me(t.type)?r.call(e):r}}(r,i,e);var c=Te;Ce(!0),Ae(a),Ce(c)}return a}function Me(e){var t=e&&e.toString().match(/^\s*function (\w+)/);return t?t[1]:""}function Fe(e,t){return Me(e)===Me(t)}function We(e,t){if(!Array.isArray(t))return Fe(t,e)?0:-1;for(var n=0,r=t.length;n<r;n++)if(Fe(t[n],e))return n;return-1}function Ue(e,t,n){de();try{if(t)for(var r=t;r=r.$parent;){var i=r.$options.errorCaptured;if(i)for(var o=0;o<i.length;o++)try{if(!1===i[o].call(r,e,t,n))return}catch(e){qe(e,r,"errorCaptured hook")}}qe(e,t,n)}finally{he()}}function Be(e,t,n,r,i){var o;try{(o=n?e.apply(t,n):e.call(t))&&!o._isVue&&p(o)&&!o._handled&&(o.catch(function(e){return Ue(e,r,i+" (Promise/async)")}),o._handled=!0)}catch(e){Ue(e,r,i)}return o}function qe(e,t,n){if(F.errorHandler)try{return F.errorHandler.call(null,e,t,n)}catch(t){t!==e&&Ve(t,null,"config.errorHandler")}Ve(e,t,n)}function Ve(e,t,n){if(!z&&!G||"undefined"==typeof console)throw e;console.error(e)}var ze,Ge=!1,Ke=[],Xe=!1;function Qe(){Xe=!1;var e=Ke.slice(0);Ke.length=0;for(var t=0;t<e.length;t++)e[t]()}if("undefined"!=typeof Promise&&ae(Promise)){var Ye=Promise.resolve();ze=function(){Ye.then(Qe),Z&&setTimeout(N)},Ge=!0}else if(Q||"undefined"==typeof MutationObserver||!ae(MutationObserver)&&"[object MutationObserverConstructor]"!==MutationObserver.toString())ze=void 0!==n&&ae(n)?function(){n(Qe)}:function(){setTimeout(Qe,0)};else{var Je=1,Ze=new MutationObserver(Qe),et=document.createTextNode(String(Je));Ze.observe(et,{characterData:!0}),ze=function(){Je=(Je+1)%2,et.data=String(Je)},Ge=!0}function tt(e,t){var n;if(Ke.push(function(){if(e)try{e.call(t)}catch(e){Ue(e,t,"nextTick")}else n&&n(t)}),Xe||(Xe=!0,ze()),!e&&"undefined"!=typeof Promise)return new Promise(function(e){n=e})}var nt=new se;function rt(e){!function e(t,n){var r,i,o=Array.isArray(t);if(!(!o&&!u(t)||Object.isFrozen(t)||t instanceof ve)){if(t.__ob__){var a=t.__ob__.dep.id;if(n.has(a))return;n.add(a)}if(o)for(r=t.length;r--;)e(t[r],n);else for(r=(i=Object.keys(t)).length;r--;)e(t[i[r]],n)}}(e,nt),nt.clear()}var it=w(function(e){var t="&"===e.charAt(0),n="~"===(e=t?e.slice(1):e).charAt(0),r="!"===(e=n?e.slice(1):e).charAt(0);return{name:e=r?e.slice(1):e,once:n,capture:r,passive:t}});function ot(e,t){function n(){var e=arguments,r=n.fns;if(!Array.isArray(r))return Be(r,null,arguments,t,"v-on handler");for(var i=r.slice(),o=0;o<i.length;o++)Be(i[o],null,e,t,"v-on handler")}return n.fns=e,n}function at(e,t,n,r,o,s){var u,c,l,f;for(u in e)c=e[u],l=t[u],f=it(u),i(c)||(i(l)?(i(c.fns)&&(c=e[u]=ot(c,s)),a(f.once)&&(c=e[u]=o(f.name,c,f.capture)),n(f.name,c,f.capture,f.passive,f.params)):c!==l&&(l.fns=c,e[u]=l));for(u in t)i(e[u])&&r((f=it(u)).name,t[u],f.capture)}function st(e,t,n){var r;e instanceof ve&&(e=e.data.hook||(e.data.hook={}));var s=e[t];function u(){n.apply(this,arguments),y(r.fns,u)}i(s)?r=ot([u]):o(s.fns)&&a(s.merged)?(r=s).fns.push(u):r=ot([s,u]),r.merged=!0,e[t]=r}function ut(e,t,n,r,i){if(o(t)){if(b(t,n))return e[n]=t[n],i||delete t[n],!0;if(b(t,r))return e[n]=t[r],i||delete t[r],!0}return!1}function ct(e){return s(e)?[ye(e)]:Array.isArray(e)?function e(t,n){var r,u,c,l,f=[];for(r=0;r<t.length;r++)i(u=t[r])||"boolean"==typeof u||(l=f[c=f.length-1],Array.isArray(u)?u.length>0&&(lt((u=e(u,(n||"")+"_"+r))[0])&<(l)&&(f[c]=ye(l.text+u[0].text),u.shift()),f.push.apply(f,u)):s(u)?lt(l)?f[c]=ye(l.text+u):""!==u&&f.push(ye(u)):lt(u)&<(l)?f[c]=ye(l.text+u.text):(a(t._isVList)&&o(u.tag)&&i(u.key)&&o(n)&&(u.key="__vlist"+n+"_"+r+"__"),f.push(u)));return f}(e):void 0}function lt(e){return o(e)&&o(e.text)&&!1===e.isComment}function ft(e,t){if(e){for(var n=Object.create(null),r=ue?Reflect.ownKeys(e):Object.keys(e),i=0;i<r.length;i++){var o=r[i];if("__ob__"!==o){for(var a=e[o].from,s=t;s;){if(s._provided&&b(s._provided,a)){n[o]=s._provided[a];break}s=s.$parent}if(!s&&"default"in e[o]){var u=e[o].default;n[o]="function"==typeof u?u.call(t):u}}}return n}}function pt(e,t){if(!e||!e.length)return{};for(var n={},r=0,i=e.length;r<i;r++){var o=e[r],a=o.data;if(a&&a.attrs&&a.attrs.slot&&delete a.attrs.slot,o.context!==t&&o.fnContext!==t||!a||null==a.slot)(n.default||(n.default=[])).push(o);else{var s=a.slot,u=n[s]||(n[s]=[]);"template"===o.tag?u.push.apply(u,o.children||[]):u.push(o)}}for(var c in n)n[c].every(dt)&&delete n[c];return n}function dt(e){return e.isComment&&!e.asyncFactory||" "===e.text}function ht(e,t,n){var i,o=Object.keys(t).length>0,a=e?!!e.$stable:!o,s=e&&e.$key;if(e){if(e._normalized)return e._normalized;if(a&&n&&n!==r&&s===n.$key&&!o&&!n.$hasNormal)return n;for(var u in i={},e)e[u]&&"$"!==u[0]&&(i[u]=vt(t,u,e[u]))}else i={};for(var c in t)c in i||(i[c]=gt(t,c));return e&&Object.isExtensible(e)&&(e._normalized=i),U(i,"$stable",a),U(i,"$key",s),U(i,"$hasNormal",o),i}function vt(e,t,n){var r=function(){var e=arguments.length?n.apply(null,arguments):n({});return(e=e&&"object"==typeof e&&!Array.isArray(e)?[e]:ct(e))&&(0===e.length||1===e.length&&e[0].isComment)?void 0:e};return n.proxy&&Object.defineProperty(e,t,{get:r,enumerable:!0,configurable:!0}),r}function gt(e,t){return function(){return e[t]}}function mt(e,t){var n,r,i,a,s;if(Array.isArray(e)||"string"==typeof e)for(n=new Array(e.length),r=0,i=e.length;r<i;r++)n[r]=t(e[r],r);else if("number"==typeof e)for(n=new Array(e),r=0;r<e;r++)n[r]=t(r+1,r);else if(u(e))if(ue&&e[Symbol.iterator]){n=[];for(var c=e[Symbol.iterator](),l=c.next();!l.done;)n.push(t(l.value,n.length)),l=c.next()}else for(a=Object.keys(e),n=new Array(a.length),r=0,i=a.length;r<i;r++)s=a[r],n[r]=t(e[s],s,r);return o(n)||(n=[]),n._isVList=!0,n}function yt(e,t,n,r){var i,o=this.$scopedSlots[e];o?(n=n||{},r&&(n=D(D({},r),n)),i=o(n)||t):i=this.$slots[e]||t;var a=n&&n.slot;return a?this.$createElement("template",{slot:a},i):i}function _t(e){return $e(this.$options,"filters",e)||L}function bt(e,t){return Array.isArray(e)?-1===e.indexOf(t):e!==t}function wt(e,t,n,r,i){var o=F.keyCodes[t]||n;return i&&r&&!F.keyCodes[t]?bt(i,r):o?bt(o,e):r?A(r)!==t:void 0}function Et(e,t,n,r,i){if(n&&u(n)){var o;Array.isArray(n)&&(n=I(n));var a=function(a){if("class"===a||"style"===a||m(a))o=e;else{var s=e.attrs&&e.attrs.type;o=r||F.mustUseProp(t,s,a)?e.domProps||(e.domProps={}):e.attrs||(e.attrs={})}var u=T(a),c=A(a);u in o||c in o||(o[a]=n[a],i&&((e.on||(e.on={}))["update:"+a]=function(e){n[a]=e}))};for(var s in n)a(s)}return e}function Tt(e,t){var n=this._staticTrees||(this._staticTrees=[]),r=n[e];return r&&!t?r:(xt(r=n[e]=this.$options.staticRenderFns[e].call(this._renderProxy,null,this),"__static__"+e,!1),r)}function Ct(e,t,n){return xt(e,"__once__"+t+(n?"_"+n:""),!0),e}function xt(e,t,n){if(Array.isArray(e))for(var r=0;r<e.length;r++)e[r]&&"string"!=typeof e[r]&&At(e[r],t+"_"+r,n);else At(e,t,n)}function At(e,t,n){e.isStatic=!0,e.key=t,e.isOnce=n}function St(e,t){if(t&&l(t)){var n=e.on=e.on?D({},e.on):{};for(var r in t){var i=n[r],o=t[r];n[r]=i?[].concat(i,o):o}}return e}function Ot(e,t,n,r){t=t||{$stable:!n};for(var i=0;i<e.length;i++){var o=e[i];Array.isArray(o)?Ot(o,t,n):o&&(o.proxy&&(o.fn.proxy=!0),t[o.key]=o.fn)}return r&&(t.$key=r),t}function Dt(e,t){for(var n=0;n<t.length;n+=2){var r=t[n];"string"==typeof r&&r&&(e[t[n]]=t[n+1])}return e}function It(e,t){return"string"==typeof e?t+e:e}function Nt(e){e._o=Ct,e._n=h,e._s=d,e._l=mt,e._t=yt,e._q=j,e._i=R,e._m=Tt,e._f=_t,e._k=wt,e._b=Et,e._v=ye,e._e=me,e._u=Ot,e._g=St,e._d=Dt,e._p=It}function kt(e,t,n,i,o){var s,u=this,c=o.options;b(i,"_uid")?(s=Object.create(i))._original=i:(s=i,i=i._original);var l=a(c._compiled),f=!l;this.data=e,this.props=t,this.children=n,this.parent=i,this.listeners=e.on||r,this.injections=ft(c.inject,i),this.slots=function(){return u.$slots||ht(e.scopedSlots,u.$slots=pt(n,i)),u.$slots},Object.defineProperty(this,"scopedSlots",{enumerable:!0,get:function(){return ht(e.scopedSlots,this.slots())}}),l&&(this.$options=c,this.$slots=this.slots(),this.$scopedSlots=ht(e.scopedSlots,this.$slots)),c._scopeId?this._c=function(e,t,n,r){var o=Wt(s,e,t,n,r,f);return o&&!Array.isArray(o)&&(o.fnScopeId=c._scopeId,o.fnContext=i),o}:this._c=function(e,t,n,r){return Wt(s,e,t,n,r,f)}}function Lt(e,t,n,r,i){var o=_e(e);return o.fnContext=n,o.fnOptions=r,t.slot&&((o.data||(o.data={})).slot=t.slot),o}function jt(e,t){for(var n in t)e[T(n)]=t[n]}Nt(kt.prototype);var Rt={init:function(e,t){if(e.componentInstance&&!e.componentInstance._isDestroyed&&e.data.keepAlive){var n=e;Rt.prepatch(n,n)}else(e.componentInstance=function(e,t){var n={_isComponent:!0,_parentVnode:e,parent:Yt},r=e.data.inlineTemplate;return o(r)&&(n.render=r.render,n.staticRenderFns=r.staticRenderFns),new e.componentOptions.Ctor(n)}(e)).$mount(t?e.elm:void 0,t)},prepatch:function(e,t){var n=t.componentOptions;!function(e,t,n,i,o){var a=i.data.scopedSlots,s=e.$scopedSlots,u=!!(a&&!a.$stable||s!==r&&!s.$stable||a&&e.$scopedSlots.$key!==a.$key),c=!!(o||e.$options._renderChildren||u);if(e.$options._parentVnode=i,e.$vnode=i,e._vnode&&(e._vnode.parent=i),e.$options._renderChildren=o,e.$attrs=i.data.attrs||r,e.$listeners=n||r,t&&e.$options.props){Ce(!1);for(var l=e._props,f=e.$options._propKeys||[],p=0;p<f.length;p++){var d=f[p],h=e.$options.props;l[d]=He(d,h,t,e)}Ce(!0),e.$options.propsData=t}n=n||r;var v=e.$options._parentListeners;e.$options._parentListeners=n,Qt(e,n,v),c&&(e.$slots=pt(o,i.context),e.$forceUpdate())}(t.componentInstance=e.componentInstance,n.propsData,n.listeners,t,n.children)},insert:function(e){var t,n=e.context,r=e.componentInstance;r._isMounted||(r._isMounted=!0,tn(r,"mounted")),e.data.keepAlive&&(n._isMounted?((t=r)._inactive=!1,rn.push(t)):en(r,!0))},destroy:function(e){var t=e.componentInstance;t._isDestroyed||(e.data.keepAlive?function e(t,n){if(!(n&&(t._directInactive=!0,Zt(t))||t._inactive)){t._inactive=!0;for(var r=0;r<t.$children.length;r++)e(t.$children[r]);tn(t,"deactivated")}}(t,!0):t.$destroy())}},Pt=Object.keys(Rt);function $t(e,t,n,s,c){if(!i(e)){var l=n.$options._base;if(u(e)&&(e=l.extend(e)),"function"==typeof e){var f;if(i(e.cid)&&void 0===(e=function(e,t){if(a(e.error)&&o(e.errorComp))return e.errorComp;if(o(e.resolved))return e.resolved;var n=Bt;if(n&&o(e.owners)&&-1===e.owners.indexOf(n)&&e.owners.push(n),a(e.loading)&&o(e.loadingComp))return e.loadingComp;if(n&&!o(e.owners)){var r=e.owners=[n],s=!0,c=null,l=null;n.$on("hook:destroyed",function(){return y(r,n)});var f=function(e){for(var t=0,n=r.length;t<n;t++)r[t].$forceUpdate();e&&(r.length=0,null!==c&&(clearTimeout(c),c=null),null!==l&&(clearTimeout(l),l=null))},d=P(function(n){e.resolved=qt(n,t),s?r.length=0:f(!0)}),h=P(function(t){o(e.errorComp)&&(e.error=!0,f(!0))}),v=e(d,h);return u(v)&&(p(v)?i(e.resolved)&&v.then(d,h):p(v.component)&&(v.component.then(d,h),o(v.error)&&(e.errorComp=qt(v.error,t)),o(v.loading)&&(e.loadingComp=qt(v.loading,t),0===v.delay?e.loading=!0:c=setTimeout(function(){c=null,i(e.resolved)&&i(e.error)&&(e.loading=!0,f(!1))},v.delay||200)),o(v.timeout)&&(l=setTimeout(function(){l=null,i(e.resolved)&&h(null)},v.timeout)))),s=!1,e.loading?e.loadingComp:e.resolved}}(f=e,l)))return function(e,t,n,r,i){var o=me();return o.asyncFactory=e,o.asyncMeta={data:t,context:n,children:r,tag:i},o}(f,t,n,s,c);t=t||{},Tn(e),o(t.model)&&function(e,t){var n=e.model&&e.model.prop||"value",r=e.model&&e.model.event||"input";(t.attrs||(t.attrs={}))[n]=t.model.value;var i=t.on||(t.on={}),a=i[r],s=t.model.callback;o(a)?(Array.isArray(a)?-1===a.indexOf(s):a!==s)&&(i[r]=[s].concat(a)):i[r]=s}(e.options,t);var d=function(e,t,n){var r=t.options.props;if(!i(r)){var a={},s=e.attrs,u=e.props;if(o(s)||o(u))for(var c in r){var l=A(c);ut(a,u,c,l,!0)||ut(a,s,c,l,!1)}return a}}(t,e);if(a(e.options.functional))return function(e,t,n,i,a){var s=e.options,u={},c=s.props;if(o(c))for(var l in c)u[l]=He(l,c,t||r);else o(n.attrs)&&jt(u,n.attrs),o(n.props)&&jt(u,n.props);var f=new kt(n,u,a,i,e),p=s.render.call(null,f._c,f);if(p instanceof ve)return Lt(p,n,f.parent,s);if(Array.isArray(p)){for(var d=ct(p)||[],h=new Array(d.length),v=0;v<d.length;v++)h[v]=Lt(d[v],n,f.parent,s);return h}}(e,d,t,n,s);var h=t.on;if(t.on=t.nativeOn,a(e.options.abstract)){var v=t.slot;t={},v&&(t.slot=v)}!function(e){for(var t=e.hook||(e.hook={}),n=0;n<Pt.length;n++){var r=Pt[n],i=t[r],o=Rt[r];i===o||i&&i._merged||(t[r]=i?Ht(o,i):o)}}(t);var g=e.options.name||c;return new ve("vue-component-"+e.cid+(g?"-"+g:""),t,void 0,void 0,void 0,n,{Ctor:e,propsData:d,listeners:h,tag:c,children:s},f)}}}function Ht(e,t){var n=function(n,r){e(n,r),t(n,r)};return n._merged=!0,n}var Mt=1,Ft=2;function Wt(e,t,n,r,c,l){return(Array.isArray(n)||s(n))&&(c=r,r=n,n=void 0),a(l)&&(c=Ft),function(e,t,n,r,s){if(o(n)&&o(n.__ob__))return me();if(o(n)&&o(n.is)&&(t=n.is),!t)return me();var c,l,f;(Array.isArray(r)&&"function"==typeof r[0]&&((n=n||{}).scopedSlots={default:r[0]},r.length=0),s===Ft?r=ct(r):s===Mt&&(r=function(e){for(var t=0;t<e.length;t++)if(Array.isArray(e[t]))return Array.prototype.concat.apply([],e);return e}(r)),"string"==typeof t)?(l=e.$vnode&&e.$vnode.ns||F.getTagNamespace(t),c=F.isReservedTag(t)?new ve(F.parsePlatformTagName(t),n,r,void 0,void 0,e):n&&n.pre||!o(f=$e(e.$options,"components",t))?new ve(t,n,r,void 0,void 0,e):$t(f,n,e,r,t)):c=$t(t,n,e,r);return Array.isArray(c)?c:o(c)?(o(l)&&function e(t,n,r){if(t.ns=n,"foreignObject"===t.tag&&(n=void 0,r=!0),o(t.children))for(var s=0,u=t.children.length;s<u;s++){var c=t.children[s];o(c.tag)&&(i(c.ns)||a(r)&&"svg"!==c.tag)&&e(c,n,r)}}(c,l),o(n)&&function(e){u(e.style)&&rt(e.style),u(e.class)&&rt(e.class)}(n),c):me()}(e,t,n,r,c)}var Ut,Bt=null;function qt(e,t){return(e.__esModule||ue&&"Module"===e[Symbol.toStringTag])&&(e=e.default),u(e)?t.extend(e):e}function Vt(e){return e.isComment&&e.asyncFactory}function zt(e){if(Array.isArray(e))for(var t=0;t<e.length;t++){var n=e[t];if(o(n)&&(o(n.componentOptions)||Vt(n)))return n}}function Gt(e,t){Ut.$on(e,t)}function Kt(e,t){Ut.$off(e,t)}function Xt(e,t){var n=Ut;return function r(){null!==t.apply(null,arguments)&&n.$off(e,r)}}function Qt(e,t,n){Ut=e,at(t,n||{},Gt,Kt,Xt,e),Ut=void 0}var Yt=null;function Jt(e){var t=Yt;return Yt=e,function(){Yt=t}}function Zt(e){for(;e&&(e=e.$parent);)if(e._inactive)return!0;return!1}function en(e,t){if(t){if(e._directInactive=!1,Zt(e))return}else if(e._directInactive)return;if(e._inactive||null===e._inactive){e._inactive=!1;for(var n=0;n<e.$children.length;n++)en(e.$children[n]);tn(e,"activated")}}function tn(e,t){de();var n=e.$options[t],r=t+" hook";if(n)for(var i=0,o=n.length;i<o;i++)Be(n[i],e,null,e,r);e._hasHookEvent&&e.$emit("hook:"+t),he()}var nn=[],rn=[],on={},an=!1,sn=!1,un=0,cn=0,ln=Date.now;if(z&&!Q){var fn=window.performance;fn&&"function"==typeof fn.now&&ln()>document.createEvent("Event").timeStamp&&(ln=function(){return fn.now()})}function pn(){var e,t;for(cn=ln(),sn=!0,nn.sort(function(e,t){return e.id-t.id}),un=0;un<nn.length;un++)(e=nn[un]).before&&e.before(),t=e.id,on[t]=null,e.run();var n=rn.slice(),r=nn.slice();un=nn.length=rn.length=0,on={},an=sn=!1,function(e){for(var t=0;t<e.length;t++)e[t]._inactive=!0,en(e[t],!0)}(n),function(e){for(var t=e.length;t--;){var n=e[t],r=n.vm;r._watcher===n&&r._isMounted&&!r._isDestroyed&&tn(r,"updated")}}(r),oe&&F.devtools&&oe.emit("flush")}var dn=0,hn=function(e,t,n,r,i){this.vm=e,i&&(e._watcher=this),e._watchers.push(this),r?(this.deep=!!r.deep,this.user=!!r.user,this.lazy=!!r.lazy,this.sync=!!r.sync,this.before=r.before):this.deep=this.user=this.lazy=this.sync=!1,this.cb=n,this.id=++dn,this.active=!0,this.dirty=this.lazy,this.deps=[],this.newDeps=[],this.depIds=new se,this.newDepIds=new se,this.expression="","function"==typeof t?this.getter=t:(this.getter=function(e){if(!q.test(e)){var t=e.split(".");return function(e){for(var n=0;n<t.length;n++){if(!e)return;e=e[t[n]]}return e}}}(t),this.getter||(this.getter=N)),this.value=this.lazy?void 0:this.get()};hn.prototype.get=function(){var e;de(this);var t=this.vm;try{e=this.getter.call(t,t)}catch(e){if(!this.user)throw e;Ue(e,t,'getter for watcher "'+this.expression+'"')}finally{this.deep&&rt(e),he(),this.cleanupDeps()}return e},hn.prototype.addDep=function(e){var t=e.id;this.newDepIds.has(t)||(this.newDepIds.add(t),this.newDeps.push(e),this.depIds.has(t)||e.addSub(this))},hn.prototype.cleanupDeps=function(){for(var e=this.deps.length;e--;){var t=this.deps[e];this.newDepIds.has(t.id)||t.removeSub(this)}var n=this.depIds;this.depIds=this.newDepIds,this.newDepIds=n,this.newDepIds.clear(),n=this.deps,this.deps=this.newDeps,this.newDeps=n,this.newDeps.length=0},hn.prototype.update=function(){this.lazy?this.dirty=!0:this.sync?this.run():function(e){var t=e.id;if(null==on[t]){if(on[t]=!0,sn){for(var n=nn.length-1;n>un&&nn[n].id>e.id;)n--;nn.splice(n+1,0,e)}else nn.push(e);an||(an=!0,tt(pn))}}(this)},hn.prototype.run=function(){if(this.active){var e=this.get();if(e!==this.value||u(e)||this.deep){var t=this.value;if(this.value=e,this.user)try{this.cb.call(this.vm,e,t)}catch(e){Ue(e,this.vm,'callback for watcher "'+this.expression+'"')}else this.cb.call(this.vm,e,t)}}},hn.prototype.evaluate=function(){this.value=this.get(),this.dirty=!1},hn.prototype.depend=function(){for(var e=this.deps.length;e--;)this.deps[e].depend()},hn.prototype.teardown=function(){if(this.active){this.vm._isBeingDestroyed||y(this.vm._watchers,this);for(var e=this.deps.length;e--;)this.deps[e].removeSub(this);this.active=!1}};var vn={enumerable:!0,configurable:!0,get:N,set:N};function gn(e,t,n){vn.get=function(){return this[t][n]},vn.set=function(e){this[t][n]=e},Object.defineProperty(e,n,vn)}var mn={lazy:!0};function yn(e,t,n){var r=!ie();"function"==typeof n?(vn.get=r?_n(t):bn(n),vn.set=N):(vn.get=n.get?r&&!1!==n.cache?_n(t):bn(n.get):N,vn.set=n.set||N),Object.defineProperty(e,t,vn)}function _n(e){return function(){var t=this._computedWatchers&&this._computedWatchers[e];if(t)return t.dirty&&t.evaluate(),fe.target&&t.depend(),t.value}}function bn(e){return function(){return e.call(this,this)}}function wn(e,t,n,r){return l(n)&&(r=n,n=n.handler),"string"==typeof n&&(n=e[n]),e.$watch(t,n,r)}var En=0;function Tn(e){var t=e.options;if(e.super){var n=Tn(e.super);if(n!==e.superOptions){e.superOptions=n;var r=function(e){var t,n=e.options,r=e.sealedOptions;for(var i in n)n[i]!==r[i]&&(t||(t={}),t[i]=n[i]);return t}(e);r&&D(e.extendOptions,r),(t=e.options=Pe(n,e.extendOptions)).name&&(t.components[t.name]=e)}}return t}function Cn(e){this._init(e)}function xn(e){return e&&(e.Ctor.options.name||e.tag)}function An(e,t){return Array.isArray(e)?e.indexOf(t)>-1:"string"==typeof e?e.split(",").indexOf(t)>-1:(n=e,"[object RegExp]"===c.call(n)&&e.test(t));var n}function Sn(e,t){var n=e.cache,r=e.keys,i=e._vnode;for(var o in n){var a=n[o];if(a){var s=xn(a.componentOptions);s&&!t(s)&&On(n,o,r,i)}}}function On(e,t,n,r){var i=e[t];!i||r&&i.tag===r.tag||i.componentInstance.$destroy(),e[t]=null,y(n,t)}Cn.prototype._init=function(e){var t=this;t._uid=En++,t._isVue=!0,e&&e._isComponent?function(e,t){var n=e.$options=Object.create(e.constructor.options),r=t._parentVnode;n.parent=t.parent,n._parentVnode=r;var i=r.componentOptions;n.propsData=i.propsData,n._parentListeners=i.listeners,n._renderChildren=i.children,n._componentTag=i.tag,t.render&&(n.render=t.render,n.staticRenderFns=t.staticRenderFns)}(t,e):t.$options=Pe(Tn(t.constructor),e||{},t),t._renderProxy=t,t._self=t,function(e){var t=e.$options,n=t.parent;if(n&&!t.abstract){for(;n.$options.abstract&&n.$parent;)n=n.$parent;n.$children.push(e)}e.$parent=n,e.$root=n?n.$root:e,e.$children=[],e.$refs={},e._watcher=null,e._inactive=null,e._directInactive=!1,e._isMounted=!1,e._isDestroyed=!1,e._isBeingDestroyed=!1}(t),function(e){e._events=Object.create(null),e._hasHookEvent=!1;var t=e.$options._parentListeners;t&&Qt(e,t)}(t),function(e){e._vnode=null,e._staticTrees=null;var t=e.$options,n=e.$vnode=t._parentVnode,i=n&&n.context;e.$slots=pt(t._renderChildren,i),e.$scopedSlots=r,e._c=function(t,n,r,i){return Wt(e,t,n,r,i,!1)},e.$createElement=function(t,n,r,i){return Wt(e,t,n,r,i,!0)};var o=n&&n.data;Se(e,"$attrs",o&&o.attrs||r,null,!0),Se(e,"$listeners",t._parentListeners||r,null,!0)}(t),tn(t,"beforeCreate"),function(e){var t=ft(e.$options.inject,e);t&&(Ce(!1),Object.keys(t).forEach(function(n){Se(e,n,t[n])}),Ce(!0))}(t),function(e){e._watchers=[];var t=e.$options;t.props&&function(e,t){var n=e.$options.propsData||{},r=e._props={},i=e.$options._propKeys=[];e.$parent&&Ce(!1);var o=function(o){i.push(o);var a=He(o,t,n,e);Se(r,o,a),o in e||gn(e,"_props",o)};for(var a in t)o(a);Ce(!0)}(e,t.props),t.methods&&function(e,t){for(var n in e.$options.props,t)e[n]="function"!=typeof t[n]?N:S(t[n],e)}(e,t.methods),t.data?function(e){var t=e.$options.data;l(t=e._data="function"==typeof t?function(e,t){de();try{return e.call(t,t)}catch(e){return Ue(e,t,"data()"),{}}finally{he()}}(t,e):t||{})||(t={});for(var n,r=Object.keys(t),i=e.$options.props,o=(e.$options.methods,r.length);o--;){var a=r[o];i&&b(i,a)||36!==(n=(a+"").charCodeAt(0))&&95!==n&&gn(e,"_data",a)}Ae(t,!0)}(e):Ae(e._data={},!0),t.computed&&function(e,t){var n=e._computedWatchers=Object.create(null),r=ie();for(var i in t){var o=t[i],a="function"==typeof o?o:o.get;r||(n[i]=new hn(e,a||N,N,mn)),i in e||yn(e,i,o)}}(e,t.computed),t.watch&&t.watch!==te&&function(e,t){for(var n in t){var r=t[n];if(Array.isArray(r))for(var i=0;i<r.length;i++)wn(e,n,r[i]);else wn(e,n,r)}}(e,t.watch)}(t),function(e){var t=e.$options.provide;t&&(e._provided="function"==typeof t?t.call(e):t)}(t),tn(t,"created"),t.$options.el&&t.$mount(t.$options.el)},function(e){Object.defineProperty(e.prototype,"$data",{get:function(){return this._data}}),Object.defineProperty(e.prototype,"$props",{get:function(){return this._props}}),e.prototype.$set=Oe,e.prototype.$delete=De,e.prototype.$watch=function(e,t,n){if(l(t))return wn(this,e,t,n);(n=n||{}).user=!0;var r=new hn(this,e,t,n);if(n.immediate)try{t.call(this,r.value)}catch(e){Ue(e,this,'callback for immediate watcher "'+r.expression+'"')}return function(){r.teardown()}}}(Cn),function(e){var t=/^hook:/;e.prototype.$on=function(e,n){var r=this;if(Array.isArray(e))for(var i=0,o=e.length;i<o;i++)r.$on(e[i],n);else(r._events[e]||(r._events[e]=[])).push(n),t.test(e)&&(r._hasHookEvent=!0);return r},e.prototype.$once=function(e,t){var n=this;function r(){n.$off(e,r),t.apply(n,arguments)}return r.fn=t,n.$on(e,r),n},e.prototype.$off=function(e,t){var n=this;if(!arguments.length)return n._events=Object.create(null),n;if(Array.isArray(e)){for(var r=0,i=e.length;r<i;r++)n.$off(e[r],t);return n}var o,a=n._events[e];if(!a)return n;if(!t)return n._events[e]=null,n;for(var s=a.length;s--;)if((o=a[s])===t||o.fn===t){a.splice(s,1);break}return n},e.prototype.$emit=function(e){var t=this._events[e];if(t){t=t.length>1?O(t):t;for(var n=O(arguments,1),r='event handler for "'+e+'"',i=0,o=t.length;i<o;i++)Be(t[i],this,n,this,r)}return this}}(Cn),function(e){e.prototype._update=function(e,t){var n=this,r=n.$el,i=n._vnode,o=Jt(n);n._vnode=e,n.$el=i?n.__patch__(i,e):n.__patch__(n.$el,e,t,!1),o(),r&&(r.__vue__=null),n.$el&&(n.$el.__vue__=n),n.$vnode&&n.$parent&&n.$vnode===n.$parent._vnode&&(n.$parent.$el=n.$el)},e.prototype.$forceUpdate=function(){this._watcher&&this._watcher.update()},e.prototype.$destroy=function(){var e=this;if(!e._isBeingDestroyed){tn(e,"beforeDestroy"),e._isBeingDestroyed=!0;var t=e.$parent;!t||t._isBeingDestroyed||e.$options.abstract||y(t.$children,e),e._watcher&&e._watcher.teardown();for(var n=e._watchers.length;n--;)e._watchers[n].teardown();e._data.__ob__&&e._data.__ob__.vmCount--,e._isDestroyed=!0,e.__patch__(e._vnode,null),tn(e,"destroyed"),e.$off(),e.$el&&(e.$el.__vue__=null),e.$vnode&&(e.$vnode.parent=null)}}}(Cn),function(e){Nt(e.prototype),e.prototype.$nextTick=function(e){return tt(e,this)},e.prototype._render=function(){var e,t=this,n=t.$options,r=n.render,i=n._parentVnode;i&&(t.$scopedSlots=ht(i.data.scopedSlots,t.$slots,t.$scopedSlots)),t.$vnode=i;try{Bt=t,e=r.call(t._renderProxy,t.$createElement)}catch(n){Ue(n,t,"render"),e=t._vnode}finally{Bt=null}return Array.isArray(e)&&1===e.length&&(e=e[0]),e instanceof ve||(e=me()),e.parent=i,e}}(Cn);var Dn=[String,RegExp,Array],In={KeepAlive:{name:"keep-alive",abstract:!0,props:{include:Dn,exclude:Dn,max:[String,Number]},created:function(){this.cache=Object.create(null),this.keys=[]},destroyed:function(){for(var e in this.cache)On(this.cache,e,this.keys)},mounted:function(){var e=this;this.$watch("include",function(t){Sn(e,function(e){return An(t,e)})}),this.$watch("exclude",function(t){Sn(e,function(e){return!An(t,e)})})},render:function(){var e=this.$slots.default,t=zt(e),n=t&&t.componentOptions;if(n){var r=xn(n),i=this.include,o=this.exclude;if(i&&(!r||!An(i,r))||o&&r&&An(o,r))return t;var a=this.cache,s=this.keys,u=null==t.key?n.Ctor.cid+(n.tag?"::"+n.tag:""):t.key;a[u]?(t.componentInstance=a[u].componentInstance,y(s,u),s.push(u)):(a[u]=t,s.push(u),this.max&&s.length>parseInt(this.max)&&On(a,s[0],s,this._vnode)),t.data.keepAlive=!0}return t||e&&e[0]}}};!function(e){var t={get:function(){return F}};Object.defineProperty(e,"config",t),e.util={warn:ce,extend:D,mergeOptions:Pe,defineReactive:Se},e.set=Oe,e.delete=De,e.nextTick=tt,e.observable=function(e){return Ae(e),e},e.options=Object.create(null),H.forEach(function(t){e.options[t+"s"]=Object.create(null)}),e.options._base=e,D(e.options.components,In),function(e){e.use=function(e){var t=this._installedPlugins||(this._installedPlugins=[]);if(t.indexOf(e)>-1)return this;var n=O(arguments,1);return n.unshift(this),"function"==typeof e.install?e.install.apply(e,n):"function"==typeof e&&e.apply(null,n),t.push(e),this}}(e),function(e){e.mixin=function(e){return this.options=Pe(this.options,e),this}}(e),function(e){e.cid=0;var t=1;e.extend=function(e){e=e||{};var n=this,r=n.cid,i=e._Ctor||(e._Ctor={});if(i[r])return i[r];var o=e.name||n.options.name,a=function(e){this._init(e)};return(a.prototype=Object.create(n.prototype)).constructor=a,a.cid=t++,a.options=Pe(n.options,e),a.super=n,a.options.props&&function(e){var t=e.options.props;for(var n in t)gn(e.prototype,"_props",n)}(a),a.options.computed&&function(e){var t=e.options.computed;for(var n in t)yn(e.prototype,n,t[n])}(a),a.extend=n.extend,a.mixin=n.mixin,a.use=n.use,H.forEach(function(e){a[e]=n[e]}),o&&(a.options.components[o]=a),a.superOptions=n.options,a.extendOptions=e,a.sealedOptions=D({},a.options),i[r]=a,a}}(e),function(e){H.forEach(function(t){e[t]=function(e,n){return n?("component"===t&&l(n)&&(n.name=n.name||e,n=this.options._base.extend(n)),"directive"===t&&"function"==typeof n&&(n={bind:n,update:n}),this.options[t+"s"][e]=n,n):this.options[t+"s"][e]}})}(e)}(Cn),Object.defineProperty(Cn.prototype,"$isServer",{get:ie}),Object.defineProperty(Cn.prototype,"$ssrContext",{get:function(){return this.$vnode&&this.$vnode.ssrContext}}),Object.defineProperty(Cn,"FunctionalRenderContext",{value:kt}),Cn.version="2.6.10";var Nn=v("style,class"),kn=v("input,textarea,option,select,progress"),Ln=function(e,t,n){return"value"===n&&kn(e)&&"button"!==t||"selected"===n&&"option"===e||"checked"===n&&"input"===e||"muted"===n&&"video"===e},jn=v("contenteditable,draggable,spellcheck"),Rn=v("events,caret,typing,plaintext-only"),Pn=function(e,t){return Wn(t)||"false"===t?"false":"contenteditable"===e&&Rn(t)?t:"true"},$n=v("allowfullscreen,async,autofocus,autoplay,checked,compact,controls,declare,default,defaultchecked,defaultmuted,defaultselected,defer,disabled,enabled,formnovalidate,hidden,indeterminate,inert,ismap,itemscope,loop,multiple,muted,nohref,noresize,noshade,novalidate,nowrap,open,pauseonexit,readonly,required,reversed,scoped,seamless,selected,sortable,translate,truespeed,typemustmatch,visible"),Hn="http://www.w3.org/1999/xlink",Mn=function(e){return":"===e.charAt(5)&&"xlink"===e.slice(0,5)},Fn=function(e){return Mn(e)?e.slice(6,e.length):""},Wn=function(e){return null==e||!1===e};function Un(e,t){return{staticClass:Bn(e.staticClass,t.staticClass),class:o(e.class)?[e.class,t.class]:t.class}}function Bn(e,t){return e?t?e+" "+t:e:t||""}function qn(e){return Array.isArray(e)?function(e){for(var t,n="",r=0,i=e.length;r<i;r++)o(t=qn(e[r]))&&""!==t&&(n&&(n+=" "),n+=t);return n}(e):u(e)?function(e){var t="";for(var n in e)e[n]&&(t&&(t+=" "),t+=n);return t}(e):"string"==typeof e?e:""}var Vn={svg:"http://www.w3.org/2000/svg",math:"http://www.w3.org/1998/Math/MathML"},zn=v("html,body,base,head,link,meta,style,title,address,article,aside,footer,header,h1,h2,h3,h4,h5,h6,hgroup,nav,section,div,dd,dl,dt,figcaption,figure,picture,hr,img,li,main,ol,p,pre,ul,a,b,abbr,bdi,bdo,br,cite,code,data,dfn,em,i,kbd,mark,q,rp,rt,rtc,ruby,s,samp,small,span,strong,sub,sup,time,u,var,wbr,area,audio,map,track,video,embed,object,param,source,canvas,script,noscript,del,ins,caption,col,colgroup,table,thead,tbody,td,th,tr,button,datalist,fieldset,form,input,label,legend,meter,optgroup,option,output,progress,select,textarea,details,dialog,menu,menuitem,summary,content,element,shadow,template,blockquote,iframe,tfoot"),Gn=v("svg,animate,circle,clippath,cursor,defs,desc,ellipse,filter,font-face,foreignObject,g,glyph,image,line,marker,mask,missing-glyph,path,pattern,polygon,polyline,rect,switch,symbol,text,textpath,tspan,use,view",!0),Kn=function(e){return zn(e)||Gn(e)};function Xn(e){return Gn(e)?"svg":"math"===e?"math":void 0}var Qn=Object.create(null),Yn=v("text,number,password,search,email,tel,url");function Jn(e){return"string"==typeof e?document.querySelector(e)||document.createElement("div"):e}var Zn=Object.freeze({createElement:function(e,t){var n=document.createElement(e);return"select"!==e?n:(t.data&&t.data.attrs&&void 0!==t.data.attrs.multiple&&n.setAttribute("multiple","multiple"),n)},createElementNS:function(e,t){return document.createElementNS(Vn[e],t)},createTextNode:function(e){return document.createTextNode(e)},createComment:function(e){return document.createComment(e)},insertBefore:function(e,t,n){e.insertBefore(t,n)},removeChild:function(e,t){e.removeChild(t)},appendChild:function(e,t){e.appendChild(t)},parentNode:function(e){return e.parentNode},nextSibling:function(e){return e.nextSibling},tagName:function(e){return e.tagName},setTextContent:function(e,t){e.textContent=t},setStyleScope:function(e,t){e.setAttribute(t,"")}}),er={create:function(e,t){tr(t)},update:function(e,t){e.data.ref!==t.data.ref&&(tr(e,!0),tr(t))},destroy:function(e){tr(e,!0)}};function tr(e,t){var n=e.data.ref;if(o(n)){var r=e.context,i=e.componentInstance||e.elm,a=r.$refs;t?Array.isArray(a[n])?y(a[n],i):a[n]===i&&(a[n]=void 0):e.data.refInFor?Array.isArray(a[n])?a[n].indexOf(i)<0&&a[n].push(i):a[n]=[i]:a[n]=i}}var nr=new ve("",{},[]),rr=["create","activate","update","remove","destroy"];function ir(e,t){return e.key===t.key&&(e.tag===t.tag&&e.isComment===t.isComment&&o(e.data)===o(t.data)&&function(e,t){if("input"!==e.tag)return!0;var n,r=o(n=e.data)&&o(n=n.attrs)&&n.type,i=o(n=t.data)&&o(n=n.attrs)&&n.type;return r===i||Yn(r)&&Yn(i)}(e,t)||a(e.isAsyncPlaceholder)&&e.asyncFactory===t.asyncFactory&&i(t.asyncFactory.error))}function or(e,t,n){var r,i,a={};for(r=t;r<=n;++r)o(i=e[r].key)&&(a[i]=r);return a}var ar={create:sr,update:sr,destroy:function(e){sr(e,nr)}};function sr(e,t){(e.data.directives||t.data.directives)&&function(e,t){var n,r,i,o=e===nr,a=t===nr,s=cr(e.data.directives,e.context),u=cr(t.data.directives,t.context),c=[],l=[];for(n in u)r=s[n],i=u[n],r?(i.oldValue=r.value,i.oldArg=r.arg,fr(i,"update",t,e),i.def&&i.def.componentUpdated&&l.push(i)):(fr(i,"bind",t,e),i.def&&i.def.inserted&&c.push(i));if(c.length){var f=function(){for(var n=0;n<c.length;n++)fr(c[n],"inserted",t,e)};o?st(t,"insert",f):f()}if(l.length&&st(t,"postpatch",function(){for(var n=0;n<l.length;n++)fr(l[n],"componentUpdated",t,e)}),!o)for(n in s)u[n]||fr(s[n],"unbind",e,e,a)}(e,t)}var ur=Object.create(null);function cr(e,t){var n,r,i=Object.create(null);if(!e)return i;for(n=0;n<e.length;n++)(r=e[n]).modifiers||(r.modifiers=ur),i[lr(r)]=r,r.def=$e(t.$options,"directives",r.name);return i}function lr(e){return e.rawName||e.name+"."+Object.keys(e.modifiers||{}).join(".")}function fr(e,t,n,r,i){var o=e.def&&e.def[t];if(o)try{o(n.elm,e,n,r,i)}catch(r){Ue(r,n.context,"directive "+e.name+" "+t+" hook")}}var pr=[er,ar];function dr(e,t){var n=t.componentOptions;if(!(o(n)&&!1===n.Ctor.options.inheritAttrs||i(e.data.attrs)&&i(t.data.attrs))){var r,a,s=t.elm,u=e.data.attrs||{},c=t.data.attrs||{};for(r in o(c.__ob__)&&(c=t.data.attrs=D({},c)),c)a=c[r],u[r]!==a&&hr(s,r,a);for(r in(Q||J)&&c.value!==u.value&&hr(s,"value",c.value),u)i(c[r])&&(Mn(r)?s.removeAttributeNS(Hn,Fn(r)):jn(r)||s.removeAttribute(r))}}function hr(e,t,n){e.tagName.indexOf("-")>-1?vr(e,t,n):$n(t)?Wn(n)?e.removeAttribute(t):(n="allowfullscreen"===t&&"EMBED"===e.tagName?"true":t,e.setAttribute(t,n)):jn(t)?e.setAttribute(t,Pn(t,n)):Mn(t)?Wn(n)?e.removeAttributeNS(Hn,Fn(t)):e.setAttributeNS(Hn,t,n):vr(e,t,n)}function vr(e,t,n){if(Wn(n))e.removeAttribute(t);else{if(Q&&!Y&&"TEXTAREA"===e.tagName&&"placeholder"===t&&""!==n&&!e.__ieph){var r=function(t){t.stopImmediatePropagation(),e.removeEventListener("input",r)};e.addEventListener("input",r),e.__ieph=!0}e.setAttribute(t,n)}}var gr={create:dr,update:dr};function mr(e,t){var n=t.elm,r=t.data,a=e.data;if(!(i(r.staticClass)&&i(r.class)&&(i(a)||i(a.staticClass)&&i(a.class)))){var s=function(e){for(var t=e.data,n=e,r=e;o(r.componentInstance);)(r=r.componentInstance._vnode)&&r.data&&(t=Un(r.data,t));for(;o(n=n.parent);)n&&n.data&&(t=Un(t,n.data));return function(e,t){return o(e)||o(t)?Bn(e,qn(t)):""}(t.staticClass,t.class)}(t),u=n._transitionClasses;o(u)&&(s=Bn(s,qn(u))),s!==n._prevClass&&(n.setAttribute("class",s),n._prevClass=s)}}var yr,_r,br,wr,Er,Tr,Cr={create:mr,update:mr},xr=/[\w).+\-_$\]]/;function Ar(e){var t,n,r,i,o,a=!1,s=!1,u=!1,c=!1,l=0,f=0,p=0,d=0;for(r=0;r<e.length;r++)if(n=t,t=e.charCodeAt(r),a)39===t&&92!==n&&(a=!1);else if(s)34===t&&92!==n&&(s=!1);else if(u)96===t&&92!==n&&(u=!1);else if(c)47===t&&92!==n&&(c=!1);else if(124!==t||124===e.charCodeAt(r+1)||124===e.charCodeAt(r-1)||l||f||p){switch(t){case 34:s=!0;break;case 39:a=!0;break;case 96:u=!0;break;case 40:p++;break;case 41:p--;break;case 91:f++;break;case 93:f--;break;case 123:l++;break;case 125:l--}if(47===t){for(var h=r-1,v=void 0;h>=0&&" "===(v=e.charAt(h));h--);v&&xr.test(v)||(c=!0)}}else void 0===i?(d=r+1,i=e.slice(0,r).trim()):g();function g(){(o||(o=[])).push(e.slice(d,r).trim()),d=r+1}if(void 0===i?i=e.slice(0,r).trim():0!==d&&g(),o)for(r=0;r<o.length;r++)i=Sr(i,o[r]);return i}function Sr(e,t){var n=t.indexOf("(");if(n<0)return'_f("'+t+'")('+e+")";var r=t.slice(0,n),i=t.slice(n+1);return'_f("'+r+'")('+e+(")"!==i?","+i:i)}function Or(e,t){console.error("[Vue compiler]: "+e)}function Dr(e,t){return e?e.map(function(e){return e[t]}).filter(function(e){return e}):[]}function Ir(e,t,n,r,i){(e.props||(e.props=[])).push(Mr({name:t,value:n,dynamic:i},r)),e.plain=!1}function Nr(e,t,n,r,i){(i?e.dynamicAttrs||(e.dynamicAttrs=[]):e.attrs||(e.attrs=[])).push(Mr({name:t,value:n,dynamic:i},r)),e.plain=!1}function kr(e,t,n,r){e.attrsMap[t]=n,e.attrsList.push(Mr({name:t,value:n},r))}function Lr(e,t,n,r,i,o,a,s){(e.directives||(e.directives=[])).push(Mr({name:t,rawName:n,value:r,arg:i,isDynamicArg:o,modifiers:a},s)),e.plain=!1}function jr(e,t,n){return n?"_p("+t+',"'+e+'")':e+t}function Rr(e,t,n,i,o,a,s,u){var c;(i=i||r).right?u?t="("+t+")==='click'?'contextmenu':("+t+")":"click"===t&&(t="contextmenu",delete i.right):i.middle&&(u?t="("+t+")==='click'?'mouseup':("+t+")":"click"===t&&(t="mouseup")),i.capture&&(delete i.capture,t=jr("!",t,u)),i.once&&(delete i.once,t=jr("~",t,u)),i.passive&&(delete i.passive,t=jr("&",t,u)),i.native?(delete i.native,c=e.nativeEvents||(e.nativeEvents={})):c=e.events||(e.events={});var l=Mr({value:n.trim(),dynamic:u},s);i!==r&&(l.modifiers=i);var f=c[t];Array.isArray(f)?o?f.unshift(l):f.push(l):c[t]=f?o?[l,f]:[f,l]:l,e.plain=!1}function Pr(e,t,n){var r=$r(e,":"+t)||$r(e,"v-bind:"+t);if(null!=r)return Ar(r);if(!1!==n){var i=$r(e,t);if(null!=i)return JSON.stringify(i)}}function $r(e,t,n){var r;if(null!=(r=e.attrsMap[t]))for(var i=e.attrsList,o=0,a=i.length;o<a;o++)if(i[o].name===t){i.splice(o,1);break}return n&&delete e.attrsMap[t],r}function Hr(e,t){for(var n=e.attrsList,r=0,i=n.length;r<i;r++){var o=n[r];if(t.test(o.name))return n.splice(r,1),o}}function Mr(e,t){return t&&(null!=t.start&&(e.start=t.start),null!=t.end&&(e.end=t.end)),e}function Fr(e,t,n){var r=n||{},i=r.number,o="$$v";r.trim&&(o="(typeof $$v === 'string'? $$v.trim(): $$v)"),i&&(o="_n("+o+")");var a=Wr(t,o);e.model={value:"("+t+")",expression:JSON.stringify(t),callback:"function ($$v) {"+a+"}"}}function Wr(e,t){var n=function(e){if(e=e.trim(),yr=e.length,e.indexOf("[")<0||e.lastIndexOf("]")<yr-1)return(wr=e.lastIndexOf("."))>-1?{exp:e.slice(0,wr),key:'"'+e.slice(wr+1)+'"'}:{exp:e,key:null};for(_r=e,wr=Er=Tr=0;!Br();)qr(br=Ur())?zr(br):91===br&&Vr(br);return{exp:e.slice(0,Er),key:e.slice(Er+1,Tr)}}(e);return null===n.key?e+"="+t:"$set("+n.exp+", "+n.key+", "+t+")"}function Ur(){return _r.charCodeAt(++wr)}function Br(){return wr>=yr}function qr(e){return 34===e||39===e}function Vr(e){var t=1;for(Er=wr;!Br();)if(qr(e=Ur()))zr(e);else if(91===e&&t++,93===e&&t--,0===t){Tr=wr;break}}function zr(e){for(var t=e;!Br()&&(e=Ur())!==t;);}var Gr,Kr="__r",Xr="__c";function Qr(e,t,n){var r=Gr;return function i(){null!==t.apply(null,arguments)&&Zr(e,i,n,r)}}var Yr=Ge&&!(ee&&Number(ee[1])<=53);function Jr(e,t,n,r){if(Yr){var i=cn,o=t;t=o._wrapper=function(e){if(e.target===e.currentTarget||e.timeStamp>=i||e.timeStamp<=0||e.target.ownerDocument!==document)return o.apply(this,arguments)}}Gr.addEventListener(e,t,ne?{capture:n,passive:r}:n)}function Zr(e,t,n,r){(r||Gr).removeEventListener(e,t._wrapper||t,n)}function ei(e,t){if(!i(e.data.on)||!i(t.data.on)){var n=t.data.on||{},r=e.data.on||{};Gr=t.elm,function(e){if(o(e[Kr])){var t=Q?"change":"input";e[t]=[].concat(e[Kr],e[t]||[]),delete e[Kr]}o(e[Xr])&&(e.change=[].concat(e[Xr],e.change||[]),delete e[Xr])}(n),at(n,r,Jr,Zr,Qr,t.context),Gr=void 0}}var ti,ni={create:ei,update:ei};function ri(e,t){if(!i(e.data.domProps)||!i(t.data.domProps)){var n,r,a=t.elm,s=e.data.domProps||{},u=t.data.domProps||{};for(n in o(u.__ob__)&&(u=t.data.domProps=D({},u)),s)n in u||(a[n]="");for(n in u){if(r=u[n],"textContent"===n||"innerHTML"===n){if(t.children&&(t.children.length=0),r===s[n])continue;1===a.childNodes.length&&a.removeChild(a.childNodes[0])}if("value"===n&&"PROGRESS"!==a.tagName){a._value=r;var c=i(r)?"":String(r);ii(a,c)&&(a.value=c)}else if("innerHTML"===n&&Gn(a.tagName)&&i(a.innerHTML)){(ti=ti||document.createElement("div")).innerHTML="<svg>"+r+"</svg>";for(var l=ti.firstChild;a.firstChild;)a.removeChild(a.firstChild);for(;l.firstChild;)a.appendChild(l.firstChild)}else if(r!==s[n])try{a[n]=r}catch(e){}}}}function ii(e,t){return!e.composing&&("OPTION"===e.tagName||function(e,t){var n=!0;try{n=document.activeElement!==e}catch(e){}return n&&e.value!==t}(e,t)||function(e,t){var n=e.value,r=e._vModifiers;if(o(r)){if(r.number)return h(n)!==h(t);if(r.trim)return n.trim()!==t.trim()}return n!==t}(e,t))}var oi={create:ri,update:ri},ai=w(function(e){var t={},n=/:(.+)/;return e.split(/;(?![^(]*\))/g).forEach(function(e){if(e){var r=e.split(n);r.length>1&&(t[r[0].trim()]=r[1].trim())}}),t});function si(e){var t=ui(e.style);return e.staticStyle?D(e.staticStyle,t):t}function ui(e){return Array.isArray(e)?I(e):"string"==typeof e?ai(e):e}var ci,li=/^--/,fi=/\s*!important$/,pi=function(e,t,n){if(li.test(t))e.style.setProperty(t,n);else if(fi.test(n))e.style.setProperty(A(t),n.replace(fi,""),"important");else{var r=hi(t);if(Array.isArray(n))for(var i=0,o=n.length;i<o;i++)e.style[r]=n[i];else e.style[r]=n}},di=["Webkit","Moz","ms"],hi=w(function(e){if(ci=ci||document.createElement("div").style,"filter"!==(e=T(e))&&e in ci)return e;for(var t=e.charAt(0).toUpperCase()+e.slice(1),n=0;n<di.length;n++){var r=di[n]+t;if(r in ci)return r}});function vi(e,t){var n=t.data,r=e.data;if(!(i(n.staticStyle)&&i(n.style)&&i(r.staticStyle)&&i(r.style))){var a,s,u=t.elm,c=r.staticStyle,l=r.normalizedStyle||r.style||{},f=c||l,p=ui(t.data.style)||{};t.data.normalizedStyle=o(p.__ob__)?D({},p):p;var d=function(e,t){for(var n,r={},i=e;i.componentInstance;)(i=i.componentInstance._vnode)&&i.data&&(n=si(i.data))&&D(r,n);(n=si(e.data))&&D(r,n);for(var o=e;o=o.parent;)o.data&&(n=si(o.data))&&D(r,n);return r}(t);for(s in f)i(d[s])&&pi(u,s,"");for(s in d)(a=d[s])!==f[s]&&pi(u,s,null==a?"":a)}}var gi={create:vi,update:vi},mi=/\s+/;function yi(e,t){if(t&&(t=t.trim()))if(e.classList)t.indexOf(" ")>-1?t.split(mi).forEach(function(t){return e.classList.add(t)}):e.classList.add(t);else{var n=" "+(e.getAttribute("class")||"")+" ";n.indexOf(" "+t+" ")<0&&e.setAttribute("class",(n+t).trim())}}function _i(e,t){if(t&&(t=t.trim()))if(e.classList)t.indexOf(" ")>-1?t.split(mi).forEach(function(t){return e.classList.remove(t)}):e.classList.remove(t),e.classList.length||e.removeAttribute("class");else{for(var n=" "+(e.getAttribute("class")||"")+" ",r=" "+t+" ";n.indexOf(r)>=0;)n=n.replace(r," ");(n=n.trim())?e.setAttribute("class",n):e.removeAttribute("class")}}function bi(e){if(e){if("object"==typeof e){var t={};return!1!==e.css&&D(t,wi(e.name||"v")),D(t,e),t}return"string"==typeof e?wi(e):void 0}}var wi=w(function(e){return{enterClass:e+"-enter",enterToClass:e+"-enter-to",enterActiveClass:e+"-enter-active",leaveClass:e+"-leave",leaveToClass:e+"-leave-to",leaveActiveClass:e+"-leave-active"}}),Ei=z&&!Y,Ti="transition",Ci="animation",xi="transition",Ai="transitionend",Si="animation",Oi="animationend";Ei&&(void 0===window.ontransitionend&&void 0!==window.onwebkittransitionend&&(xi="WebkitTransition",Ai="webkitTransitionEnd"),void 0===window.onanimationend&&void 0!==window.onwebkitanimationend&&(Si="WebkitAnimation",Oi="webkitAnimationEnd"));var Di=z?window.requestAnimationFrame?window.requestAnimationFrame.bind(window):setTimeout:function(e){return e()};function Ii(e){Di(function(){Di(e)})}function Ni(e,t){var n=e._transitionClasses||(e._transitionClasses=[]);n.indexOf(t)<0&&(n.push(t),yi(e,t))}function ki(e,t){e._transitionClasses&&y(e._transitionClasses,t),_i(e,t)}function Li(e,t,n){var r=Ri(e,t),i=r.type,o=r.timeout,a=r.propCount;if(!i)return n();var s=i===Ti?Ai:Oi,u=0,c=function(){e.removeEventListener(s,l),n()},l=function(t){t.target===e&&++u>=a&&c()};setTimeout(function(){u<a&&c()},o+1),e.addEventListener(s,l)}var ji=/\b(transform|all)(,|$)/;function Ri(e,t){var n,r=window.getComputedStyle(e),i=(r[xi+"Delay"]||"").split(", "),o=(r[xi+"Duration"]||"").split(", "),a=Pi(i,o),s=(r[Si+"Delay"]||"").split(", "),u=(r[Si+"Duration"]||"").split(", "),c=Pi(s,u),l=0,f=0;return t===Ti?a>0&&(n=Ti,l=a,f=o.length):t===Ci?c>0&&(n=Ci,l=c,f=u.length):f=(n=(l=Math.max(a,c))>0?a>c?Ti:Ci:null)?n===Ti?o.length:u.length:0,{type:n,timeout:l,propCount:f,hasTransform:n===Ti&&ji.test(r[xi+"Property"])}}function Pi(e,t){for(;e.length<t.length;)e=e.concat(e);return Math.max.apply(null,t.map(function(t,n){return $i(t)+$i(e[n])}))}function $i(e){return 1e3*Number(e.slice(0,-1).replace(",","."))}function Hi(e,t){var n=e.elm;o(n._leaveCb)&&(n._leaveCb.cancelled=!0,n._leaveCb());var r=bi(e.data.transition);if(!i(r)&&!o(n._enterCb)&&1===n.nodeType){for(var a=r.css,s=r.type,c=r.enterClass,l=r.enterToClass,f=r.enterActiveClass,p=r.appearClass,d=r.appearToClass,v=r.appearActiveClass,g=r.beforeEnter,m=r.enter,y=r.afterEnter,_=r.enterCancelled,b=r.beforeAppear,w=r.appear,E=r.afterAppear,T=r.appearCancelled,C=r.duration,x=Yt,A=Yt.$vnode;A&&A.parent;)x=A.context,A=A.parent;var S=!x._isMounted||!e.isRootInsert;if(!S||w||""===w){var O=S&&p?p:c,D=S&&v?v:f,I=S&&d?d:l,N=S&&b||g,k=S&&"function"==typeof w?w:m,L=S&&E||y,j=S&&T||_,R=h(u(C)?C.enter:C),$=!1!==a&&!Y,H=Wi(k),M=n._enterCb=P(function(){$&&(ki(n,I),ki(n,D)),M.cancelled?($&&ki(n,O),j&&j(n)):L&&L(n),n._enterCb=null});e.data.show||st(e,"insert",function(){var t=n.parentNode,r=t&&t._pending&&t._pending[e.key];r&&r.tag===e.tag&&r.elm._leaveCb&&r.elm._leaveCb(),k&&k(n,M)}),N&&N(n),$&&(Ni(n,O),Ni(n,D),Ii(function(){ki(n,O),M.cancelled||(Ni(n,I),H||(Fi(R)?setTimeout(M,R):Li(n,s,M)))})),e.data.show&&(t&&t(),k&&k(n,M)),$||H||M()}}}function Mi(e,t){var n=e.elm;o(n._enterCb)&&(n._enterCb.cancelled=!0,n._enterCb());var r=bi(e.data.transition);if(i(r)||1!==n.nodeType)return t();if(!o(n._leaveCb)){var a=r.css,s=r.type,c=r.leaveClass,l=r.leaveToClass,f=r.leaveActiveClass,p=r.beforeLeave,d=r.leave,v=r.afterLeave,g=r.leaveCancelled,m=r.delayLeave,y=r.duration,_=!1!==a&&!Y,b=Wi(d),w=h(u(y)?y.leave:y),E=n._leaveCb=P(function(){n.parentNode&&n.parentNode._pending&&(n.parentNode._pending[e.key]=null),_&&(ki(n,l),ki(n,f)),E.cancelled?(_&&ki(n,c),g&&g(n)):(t(),v&&v(n)),n._leaveCb=null});m?m(T):T()}function T(){E.cancelled||(!e.data.show&&n.parentNode&&((n.parentNode._pending||(n.parentNode._pending={}))[e.key]=e),p&&p(n),_&&(Ni(n,c),Ni(n,f),Ii(function(){ki(n,c),E.cancelled||(Ni(n,l),b||(Fi(w)?setTimeout(E,w):Li(n,s,E)))})),d&&d(n,E),_||b||E())}}function Fi(e){return"number"==typeof e&&!isNaN(e)}function Wi(e){if(i(e))return!1;var t=e.fns;return o(t)?Wi(Array.isArray(t)?t[0]:t):(e._length||e.length)>1}function Ui(e,t){!0!==t.data.show&&Hi(t)}var Bi=function(e){var t,n,r={},u=e.modules,c=e.nodeOps;for(t=0;t<rr.length;++t)for(r[rr[t]]=[],n=0;n<u.length;++n)o(u[n][rr[t]])&&r[rr[t]].push(u[n][rr[t]]);function l(e){var t=c.parentNode(e);o(t)&&c.removeChild(t,e)}function f(e,t,n,i,s,u,l){if(o(e.elm)&&o(u)&&(e=u[l]=_e(e)),e.isRootInsert=!s,!function(e,t,n,i){var s=e.data;if(o(s)){var u=o(e.componentInstance)&&s.keepAlive;if(o(s=s.hook)&&o(s=s.init)&&s(e,!1),o(e.componentInstance))return p(e,t),d(n,e.elm,i),a(u)&&function(e,t,n,i){for(var a,s=e;s.componentInstance;)if(o(a=(s=s.componentInstance._vnode).data)&&o(a=a.transition)){for(a=0;a<r.activate.length;++a)r.activate[a](nr,s);t.push(s);break}d(n,e.elm,i)}(e,t,n,i),!0}}(e,t,n,i)){var f=e.data,v=e.children,g=e.tag;o(g)?(e.elm=e.ns?c.createElementNS(e.ns,g):c.createElement(g,e),y(e),h(e,v,t),o(f)&&m(e,t),d(n,e.elm,i)):a(e.isComment)?(e.elm=c.createComment(e.text),d(n,e.elm,i)):(e.elm=c.createTextNode(e.text),d(n,e.elm,i))}}function p(e,t){o(e.data.pendingInsert)&&(t.push.apply(t,e.data.pendingInsert),e.data.pendingInsert=null),e.elm=e.componentInstance.$el,g(e)?(m(e,t),y(e)):(tr(e),t.push(e))}function d(e,t,n){o(e)&&(o(n)?c.parentNode(n)===e&&c.insertBefore(e,t,n):c.appendChild(e,t))}function h(e,t,n){if(Array.isArray(t))for(var r=0;r<t.length;++r)f(t[r],n,e.elm,null,!0,t,r);else s(e.text)&&c.appendChild(e.elm,c.createTextNode(String(e.text)))}function g(e){for(;e.componentInstance;)e=e.componentInstance._vnode;return o(e.tag)}function m(e,n){for(var i=0;i<r.create.length;++i)r.create[i](nr,e);o(t=e.data.hook)&&(o(t.create)&&t.create(nr,e),o(t.insert)&&n.push(e))}function y(e){var t;if(o(t=e.fnScopeId))c.setStyleScope(e.elm,t);else for(var n=e;n;)o(t=n.context)&&o(t=t.$options._scopeId)&&c.setStyleScope(e.elm,t),n=n.parent;o(t=Yt)&&t!==e.context&&t!==e.fnContext&&o(t=t.$options._scopeId)&&c.setStyleScope(e.elm,t)}function _(e,t,n,r,i,o){for(;r<=i;++r)f(n[r],o,e,t,!1,n,r)}function b(e){var t,n,i=e.data;if(o(i))for(o(t=i.hook)&&o(t=t.destroy)&&t(e),t=0;t<r.destroy.length;++t)r.destroy[t](e);if(o(t=e.children))for(n=0;n<e.children.length;++n)b(e.children[n])}function w(e,t,n,r){for(;n<=r;++n){var i=t[n];o(i)&&(o(i.tag)?(E(i),b(i)):l(i.elm))}}function E(e,t){if(o(t)||o(e.data)){var n,i=r.remove.length+1;for(o(t)?t.listeners+=i:t=function(e,t){function n(){0==--n.listeners&&l(e)}return n.listeners=t,n}(e.elm,i),o(n=e.componentInstance)&&o(n=n._vnode)&&o(n.data)&&E(n,t),n=0;n<r.remove.length;++n)r.remove[n](e,t);o(n=e.data.hook)&&o(n=n.remove)?n(e,t):t()}else l(e.elm)}function T(e,t,n,r){for(var i=n;i<r;i++){var a=t[i];if(o(a)&&ir(e,a))return i}}function C(e,t,n,s,u,l){if(e!==t){o(t.elm)&&o(s)&&(t=s[u]=_e(t));var p=t.elm=e.elm;if(a(e.isAsyncPlaceholder))o(t.asyncFactory.resolved)?S(e.elm,t,n):t.isAsyncPlaceholder=!0;else if(a(t.isStatic)&&a(e.isStatic)&&t.key===e.key&&(a(t.isCloned)||a(t.isOnce)))t.componentInstance=e.componentInstance;else{var d,h=t.data;o(h)&&o(d=h.hook)&&o(d=d.prepatch)&&d(e,t);var v=e.children,m=t.children;if(o(h)&&g(t)){for(d=0;d<r.update.length;++d)r.update[d](e,t);o(d=h.hook)&&o(d=d.update)&&d(e,t)}i(t.text)?o(v)&&o(m)?v!==m&&function(e,t,n,r,a){for(var s,u,l,p=0,d=0,h=t.length-1,v=t[0],g=t[h],m=n.length-1,y=n[0],b=n[m],E=!a;p<=h&&d<=m;)i(v)?v=t[++p]:i(g)?g=t[--h]:ir(v,y)?(C(v,y,r,n,d),v=t[++p],y=n[++d]):ir(g,b)?(C(g,b,r,n,m),g=t[--h],b=n[--m]):ir(v,b)?(C(v,b,r,n,m),E&&c.insertBefore(e,v.elm,c.nextSibling(g.elm)),v=t[++p],b=n[--m]):ir(g,y)?(C(g,y,r,n,d),E&&c.insertBefore(e,g.elm,v.elm),g=t[--h],y=n[++d]):(i(s)&&(s=or(t,p,h)),i(u=o(y.key)?s[y.key]:T(y,t,p,h))?f(y,r,e,v.elm,!1,n,d):ir(l=t[u],y)?(C(l,y,r,n,d),t[u]=void 0,E&&c.insertBefore(e,l.elm,v.elm)):f(y,r,e,v.elm,!1,n,d),y=n[++d]);p>h?_(e,i(n[m+1])?null:n[m+1].elm,n,d,m,r):d>m&&w(0,t,p,h)}(p,v,m,n,l):o(m)?(o(e.text)&&c.setTextContent(p,""),_(p,null,m,0,m.length-1,n)):o(v)?w(0,v,0,v.length-1):o(e.text)&&c.setTextContent(p,""):e.text!==t.text&&c.setTextContent(p,t.text),o(h)&&o(d=h.hook)&&o(d=d.postpatch)&&d(e,t)}}}function x(e,t,n){if(a(n)&&o(e.parent))e.parent.data.pendingInsert=t;else for(var r=0;r<t.length;++r)t[r].data.hook.insert(t[r])}var A=v("attrs,class,staticClass,staticStyle,key");function S(e,t,n,r){var i,s=t.tag,u=t.data,c=t.children;if(r=r||u&&u.pre,t.elm=e,a(t.isComment)&&o(t.asyncFactory))return t.isAsyncPlaceholder=!0,!0;if(o(u)&&(o(i=u.hook)&&o(i=i.init)&&i(t,!0),o(i=t.componentInstance)))return p(t,n),!0;if(o(s)){if(o(c))if(e.hasChildNodes())if(o(i=u)&&o(i=i.domProps)&&o(i=i.innerHTML)){if(i!==e.innerHTML)return!1}else{for(var l=!0,f=e.firstChild,d=0;d<c.length;d++){if(!f||!S(f,c[d],n,r)){l=!1;break}f=f.nextSibling}if(!l||f)return!1}else h(t,c,n);if(o(u)){var v=!1;for(var g in u)if(!A(g)){v=!0,m(t,n);break}!v&&u.class&&rt(u.class)}}else e.data!==t.text&&(e.data=t.text);return!0}return function(e,t,n,s){if(!i(t)){var u,l=!1,p=[];if(i(e))l=!0,f(t,p);else{var d=o(e.nodeType);if(!d&&ir(e,t))C(e,t,p,null,null,s);else{if(d){if(1===e.nodeType&&e.hasAttribute($)&&(e.removeAttribute($),n=!0),a(n)&&S(e,t,p))return x(t,p,!0),e;u=e,e=new ve(c.tagName(u).toLowerCase(),{},[],void 0,u)}var h=e.elm,v=c.parentNode(h);if(f(t,p,h._leaveCb?null:v,c.nextSibling(h)),o(t.parent))for(var m=t.parent,y=g(t);m;){for(var _=0;_<r.destroy.length;++_)r.destroy[_](m);if(m.elm=t.elm,y){for(var E=0;E<r.create.length;++E)r.create[E](nr,m);var T=m.data.hook.insert;if(T.merged)for(var A=1;A<T.fns.length;A++)T.fns[A]()}else tr(m);m=m.parent}o(v)?w(0,[e],0,0):o(e.tag)&&b(e)}}return x(t,p,l),t.elm}o(e)&&b(e)}}({nodeOps:Zn,modules:[gr,Cr,ni,oi,gi,z?{create:Ui,activate:Ui,remove:function(e,t){!0!==e.data.show?Mi(e,t):t()}}:{}].concat(pr)});Y&&document.addEventListener("selectionchange",function(){var e=document.activeElement;e&&e.vmodel&&Yi(e,"input")});var qi={inserted:function(e,t,n,r){"select"===n.tag?(r.elm&&!r.elm._vOptions?st(n,"postpatch",function(){qi.componentUpdated(e,t,n)}):Vi(e,t,n.context),e._vOptions=[].map.call(e.options,Ki)):("textarea"===n.tag||Yn(e.type))&&(e._vModifiers=t.modifiers,t.modifiers.lazy||(e.addEventListener("compositionstart",Xi),e.addEventListener("compositionend",Qi),e.addEventListener("change",Qi),Y&&(e.vmodel=!0)))},componentUpdated:function(e,t,n){if("select"===n.tag){Vi(e,t,n.context);var r=e._vOptions,i=e._vOptions=[].map.call(e.options,Ki);i.some(function(e,t){return!j(e,r[t])})&&(e.multiple?t.value.some(function(e){return Gi(e,i)}):t.value!==t.oldValue&&Gi(t.value,i))&&Yi(e,"change")}}};function Vi(e,t,n){zi(e,t,n),(Q||J)&&setTimeout(function(){zi(e,t,n)},0)}function zi(e,t,n){var r=t.value,i=e.multiple;if(!i||Array.isArray(r)){for(var o,a,s=0,u=e.options.length;s<u;s++)if(a=e.options[s],i)o=R(r,Ki(a))>-1,a.selected!==o&&(a.selected=o);else if(j(Ki(a),r))return void(e.selectedIndex!==s&&(e.selectedIndex=s));i||(e.selectedIndex=-1)}}function Gi(e,t){return t.every(function(t){return!j(t,e)})}function Ki(e){return"_value"in e?e._value:e.value}function Xi(e){e.target.composing=!0}function Qi(e){e.target.composing&&(e.target.composing=!1,Yi(e.target,"input"))}function Yi(e,t){var n=document.createEvent("HTMLEvents");n.initEvent(t,!0,!0),e.dispatchEvent(n)}function Ji(e){return!e.componentInstance||e.data&&e.data.transition?e:Ji(e.componentInstance._vnode)}var Zi={model:qi,show:{bind:function(e,t,n){var r=t.value,i=(n=Ji(n)).data&&n.data.transition,o=e.__vOriginalDisplay="none"===e.style.display?"":e.style.display;r&&i?(n.data.show=!0,Hi(n,function(){e.style.display=o})):e.style.display=r?o:"none"},update:function(e,t,n){var r=t.value;!r!=!t.oldValue&&((n=Ji(n)).data&&n.data.transition?(n.data.show=!0,r?Hi(n,function(){e.style.display=e.__vOriginalDisplay}):Mi(n,function(){e.style.display="none"})):e.style.display=r?e.__vOriginalDisplay:"none")},unbind:function(e,t,n,r,i){i||(e.style.display=e.__vOriginalDisplay)}}},eo={name:String,appear:Boolean,css:Boolean,mode:String,type:String,enterClass:String,leaveClass:String,enterToClass:String,leaveToClass:String,enterActiveClass:String,leaveActiveClass:String,appearClass:String,appearActiveClass:String,appearToClass:String,duration:[Number,String,Object]};function to(e){var t=e&&e.componentOptions;return t&&t.Ctor.options.abstract?to(zt(t.children)):e}function no(e){var t={},n=e.$options;for(var r in n.propsData)t[r]=e[r];var i=n._parentListeners;for(var o in i)t[T(o)]=i[o];return t}function ro(e,t){if(/\d-keep-alive$/.test(t.tag))return e("keep-alive",{props:t.componentOptions.propsData})}var io=function(e){return e.tag||Vt(e)},oo=function(e){return"show"===e.name},ao={name:"transition",props:eo,abstract:!0,render:function(e){var t=this,n=this.$slots.default;if(n&&(n=n.filter(io)).length){var r=this.mode,i=n[0];if(function(e){for(;e=e.parent;)if(e.data.transition)return!0}(this.$vnode))return i;var o=to(i);if(!o)return i;if(this._leaving)return ro(e,i);var a="__transition-"+this._uid+"-";o.key=null==o.key?o.isComment?a+"comment":a+o.tag:s(o.key)?0===String(o.key).indexOf(a)?o.key:a+o.key:o.key;var u=(o.data||(o.data={})).transition=no(this),c=this._vnode,l=to(c);if(o.data.directives&&o.data.directives.some(oo)&&(o.data.show=!0),l&&l.data&&!function(e,t){return t.key===e.key&&t.tag===e.tag}(o,l)&&!Vt(l)&&(!l.componentInstance||!l.componentInstance._vnode.isComment)){var f=l.data.transition=D({},u);if("out-in"===r)return this._leaving=!0,st(f,"afterLeave",function(){t._leaving=!1,t.$forceUpdate()}),ro(e,i);if("in-out"===r){if(Vt(o))return c;var p,d=function(){p()};st(u,"afterEnter",d),st(u,"enterCancelled",d),st(f,"delayLeave",function(e){p=e})}}return i}}},so=D({tag:String,moveClass:String},eo);function uo(e){e.elm._moveCb&&e.elm._moveCb(),e.elm._enterCb&&e.elm._enterCb()}function co(e){e.data.newPos=e.elm.getBoundingClientRect()}function lo(e){var t=e.data.pos,n=e.data.newPos,r=t.left-n.left,i=t.top-n.top;if(r||i){e.data.moved=!0;var o=e.elm.style;o.transform=o.WebkitTransform="translate("+r+"px,"+i+"px)",o.transitionDuration="0s"}}delete so.mode;var fo={Transition:ao,TransitionGroup:{props:so,beforeMount:function(){var e=this,t=this._update;this._update=function(n,r){var i=Jt(e);e.__patch__(e._vnode,e.kept,!1,!0),e._vnode=e.kept,i(),t.call(e,n,r)}},render:function(e){for(var t=this.tag||this.$vnode.data.tag||"span",n=Object.create(null),r=this.prevChildren=this.children,i=this.$slots.default||[],o=this.children=[],a=no(this),s=0;s<i.length;s++){var u=i[s];u.tag&&null!=u.key&&0!==String(u.key).indexOf("__vlist")&&(o.push(u),n[u.key]=u,(u.data||(u.data={})).transition=a)}if(r){for(var c=[],l=[],f=0;f<r.length;f++){var p=r[f];p.data.transition=a,p.data.pos=p.elm.getBoundingClientRect(),n[p.key]?c.push(p):l.push(p)}this.kept=e(t,null,c),this.removed=l}return e(t,null,o)},updated:function(){var e=this.prevChildren,t=this.moveClass||(this.name||"v")+"-move";e.length&&this.hasMove(e[0].elm,t)&&(e.forEach(uo),e.forEach(co),e.forEach(lo),this._reflow=document.body.offsetHeight,e.forEach(function(e){if(e.data.moved){var n=e.elm,r=n.style;Ni(n,t),r.transform=r.WebkitTransform=r.transitionDuration="",n.addEventListener(Ai,n._moveCb=function e(r){r&&r.target!==n||r&&!/transform$/.test(r.propertyName)||(n.removeEventListener(Ai,e),n._moveCb=null,ki(n,t))})}}))},methods:{hasMove:function(e,t){if(!Ei)return!1;if(this._hasMove)return this._hasMove;var n=e.cloneNode();e._transitionClasses&&e._transitionClasses.forEach(function(e){_i(n,e)}),yi(n,t),n.style.display="none",this.$el.appendChild(n);var r=Ri(n);return this.$el.removeChild(n),this._hasMove=r.hasTransform}}}};Cn.config.mustUseProp=Ln,Cn.config.isReservedTag=Kn,Cn.config.isReservedAttr=Nn,Cn.config.getTagNamespace=Xn,Cn.config.isUnknownElement=function(e){if(!z)return!0;if(Kn(e))return!1;if(e=e.toLowerCase(),null!=Qn[e])return Qn[e];var t=document.createElement(e);return e.indexOf("-")>-1?Qn[e]=t.constructor===window.HTMLUnknownElement||t.constructor===window.HTMLElement:Qn[e]=/HTMLUnknownElement/.test(t.toString())},D(Cn.options.directives,Zi),D(Cn.options.components,fo),Cn.prototype.__patch__=z?Bi:N,Cn.prototype.$mount=function(e,t){return function(e,t,n){var r;return e.$el=t,e.$options.render||(e.$options.render=me),tn(e,"beforeMount"),r=function(){e._update(e._render(),n)},new hn(e,r,N,{before:function(){e._isMounted&&!e._isDestroyed&&tn(e,"beforeUpdate")}},!0),n=!1,null==e.$vnode&&(e._isMounted=!0,tn(e,"mounted")),e}(this,e=e&&z?Jn(e):void 0,t)},z&&setTimeout(function(){F.devtools&&oe&&oe.emit("init",Cn)},0);var po,ho=/\{\{((?:.|\r?\n)+?)\}\}/g,vo=/[-.*+?^${}()|[\]\/\\]/g,go=w(function(e){var t=e[0].replace(vo,"\\$&"),n=e[1].replace(vo,"\\$&");return new RegExp(t+"((?:.|\\n)+?)"+n,"g")}),mo={staticKeys:["staticClass"],transformNode:function(e,t){t.warn;var n=$r(e,"class");n&&(e.staticClass=JSON.stringify(n));var r=Pr(e,"class",!1);r&&(e.classBinding=r)},genData:function(e){var t="";return e.staticClass&&(t+="staticClass:"+e.staticClass+","),e.classBinding&&(t+="class:"+e.classBinding+","),t}},yo={staticKeys:["staticStyle"],transformNode:function(e,t){t.warn;var n=$r(e,"style");n&&(e.staticStyle=JSON.stringify(ai(n)));var r=Pr(e,"style",!1);r&&(e.styleBinding=r)},genData:function(e){var t="";return e.staticStyle&&(t+="staticStyle:"+e.staticStyle+","),e.styleBinding&&(t+="style:("+e.styleBinding+"),"),t}},_o=v("area,base,br,col,embed,frame,hr,img,input,isindex,keygen,link,meta,param,source,track,wbr"),bo=v("colgroup,dd,dt,li,options,p,td,tfoot,th,thead,tr,source"),wo=v("address,article,aside,base,blockquote,body,caption,col,colgroup,dd,details,dialog,div,dl,dt,fieldset,figcaption,figure,footer,form,h1,h2,h3,h4,h5,h6,head,header,hgroup,hr,html,legend,li,menuitem,meta,optgroup,option,param,rp,rt,source,style,summary,tbody,td,tfoot,th,thead,title,tr,track"),Eo=/^\s*([^\s"'<>\/=]+)(?:\s*(=)\s*(?:"([^"]*)"+|'([^']*)'+|([^\s"'=<>`]+)))?/,To=/^\s*((?:v-[\w-]+:|@|:|#)\[[^=]+\][^\s"'<>\/=]*)(?:\s*(=)\s*(?:"([^"]*)"+|'([^']*)'+|([^\s"'=<>`]+)))?/,Co="[a-zA-Z_][\\-\\.0-9_a-zA-Z"+W.source+"]*",xo="((?:"+Co+"\\:)?"+Co+")",Ao=new RegExp("^<"+xo),So=/^\s*(\/?)>/,Oo=new RegExp("^<\\/"+xo+"[^>]*>"),Do=/^<!DOCTYPE [^>]+>/i,Io=/^<!\--/,No=/^<!\[/,ko=v("script,style,textarea",!0),Lo={},jo={"<":"<",">":">",""":'"',"&":"&"," ":"\n","	":"\t","'":"'"},Ro=/&(?:lt|gt|quot|amp|#39);/g,Po=/&(?:lt|gt|quot|amp|#39|#10|#9);/g,$o=v("pre,textarea",!0),Ho=function(e,t){return e&&$o(e)&&"\n"===t[0]};function Mo(e,t){var n=t?Po:Ro;return e.replace(n,function(e){return jo[e]})}var Fo,Wo,Uo,Bo,qo,Vo,zo,Go,Ko=/^@|^v-on:/,Xo=/^v-|^@|^:/,Qo=/([\s\S]*?)\s+(?:in|of)\s+([\s\S]*)/,Yo=/,([^,\}\]]*)(?:,([^,\}\]]*))?$/,Jo=/^\(|\)$/g,Zo=/^\[.*\]$/,ea=/:(.*)$/,ta=/^:|^\.|^v-bind:/,na=/\.[^.\]]+(?=[^\]]*$)/g,ra=/^v-slot(:|$)|^#/,ia=/[\r\n]/,oa=/\s+/g,aa=w(function(e){return(po=po||document.createElement("div")).innerHTML=e,po.textContent}),sa="_empty_";function ua(e,t,n){return{type:1,tag:e,attrsList:t,attrsMap:ha(t),rawAttrsMap:{},parent:n,children:[]}}function ca(e,t){var n,r;(r=Pr(n=e,"key"))&&(n.key=r),e.plain=!e.key&&!e.scopedSlots&&!e.attrsList.length,function(e){var t=Pr(e,"ref");t&&(e.ref=t,e.refInFor=function(e){for(var t=e;t;){if(void 0!==t.for)return!0;t=t.parent}return!1}(e))}(e),function(e){var t;"template"===e.tag?(t=$r(e,"scope"),e.slotScope=t||$r(e,"slot-scope")):(t=$r(e,"slot-scope"))&&(e.slotScope=t);var n=Pr(e,"slot");if(n&&(e.slotTarget='""'===n?'"default"':n,e.slotTargetDynamic=!(!e.attrsMap[":slot"]&&!e.attrsMap["v-bind:slot"]),"template"===e.tag||e.slotScope||Nr(e,"slot",n,function(e,t){return e.rawAttrsMap[":"+t]||e.rawAttrsMap["v-bind:"+t]||e.rawAttrsMap[t]}(e,"slot"))),"template"===e.tag){var r=Hr(e,ra);if(r){var i=pa(r),o=i.name,a=i.dynamic;e.slotTarget=o,e.slotTargetDynamic=a,e.slotScope=r.value||sa}}else{var s=Hr(e,ra);if(s){var u=e.scopedSlots||(e.scopedSlots={}),c=pa(s),l=c.name,f=c.dynamic,p=u[l]=ua("template",[],e);p.slotTarget=l,p.slotTargetDynamic=f,p.children=e.children.filter(function(e){if(!e.slotScope)return e.parent=p,!0}),p.slotScope=s.value||sa,e.children=[],e.plain=!1}}}(e),function(e){"slot"===e.tag&&(e.slotName=Pr(e,"name"))}(e),function(e){var t;(t=Pr(e,"is"))&&(e.component=t),null!=$r(e,"inline-template")&&(e.inlineTemplate=!0)}(e);for(var i=0;i<Uo.length;i++)e=Uo[i](e,t)||e;return function(e){var t,n,r,i,o,a,s,u,c=e.attrsList;for(t=0,n=c.length;t<n;t++)if(r=i=c[t].name,o=c[t].value,Xo.test(r))if(e.hasBindings=!0,(a=da(r.replace(Xo,"")))&&(r=r.replace(na,"")),ta.test(r))r=r.replace(ta,""),o=Ar(o),(u=Zo.test(r))&&(r=r.slice(1,-1)),a&&(a.prop&&!u&&"innerHtml"===(r=T(r))&&(r="innerHTML"),a.camel&&!u&&(r=T(r)),a.sync&&(s=Wr(o,"$event"),u?Rr(e,'"update:"+('+r+")",s,null,!1,0,c[t],!0):(Rr(e,"update:"+T(r),s,null,!1,0,c[t]),A(r)!==T(r)&&Rr(e,"update:"+A(r),s,null,!1,0,c[t])))),a&&a.prop||!e.component&&zo(e.tag,e.attrsMap.type,r)?Ir(e,r,o,c[t],u):Nr(e,r,o,c[t],u);else if(Ko.test(r))r=r.replace(Ko,""),(u=Zo.test(r))&&(r=r.slice(1,-1)),Rr(e,r,o,a,!1,0,c[t],u);else{var l=(r=r.replace(Xo,"")).match(ea),f=l&&l[1];u=!1,f&&(r=r.slice(0,-(f.length+1)),Zo.test(f)&&(f=f.slice(1,-1),u=!0)),Lr(e,r,i,o,f,u,a,c[t])}else Nr(e,r,JSON.stringify(o),c[t]),!e.component&&"muted"===r&&zo(e.tag,e.attrsMap.type,r)&&Ir(e,r,"true",c[t])}(e),e}function la(e){var t;if(t=$r(e,"v-for")){var n=function(e){var t=e.match(Qo);if(t){var n={};n.for=t[2].trim();var r=t[1].trim().replace(Jo,""),i=r.match(Yo);return i?(n.alias=r.replace(Yo,"").trim(),n.iterator1=i[1].trim(),i[2]&&(n.iterator2=i[2].trim())):n.alias=r,n}}(t);n&&D(e,n)}}function fa(e,t){e.ifConditions||(e.ifConditions=[]),e.ifConditions.push(t)}function pa(e){var t=e.name.replace(ra,"");return t||"#"!==e.name[0]&&(t="default"),Zo.test(t)?{name:t.slice(1,-1),dynamic:!0}:{name:'"'+t+'"',dynamic:!1}}function da(e){var t=e.match(na);if(t){var n={};return t.forEach(function(e){n[e.slice(1)]=!0}),n}}function ha(e){for(var t={},n=0,r=e.length;n<r;n++)t[e[n].name]=e[n].value;return t}var va=/^xmlns:NS\d+/,ga=/^NS\d+:/;function ma(e){return ua(e.tag,e.attrsList.slice(),e.parent)}var ya,_a,ba=[mo,yo,{preTransformNode:function(e,t){if("input"===e.tag){var n,r=e.attrsMap;if(!r["v-model"])return;if((r[":type"]||r["v-bind:type"])&&(n=Pr(e,"type")),r.type||n||!r["v-bind"]||(n="("+r["v-bind"]+").type"),n){var i=$r(e,"v-if",!0),o=i?"&&("+i+")":"",a=null!=$r(e,"v-else",!0),s=$r(e,"v-else-if",!0),u=ma(e);la(u),kr(u,"type","checkbox"),ca(u,t),u.processed=!0,u.if="("+n+")==='checkbox'"+o,fa(u,{exp:u.if,block:u});var c=ma(e);$r(c,"v-for",!0),kr(c,"type","radio"),ca(c,t),fa(u,{exp:"("+n+")==='radio'"+o,block:c});var l=ma(e);return $r(l,"v-for",!0),kr(l,":type",n),ca(l,t),fa(u,{exp:i,block:l}),a?u.else=!0:s&&(u.elseif=s),u}}}}],wa={expectHTML:!0,modules:ba,directives:{model:function(e,t,n){var r=t.value,i=t.modifiers,o=e.tag,a=e.attrsMap.type;if(e.component)return Fr(e,r,i),!1;if("select"===o)!function(e,t,n){var r='var $$selectedVal = Array.prototype.filter.call($event.target.options,function(o){return o.selected}).map(function(o){var val = "_value" in o ? o._value : o.value;return '+(i&&i.number?"_n(val)":"val")+"});";Rr(e,"change",r=r+" "+Wr(t,"$event.target.multiple ? $$selectedVal : $$selectedVal[0]"),null,!0)}(e,r);else if("input"===o&&"checkbox"===a)!function(e,t,n){var r=n&&n.number,i=Pr(e,"value")||"null",o=Pr(e,"true-value")||"true",a=Pr(e,"false-value")||"false";Ir(e,"checked","Array.isArray("+t+")?_i("+t+","+i+")>-1"+("true"===o?":("+t+")":":_q("+t+","+o+")")),Rr(e,"change","var $$a="+t+",$$el=$event.target,$$c=$$el.checked?("+o+"):("+a+");if(Array.isArray($$a)){var $$v="+(r?"_n("+i+")":i)+",$$i=_i($$a,$$v);if($$el.checked){$$i<0&&("+Wr(t,"$$a.concat([$$v])")+")}else{$$i>-1&&("+Wr(t,"$$a.slice(0,$$i).concat($$a.slice($$i+1))")+")}}else{"+Wr(t,"$$c")+"}",null,!0)}(e,r,i);else if("input"===o&&"radio"===a)!function(e,t,n){var r=n&&n.number,i=Pr(e,"value")||"null";Ir(e,"checked","_q("+t+","+(i=r?"_n("+i+")":i)+")"),Rr(e,"change",Wr(t,i),null,!0)}(e,r,i);else if("input"===o||"textarea"===o)!function(e,t,n){var r=e.attrsMap.type,i=n||{},o=i.lazy,a=i.number,s=i.trim,u=!o&&"range"!==r,c=o?"change":"range"===r?Kr:"input",l="$event.target.value";s&&(l="$event.target.value.trim()"),a&&(l="_n("+l+")");var f=Wr(t,l);u&&(f="if($event.target.composing)return;"+f),Ir(e,"value","("+t+")"),Rr(e,c,f,null,!0),(s||a)&&Rr(e,"blur","$forceUpdate()")}(e,r,i);else if(!F.isReservedTag(o))return Fr(e,r,i),!1;return!0},text:function(e,t){t.value&&Ir(e,"textContent","_s("+t.value+")",t)},html:function(e,t){t.value&&Ir(e,"innerHTML","_s("+t.value+")",t)}},isPreTag:function(e){return"pre"===e},isUnaryTag:_o,mustUseProp:Ln,canBeLeftOpenTag:bo,isReservedTag:Kn,getTagNamespace:Xn,staticKeys:ba.reduce(function(e,t){return e.concat(t.staticKeys||[])},[]).join(",")},Ea=w(function(e){return v("type,tag,attrsList,attrsMap,plain,parent,children,attrs,start,end,rawAttrsMap"+(e?","+e:""))});var Ta=/^([\w$_]+|\([^)]*?\))\s*=>|^function\s*(?:[\w$]+)?\s*\(/,Ca=/\([^)]*?\);*$/,xa=/^[A-Za-z_$][\w$]*(?:\.[A-Za-z_$][\w$]*|\['[^']*?']|\["[^"]*?"]|\[\d+]|\[[A-Za-z_$][\w$]*])*$/,Aa={esc:27,tab:9,enter:13,space:32,up:38,left:37,right:39,down:40,delete:[8,46]},Sa={esc:["Esc","Escape"],tab:"Tab",enter:"Enter",space:[" ","Spacebar"],up:["Up","ArrowUp"],left:["Left","ArrowLeft"],right:["Right","ArrowRight"],down:["Down","ArrowDown"],delete:["Backspace","Delete","Del"]},Oa=function(e){return"if("+e+")return null;"},Da={stop:"$event.stopPropagation();",prevent:"$event.preventDefault();",self:Oa("$event.target !== $event.currentTarget"),ctrl:Oa("!$event.ctrlKey"),shift:Oa("!$event.shiftKey"),alt:Oa("!$event.altKey"),meta:Oa("!$event.metaKey"),left:Oa("'button' in $event && $event.button !== 0"),middle:Oa("'button' in $event && $event.button !== 1"),right:Oa("'button' in $event && $event.button !== 2")};function Ia(e,t){var n=t?"nativeOn:":"on:",r="",i="";for(var o in e){var a=Na(e[o]);e[o]&&e[o].dynamic?i+=o+","+a+",":r+='"'+o+'":'+a+","}return r="{"+r.slice(0,-1)+"}",i?n+"_d("+r+",["+i.slice(0,-1)+"])":n+r}function Na(e){if(!e)return"function(){}";if(Array.isArray(e))return"["+e.map(function(e){return Na(e)}).join(",")+"]";var t=xa.test(e.value),n=Ta.test(e.value),r=xa.test(e.value.replace(Ca,""));if(e.modifiers){var i="",o="",a=[];for(var s in e.modifiers)if(Da[s])o+=Da[s],Aa[s]&&a.push(s);else if("exact"===s){var u=e.modifiers;o+=Oa(["ctrl","shift","alt","meta"].filter(function(e){return!u[e]}).map(function(e){return"$event."+e+"Key"}).join("||"))}else a.push(s);return a.length&&(i+="if(!$event.type.indexOf('key')&&"+a.map(ka).join("&&")+")return null;"),o&&(i+=o),"function($event){"+i+(t?"return "+e.value+"($event)":n?"return ("+e.value+")($event)":r?"return "+e.value:e.value)+"}"}return t||n?e.value:"function($event){"+(r?"return "+e.value:e.value)+"}"}function ka(e){var t=parseInt(e,10);if(t)return"$event.keyCode!=="+t;var n=Aa[e],r=Sa[e];return"_k($event.keyCode,"+JSON.stringify(e)+","+JSON.stringify(n)+",$event.key,"+JSON.stringify(r)+")"}var La={on:function(e,t){e.wrapListeners=function(e){return"_g("+e+","+t.value+")"}},bind:function(e,t){e.wrapData=function(n){return"_b("+n+",'"+e.tag+"',"+t.value+","+(t.modifiers&&t.modifiers.prop?"true":"false")+(t.modifiers&&t.modifiers.sync?",true":"")+")"}},cloak:N},ja=function(e){this.options=e,this.warn=e.warn||Or,this.transforms=Dr(e.modules,"transformCode"),this.dataGenFns=Dr(e.modules,"genData"),this.directives=D(D({},La),e.directives);var t=e.isReservedTag||k;this.maybeComponent=function(e){return!!e.component||!t(e.tag)},this.onceId=0,this.staticRenderFns=[],this.pre=!1};function Ra(e,t){var n=new ja(t);return{render:"with(this){return "+(e?Pa(e,n):'_c("div")')+"}",staticRenderFns:n.staticRenderFns}}function Pa(e,t){if(e.parent&&(e.pre=e.pre||e.parent.pre),e.staticRoot&&!e.staticProcessed)return $a(e,t);if(e.once&&!e.onceProcessed)return Ha(e,t);if(e.for&&!e.forProcessed)return Fa(e,t);if(e.if&&!e.ifProcessed)return Ma(e,t);if("template"!==e.tag||e.slotTarget||t.pre){if("slot"===e.tag)return function(e,t){var n=e.slotName||'"default"',r=qa(e,t),i="_t("+n+(r?","+r:""),o=e.attrs||e.dynamicAttrs?Ga((e.attrs||[]).concat(e.dynamicAttrs||[]).map(function(e){return{name:T(e.name),value:e.value,dynamic:e.dynamic}})):null,a=e.attrsMap["v-bind"];return!o&&!a||r||(i+=",null"),o&&(i+=","+o),a&&(i+=(o?"":",null")+","+a),i+")"}(e,t);var n;if(e.component)n=function(e,t,n){var r=t.inlineTemplate?null:qa(t,n,!0);return"_c("+e+","+Wa(t,n)+(r?","+r:"")+")"}(e.component,e,t);else{var r;(!e.plain||e.pre&&t.maybeComponent(e))&&(r=Wa(e,t));var i=e.inlineTemplate?null:qa(e,t,!0);n="_c('"+e.tag+"'"+(r?","+r:"")+(i?","+i:"")+")"}for(var o=0;o<t.transforms.length;o++)n=t.transforms[o](e,n);return n}return qa(e,t)||"void 0"}function $a(e,t){e.staticProcessed=!0;var n=t.pre;return e.pre&&(t.pre=e.pre),t.staticRenderFns.push("with(this){return "+Pa(e,t)+"}"),t.pre=n,"_m("+(t.staticRenderFns.length-1)+(e.staticInFor?",true":"")+")"}function Ha(e,t){if(e.onceProcessed=!0,e.if&&!e.ifProcessed)return Ma(e,t);if(e.staticInFor){for(var n="",r=e.parent;r;){if(r.for){n=r.key;break}r=r.parent}return n?"_o("+Pa(e,t)+","+t.onceId+++","+n+")":Pa(e,t)}return $a(e,t)}function Ma(e,t,n,r){return e.ifProcessed=!0,function e(t,n,r,i){if(!t.length)return i||"_e()";var o=t.shift();return o.exp?"("+o.exp+")?"+a(o.block)+":"+e(t,n,r,i):""+a(o.block);function a(e){return r?r(e,n):e.once?Ha(e,n):Pa(e,n)}}(e.ifConditions.slice(),t,n,r)}function Fa(e,t,n,r){var i=e.for,o=e.alias,a=e.iterator1?","+e.iterator1:"",s=e.iterator2?","+e.iterator2:"";return e.forProcessed=!0,(r||"_l")+"(("+i+"),function("+o+a+s+"){return "+(n||Pa)(e,t)+"})"}function Wa(e,t){var n="{",r=function(e,t){var n=e.directives;if(n){var r,i,o,a,s="directives:[",u=!1;for(r=0,i=n.length;r<i;r++){o=n[r],a=!0;var c=t.directives[o.name];c&&(a=!!c(e,o,t.warn)),a&&(u=!0,s+='{name:"'+o.name+'",rawName:"'+o.rawName+'"'+(o.value?",value:("+o.value+"),expression:"+JSON.stringify(o.value):"")+(o.arg?",arg:"+(o.isDynamicArg?o.arg:'"'+o.arg+'"'):"")+(o.modifiers?",modifiers:"+JSON.stringify(o.modifiers):"")+"},")}return u?s.slice(0,-1)+"]":void 0}}(e,t);r&&(n+=r+","),e.key&&(n+="key:"+e.key+","),e.ref&&(n+="ref:"+e.ref+","),e.refInFor&&(n+="refInFor:true,"),e.pre&&(n+="pre:true,"),e.component&&(n+='tag:"'+e.tag+'",');for(var i=0;i<t.dataGenFns.length;i++)n+=t.dataGenFns[i](e);if(e.attrs&&(n+="attrs:"+Ga(e.attrs)+","),e.props&&(n+="domProps:"+Ga(e.props)+","),e.events&&(n+=Ia(e.events,!1)+","),e.nativeEvents&&(n+=Ia(e.nativeEvents,!0)+","),e.slotTarget&&!e.slotScope&&(n+="slot:"+e.slotTarget+","),e.scopedSlots&&(n+=function(e,t,n){var r=e.for||Object.keys(t).some(function(e){var n=t[e];return n.slotTargetDynamic||n.if||n.for||Ua(n)}),i=!!e.if;if(!r)for(var o=e.parent;o;){if(o.slotScope&&o.slotScope!==sa||o.for){r=!0;break}o.if&&(i=!0),o=o.parent}var a=Object.keys(t).map(function(e){return Ba(t[e],n)}).join(",");return"scopedSlots:_u(["+a+"]"+(r?",null,true":"")+(!r&&i?",null,false,"+function(e){for(var t=5381,n=e.length;n;)t=33*t^e.charCodeAt(--n);return t>>>0}(a):"")+")"}(e,e.scopedSlots,t)+","),e.model&&(n+="model:{value:"+e.model.value+",callback:"+e.model.callback+",expression:"+e.model.expression+"},"),e.inlineTemplate){var o=function(e,t){var n=e.children[0];if(n&&1===n.type){var r=Ra(n,t.options);return"inlineTemplate:{render:function(){"+r.render+"},staticRenderFns:["+r.staticRenderFns.map(function(e){return"function(){"+e+"}"}).join(",")+"]}"}}(e,t);o&&(n+=o+",")}return n=n.replace(/,$/,"")+"}",e.dynamicAttrs&&(n="_b("+n+',"'+e.tag+'",'+Ga(e.dynamicAttrs)+")"),e.wrapData&&(n=e.wrapData(n)),e.wrapListeners&&(n=e.wrapListeners(n)),n}function Ua(e){return 1===e.type&&("slot"===e.tag||e.children.some(Ua))}function Ba(e,t){var n=e.attrsMap["slot-scope"];if(e.if&&!e.ifProcessed&&!n)return Ma(e,t,Ba,"null");if(e.for&&!e.forProcessed)return Fa(e,t,Ba);var r=e.slotScope===sa?"":String(e.slotScope),i="function("+r+"){return "+("template"===e.tag?e.if&&n?"("+e.if+")?"+(qa(e,t)||"undefined")+":undefined":qa(e,t)||"undefined":Pa(e,t))+"}",o=r?"":",proxy:true";return"{key:"+(e.slotTarget||'"default"')+",fn:"+i+o+"}"}function qa(e,t,n,r,i){var o=e.children;if(o.length){var a=o[0];if(1===o.length&&a.for&&"template"!==a.tag&&"slot"!==a.tag){var s=n?t.maybeComponent(a)?",1":",0":"";return""+(r||Pa)(a,t)+s}var u=n?function(e,t){for(var n=0,r=0;r<e.length;r++){var i=e[r];if(1===i.type){if(Va(i)||i.ifConditions&&i.ifConditions.some(function(e){return Va(e.block)})){n=2;break}(t(i)||i.ifConditions&&i.ifConditions.some(function(e){return t(e.block)}))&&(n=1)}}return n}(o,t.maybeComponent):0,c=i||za;return"["+o.map(function(e){return c(e,t)}).join(",")+"]"+(u?","+u:"")}}function Va(e){return void 0!==e.for||"template"===e.tag||"slot"===e.tag}function za(e,t){return 1===e.type?Pa(e,t):3===e.type&&e.isComment?(r=e,"_e("+JSON.stringify(r.text)+")"):"_v("+(2===(n=e).type?n.expression:Ka(JSON.stringify(n.text)))+")";var n,r}function Ga(e){for(var t="",n="",r=0;r<e.length;r++){var i=e[r],o=Ka(i.value);i.dynamic?n+=i.name+","+o+",":t+='"'+i.name+'":'+o+","}return t="{"+t.slice(0,-1)+"}",n?"_d("+t+",["+n.slice(0,-1)+"])":t}function Ka(e){return e.replace(/\u2028/g,"\\u2028").replace(/\u2029/g,"\\u2029")}function Xa(e,t){try{return new Function(e)}catch(n){return t.push({err:n,code:e}),N}}function Qa(e){var t=Object.create(null);return function(n,r,i){(r=D({},r)).warn,delete r.warn;var o=r.delimiters?String(r.delimiters)+n:n;if(t[o])return t[o];var a=e(n,r),s={},u=[];return s.render=Xa(a.render,u),s.staticRenderFns=a.staticRenderFns.map(function(e){return Xa(e,u)}),t[o]=s}}new RegExp("\\b"+"do,if,for,let,new,try,var,case,else,with,await,break,catch,class,const,super,throw,while,yield,delete,export,import,return,switch,default,extends,finally,continue,debugger,function,arguments".split(",").join("\\b|\\b")+"\\b");var Ya,Ja,Za=(Ya=function(e,t){var n=function(e,t){Fo=t.warn||Or,Vo=t.isPreTag||k,zo=t.mustUseProp||k,Go=t.getTagNamespace||k,t.isReservedTag,Uo=Dr(t.modules,"transformNode"),Bo=Dr(t.modules,"preTransformNode"),qo=Dr(t.modules,"postTransformNode"),Wo=t.delimiters;var n,r,i=[],o=!1!==t.preserveWhitespace,a=t.whitespace,s=!1,u=!1;function c(e){if(l(e),s||e.processed||(e=ca(e,t)),i.length||e===n||n.if&&(e.elseif||e.else)&&fa(n,{exp:e.elseif,block:e}),r&&!e.forbidden)if(e.elseif||e.else)a=e,(c=function(e){for(var t=e.length;t--;){if(1===e[t].type)return e[t];e.pop()}}(r.children))&&c.if&&fa(c,{exp:a.elseif,block:a});else{if(e.slotScope){var o=e.slotTarget||'"default"';(r.scopedSlots||(r.scopedSlots={}))[o]=e}r.children.push(e),e.parent=r}var a,c;e.children=e.children.filter(function(e){return!e.slotScope}),l(e),e.pre&&(s=!1),Vo(e.tag)&&(u=!1);for(var f=0;f<qo.length;f++)qo[f](e,t)}function l(e){if(!u)for(var t;(t=e.children[e.children.length-1])&&3===t.type&&" "===t.text;)e.children.pop()}return function(e,t){for(var n,r,i=[],o=t.expectHTML,a=t.isUnaryTag||k,s=t.canBeLeftOpenTag||k,u=0;e;){if(n=e,r&&ko(r)){var c=0,l=r.toLowerCase(),f=Lo[l]||(Lo[l]=new RegExp("([\\s\\S]*?)(</"+l+"[^>]*>)","i")),p=e.replace(f,function(e,n,r){return c=r.length,ko(l)||"noscript"===l||(n=n.replace(/<!\--([\s\S]*?)-->/g,"$1").replace(/<!\[CDATA\[([\s\S]*?)]]>/g,"$1")),Ho(l,n)&&(n=n.slice(1)),t.chars&&t.chars(n),""});u+=e.length-p.length,e=p,A(l,u-c,u)}else{var d=e.indexOf("<");if(0===d){if(Io.test(e)){var h=e.indexOf("--\x3e");if(h>=0){t.shouldKeepComment&&t.comment(e.substring(4,h),u,u+h+3),T(h+3);continue}}if(No.test(e)){var v=e.indexOf("]>");if(v>=0){T(v+2);continue}}var g=e.match(Do);if(g){T(g[0].length);continue}var m=e.match(Oo);if(m){var y=u;T(m[0].length),A(m[1],y,u);continue}var _=C();if(_){x(_),Ho(_.tagName,e)&&T(1);continue}}var b=void 0,w=void 0,E=void 0;if(d>=0){for(w=e.slice(d);!(Oo.test(w)||Ao.test(w)||Io.test(w)||No.test(w)||(E=w.indexOf("<",1))<0);)d+=E,w=e.slice(d);b=e.substring(0,d)}d<0&&(b=e),b&&T(b.length),t.chars&&b&&t.chars(b,u-b.length,u)}if(e===n){t.chars&&t.chars(e);break}}function T(t){u+=t,e=e.substring(t)}function C(){var t=e.match(Ao);if(t){var n,r,i={tagName:t[1],attrs:[],start:u};for(T(t[0].length);!(n=e.match(So))&&(r=e.match(To)||e.match(Eo));)r.start=u,T(r[0].length),r.end=u,i.attrs.push(r);if(n)return i.unarySlash=n[1],T(n[0].length),i.end=u,i}}function x(e){var n=e.tagName,u=e.unarySlash;o&&("p"===r&&wo(n)&&A(r),s(n)&&r===n&&A(n));for(var c=a(n)||!!u,l=e.attrs.length,f=new Array(l),p=0;p<l;p++){var d=e.attrs[p],h=d[3]||d[4]||d[5]||"",v="a"===n&&"href"===d[1]?t.shouldDecodeNewlinesForHref:t.shouldDecodeNewlines;f[p]={name:d[1],value:Mo(h,v)}}c||(i.push({tag:n,lowerCasedTag:n.toLowerCase(),attrs:f,start:e.start,end:e.end}),r=n),t.start&&t.start(n,f,c,e.start,e.end)}function A(e,n,o){var a,s;if(null==n&&(n=u),null==o&&(o=u),e)for(s=e.toLowerCase(),a=i.length-1;a>=0&&i[a].lowerCasedTag!==s;a--);else a=0;if(a>=0){for(var c=i.length-1;c>=a;c--)t.end&&t.end(i[c].tag,n,o);i.length=a,r=a&&i[a-1].tag}else"br"===s?t.start&&t.start(e,[],!0,n,o):"p"===s&&(t.start&&t.start(e,[],!1,n,o),t.end&&t.end(e,n,o))}A()}(e,{warn:Fo,expectHTML:t.expectHTML,isUnaryTag:t.isUnaryTag,canBeLeftOpenTag:t.canBeLeftOpenTag,shouldDecodeNewlines:t.shouldDecodeNewlines,shouldDecodeNewlinesForHref:t.shouldDecodeNewlinesForHref,shouldKeepComment:t.comments,outputSourceRange:t.outputSourceRange,start:function(e,o,a,l,f){var p=r&&r.ns||Go(e);Q&&"svg"===p&&(o=function(e){for(var t=[],n=0;n<e.length;n++){var r=e[n];va.test(r.name)||(r.name=r.name.replace(ga,""),t.push(r))}return t}(o));var d,h=ua(e,o,r);p&&(h.ns=p),"style"!==(d=h).tag&&("script"!==d.tag||d.attrsMap.type&&"text/javascript"!==d.attrsMap.type)||ie()||(h.forbidden=!0);for(var v=0;v<Bo.length;v++)h=Bo[v](h,t)||h;s||(function(e){null!=$r(e,"v-pre")&&(e.pre=!0)}(h),h.pre&&(s=!0)),Vo(h.tag)&&(u=!0),s?function(e){var t=e.attrsList,n=t.length;if(n)for(var r=e.attrs=new Array(n),i=0;i<n;i++)r[i]={name:t[i].name,value:JSON.stringify(t[i].value)},null!=t[i].start&&(r[i].start=t[i].start,r[i].end=t[i].end);else e.pre||(e.plain=!0)}(h):h.processed||(la(h),function(e){var t=$r(e,"v-if");if(t)e.if=t,fa(e,{exp:t,block:e});else{null!=$r(e,"v-else")&&(e.else=!0);var n=$r(e,"v-else-if");n&&(e.elseif=n)}}(h),function(e){null!=$r(e,"v-once")&&(e.once=!0)}(h)),n||(n=h),a?c(h):(r=h,i.push(h))},end:function(e,t,n){var o=i[i.length-1];i.length-=1,r=i[i.length-1],c(o)},chars:function(e,t,n){if(r&&(!Q||"textarea"!==r.tag||r.attrsMap.placeholder!==e)){var i,c,l,f=r.children;(e=u||e.trim()?"script"===(i=r).tag||"style"===i.tag?e:aa(e):f.length?a?"condense"===a&&ia.test(e)?"":" ":o?" ":"":"")&&(u||"condense"!==a||(e=e.replace(oa," ")),!s&&" "!==e&&(c=function(e,t){var n=Wo?go(Wo):ho;if(n.test(e)){for(var r,i,o,a=[],s=[],u=n.lastIndex=0;r=n.exec(e);){(i=r.index)>u&&(s.push(o=e.slice(u,i)),a.push(JSON.stringify(o)));var c=Ar(r[1].trim());a.push("_s("+c+")"),s.push({"@binding":c}),u=i+r[0].length}return u<e.length&&(s.push(o=e.slice(u)),a.push(JSON.stringify(o))),{expression:a.join("+"),tokens:s}}}(e))?l={type:2,expression:c.expression,tokens:c.tokens,text:e}:" "===e&&f.length&&" "===f[f.length-1].text||(l={type:3,text:e}),l&&f.push(l))}},comment:function(e,t,n){if(r){var i={type:3,text:e,isComment:!0};r.children.push(i)}}}),n}(e.trim(),t);!1!==t.optimize&&function(e,t){e&&(ya=Ea(t.staticKeys||""),_a=t.isReservedTag||k,function e(t){if(t.static=function(e){return 2!==e.type&&(3===e.type||!(!e.pre&&(e.hasBindings||e.if||e.for||g(e.tag)||!_a(e.tag)||function(e){for(;e.parent;){if("template"!==(e=e.parent).tag)return!1;if(e.for)return!0}return!1}(e)||!Object.keys(e).every(ya))))}(t),1===t.type){if(!_a(t.tag)&&"slot"!==t.tag&&null==t.attrsMap["inline-template"])return;for(var n=0,r=t.children.length;n<r;n++){var i=t.children[n];e(i),i.static||(t.static=!1)}if(t.ifConditions)for(var o=1,a=t.ifConditions.length;o<a;o++){var s=t.ifConditions[o].block;e(s),s.static||(t.static=!1)}}}(e),function e(t,n){if(1===t.type){if((t.static||t.once)&&(t.staticInFor=n),t.static&&t.children.length&&(1!==t.children.length||3!==t.children[0].type))return void(t.staticRoot=!0);if(t.staticRoot=!1,t.children)for(var r=0,i=t.children.length;r<i;r++)e(t.children[r],n||!!t.for);if(t.ifConditions)for(var o=1,a=t.ifConditions.length;o<a;o++)e(t.ifConditions[o].block,n)}}(e,!1))}(n,t);var r=Ra(n,t);return{ast:n,render:r.render,staticRenderFns:r.staticRenderFns}},function(e){function t(t,n){var r=Object.create(e),i=[],o=[];if(n)for(var a in n.modules&&(r.modules=(e.modules||[]).concat(n.modules)),n.directives&&(r.directives=D(Object.create(e.directives||null),n.directives)),n)"modules"!==a&&"directives"!==a&&(r[a]=n[a]);r.warn=function(e,t,n){(n?o:i).push(e)};var s=Ya(t.trim(),r);return s.errors=i,s.tips=o,s}return{compile:t,compileToFunctions:Qa(t)}})(wa),es=(Za.compile,Za.compileToFunctions);function ts(e){return(Ja=Ja||document.createElement("div")).innerHTML=e?'<a href="\n"/>':'<div a="\n"/>',Ja.innerHTML.indexOf(" ")>0}var ns=!!z&&ts(!1),rs=!!z&&ts(!0),is=w(function(e){var t=Jn(e);return t&&t.innerHTML}),os=Cn.prototype.$mount;Cn.prototype.$mount=function(e,t){if((e=e&&Jn(e))===document.body||e===document.documentElement)return this;var n=this.$options;if(!n.render){var r=n.template;if(r)if("string"==typeof r)"#"===r.charAt(0)&&(r=is(r));else{if(!r.nodeType)return this;r=r.innerHTML}else e&&(r=function(e){if(e.outerHTML)return e.outerHTML;var t=document.createElement("div");return t.appendChild(e.cloneNode(!0)),t.innerHTML}(e));if(r){var i=es(r,{outputSourceRange:!1,shouldDecodeNewlines:ns,shouldDecodeNewlinesForHref:rs,delimiters:n.delimiters,comments:n.comments},this),o=i.render,a=i.staticRenderFns;n.render=o,n.staticRenderFns=a}}return os.call(this,e,t)},Cn.compile=es,e.exports=Cn}).call(this,n(1),n(38).setImmediate)},function(e,t,n){(function(e){var r=void 0!==e&&e||"undefined"!=typeof self&&self||window,i=Function.prototype.apply;function o(e,t){this._id=e,this._clearFn=t}t.setTimeout=function(){return new o(i.call(setTimeout,r,arguments),clearTimeout)},t.setInterval=function(){return new o(i.call(setInterval,r,arguments),clearInterval)},t.clearTimeout=t.clearInterval=function(e){e&&e.close()},o.prototype.unref=o.prototype.ref=function(){},o.prototype.close=function(){this._clearFn.call(r,this._id)},t.enroll=function(e,t){clearTimeout(e._idleTimeoutId),e._idleTimeout=t},t.unenroll=function(e){clearTimeout(e._idleTimeoutId),e._idleTimeout=-1},t._unrefActive=t.active=function(e){clearTimeout(e._idleTimeoutId);var t=e._idleTimeout;t>=0&&(e._idleTimeoutId=setTimeout(function(){e._onTimeout&&e._onTimeout()},t))},n(39),t.setImmediate="undefined"!=typeof self&&self.setImmediate||void 0!==e&&e.setImmediate||this&&this.setImmediate,t.clearImmediate="undefined"!=typeof self&&self.clearImmediate||void 0!==e&&e.clearImmediate||this&&this.clearImmediate}).call(this,n(1))},function(e,t,n){(function(e,t){!function(e,n){"use strict";if(!e.setImmediate){var r,i,o,a,s,u=1,c={},l=!1,f=e.document,p=Object.getPrototypeOf&&Object.getPrototypeOf(e);p=p&&p.setTimeout?p:e,"[object process]"==={}.toString.call(e.process)?r=function(e){t.nextTick(function(){h(e)})}:!function(){if(e.postMessage&&!e.importScripts){var t=!0,n=e.onmessage;return e.onmessage=function(){t=!1},e.postMessage("","*"),e.onmessage=n,t}}()?e.MessageChannel?((o=new MessageChannel).port1.onmessage=function(e){h(e.data)},r=function(e){o.port2.postMessage(e)}):f&&"onreadystatechange"in f.createElement("script")?(i=f.documentElement,r=function(e){var t=f.createElement("script");t.onreadystatechange=function(){h(e),t.onreadystatechange=null,i.removeChild(t),t=null},i.appendChild(t)}):r=function(e){setTimeout(h,0,e)}:(a="setImmediate$"+Math.random()+"$",s=function(t){t.source===e&&"string"==typeof t.data&&0===t.data.indexOf(a)&&h(+t.data.slice(a.length))},e.addEventListener?e.addEventListener("message",s,!1):e.attachEvent("onmessage",s),r=function(t){e.postMessage(a+t,"*")}),p.setImmediate=function(e){"function"!=typeof e&&(e=new Function(""+e));for(var t=new Array(arguments.length-1),n=0;n<t.length;n++)t[n]=arguments[n+1];var i={callback:e,args:t};return c[u]=i,r(u),u++},p.clearImmediate=d}function d(e){delete c[e]}function h(e){if(l)setTimeout(h,0,e);else{var t=c[e];if(t){l=!0;try{!function(e){var t=e.callback,r=e.args;switch(r.length){case 0:t();break;case 1:t(r[0]);break;case 2:t(r[0],r[1]);break;case 3:t(r[0],r[1],r[2]);break;default:t.apply(n,r)}}(t)}finally{d(e),l=!1}}}}}("undefined"==typeof self?void 0===e?this:e:self)}).call(this,n(1),n(6))},function(e,t,n){"use strict";n.r(t);var r=function(e,t,n,r,i,o,a,s){var u,c="function"==typeof e?e.options:e;if(t&&(c.render=t,c.staticRenderFns=n,c._compiled=!0),r&&(c.functional=!0),o&&(c._scopeId="data-v-"+o),a?(u=function(e){(e=e||this.$vnode&&this.$vnode.ssrContext||this.parent&&this.parent.$vnode&&this.parent.$vnode.ssrContext)||"undefined"==typeof __VUE_SSR_CONTEXT__||(e=__VUE_SSR_CONTEXT__),i&&i.call(this,e),e&&e._registeredComponents&&e._registeredComponents.add(a)},c._ssrRegister=u):i&&(u=s?function(){i.call(this,this.$root.$options.shadowRoot)}:i),u)if(c.functional){c._injectStyles=u;var l=c.render;c.render=function(e,t){return u.call(t),l(e,t)}}else{var f=c.beforeCreate;c.beforeCreate=f?[].concat(f,u):[u]}return{exports:e,options:c}}({mounted:function(){console.log("Component mounted.")}},function(){this.$createElement;this._self._c;return this._m(0)},[function(){var e=this.$createElement,t=this._self._c||e;return t("div",{staticClass:"container"},[t("div",{staticClass:"row justify-content-center"},[t("div",{staticClass:"col-md-8"},[t("div",{staticClass:"card"},[t("div",{staticClass:"card-header"},[this._v("Example Component")]),this._v(" "),t("div",{staticClass:"card-body"},[this._v("\n I'm an example component.\n ")])])])])])}],!1,null,null,null);t.default=r.exports},function(e,t){}]);
\ No newline at end of file
+/******/ (function(modules) { // webpackBootstrap
+/******/ // The module cache
+/******/ var installedModules = {};
+/******/
+/******/ // The require function
+/******/ function __webpack_require__(moduleId) {
+/******/
+/******/ // Check if module is in cache
+/******/ if(installedModules[moduleId]) {
+/******/ return installedModules[moduleId].exports;
+/******/ }
+/******/ // Create a new module (and put it into the cache)
+/******/ var module = installedModules[moduleId] = {
+/******/ i: moduleId,
+/******/ l: false,
+/******/ exports: {}
+/******/ };
+/******/
+/******/ // Execute the module function
+/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
+/******/
+/******/ // Flag the module as loaded
+/******/ module.l = true;
+/******/
+/******/ // Return the exports of the module
+/******/ return module.exports;
+/******/ }
+/******/
+/******/
+/******/ // expose the modules object (__webpack_modules__)
+/******/ __webpack_require__.m = modules;
+/******/
+/******/ // expose the module cache
+/******/ __webpack_require__.c = installedModules;
+/******/
+/******/ // define getter function for harmony exports
+/******/ __webpack_require__.d = function(exports, name, getter) {
+/******/ if(!__webpack_require__.o(exports, name)) {
+/******/ Object.defineProperty(exports, name, { enumerable: true, get: getter });
+/******/ }
+/******/ };
+/******/
+/******/ // define __esModule on exports
+/******/ __webpack_require__.r = function(exports) {
+/******/ if(typeof Symbol !== 'undefined' && Symbol.toStringTag) {
+/******/ Object.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });
+/******/ }
+/******/ Object.defineProperty(exports, '__esModule', { value: true });
+/******/ };
+/******/
+/******/ // create a fake namespace object
+/******/ // mode & 1: value is a module id, require it
+/******/ // mode & 2: merge all properties of value into the ns
+/******/ // mode & 4: return value when already ns object
+/******/ // mode & 8|1: behave like require
+/******/ __webpack_require__.t = function(value, mode) {
+/******/ if(mode & 1) value = __webpack_require__(value);
+/******/ if(mode & 8) return value;
+/******/ if((mode & 4) && typeof value === 'object' && value && value.__esModule) return value;
+/******/ var ns = Object.create(null);
+/******/ __webpack_require__.r(ns);
+/******/ Object.defineProperty(ns, 'default', { enumerable: true, value: value });
+/******/ if(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key));
+/******/ return ns;
+/******/ };
+/******/
+/******/ // getDefaultExport function for compatibility with non-harmony modules
+/******/ __webpack_require__.n = function(module) {
+/******/ var getter = module && module.__esModule ?
+/******/ function getDefault() { return module['default']; } :
+/******/ function getModuleExports() { return module; };
+/******/ __webpack_require__.d(getter, 'a', getter);
+/******/ return getter;
+/******/ };
+/******/
+/******/ // Object.prototype.hasOwnProperty.call
+/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };
+/******/
+/******/ // __webpack_public_path__
+/******/ __webpack_require__.p = "/";
+/******/
+/******/
+/******/ // Load entry module and return exports
+/******/ return __webpack_require__(__webpack_require__.s = 0);
+/******/ })
+/************************************************************************/
+/******/ ({
+
+/***/ "./node_modules/axios/index.js":
+/*!*************************************!*\
+ !*** ./node_modules/axios/index.js ***!
+ \*************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+module.exports = __webpack_require__(/*! ./lib/axios */ "./node_modules/axios/lib/axios.js");
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/adapters/xhr.js":
+/*!************************************************!*\
+ !*** ./node_modules/axios/lib/adapters/xhr.js ***!
+ \************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
+var settle = __webpack_require__(/*! ./../core/settle */ "./node_modules/axios/lib/core/settle.js");
+var buildURL = __webpack_require__(/*! ./../helpers/buildURL */ "./node_modules/axios/lib/helpers/buildURL.js");
+var parseHeaders = __webpack_require__(/*! ./../helpers/parseHeaders */ "./node_modules/axios/lib/helpers/parseHeaders.js");
+var isURLSameOrigin = __webpack_require__(/*! ./../helpers/isURLSameOrigin */ "./node_modules/axios/lib/helpers/isURLSameOrigin.js");
+var createError = __webpack_require__(/*! ../core/createError */ "./node_modules/axios/lib/core/createError.js");
+var btoa = (typeof window !== 'undefined' && window.btoa && window.btoa.bind(window)) || __webpack_require__(/*! ./../helpers/btoa */ "./node_modules/axios/lib/helpers/btoa.js");
+
+module.exports = function xhrAdapter(config) {
+ return new Promise(function dispatchXhrRequest(resolve, reject) {
+ var requestData = config.data;
+ var requestHeaders = config.headers;
+
+ if (utils.isFormData(requestData)) {
+ delete requestHeaders['Content-Type']; // Let the browser set it
+ }
+
+ var request = new XMLHttpRequest();
+ var loadEvent = 'onreadystatechange';
+ var xDomain = false;
+
+ // For IE 8/9 CORS support
+ // Only supports POST and GET calls and doesn't returns the response headers.
+ // DON'T do this for testing b/c XMLHttpRequest is mocked, not XDomainRequest.
+ if ( true &&
+ typeof window !== 'undefined' &&
+ window.XDomainRequest && !('withCredentials' in request) &&
+ !isURLSameOrigin(config.url)) {
+ request = new window.XDomainRequest();
+ loadEvent = 'onload';
+ xDomain = true;
+ request.onprogress = function handleProgress() {};
+ request.ontimeout = function handleTimeout() {};
+ }
+
+ // HTTP basic authentication
+ if (config.auth) {
+ var username = config.auth.username || '';
+ var password = config.auth.password || '';
+ requestHeaders.Authorization = 'Basic ' + btoa(username + ':' + password);
+ }
+
+ request.open(config.method.toUpperCase(), buildURL(config.url, config.params, config.paramsSerializer), true);
+
+ // Set the request timeout in MS
+ request.timeout = config.timeout;
+
+ // Listen for ready state
+ request[loadEvent] = function handleLoad() {
+ if (!request || (request.readyState !== 4 && !xDomain)) {
+ return;
+ }
+
+ // The request errored out and we didn't get a response, this will be
+ // handled by onerror instead
+ // With one exception: request that using file: protocol, most browsers
+ // will return status as 0 even though it's a successful request
+ if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {
+ return;
+ }
+
+ // Prepare the response
+ var responseHeaders = 'getAllResponseHeaders' in request ? parseHeaders(request.getAllResponseHeaders()) : null;
+ var responseData = !config.responseType || config.responseType === 'text' ? request.responseText : request.response;
+ var response = {
+ data: responseData,
+ // IE sends 1223 instead of 204 (https://github.com/axios/axios/issues/201)
+ status: request.status === 1223 ? 204 : request.status,
+ statusText: request.status === 1223 ? 'No Content' : request.statusText,
+ headers: responseHeaders,
+ config: config,
+ request: request
+ };
+
+ settle(resolve, reject, response);
+
+ // Clean up request
+ request = null;
+ };
+
+ // Handle low level network errors
+ request.onerror = function handleError() {
+ // Real errors are hidden from us by the browser
+ // onerror should only fire if it's a network error
+ reject(createError('Network Error', config, null, request));
+
+ // Clean up request
+ request = null;
+ };
+
+ // Handle timeout
+ request.ontimeout = function handleTimeout() {
+ reject(createError('timeout of ' + config.timeout + 'ms exceeded', config, 'ECONNABORTED',
+ request));
+
+ // Clean up request
+ request = null;
+ };
+
+ // Add xsrf header
+ // This is only done if running in a standard browser environment.
+ // Specifically not if we're in a web worker, or react-native.
+ if (utils.isStandardBrowserEnv()) {
+ var cookies = __webpack_require__(/*! ./../helpers/cookies */ "./node_modules/axios/lib/helpers/cookies.js");
+
+ // Add xsrf header
+ var xsrfValue = (config.withCredentials || isURLSameOrigin(config.url)) && config.xsrfCookieName ?
+ cookies.read(config.xsrfCookieName) :
+ undefined;
+
+ if (xsrfValue) {
+ requestHeaders[config.xsrfHeaderName] = xsrfValue;
+ }
+ }
+
+ // Add headers to the request
+ if ('setRequestHeader' in request) {
+ utils.forEach(requestHeaders, function setRequestHeader(val, key) {
+ if (typeof requestData === 'undefined' && key.toLowerCase() === 'content-type') {
+ // Remove Content-Type if data is undefined
+ delete requestHeaders[key];
+ } else {
+ // Otherwise add header to the request
+ request.setRequestHeader(key, val);
+ }
+ });
+ }
+
+ // Add withCredentials to request if needed
+ if (config.withCredentials) {
+ request.withCredentials = true;
+ }
+
+ // Add responseType to request if needed
+ if (config.responseType) {
+ try {
+ request.responseType = config.responseType;
+ } catch (e) {
+ // Expected DOMException thrown by browsers not compatible XMLHttpRequest Level 2.
+ // But, this can be suppressed for 'json' type as it can be parsed by default 'transformResponse' function.
+ if (config.responseType !== 'json') {
+ throw e;
+ }
+ }
+ }
+
+ // Handle progress if needed
+ if (typeof config.onDownloadProgress === 'function') {
+ request.addEventListener('progress', config.onDownloadProgress);
+ }
+
+ // Not all browsers support upload events
+ if (typeof config.onUploadProgress === 'function' && request.upload) {
+ request.upload.addEventListener('progress', config.onUploadProgress);
+ }
+
+ if (config.cancelToken) {
+ // Handle cancellation
+ config.cancelToken.promise.then(function onCanceled(cancel) {
+ if (!request) {
+ return;
+ }
+
+ request.abort();
+ reject(cancel);
+ // Clean up request
+ request = null;
+ });
+ }
+
+ if (requestData === undefined) {
+ requestData = null;
+ }
+
+ // Send the request
+ request.send(requestData);
+ });
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/axios.js":
+/*!*****************************************!*\
+ !*** ./node_modules/axios/lib/axios.js ***!
+ \*****************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var utils = __webpack_require__(/*! ./utils */ "./node_modules/axios/lib/utils.js");
+var bind = __webpack_require__(/*! ./helpers/bind */ "./node_modules/axios/lib/helpers/bind.js");
+var Axios = __webpack_require__(/*! ./core/Axios */ "./node_modules/axios/lib/core/Axios.js");
+var defaults = __webpack_require__(/*! ./defaults */ "./node_modules/axios/lib/defaults.js");
+
+/**
+ * Create an instance of Axios
+ *
+ * @param {Object} defaultConfig The default config for the instance
+ * @return {Axios} A new instance of Axios
+ */
+function createInstance(defaultConfig) {
+ var context = new Axios(defaultConfig);
+ var instance = bind(Axios.prototype.request, context);
+
+ // Copy axios.prototype to instance
+ utils.extend(instance, Axios.prototype, context);
+
+ // Copy context to instance
+ utils.extend(instance, context);
+
+ return instance;
+}
+
+// Create the default instance to be exported
+var axios = createInstance(defaults);
+
+// Expose Axios class to allow class inheritance
+axios.Axios = Axios;
+
+// Factory for creating new instances
+axios.create = function create(instanceConfig) {
+ return createInstance(utils.merge(defaults, instanceConfig));
+};
+
+// Expose Cancel & CancelToken
+axios.Cancel = __webpack_require__(/*! ./cancel/Cancel */ "./node_modules/axios/lib/cancel/Cancel.js");
+axios.CancelToken = __webpack_require__(/*! ./cancel/CancelToken */ "./node_modules/axios/lib/cancel/CancelToken.js");
+axios.isCancel = __webpack_require__(/*! ./cancel/isCancel */ "./node_modules/axios/lib/cancel/isCancel.js");
+
+// Expose all/spread
+axios.all = function all(promises) {
+ return Promise.all(promises);
+};
+axios.spread = __webpack_require__(/*! ./helpers/spread */ "./node_modules/axios/lib/helpers/spread.js");
+
+module.exports = axios;
+
+// Allow use of default import syntax in TypeScript
+module.exports.default = axios;
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/cancel/Cancel.js":
+/*!*************************************************!*\
+ !*** ./node_modules/axios/lib/cancel/Cancel.js ***!
+ \*************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+/**
+ * A `Cancel` is an object that is thrown when an operation is canceled.
+ *
+ * @class
+ * @param {string=} message The message.
+ */
+function Cancel(message) {
+ this.message = message;
+}
+
+Cancel.prototype.toString = function toString() {
+ return 'Cancel' + (this.message ? ': ' + this.message : '');
+};
+
+Cancel.prototype.__CANCEL__ = true;
+
+module.exports = Cancel;
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/cancel/CancelToken.js":
+/*!******************************************************!*\
+ !*** ./node_modules/axios/lib/cancel/CancelToken.js ***!
+ \******************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var Cancel = __webpack_require__(/*! ./Cancel */ "./node_modules/axios/lib/cancel/Cancel.js");
+
+/**
+ * A `CancelToken` is an object that can be used to request cancellation of an operation.
+ *
+ * @class
+ * @param {Function} executor The executor function.
+ */
+function CancelToken(executor) {
+ if (typeof executor !== 'function') {
+ throw new TypeError('executor must be a function.');
+ }
+
+ var resolvePromise;
+ this.promise = new Promise(function promiseExecutor(resolve) {
+ resolvePromise = resolve;
+ });
+
+ var token = this;
+ executor(function cancel(message) {
+ if (token.reason) {
+ // Cancellation has already been requested
+ return;
+ }
+
+ token.reason = new Cancel(message);
+ resolvePromise(token.reason);
+ });
+}
+
+/**
+ * Throws a `Cancel` if cancellation has been requested.
+ */
+CancelToken.prototype.throwIfRequested = function throwIfRequested() {
+ if (this.reason) {
+ throw this.reason;
+ }
+};
+
+/**
+ * Returns an object that contains a new `CancelToken` and a function that, when called,
+ * cancels the `CancelToken`.
+ */
+CancelToken.source = function source() {
+ var cancel;
+ var token = new CancelToken(function executor(c) {
+ cancel = c;
+ });
+ return {
+ token: token,
+ cancel: cancel
+ };
+};
+
+module.exports = CancelToken;
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/cancel/isCancel.js":
+/*!***************************************************!*\
+ !*** ./node_modules/axios/lib/cancel/isCancel.js ***!
+ \***************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+module.exports = function isCancel(value) {
+ return !!(value && value.__CANCEL__);
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/core/Axios.js":
+/*!**********************************************!*\
+ !*** ./node_modules/axios/lib/core/Axios.js ***!
+ \**********************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var defaults = __webpack_require__(/*! ./../defaults */ "./node_modules/axios/lib/defaults.js");
+var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
+var InterceptorManager = __webpack_require__(/*! ./InterceptorManager */ "./node_modules/axios/lib/core/InterceptorManager.js");
+var dispatchRequest = __webpack_require__(/*! ./dispatchRequest */ "./node_modules/axios/lib/core/dispatchRequest.js");
+
+/**
+ * Create a new instance of Axios
+ *
+ * @param {Object} instanceConfig The default config for the instance
+ */
+function Axios(instanceConfig) {
+ this.defaults = instanceConfig;
+ this.interceptors = {
+ request: new InterceptorManager(),
+ response: new InterceptorManager()
+ };
+}
+
+/**
+ * Dispatch a request
+ *
+ * @param {Object} config The config specific for this request (merged with this.defaults)
+ */
+Axios.prototype.request = function request(config) {
+ /*eslint no-param-reassign:0*/
+ // Allow for axios('example/url'[, config]) a la fetch API
+ if (typeof config === 'string') {
+ config = utils.merge({
+ url: arguments[0]
+ }, arguments[1]);
+ }
+
+ config = utils.merge(defaults, {method: 'get'}, this.defaults, config);
+ config.method = config.method.toLowerCase();
+
+ // Hook up interceptors middleware
+ var chain = [dispatchRequest, undefined];
+ var promise = Promise.resolve(config);
+
+ this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {
+ chain.unshift(interceptor.fulfilled, interceptor.rejected);
+ });
+
+ this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {
+ chain.push(interceptor.fulfilled, interceptor.rejected);
+ });
+
+ while (chain.length) {
+ promise = promise.then(chain.shift(), chain.shift());
+ }
+
+ return promise;
+};
+
+// Provide aliases for supported request methods
+utils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {
+ /*eslint func-names:0*/
+ Axios.prototype[method] = function(url, config) {
+ return this.request(utils.merge(config || {}, {
+ method: method,
+ url: url
+ }));
+ };
+});
+
+utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {
+ /*eslint func-names:0*/
+ Axios.prototype[method] = function(url, data, config) {
+ return this.request(utils.merge(config || {}, {
+ method: method,
+ url: url,
+ data: data
+ }));
+ };
+});
+
+module.exports = Axios;
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/core/InterceptorManager.js":
+/*!***********************************************************!*\
+ !*** ./node_modules/axios/lib/core/InterceptorManager.js ***!
+ \***********************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
+
+function InterceptorManager() {
+ this.handlers = [];
+}
+
+/**
+ * Add a new interceptor to the stack
+ *
+ * @param {Function} fulfilled The function to handle `then` for a `Promise`
+ * @param {Function} rejected The function to handle `reject` for a `Promise`
+ *
+ * @return {Number} An ID used to remove interceptor later
+ */
+InterceptorManager.prototype.use = function use(fulfilled, rejected) {
+ this.handlers.push({
+ fulfilled: fulfilled,
+ rejected: rejected
+ });
+ return this.handlers.length - 1;
+};
+
+/**
+ * Remove an interceptor from the stack
+ *
+ * @param {Number} id The ID that was returned by `use`
+ */
+InterceptorManager.prototype.eject = function eject(id) {
+ if (this.handlers[id]) {
+ this.handlers[id] = null;
+ }
+};
+
+/**
+ * Iterate over all the registered interceptors
+ *
+ * This method is particularly useful for skipping over any
+ * interceptors that may have become `null` calling `eject`.
+ *
+ * @param {Function} fn The function to call for each interceptor
+ */
+InterceptorManager.prototype.forEach = function forEach(fn) {
+ utils.forEach(this.handlers, function forEachHandler(h) {
+ if (h !== null) {
+ fn(h);
+ }
+ });
+};
+
+module.exports = InterceptorManager;
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/core/createError.js":
+/*!****************************************************!*\
+ !*** ./node_modules/axios/lib/core/createError.js ***!
+ \****************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var enhanceError = __webpack_require__(/*! ./enhanceError */ "./node_modules/axios/lib/core/enhanceError.js");
+
+/**
+ * Create an Error with the specified message, config, error code, request and response.
+ *
+ * @param {string} message The error message.
+ * @param {Object} config The config.
+ * @param {string} [code] The error code (for example, 'ECONNABORTED').
+ * @param {Object} [request] The request.
+ * @param {Object} [response] The response.
+ * @returns {Error} The created error.
+ */
+module.exports = function createError(message, config, code, request, response) {
+ var error = new Error(message);
+ return enhanceError(error, config, code, request, response);
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/core/dispatchRequest.js":
+/*!********************************************************!*\
+ !*** ./node_modules/axios/lib/core/dispatchRequest.js ***!
+ \********************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
+var transformData = __webpack_require__(/*! ./transformData */ "./node_modules/axios/lib/core/transformData.js");
+var isCancel = __webpack_require__(/*! ../cancel/isCancel */ "./node_modules/axios/lib/cancel/isCancel.js");
+var defaults = __webpack_require__(/*! ../defaults */ "./node_modules/axios/lib/defaults.js");
+var isAbsoluteURL = __webpack_require__(/*! ./../helpers/isAbsoluteURL */ "./node_modules/axios/lib/helpers/isAbsoluteURL.js");
+var combineURLs = __webpack_require__(/*! ./../helpers/combineURLs */ "./node_modules/axios/lib/helpers/combineURLs.js");
+
+/**
+ * Throws a `Cancel` if cancellation has been requested.
+ */
+function throwIfCancellationRequested(config) {
+ if (config.cancelToken) {
+ config.cancelToken.throwIfRequested();
+ }
+}
+
+/**
+ * Dispatch a request to the server using the configured adapter.
+ *
+ * @param {object} config The config that is to be used for the request
+ * @returns {Promise} The Promise to be fulfilled
+ */
+module.exports = function dispatchRequest(config) {
+ throwIfCancellationRequested(config);
+
+ // Support baseURL config
+ if (config.baseURL && !isAbsoluteURL(config.url)) {
+ config.url = combineURLs(config.baseURL, config.url);
+ }
+
+ // Ensure headers exist
+ config.headers = config.headers || {};
+
+ // Transform request data
+ config.data = transformData(
+ config.data,
+ config.headers,
+ config.transformRequest
+ );
+
+ // Flatten headers
+ config.headers = utils.merge(
+ config.headers.common || {},
+ config.headers[config.method] || {},
+ config.headers || {}
+ );
+
+ utils.forEach(
+ ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],
+ function cleanHeaderConfig(method) {
+ delete config.headers[method];
+ }
+ );
+
+ var adapter = config.adapter || defaults.adapter;
+
+ return adapter(config).then(function onAdapterResolution(response) {
+ throwIfCancellationRequested(config);
+
+ // Transform response data
+ response.data = transformData(
+ response.data,
+ response.headers,
+ config.transformResponse
+ );
+
+ return response;
+ }, function onAdapterRejection(reason) {
+ if (!isCancel(reason)) {
+ throwIfCancellationRequested(config);
+
+ // Transform response data
+ if (reason && reason.response) {
+ reason.response.data = transformData(
+ reason.response.data,
+ reason.response.headers,
+ config.transformResponse
+ );
+ }
+ }
+
+ return Promise.reject(reason);
+ });
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/core/enhanceError.js":
+/*!*****************************************************!*\
+ !*** ./node_modules/axios/lib/core/enhanceError.js ***!
+ \*****************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+/**
+ * Update an Error with the specified config, error code, and response.
+ *
+ * @param {Error} error The error to update.
+ * @param {Object} config The config.
+ * @param {string} [code] The error code (for example, 'ECONNABORTED').
+ * @param {Object} [request] The request.
+ * @param {Object} [response] The response.
+ * @returns {Error} The error.
+ */
+module.exports = function enhanceError(error, config, code, request, response) {
+ error.config = config;
+ if (code) {
+ error.code = code;
+ }
+ error.request = request;
+ error.response = response;
+ return error;
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/core/settle.js":
+/*!***********************************************!*\
+ !*** ./node_modules/axios/lib/core/settle.js ***!
+ \***********************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var createError = __webpack_require__(/*! ./createError */ "./node_modules/axios/lib/core/createError.js");
+
+/**
+ * Resolve or reject a Promise based on response status.
+ *
+ * @param {Function} resolve A function that resolves the promise.
+ * @param {Function} reject A function that rejects the promise.
+ * @param {object} response The response.
+ */
+module.exports = function settle(resolve, reject, response) {
+ var validateStatus = response.config.validateStatus;
+ // Note: status is not exposed by XDomainRequest
+ if (!response.status || !validateStatus || validateStatus(response.status)) {
+ resolve(response);
+ } else {
+ reject(createError(
+ 'Request failed with status code ' + response.status,
+ response.config,
+ null,
+ response.request,
+ response
+ ));
+ }
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/core/transformData.js":
+/*!******************************************************!*\
+ !*** ./node_modules/axios/lib/core/transformData.js ***!
+ \******************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
+
+/**
+ * Transform the data for a request or a response
+ *
+ * @param {Object|String} data The data to be transformed
+ * @param {Array} headers The headers for the request or response
+ * @param {Array|Function} fns A single function or Array of functions
+ * @returns {*} The resulting transformed data
+ */
+module.exports = function transformData(data, headers, fns) {
+ /*eslint no-param-reassign:0*/
+ utils.forEach(fns, function transform(fn) {
+ data = fn(data, headers);
+ });
+
+ return data;
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/defaults.js":
+/*!********************************************!*\
+ !*** ./node_modules/axios/lib/defaults.js ***!
+ \********************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+/* WEBPACK VAR INJECTION */(function(process) {
+
+var utils = __webpack_require__(/*! ./utils */ "./node_modules/axios/lib/utils.js");
+var normalizeHeaderName = __webpack_require__(/*! ./helpers/normalizeHeaderName */ "./node_modules/axios/lib/helpers/normalizeHeaderName.js");
+
+var DEFAULT_CONTENT_TYPE = {
+ 'Content-Type': 'application/x-www-form-urlencoded'
+};
+
+function setContentTypeIfUnset(headers, value) {
+ if (!utils.isUndefined(headers) && utils.isUndefined(headers['Content-Type'])) {
+ headers['Content-Type'] = value;
+ }
+}
+
+function getDefaultAdapter() {
+ var adapter;
+ if (typeof XMLHttpRequest !== 'undefined') {
+ // For browsers use XHR adapter
+ adapter = __webpack_require__(/*! ./adapters/xhr */ "./node_modules/axios/lib/adapters/xhr.js");
+ } else if (typeof process !== 'undefined') {
+ // For node use HTTP adapter
+ adapter = __webpack_require__(/*! ./adapters/http */ "./node_modules/axios/lib/adapters/xhr.js");
+ }
+ return adapter;
+}
+
+var defaults = {
+ adapter: getDefaultAdapter(),
+
+ transformRequest: [function transformRequest(data, headers) {
+ normalizeHeaderName(headers, 'Content-Type');
+ if (utils.isFormData(data) ||
+ utils.isArrayBuffer(data) ||
+ utils.isBuffer(data) ||
+ utils.isStream(data) ||
+ utils.isFile(data) ||
+ utils.isBlob(data)
+ ) {
+ return data;
+ }
+ if (utils.isArrayBufferView(data)) {
+ return data.buffer;
+ }
+ if (utils.isURLSearchParams(data)) {
+ setContentTypeIfUnset(headers, 'application/x-www-form-urlencoded;charset=utf-8');
+ return data.toString();
+ }
+ if (utils.isObject(data)) {
+ setContentTypeIfUnset(headers, 'application/json;charset=utf-8');
+ return JSON.stringify(data);
+ }
+ return data;
+ }],
+
+ transformResponse: [function transformResponse(data) {
+ /*eslint no-param-reassign:0*/
+ if (typeof data === 'string') {
+ try {
+ data = JSON.parse(data);
+ } catch (e) { /* Ignore */ }
+ }
+ return data;
+ }],
+
+ /**
+ * A timeout in milliseconds to abort a request. If set to 0 (default) a
+ * timeout is not created.
+ */
+ timeout: 0,
+
+ xsrfCookieName: 'XSRF-TOKEN',
+ xsrfHeaderName: 'X-XSRF-TOKEN',
+
+ maxContentLength: -1,
+
+ validateStatus: function validateStatus(status) {
+ return status >= 200 && status < 300;
+ }
+};
+
+defaults.headers = {
+ common: {
+ 'Accept': 'application/json, text/plain, */*'
+ }
+};
+
+utils.forEach(['delete', 'get', 'head'], function forEachMethodNoData(method) {
+ defaults.headers[method] = {};
+});
+
+utils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {
+ defaults.headers[method] = utils.merge(DEFAULT_CONTENT_TYPE);
+});
+
+module.exports = defaults;
+
+/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(/*! ./../../process/browser.js */ "./node_modules/process/browser.js")))
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/helpers/bind.js":
+/*!************************************************!*\
+ !*** ./node_modules/axios/lib/helpers/bind.js ***!
+ \************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+module.exports = function bind(fn, thisArg) {
+ return function wrap() {
+ var args = new Array(arguments.length);
+ for (var i = 0; i < args.length; i++) {
+ args[i] = arguments[i];
+ }
+ return fn.apply(thisArg, args);
+ };
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/helpers/btoa.js":
+/*!************************************************!*\
+ !*** ./node_modules/axios/lib/helpers/btoa.js ***!
+ \************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+// btoa polyfill for IE<10 courtesy https://github.com/davidchambers/Base64.js
+
+var chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=';
+
+function E() {
+ this.message = 'String contains an invalid character';
+}
+E.prototype = new Error;
+E.prototype.code = 5;
+E.prototype.name = 'InvalidCharacterError';
+
+function btoa(input) {
+ var str = String(input);
+ var output = '';
+ for (
+ // initialize result and counter
+ var block, charCode, idx = 0, map = chars;
+ // if the next str index does not exist:
+ // change the mapping table to "="
+ // check if d has no fractional digits
+ str.charAt(idx | 0) || (map = '=', idx % 1);
+ // "8 - idx % 1 * 8" generates the sequence 2, 4, 6, 8
+ output += map.charAt(63 & block >> 8 - idx % 1 * 8)
+ ) {
+ charCode = str.charCodeAt(idx += 3 / 4);
+ if (charCode > 0xFF) {
+ throw new E();
+ }
+ block = block << 8 | charCode;
+ }
+ return output;
+}
+
+module.exports = btoa;
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/helpers/buildURL.js":
+/*!****************************************************!*\
+ !*** ./node_modules/axios/lib/helpers/buildURL.js ***!
+ \****************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
+
+function encode(val) {
+ return encodeURIComponent(val).
+ replace(/%40/gi, '@').
+ replace(/%3A/gi, ':').
+ replace(/%24/g, '$').
+ replace(/%2C/gi, ',').
+ replace(/%20/g, '+').
+ replace(/%5B/gi, '[').
+ replace(/%5D/gi, ']');
+}
+
+/**
+ * Build a URL by appending params to the end
+ *
+ * @param {string} url The base of the url (e.g., http://www.google.com)
+ * @param {object} [params] The params to be appended
+ * @returns {string} The formatted url
+ */
+module.exports = function buildURL(url, params, paramsSerializer) {
+ /*eslint no-param-reassign:0*/
+ if (!params) {
+ return url;
+ }
+
+ var serializedParams;
+ if (paramsSerializer) {
+ serializedParams = paramsSerializer(params);
+ } else if (utils.isURLSearchParams(params)) {
+ serializedParams = params.toString();
+ } else {
+ var parts = [];
+
+ utils.forEach(params, function serialize(val, key) {
+ if (val === null || typeof val === 'undefined') {
+ return;
+ }
+
+ if (utils.isArray(val)) {
+ key = key + '[]';
+ } else {
+ val = [val];
+ }
+
+ utils.forEach(val, function parseValue(v) {
+ if (utils.isDate(v)) {
+ v = v.toISOString();
+ } else if (utils.isObject(v)) {
+ v = JSON.stringify(v);
+ }
+ parts.push(encode(key) + '=' + encode(v));
+ });
+ });
+
+ serializedParams = parts.join('&');
+ }
+
+ if (serializedParams) {
+ url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;
+ }
+
+ return url;
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/helpers/combineURLs.js":
+/*!*******************************************************!*\
+ !*** ./node_modules/axios/lib/helpers/combineURLs.js ***!
+ \*******************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+/**
+ * Creates a new URL by combining the specified URLs
+ *
+ * @param {string} baseURL The base URL
+ * @param {string} relativeURL The relative URL
+ * @returns {string} The combined URL
+ */
+module.exports = function combineURLs(baseURL, relativeURL) {
+ return relativeURL
+ ? baseURL.replace(/\/+$/, '') + '/' + relativeURL.replace(/^\/+/, '')
+ : baseURL;
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/helpers/cookies.js":
+/*!***************************************************!*\
+ !*** ./node_modules/axios/lib/helpers/cookies.js ***!
+ \***************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
+
+module.exports = (
+ utils.isStandardBrowserEnv() ?
+
+ // Standard browser envs support document.cookie
+ (function standardBrowserEnv() {
+ return {
+ write: function write(name, value, expires, path, domain, secure) {
+ var cookie = [];
+ cookie.push(name + '=' + encodeURIComponent(value));
+
+ if (utils.isNumber(expires)) {
+ cookie.push('expires=' + new Date(expires).toGMTString());
+ }
+
+ if (utils.isString(path)) {
+ cookie.push('path=' + path);
+ }
+
+ if (utils.isString(domain)) {
+ cookie.push('domain=' + domain);
+ }
+
+ if (secure === true) {
+ cookie.push('secure');
+ }
+
+ document.cookie = cookie.join('; ');
+ },
+
+ read: function read(name) {
+ var match = document.cookie.match(new RegExp('(^|;\\s*)(' + name + ')=([^;]*)'));
+ return (match ? decodeURIComponent(match[3]) : null);
+ },
+
+ remove: function remove(name) {
+ this.write(name, '', Date.now() - 86400000);
+ }
+ };
+ })() :
+
+ // Non standard browser env (web workers, react-native) lack needed support.
+ (function nonStandardBrowserEnv() {
+ return {
+ write: function write() {},
+ read: function read() { return null; },
+ remove: function remove() {}
+ };
+ })()
+);
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/helpers/isAbsoluteURL.js":
+/*!*********************************************************!*\
+ !*** ./node_modules/axios/lib/helpers/isAbsoluteURL.js ***!
+ \*********************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+/**
+ * Determines whether the specified URL is absolute
+ *
+ * @param {string} url The URL to test
+ * @returns {boolean} True if the specified URL is absolute, otherwise false
+ */
+module.exports = function isAbsoluteURL(url) {
+ // A URL is considered absolute if it begins with "<scheme>://" or "//" (protocol-relative URL).
+ // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed
+ // by any combination of letters, digits, plus, period, or hyphen.
+ return /^([a-z][a-z\d\+\-\.]*:)?\/\//i.test(url);
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/helpers/isURLSameOrigin.js":
+/*!***********************************************************!*\
+ !*** ./node_modules/axios/lib/helpers/isURLSameOrigin.js ***!
+ \***********************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
+
+module.exports = (
+ utils.isStandardBrowserEnv() ?
+
+ // Standard browser envs have full support of the APIs needed to test
+ // whether the request URL is of the same origin as current location.
+ (function standardBrowserEnv() {
+ var msie = /(msie|trident)/i.test(navigator.userAgent);
+ var urlParsingNode = document.createElement('a');
+ var originURL;
+
+ /**
+ * Parse a URL to discover it's components
+ *
+ * @param {String} url The URL to be parsed
+ * @returns {Object}
+ */
+ function resolveURL(url) {
+ var href = url;
+
+ if (msie) {
+ // IE needs attribute set twice to normalize properties
+ urlParsingNode.setAttribute('href', href);
+ href = urlParsingNode.href;
+ }
+
+ urlParsingNode.setAttribute('href', href);
+
+ // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils
+ return {
+ href: urlParsingNode.href,
+ protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',
+ host: urlParsingNode.host,
+ search: urlParsingNode.search ? urlParsingNode.search.replace(/^\?/, '') : '',
+ hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',
+ hostname: urlParsingNode.hostname,
+ port: urlParsingNode.port,
+ pathname: (urlParsingNode.pathname.charAt(0) === '/') ?
+ urlParsingNode.pathname :
+ '/' + urlParsingNode.pathname
+ };
+ }
+
+ originURL = resolveURL(window.location.href);
+
+ /**
+ * Determine if a URL shares the same origin as the current location
+ *
+ * @param {String} requestURL The URL to test
+ * @returns {boolean} True if URL shares the same origin, otherwise false
+ */
+ return function isURLSameOrigin(requestURL) {
+ var parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;
+ return (parsed.protocol === originURL.protocol &&
+ parsed.host === originURL.host);
+ };
+ })() :
+
+ // Non standard browser envs (web workers, react-native) lack needed support.
+ (function nonStandardBrowserEnv() {
+ return function isURLSameOrigin() {
+ return true;
+ };
+ })()
+);
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/helpers/normalizeHeaderName.js":
+/*!***************************************************************!*\
+ !*** ./node_modules/axios/lib/helpers/normalizeHeaderName.js ***!
+ \***************************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var utils = __webpack_require__(/*! ../utils */ "./node_modules/axios/lib/utils.js");
+
+module.exports = function normalizeHeaderName(headers, normalizedName) {
+ utils.forEach(headers, function processHeader(value, name) {
+ if (name !== normalizedName && name.toUpperCase() === normalizedName.toUpperCase()) {
+ headers[normalizedName] = value;
+ delete headers[name];
+ }
+ });
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/helpers/parseHeaders.js":
+/*!********************************************************!*\
+ !*** ./node_modules/axios/lib/helpers/parseHeaders.js ***!
+ \********************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var utils = __webpack_require__(/*! ./../utils */ "./node_modules/axios/lib/utils.js");
+
+// Headers whose duplicates are ignored by node
+// c.f. https://nodejs.org/api/http.html#http_message_headers
+var ignoreDuplicateOf = [
+ 'age', 'authorization', 'content-length', 'content-type', 'etag',
+ 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',
+ 'last-modified', 'location', 'max-forwards', 'proxy-authorization',
+ 'referer', 'retry-after', 'user-agent'
+];
+
+/**
+ * Parse headers into an object
+ *
+ * ```
+ * Date: Wed, 27 Aug 2014 08:58:49 GMT
+ * Content-Type: application/json
+ * Connection: keep-alive
+ * Transfer-Encoding: chunked
+ * ```
+ *
+ * @param {String} headers Headers needing to be parsed
+ * @returns {Object} Headers parsed into an object
+ */
+module.exports = function parseHeaders(headers) {
+ var parsed = {};
+ var key;
+ var val;
+ var i;
+
+ if (!headers) { return parsed; }
+
+ utils.forEach(headers.split('\n'), function parser(line) {
+ i = line.indexOf(':');
+ key = utils.trim(line.substr(0, i)).toLowerCase();
+ val = utils.trim(line.substr(i + 1));
+
+ if (key) {
+ if (parsed[key] && ignoreDuplicateOf.indexOf(key) >= 0) {
+ return;
+ }
+ if (key === 'set-cookie') {
+ parsed[key] = (parsed[key] ? parsed[key] : []).concat([val]);
+ } else {
+ parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;
+ }
+ }
+ });
+
+ return parsed;
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/helpers/spread.js":
+/*!**************************************************!*\
+ !*** ./node_modules/axios/lib/helpers/spread.js ***!
+ \**************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+/**
+ * Syntactic sugar for invoking a function and expanding an array for arguments.
+ *
+ * Common use case would be to use `Function.prototype.apply`.
+ *
+ * ```js
+ * function f(x, y, z) {}
+ * var args = [1, 2, 3];
+ * f.apply(null, args);
+ * ```
+ *
+ * With `spread` this example can be re-written.
+ *
+ * ```js
+ * spread(function(x, y, z) {})([1, 2, 3]);
+ * ```
+ *
+ * @param {Function} callback
+ * @returns {Function}
+ */
+module.exports = function spread(callback) {
+ return function wrap(arr) {
+ return callback.apply(null, arr);
+ };
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/axios/lib/utils.js":
+/*!*****************************************!*\
+ !*** ./node_modules/axios/lib/utils.js ***!
+ \*****************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+
+
+var bind = __webpack_require__(/*! ./helpers/bind */ "./node_modules/axios/lib/helpers/bind.js");
+var isBuffer = __webpack_require__(/*! is-buffer */ "./node_modules/is-buffer/index.js");
+
+/*global toString:true*/
+
+// utils is a library of generic helper functions non-specific to axios
+
+var toString = Object.prototype.toString;
+
+/**
+ * Determine if a value is an Array
+ *
+ * @param {Object} val The value to test
+ * @returns {boolean} True if value is an Array, otherwise false
+ */
+function isArray(val) {
+ return toString.call(val) === '[object Array]';
+}
+
+/**
+ * Determine if a value is an ArrayBuffer
+ *
+ * @param {Object} val The value to test
+ * @returns {boolean} True if value is an ArrayBuffer, otherwise false
+ */
+function isArrayBuffer(val) {
+ return toString.call(val) === '[object ArrayBuffer]';
+}
+
+/**
+ * Determine if a value is a FormData
+ *
+ * @param {Object} val The value to test
+ * @returns {boolean} True if value is an FormData, otherwise false
+ */
+function isFormData(val) {
+ return (typeof FormData !== 'undefined') && (val instanceof FormData);
+}
+
+/**
+ * Determine if a value is a view on an ArrayBuffer
+ *
+ * @param {Object} val The value to test
+ * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false
+ */
+function isArrayBufferView(val) {
+ var result;
+ if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {
+ result = ArrayBuffer.isView(val);
+ } else {
+ result = (val) && (val.buffer) && (val.buffer instanceof ArrayBuffer);
+ }
+ return result;
+}
+
+/**
+ * Determine if a value is a String
+ *
+ * @param {Object} val The value to test
+ * @returns {boolean} True if value is a String, otherwise false
+ */
+function isString(val) {
+ return typeof val === 'string';
+}
+
+/**
+ * Determine if a value is a Number
+ *
+ * @param {Object} val The value to test
+ * @returns {boolean} True if value is a Number, otherwise false
+ */
+function isNumber(val) {
+ return typeof val === 'number';
+}
+
+/**
+ * Determine if a value is undefined
+ *
+ * @param {Object} val The value to test
+ * @returns {boolean} True if the value is undefined, otherwise false
+ */
+function isUndefined(val) {
+ return typeof val === 'undefined';
+}
+
+/**
+ * Determine if a value is an Object
+ *
+ * @param {Object} val The value to test
+ * @returns {boolean} True if value is an Object, otherwise false
+ */
+function isObject(val) {
+ return val !== null && typeof val === 'object';
+}
+
+/**
+ * Determine if a value is a Date
+ *
+ * @param {Object} val The value to test
+ * @returns {boolean} True if value is a Date, otherwise false
+ */
+function isDate(val) {
+ return toString.call(val) === '[object Date]';
+}
+
+/**
+ * Determine if a value is a File
+ *
+ * @param {Object} val The value to test
+ * @returns {boolean} True if value is a File, otherwise false
+ */
+function isFile(val) {
+ return toString.call(val) === '[object File]';
+}
+
+/**
+ * Determine if a value is a Blob
+ *
+ * @param {Object} val The value to test
+ * @returns {boolean} True if value is a Blob, otherwise false
+ */
+function isBlob(val) {
+ return toString.call(val) === '[object Blob]';
+}
+
+/**
+ * Determine if a value is a Function
+ *
+ * @param {Object} val The value to test
+ * @returns {boolean} True if value is a Function, otherwise false
+ */
+function isFunction(val) {
+ return toString.call(val) === '[object Function]';
+}
+
+/**
+ * Determine if a value is a Stream
+ *
+ * @param {Object} val The value to test
+ * @returns {boolean} True if value is a Stream, otherwise false
+ */
+function isStream(val) {
+ return isObject(val) && isFunction(val.pipe);
+}
+
+/**
+ * Determine if a value is a URLSearchParams object
+ *
+ * @param {Object} val The value to test
+ * @returns {boolean} True if value is a URLSearchParams object, otherwise false
+ */
+function isURLSearchParams(val) {
+ return typeof URLSearchParams !== 'undefined' && val instanceof URLSearchParams;
+}
+
+/**
+ * Trim excess whitespace off the beginning and end of a string
+ *
+ * @param {String} str The String to trim
+ * @returns {String} The String freed of excess whitespace
+ */
+function trim(str) {
+ return str.replace(/^\s*/, '').replace(/\s*$/, '');
+}
+
+/**
+ * Determine if we're running in a standard browser environment
+ *
+ * This allows axios to run in a web worker, and react-native.
+ * Both environments support XMLHttpRequest, but not fully standard globals.
+ *
+ * web workers:
+ * typeof window -> undefined
+ * typeof document -> undefined
+ *
+ * react-native:
+ * navigator.product -> 'ReactNative'
+ */
+function isStandardBrowserEnv() {
+ if (typeof navigator !== 'undefined' && navigator.product === 'ReactNative') {
+ return false;
+ }
+ return (
+ typeof window !== 'undefined' &&
+ typeof document !== 'undefined'
+ );
+}
+
+/**
+ * Iterate over an Array or an Object invoking a function for each item.
+ *
+ * If `obj` is an Array callback will be called passing
+ * the value, index, and complete array for each item.
+ *
+ * If 'obj' is an Object callback will be called passing
+ * the value, key, and complete object for each property.
+ *
+ * @param {Object|Array} obj The object to iterate
+ * @param {Function} fn The callback to invoke for each item
+ */
+function forEach(obj, fn) {
+ // Don't bother if no value provided
+ if (obj === null || typeof obj === 'undefined') {
+ return;
+ }
+
+ // Force an array if not already something iterable
+ if (typeof obj !== 'object') {
+ /*eslint no-param-reassign:0*/
+ obj = [obj];
+ }
+
+ if (isArray(obj)) {
+ // Iterate over array values
+ for (var i = 0, l = obj.length; i < l; i++) {
+ fn.call(null, obj[i], i, obj);
+ }
+ } else {
+ // Iterate over object keys
+ for (var key in obj) {
+ if (Object.prototype.hasOwnProperty.call(obj, key)) {
+ fn.call(null, obj[key], key, obj);
+ }
+ }
+ }
+}
+
+/**
+ * Accepts varargs expecting each argument to be an object, then
+ * immutably merges the properties of each object and returns result.
+ *
+ * When multiple objects contain the same key the later object in
+ * the arguments list will take precedence.
+ *
+ * Example:
+ *
+ * ```js
+ * var result = merge({foo: 123}, {foo: 456});
+ * console.log(result.foo); // outputs 456
+ * ```
+ *
+ * @param {Object} obj1 Object to merge
+ * @returns {Object} Result of all merge properties
+ */
+function merge(/* obj1, obj2, obj3, ... */) {
+ var result = {};
+ function assignValue(val, key) {
+ if (typeof result[key] === 'object' && typeof val === 'object') {
+ result[key] = merge(result[key], val);
+ } else {
+ result[key] = val;
+ }
+ }
+
+ for (var i = 0, l = arguments.length; i < l; i++) {
+ forEach(arguments[i], assignValue);
+ }
+ return result;
+}
+
+/**
+ * Extends object a by mutably adding to it the properties of object b.
+ *
+ * @param {Object} a The object to be extended
+ * @param {Object} b The object to copy properties from
+ * @param {Object} thisArg The object to bind function to
+ * @return {Object} The resulting value of object a
+ */
+function extend(a, b, thisArg) {
+ forEach(b, function assignValue(val, key) {
+ if (thisArg && typeof val === 'function') {
+ a[key] = bind(val, thisArg);
+ } else {
+ a[key] = val;
+ }
+ });
+ return a;
+}
+
+module.exports = {
+ isArray: isArray,
+ isArrayBuffer: isArrayBuffer,
+ isBuffer: isBuffer,
+ isFormData: isFormData,
+ isArrayBufferView: isArrayBufferView,
+ isString: isString,
+ isNumber: isNumber,
+ isObject: isObject,
+ isUndefined: isUndefined,
+ isDate: isDate,
+ isFile: isFile,
+ isBlob: isBlob,
+ isFunction: isFunction,
+ isStream: isStream,
+ isURLSearchParams: isURLSearchParams,
+ isStandardBrowserEnv: isStandardBrowserEnv,
+ forEach: forEach,
+ merge: merge,
+ extend: extend,
+ trim: trim
+};
+
+
+/***/ }),
+
+/***/ "./node_modules/babel-loader/lib/index.js?!./node_modules/vue-loader/lib/index.js?!./resources/js/components/ExampleComponent.vue?vue&type=script&lang=js&":
+/*!***************************************************************************************************************************************************************************!*\
+ !*** ./node_modules/babel-loader/lib??ref--4-0!./node_modules/vue-loader/lib??vue-loader-options!./resources/js/components/ExampleComponent.vue?vue&type=script&lang=js& ***!
+ \***************************************************************************************************************************************************************************/
+/*! exports provided: default */
+/***/ (function(module, __webpack_exports__, __webpack_require__) {
+
+"use strict";
+__webpack_require__.r(__webpack_exports__);
+//
+//
+//
+//
+//
+//
+//
+//
+//
+//
+//
+//
+//
+//
+//
+//
+/* harmony default export */ __webpack_exports__["default"] = ({
+ mounted: function mounted() {
+ console.log('Component mounted.');
+ }
+});
+
+/***/ }),
+
+/***/ "./node_modules/bootstrap/dist/js/bootstrap.js":
+/*!*****************************************************!*\
+ !*** ./node_modules/bootstrap/dist/js/bootstrap.js ***!
+ \*****************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+/*!
+ * Bootstrap v4.2.1 (https://getbootstrap.com/)
+ * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */
+(function (global, factory) {
+ true ? factory(exports, __webpack_require__(/*! popper.js */ "./node_modules/popper.js/dist/esm/popper.js"), __webpack_require__(/*! jquery */ "./node_modules/jquery/dist/jquery.js")) :
+ undefined;
+}(this, (function (exports,Popper,$) { 'use strict';
+
+ Popper = Popper && Popper.hasOwnProperty('default') ? Popper['default'] : Popper;
+ $ = $ && $.hasOwnProperty('default') ? $['default'] : $;
+
+ function _defineProperties(target, props) {
+ for (var i = 0; i < props.length; i++) {
+ var descriptor = props[i];
+ descriptor.enumerable = descriptor.enumerable || false;
+ descriptor.configurable = true;
+ if ("value" in descriptor) descriptor.writable = true;
+ Object.defineProperty(target, descriptor.key, descriptor);
+ }
+ }
+
+ function _createClass(Constructor, protoProps, staticProps) {
+ if (protoProps) _defineProperties(Constructor.prototype, protoProps);
+ if (staticProps) _defineProperties(Constructor, staticProps);
+ return Constructor;
+ }
+
+ function _defineProperty(obj, key, value) {
+ if (key in obj) {
+ Object.defineProperty(obj, key, {
+ value: value,
+ enumerable: true,
+ configurable: true,
+ writable: true
+ });
+ } else {
+ obj[key] = value;
+ }
+
+ return obj;
+ }
+
+ function _objectSpread(target) {
+ for (var i = 1; i < arguments.length; i++) {
+ var source = arguments[i] != null ? arguments[i] : {};
+ var ownKeys = Object.keys(source);
+
+ if (typeof Object.getOwnPropertySymbols === 'function') {
+ ownKeys = ownKeys.concat(Object.getOwnPropertySymbols(source).filter(function (sym) {
+ return Object.getOwnPropertyDescriptor(source, sym).enumerable;
+ }));
+ }
+
+ ownKeys.forEach(function (key) {
+ _defineProperty(target, key, source[key]);
+ });
+ }
+
+ return target;
+ }
+
+ function _inheritsLoose(subClass, superClass) {
+ subClass.prototype = Object.create(superClass.prototype);
+ subClass.prototype.constructor = subClass;
+ subClass.__proto__ = superClass;
+ }
+
+ /**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.2.1): util.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+ /**
+ * ------------------------------------------------------------------------
+ * Private TransitionEnd Helpers
+ * ------------------------------------------------------------------------
+ */
+
+ var TRANSITION_END = 'transitionend';
+ var MAX_UID = 1000000;
+ var MILLISECONDS_MULTIPLIER = 1000; // Shoutout AngusCroll (https://goo.gl/pxwQGp)
+
+ function toType(obj) {
+ return {}.toString.call(obj).match(/\s([a-z]+)/i)[1].toLowerCase();
+ }
+
+ function getSpecialTransitionEndEvent() {
+ return {
+ bindType: TRANSITION_END,
+ delegateType: TRANSITION_END,
+ handle: function handle(event) {
+ if ($(event.target).is(this)) {
+ return event.handleObj.handler.apply(this, arguments); // eslint-disable-line prefer-rest-params
+ }
+
+ return undefined; // eslint-disable-line no-undefined
+ }
+ };
+ }
+
+ function transitionEndEmulator(duration) {
+ var _this = this;
+
+ var called = false;
+ $(this).one(Util.TRANSITION_END, function () {
+ called = true;
+ });
+ setTimeout(function () {
+ if (!called) {
+ Util.triggerTransitionEnd(_this);
+ }
+ }, duration);
+ return this;
+ }
+
+ function setTransitionEndSupport() {
+ $.fn.emulateTransitionEnd = transitionEndEmulator;
+ $.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent();
+ }
+ /**
+ * --------------------------------------------------------------------------
+ * Public Util Api
+ * --------------------------------------------------------------------------
+ */
+
+
+ var Util = {
+ TRANSITION_END: 'bsTransitionEnd',
+ getUID: function getUID(prefix) {
+ do {
+ // eslint-disable-next-line no-bitwise
+ prefix += ~~(Math.random() * MAX_UID); // "~~" acts like a faster Math.floor() here
+ } while (document.getElementById(prefix));
+
+ return prefix;
+ },
+ getSelectorFromElement: function getSelectorFromElement(element) {
+ var selector = element.getAttribute('data-target');
+
+ if (!selector || selector === '#') {
+ var hrefAttr = element.getAttribute('href');
+ selector = hrefAttr && hrefAttr !== '#' ? hrefAttr.trim() : '';
+ }
+
+ return selector && document.querySelector(selector) ? selector : null;
+ },
+ getTransitionDurationFromElement: function getTransitionDurationFromElement(element) {
+ if (!element) {
+ return 0;
+ } // Get transition-duration of the element
+
+
+ var transitionDuration = $(element).css('transition-duration');
+ var transitionDelay = $(element).css('transition-delay');
+ var floatTransitionDuration = parseFloat(transitionDuration);
+ var floatTransitionDelay = parseFloat(transitionDelay); // Return 0 if element or transition duration is not found
+
+ if (!floatTransitionDuration && !floatTransitionDelay) {
+ return 0;
+ } // If multiple durations are defined, take the first
+
+
+ transitionDuration = transitionDuration.split(',')[0];
+ transitionDelay = transitionDelay.split(',')[0];
+ return (parseFloat(transitionDuration) + parseFloat(transitionDelay)) * MILLISECONDS_MULTIPLIER;
+ },
+ reflow: function reflow(element) {
+ return element.offsetHeight;
+ },
+ triggerTransitionEnd: function triggerTransitionEnd(element) {
+ $(element).trigger(TRANSITION_END);
+ },
+ // TODO: Remove in v5
+ supportsTransitionEnd: function supportsTransitionEnd() {
+ return Boolean(TRANSITION_END);
+ },
+ isElement: function isElement(obj) {
+ return (obj[0] || obj).nodeType;
+ },
+ typeCheckConfig: function typeCheckConfig(componentName, config, configTypes) {
+ for (var property in configTypes) {
+ if (Object.prototype.hasOwnProperty.call(configTypes, property)) {
+ var expectedTypes = configTypes[property];
+ var value = config[property];
+ var valueType = value && Util.isElement(value) ? 'element' : toType(value);
+
+ if (!new RegExp(expectedTypes).test(valueType)) {
+ throw new Error(componentName.toUpperCase() + ": " + ("Option \"" + property + "\" provided type \"" + valueType + "\" ") + ("but expected type \"" + expectedTypes + "\"."));
+ }
+ }
+ }
+ },
+ findShadowRoot: function findShadowRoot(element) {
+ if (!document.documentElement.attachShadow) {
+ return null;
+ } // Can find the shadow root otherwise it'll return the document
+
+
+ if (typeof element.getRootNode === 'function') {
+ var root = element.getRootNode();
+ return root instanceof ShadowRoot ? root : null;
+ }
+
+ if (element instanceof ShadowRoot) {
+ return element;
+ } // when we don't find a shadow root
+
+
+ if (!element.parentNode) {
+ return null;
+ }
+
+ return Util.findShadowRoot(element.parentNode);
+ }
+ };
+ setTransitionEndSupport();
+
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+
+ var NAME = 'alert';
+ var VERSION = '4.2.1';
+ var DATA_KEY = 'bs.alert';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $.fn[NAME];
+ var Selector = {
+ DISMISS: '[data-dismiss="alert"]'
+ };
+ var Event = {
+ CLOSE: "close" + EVENT_KEY,
+ CLOSED: "closed" + EVENT_KEY,
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ ALERT: 'alert',
+ FADE: 'fade',
+ SHOW: 'show'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Alert =
+ /*#__PURE__*/
+ function () {
+ function Alert(element) {
+ this._element = element;
+ } // Getters
+
+
+ var _proto = Alert.prototype;
+
+ // Public
+ _proto.close = function close(element) {
+ var rootElement = this._element;
+
+ if (element) {
+ rootElement = this._getRootElement(element);
+ }
+
+ var customEvent = this._triggerCloseEvent(rootElement);
+
+ if (customEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ this._removeElement(rootElement);
+ };
+
+ _proto.dispose = function dispose() {
+ $.removeData(this._element, DATA_KEY);
+ this._element = null;
+ }; // Private
+
+
+ _proto._getRootElement = function _getRootElement(element) {
+ var selector = Util.getSelectorFromElement(element);
+ var parent = false;
+
+ if (selector) {
+ parent = document.querySelector(selector);
+ }
+
+ if (!parent) {
+ parent = $(element).closest("." + ClassName.ALERT)[0];
+ }
+
+ return parent;
+ };
+
+ _proto._triggerCloseEvent = function _triggerCloseEvent(element) {
+ var closeEvent = $.Event(Event.CLOSE);
+ $(element).trigger(closeEvent);
+ return closeEvent;
+ };
+
+ _proto._removeElement = function _removeElement(element) {
+ var _this = this;
+
+ $(element).removeClass(ClassName.SHOW);
+
+ if (!$(element).hasClass(ClassName.FADE)) {
+ this._destroyElement(element);
+
+ return;
+ }
+
+ var transitionDuration = Util.getTransitionDurationFromElement(element);
+ $(element).one(Util.TRANSITION_END, function (event) {
+ return _this._destroyElement(element, event);
+ }).emulateTransitionEnd(transitionDuration);
+ };
+
+ _proto._destroyElement = function _destroyElement(element) {
+ $(element).detach().trigger(Event.CLOSED).remove();
+ }; // Static
+
+
+ Alert._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var $element = $(this);
+ var data = $element.data(DATA_KEY);
+
+ if (!data) {
+ data = new Alert(this);
+ $element.data(DATA_KEY, data);
+ }
+
+ if (config === 'close') {
+ data[config](this);
+ }
+ });
+ };
+
+ Alert._handleDismiss = function _handleDismiss(alertInstance) {
+ return function (event) {
+ if (event) {
+ event.preventDefault();
+ }
+
+ alertInstance.close(this);
+ };
+ };
+
+ _createClass(Alert, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }]);
+
+ return Alert;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $(document).on(Event.CLICK_DATA_API, Selector.DISMISS, Alert._handleDismiss(new Alert()));
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $.fn[NAME] = Alert._jQueryInterface;
+ $.fn[NAME].Constructor = Alert;
+
+ $.fn[NAME].noConflict = function () {
+ $.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Alert._jQueryInterface;
+ };
+
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+
+ var NAME$1 = 'button';
+ var VERSION$1 = '4.2.1';
+ var DATA_KEY$1 = 'bs.button';
+ var EVENT_KEY$1 = "." + DATA_KEY$1;
+ var DATA_API_KEY$1 = '.data-api';
+ var JQUERY_NO_CONFLICT$1 = $.fn[NAME$1];
+ var ClassName$1 = {
+ ACTIVE: 'active',
+ BUTTON: 'btn',
+ FOCUS: 'focus'
+ };
+ var Selector$1 = {
+ DATA_TOGGLE_CARROT: '[data-toggle^="button"]',
+ DATA_TOGGLE: '[data-toggle="buttons"]',
+ INPUT: 'input:not([type="hidden"])',
+ ACTIVE: '.active',
+ BUTTON: '.btn'
+ };
+ var Event$1 = {
+ CLICK_DATA_API: "click" + EVENT_KEY$1 + DATA_API_KEY$1,
+ FOCUS_BLUR_DATA_API: "focus" + EVENT_KEY$1 + DATA_API_KEY$1 + " " + ("blur" + EVENT_KEY$1 + DATA_API_KEY$1)
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Button =
+ /*#__PURE__*/
+ function () {
+ function Button(element) {
+ this._element = element;
+ } // Getters
+
+
+ var _proto = Button.prototype;
+
+ // Public
+ _proto.toggle = function toggle() {
+ var triggerChangeEvent = true;
+ var addAriaPressed = true;
+ var rootElement = $(this._element).closest(Selector$1.DATA_TOGGLE)[0];
+
+ if (rootElement) {
+ var input = this._element.querySelector(Selector$1.INPUT);
+
+ if (input) {
+ if (input.type === 'radio') {
+ if (input.checked && this._element.classList.contains(ClassName$1.ACTIVE)) {
+ triggerChangeEvent = false;
+ } else {
+ var activeElement = rootElement.querySelector(Selector$1.ACTIVE);
+
+ if (activeElement) {
+ $(activeElement).removeClass(ClassName$1.ACTIVE);
+ }
+ }
+ }
+
+ if (triggerChangeEvent) {
+ if (input.hasAttribute('disabled') || rootElement.hasAttribute('disabled') || input.classList.contains('disabled') || rootElement.classList.contains('disabled')) {
+ return;
+ }
+
+ input.checked = !this._element.classList.contains(ClassName$1.ACTIVE);
+ $(input).trigger('change');
+ }
+
+ input.focus();
+ addAriaPressed = false;
+ }
+ }
+
+ if (addAriaPressed) {
+ this._element.setAttribute('aria-pressed', !this._element.classList.contains(ClassName$1.ACTIVE));
+ }
+
+ if (triggerChangeEvent) {
+ $(this._element).toggleClass(ClassName$1.ACTIVE);
+ }
+ };
+
+ _proto.dispose = function dispose() {
+ $.removeData(this._element, DATA_KEY$1);
+ this._element = null;
+ }; // Static
+
+
+ Button._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $(this).data(DATA_KEY$1);
+
+ if (!data) {
+ data = new Button(this);
+ $(this).data(DATA_KEY$1, data);
+ }
+
+ if (config === 'toggle') {
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Button, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION$1;
+ }
+ }]);
+
+ return Button;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $(document).on(Event$1.CLICK_DATA_API, Selector$1.DATA_TOGGLE_CARROT, function (event) {
+ event.preventDefault();
+ var button = event.target;
+
+ if (!$(button).hasClass(ClassName$1.BUTTON)) {
+ button = $(button).closest(Selector$1.BUTTON);
+ }
+
+ Button._jQueryInterface.call($(button), 'toggle');
+ }).on(Event$1.FOCUS_BLUR_DATA_API, Selector$1.DATA_TOGGLE_CARROT, function (event) {
+ var button = $(event.target).closest(Selector$1.BUTTON)[0];
+ $(button).toggleClass(ClassName$1.FOCUS, /^focus(in)?$/.test(event.type));
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $.fn[NAME$1] = Button._jQueryInterface;
+ $.fn[NAME$1].Constructor = Button;
+
+ $.fn[NAME$1].noConflict = function () {
+ $.fn[NAME$1] = JQUERY_NO_CONFLICT$1;
+ return Button._jQueryInterface;
+ };
+
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+
+ var NAME$2 = 'carousel';
+ var VERSION$2 = '4.2.1';
+ var DATA_KEY$2 = 'bs.carousel';
+ var EVENT_KEY$2 = "." + DATA_KEY$2;
+ var DATA_API_KEY$2 = '.data-api';
+ var JQUERY_NO_CONFLICT$2 = $.fn[NAME$2];
+ var ARROW_LEFT_KEYCODE = 37; // KeyboardEvent.which value for left arrow key
+
+ var ARROW_RIGHT_KEYCODE = 39; // KeyboardEvent.which value for right arrow key
+
+ var TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch
+
+ var SWIPE_THRESHOLD = 40;
+ var Default = {
+ interval: 5000,
+ keyboard: true,
+ slide: false,
+ pause: 'hover',
+ wrap: true,
+ touch: true
+ };
+ var DefaultType = {
+ interval: '(number|boolean)',
+ keyboard: 'boolean',
+ slide: '(boolean|string)',
+ pause: '(string|boolean)',
+ wrap: 'boolean',
+ touch: 'boolean'
+ };
+ var Direction = {
+ NEXT: 'next',
+ PREV: 'prev',
+ LEFT: 'left',
+ RIGHT: 'right'
+ };
+ var Event$2 = {
+ SLIDE: "slide" + EVENT_KEY$2,
+ SLID: "slid" + EVENT_KEY$2,
+ KEYDOWN: "keydown" + EVENT_KEY$2,
+ MOUSEENTER: "mouseenter" + EVENT_KEY$2,
+ MOUSELEAVE: "mouseleave" + EVENT_KEY$2,
+ TOUCHSTART: "touchstart" + EVENT_KEY$2,
+ TOUCHMOVE: "touchmove" + EVENT_KEY$2,
+ TOUCHEND: "touchend" + EVENT_KEY$2,
+ POINTERDOWN: "pointerdown" + EVENT_KEY$2,
+ POINTERUP: "pointerup" + EVENT_KEY$2,
+ DRAG_START: "dragstart" + EVENT_KEY$2,
+ LOAD_DATA_API: "load" + EVENT_KEY$2 + DATA_API_KEY$2,
+ CLICK_DATA_API: "click" + EVENT_KEY$2 + DATA_API_KEY$2
+ };
+ var ClassName$2 = {
+ CAROUSEL: 'carousel',
+ ACTIVE: 'active',
+ SLIDE: 'slide',
+ RIGHT: 'carousel-item-right',
+ LEFT: 'carousel-item-left',
+ NEXT: 'carousel-item-next',
+ PREV: 'carousel-item-prev',
+ ITEM: 'carousel-item',
+ POINTER_EVENT: 'pointer-event'
+ };
+ var Selector$2 = {
+ ACTIVE: '.active',
+ ACTIVE_ITEM: '.active.carousel-item',
+ ITEM: '.carousel-item',
+ ITEM_IMG: '.carousel-item img',
+ NEXT_PREV: '.carousel-item-next, .carousel-item-prev',
+ INDICATORS: '.carousel-indicators',
+ DATA_SLIDE: '[data-slide], [data-slide-to]',
+ DATA_RIDE: '[data-ride="carousel"]'
+ };
+ var PointerType = {
+ TOUCH: 'touch',
+ PEN: 'pen'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Carousel =
+ /*#__PURE__*/
+ function () {
+ function Carousel(element, config) {
+ this._items = null;
+ this._interval = null;
+ this._activeElement = null;
+ this._isPaused = false;
+ this._isSliding = false;
+ this.touchTimeout = null;
+ this.touchStartX = 0;
+ this.touchDeltaX = 0;
+ this._config = this._getConfig(config);
+ this._element = element;
+ this._indicatorsElement = this._element.querySelector(Selector$2.INDICATORS);
+ this._touchSupported = 'ontouchstart' in document.documentElement || navigator.maxTouchPoints > 0;
+ this._pointerEvent = Boolean(window.PointerEvent || window.MSPointerEvent);
+
+ this._addEventListeners();
+ } // Getters
+
+
+ var _proto = Carousel.prototype;
+
+ // Public
+ _proto.next = function next() {
+ if (!this._isSliding) {
+ this._slide(Direction.NEXT);
+ }
+ };
+
+ _proto.nextWhenVisible = function nextWhenVisible() {
+ // Don't call next when the page isn't visible
+ // or the carousel or its parent isn't visible
+ if (!document.hidden && $(this._element).is(':visible') && $(this._element).css('visibility') !== 'hidden') {
+ this.next();
+ }
+ };
+
+ _proto.prev = function prev() {
+ if (!this._isSliding) {
+ this._slide(Direction.PREV);
+ }
+ };
+
+ _proto.pause = function pause(event) {
+ if (!event) {
+ this._isPaused = true;
+ }
+
+ if (this._element.querySelector(Selector$2.NEXT_PREV)) {
+ Util.triggerTransitionEnd(this._element);
+ this.cycle(true);
+ }
+
+ clearInterval(this._interval);
+ this._interval = null;
+ };
+
+ _proto.cycle = function cycle(event) {
+ if (!event) {
+ this._isPaused = false;
+ }
+
+ if (this._interval) {
+ clearInterval(this._interval);
+ this._interval = null;
+ }
+
+ if (this._config.interval && !this._isPaused) {
+ this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval);
+ }
+ };
+
+ _proto.to = function to(index) {
+ var _this = this;
+
+ this._activeElement = this._element.querySelector(Selector$2.ACTIVE_ITEM);
+
+ var activeIndex = this._getItemIndex(this._activeElement);
+
+ if (index > this._items.length - 1 || index < 0) {
+ return;
+ }
+
+ if (this._isSliding) {
+ $(this._element).one(Event$2.SLID, function () {
+ return _this.to(index);
+ });
+ return;
+ }
+
+ if (activeIndex === index) {
+ this.pause();
+ this.cycle();
+ return;
+ }
+
+ var direction = index > activeIndex ? Direction.NEXT : Direction.PREV;
+
+ this._slide(direction, this._items[index]);
+ };
+
+ _proto.dispose = function dispose() {
+ $(this._element).off(EVENT_KEY$2);
+ $.removeData(this._element, DATA_KEY$2);
+ this._items = null;
+ this._config = null;
+ this._element = null;
+ this._interval = null;
+ this._isPaused = null;
+ this._isSliding = null;
+ this._activeElement = null;
+ this._indicatorsElement = null;
+ }; // Private
+
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _objectSpread({}, Default, config);
+ Util.typeCheckConfig(NAME$2, config, DefaultType);
+ return config;
+ };
+
+ _proto._handleSwipe = function _handleSwipe() {
+ var absDeltax = Math.abs(this.touchDeltaX);
+
+ if (absDeltax <= SWIPE_THRESHOLD) {
+ return;
+ }
+
+ var direction = absDeltax / this.touchDeltaX; // swipe left
+
+ if (direction > 0) {
+ this.prev();
+ } // swipe right
+
+
+ if (direction < 0) {
+ this.next();
+ }
+ };
+
+ _proto._addEventListeners = function _addEventListeners() {
+ var _this2 = this;
+
+ if (this._config.keyboard) {
+ $(this._element).on(Event$2.KEYDOWN, function (event) {
+ return _this2._keydown(event);
+ });
+ }
+
+ if (this._config.pause === 'hover') {
+ $(this._element).on(Event$2.MOUSEENTER, function (event) {
+ return _this2.pause(event);
+ }).on(Event$2.MOUSELEAVE, function (event) {
+ return _this2.cycle(event);
+ });
+ }
+
+ this._addTouchEventListeners();
+ };
+
+ _proto._addTouchEventListeners = function _addTouchEventListeners() {
+ var _this3 = this;
+
+ if (!this._touchSupported) {
+ return;
+ }
+
+ var start = function start(event) {
+ if (_this3._pointerEvent && PointerType[event.originalEvent.pointerType.toUpperCase()]) {
+ _this3.touchStartX = event.originalEvent.clientX;
+ } else if (!_this3._pointerEvent) {
+ _this3.touchStartX = event.originalEvent.touches[0].clientX;
+ }
+ };
+
+ var move = function move(event) {
+ // ensure swiping with one touch and not pinching
+ if (event.originalEvent.touches && event.originalEvent.touches.length > 1) {
+ _this3.touchDeltaX = 0;
+ } else {
+ _this3.touchDeltaX = event.originalEvent.touches[0].clientX - _this3.touchStartX;
+ }
+ };
+
+ var end = function end(event) {
+ if (_this3._pointerEvent && PointerType[event.originalEvent.pointerType.toUpperCase()]) {
+ _this3.touchDeltaX = event.originalEvent.clientX - _this3.touchStartX;
+ }
+
+ _this3._handleSwipe();
+
+ if (_this3._config.pause === 'hover') {
+ // If it's a touch-enabled device, mouseenter/leave are fired as
+ // part of the mouse compatibility events on first tap - the carousel
+ // would stop cycling until user tapped out of it;
+ // here, we listen for touchend, explicitly pause the carousel
+ // (as if it's the second time we tap on it, mouseenter compat event
+ // is NOT fired) and after a timeout (to allow for mouse compatibility
+ // events to fire) we explicitly restart cycling
+ _this3.pause();
+
+ if (_this3.touchTimeout) {
+ clearTimeout(_this3.touchTimeout);
+ }
+
+ _this3.touchTimeout = setTimeout(function (event) {
+ return _this3.cycle(event);
+ }, TOUCHEVENT_COMPAT_WAIT + _this3._config.interval);
+ }
+ };
+
+ $(this._element.querySelectorAll(Selector$2.ITEM_IMG)).on(Event$2.DRAG_START, function (e) {
+ return e.preventDefault();
+ });
+
+ if (this._pointerEvent) {
+ $(this._element).on(Event$2.POINTERDOWN, function (event) {
+ return start(event);
+ });
+ $(this._element).on(Event$2.POINTERUP, function (event) {
+ return end(event);
+ });
+
+ this._element.classList.add(ClassName$2.POINTER_EVENT);
+ } else {
+ $(this._element).on(Event$2.TOUCHSTART, function (event) {
+ return start(event);
+ });
+ $(this._element).on(Event$2.TOUCHMOVE, function (event) {
+ return move(event);
+ });
+ $(this._element).on(Event$2.TOUCHEND, function (event) {
+ return end(event);
+ });
+ }
+ };
+
+ _proto._keydown = function _keydown(event) {
+ if (/input|textarea/i.test(event.target.tagName)) {
+ return;
+ }
+
+ switch (event.which) {
+ case ARROW_LEFT_KEYCODE:
+ event.preventDefault();
+ this.prev();
+ break;
+
+ case ARROW_RIGHT_KEYCODE:
+ event.preventDefault();
+ this.next();
+ break;
+
+ default:
+ }
+ };
+
+ _proto._getItemIndex = function _getItemIndex(element) {
+ this._items = element && element.parentNode ? [].slice.call(element.parentNode.querySelectorAll(Selector$2.ITEM)) : [];
+ return this._items.indexOf(element);
+ };
+
+ _proto._getItemByDirection = function _getItemByDirection(direction, activeElement) {
+ var isNextDirection = direction === Direction.NEXT;
+ var isPrevDirection = direction === Direction.PREV;
+
+ var activeIndex = this._getItemIndex(activeElement);
+
+ var lastItemIndex = this._items.length - 1;
+ var isGoingToWrap = isPrevDirection && activeIndex === 0 || isNextDirection && activeIndex === lastItemIndex;
+
+ if (isGoingToWrap && !this._config.wrap) {
+ return activeElement;
+ }
+
+ var delta = direction === Direction.PREV ? -1 : 1;
+ var itemIndex = (activeIndex + delta) % this._items.length;
+ return itemIndex === -1 ? this._items[this._items.length - 1] : this._items[itemIndex];
+ };
+
+ _proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) {
+ var targetIndex = this._getItemIndex(relatedTarget);
+
+ var fromIndex = this._getItemIndex(this._element.querySelector(Selector$2.ACTIVE_ITEM));
+
+ var slideEvent = $.Event(Event$2.SLIDE, {
+ relatedTarget: relatedTarget,
+ direction: eventDirectionName,
+ from: fromIndex,
+ to: targetIndex
+ });
+ $(this._element).trigger(slideEvent);
+ return slideEvent;
+ };
+
+ _proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) {
+ if (this._indicatorsElement) {
+ var indicators = [].slice.call(this._indicatorsElement.querySelectorAll(Selector$2.ACTIVE));
+ $(indicators).removeClass(ClassName$2.ACTIVE);
+
+ var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)];
+
+ if (nextIndicator) {
+ $(nextIndicator).addClass(ClassName$2.ACTIVE);
+ }
+ }
+ };
+
+ _proto._slide = function _slide(direction, element) {
+ var _this4 = this;
+
+ var activeElement = this._element.querySelector(Selector$2.ACTIVE_ITEM);
+
+ var activeElementIndex = this._getItemIndex(activeElement);
+
+ var nextElement = element || activeElement && this._getItemByDirection(direction, activeElement);
+
+ var nextElementIndex = this._getItemIndex(nextElement);
+
+ var isCycling = Boolean(this._interval);
+ var directionalClassName;
+ var orderClassName;
+ var eventDirectionName;
+
+ if (direction === Direction.NEXT) {
+ directionalClassName = ClassName$2.LEFT;
+ orderClassName = ClassName$2.NEXT;
+ eventDirectionName = Direction.LEFT;
+ } else {
+ directionalClassName = ClassName$2.RIGHT;
+ orderClassName = ClassName$2.PREV;
+ eventDirectionName = Direction.RIGHT;
+ }
+
+ if (nextElement && $(nextElement).hasClass(ClassName$2.ACTIVE)) {
+ this._isSliding = false;
+ return;
+ }
+
+ var slideEvent = this._triggerSlideEvent(nextElement, eventDirectionName);
+
+ if (slideEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ if (!activeElement || !nextElement) {
+ // Some weirdness is happening, so we bail
+ return;
+ }
+
+ this._isSliding = true;
+
+ if (isCycling) {
+ this.pause();
+ }
+
+ this._setActiveIndicatorElement(nextElement);
+
+ var slidEvent = $.Event(Event$2.SLID, {
+ relatedTarget: nextElement,
+ direction: eventDirectionName,
+ from: activeElementIndex,
+ to: nextElementIndex
+ });
+
+ if ($(this._element).hasClass(ClassName$2.SLIDE)) {
+ $(nextElement).addClass(orderClassName);
+ Util.reflow(nextElement);
+ $(activeElement).addClass(directionalClassName);
+ $(nextElement).addClass(directionalClassName);
+ var nextElementInterval = parseInt(nextElement.getAttribute('data-interval'), 10);
+
+ if (nextElementInterval) {
+ this._config.defaultInterval = this._config.defaultInterval || this._config.interval;
+ this._config.interval = nextElementInterval;
+ } else {
+ this._config.interval = this._config.defaultInterval || this._config.interval;
+ }
+
+ var transitionDuration = Util.getTransitionDurationFromElement(activeElement);
+ $(activeElement).one(Util.TRANSITION_END, function () {
+ $(nextElement).removeClass(directionalClassName + " " + orderClassName).addClass(ClassName$2.ACTIVE);
+ $(activeElement).removeClass(ClassName$2.ACTIVE + " " + orderClassName + " " + directionalClassName);
+ _this4._isSliding = false;
+ setTimeout(function () {
+ return $(_this4._element).trigger(slidEvent);
+ }, 0);
+ }).emulateTransitionEnd(transitionDuration);
+ } else {
+ $(activeElement).removeClass(ClassName$2.ACTIVE);
+ $(nextElement).addClass(ClassName$2.ACTIVE);
+ this._isSliding = false;
+ $(this._element).trigger(slidEvent);
+ }
+
+ if (isCycling) {
+ this.cycle();
+ }
+ }; // Static
+
+
+ Carousel._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $(this).data(DATA_KEY$2);
+
+ var _config = _objectSpread({}, Default, $(this).data());
+
+ if (typeof config === 'object') {
+ _config = _objectSpread({}, _config, config);
+ }
+
+ var action = typeof config === 'string' ? config : _config.slide;
+
+ if (!data) {
+ data = new Carousel(this, _config);
+ $(this).data(DATA_KEY$2, data);
+ }
+
+ if (typeof config === 'number') {
+ data.to(config);
+ } else if (typeof action === 'string') {
+ if (typeof data[action] === 'undefined') {
+ throw new TypeError("No method named \"" + action + "\"");
+ }
+
+ data[action]();
+ } else if (_config.interval) {
+ data.pause();
+ data.cycle();
+ }
+ });
+ };
+
+ Carousel._dataApiClickHandler = function _dataApiClickHandler(event) {
+ var selector = Util.getSelectorFromElement(this);
+
+ if (!selector) {
+ return;
+ }
+
+ var target = $(selector)[0];
+
+ if (!target || !$(target).hasClass(ClassName$2.CAROUSEL)) {
+ return;
+ }
+
+ var config = _objectSpread({}, $(target).data(), $(this).data());
+
+ var slideIndex = this.getAttribute('data-slide-to');
+
+ if (slideIndex) {
+ config.interval = false;
+ }
+
+ Carousel._jQueryInterface.call($(target), config);
+
+ if (slideIndex) {
+ $(target).data(DATA_KEY$2).to(slideIndex);
+ }
+
+ event.preventDefault();
+ };
+
+ _createClass(Carousel, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION$2;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }]);
+
+ return Carousel;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $(document).on(Event$2.CLICK_DATA_API, Selector$2.DATA_SLIDE, Carousel._dataApiClickHandler);
+ $(window).on(Event$2.LOAD_DATA_API, function () {
+ var carousels = [].slice.call(document.querySelectorAll(Selector$2.DATA_RIDE));
+
+ for (var i = 0, len = carousels.length; i < len; i++) {
+ var $carousel = $(carousels[i]);
+
+ Carousel._jQueryInterface.call($carousel, $carousel.data());
+ }
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $.fn[NAME$2] = Carousel._jQueryInterface;
+ $.fn[NAME$2].Constructor = Carousel;
+
+ $.fn[NAME$2].noConflict = function () {
+ $.fn[NAME$2] = JQUERY_NO_CONFLICT$2;
+ return Carousel._jQueryInterface;
+ };
+
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+
+ var NAME$3 = 'collapse';
+ var VERSION$3 = '4.2.1';
+ var DATA_KEY$3 = 'bs.collapse';
+ var EVENT_KEY$3 = "." + DATA_KEY$3;
+ var DATA_API_KEY$3 = '.data-api';
+ var JQUERY_NO_CONFLICT$3 = $.fn[NAME$3];
+ var Default$1 = {
+ toggle: true,
+ parent: ''
+ };
+ var DefaultType$1 = {
+ toggle: 'boolean',
+ parent: '(string|element)'
+ };
+ var Event$3 = {
+ SHOW: "show" + EVENT_KEY$3,
+ SHOWN: "shown" + EVENT_KEY$3,
+ HIDE: "hide" + EVENT_KEY$3,
+ HIDDEN: "hidden" + EVENT_KEY$3,
+ CLICK_DATA_API: "click" + EVENT_KEY$3 + DATA_API_KEY$3
+ };
+ var ClassName$3 = {
+ SHOW: 'show',
+ COLLAPSE: 'collapse',
+ COLLAPSING: 'collapsing',
+ COLLAPSED: 'collapsed'
+ };
+ var Dimension = {
+ WIDTH: 'width',
+ HEIGHT: 'height'
+ };
+ var Selector$3 = {
+ ACTIVES: '.show, .collapsing',
+ DATA_TOGGLE: '[data-toggle="collapse"]'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Collapse =
+ /*#__PURE__*/
+ function () {
+ function Collapse(element, config) {
+ this._isTransitioning = false;
+ this._element = element;
+ this._config = this._getConfig(config);
+ this._triggerArray = [].slice.call(document.querySelectorAll("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]")));
+ var toggleList = [].slice.call(document.querySelectorAll(Selector$3.DATA_TOGGLE));
+
+ for (var i = 0, len = toggleList.length; i < len; i++) {
+ var elem = toggleList[i];
+ var selector = Util.getSelectorFromElement(elem);
+ var filterElement = [].slice.call(document.querySelectorAll(selector)).filter(function (foundElem) {
+ return foundElem === element;
+ });
+
+ if (selector !== null && filterElement.length > 0) {
+ this._selector = selector;
+
+ this._triggerArray.push(elem);
+ }
+ }
+
+ this._parent = this._config.parent ? this._getParent() : null;
+
+ if (!this._config.parent) {
+ this._addAriaAndCollapsedClass(this._element, this._triggerArray);
+ }
+
+ if (this._config.toggle) {
+ this.toggle();
+ }
+ } // Getters
+
+
+ var _proto = Collapse.prototype;
+
+ // Public
+ _proto.toggle = function toggle() {
+ if ($(this._element).hasClass(ClassName$3.SHOW)) {
+ this.hide();
+ } else {
+ this.show();
+ }
+ };
+
+ _proto.show = function show() {
+ var _this = this;
+
+ if (this._isTransitioning || $(this._element).hasClass(ClassName$3.SHOW)) {
+ return;
+ }
+
+ var actives;
+ var activesData;
+
+ if (this._parent) {
+ actives = [].slice.call(this._parent.querySelectorAll(Selector$3.ACTIVES)).filter(function (elem) {
+ if (typeof _this._config.parent === 'string') {
+ return elem.getAttribute('data-parent') === _this._config.parent;
+ }
+
+ return elem.classList.contains(ClassName$3.COLLAPSE);
+ });
+
+ if (actives.length === 0) {
+ actives = null;
+ }
+ }
+
+ if (actives) {
+ activesData = $(actives).not(this._selector).data(DATA_KEY$3);
+
+ if (activesData && activesData._isTransitioning) {
+ return;
+ }
+ }
+
+ var startEvent = $.Event(Event$3.SHOW);
+ $(this._element).trigger(startEvent);
+
+ if (startEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ if (actives) {
+ Collapse._jQueryInterface.call($(actives).not(this._selector), 'hide');
+
+ if (!activesData) {
+ $(actives).data(DATA_KEY$3, null);
+ }
+ }
+
+ var dimension = this._getDimension();
+
+ $(this._element).removeClass(ClassName$3.COLLAPSE).addClass(ClassName$3.COLLAPSING);
+ this._element.style[dimension] = 0;
+
+ if (this._triggerArray.length) {
+ $(this._triggerArray).removeClass(ClassName$3.COLLAPSED).attr('aria-expanded', true);
+ }
+
+ this.setTransitioning(true);
+
+ var complete = function complete() {
+ $(_this._element).removeClass(ClassName$3.COLLAPSING).addClass(ClassName$3.COLLAPSE).addClass(ClassName$3.SHOW);
+ _this._element.style[dimension] = '';
+
+ _this.setTransitioning(false);
+
+ $(_this._element).trigger(Event$3.SHOWN);
+ };
+
+ var capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);
+ var scrollSize = "scroll" + capitalizedDimension;
+ var transitionDuration = Util.getTransitionDurationFromElement(this._element);
+ $(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
+ this._element.style[dimension] = this._element[scrollSize] + "px";
+ };
+
+ _proto.hide = function hide() {
+ var _this2 = this;
+
+ if (this._isTransitioning || !$(this._element).hasClass(ClassName$3.SHOW)) {
+ return;
+ }
+
+ var startEvent = $.Event(Event$3.HIDE);
+ $(this._element).trigger(startEvent);
+
+ if (startEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ var dimension = this._getDimension();
+
+ this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px";
+ Util.reflow(this._element);
+ $(this._element).addClass(ClassName$3.COLLAPSING).removeClass(ClassName$3.COLLAPSE).removeClass(ClassName$3.SHOW);
+ var triggerArrayLength = this._triggerArray.length;
+
+ if (triggerArrayLength > 0) {
+ for (var i = 0; i < triggerArrayLength; i++) {
+ var trigger = this._triggerArray[i];
+ var selector = Util.getSelectorFromElement(trigger);
+
+ if (selector !== null) {
+ var $elem = $([].slice.call(document.querySelectorAll(selector)));
+
+ if (!$elem.hasClass(ClassName$3.SHOW)) {
+ $(trigger).addClass(ClassName$3.COLLAPSED).attr('aria-expanded', false);
+ }
+ }
+ }
+ }
+
+ this.setTransitioning(true);
+
+ var complete = function complete() {
+ _this2.setTransitioning(false);
+
+ $(_this2._element).removeClass(ClassName$3.COLLAPSING).addClass(ClassName$3.COLLAPSE).trigger(Event$3.HIDDEN);
+ };
+
+ this._element.style[dimension] = '';
+ var transitionDuration = Util.getTransitionDurationFromElement(this._element);
+ $(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
+ };
+
+ _proto.setTransitioning = function setTransitioning(isTransitioning) {
+ this._isTransitioning = isTransitioning;
+ };
+
+ _proto.dispose = function dispose() {
+ $.removeData(this._element, DATA_KEY$3);
+ this._config = null;
+ this._parent = null;
+ this._element = null;
+ this._triggerArray = null;
+ this._isTransitioning = null;
+ }; // Private
+
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _objectSpread({}, Default$1, config);
+ config.toggle = Boolean(config.toggle); // Coerce string values
+
+ Util.typeCheckConfig(NAME$3, config, DefaultType$1);
+ return config;
+ };
+
+ _proto._getDimension = function _getDimension() {
+ var hasWidth = $(this._element).hasClass(Dimension.WIDTH);
+ return hasWidth ? Dimension.WIDTH : Dimension.HEIGHT;
+ };
+
+ _proto._getParent = function _getParent() {
+ var _this3 = this;
+
+ var parent;
+
+ if (Util.isElement(this._config.parent)) {
+ parent = this._config.parent; // It's a jQuery object
+
+ if (typeof this._config.parent.jquery !== 'undefined') {
+ parent = this._config.parent[0];
+ }
+ } else {
+ parent = document.querySelector(this._config.parent);
+ }
+
+ var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]";
+ var children = [].slice.call(parent.querySelectorAll(selector));
+ $(children).each(function (i, element) {
+ _this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]);
+ });
+ return parent;
+ };
+
+ _proto._addAriaAndCollapsedClass = function _addAriaAndCollapsedClass(element, triggerArray) {
+ var isOpen = $(element).hasClass(ClassName$3.SHOW);
+
+ if (triggerArray.length) {
+ $(triggerArray).toggleClass(ClassName$3.COLLAPSED, !isOpen).attr('aria-expanded', isOpen);
+ }
+ }; // Static
+
+
+ Collapse._getTargetFromElement = function _getTargetFromElement(element) {
+ var selector = Util.getSelectorFromElement(element);
+ return selector ? document.querySelector(selector) : null;
+ };
+
+ Collapse._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var $this = $(this);
+ var data = $this.data(DATA_KEY$3);
+
+ var _config = _objectSpread({}, Default$1, $this.data(), typeof config === 'object' && config ? config : {});
+
+ if (!data && _config.toggle && /show|hide/.test(config)) {
+ _config.toggle = false;
+ }
+
+ if (!data) {
+ data = new Collapse(this, _config);
+ $this.data(DATA_KEY$3, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Collapse, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION$3;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default$1;
+ }
+ }]);
+
+ return Collapse;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $(document).on(Event$3.CLICK_DATA_API, Selector$3.DATA_TOGGLE, function (event) {
+ // preventDefault only for <a> elements (which change the URL) not inside the collapsible element
+ if (event.currentTarget.tagName === 'A') {
+ event.preventDefault();
+ }
+
+ var $trigger = $(this);
+ var selector = Util.getSelectorFromElement(this);
+ var selectors = [].slice.call(document.querySelectorAll(selector));
+ $(selectors).each(function () {
+ var $target = $(this);
+ var data = $target.data(DATA_KEY$3);
+ var config = data ? 'toggle' : $trigger.data();
+
+ Collapse._jQueryInterface.call($target, config);
+ });
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $.fn[NAME$3] = Collapse._jQueryInterface;
+ $.fn[NAME$3].Constructor = Collapse;
+
+ $.fn[NAME$3].noConflict = function () {
+ $.fn[NAME$3] = JQUERY_NO_CONFLICT$3;
+ return Collapse._jQueryInterface;
+ };
+
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+
+ var NAME$4 = 'dropdown';
+ var VERSION$4 = '4.2.1';
+ var DATA_KEY$4 = 'bs.dropdown';
+ var EVENT_KEY$4 = "." + DATA_KEY$4;
+ var DATA_API_KEY$4 = '.data-api';
+ var JQUERY_NO_CONFLICT$4 = $.fn[NAME$4];
+ var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key
+
+ var SPACE_KEYCODE = 32; // KeyboardEvent.which value for space key
+
+ var TAB_KEYCODE = 9; // KeyboardEvent.which value for tab key
+
+ var ARROW_UP_KEYCODE = 38; // KeyboardEvent.which value for up arrow key
+
+ var ARROW_DOWN_KEYCODE = 40; // KeyboardEvent.which value for down arrow key
+
+ var RIGHT_MOUSE_BUTTON_WHICH = 3; // MouseEvent.which value for the right button (assuming a right-handed mouse)
+
+ var REGEXP_KEYDOWN = new RegExp(ARROW_UP_KEYCODE + "|" + ARROW_DOWN_KEYCODE + "|" + ESCAPE_KEYCODE);
+ var Event$4 = {
+ HIDE: "hide" + EVENT_KEY$4,
+ HIDDEN: "hidden" + EVENT_KEY$4,
+ SHOW: "show" + EVENT_KEY$4,
+ SHOWN: "shown" + EVENT_KEY$4,
+ CLICK: "click" + EVENT_KEY$4,
+ CLICK_DATA_API: "click" + EVENT_KEY$4 + DATA_API_KEY$4,
+ KEYDOWN_DATA_API: "keydown" + EVENT_KEY$4 + DATA_API_KEY$4,
+ KEYUP_DATA_API: "keyup" + EVENT_KEY$4 + DATA_API_KEY$4
+ };
+ var ClassName$4 = {
+ DISABLED: 'disabled',
+ SHOW: 'show',
+ DROPUP: 'dropup',
+ DROPRIGHT: 'dropright',
+ DROPLEFT: 'dropleft',
+ MENURIGHT: 'dropdown-menu-right',
+ MENULEFT: 'dropdown-menu-left',
+ POSITION_STATIC: 'position-static'
+ };
+ var Selector$4 = {
+ DATA_TOGGLE: '[data-toggle="dropdown"]',
+ FORM_CHILD: '.dropdown form',
+ MENU: '.dropdown-menu',
+ NAVBAR_NAV: '.navbar-nav',
+ VISIBLE_ITEMS: '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)'
+ };
+ var AttachmentMap = {
+ TOP: 'top-start',
+ TOPEND: 'top-end',
+ BOTTOM: 'bottom-start',
+ BOTTOMEND: 'bottom-end',
+ RIGHT: 'right-start',
+ RIGHTEND: 'right-end',
+ LEFT: 'left-start',
+ LEFTEND: 'left-end'
+ };
+ var Default$2 = {
+ offset: 0,
+ flip: true,
+ boundary: 'scrollParent',
+ reference: 'toggle',
+ display: 'dynamic'
+ };
+ var DefaultType$2 = {
+ offset: '(number|string|function)',
+ flip: 'boolean',
+ boundary: '(string|element)',
+ reference: '(string|element)',
+ display: 'string'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Dropdown =
+ /*#__PURE__*/
+ function () {
+ function Dropdown(element, config) {
+ this._element = element;
+ this._popper = null;
+ this._config = this._getConfig(config);
+ this._menu = this._getMenuElement();
+ this._inNavbar = this._detectNavbar();
+
+ this._addEventListeners();
+ } // Getters
+
+
+ var _proto = Dropdown.prototype;
+
+ // Public
+ _proto.toggle = function toggle() {
+ if (this._element.disabled || $(this._element).hasClass(ClassName$4.DISABLED)) {
+ return;
+ }
+
+ var parent = Dropdown._getParentFromElement(this._element);
+
+ var isActive = $(this._menu).hasClass(ClassName$4.SHOW);
+
+ Dropdown._clearMenus();
+
+ if (isActive) {
+ return;
+ }
+
+ var relatedTarget = {
+ relatedTarget: this._element
+ };
+ var showEvent = $.Event(Event$4.SHOW, relatedTarget);
+ $(parent).trigger(showEvent);
+
+ if (showEvent.isDefaultPrevented()) {
+ return;
+ } // Disable totally Popper.js for Dropdown in Navbar
+
+
+ if (!this._inNavbar) {
+ /**
+ * Check for Popper dependency
+ * Popper - https://popper.js.org
+ */
+ if (typeof Popper === 'undefined') {
+ throw new TypeError('Bootstrap\'s dropdowns require Popper.js (https://popper.js.org/)');
+ }
+
+ var referenceElement = this._element;
+
+ if (this._config.reference === 'parent') {
+ referenceElement = parent;
+ } else if (Util.isElement(this._config.reference)) {
+ referenceElement = this._config.reference; // Check if it's jQuery element
+
+ if (typeof this._config.reference.jquery !== 'undefined') {
+ referenceElement = this._config.reference[0];
+ }
+ } // If boundary is not `scrollParent`, then set position to `static`
+ // to allow the menu to "escape" the scroll parent's boundaries
+ // https://github.com/twbs/bootstrap/issues/24251
+
+
+ if (this._config.boundary !== 'scrollParent') {
+ $(parent).addClass(ClassName$4.POSITION_STATIC);
+ }
+
+ this._popper = new Popper(referenceElement, this._menu, this._getPopperConfig());
+ } // If this is a touch-enabled device we add extra
+ // empty mouseover listeners to the body's immediate children;
+ // only needed because of broken event delegation on iOS
+ // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
+
+
+ if ('ontouchstart' in document.documentElement && $(parent).closest(Selector$4.NAVBAR_NAV).length === 0) {
+ $(document.body).children().on('mouseover', null, $.noop);
+ }
+
+ this._element.focus();
+
+ this._element.setAttribute('aria-expanded', true);
+
+ $(this._menu).toggleClass(ClassName$4.SHOW);
+ $(parent).toggleClass(ClassName$4.SHOW).trigger($.Event(Event$4.SHOWN, relatedTarget));
+ };
+
+ _proto.show = function show() {
+ if (this._element.disabled || $(this._element).hasClass(ClassName$4.DISABLED) || $(this._menu).hasClass(ClassName$4.SHOW)) {
+ return;
+ }
+
+ var relatedTarget = {
+ relatedTarget: this._element
+ };
+ var showEvent = $.Event(Event$4.SHOW, relatedTarget);
+
+ var parent = Dropdown._getParentFromElement(this._element);
+
+ $(parent).trigger(showEvent);
+
+ if (showEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ $(this._menu).toggleClass(ClassName$4.SHOW);
+ $(parent).toggleClass(ClassName$4.SHOW).trigger($.Event(Event$4.SHOWN, relatedTarget));
+ };
+
+ _proto.hide = function hide() {
+ if (this._element.disabled || $(this._element).hasClass(ClassName$4.DISABLED) || !$(this._menu).hasClass(ClassName$4.SHOW)) {
+ return;
+ }
+
+ var relatedTarget = {
+ relatedTarget: this._element
+ };
+ var hideEvent = $.Event(Event$4.HIDE, relatedTarget);
+
+ var parent = Dropdown._getParentFromElement(this._element);
+
+ $(parent).trigger(hideEvent);
+
+ if (hideEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ $(this._menu).toggleClass(ClassName$4.SHOW);
+ $(parent).toggleClass(ClassName$4.SHOW).trigger($.Event(Event$4.HIDDEN, relatedTarget));
+ };
+
+ _proto.dispose = function dispose() {
+ $.removeData(this._element, DATA_KEY$4);
+ $(this._element).off(EVENT_KEY$4);
+ this._element = null;
+ this._menu = null;
+
+ if (this._popper !== null) {
+ this._popper.destroy();
+
+ this._popper = null;
+ }
+ };
+
+ _proto.update = function update() {
+ this._inNavbar = this._detectNavbar();
+
+ if (this._popper !== null) {
+ this._popper.scheduleUpdate();
+ }
+ }; // Private
+
+
+ _proto._addEventListeners = function _addEventListeners() {
+ var _this = this;
+
+ $(this._element).on(Event$4.CLICK, function (event) {
+ event.preventDefault();
+ event.stopPropagation();
+
+ _this.toggle();
+ });
+ };
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _objectSpread({}, this.constructor.Default, $(this._element).data(), config);
+ Util.typeCheckConfig(NAME$4, config, this.constructor.DefaultType);
+ return config;
+ };
+
+ _proto._getMenuElement = function _getMenuElement() {
+ if (!this._menu) {
+ var parent = Dropdown._getParentFromElement(this._element);
+
+ if (parent) {
+ this._menu = parent.querySelector(Selector$4.MENU);
+ }
+ }
+
+ return this._menu;
+ };
+
+ _proto._getPlacement = function _getPlacement() {
+ var $parentDropdown = $(this._element.parentNode);
+ var placement = AttachmentMap.BOTTOM; // Handle dropup
+
+ if ($parentDropdown.hasClass(ClassName$4.DROPUP)) {
+ placement = AttachmentMap.TOP;
+
+ if ($(this._menu).hasClass(ClassName$4.MENURIGHT)) {
+ placement = AttachmentMap.TOPEND;
+ }
+ } else if ($parentDropdown.hasClass(ClassName$4.DROPRIGHT)) {
+ placement = AttachmentMap.RIGHT;
+ } else if ($parentDropdown.hasClass(ClassName$4.DROPLEFT)) {
+ placement = AttachmentMap.LEFT;
+ } else if ($(this._menu).hasClass(ClassName$4.MENURIGHT)) {
+ placement = AttachmentMap.BOTTOMEND;
+ }
+
+ return placement;
+ };
+
+ _proto._detectNavbar = function _detectNavbar() {
+ return $(this._element).closest('.navbar').length > 0;
+ };
+
+ _proto._getPopperConfig = function _getPopperConfig() {
+ var _this2 = this;
+
+ var offsetConf = {};
+
+ if (typeof this._config.offset === 'function') {
+ offsetConf.fn = function (data) {
+ data.offsets = _objectSpread({}, data.offsets, _this2._config.offset(data.offsets) || {});
+ return data;
+ };
+ } else {
+ offsetConf.offset = this._config.offset;
+ }
+
+ var popperConfig = {
+ placement: this._getPlacement(),
+ modifiers: {
+ offset: offsetConf,
+ flip: {
+ enabled: this._config.flip
+ },
+ preventOverflow: {
+ boundariesElement: this._config.boundary
+ }
+ } // Disable Popper.js if we have a static display
+
+ };
+
+ if (this._config.display === 'static') {
+ popperConfig.modifiers.applyStyle = {
+ enabled: false
+ };
+ }
+
+ return popperConfig;
+ }; // Static
+
+
+ Dropdown._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $(this).data(DATA_KEY$4);
+
+ var _config = typeof config === 'object' ? config : null;
+
+ if (!data) {
+ data = new Dropdown(this, _config);
+ $(this).data(DATA_KEY$4, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ Dropdown._clearMenus = function _clearMenus(event) {
+ if (event && (event.which === RIGHT_MOUSE_BUTTON_WHICH || event.type === 'keyup' && event.which !== TAB_KEYCODE)) {
+ return;
+ }
+
+ var toggles = [].slice.call(document.querySelectorAll(Selector$4.DATA_TOGGLE));
+
+ for (var i = 0, len = toggles.length; i < len; i++) {
+ var parent = Dropdown._getParentFromElement(toggles[i]);
+
+ var context = $(toggles[i]).data(DATA_KEY$4);
+ var relatedTarget = {
+ relatedTarget: toggles[i]
+ };
+
+ if (event && event.type === 'click') {
+ relatedTarget.clickEvent = event;
+ }
+
+ if (!context) {
+ continue;
+ }
+
+ var dropdownMenu = context._menu;
+
+ if (!$(parent).hasClass(ClassName$4.SHOW)) {
+ continue;
+ }
+
+ if (event && (event.type === 'click' && /input|textarea/i.test(event.target.tagName) || event.type === 'keyup' && event.which === TAB_KEYCODE) && $.contains(parent, event.target)) {
+ continue;
+ }
+
+ var hideEvent = $.Event(Event$4.HIDE, relatedTarget);
+ $(parent).trigger(hideEvent);
+
+ if (hideEvent.isDefaultPrevented()) {
+ continue;
+ } // If this is a touch-enabled device we remove the extra
+ // empty mouseover listeners we added for iOS support
+
+
+ if ('ontouchstart' in document.documentElement) {
+ $(document.body).children().off('mouseover', null, $.noop);
+ }
+
+ toggles[i].setAttribute('aria-expanded', 'false');
+ $(dropdownMenu).removeClass(ClassName$4.SHOW);
+ $(parent).removeClass(ClassName$4.SHOW).trigger($.Event(Event$4.HIDDEN, relatedTarget));
+ }
+ };
+
+ Dropdown._getParentFromElement = function _getParentFromElement(element) {
+ var parent;
+ var selector = Util.getSelectorFromElement(element);
+
+ if (selector) {
+ parent = document.querySelector(selector);
+ }
+
+ return parent || element.parentNode;
+ }; // eslint-disable-next-line complexity
+
+
+ Dropdown._dataApiKeydownHandler = function _dataApiKeydownHandler(event) {
+ // If not input/textarea:
+ // - And not a key in REGEXP_KEYDOWN => not a dropdown command
+ // If input/textarea:
+ // - If space key => not a dropdown command
+ // - If key is other than escape
+ // - If key is not up or down => not a dropdown command
+ // - If trigger inside the menu => not a dropdown command
+ if (/input|textarea/i.test(event.target.tagName) ? event.which === SPACE_KEYCODE || event.which !== ESCAPE_KEYCODE && (event.which !== ARROW_DOWN_KEYCODE && event.which !== ARROW_UP_KEYCODE || $(event.target).closest(Selector$4.MENU).length) : !REGEXP_KEYDOWN.test(event.which)) {
+ return;
+ }
+
+ event.preventDefault();
+ event.stopPropagation();
+
+ if (this.disabled || $(this).hasClass(ClassName$4.DISABLED)) {
+ return;
+ }
+
+ var parent = Dropdown._getParentFromElement(this);
+
+ var isActive = $(parent).hasClass(ClassName$4.SHOW);
+
+ if (!isActive || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) {
+ if (event.which === ESCAPE_KEYCODE) {
+ var toggle = parent.querySelector(Selector$4.DATA_TOGGLE);
+ $(toggle).trigger('focus');
+ }
+
+ $(this).trigger('click');
+ return;
+ }
+
+ var items = [].slice.call(parent.querySelectorAll(Selector$4.VISIBLE_ITEMS));
+
+ if (items.length === 0) {
+ return;
+ }
+
+ var index = items.indexOf(event.target);
+
+ if (event.which === ARROW_UP_KEYCODE && index > 0) {
+ // Up
+ index--;
+ }
+
+ if (event.which === ARROW_DOWN_KEYCODE && index < items.length - 1) {
+ // Down
+ index++;
+ }
+
+ if (index < 0) {
+ index = 0;
+ }
+
+ items[index].focus();
+ };
+
+ _createClass(Dropdown, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION$4;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default$2;
+ }
+ }, {
+ key: "DefaultType",
+ get: function get() {
+ return DefaultType$2;
+ }
+ }]);
+
+ return Dropdown;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $(document).on(Event$4.KEYDOWN_DATA_API, Selector$4.DATA_TOGGLE, Dropdown._dataApiKeydownHandler).on(Event$4.KEYDOWN_DATA_API, Selector$4.MENU, Dropdown._dataApiKeydownHandler).on(Event$4.CLICK_DATA_API + " " + Event$4.KEYUP_DATA_API, Dropdown._clearMenus).on(Event$4.CLICK_DATA_API, Selector$4.DATA_TOGGLE, function (event) {
+ event.preventDefault();
+ event.stopPropagation();
+
+ Dropdown._jQueryInterface.call($(this), 'toggle');
+ }).on(Event$4.CLICK_DATA_API, Selector$4.FORM_CHILD, function (e) {
+ e.stopPropagation();
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $.fn[NAME$4] = Dropdown._jQueryInterface;
+ $.fn[NAME$4].Constructor = Dropdown;
+
+ $.fn[NAME$4].noConflict = function () {
+ $.fn[NAME$4] = JQUERY_NO_CONFLICT$4;
+ return Dropdown._jQueryInterface;
+ };
+
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+
+ var NAME$5 = 'modal';
+ var VERSION$5 = '4.2.1';
+ var DATA_KEY$5 = 'bs.modal';
+ var EVENT_KEY$5 = "." + DATA_KEY$5;
+ var DATA_API_KEY$5 = '.data-api';
+ var JQUERY_NO_CONFLICT$5 = $.fn[NAME$5];
+ var ESCAPE_KEYCODE$1 = 27; // KeyboardEvent.which value for Escape (Esc) key
+
+ var Default$3 = {
+ backdrop: true,
+ keyboard: true,
+ focus: true,
+ show: true
+ };
+ var DefaultType$3 = {
+ backdrop: '(boolean|string)',
+ keyboard: 'boolean',
+ focus: 'boolean',
+ show: 'boolean'
+ };
+ var Event$5 = {
+ HIDE: "hide" + EVENT_KEY$5,
+ HIDDEN: "hidden" + EVENT_KEY$5,
+ SHOW: "show" + EVENT_KEY$5,
+ SHOWN: "shown" + EVENT_KEY$5,
+ FOCUSIN: "focusin" + EVENT_KEY$5,
+ RESIZE: "resize" + EVENT_KEY$5,
+ CLICK_DISMISS: "click.dismiss" + EVENT_KEY$5,
+ KEYDOWN_DISMISS: "keydown.dismiss" + EVENT_KEY$5,
+ MOUSEUP_DISMISS: "mouseup.dismiss" + EVENT_KEY$5,
+ MOUSEDOWN_DISMISS: "mousedown.dismiss" + EVENT_KEY$5,
+ CLICK_DATA_API: "click" + EVENT_KEY$5 + DATA_API_KEY$5
+ };
+ var ClassName$5 = {
+ SCROLLBAR_MEASURER: 'modal-scrollbar-measure',
+ BACKDROP: 'modal-backdrop',
+ OPEN: 'modal-open',
+ FADE: 'fade',
+ SHOW: 'show'
+ };
+ var Selector$5 = {
+ DIALOG: '.modal-dialog',
+ DATA_TOGGLE: '[data-toggle="modal"]',
+ DATA_DISMISS: '[data-dismiss="modal"]',
+ FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top',
+ STICKY_CONTENT: '.sticky-top'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Modal =
+ /*#__PURE__*/
+ function () {
+ function Modal(element, config) {
+ this._config = this._getConfig(config);
+ this._element = element;
+ this._dialog = element.querySelector(Selector$5.DIALOG);
+ this._backdrop = null;
+ this._isShown = false;
+ this._isBodyOverflowing = false;
+ this._ignoreBackdropClick = false;
+ this._isTransitioning = false;
+ this._scrollbarWidth = 0;
+ } // Getters
+
+
+ var _proto = Modal.prototype;
+
+ // Public
+ _proto.toggle = function toggle(relatedTarget) {
+ return this._isShown ? this.hide() : this.show(relatedTarget);
+ };
+
+ _proto.show = function show(relatedTarget) {
+ var _this = this;
+
+ if (this._isShown || this._isTransitioning) {
+ return;
+ }
+
+ if ($(this._element).hasClass(ClassName$5.FADE)) {
+ this._isTransitioning = true;
+ }
+
+ var showEvent = $.Event(Event$5.SHOW, {
+ relatedTarget: relatedTarget
+ });
+ $(this._element).trigger(showEvent);
+
+ if (this._isShown || showEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ this._isShown = true;
+
+ this._checkScrollbar();
+
+ this._setScrollbar();
+
+ this._adjustDialog();
+
+ this._setEscapeEvent();
+
+ this._setResizeEvent();
+
+ $(this._element).on(Event$5.CLICK_DISMISS, Selector$5.DATA_DISMISS, function (event) {
+ return _this.hide(event);
+ });
+ $(this._dialog).on(Event$5.MOUSEDOWN_DISMISS, function () {
+ $(_this._element).one(Event$5.MOUSEUP_DISMISS, function (event) {
+ if ($(event.target).is(_this._element)) {
+ _this._ignoreBackdropClick = true;
+ }
+ });
+ });
+
+ this._showBackdrop(function () {
+ return _this._showElement(relatedTarget);
+ });
+ };
+
+ _proto.hide = function hide(event) {
+ var _this2 = this;
+
+ if (event) {
+ event.preventDefault();
+ }
+
+ if (!this._isShown || this._isTransitioning) {
+ return;
+ }
+
+ var hideEvent = $.Event(Event$5.HIDE);
+ $(this._element).trigger(hideEvent);
+
+ if (!this._isShown || hideEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ this._isShown = false;
+ var transition = $(this._element).hasClass(ClassName$5.FADE);
+
+ if (transition) {
+ this._isTransitioning = true;
+ }
+
+ this._setEscapeEvent();
+
+ this._setResizeEvent();
+
+ $(document).off(Event$5.FOCUSIN);
+ $(this._element).removeClass(ClassName$5.SHOW);
+ $(this._element).off(Event$5.CLICK_DISMISS);
+ $(this._dialog).off(Event$5.MOUSEDOWN_DISMISS);
+
+ if (transition) {
+ var transitionDuration = Util.getTransitionDurationFromElement(this._element);
+ $(this._element).one(Util.TRANSITION_END, function (event) {
+ return _this2._hideModal(event);
+ }).emulateTransitionEnd(transitionDuration);
+ } else {
+ this._hideModal();
+ }
+ };
+
+ _proto.dispose = function dispose() {
+ [window, this._element, this._dialog].forEach(function (htmlElement) {
+ return $(htmlElement).off(EVENT_KEY$5);
+ });
+ /**
+ * `document` has 2 events `Event.FOCUSIN` and `Event.CLICK_DATA_API`
+ * Do not move `document` in `htmlElements` array
+ * It will remove `Event.CLICK_DATA_API` event that should remain
+ */
+
+ $(document).off(Event$5.FOCUSIN);
+ $.removeData(this._element, DATA_KEY$5);
+ this._config = null;
+ this._element = null;
+ this._dialog = null;
+ this._backdrop = null;
+ this._isShown = null;
+ this._isBodyOverflowing = null;
+ this._ignoreBackdropClick = null;
+ this._isTransitioning = null;
+ this._scrollbarWidth = null;
+ };
+
+ _proto.handleUpdate = function handleUpdate() {
+ this._adjustDialog();
+ }; // Private
+
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _objectSpread({}, Default$3, config);
+ Util.typeCheckConfig(NAME$5, config, DefaultType$3);
+ return config;
+ };
+
+ _proto._showElement = function _showElement(relatedTarget) {
+ var _this3 = this;
+
+ var transition = $(this._element).hasClass(ClassName$5.FADE);
+
+ if (!this._element.parentNode || this._element.parentNode.nodeType !== Node.ELEMENT_NODE) {
+ // Don't move modal's DOM position
+ document.body.appendChild(this._element);
+ }
+
+ this._element.style.display = 'block';
+
+ this._element.removeAttribute('aria-hidden');
+
+ this._element.setAttribute('aria-modal', true);
+
+ this._element.scrollTop = 0;
+
+ if (transition) {
+ Util.reflow(this._element);
+ }
+
+ $(this._element).addClass(ClassName$5.SHOW);
+
+ if (this._config.focus) {
+ this._enforceFocus();
+ }
+
+ var shownEvent = $.Event(Event$5.SHOWN, {
+ relatedTarget: relatedTarget
+ });
+
+ var transitionComplete = function transitionComplete() {
+ if (_this3._config.focus) {
+ _this3._element.focus();
+ }
+
+ _this3._isTransitioning = false;
+ $(_this3._element).trigger(shownEvent);
+ };
+
+ if (transition) {
+ var transitionDuration = Util.getTransitionDurationFromElement(this._dialog);
+ $(this._dialog).one(Util.TRANSITION_END, transitionComplete).emulateTransitionEnd(transitionDuration);
+ } else {
+ transitionComplete();
+ }
+ };
+
+ _proto._enforceFocus = function _enforceFocus() {
+ var _this4 = this;
+
+ $(document).off(Event$5.FOCUSIN) // Guard against infinite focus loop
+ .on(Event$5.FOCUSIN, function (event) {
+ if (document !== event.target && _this4._element !== event.target && $(_this4._element).has(event.target).length === 0) {
+ _this4._element.focus();
+ }
+ });
+ };
+
+ _proto._setEscapeEvent = function _setEscapeEvent() {
+ var _this5 = this;
+
+ if (this._isShown && this._config.keyboard) {
+ $(this._element).on(Event$5.KEYDOWN_DISMISS, function (event) {
+ if (event.which === ESCAPE_KEYCODE$1) {
+ event.preventDefault();
+
+ _this5.hide();
+ }
+ });
+ } else if (!this._isShown) {
+ $(this._element).off(Event$5.KEYDOWN_DISMISS);
+ }
+ };
+
+ _proto._setResizeEvent = function _setResizeEvent() {
+ var _this6 = this;
+
+ if (this._isShown) {
+ $(window).on(Event$5.RESIZE, function (event) {
+ return _this6.handleUpdate(event);
+ });
+ } else {
+ $(window).off(Event$5.RESIZE);
+ }
+ };
+
+ _proto._hideModal = function _hideModal() {
+ var _this7 = this;
+
+ this._element.style.display = 'none';
+
+ this._element.setAttribute('aria-hidden', true);
+
+ this._element.removeAttribute('aria-modal');
+
+ this._isTransitioning = false;
+
+ this._showBackdrop(function () {
+ $(document.body).removeClass(ClassName$5.OPEN);
+
+ _this7._resetAdjustments();
+
+ _this7._resetScrollbar();
+
+ $(_this7._element).trigger(Event$5.HIDDEN);
+ });
+ };
+
+ _proto._removeBackdrop = function _removeBackdrop() {
+ if (this._backdrop) {
+ $(this._backdrop).remove();
+ this._backdrop = null;
+ }
+ };
+
+ _proto._showBackdrop = function _showBackdrop(callback) {
+ var _this8 = this;
+
+ var animate = $(this._element).hasClass(ClassName$5.FADE) ? ClassName$5.FADE : '';
+
+ if (this._isShown && this._config.backdrop) {
+ this._backdrop = document.createElement('div');
+ this._backdrop.className = ClassName$5.BACKDROP;
+
+ if (animate) {
+ this._backdrop.classList.add(animate);
+ }
+
+ $(this._backdrop).appendTo(document.body);
+ $(this._element).on(Event$5.CLICK_DISMISS, function (event) {
+ if (_this8._ignoreBackdropClick) {
+ _this8._ignoreBackdropClick = false;
+ return;
+ }
+
+ if (event.target !== event.currentTarget) {
+ return;
+ }
+
+ if (_this8._config.backdrop === 'static') {
+ _this8._element.focus();
+ } else {
+ _this8.hide();
+ }
+ });
+
+ if (animate) {
+ Util.reflow(this._backdrop);
+ }
+
+ $(this._backdrop).addClass(ClassName$5.SHOW);
+
+ if (!callback) {
+ return;
+ }
+
+ if (!animate) {
+ callback();
+ return;
+ }
+
+ var backdropTransitionDuration = Util.getTransitionDurationFromElement(this._backdrop);
+ $(this._backdrop).one(Util.TRANSITION_END, callback).emulateTransitionEnd(backdropTransitionDuration);
+ } else if (!this._isShown && this._backdrop) {
+ $(this._backdrop).removeClass(ClassName$5.SHOW);
+
+ var callbackRemove = function callbackRemove() {
+ _this8._removeBackdrop();
+
+ if (callback) {
+ callback();
+ }
+ };
+
+ if ($(this._element).hasClass(ClassName$5.FADE)) {
+ var _backdropTransitionDuration = Util.getTransitionDurationFromElement(this._backdrop);
+
+ $(this._backdrop).one(Util.TRANSITION_END, callbackRemove).emulateTransitionEnd(_backdropTransitionDuration);
+ } else {
+ callbackRemove();
+ }
+ } else if (callback) {
+ callback();
+ }
+ }; // ----------------------------------------------------------------------
+ // the following methods are used to handle overflowing modals
+ // todo (fat): these should probably be refactored out of modal.js
+ // ----------------------------------------------------------------------
+
+
+ _proto._adjustDialog = function _adjustDialog() {
+ var isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;
+
+ if (!this._isBodyOverflowing && isModalOverflowing) {
+ this._element.style.paddingLeft = this._scrollbarWidth + "px";
+ }
+
+ if (this._isBodyOverflowing && !isModalOverflowing) {
+ this._element.style.paddingRight = this._scrollbarWidth + "px";
+ }
+ };
+
+ _proto._resetAdjustments = function _resetAdjustments() {
+ this._element.style.paddingLeft = '';
+ this._element.style.paddingRight = '';
+ };
+
+ _proto._checkScrollbar = function _checkScrollbar() {
+ var rect = document.body.getBoundingClientRect();
+ this._isBodyOverflowing = rect.left + rect.right < window.innerWidth;
+ this._scrollbarWidth = this._getScrollbarWidth();
+ };
+
+ _proto._setScrollbar = function _setScrollbar() {
+ var _this9 = this;
+
+ if (this._isBodyOverflowing) {
+ // Note: DOMNode.style.paddingRight returns the actual value or '' if not set
+ // while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set
+ var fixedContent = [].slice.call(document.querySelectorAll(Selector$5.FIXED_CONTENT));
+ var stickyContent = [].slice.call(document.querySelectorAll(Selector$5.STICKY_CONTENT)); // Adjust fixed content padding
+
+ $(fixedContent).each(function (index, element) {
+ var actualPadding = element.style.paddingRight;
+ var calculatedPadding = $(element).css('padding-right');
+ $(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px");
+ }); // Adjust sticky content margin
+
+ $(stickyContent).each(function (index, element) {
+ var actualMargin = element.style.marginRight;
+ var calculatedMargin = $(element).css('margin-right');
+ $(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px");
+ }); // Adjust body padding
+
+ var actualPadding = document.body.style.paddingRight;
+ var calculatedPadding = $(document.body).css('padding-right');
+ $(document.body).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + this._scrollbarWidth + "px");
+ }
+
+ $(document.body).addClass(ClassName$5.OPEN);
+ };
+
+ _proto._resetScrollbar = function _resetScrollbar() {
+ // Restore fixed content padding
+ var fixedContent = [].slice.call(document.querySelectorAll(Selector$5.FIXED_CONTENT));
+ $(fixedContent).each(function (index, element) {
+ var padding = $(element).data('padding-right');
+ $(element).removeData('padding-right');
+ element.style.paddingRight = padding ? padding : '';
+ }); // Restore sticky content
+
+ var elements = [].slice.call(document.querySelectorAll("" + Selector$5.STICKY_CONTENT));
+ $(elements).each(function (index, element) {
+ var margin = $(element).data('margin-right');
+
+ if (typeof margin !== 'undefined') {
+ $(element).css('margin-right', margin).removeData('margin-right');
+ }
+ }); // Restore body padding
+
+ var padding = $(document.body).data('padding-right');
+ $(document.body).removeData('padding-right');
+ document.body.style.paddingRight = padding ? padding : '';
+ };
+
+ _proto._getScrollbarWidth = function _getScrollbarWidth() {
+ // thx d.walsh
+ var scrollDiv = document.createElement('div');
+ scrollDiv.className = ClassName$5.SCROLLBAR_MEASURER;
+ document.body.appendChild(scrollDiv);
+ var scrollbarWidth = scrollDiv.getBoundingClientRect().width - scrollDiv.clientWidth;
+ document.body.removeChild(scrollDiv);
+ return scrollbarWidth;
+ }; // Static
+
+
+ Modal._jQueryInterface = function _jQueryInterface(config, relatedTarget) {
+ return this.each(function () {
+ var data = $(this).data(DATA_KEY$5);
+
+ var _config = _objectSpread({}, Default$3, $(this).data(), typeof config === 'object' && config ? config : {});
+
+ if (!data) {
+ data = new Modal(this, _config);
+ $(this).data(DATA_KEY$5, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config](relatedTarget);
+ } else if (_config.show) {
+ data.show(relatedTarget);
+ }
+ });
+ };
+
+ _createClass(Modal, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION$5;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default$3;
+ }
+ }]);
+
+ return Modal;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $(document).on(Event$5.CLICK_DATA_API, Selector$5.DATA_TOGGLE, function (event) {
+ var _this10 = this;
+
+ var target;
+ var selector = Util.getSelectorFromElement(this);
+
+ if (selector) {
+ target = document.querySelector(selector);
+ }
+
+ var config = $(target).data(DATA_KEY$5) ? 'toggle' : _objectSpread({}, $(target).data(), $(this).data());
+
+ if (this.tagName === 'A' || this.tagName === 'AREA') {
+ event.preventDefault();
+ }
+
+ var $target = $(target).one(Event$5.SHOW, function (showEvent) {
+ if (showEvent.isDefaultPrevented()) {
+ // Only register focus restorer if modal will actually get shown
+ return;
+ }
+
+ $target.one(Event$5.HIDDEN, function () {
+ if ($(_this10).is(':visible')) {
+ _this10.focus();
+ }
+ });
+ });
+
+ Modal._jQueryInterface.call($(target), config, this);
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $.fn[NAME$5] = Modal._jQueryInterface;
+ $.fn[NAME$5].Constructor = Modal;
+
+ $.fn[NAME$5].noConflict = function () {
+ $.fn[NAME$5] = JQUERY_NO_CONFLICT$5;
+ return Modal._jQueryInterface;
+ };
+
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+
+ var NAME$6 = 'tooltip';
+ var VERSION$6 = '4.2.1';
+ var DATA_KEY$6 = 'bs.tooltip';
+ var EVENT_KEY$6 = "." + DATA_KEY$6;
+ var JQUERY_NO_CONFLICT$6 = $.fn[NAME$6];
+ var CLASS_PREFIX = 'bs-tooltip';
+ var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g');
+ var DefaultType$4 = {
+ animation: 'boolean',
+ template: 'string',
+ title: '(string|element|function)',
+ trigger: 'string',
+ delay: '(number|object)',
+ html: 'boolean',
+ selector: '(string|boolean)',
+ placement: '(string|function)',
+ offset: '(number|string)',
+ container: '(string|element|boolean)',
+ fallbackPlacement: '(string|array)',
+ boundary: '(string|element)'
+ };
+ var AttachmentMap$1 = {
+ AUTO: 'auto',
+ TOP: 'top',
+ RIGHT: 'right',
+ BOTTOM: 'bottom',
+ LEFT: 'left'
+ };
+ var Default$4 = {
+ animation: true,
+ template: '<div class="tooltip" role="tooltip">' + '<div class="arrow"></div>' + '<div class="tooltip-inner"></div></div>',
+ trigger: 'hover focus',
+ title: '',
+ delay: 0,
+ html: false,
+ selector: false,
+ placement: 'top',
+ offset: 0,
+ container: false,
+ fallbackPlacement: 'flip',
+ boundary: 'scrollParent'
+ };
+ var HoverState = {
+ SHOW: 'show',
+ OUT: 'out'
+ };
+ var Event$6 = {
+ HIDE: "hide" + EVENT_KEY$6,
+ HIDDEN: "hidden" + EVENT_KEY$6,
+ SHOW: "show" + EVENT_KEY$6,
+ SHOWN: "shown" + EVENT_KEY$6,
+ INSERTED: "inserted" + EVENT_KEY$6,
+ CLICK: "click" + EVENT_KEY$6,
+ FOCUSIN: "focusin" + EVENT_KEY$6,
+ FOCUSOUT: "focusout" + EVENT_KEY$6,
+ MOUSEENTER: "mouseenter" + EVENT_KEY$6,
+ MOUSELEAVE: "mouseleave" + EVENT_KEY$6
+ };
+ var ClassName$6 = {
+ FADE: 'fade',
+ SHOW: 'show'
+ };
+ var Selector$6 = {
+ TOOLTIP: '.tooltip',
+ TOOLTIP_INNER: '.tooltip-inner',
+ ARROW: '.arrow'
+ };
+ var Trigger = {
+ HOVER: 'hover',
+ FOCUS: 'focus',
+ CLICK: 'click',
+ MANUAL: 'manual'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Tooltip =
+ /*#__PURE__*/
+ function () {
+ function Tooltip(element, config) {
+ /**
+ * Check for Popper dependency
+ * Popper - https://popper.js.org
+ */
+ if (typeof Popper === 'undefined') {
+ throw new TypeError('Bootstrap\'s tooltips require Popper.js (https://popper.js.org/)');
+ } // private
+
+
+ this._isEnabled = true;
+ this._timeout = 0;
+ this._hoverState = '';
+ this._activeTrigger = {};
+ this._popper = null; // Protected
+
+ this.element = element;
+ this.config = this._getConfig(config);
+ this.tip = null;
+
+ this._setListeners();
+ } // Getters
+
+
+ var _proto = Tooltip.prototype;
+
+ // Public
+ _proto.enable = function enable() {
+ this._isEnabled = true;
+ };
+
+ _proto.disable = function disable() {
+ this._isEnabled = false;
+ };
+
+ _proto.toggleEnabled = function toggleEnabled() {
+ this._isEnabled = !this._isEnabled;
+ };
+
+ _proto.toggle = function toggle(event) {
+ if (!this._isEnabled) {
+ return;
+ }
+
+ if (event) {
+ var dataKey = this.constructor.DATA_KEY;
+ var context = $(event.currentTarget).data(dataKey);
+
+ if (!context) {
+ context = new this.constructor(event.currentTarget, this._getDelegateConfig());
+ $(event.currentTarget).data(dataKey, context);
+ }
+
+ context._activeTrigger.click = !context._activeTrigger.click;
+
+ if (context._isWithActiveTrigger()) {
+ context._enter(null, context);
+ } else {
+ context._leave(null, context);
+ }
+ } else {
+ if ($(this.getTipElement()).hasClass(ClassName$6.SHOW)) {
+ this._leave(null, this);
+
+ return;
+ }
+
+ this._enter(null, this);
+ }
+ };
+
+ _proto.dispose = function dispose() {
+ clearTimeout(this._timeout);
+ $.removeData(this.element, this.constructor.DATA_KEY);
+ $(this.element).off(this.constructor.EVENT_KEY);
+ $(this.element).closest('.modal').off('hide.bs.modal');
+
+ if (this.tip) {
+ $(this.tip).remove();
+ }
+
+ this._isEnabled = null;
+ this._timeout = null;
+ this._hoverState = null;
+ this._activeTrigger = null;
+
+ if (this._popper !== null) {
+ this._popper.destroy();
+ }
+
+ this._popper = null;
+ this.element = null;
+ this.config = null;
+ this.tip = null;
+ };
+
+ _proto.show = function show() {
+ var _this = this;
+
+ if ($(this.element).css('display') === 'none') {
+ throw new Error('Please use show on visible elements');
+ }
+
+ var showEvent = $.Event(this.constructor.Event.SHOW);
+
+ if (this.isWithContent() && this._isEnabled) {
+ $(this.element).trigger(showEvent);
+ var shadowRoot = Util.findShadowRoot(this.element);
+ var isInTheDom = $.contains(shadowRoot !== null ? shadowRoot : this.element.ownerDocument.documentElement, this.element);
+
+ if (showEvent.isDefaultPrevented() || !isInTheDom) {
+ return;
+ }
+
+ var tip = this.getTipElement();
+ var tipId = Util.getUID(this.constructor.NAME);
+ tip.setAttribute('id', tipId);
+ this.element.setAttribute('aria-describedby', tipId);
+ this.setContent();
+
+ if (this.config.animation) {
+ $(tip).addClass(ClassName$6.FADE);
+ }
+
+ var placement = typeof this.config.placement === 'function' ? this.config.placement.call(this, tip, this.element) : this.config.placement;
+
+ var attachment = this._getAttachment(placement);
+
+ this.addAttachmentClass(attachment);
+
+ var container = this._getContainer();
+
+ $(tip).data(this.constructor.DATA_KEY, this);
+
+ if (!$.contains(this.element.ownerDocument.documentElement, this.tip)) {
+ $(tip).appendTo(container);
+ }
+
+ $(this.element).trigger(this.constructor.Event.INSERTED);
+ this._popper = new Popper(this.element, tip, {
+ placement: attachment,
+ modifiers: {
+ offset: {
+ offset: this.config.offset
+ },
+ flip: {
+ behavior: this.config.fallbackPlacement
+ },
+ arrow: {
+ element: Selector$6.ARROW
+ },
+ preventOverflow: {
+ boundariesElement: this.config.boundary
+ }
+ },
+ onCreate: function onCreate(data) {
+ if (data.originalPlacement !== data.placement) {
+ _this._handlePopperPlacementChange(data);
+ }
+ },
+ onUpdate: function onUpdate(data) {
+ return _this._handlePopperPlacementChange(data);
+ }
+ });
+ $(tip).addClass(ClassName$6.SHOW); // If this is a touch-enabled device we add extra
+ // empty mouseover listeners to the body's immediate children;
+ // only needed because of broken event delegation on iOS
+ // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
+
+ if ('ontouchstart' in document.documentElement) {
+ $(document.body).children().on('mouseover', null, $.noop);
+ }
+
+ var complete = function complete() {
+ if (_this.config.animation) {
+ _this._fixTransition();
+ }
+
+ var prevHoverState = _this._hoverState;
+ _this._hoverState = null;
+ $(_this.element).trigger(_this.constructor.Event.SHOWN);
+
+ if (prevHoverState === HoverState.OUT) {
+ _this._leave(null, _this);
+ }
+ };
+
+ if ($(this.tip).hasClass(ClassName$6.FADE)) {
+ var transitionDuration = Util.getTransitionDurationFromElement(this.tip);
+ $(this.tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
+ } else {
+ complete();
+ }
+ }
+ };
+
+ _proto.hide = function hide(callback) {
+ var _this2 = this;
+
+ var tip = this.getTipElement();
+ var hideEvent = $.Event(this.constructor.Event.HIDE);
+
+ var complete = function complete() {
+ if (_this2._hoverState !== HoverState.SHOW && tip.parentNode) {
+ tip.parentNode.removeChild(tip);
+ }
+
+ _this2._cleanTipClass();
+
+ _this2.element.removeAttribute('aria-describedby');
+
+ $(_this2.element).trigger(_this2.constructor.Event.HIDDEN);
+
+ if (_this2._popper !== null) {
+ _this2._popper.destroy();
+ }
+
+ if (callback) {
+ callback();
+ }
+ };
+
+ $(this.element).trigger(hideEvent);
+
+ if (hideEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ $(tip).removeClass(ClassName$6.SHOW); // If this is a touch-enabled device we remove the extra
+ // empty mouseover listeners we added for iOS support
+
+ if ('ontouchstart' in document.documentElement) {
+ $(document.body).children().off('mouseover', null, $.noop);
+ }
+
+ this._activeTrigger[Trigger.CLICK] = false;
+ this._activeTrigger[Trigger.FOCUS] = false;
+ this._activeTrigger[Trigger.HOVER] = false;
+
+ if ($(this.tip).hasClass(ClassName$6.FADE)) {
+ var transitionDuration = Util.getTransitionDurationFromElement(tip);
+ $(tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
+ } else {
+ complete();
+ }
+
+ this._hoverState = '';
+ };
+
+ _proto.update = function update() {
+ if (this._popper !== null) {
+ this._popper.scheduleUpdate();
+ }
+ }; // Protected
+
+
+ _proto.isWithContent = function isWithContent() {
+ return Boolean(this.getTitle());
+ };
+
+ _proto.addAttachmentClass = function addAttachmentClass(attachment) {
+ $(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment);
+ };
+
+ _proto.getTipElement = function getTipElement() {
+ this.tip = this.tip || $(this.config.template)[0];
+ return this.tip;
+ };
+
+ _proto.setContent = function setContent() {
+ var tip = this.getTipElement();
+ this.setElementContent($(tip.querySelectorAll(Selector$6.TOOLTIP_INNER)), this.getTitle());
+ $(tip).removeClass(ClassName$6.FADE + " " + ClassName$6.SHOW);
+ };
+
+ _proto.setElementContent = function setElementContent($element, content) {
+ var html = this.config.html;
+
+ if (typeof content === 'object' && (content.nodeType || content.jquery)) {
+ // Content is a DOM node or a jQuery
+ if (html) {
+ if (!$(content).parent().is($element)) {
+ $element.empty().append(content);
+ }
+ } else {
+ $element.text($(content).text());
+ }
+ } else {
+ $element[html ? 'html' : 'text'](content);
+ }
+ };
+
+ _proto.getTitle = function getTitle() {
+ var title = this.element.getAttribute('data-original-title');
+
+ if (!title) {
+ title = typeof this.config.title === 'function' ? this.config.title.call(this.element) : this.config.title;
+ }
+
+ return title;
+ }; // Private
+
+
+ _proto._getContainer = function _getContainer() {
+ if (this.config.container === false) {
+ return document.body;
+ }
+
+ if (Util.isElement(this.config.container)) {
+ return $(this.config.container);
+ }
+
+ return $(document).find(this.config.container);
+ };
+
+ _proto._getAttachment = function _getAttachment(placement) {
+ return AttachmentMap$1[placement.toUpperCase()];
+ };
+
+ _proto._setListeners = function _setListeners() {
+ var _this3 = this;
+
+ var triggers = this.config.trigger.split(' ');
+ triggers.forEach(function (trigger) {
+ if (trigger === 'click') {
+ $(_this3.element).on(_this3.constructor.Event.CLICK, _this3.config.selector, function (event) {
+ return _this3.toggle(event);
+ });
+ } else if (trigger !== Trigger.MANUAL) {
+ var eventIn = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSEENTER : _this3.constructor.Event.FOCUSIN;
+ var eventOut = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSELEAVE : _this3.constructor.Event.FOCUSOUT;
+ $(_this3.element).on(eventIn, _this3.config.selector, function (event) {
+ return _this3._enter(event);
+ }).on(eventOut, _this3.config.selector, function (event) {
+ return _this3._leave(event);
+ });
+ }
+ });
+ $(this.element).closest('.modal').on('hide.bs.modal', function () {
+ if (_this3.element) {
+ _this3.hide();
+ }
+ });
+
+ if (this.config.selector) {
+ this.config = _objectSpread({}, this.config, {
+ trigger: 'manual',
+ selector: ''
+ });
+ } else {
+ this._fixTitle();
+ }
+ };
+
+ _proto._fixTitle = function _fixTitle() {
+ var titleType = typeof this.element.getAttribute('data-original-title');
+
+ if (this.element.getAttribute('title') || titleType !== 'string') {
+ this.element.setAttribute('data-original-title', this.element.getAttribute('title') || '');
+ this.element.setAttribute('title', '');
+ }
+ };
+
+ _proto._enter = function _enter(event, context) {
+ var dataKey = this.constructor.DATA_KEY;
+ context = context || $(event.currentTarget).data(dataKey);
+
+ if (!context) {
+ context = new this.constructor(event.currentTarget, this._getDelegateConfig());
+ $(event.currentTarget).data(dataKey, context);
+ }
+
+ if (event) {
+ context._activeTrigger[event.type === 'focusin' ? Trigger.FOCUS : Trigger.HOVER] = true;
+ }
+
+ if ($(context.getTipElement()).hasClass(ClassName$6.SHOW) || context._hoverState === HoverState.SHOW) {
+ context._hoverState = HoverState.SHOW;
+ return;
+ }
+
+ clearTimeout(context._timeout);
+ context._hoverState = HoverState.SHOW;
+
+ if (!context.config.delay || !context.config.delay.show) {
+ context.show();
+ return;
+ }
+
+ context._timeout = setTimeout(function () {
+ if (context._hoverState === HoverState.SHOW) {
+ context.show();
+ }
+ }, context.config.delay.show);
+ };
+
+ _proto._leave = function _leave(event, context) {
+ var dataKey = this.constructor.DATA_KEY;
+ context = context || $(event.currentTarget).data(dataKey);
+
+ if (!context) {
+ context = new this.constructor(event.currentTarget, this._getDelegateConfig());
+ $(event.currentTarget).data(dataKey, context);
+ }
+
+ if (event) {
+ context._activeTrigger[event.type === 'focusout' ? Trigger.FOCUS : Trigger.HOVER] = false;
+ }
+
+ if (context._isWithActiveTrigger()) {
+ return;
+ }
+
+ clearTimeout(context._timeout);
+ context._hoverState = HoverState.OUT;
+
+ if (!context.config.delay || !context.config.delay.hide) {
+ context.hide();
+ return;
+ }
+
+ context._timeout = setTimeout(function () {
+ if (context._hoverState === HoverState.OUT) {
+ context.hide();
+ }
+ }, context.config.delay.hide);
+ };
+
+ _proto._isWithActiveTrigger = function _isWithActiveTrigger() {
+ for (var trigger in this._activeTrigger) {
+ if (this._activeTrigger[trigger]) {
+ return true;
+ }
+ }
+
+ return false;
+ };
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _objectSpread({}, this.constructor.Default, $(this.element).data(), typeof config === 'object' && config ? config : {});
+
+ if (typeof config.delay === 'number') {
+ config.delay = {
+ show: config.delay,
+ hide: config.delay
+ };
+ }
+
+ if (typeof config.title === 'number') {
+ config.title = config.title.toString();
+ }
+
+ if (typeof config.content === 'number') {
+ config.content = config.content.toString();
+ }
+
+ Util.typeCheckConfig(NAME$6, config, this.constructor.DefaultType);
+ return config;
+ };
+
+ _proto._getDelegateConfig = function _getDelegateConfig() {
+ var config = {};
+
+ if (this.config) {
+ for (var key in this.config) {
+ if (this.constructor.Default[key] !== this.config[key]) {
+ config[key] = this.config[key];
+ }
+ }
+ }
+
+ return config;
+ };
+
+ _proto._cleanTipClass = function _cleanTipClass() {
+ var $tip = $(this.getTipElement());
+ var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX);
+
+ if (tabClass !== null && tabClass.length) {
+ $tip.removeClass(tabClass.join(''));
+ }
+ };
+
+ _proto._handlePopperPlacementChange = function _handlePopperPlacementChange(popperData) {
+ var popperInstance = popperData.instance;
+ this.tip = popperInstance.popper;
+
+ this._cleanTipClass();
+
+ this.addAttachmentClass(this._getAttachment(popperData.placement));
+ };
+
+ _proto._fixTransition = function _fixTransition() {
+ var tip = this.getTipElement();
+ var initConfigAnimation = this.config.animation;
+
+ if (tip.getAttribute('x-placement') !== null) {
+ return;
+ }
+
+ $(tip).removeClass(ClassName$6.FADE);
+ this.config.animation = false;
+ this.hide();
+ this.show();
+ this.config.animation = initConfigAnimation;
+ }; // Static
+
+
+ Tooltip._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $(this).data(DATA_KEY$6);
+
+ var _config = typeof config === 'object' && config;
+
+ if (!data && /dispose|hide/.test(config)) {
+ return;
+ }
+
+ if (!data) {
+ data = new Tooltip(this, _config);
+ $(this).data(DATA_KEY$6, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Tooltip, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION$6;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default$4;
+ }
+ }, {
+ key: "NAME",
+ get: function get() {
+ return NAME$6;
+ }
+ }, {
+ key: "DATA_KEY",
+ get: function get() {
+ return DATA_KEY$6;
+ }
+ }, {
+ key: "Event",
+ get: function get() {
+ return Event$6;
+ }
+ }, {
+ key: "EVENT_KEY",
+ get: function get() {
+ return EVENT_KEY$6;
+ }
+ }, {
+ key: "DefaultType",
+ get: function get() {
+ return DefaultType$4;
+ }
+ }]);
+
+ return Tooltip;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+
+ $.fn[NAME$6] = Tooltip._jQueryInterface;
+ $.fn[NAME$6].Constructor = Tooltip;
+
+ $.fn[NAME$6].noConflict = function () {
+ $.fn[NAME$6] = JQUERY_NO_CONFLICT$6;
+ return Tooltip._jQueryInterface;
+ };
+
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+
+ var NAME$7 = 'popover';
+ var VERSION$7 = '4.2.1';
+ var DATA_KEY$7 = 'bs.popover';
+ var EVENT_KEY$7 = "." + DATA_KEY$7;
+ var JQUERY_NO_CONFLICT$7 = $.fn[NAME$7];
+ var CLASS_PREFIX$1 = 'bs-popover';
+ var BSCLS_PREFIX_REGEX$1 = new RegExp("(^|\\s)" + CLASS_PREFIX$1 + "\\S+", 'g');
+
+ var Default$5 = _objectSpread({}, Tooltip.Default, {
+ placement: 'right',
+ trigger: 'click',
+ content: '',
+ template: '<div class="popover" role="tooltip">' + '<div class="arrow"></div>' + '<h3 class="popover-header"></h3>' + '<div class="popover-body"></div></div>'
+ });
+
+ var DefaultType$5 = _objectSpread({}, Tooltip.DefaultType, {
+ content: '(string|element|function)'
+ });
+
+ var ClassName$7 = {
+ FADE: 'fade',
+ SHOW: 'show'
+ };
+ var Selector$7 = {
+ TITLE: '.popover-header',
+ CONTENT: '.popover-body'
+ };
+ var Event$7 = {
+ HIDE: "hide" + EVENT_KEY$7,
+ HIDDEN: "hidden" + EVENT_KEY$7,
+ SHOW: "show" + EVENT_KEY$7,
+ SHOWN: "shown" + EVENT_KEY$7,
+ INSERTED: "inserted" + EVENT_KEY$7,
+ CLICK: "click" + EVENT_KEY$7,
+ FOCUSIN: "focusin" + EVENT_KEY$7,
+ FOCUSOUT: "focusout" + EVENT_KEY$7,
+ MOUSEENTER: "mouseenter" + EVENT_KEY$7,
+ MOUSELEAVE: "mouseleave" + EVENT_KEY$7
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Popover =
+ /*#__PURE__*/
+ function (_Tooltip) {
+ _inheritsLoose(Popover, _Tooltip);
+
+ function Popover() {
+ return _Tooltip.apply(this, arguments) || this;
+ }
+
+ var _proto = Popover.prototype;
+
+ // Overrides
+ _proto.isWithContent = function isWithContent() {
+ return this.getTitle() || this._getContent();
+ };
+
+ _proto.addAttachmentClass = function addAttachmentClass(attachment) {
+ $(this.getTipElement()).addClass(CLASS_PREFIX$1 + "-" + attachment);
+ };
+
+ _proto.getTipElement = function getTipElement() {
+ this.tip = this.tip || $(this.config.template)[0];
+ return this.tip;
+ };
+
+ _proto.setContent = function setContent() {
+ var $tip = $(this.getTipElement()); // We use append for html objects to maintain js events
+
+ this.setElementContent($tip.find(Selector$7.TITLE), this.getTitle());
+
+ var content = this._getContent();
+
+ if (typeof content === 'function') {
+ content = content.call(this.element);
+ }
+
+ this.setElementContent($tip.find(Selector$7.CONTENT), content);
+ $tip.removeClass(ClassName$7.FADE + " " + ClassName$7.SHOW);
+ }; // Private
+
+
+ _proto._getContent = function _getContent() {
+ return this.element.getAttribute('data-content') || this.config.content;
+ };
+
+ _proto._cleanTipClass = function _cleanTipClass() {
+ var $tip = $(this.getTipElement());
+ var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX$1);
+
+ if (tabClass !== null && tabClass.length > 0) {
+ $tip.removeClass(tabClass.join(''));
+ }
+ }; // Static
+
+
+ Popover._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $(this).data(DATA_KEY$7);
+
+ var _config = typeof config === 'object' ? config : null;
+
+ if (!data && /dispose|hide/.test(config)) {
+ return;
+ }
+
+ if (!data) {
+ data = new Popover(this, _config);
+ $(this).data(DATA_KEY$7, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Popover, null, [{
+ key: "VERSION",
+ // Getters
+ get: function get() {
+ return VERSION$7;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default$5;
+ }
+ }, {
+ key: "NAME",
+ get: function get() {
+ return NAME$7;
+ }
+ }, {
+ key: "DATA_KEY",
+ get: function get() {
+ return DATA_KEY$7;
+ }
+ }, {
+ key: "Event",
+ get: function get() {
+ return Event$7;
+ }
+ }, {
+ key: "EVENT_KEY",
+ get: function get() {
+ return EVENT_KEY$7;
+ }
+ }, {
+ key: "DefaultType",
+ get: function get() {
+ return DefaultType$5;
+ }
+ }]);
+
+ return Popover;
+ }(Tooltip);
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+
+ $.fn[NAME$7] = Popover._jQueryInterface;
+ $.fn[NAME$7].Constructor = Popover;
+
+ $.fn[NAME$7].noConflict = function () {
+ $.fn[NAME$7] = JQUERY_NO_CONFLICT$7;
+ return Popover._jQueryInterface;
+ };
+
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+
+ var NAME$8 = 'scrollspy';
+ var VERSION$8 = '4.2.1';
+ var DATA_KEY$8 = 'bs.scrollspy';
+ var EVENT_KEY$8 = "." + DATA_KEY$8;
+ var DATA_API_KEY$6 = '.data-api';
+ var JQUERY_NO_CONFLICT$8 = $.fn[NAME$8];
+ var Default$6 = {
+ offset: 10,
+ method: 'auto',
+ target: ''
+ };
+ var DefaultType$6 = {
+ offset: 'number',
+ method: 'string',
+ target: '(string|element)'
+ };
+ var Event$8 = {
+ ACTIVATE: "activate" + EVENT_KEY$8,
+ SCROLL: "scroll" + EVENT_KEY$8,
+ LOAD_DATA_API: "load" + EVENT_KEY$8 + DATA_API_KEY$6
+ };
+ var ClassName$8 = {
+ DROPDOWN_ITEM: 'dropdown-item',
+ DROPDOWN_MENU: 'dropdown-menu',
+ ACTIVE: 'active'
+ };
+ var Selector$8 = {
+ DATA_SPY: '[data-spy="scroll"]',
+ ACTIVE: '.active',
+ NAV_LIST_GROUP: '.nav, .list-group',
+ NAV_LINKS: '.nav-link',
+ NAV_ITEMS: '.nav-item',
+ LIST_ITEMS: '.list-group-item',
+ DROPDOWN: '.dropdown',
+ DROPDOWN_ITEMS: '.dropdown-item',
+ DROPDOWN_TOGGLE: '.dropdown-toggle'
+ };
+ var OffsetMethod = {
+ OFFSET: 'offset',
+ POSITION: 'position'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var ScrollSpy =
+ /*#__PURE__*/
+ function () {
+ function ScrollSpy(element, config) {
+ var _this = this;
+
+ this._element = element;
+ this._scrollElement = element.tagName === 'BODY' ? window : element;
+ this._config = this._getConfig(config);
+ this._selector = this._config.target + " " + Selector$8.NAV_LINKS + "," + (this._config.target + " " + Selector$8.LIST_ITEMS + ",") + (this._config.target + " " + Selector$8.DROPDOWN_ITEMS);
+ this._offsets = [];
+ this._targets = [];
+ this._activeTarget = null;
+ this._scrollHeight = 0;
+ $(this._scrollElement).on(Event$8.SCROLL, function (event) {
+ return _this._process(event);
+ });
+ this.refresh();
+
+ this._process();
+ } // Getters
+
+
+ var _proto = ScrollSpy.prototype;
+
+ // Public
+ _proto.refresh = function refresh() {
+ var _this2 = this;
+
+ var autoMethod = this._scrollElement === this._scrollElement.window ? OffsetMethod.OFFSET : OffsetMethod.POSITION;
+ var offsetMethod = this._config.method === 'auto' ? autoMethod : this._config.method;
+ var offsetBase = offsetMethod === OffsetMethod.POSITION ? this._getScrollTop() : 0;
+ this._offsets = [];
+ this._targets = [];
+ this._scrollHeight = this._getScrollHeight();
+ var targets = [].slice.call(document.querySelectorAll(this._selector));
+ targets.map(function (element) {
+ var target;
+ var targetSelector = Util.getSelectorFromElement(element);
+
+ if (targetSelector) {
+ target = document.querySelector(targetSelector);
+ }
+
+ if (target) {
+ var targetBCR = target.getBoundingClientRect();
+
+ if (targetBCR.width || targetBCR.height) {
+ // TODO (fat): remove sketch reliance on jQuery position/offset
+ return [$(target)[offsetMethod]().top + offsetBase, targetSelector];
+ }
+ }
+
+ return null;
+ }).filter(function (item) {
+ return item;
+ }).sort(function (a, b) {
+ return a[0] - b[0];
+ }).forEach(function (item) {
+ _this2._offsets.push(item[0]);
+
+ _this2._targets.push(item[1]);
+ });
+ };
+
+ _proto.dispose = function dispose() {
+ $.removeData(this._element, DATA_KEY$8);
+ $(this._scrollElement).off(EVENT_KEY$8);
+ this._element = null;
+ this._scrollElement = null;
+ this._config = null;
+ this._selector = null;
+ this._offsets = null;
+ this._targets = null;
+ this._activeTarget = null;
+ this._scrollHeight = null;
+ }; // Private
+
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _objectSpread({}, Default$6, typeof config === 'object' && config ? config : {});
+
+ if (typeof config.target !== 'string') {
+ var id = $(config.target).attr('id');
+
+ if (!id) {
+ id = Util.getUID(NAME$8);
+ $(config.target).attr('id', id);
+ }
+
+ config.target = "#" + id;
+ }
+
+ Util.typeCheckConfig(NAME$8, config, DefaultType$6);
+ return config;
+ };
+
+ _proto._getScrollTop = function _getScrollTop() {
+ return this._scrollElement === window ? this._scrollElement.pageYOffset : this._scrollElement.scrollTop;
+ };
+
+ _proto._getScrollHeight = function _getScrollHeight() {
+ return this._scrollElement.scrollHeight || Math.max(document.body.scrollHeight, document.documentElement.scrollHeight);
+ };
+
+ _proto._getOffsetHeight = function _getOffsetHeight() {
+ return this._scrollElement === window ? window.innerHeight : this._scrollElement.getBoundingClientRect().height;
+ };
+
+ _proto._process = function _process() {
+ var scrollTop = this._getScrollTop() + this._config.offset;
+
+ var scrollHeight = this._getScrollHeight();
+
+ var maxScroll = this._config.offset + scrollHeight - this._getOffsetHeight();
+
+ if (this._scrollHeight !== scrollHeight) {
+ this.refresh();
+ }
+
+ if (scrollTop >= maxScroll) {
+ var target = this._targets[this._targets.length - 1];
+
+ if (this._activeTarget !== target) {
+ this._activate(target);
+ }
+
+ return;
+ }
+
+ if (this._activeTarget && scrollTop < this._offsets[0] && this._offsets[0] > 0) {
+ this._activeTarget = null;
+
+ this._clear();
+
+ return;
+ }
+
+ var offsetLength = this._offsets.length;
+
+ for (var i = offsetLength; i--;) {
+ var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' || scrollTop < this._offsets[i + 1]);
+
+ if (isActiveTarget) {
+ this._activate(this._targets[i]);
+ }
+ }
+ };
+
+ _proto._activate = function _activate(target) {
+ this._activeTarget = target;
+
+ this._clear();
+
+ var queries = this._selector.split(',').map(function (selector) {
+ return selector + "[data-target=\"" + target + "\"]," + selector + "[href=\"" + target + "\"]";
+ });
+
+ var $link = $([].slice.call(document.querySelectorAll(queries.join(','))));
+
+ if ($link.hasClass(ClassName$8.DROPDOWN_ITEM)) {
+ $link.closest(Selector$8.DROPDOWN).find(Selector$8.DROPDOWN_TOGGLE).addClass(ClassName$8.ACTIVE);
+ $link.addClass(ClassName$8.ACTIVE);
+ } else {
+ // Set triggered link as active
+ $link.addClass(ClassName$8.ACTIVE); // Set triggered links parents as active
+ // With both <ul> and <nav> markup a parent is the previous sibling of any nav ancestor
+
+ $link.parents(Selector$8.NAV_LIST_GROUP).prev(Selector$8.NAV_LINKS + ", " + Selector$8.LIST_ITEMS).addClass(ClassName$8.ACTIVE); // Handle special case when .nav-link is inside .nav-item
+
+ $link.parents(Selector$8.NAV_LIST_GROUP).prev(Selector$8.NAV_ITEMS).children(Selector$8.NAV_LINKS).addClass(ClassName$8.ACTIVE);
+ }
+
+ $(this._scrollElement).trigger(Event$8.ACTIVATE, {
+ relatedTarget: target
+ });
+ };
+
+ _proto._clear = function _clear() {
+ [].slice.call(document.querySelectorAll(this._selector)).filter(function (node) {
+ return node.classList.contains(ClassName$8.ACTIVE);
+ }).forEach(function (node) {
+ return node.classList.remove(ClassName$8.ACTIVE);
+ });
+ }; // Static
+
+
+ ScrollSpy._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $(this).data(DATA_KEY$8);
+
+ var _config = typeof config === 'object' && config;
+
+ if (!data) {
+ data = new ScrollSpy(this, _config);
+ $(this).data(DATA_KEY$8, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(ScrollSpy, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION$8;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default$6;
+ }
+ }]);
+
+ return ScrollSpy;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $(window).on(Event$8.LOAD_DATA_API, function () {
+ var scrollSpys = [].slice.call(document.querySelectorAll(Selector$8.DATA_SPY));
+ var scrollSpysLength = scrollSpys.length;
+
+ for (var i = scrollSpysLength; i--;) {
+ var $spy = $(scrollSpys[i]);
+
+ ScrollSpy._jQueryInterface.call($spy, $spy.data());
+ }
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $.fn[NAME$8] = ScrollSpy._jQueryInterface;
+ $.fn[NAME$8].Constructor = ScrollSpy;
+
+ $.fn[NAME$8].noConflict = function () {
+ $.fn[NAME$8] = JQUERY_NO_CONFLICT$8;
+ return ScrollSpy._jQueryInterface;
+ };
+
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+
+ var NAME$9 = 'tab';
+ var VERSION$9 = '4.2.1';
+ var DATA_KEY$9 = 'bs.tab';
+ var EVENT_KEY$9 = "." + DATA_KEY$9;
+ var DATA_API_KEY$7 = '.data-api';
+ var JQUERY_NO_CONFLICT$9 = $.fn[NAME$9];
+ var Event$9 = {
+ HIDE: "hide" + EVENT_KEY$9,
+ HIDDEN: "hidden" + EVENT_KEY$9,
+ SHOW: "show" + EVENT_KEY$9,
+ SHOWN: "shown" + EVENT_KEY$9,
+ CLICK_DATA_API: "click" + EVENT_KEY$9 + DATA_API_KEY$7
+ };
+ var ClassName$9 = {
+ DROPDOWN_MENU: 'dropdown-menu',
+ ACTIVE: 'active',
+ DISABLED: 'disabled',
+ FADE: 'fade',
+ SHOW: 'show'
+ };
+ var Selector$9 = {
+ DROPDOWN: '.dropdown',
+ NAV_LIST_GROUP: '.nav, .list-group',
+ ACTIVE: '.active',
+ ACTIVE_UL: '> li > .active',
+ DATA_TOGGLE: '[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',
+ DROPDOWN_TOGGLE: '.dropdown-toggle',
+ DROPDOWN_ACTIVE_CHILD: '> .dropdown-menu .active'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Tab =
+ /*#__PURE__*/
+ function () {
+ function Tab(element) {
+ this._element = element;
+ } // Getters
+
+
+ var _proto = Tab.prototype;
+
+ // Public
+ _proto.show = function show() {
+ var _this = this;
+
+ if (this._element.parentNode && this._element.parentNode.nodeType === Node.ELEMENT_NODE && $(this._element).hasClass(ClassName$9.ACTIVE) || $(this._element).hasClass(ClassName$9.DISABLED)) {
+ return;
+ }
+
+ var target;
+ var previous;
+ var listElement = $(this._element).closest(Selector$9.NAV_LIST_GROUP)[0];
+ var selector = Util.getSelectorFromElement(this._element);
+
+ if (listElement) {
+ var itemSelector = listElement.nodeName === 'UL' || listElement.nodeName === 'OL' ? Selector$9.ACTIVE_UL : Selector$9.ACTIVE;
+ previous = $.makeArray($(listElement).find(itemSelector));
+ previous = previous[previous.length - 1];
+ }
+
+ var hideEvent = $.Event(Event$9.HIDE, {
+ relatedTarget: this._element
+ });
+ var showEvent = $.Event(Event$9.SHOW, {
+ relatedTarget: previous
+ });
+
+ if (previous) {
+ $(previous).trigger(hideEvent);
+ }
+
+ $(this._element).trigger(showEvent);
+
+ if (showEvent.isDefaultPrevented() || hideEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ if (selector) {
+ target = document.querySelector(selector);
+ }
+
+ this._activate(this._element, listElement);
+
+ var complete = function complete() {
+ var hiddenEvent = $.Event(Event$9.HIDDEN, {
+ relatedTarget: _this._element
+ });
+ var shownEvent = $.Event(Event$9.SHOWN, {
+ relatedTarget: previous
+ });
+ $(previous).trigger(hiddenEvent);
+ $(_this._element).trigger(shownEvent);
+ };
+
+ if (target) {
+ this._activate(target, target.parentNode, complete);
+ } else {
+ complete();
+ }
+ };
+
+ _proto.dispose = function dispose() {
+ $.removeData(this._element, DATA_KEY$9);
+ this._element = null;
+ }; // Private
+
+
+ _proto._activate = function _activate(element, container, callback) {
+ var _this2 = this;
+
+ var activeElements = container && (container.nodeName === 'UL' || container.nodeName === 'OL') ? $(container).find(Selector$9.ACTIVE_UL) : $(container).children(Selector$9.ACTIVE);
+ var active = activeElements[0];
+ var isTransitioning = callback && active && $(active).hasClass(ClassName$9.FADE);
+
+ var complete = function complete() {
+ return _this2._transitionComplete(element, active, callback);
+ };
+
+ if (active && isTransitioning) {
+ var transitionDuration = Util.getTransitionDurationFromElement(active);
+ $(active).removeClass(ClassName$9.SHOW).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
+ } else {
+ complete();
+ }
+ };
+
+ _proto._transitionComplete = function _transitionComplete(element, active, callback) {
+ if (active) {
+ $(active).removeClass(ClassName$9.ACTIVE);
+ var dropdownChild = $(active.parentNode).find(Selector$9.DROPDOWN_ACTIVE_CHILD)[0];
+
+ if (dropdownChild) {
+ $(dropdownChild).removeClass(ClassName$9.ACTIVE);
+ }
+
+ if (active.getAttribute('role') === 'tab') {
+ active.setAttribute('aria-selected', false);
+ }
+ }
+
+ $(element).addClass(ClassName$9.ACTIVE);
+
+ if (element.getAttribute('role') === 'tab') {
+ element.setAttribute('aria-selected', true);
+ }
+
+ Util.reflow(element);
+ $(element).addClass(ClassName$9.SHOW);
+
+ if (element.parentNode && $(element.parentNode).hasClass(ClassName$9.DROPDOWN_MENU)) {
+ var dropdownElement = $(element).closest(Selector$9.DROPDOWN)[0];
+
+ if (dropdownElement) {
+ var dropdownToggleList = [].slice.call(dropdownElement.querySelectorAll(Selector$9.DROPDOWN_TOGGLE));
+ $(dropdownToggleList).addClass(ClassName$9.ACTIVE);
+ }
+
+ element.setAttribute('aria-expanded', true);
+ }
+
+ if (callback) {
+ callback();
+ }
+ }; // Static
+
+
+ Tab._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var $this = $(this);
+ var data = $this.data(DATA_KEY$9);
+
+ if (!data) {
+ data = new Tab(this);
+ $this.data(DATA_KEY$9, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Tab, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION$9;
+ }
+ }]);
+
+ return Tab;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $(document).on(Event$9.CLICK_DATA_API, Selector$9.DATA_TOGGLE, function (event) {
+ event.preventDefault();
+
+ Tab._jQueryInterface.call($(this), 'show');
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $.fn[NAME$9] = Tab._jQueryInterface;
+ $.fn[NAME$9].Constructor = Tab;
+
+ $.fn[NAME$9].noConflict = function () {
+ $.fn[NAME$9] = JQUERY_NO_CONFLICT$9;
+ return Tab._jQueryInterface;
+ };
+
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+
+ var NAME$a = 'toast';
+ var VERSION$a = '4.2.1';
+ var DATA_KEY$a = 'bs.toast';
+ var EVENT_KEY$a = "." + DATA_KEY$a;
+ var JQUERY_NO_CONFLICT$a = $.fn[NAME$a];
+ var Event$a = {
+ CLICK_DISMISS: "click.dismiss" + EVENT_KEY$a,
+ HIDE: "hide" + EVENT_KEY$a,
+ HIDDEN: "hidden" + EVENT_KEY$a,
+ SHOW: "show" + EVENT_KEY$a,
+ SHOWN: "shown" + EVENT_KEY$a
+ };
+ var ClassName$a = {
+ FADE: 'fade',
+ HIDE: 'hide',
+ SHOW: 'show',
+ SHOWING: 'showing'
+ };
+ var DefaultType$7 = {
+ animation: 'boolean',
+ autohide: 'boolean',
+ delay: 'number'
+ };
+ var Default$7 = {
+ animation: true,
+ autohide: true,
+ delay: 500
+ };
+ var Selector$a = {
+ DATA_DISMISS: '[data-dismiss="toast"]'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Toast =
+ /*#__PURE__*/
+ function () {
+ function Toast(element, config) {
+ this._element = element;
+ this._config = this._getConfig(config);
+ this._timeout = null;
+
+ this._setListeners();
+ } // Getters
+
+
+ var _proto = Toast.prototype;
+
+ // Public
+ _proto.show = function show() {
+ var _this = this;
+
+ $(this._element).trigger(Event$a.SHOW);
+
+ if (this._config.animation) {
+ this._element.classList.add(ClassName$a.FADE);
+ }
+
+ var complete = function complete() {
+ _this._element.classList.remove(ClassName$a.SHOWING);
+
+ _this._element.classList.add(ClassName$a.SHOW);
+
+ $(_this._element).trigger(Event$a.SHOWN);
+
+ if (_this._config.autohide) {
+ _this.hide();
+ }
+ };
+
+ this._element.classList.remove(ClassName$a.HIDE);
+
+ this._element.classList.add(ClassName$a.SHOWING);
+
+ if (this._config.animation) {
+ var transitionDuration = Util.getTransitionDurationFromElement(this._element);
+ $(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
+ } else {
+ complete();
+ }
+ };
+
+ _proto.hide = function hide(withoutTimeout) {
+ var _this2 = this;
+
+ if (!this._element.classList.contains(ClassName$a.SHOW)) {
+ return;
+ }
+
+ $(this._element).trigger(Event$a.HIDE);
+
+ if (withoutTimeout) {
+ this._close();
+ } else {
+ this._timeout = setTimeout(function () {
+ _this2._close();
+ }, this._config.delay);
+ }
+ };
+
+ _proto.dispose = function dispose() {
+ clearTimeout(this._timeout);
+ this._timeout = null;
+
+ if (this._element.classList.contains(ClassName$a.SHOW)) {
+ this._element.classList.remove(ClassName$a.SHOW);
+ }
+
+ $(this._element).off(Event$a.CLICK_DISMISS);
+ $.removeData(this._element, DATA_KEY$a);
+ this._element = null;
+ this._config = null;
+ }; // Private
+
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _objectSpread({}, Default$7, $(this._element).data(), typeof config === 'object' && config ? config : {});
+ Util.typeCheckConfig(NAME$a, config, this.constructor.DefaultType);
+ return config;
+ };
+
+ _proto._setListeners = function _setListeners() {
+ var _this3 = this;
+
+ $(this._element).on(Event$a.CLICK_DISMISS, Selector$a.DATA_DISMISS, function () {
+ return _this3.hide(true);
+ });
+ };
+
+ _proto._close = function _close() {
+ var _this4 = this;
+
+ var complete = function complete() {
+ _this4._element.classList.add(ClassName$a.HIDE);
+
+ $(_this4._element).trigger(Event$a.HIDDEN);
+ };
+
+ this._element.classList.remove(ClassName$a.SHOW);
+
+ if (this._config.animation) {
+ var transitionDuration = Util.getTransitionDurationFromElement(this._element);
+ $(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
+ } else {
+ complete();
+ }
+ }; // Static
+
+
+ Toast._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var $element = $(this);
+ var data = $element.data(DATA_KEY$a);
+
+ var _config = typeof config === 'object' && config;
+
+ if (!data) {
+ data = new Toast(this, _config);
+ $element.data(DATA_KEY$a, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config](this);
+ }
+ });
+ };
+
+ _createClass(Toast, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION$a;
+ }
+ }, {
+ key: "DefaultType",
+ get: function get() {
+ return DefaultType$7;
+ }
+ }]);
+
+ return Toast;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+
+ $.fn[NAME$a] = Toast._jQueryInterface;
+ $.fn[NAME$a].Constructor = Toast;
+
+ $.fn[NAME$a].noConflict = function () {
+ $.fn[NAME$a] = JQUERY_NO_CONFLICT$a;
+ return Toast._jQueryInterface;
+ };
+
+ /**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.2.1): index.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+ (function () {
+ if (typeof $ === 'undefined') {
+ throw new TypeError('Bootstrap\'s JavaScript requires jQuery. jQuery must be included before Bootstrap\'s JavaScript.');
+ }
+
+ var version = $.fn.jquery.split(' ')[0].split('.');
+ var minMajor = 1;
+ var ltMajor = 2;
+ var minMinor = 9;
+ var minPatch = 1;
+ var maxMajor = 4;
+
+ if (version[0] < ltMajor && version[1] < minMinor || version[0] === minMajor && version[1] === minMinor && version[2] < minPatch || version[0] >= maxMajor) {
+ throw new Error('Bootstrap\'s JavaScript requires at least jQuery v1.9.1 but less than v4.0.0');
+ }
+ })();
+
+ exports.Util = Util;
+ exports.Alert = Alert;
+ exports.Button = Button;
+ exports.Carousel = Carousel;
+ exports.Collapse = Collapse;
+ exports.Dropdown = Dropdown;
+ exports.Modal = Modal;
+ exports.Popover = Popover;
+ exports.Scrollspy = ScrollSpy;
+ exports.Tab = Tab;
+ exports.Toast = Toast;
+ exports.Tooltip = Tooltip;
+
+ Object.defineProperty(exports, '__esModule', { value: true });
+
+})));
+//# sourceMappingURL=bootstrap.js.map
+
+
+/***/ }),
+
+/***/ "./node_modules/is-buffer/index.js":
+/*!*****************************************!*\
+ !*** ./node_modules/is-buffer/index.js ***!
+ \*****************************************/
+/*! no static exports found */
+/***/ (function(module, exports) {
+
+/*!
+ * Determine if an object is a Buffer
+ *
+ * @author Feross Aboukhadijeh <https://feross.org>
+ * @license MIT
+ */
+
+// The _isBuffer check is for Safari 5-7 support, because it's missing
+// Object.prototype.constructor. Remove this eventually
+module.exports = function (obj) {
+ return obj != null && (isBuffer(obj) || isSlowBuffer(obj) || !!obj._isBuffer)
+}
+
+function isBuffer (obj) {
+ return !!obj.constructor && typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj)
+}
+
+// For Node v0.10 support. Remove this eventually.
+function isSlowBuffer (obj) {
+ return typeof obj.readFloatLE === 'function' && typeof obj.slice === 'function' && isBuffer(obj.slice(0, 0))
+}
+
+
+/***/ }),
+
+/***/ "./node_modules/jquery/dist/jquery.js":
+/*!********************************************!*\
+ !*** ./node_modules/jquery/dist/jquery.js ***!
+ \********************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;/*!
+ * jQuery JavaScript Library v3.3.1
+ * https://jquery.com/
+ *
+ * Includes Sizzle.js
+ * https://sizzlejs.com/
+ *
+ * Copyright JS Foundation and other contributors
+ * Released under the MIT license
+ * https://jquery.org/license
+ *
+ * Date: 2018-01-20T17:24Z
+ */
+( function( global, factory ) {
+
+ "use strict";
+
+ if ( true && typeof module.exports === "object" ) {
+
+ // For CommonJS and CommonJS-like environments where a proper `window`
+ // is present, execute the factory and get jQuery.
+ // For environments that do not have a `window` with a `document`
+ // (such as Node.js), expose a factory as module.exports.
+ // This accentuates the need for the creation of a real `window`.
+ // e.g. var jQuery = require("jquery")(window);
+ // See ticket #14549 for more info.
+ module.exports = global.document ?
+ factory( global, true ) :
+ function( w ) {
+ if ( !w.document ) {
+ throw new Error( "jQuery requires a window with a document" );
+ }
+ return factory( w );
+ };
+ } else {
+ factory( global );
+ }
+
+// Pass this if window is not defined yet
+} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) {
+
+// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1
+// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode
+// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common
+// enough that all such attempts are guarded in a try block.
+"use strict";
+
+var arr = [];
+
+var document = window.document;
+
+var getProto = Object.getPrototypeOf;
+
+var slice = arr.slice;
+
+var concat = arr.concat;
+
+var push = arr.push;
+
+var indexOf = arr.indexOf;
+
+var class2type = {};
+
+var toString = class2type.toString;
+
+var hasOwn = class2type.hasOwnProperty;
+
+var fnToString = hasOwn.toString;
+
+var ObjectFunctionString = fnToString.call( Object );
+
+var support = {};
+
+var isFunction = function isFunction( obj ) {
+
+ // Support: Chrome <=57, Firefox <=52
+ // In some browsers, typeof returns "function" for HTML <object> elements
+ // (i.e., `typeof document.createElement( "object" ) === "function"`).
+ // We don't want to classify *any* DOM node as a function.
+ return typeof obj === "function" && typeof obj.nodeType !== "number";
+ };
+
+
+var isWindow = function isWindow( obj ) {
+ return obj != null && obj === obj.window;
+ };
+
+
+
+
+ var preservedScriptAttributes = {
+ type: true,
+ src: true,
+ noModule: true
+ };
+
+ function DOMEval( code, doc, node ) {
+ doc = doc || document;
+
+ var i,
+ script = doc.createElement( "script" );
+
+ script.text = code;
+ if ( node ) {
+ for ( i in preservedScriptAttributes ) {
+ if ( node[ i ] ) {
+ script[ i ] = node[ i ];
+ }
+ }
+ }
+ doc.head.appendChild( script ).parentNode.removeChild( script );
+ }
+
+
+function toType( obj ) {
+ if ( obj == null ) {
+ return obj + "";
+ }
+
+ // Support: Android <=2.3 only (functionish RegExp)
+ return typeof obj === "object" || typeof obj === "function" ?
+ class2type[ toString.call( obj ) ] || "object" :
+ typeof obj;
+}
+/* global Symbol */
+// Defining this global in .eslintrc.json would create a danger of using the global
+// unguarded in another place, it seems safer to define global only for this module
+
+
+
+var
+ version = "3.3.1",
+
+ // Define a local copy of jQuery
+ jQuery = function( selector, context ) {
+
+ // The jQuery object is actually just the init constructor 'enhanced'
+ // Need init if jQuery is called (just allow error to be thrown if not included)
+ return new jQuery.fn.init( selector, context );
+ },
+
+ // Support: Android <=4.0 only
+ // Make sure we trim BOM and NBSP
+ rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g;
+
+jQuery.fn = jQuery.prototype = {
+
+ // The current version of jQuery being used
+ jquery: version,
+
+ constructor: jQuery,
+
+ // The default length of a jQuery object is 0
+ length: 0,
+
+ toArray: function() {
+ return slice.call( this );
+ },
+
+ // Get the Nth element in the matched element set OR
+ // Get the whole matched element set as a clean array
+ get: function( num ) {
+
+ // Return all the elements in a clean array
+ if ( num == null ) {
+ return slice.call( this );
+ }
+
+ // Return just the one element from the set
+ return num < 0 ? this[ num + this.length ] : this[ num ];
+ },
+
+ // Take an array of elements and push it onto the stack
+ // (returning the new matched element set)
+ pushStack: function( elems ) {
+
+ // Build a new jQuery matched element set
+ var ret = jQuery.merge( this.constructor(), elems );
+
+ // Add the old object onto the stack (as a reference)
+ ret.prevObject = this;
+
+ // Return the newly-formed element set
+ return ret;
+ },
+
+ // Execute a callback for every element in the matched set.
+ each: function( callback ) {
+ return jQuery.each( this, callback );
+ },
+
+ map: function( callback ) {
+ return this.pushStack( jQuery.map( this, function( elem, i ) {
+ return callback.call( elem, i, elem );
+ } ) );
+ },
+
+ slice: function() {
+ return this.pushStack( slice.apply( this, arguments ) );
+ },
+
+ first: function() {
+ return this.eq( 0 );
+ },
+
+ last: function() {
+ return this.eq( -1 );
+ },
+
+ eq: function( i ) {
+ var len = this.length,
+ j = +i + ( i < 0 ? len : 0 );
+ return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] );
+ },
+
+ end: function() {
+ return this.prevObject || this.constructor();
+ },
+
+ // For internal use only.
+ // Behaves like an Array's method, not like a jQuery method.
+ push: push,
+ sort: arr.sort,
+ splice: arr.splice
+};
+
+jQuery.extend = jQuery.fn.extend = function() {
+ var options, name, src, copy, copyIsArray, clone,
+ target = arguments[ 0 ] || {},
+ i = 1,
+ length = arguments.length,
+ deep = false;
+
+ // Handle a deep copy situation
+ if ( typeof target === "boolean" ) {
+ deep = target;
+
+ // Skip the boolean and the target
+ target = arguments[ i ] || {};
+ i++;
+ }
+
+ // Handle case when target is a string or something (possible in deep copy)
+ if ( typeof target !== "object" && !isFunction( target ) ) {
+ target = {};
+ }
+
+ // Extend jQuery itself if only one argument is passed
+ if ( i === length ) {
+ target = this;
+ i--;
+ }
+
+ for ( ; i < length; i++ ) {
+
+ // Only deal with non-null/undefined values
+ if ( ( options = arguments[ i ] ) != null ) {
+
+ // Extend the base object
+ for ( name in options ) {
+ src = target[ name ];
+ copy = options[ name ];
+
+ // Prevent never-ending loop
+ if ( target === copy ) {
+ continue;
+ }
+
+ // Recurse if we're merging plain objects or arrays
+ if ( deep && copy && ( jQuery.isPlainObject( copy ) ||
+ ( copyIsArray = Array.isArray( copy ) ) ) ) {
+
+ if ( copyIsArray ) {
+ copyIsArray = false;
+ clone = src && Array.isArray( src ) ? src : [];
+
+ } else {
+ clone = src && jQuery.isPlainObject( src ) ? src : {};
+ }
+
+ // Never move original objects, clone them
+ target[ name ] = jQuery.extend( deep, clone, copy );
+
+ // Don't bring in undefined values
+ } else if ( copy !== undefined ) {
+ target[ name ] = copy;
+ }
+ }
+ }
+ }
+
+ // Return the modified object
+ return target;
+};
+
+jQuery.extend( {
+
+ // Unique for each copy of jQuery on the page
+ expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ),
+
+ // Assume jQuery is ready without the ready module
+ isReady: true,
+
+ error: function( msg ) {
+ throw new Error( msg );
+ },
+
+ noop: function() {},
+
+ isPlainObject: function( obj ) {
+ var proto, Ctor;
+
+ // Detect obvious negatives
+ // Use toString instead of jQuery.type to catch host objects
+ if ( !obj || toString.call( obj ) !== "[object Object]" ) {
+ return false;
+ }
+
+ proto = getProto( obj );
+
+ // Objects with no prototype (e.g., `Object.create( null )`) are plain
+ if ( !proto ) {
+ return true;
+ }
+
+ // Objects with prototype are plain iff they were constructed by a global Object function
+ Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor;
+ return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString;
+ },
+
+ isEmptyObject: function( obj ) {
+
+ /* eslint-disable no-unused-vars */
+ // See https://github.com/eslint/eslint/issues/6125
+ var name;
+
+ for ( name in obj ) {
+ return false;
+ }
+ return true;
+ },
+
+ // Evaluates a script in a global context
+ globalEval: function( code ) {
+ DOMEval( code );
+ },
+
+ each: function( obj, callback ) {
+ var length, i = 0;
+
+ if ( isArrayLike( obj ) ) {
+ length = obj.length;
+ for ( ; i < length; i++ ) {
+ if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
+ break;
+ }
+ }
+ } else {
+ for ( i in obj ) {
+ if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
+ break;
+ }
+ }
+ }
+
+ return obj;
+ },
+
+ // Support: Android <=4.0 only
+ trim: function( text ) {
+ return text == null ?
+ "" :
+ ( text + "" ).replace( rtrim, "" );
+ },
+
+ // results is for internal usage only
+ makeArray: function( arr, results ) {
+ var ret = results || [];
+
+ if ( arr != null ) {
+ if ( isArrayLike( Object( arr ) ) ) {
+ jQuery.merge( ret,
+ typeof arr === "string" ?
+ [ arr ] : arr
+ );
+ } else {
+ push.call( ret, arr );
+ }
+ }
+
+ return ret;
+ },
+
+ inArray: function( elem, arr, i ) {
+ return arr == null ? -1 : indexOf.call( arr, elem, i );
+ },
+
+ // Support: Android <=4.0 only, PhantomJS 1 only
+ // push.apply(_, arraylike) throws on ancient WebKit
+ merge: function( first, second ) {
+ var len = +second.length,
+ j = 0,
+ i = first.length;
+
+ for ( ; j < len; j++ ) {
+ first[ i++ ] = second[ j ];
+ }
+
+ first.length = i;
+
+ return first;
+ },
+
+ grep: function( elems, callback, invert ) {
+ var callbackInverse,
+ matches = [],
+ i = 0,
+ length = elems.length,
+ callbackExpect = !invert;
+
+ // Go through the array, only saving the items
+ // that pass the validator function
+ for ( ; i < length; i++ ) {
+ callbackInverse = !callback( elems[ i ], i );
+ if ( callbackInverse !== callbackExpect ) {
+ matches.push( elems[ i ] );
+ }
+ }
+
+ return matches;
+ },
+
+ // arg is for internal usage only
+ map: function( elems, callback, arg ) {
+ var length, value,
+ i = 0,
+ ret = [];
+
+ // Go through the array, translating each of the items to their new values
+ if ( isArrayLike( elems ) ) {
+ length = elems.length;
+ for ( ; i < length; i++ ) {
+ value = callback( elems[ i ], i, arg );
+
+ if ( value != null ) {
+ ret.push( value );
+ }
+ }
+
+ // Go through every key on the object,
+ } else {
+ for ( i in elems ) {
+ value = callback( elems[ i ], i, arg );
+
+ if ( value != null ) {
+ ret.push( value );
+ }
+ }
+ }
+
+ // Flatten any nested arrays
+ return concat.apply( [], ret );
+ },
+
+ // A global GUID counter for objects
+ guid: 1,
+
+ // jQuery.support is not used in Core but other projects attach their
+ // properties to it so it needs to exist.
+ support: support
+} );
+
+if ( typeof Symbol === "function" ) {
+ jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ];
+}
+
+// Populate the class2type map
+jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ),
+function( i, name ) {
+ class2type[ "[object " + name + "]" ] = name.toLowerCase();
+} );
+
+function isArrayLike( obj ) {
+
+ // Support: real iOS 8.2 only (not reproducible in simulator)
+ // `in` check used to prevent JIT error (gh-2145)
+ // hasOwn isn't used here due to false negatives
+ // regarding Nodelist length in IE
+ var length = !!obj && "length" in obj && obj.length,
+ type = toType( obj );
+
+ if ( isFunction( obj ) || isWindow( obj ) ) {
+ return false;
+ }
+
+ return type === "array" || length === 0 ||
+ typeof length === "number" && length > 0 && ( length - 1 ) in obj;
+}
+var Sizzle =
+/*!
+ * Sizzle CSS Selector Engine v2.3.3
+ * https://sizzlejs.com/
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license
+ * http://jquery.org/license
+ *
+ * Date: 2016-08-08
+ */
+(function( window ) {
+
+var i,
+ support,
+ Expr,
+ getText,
+ isXML,
+ tokenize,
+ compile,
+ select,
+ outermostContext,
+ sortInput,
+ hasDuplicate,
+
+ // Local document vars
+ setDocument,
+ document,
+ docElem,
+ documentIsHTML,
+ rbuggyQSA,
+ rbuggyMatches,
+ matches,
+ contains,
+
+ // Instance-specific data
+ expando = "sizzle" + 1 * new Date(),
+ preferredDoc = window.document,
+ dirruns = 0,
+ done = 0,
+ classCache = createCache(),
+ tokenCache = createCache(),
+ compilerCache = createCache(),
+ sortOrder = function( a, b ) {
+ if ( a === b ) {
+ hasDuplicate = true;
+ }
+ return 0;
+ },
+
+ // Instance methods
+ hasOwn = ({}).hasOwnProperty,
+ arr = [],
+ pop = arr.pop,
+ push_native = arr.push,
+ push = arr.push,
+ slice = arr.slice,
+ // Use a stripped-down indexOf as it's faster than native
+ // https://jsperf.com/thor-indexof-vs-for/5
+ indexOf = function( list, elem ) {
+ var i = 0,
+ len = list.length;
+ for ( ; i < len; i++ ) {
+ if ( list[i] === elem ) {
+ return i;
+ }
+ }
+ return -1;
+ },
+
+ booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",
+
+ // Regular expressions
+
+ // http://www.w3.org/TR/css3-selectors/#whitespace
+ whitespace = "[\\x20\\t\\r\\n\\f]",
+
+ // http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier
+ identifier = "(?:\\\\.|[\\w-]|[^\0-\\xa0])+",
+
+ // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors
+ attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace +
+ // Operator (capture 2)
+ "*([*^$|!~]?=)" + whitespace +
+ // "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]"
+ "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + whitespace +
+ "*\\]",
+
+ pseudos = ":(" + identifier + ")(?:\\((" +
+ // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments:
+ // 1. quoted (capture 3; capture 4 or capture 5)
+ "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" +
+ // 2. simple (capture 6)
+ "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" +
+ // 3. anything else (capture 2)
+ ".*" +
+ ")\\)|)",
+
+ // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
+ rwhitespace = new RegExp( whitespace + "+", "g" ),
+ rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ),
+
+ rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ),
+ rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*" ),
+
+ rattributeQuotes = new RegExp( "=" + whitespace + "*([^\\]'\"]*?)" + whitespace + "*\\]", "g" ),
+
+ rpseudo = new RegExp( pseudos ),
+ ridentifier = new RegExp( "^" + identifier + "$" ),
+
+ matchExpr = {
+ "ID": new RegExp( "^#(" + identifier + ")" ),
+ "CLASS": new RegExp( "^\\.(" + identifier + ")" ),
+ "TAG": new RegExp( "^(" + identifier + "|[*])" ),
+ "ATTR": new RegExp( "^" + attributes ),
+ "PSEUDO": new RegExp( "^" + pseudos ),
+ "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace +
+ "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace +
+ "*(\\d+)|))" + whitespace + "*\\)|)", "i" ),
+ "bool": new RegExp( "^(?:" + booleans + ")$", "i" ),
+ // For use in libraries implementing .is()
+ // We use this for POS matching in `select`
+ "needsContext": new RegExp( "^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" +
+ whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" )
+ },
+
+ rinputs = /^(?:input|select|textarea|button)$/i,
+ rheader = /^h\d$/i,
+
+ rnative = /^[^{]+\{\s*\[native \w/,
+
+ // Easily-parseable/retrievable ID or TAG or CLASS selectors
+ rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,
+
+ rsibling = /[+~]/,
+
+ // CSS escapes
+ // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters
+ runescape = new RegExp( "\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)", "ig" ),
+ funescape = function( _, escaped, escapedWhitespace ) {
+ var high = "0x" + escaped - 0x10000;
+ // NaN means non-codepoint
+ // Support: Firefox<24
+ // Workaround erroneous numeric interpretation of +"0x"
+ return high !== high || escapedWhitespace ?
+ escaped :
+ high < 0 ?
+ // BMP codepoint
+ String.fromCharCode( high + 0x10000 ) :
+ // Supplemental Plane codepoint (surrogate pair)
+ String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 );
+ },
+
+ // CSS string/identifier serialization
+ // https://drafts.csswg.org/cssom/#common-serializing-idioms
+ rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,
+ fcssescape = function( ch, asCodePoint ) {
+ if ( asCodePoint ) {
+
+ // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER
+ if ( ch === "\0" ) {
+ return "\uFFFD";
+ }
+
+ // Control characters and (dependent upon position) numbers get escaped as code points
+ return ch.slice( 0, -1 ) + "\\" + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " ";
+ }
+
+ // Other potentially-special ASCII characters get backslash-escaped
+ return "\\" + ch;
+ },
+
+ // Used for iframes
+ // See setDocument()
+ // Removing the function wrapper causes a "Permission Denied"
+ // error in IE
+ unloadHandler = function() {
+ setDocument();
+ },
+
+ disabledAncestor = addCombinator(
+ function( elem ) {
+ return elem.disabled === true && ("form" in elem || "label" in elem);
+ },
+ { dir: "parentNode", next: "legend" }
+ );
+
+// Optimize for push.apply( _, NodeList )
+try {
+ push.apply(
+ (arr = slice.call( preferredDoc.childNodes )),
+ preferredDoc.childNodes
+ );
+ // Support: Android<4.0
+ // Detect silently failing push.apply
+ arr[ preferredDoc.childNodes.length ].nodeType;
+} catch ( e ) {
+ push = { apply: arr.length ?
+
+ // Leverage slice if possible
+ function( target, els ) {
+ push_native.apply( target, slice.call(els) );
+ } :
+
+ // Support: IE<9
+ // Otherwise append directly
+ function( target, els ) {
+ var j = target.length,
+ i = 0;
+ // Can't trust NodeList.length
+ while ( (target[j++] = els[i++]) ) {}
+ target.length = j - 1;
+ }
+ };
+}
+
+function Sizzle( selector, context, results, seed ) {
+ var m, i, elem, nid, match, groups, newSelector,
+ newContext = context && context.ownerDocument,
+
+ // nodeType defaults to 9, since context defaults to document
+ nodeType = context ? context.nodeType : 9;
+
+ results = results || [];
+
+ // Return early from calls with invalid selector or context
+ if ( typeof selector !== "string" || !selector ||
+ nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) {
+
+ return results;
+ }
+
+ // Try to shortcut find operations (as opposed to filters) in HTML documents
+ if ( !seed ) {
+
+ if ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) {
+ setDocument( context );
+ }
+ context = context || document;
+
+ if ( documentIsHTML ) {
+
+ // If the selector is sufficiently simple, try using a "get*By*" DOM method
+ // (excepting DocumentFragment context, where the methods don't exist)
+ if ( nodeType !== 11 && (match = rquickExpr.exec( selector )) ) {
+
+ // ID selector
+ if ( (m = match[1]) ) {
+
+ // Document context
+ if ( nodeType === 9 ) {
+ if ( (elem = context.getElementById( m )) ) {
+
+ // Support: IE, Opera, Webkit
+ // TODO: identify versions
+ // getElementById can match elements by name instead of ID
+ if ( elem.id === m ) {
+ results.push( elem );
+ return results;
+ }
+ } else {
+ return results;
+ }
+
+ // Element context
+ } else {
+
+ // Support: IE, Opera, Webkit
+ // TODO: identify versions
+ // getElementById can match elements by name instead of ID
+ if ( newContext && (elem = newContext.getElementById( m )) &&
+ contains( context, elem ) &&
+ elem.id === m ) {
+
+ results.push( elem );
+ return results;
+ }
+ }
+
+ // Type selector
+ } else if ( match[2] ) {
+ push.apply( results, context.getElementsByTagName( selector ) );
+ return results;
+
+ // Class selector
+ } else if ( (m = match[3]) && support.getElementsByClassName &&
+ context.getElementsByClassName ) {
+
+ push.apply( results, context.getElementsByClassName( m ) );
+ return results;
+ }
+ }
+
+ // Take advantage of querySelectorAll
+ if ( support.qsa &&
+ !compilerCache[ selector + " " ] &&
+ (!rbuggyQSA || !rbuggyQSA.test( selector )) ) {
+
+ if ( nodeType !== 1 ) {
+ newContext = context;
+ newSelector = selector;
+
+ // qSA looks outside Element context, which is not what we want
+ // Thanks to Andrew Dupont for this workaround technique
+ // Support: IE <=8
+ // Exclude object elements
+ } else if ( context.nodeName.toLowerCase() !== "object" ) {
+
+ // Capture the context ID, setting it first if necessary
+ if ( (nid = context.getAttribute( "id" )) ) {
+ nid = nid.replace( rcssescape, fcssescape );
+ } else {
+ context.setAttribute( "id", (nid = expando) );
+ }
+
+ // Prefix every selector in the list
+ groups = tokenize( selector );
+ i = groups.length;
+ while ( i-- ) {
+ groups[i] = "#" + nid + " " + toSelector( groups[i] );
+ }
+ newSelector = groups.join( "," );
+
+ // Expand context for sibling selectors
+ newContext = rsibling.test( selector ) && testContext( context.parentNode ) ||
+ context;
+ }
+
+ if ( newSelector ) {
+ try {
+ push.apply( results,
+ newContext.querySelectorAll( newSelector )
+ );
+ return results;
+ } catch ( qsaError ) {
+ } finally {
+ if ( nid === expando ) {
+ context.removeAttribute( "id" );
+ }
+ }
+ }
+ }
+ }
+ }
+
+ // All others
+ return select( selector.replace( rtrim, "$1" ), context, results, seed );
+}
+
+/**
+ * Create key-value caches of limited size
+ * @returns {function(string, object)} Returns the Object data after storing it on itself with
+ * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
+ * deleting the oldest entry
+ */
+function createCache() {
+ var keys = [];
+
+ function cache( key, value ) {
+ // Use (key + " ") to avoid collision with native prototype properties (see Issue #157)
+ if ( keys.push( key + " " ) > Expr.cacheLength ) {
+ // Only keep the most recent entries
+ delete cache[ keys.shift() ];
+ }
+ return (cache[ key + " " ] = value);
+ }
+ return cache;
+}
+
+/**
+ * Mark a function for special use by Sizzle
+ * @param {Function} fn The function to mark
+ */
+function markFunction( fn ) {
+ fn[ expando ] = true;
+ return fn;
+}
+
+/**
+ * Support testing using an element
+ * @param {Function} fn Passed the created element and returns a boolean result
+ */
+function assert( fn ) {
+ var el = document.createElement("fieldset");
+
+ try {
+ return !!fn( el );
+ } catch (e) {
+ return false;
+ } finally {
+ // Remove from its parent by default
+ if ( el.parentNode ) {
+ el.parentNode.removeChild( el );
+ }
+ // release memory in IE
+ el = null;
+ }
+}
+
+/**
+ * Adds the same handler for all of the specified attrs
+ * @param {String} attrs Pipe-separated list of attributes
+ * @param {Function} handler The method that will be applied
+ */
+function addHandle( attrs, handler ) {
+ var arr = attrs.split("|"),
+ i = arr.length;
+
+ while ( i-- ) {
+ Expr.attrHandle[ arr[i] ] = handler;
+ }
+}
+
+/**
+ * Checks document order of two siblings
+ * @param {Element} a
+ * @param {Element} b
+ * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b
+ */
+function siblingCheck( a, b ) {
+ var cur = b && a,
+ diff = cur && a.nodeType === 1 && b.nodeType === 1 &&
+ a.sourceIndex - b.sourceIndex;
+
+ // Use IE sourceIndex if available on both nodes
+ if ( diff ) {
+ return diff;
+ }
+
+ // Check if b follows a
+ if ( cur ) {
+ while ( (cur = cur.nextSibling) ) {
+ if ( cur === b ) {
+ return -1;
+ }
+ }
+ }
+
+ return a ? 1 : -1;
+}
+
+/**
+ * Returns a function to use in pseudos for input types
+ * @param {String} type
+ */
+function createInputPseudo( type ) {
+ return function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && elem.type === type;
+ };
+}
+
+/**
+ * Returns a function to use in pseudos for buttons
+ * @param {String} type
+ */
+function createButtonPseudo( type ) {
+ return function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return (name === "input" || name === "button") && elem.type === type;
+ };
+}
+
+/**
+ * Returns a function to use in pseudos for :enabled/:disabled
+ * @param {Boolean} disabled true for :disabled; false for :enabled
+ */
+function createDisabledPseudo( disabled ) {
+
+ // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable
+ return function( elem ) {
+
+ // Only certain elements can match :enabled or :disabled
+ // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled
+ // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled
+ if ( "form" in elem ) {
+
+ // Check for inherited disabledness on relevant non-disabled elements:
+ // * listed form-associated elements in a disabled fieldset
+ // https://html.spec.whatwg.org/multipage/forms.html#category-listed
+ // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled
+ // * option elements in a disabled optgroup
+ // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled
+ // All such elements have a "form" property.
+ if ( elem.parentNode && elem.disabled === false ) {
+
+ // Option elements defer to a parent optgroup if present
+ if ( "label" in elem ) {
+ if ( "label" in elem.parentNode ) {
+ return elem.parentNode.disabled === disabled;
+ } else {
+ return elem.disabled === disabled;
+ }
+ }
+
+ // Support: IE 6 - 11
+ // Use the isDisabled shortcut property to check for disabled fieldset ancestors
+ return elem.isDisabled === disabled ||
+
+ // Where there is no isDisabled, check manually
+ /* jshint -W018 */
+ elem.isDisabled !== !disabled &&
+ disabledAncestor( elem ) === disabled;
+ }
+
+ return elem.disabled === disabled;
+
+ // Try to winnow out elements that can't be disabled before trusting the disabled property.
+ // Some victims get caught in our net (label, legend, menu, track), but it shouldn't
+ // even exist on them, let alone have a boolean value.
+ } else if ( "label" in elem ) {
+ return elem.disabled === disabled;
+ }
+
+ // Remaining elements are neither :enabled nor :disabled
+ return false;
+ };
+}
+
+/**
+ * Returns a function to use in pseudos for positionals
+ * @param {Function} fn
+ */
+function createPositionalPseudo( fn ) {
+ return markFunction(function( argument ) {
+ argument = +argument;
+ return markFunction(function( seed, matches ) {
+ var j,
+ matchIndexes = fn( [], seed.length, argument ),
+ i = matchIndexes.length;
+
+ // Match elements found at the specified indexes
+ while ( i-- ) {
+ if ( seed[ (j = matchIndexes[i]) ] ) {
+ seed[j] = !(matches[j] = seed[j]);
+ }
+ }
+ });
+ });
+}
+
+/**
+ * Checks a node for validity as a Sizzle context
+ * @param {Element|Object=} context
+ * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value
+ */
+function testContext( context ) {
+ return context && typeof context.getElementsByTagName !== "undefined" && context;
+}
+
+// Expose support vars for convenience
+support = Sizzle.support = {};
+
+/**
+ * Detects XML nodes
+ * @param {Element|Object} elem An element or a document
+ * @returns {Boolean} True iff elem is a non-HTML XML node
+ */
+isXML = Sizzle.isXML = function( elem ) {
+ // documentElement is verified for cases where it doesn't yet exist
+ // (such as loading iframes in IE - #4833)
+ var documentElement = elem && (elem.ownerDocument || elem).documentElement;
+ return documentElement ? documentElement.nodeName !== "HTML" : false;
+};
+
+/**
+ * Sets document-related variables once based on the current document
+ * @param {Element|Object} [doc] An element or document object to use to set the document
+ * @returns {Object} Returns the current document
+ */
+setDocument = Sizzle.setDocument = function( node ) {
+ var hasCompare, subWindow,
+ doc = node ? node.ownerDocument || node : preferredDoc;
+
+ // Return early if doc is invalid or already selected
+ if ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) {
+ return document;
+ }
+
+ // Update global variables
+ document = doc;
+ docElem = document.documentElement;
+ documentIsHTML = !isXML( document );
+
+ // Support: IE 9-11, Edge
+ // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936)
+ if ( preferredDoc !== document &&
+ (subWindow = document.defaultView) && subWindow.top !== subWindow ) {
+
+ // Support: IE 11, Edge
+ if ( subWindow.addEventListener ) {
+ subWindow.addEventListener( "unload", unloadHandler, false );
+
+ // Support: IE 9 - 10 only
+ } else if ( subWindow.attachEvent ) {
+ subWindow.attachEvent( "onunload", unloadHandler );
+ }
+ }
+
+ /* Attributes
+ ---------------------------------------------------------------------- */
+
+ // Support: IE<8
+ // Verify that getAttribute really returns attributes and not properties
+ // (excepting IE8 booleans)
+ support.attributes = assert(function( el ) {
+ el.className = "i";
+ return !el.getAttribute("className");
+ });
+
+ /* getElement(s)By*
+ ---------------------------------------------------------------------- */
+
+ // Check if getElementsByTagName("*") returns only elements
+ support.getElementsByTagName = assert(function( el ) {
+ el.appendChild( document.createComment("") );
+ return !el.getElementsByTagName("*").length;
+ });
+
+ // Support: IE<9
+ support.getElementsByClassName = rnative.test( document.getElementsByClassName );
+
+ // Support: IE<10
+ // Check if getElementById returns elements by name
+ // The broken getElementById methods don't pick up programmatically-set names,
+ // so use a roundabout getElementsByName test
+ support.getById = assert(function( el ) {
+ docElem.appendChild( el ).id = expando;
+ return !document.getElementsByName || !document.getElementsByName( expando ).length;
+ });
+
+ // ID filter and find
+ if ( support.getById ) {
+ Expr.filter["ID"] = function( id ) {
+ var attrId = id.replace( runescape, funescape );
+ return function( elem ) {
+ return elem.getAttribute("id") === attrId;
+ };
+ };
+ Expr.find["ID"] = function( id, context ) {
+ if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
+ var elem = context.getElementById( id );
+ return elem ? [ elem ] : [];
+ }
+ };
+ } else {
+ Expr.filter["ID"] = function( id ) {
+ var attrId = id.replace( runescape, funescape );
+ return function( elem ) {
+ var node = typeof elem.getAttributeNode !== "undefined" &&
+ elem.getAttributeNode("id");
+ return node && node.value === attrId;
+ };
+ };
+
+ // Support: IE 6 - 7 only
+ // getElementById is not reliable as a find shortcut
+ Expr.find["ID"] = function( id, context ) {
+ if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
+ var node, i, elems,
+ elem = context.getElementById( id );
+
+ if ( elem ) {
+
+ // Verify the id attribute
+ node = elem.getAttributeNode("id");
+ if ( node && node.value === id ) {
+ return [ elem ];
+ }
+
+ // Fall back on getElementsByName
+ elems = context.getElementsByName( id );
+ i = 0;
+ while ( (elem = elems[i++]) ) {
+ node = elem.getAttributeNode("id");
+ if ( node && node.value === id ) {
+ return [ elem ];
+ }
+ }
+ }
+
+ return [];
+ }
+ };
+ }
+
+ // Tag
+ Expr.find["TAG"] = support.getElementsByTagName ?
+ function( tag, context ) {
+ if ( typeof context.getElementsByTagName !== "undefined" ) {
+ return context.getElementsByTagName( tag );
+
+ // DocumentFragment nodes don't have gEBTN
+ } else if ( support.qsa ) {
+ return context.querySelectorAll( tag );
+ }
+ } :
+
+ function( tag, context ) {
+ var elem,
+ tmp = [],
+ i = 0,
+ // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too
+ results = context.getElementsByTagName( tag );
+
+ // Filter out possible comments
+ if ( tag === "*" ) {
+ while ( (elem = results[i++]) ) {
+ if ( elem.nodeType === 1 ) {
+ tmp.push( elem );
+ }
+ }
+
+ return tmp;
+ }
+ return results;
+ };
+
+ // Class
+ Expr.find["CLASS"] = support.getElementsByClassName && function( className, context ) {
+ if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) {
+ return context.getElementsByClassName( className );
+ }
+ };
+
+ /* QSA/matchesSelector
+ ---------------------------------------------------------------------- */
+
+ // QSA and matchesSelector support
+
+ // matchesSelector(:active) reports false when true (IE9/Opera 11.5)
+ rbuggyMatches = [];
+
+ // qSa(:focus) reports false when true (Chrome 21)
+ // We allow this because of a bug in IE8/9 that throws an error
+ // whenever `document.activeElement` is accessed on an iframe
+ // So, we allow :focus to pass through QSA all the time to avoid the IE error
+ // See https://bugs.jquery.com/ticket/13378
+ rbuggyQSA = [];
+
+ if ( (support.qsa = rnative.test( document.querySelectorAll )) ) {
+ // Build QSA regex
+ // Regex strategy adopted from Diego Perini
+ assert(function( el ) {
+ // Select is set to empty string on purpose
+ // This is to test IE's treatment of not explicitly
+ // setting a boolean content attribute,
+ // since its presence should be enough
+ // https://bugs.jquery.com/ticket/12359
+ docElem.appendChild( el ).innerHTML = "<a id='" + expando + "'></a>" +
+ "<select id='" + expando + "-\r\\' msallowcapture=''>" +
+ "<option selected=''></option></select>";
+
+ // Support: IE8, Opera 11-12.16
+ // Nothing should be selected when empty strings follow ^= or $= or *=
+ // The test attribute must be unknown in Opera but "safe" for WinRT
+ // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section
+ if ( el.querySelectorAll("[msallowcapture^='']").length ) {
+ rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" );
+ }
+
+ // Support: IE8
+ // Boolean attributes and "value" are not treated correctly
+ if ( !el.querySelectorAll("[selected]").length ) {
+ rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" );
+ }
+
+ // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+
+ if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) {
+ rbuggyQSA.push("~=");
+ }
+
+ // Webkit/Opera - :checked should return selected option elements
+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+ // IE8 throws error here and will not see later tests
+ if ( !el.querySelectorAll(":checked").length ) {
+ rbuggyQSA.push(":checked");
+ }
+
+ // Support: Safari 8+, iOS 8+
+ // https://bugs.webkit.org/show_bug.cgi?id=136851
+ // In-page `selector#id sibling-combinator selector` fails
+ if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) {
+ rbuggyQSA.push(".#.+[+~]");
+ }
+ });
+
+ assert(function( el ) {
+ el.innerHTML = "<a href='' disabled='disabled'></a>" +
+ "<select disabled='disabled'><option/></select>";
+
+ // Support: Windows 8 Native Apps
+ // The type and name attributes are restricted during .innerHTML assignment
+ var input = document.createElement("input");
+ input.setAttribute( "type", "hidden" );
+ el.appendChild( input ).setAttribute( "name", "D" );
+
+ // Support: IE8
+ // Enforce case-sensitivity of name attribute
+ if ( el.querySelectorAll("[name=d]").length ) {
+ rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" );
+ }
+
+ // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
+ // IE8 throws error here and will not see later tests
+ if ( el.querySelectorAll(":enabled").length !== 2 ) {
+ rbuggyQSA.push( ":enabled", ":disabled" );
+ }
+
+ // Support: IE9-11+
+ // IE's :disabled selector does not pick up the children of disabled fieldsets
+ docElem.appendChild( el ).disabled = true;
+ if ( el.querySelectorAll(":disabled").length !== 2 ) {
+ rbuggyQSA.push( ":enabled", ":disabled" );
+ }
+
+ // Opera 10-11 does not throw on post-comma invalid pseudos
+ el.querySelectorAll("*,:x");
+ rbuggyQSA.push(",.*:");
+ });
+ }
+
+ if ( (support.matchesSelector = rnative.test( (matches = docElem.matches ||
+ docElem.webkitMatchesSelector ||
+ docElem.mozMatchesSelector ||
+ docElem.oMatchesSelector ||
+ docElem.msMatchesSelector) )) ) {
+
+ assert(function( el ) {
+ // Check to see if it's possible to do matchesSelector
+ // on a disconnected node (IE 9)
+ support.disconnectedMatch = matches.call( el, "*" );
+
+ // This should fail with an exception
+ // Gecko does not error, returns false instead
+ matches.call( el, "[s!='']:x" );
+ rbuggyMatches.push( "!=", pseudos );
+ });
+ }
+
+ rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("|") );
+ rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join("|") );
+
+ /* Contains
+ ---------------------------------------------------------------------- */
+ hasCompare = rnative.test( docElem.compareDocumentPosition );
+
+ // Element contains another
+ // Purposefully self-exclusive
+ // As in, an element does not contain itself
+ contains = hasCompare || rnative.test( docElem.contains ) ?
+ function( a, b ) {
+ var adown = a.nodeType === 9 ? a.documentElement : a,
+ bup = b && b.parentNode;
+ return a === bup || !!( bup && bup.nodeType === 1 && (
+ adown.contains ?
+ adown.contains( bup ) :
+ a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16
+ ));
+ } :
+ function( a, b ) {
+ if ( b ) {
+ while ( (b = b.parentNode) ) {
+ if ( b === a ) {
+ return true;
+ }
+ }
+ }
+ return false;
+ };
+
+ /* Sorting
+ ---------------------------------------------------------------------- */
+
+ // Document order sorting
+ sortOrder = hasCompare ?
+ function( a, b ) {
+
+ // Flag for duplicate removal
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+ }
+
+ // Sort on method existence if only one input has compareDocumentPosition
+ var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
+ if ( compare ) {
+ return compare;
+ }
+
+ // Calculate position if both inputs belong to the same document
+ compare = ( a.ownerDocument || a ) === ( b.ownerDocument || b ) ?
+ a.compareDocumentPosition( b ) :
+
+ // Otherwise we know they are disconnected
+ 1;
+
+ // Disconnected nodes
+ if ( compare & 1 ||
+ (!support.sortDetached && b.compareDocumentPosition( a ) === compare) ) {
+
+ // Choose the first element that is related to our preferred document
+ if ( a === document || a.ownerDocument === preferredDoc && contains(preferredDoc, a) ) {
+ return -1;
+ }
+ if ( b === document || b.ownerDocument === preferredDoc && contains(preferredDoc, b) ) {
+ return 1;
+ }
+
+ // Maintain original order
+ return sortInput ?
+ ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :
+ 0;
+ }
+
+ return compare & 4 ? -1 : 1;
+ } :
+ function( a, b ) {
+ // Exit early if the nodes are identical
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+ }
+
+ var cur,
+ i = 0,
+ aup = a.parentNode,
+ bup = b.parentNode,
+ ap = [ a ],
+ bp = [ b ];
+
+ // Parentless nodes are either documents or disconnected
+ if ( !aup || !bup ) {
+ return a === document ? -1 :
+ b === document ? 1 :
+ aup ? -1 :
+ bup ? 1 :
+ sortInput ?
+ ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :
+ 0;
+
+ // If the nodes are siblings, we can do a quick check
+ } else if ( aup === bup ) {
+ return siblingCheck( a, b );
+ }
+
+ // Otherwise we need full lists of their ancestors for comparison
+ cur = a;
+ while ( (cur = cur.parentNode) ) {
+ ap.unshift( cur );
+ }
+ cur = b;
+ while ( (cur = cur.parentNode) ) {
+ bp.unshift( cur );
+ }
+
+ // Walk down the tree looking for a discrepancy
+ while ( ap[i] === bp[i] ) {
+ i++;
+ }
+
+ return i ?
+ // Do a sibling check if the nodes have a common ancestor
+ siblingCheck( ap[i], bp[i] ) :
+
+ // Otherwise nodes in our document sort first
+ ap[i] === preferredDoc ? -1 :
+ bp[i] === preferredDoc ? 1 :
+ 0;
+ };
+
+ return document;
+};
+
+Sizzle.matches = function( expr, elements ) {
+ return Sizzle( expr, null, null, elements );
+};
+
+Sizzle.matchesSelector = function( elem, expr ) {
+ // Set document vars if needed
+ if ( ( elem.ownerDocument || elem ) !== document ) {
+ setDocument( elem );
+ }
+
+ // Make sure that attribute selectors are quoted
+ expr = expr.replace( rattributeQuotes, "='$1']" );
+
+ if ( support.matchesSelector && documentIsHTML &&
+ !compilerCache[ expr + " " ] &&
+ ( !rbuggyMatches || !rbuggyMatches.test( expr ) ) &&
+ ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) {
+
+ try {
+ var ret = matches.call( elem, expr );
+
+ // IE 9's matchesSelector returns false on disconnected nodes
+ if ( ret || support.disconnectedMatch ||
+ // As well, disconnected nodes are said to be in a document
+ // fragment in IE 9
+ elem.document && elem.document.nodeType !== 11 ) {
+ return ret;
+ }
+ } catch (e) {}
+ }
+
+ return Sizzle( expr, document, null, [ elem ] ).length > 0;
+};
+
+Sizzle.contains = function( context, elem ) {
+ // Set document vars if needed
+ if ( ( context.ownerDocument || context ) !== document ) {
+ setDocument( context );
+ }
+ return contains( context, elem );
+};
+
+Sizzle.attr = function( elem, name ) {
+ // Set document vars if needed
+ if ( ( elem.ownerDocument || elem ) !== document ) {
+ setDocument( elem );
+ }
+
+ var fn = Expr.attrHandle[ name.toLowerCase() ],
+ // Don't get fooled by Object.prototype properties (jQuery #13807)
+ val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ?
+ fn( elem, name, !documentIsHTML ) :
+ undefined;
+
+ return val !== undefined ?
+ val :
+ support.attributes || !documentIsHTML ?
+ elem.getAttribute( name ) :
+ (val = elem.getAttributeNode(name)) && val.specified ?
+ val.value :
+ null;
+};
+
+Sizzle.escape = function( sel ) {
+ return (sel + "").replace( rcssescape, fcssescape );
+};
+
+Sizzle.error = function( msg ) {
+ throw new Error( "Syntax error, unrecognized expression: " + msg );
+};
+
+/**
+ * Document sorting and removing duplicates
+ * @param {ArrayLike} results
+ */
+Sizzle.uniqueSort = function( results ) {
+ var elem,
+ duplicates = [],
+ j = 0,
+ i = 0;
+
+ // Unless we *know* we can detect duplicates, assume their presence
+ hasDuplicate = !support.detectDuplicates;
+ sortInput = !support.sortStable && results.slice( 0 );
+ results.sort( sortOrder );
+
+ if ( hasDuplicate ) {
+ while ( (elem = results[i++]) ) {
+ if ( elem === results[ i ] ) {
+ j = duplicates.push( i );
+ }
+ }
+ while ( j-- ) {
+ results.splice( duplicates[ j ], 1 );
+ }
+ }
+
+ // Clear input after sorting to release objects
+ // See https://github.com/jquery/sizzle/pull/225
+ sortInput = null;
+
+ return results;
+};
+
+/**
+ * Utility function for retrieving the text value of an array of DOM nodes
+ * @param {Array|Element} elem
+ */
+getText = Sizzle.getText = function( elem ) {
+ var node,
+ ret = "",
+ i = 0,
+ nodeType = elem.nodeType;
+
+ if ( !nodeType ) {
+ // If no nodeType, this is expected to be an array
+ while ( (node = elem[i++]) ) {
+ // Do not traverse comment nodes
+ ret += getText( node );
+ }
+ } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {
+ // Use textContent for elements
+ // innerText usage removed for consistency of new lines (jQuery #11153)
+ if ( typeof elem.textContent === "string" ) {
+ return elem.textContent;
+ } else {
+ // Traverse its children
+ for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+ ret += getText( elem );
+ }
+ }
+ } else if ( nodeType === 3 || nodeType === 4 ) {
+ return elem.nodeValue;
+ }
+ // Do not include comment or processing instruction nodes
+
+ return ret;
+};
+
+Expr = Sizzle.selectors = {
+
+ // Can be adjusted by the user
+ cacheLength: 50,
+
+ createPseudo: markFunction,
+
+ match: matchExpr,
+
+ attrHandle: {},
+
+ find: {},
+
+ relative: {
+ ">": { dir: "parentNode", first: true },
+ " ": { dir: "parentNode" },
+ "+": { dir: "previousSibling", first: true },
+ "~": { dir: "previousSibling" }
+ },
+
+ preFilter: {
+ "ATTR": function( match ) {
+ match[1] = match[1].replace( runescape, funescape );
+
+ // Move the given value to match[3] whether quoted or unquoted
+ match[3] = ( match[3] || match[4] || match[5] || "" ).replace( runescape, funescape );
+
+ if ( match[2] === "~=" ) {
+ match[3] = " " + match[3] + " ";
+ }
+
+ return match.slice( 0, 4 );
+ },
+
+ "CHILD": function( match ) {
+ /* matches from matchExpr["CHILD"]
+ 1 type (only|nth|...)
+ 2 what (child|of-type)
+ 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
+ 4 xn-component of xn+y argument ([+-]?\d*n|)
+ 5 sign of xn-component
+ 6 x of xn-component
+ 7 sign of y-component
+ 8 y of y-component
+ */
+ match[1] = match[1].toLowerCase();
+
+ if ( match[1].slice( 0, 3 ) === "nth" ) {
+ // nth-* requires argument
+ if ( !match[3] ) {
+ Sizzle.error( match[0] );
+ }
+
+ // numeric x and y parameters for Expr.filter.CHILD
+ // remember that false/true cast respectively to 0/1
+ match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) );
+ match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" );
+
+ // other types prohibit arguments
+ } else if ( match[3] ) {
+ Sizzle.error( match[0] );
+ }
+
+ return match;
+ },
+
+ "PSEUDO": function( match ) {
+ var excess,
+ unquoted = !match[6] && match[2];
+
+ if ( matchExpr["CHILD"].test( match[0] ) ) {
+ return null;
+ }
+
+ // Accept quoted arguments as-is
+ if ( match[3] ) {
+ match[2] = match[4] || match[5] || "";
+
+ // Strip excess characters from unquoted arguments
+ } else if ( unquoted && rpseudo.test( unquoted ) &&
+ // Get excess from tokenize (recursively)
+ (excess = tokenize( unquoted, true )) &&
+ // advance to the next closing parenthesis
+ (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) {
+
+ // excess is a negative index
+ match[0] = match[0].slice( 0, excess );
+ match[2] = unquoted.slice( 0, excess );
+ }
+
+ // Return only captures needed by the pseudo filter method (type and argument)
+ return match.slice( 0, 3 );
+ }
+ },
+
+ filter: {
+
+ "TAG": function( nodeNameSelector ) {
+ var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase();
+ return nodeNameSelector === "*" ?
+ function() { return true; } :
+ function( elem ) {
+ return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
+ };
+ },
+
+ "CLASS": function( className ) {
+ var pattern = classCache[ className + " " ];
+
+ return pattern ||
+ (pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) &&
+ classCache( className, function( elem ) {
+ return pattern.test( typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== "undefined" && elem.getAttribute("class") || "" );
+ });
+ },
+
+ "ATTR": function( name, operator, check ) {
+ return function( elem ) {
+ var result = Sizzle.attr( elem, name );
+
+ if ( result == null ) {
+ return operator === "!=";
+ }
+ if ( !operator ) {
+ return true;
+ }
+
+ result += "";
+
+ return operator === "=" ? result === check :
+ operator === "!=" ? result !== check :
+ operator === "^=" ? check && result.indexOf( check ) === 0 :
+ operator === "*=" ? check && result.indexOf( check ) > -1 :
+ operator === "$=" ? check && result.slice( -check.length ) === check :
+ operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 :
+ operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" :
+ false;
+ };
+ },
+
+ "CHILD": function( type, what, argument, first, last ) {
+ var simple = type.slice( 0, 3 ) !== "nth",
+ forward = type.slice( -4 ) !== "last",
+ ofType = what === "of-type";
+
+ return first === 1 && last === 0 ?
+
+ // Shortcut for :nth-*(n)
+ function( elem ) {
+ return !!elem.parentNode;
+ } :
+
+ function( elem, context, xml ) {
+ var cache, uniqueCache, outerCache, node, nodeIndex, start,
+ dir = simple !== forward ? "nextSibling" : "previousSibling",
+ parent = elem.parentNode,
+ name = ofType && elem.nodeName.toLowerCase(),
+ useCache = !xml && !ofType,
+ diff = false;
+
+ if ( parent ) {
+
+ // :(first|last|only)-(child|of-type)
+ if ( simple ) {
+ while ( dir ) {
+ node = elem;
+ while ( (node = node[ dir ]) ) {
+ if ( ofType ?
+ node.nodeName.toLowerCase() === name :
+ node.nodeType === 1 ) {
+
+ return false;
+ }
+ }
+ // Reverse direction for :only-* (if we haven't yet done so)
+ start = dir = type === "only" && !start && "nextSibling";
+ }
+ return true;
+ }
+
+ start = [ forward ? parent.firstChild : parent.lastChild ];
+
+ // non-xml :nth-child(...) stores cache data on `parent`
+ if ( forward && useCache ) {
+
+ // Seek `elem` from a previously-cached index
+
+ // ...in a gzip-friendly way
+ node = parent;
+ outerCache = node[ expando ] || (node[ expando ] = {});
+
+ // Support: IE <9 only
+ // Defend against cloned attroperties (jQuery gh-1709)
+ uniqueCache = outerCache[ node.uniqueID ] ||
+ (outerCache[ node.uniqueID ] = {});
+
+ cache = uniqueCache[ type ] || [];
+ nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
+ diff = nodeIndex && cache[ 2 ];
+ node = nodeIndex && parent.childNodes[ nodeIndex ];
+
+ while ( (node = ++nodeIndex && node && node[ dir ] ||
+
+ // Fallback to seeking `elem` from the start
+ (diff = nodeIndex = 0) || start.pop()) ) {
+
+ // When found, cache indexes on `parent` and break
+ if ( node.nodeType === 1 && ++diff && node === elem ) {
+ uniqueCache[ type ] = [ dirruns, nodeIndex, diff ];
+ break;
+ }
+ }
+
+ } else {
+ // Use previously-cached element index if available
+ if ( useCache ) {
+ // ...in a gzip-friendly way
+ node = elem;
+ outerCache = node[ expando ] || (node[ expando ] = {});
+
+ // Support: IE <9 only
+ // Defend against cloned attroperties (jQuery gh-1709)
+ uniqueCache = outerCache[ node.uniqueID ] ||
+ (outerCache[ node.uniqueID ] = {});
+
+ cache = uniqueCache[ type ] || [];
+ nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
+ diff = nodeIndex;
+ }
+
+ // xml :nth-child(...)
+ // or :nth-last-child(...) or :nth(-last)?-of-type(...)
+ if ( diff === false ) {
+ // Use the same loop as above to seek `elem` from the start
+ while ( (node = ++nodeIndex && node && node[ dir ] ||
+ (diff = nodeIndex = 0) || start.pop()) ) {
+
+ if ( ( ofType ?
+ node.nodeName.toLowerCase() === name :
+ node.nodeType === 1 ) &&
+ ++diff ) {
+
+ // Cache the index of each encountered element
+ if ( useCache ) {
+ outerCache = node[ expando ] || (node[ expando ] = {});
+
+ // Support: IE <9 only
+ // Defend against cloned attroperties (jQuery gh-1709)
+ uniqueCache = outerCache[ node.uniqueID ] ||
+ (outerCache[ node.uniqueID ] = {});
+
+ uniqueCache[ type ] = [ dirruns, diff ];
+ }
+
+ if ( node === elem ) {
+ break;
+ }
+ }
+ }
+ }
+ }
+
+ // Incorporate the offset, then check against cycle size
+ diff -= last;
+ return diff === first || ( diff % first === 0 && diff / first >= 0 );
+ }
+ };
+ },
+
+ "PSEUDO": function( pseudo, argument ) {
+ // pseudo-class names are case-insensitive
+ // http://www.w3.org/TR/selectors/#pseudo-classes
+ // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
+ // Remember that setFilters inherits from pseudos
+ var args,
+ fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] ||
+ Sizzle.error( "unsupported pseudo: " + pseudo );
+
+ // The user may use createPseudo to indicate that
+ // arguments are needed to create the filter function
+ // just as Sizzle does
+ if ( fn[ expando ] ) {
+ return fn( argument );
+ }
+
+ // But maintain support for old signatures
+ if ( fn.length > 1 ) {
+ args = [ pseudo, pseudo, "", argument ];
+ return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?
+ markFunction(function( seed, matches ) {
+ var idx,
+ matched = fn( seed, argument ),
+ i = matched.length;
+ while ( i-- ) {
+ idx = indexOf( seed, matched[i] );
+ seed[ idx ] = !( matches[ idx ] = matched[i] );
+ }
+ }) :
+ function( elem ) {
+ return fn( elem, 0, args );
+ };
+ }
+
+ return fn;
+ }
+ },
+
+ pseudos: {
+ // Potentially complex pseudos
+ "not": markFunction(function( selector ) {
+ // Trim the selector passed to compile
+ // to avoid treating leading and trailing
+ // spaces as combinators
+ var input = [],
+ results = [],
+ matcher = compile( selector.replace( rtrim, "$1" ) );
+
+ return matcher[ expando ] ?
+ markFunction(function( seed, matches, context, xml ) {
+ var elem,
+ unmatched = matcher( seed, null, xml, [] ),
+ i = seed.length;
+
+ // Match elements unmatched by `matcher`
+ while ( i-- ) {
+ if ( (elem = unmatched[i]) ) {
+ seed[i] = !(matches[i] = elem);
+ }
+ }
+ }) :
+ function( elem, context, xml ) {
+ input[0] = elem;
+ matcher( input, null, xml, results );
+ // Don't keep the element (issue #299)
+ input[0] = null;
+ return !results.pop();
+ };
+ }),
+
+ "has": markFunction(function( selector ) {
+ return function( elem ) {
+ return Sizzle( selector, elem ).length > 0;
+ };
+ }),
+
+ "contains": markFunction(function( text ) {
+ text = text.replace( runescape, funescape );
+ return function( elem ) {
+ return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1;
+ };
+ }),
+
+ // "Whether an element is represented by a :lang() selector
+ // is based solely on the element's language value
+ // being equal to the identifier C,
+ // or beginning with the identifier C immediately followed by "-".
+ // The matching of C against the element's language value is performed case-insensitively.
+ // The identifier C does not have to be a valid language name."
+ // http://www.w3.org/TR/selectors/#lang-pseudo
+ "lang": markFunction( function( lang ) {
+ // lang value must be a valid identifier
+ if ( !ridentifier.test(lang || "") ) {
+ Sizzle.error( "unsupported lang: " + lang );
+ }
+ lang = lang.replace( runescape, funescape ).toLowerCase();
+ return function( elem ) {
+ var elemLang;
+ do {
+ if ( (elemLang = documentIsHTML ?
+ elem.lang :
+ elem.getAttribute("xml:lang") || elem.getAttribute("lang")) ) {
+
+ elemLang = elemLang.toLowerCase();
+ return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0;
+ }
+ } while ( (elem = elem.parentNode) && elem.nodeType === 1 );
+ return false;
+ };
+ }),
+
+ // Miscellaneous
+ "target": function( elem ) {
+ var hash = window.location && window.location.hash;
+ return hash && hash.slice( 1 ) === elem.id;
+ },
+
+ "root": function( elem ) {
+ return elem === docElem;
+ },
+
+ "focus": function( elem ) {
+ return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);
+ },
+
+ // Boolean properties
+ "enabled": createDisabledPseudo( false ),
+ "disabled": createDisabledPseudo( true ),
+
+ "checked": function( elem ) {
+ // In CSS3, :checked should return both checked and selected elements
+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+ var nodeName = elem.nodeName.toLowerCase();
+ return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected);
+ },
+
+ "selected": function( elem ) {
+ // Accessing this property makes selected-by-default
+ // options in Safari work properly
+ if ( elem.parentNode ) {
+ elem.parentNode.selectedIndex;
+ }
+
+ return elem.selected === true;
+ },
+
+ // Contents
+ "empty": function( elem ) {
+ // http://www.w3.org/TR/selectors/#empty-pseudo
+ // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),
+ // but not by others (comment: 8; processing instruction: 7; etc.)
+ // nodeType < 6 works because attributes (2) do not appear as children
+ for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+ if ( elem.nodeType < 6 ) {
+ return false;
+ }
+ }
+ return true;
+ },
+
+ "parent": function( elem ) {
+ return !Expr.pseudos["empty"]( elem );
+ },
+
+ // Element/input types
+ "header": function( elem ) {
+ return rheader.test( elem.nodeName );
+ },
+
+ "input": function( elem ) {
+ return rinputs.test( elem.nodeName );
+ },
+
+ "button": function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && elem.type === "button" || name === "button";
+ },
+
+ "text": function( elem ) {
+ var attr;
+ return elem.nodeName.toLowerCase() === "input" &&
+ elem.type === "text" &&
+
+ // Support: IE<8
+ // New HTML5 attribute values (e.g., "search") appear with elem.type === "text"
+ ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text" );
+ },
+
+ // Position-in-collection
+ "first": createPositionalPseudo(function() {
+ return [ 0 ];
+ }),
+
+ "last": createPositionalPseudo(function( matchIndexes, length ) {
+ return [ length - 1 ];
+ }),
+
+ "eq": createPositionalPseudo(function( matchIndexes, length, argument ) {
+ return [ argument < 0 ? argument + length : argument ];
+ }),
+
+ "even": createPositionalPseudo(function( matchIndexes, length ) {
+ var i = 0;
+ for ( ; i < length; i += 2 ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ }),
+
+ "odd": createPositionalPseudo(function( matchIndexes, length ) {
+ var i = 1;
+ for ( ; i < length; i += 2 ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ }),
+
+ "lt": createPositionalPseudo(function( matchIndexes, length, argument ) {
+ var i = argument < 0 ? argument + length : argument;
+ for ( ; --i >= 0; ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ }),
+
+ "gt": createPositionalPseudo(function( matchIndexes, length, argument ) {
+ var i = argument < 0 ? argument + length : argument;
+ for ( ; ++i < length; ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ })
+ }
+};
+
+Expr.pseudos["nth"] = Expr.pseudos["eq"];
+
+// Add button/input type pseudos
+for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) {
+ Expr.pseudos[ i ] = createInputPseudo( i );
+}
+for ( i in { submit: true, reset: true } ) {
+ Expr.pseudos[ i ] = createButtonPseudo( i );
+}
+
+// Easy API for creating new setFilters
+function setFilters() {}
+setFilters.prototype = Expr.filters = Expr.pseudos;
+Expr.setFilters = new setFilters();
+
+tokenize = Sizzle.tokenize = function( selector, parseOnly ) {
+ var matched, match, tokens, type,
+ soFar, groups, preFilters,
+ cached = tokenCache[ selector + " " ];
+
+ if ( cached ) {
+ return parseOnly ? 0 : cached.slice( 0 );
+ }
+
+ soFar = selector;
+ groups = [];
+ preFilters = Expr.preFilter;
+
+ while ( soFar ) {
+
+ // Comma and first run
+ if ( !matched || (match = rcomma.exec( soFar )) ) {
+ if ( match ) {
+ // Don't consume trailing commas as valid
+ soFar = soFar.slice( match[0].length ) || soFar;
+ }
+ groups.push( (tokens = []) );
+ }
+
+ matched = false;
+
+ // Combinators
+ if ( (match = rcombinators.exec( soFar )) ) {
+ matched = match.shift();
+ tokens.push({
+ value: matched,
+ // Cast descendant combinators to space
+ type: match[0].replace( rtrim, " " )
+ });
+ soFar = soFar.slice( matched.length );
+ }
+
+ // Filters
+ for ( type in Expr.filter ) {
+ if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] ||
+ (match = preFilters[ type ]( match ))) ) {
+ matched = match.shift();
+ tokens.push({
+ value: matched,
+ type: type,
+ matches: match
+ });
+ soFar = soFar.slice( matched.length );
+ }
+ }
+
+ if ( !matched ) {
+ break;
+ }
+ }
+
+ // Return the length of the invalid excess
+ // if we're just parsing
+ // Otherwise, throw an error or return tokens
+ return parseOnly ?
+ soFar.length :
+ soFar ?
+ Sizzle.error( selector ) :
+ // Cache the tokens
+ tokenCache( selector, groups ).slice( 0 );
+};
+
+function toSelector( tokens ) {
+ var i = 0,
+ len = tokens.length,
+ selector = "";
+ for ( ; i < len; i++ ) {
+ selector += tokens[i].value;
+ }
+ return selector;
+}
+
+function addCombinator( matcher, combinator, base ) {
+ var dir = combinator.dir,
+ skip = combinator.next,
+ key = skip || dir,
+ checkNonElements = base && key === "parentNode",
+ doneName = done++;
+
+ return combinator.first ?
+ // Check against closest ancestor/preceding element
+ function( elem, context, xml ) {
+ while ( (elem = elem[ dir ]) ) {
+ if ( elem.nodeType === 1 || checkNonElements ) {
+ return matcher( elem, context, xml );
+ }
+ }
+ return false;
+ } :
+
+ // Check against all ancestor/preceding elements
+ function( elem, context, xml ) {
+ var oldCache, uniqueCache, outerCache,
+ newCache = [ dirruns, doneName ];
+
+ // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching
+ if ( xml ) {
+ while ( (elem = elem[ dir ]) ) {
+ if ( elem.nodeType === 1 || checkNonElements ) {
+ if ( matcher( elem, context, xml ) ) {
+ return true;
+ }
+ }
+ }
+ } else {
+ while ( (elem = elem[ dir ]) ) {
+ if ( elem.nodeType === 1 || checkNonElements ) {
+ outerCache = elem[ expando ] || (elem[ expando ] = {});
+
+ // Support: IE <9 only
+ // Defend against cloned attroperties (jQuery gh-1709)
+ uniqueCache = outerCache[ elem.uniqueID ] || (outerCache[ elem.uniqueID ] = {});
+
+ if ( skip && skip === elem.nodeName.toLowerCase() ) {
+ elem = elem[ dir ] || elem;
+ } else if ( (oldCache = uniqueCache[ key ]) &&
+ oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) {
+
+ // Assign to newCache so results back-propagate to previous elements
+ return (newCache[ 2 ] = oldCache[ 2 ]);
+ } else {
+ // Reuse newcache so results back-propagate to previous elements
+ uniqueCache[ key ] = newCache;
+
+ // A match means we're done; a fail means we have to keep checking
+ if ( (newCache[ 2 ] = matcher( elem, context, xml )) ) {
+ return true;
+ }
+ }
+ }
+ }
+ }
+ return false;
+ };
+}
+
+function elementMatcher( matchers ) {
+ return matchers.length > 1 ?
+ function( elem, context, xml ) {
+ var i = matchers.length;
+ while ( i-- ) {
+ if ( !matchers[i]( elem, context, xml ) ) {
+ return false;
+ }
+ }
+ return true;
+ } :
+ matchers[0];
+}
+
+function multipleContexts( selector, contexts, results ) {
+ var i = 0,
+ len = contexts.length;
+ for ( ; i < len; i++ ) {
+ Sizzle( selector, contexts[i], results );
+ }
+ return results;
+}
+
+function condense( unmatched, map, filter, context, xml ) {
+ var elem,
+ newUnmatched = [],
+ i = 0,
+ len = unmatched.length,
+ mapped = map != null;
+
+ for ( ; i < len; i++ ) {
+ if ( (elem = unmatched[i]) ) {
+ if ( !filter || filter( elem, context, xml ) ) {
+ newUnmatched.push( elem );
+ if ( mapped ) {
+ map.push( i );
+ }
+ }
+ }
+ }
+
+ return newUnmatched;
+}
+
+function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {
+ if ( postFilter && !postFilter[ expando ] ) {
+ postFilter = setMatcher( postFilter );
+ }
+ if ( postFinder && !postFinder[ expando ] ) {
+ postFinder = setMatcher( postFinder, postSelector );
+ }
+ return markFunction(function( seed, results, context, xml ) {
+ var temp, i, elem,
+ preMap = [],
+ postMap = [],
+ preexisting = results.length,
+
+ // Get initial elements from seed or context
+ elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ),
+
+ // Prefilter to get matcher input, preserving a map for seed-results synchronization
+ matcherIn = preFilter && ( seed || !selector ) ?
+ condense( elems, preMap, preFilter, context, xml ) :
+ elems,
+
+ matcherOut = matcher ?
+ // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
+ postFinder || ( seed ? preFilter : preexisting || postFilter ) ?
+
+ // ...intermediate processing is necessary
+ [] :
+
+ // ...otherwise use results directly
+ results :
+ matcherIn;
+
+ // Find primary matches
+ if ( matcher ) {
+ matcher( matcherIn, matcherOut, context, xml );
+ }
+
+ // Apply postFilter
+ if ( postFilter ) {
+ temp = condense( matcherOut, postMap );
+ postFilter( temp, [], context, xml );
+
+ // Un-match failing elements by moving them back to matcherIn
+ i = temp.length;
+ while ( i-- ) {
+ if ( (elem = temp[i]) ) {
+ matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem);
+ }
+ }
+ }
+
+ if ( seed ) {
+ if ( postFinder || preFilter ) {
+ if ( postFinder ) {
+ // Get the final matcherOut by condensing this intermediate into postFinder contexts
+ temp = [];
+ i = matcherOut.length;
+ while ( i-- ) {
+ if ( (elem = matcherOut[i]) ) {
+ // Restore matcherIn since elem is not yet a final match
+ temp.push( (matcherIn[i] = elem) );
+ }
+ }
+ postFinder( null, (matcherOut = []), temp, xml );
+ }
+
+ // Move matched elements from seed to results to keep them synchronized
+ i = matcherOut.length;
+ while ( i-- ) {
+ if ( (elem = matcherOut[i]) &&
+ (temp = postFinder ? indexOf( seed, elem ) : preMap[i]) > -1 ) {
+
+ seed[temp] = !(results[temp] = elem);
+ }
+ }
+ }
+
+ // Add elements to results, through postFinder if defined
+ } else {
+ matcherOut = condense(
+ matcherOut === results ?
+ matcherOut.splice( preexisting, matcherOut.length ) :
+ matcherOut
+ );
+ if ( postFinder ) {
+ postFinder( null, results, matcherOut, xml );
+ } else {
+ push.apply( results, matcherOut );
+ }
+ }
+ });
+}
+
+function matcherFromTokens( tokens ) {
+ var checkContext, matcher, j,
+ len = tokens.length,
+ leadingRelative = Expr.relative[ tokens[0].type ],
+ implicitRelative = leadingRelative || Expr.relative[" "],
+ i = leadingRelative ? 1 : 0,
+
+ // The foundational matcher ensures that elements are reachable from top-level context(s)
+ matchContext = addCombinator( function( elem ) {
+ return elem === checkContext;
+ }, implicitRelative, true ),
+ matchAnyContext = addCombinator( function( elem ) {
+ return indexOf( checkContext, elem ) > -1;
+ }, implicitRelative, true ),
+ matchers = [ function( elem, context, xml ) {
+ var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || (
+ (checkContext = context).nodeType ?
+ matchContext( elem, context, xml ) :
+ matchAnyContext( elem, context, xml ) );
+ // Avoid hanging onto element (issue #299)
+ checkContext = null;
+ return ret;
+ } ];
+
+ for ( ; i < len; i++ ) {
+ if ( (matcher = Expr.relative[ tokens[i].type ]) ) {
+ matchers = [ addCombinator(elementMatcher( matchers ), matcher) ];
+ } else {
+ matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches );
+
+ // Return special upon seeing a positional matcher
+ if ( matcher[ expando ] ) {
+ // Find the next relative operator (if any) for proper handling
+ j = ++i;
+ for ( ; j < len; j++ ) {
+ if ( Expr.relative[ tokens[j].type ] ) {
+ break;
+ }
+ }
+ return setMatcher(
+ i > 1 && elementMatcher( matchers ),
+ i > 1 && toSelector(
+ // If the preceding token was a descendant combinator, insert an implicit any-element `*`
+ tokens.slice( 0, i - 1 ).concat({ value: tokens[ i - 2 ].type === " " ? "*" : "" })
+ ).replace( rtrim, "$1" ),
+ matcher,
+ i < j && matcherFromTokens( tokens.slice( i, j ) ),
+ j < len && matcherFromTokens( (tokens = tokens.slice( j )) ),
+ j < len && toSelector( tokens )
+ );
+ }
+ matchers.push( matcher );
+ }
+ }
+
+ return elementMatcher( matchers );
+}
+
+function matcherFromGroupMatchers( elementMatchers, setMatchers ) {
+ var bySet = setMatchers.length > 0,
+ byElement = elementMatchers.length > 0,
+ superMatcher = function( seed, context, xml, results, outermost ) {
+ var elem, j, matcher,
+ matchedCount = 0,
+ i = "0",
+ unmatched = seed && [],
+ setMatched = [],
+ contextBackup = outermostContext,
+ // We must always have either seed elements or outermost context
+ elems = seed || byElement && Expr.find["TAG"]( "*", outermost ),
+ // Use integer dirruns iff this is the outermost matcher
+ dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1),
+ len = elems.length;
+
+ if ( outermost ) {
+ outermostContext = context === document || context || outermost;
+ }
+
+ // Add elements passing elementMatchers directly to results
+ // Support: IE<9, Safari
+ // Tolerate NodeList properties (IE: "length"; Safari: <number>) matching elements by id
+ for ( ; i !== len && (elem = elems[i]) != null; i++ ) {
+ if ( byElement && elem ) {
+ j = 0;
+ if ( !context && elem.ownerDocument !== document ) {
+ setDocument( elem );
+ xml = !documentIsHTML;
+ }
+ while ( (matcher = elementMatchers[j++]) ) {
+ if ( matcher( elem, context || document, xml) ) {
+ results.push( elem );
+ break;
+ }
+ }
+ if ( outermost ) {
+ dirruns = dirrunsUnique;
+ }
+ }
+
+ // Track unmatched elements for set filters
+ if ( bySet ) {
+ // They will have gone through all possible matchers
+ if ( (elem = !matcher && elem) ) {
+ matchedCount--;
+ }
+
+ // Lengthen the array for every element, matched or not
+ if ( seed ) {
+ unmatched.push( elem );
+ }
+ }
+ }
+
+ // `i` is now the count of elements visited above, and adding it to `matchedCount`
+ // makes the latter nonnegative.
+ matchedCount += i;
+
+ // Apply set filters to unmatched elements
+ // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount`
+ // equals `i`), unless we didn't visit _any_ elements in the above loop because we have
+ // no element matchers and no seed.
+ // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that
+ // case, which will result in a "00" `matchedCount` that differs from `i` but is also
+ // numerically zero.
+ if ( bySet && i !== matchedCount ) {
+ j = 0;
+ while ( (matcher = setMatchers[j++]) ) {
+ matcher( unmatched, setMatched, context, xml );
+ }
+
+ if ( seed ) {
+ // Reintegrate element matches to eliminate the need for sorting
+ if ( matchedCount > 0 ) {
+ while ( i-- ) {
+ if ( !(unmatched[i] || setMatched[i]) ) {
+ setMatched[i] = pop.call( results );
+ }
+ }
+ }
+
+ // Discard index placeholder values to get only actual matches
+ setMatched = condense( setMatched );
+ }
+
+ // Add matches to results
+ push.apply( results, setMatched );
+
+ // Seedless set matches succeeding multiple successful matchers stipulate sorting
+ if ( outermost && !seed && setMatched.length > 0 &&
+ ( matchedCount + setMatchers.length ) > 1 ) {
+
+ Sizzle.uniqueSort( results );
+ }
+ }
+
+ // Override manipulation of globals by nested matchers
+ if ( outermost ) {
+ dirruns = dirrunsUnique;
+ outermostContext = contextBackup;
+ }
+
+ return unmatched;
+ };
+
+ return bySet ?
+ markFunction( superMatcher ) :
+ superMatcher;
+}
+
+compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) {
+ var i,
+ setMatchers = [],
+ elementMatchers = [],
+ cached = compilerCache[ selector + " " ];
+
+ if ( !cached ) {
+ // Generate a function of recursive functions that can be used to check each element
+ if ( !match ) {
+ match = tokenize( selector );
+ }
+ i = match.length;
+ while ( i-- ) {
+ cached = matcherFromTokens( match[i] );
+ if ( cached[ expando ] ) {
+ setMatchers.push( cached );
+ } else {
+ elementMatchers.push( cached );
+ }
+ }
+
+ // Cache the compiled function
+ cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) );
+
+ // Save selector and tokenization
+ cached.selector = selector;
+ }
+ return cached;
+};
+
+/**
+ * A low-level selection function that works with Sizzle's compiled
+ * selector functions
+ * @param {String|Function} selector A selector or a pre-compiled
+ * selector function built with Sizzle.compile
+ * @param {Element} context
+ * @param {Array} [results]
+ * @param {Array} [seed] A set of elements to match against
+ */
+select = Sizzle.select = function( selector, context, results, seed ) {
+ var i, tokens, token, type, find,
+ compiled = typeof selector === "function" && selector,
+ match = !seed && tokenize( (selector = compiled.selector || selector) );
+
+ results = results || [];
+
+ // Try to minimize operations if there is only one selector in the list and no seed
+ // (the latter of which guarantees us context)
+ if ( match.length === 1 ) {
+
+ // Reduce context if the leading compound selector is an ID
+ tokens = match[0] = match[0].slice( 0 );
+ if ( tokens.length > 2 && (token = tokens[0]).type === "ID" &&
+ context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[1].type ] ) {
+
+ context = ( Expr.find["ID"]( token.matches[0].replace(runescape, funescape), context ) || [] )[0];
+ if ( !context ) {
+ return results;
+
+ // Precompiled matchers will still verify ancestry, so step up a level
+ } else if ( compiled ) {
+ context = context.parentNode;
+ }
+
+ selector = selector.slice( tokens.shift().value.length );
+ }
+
+ // Fetch a seed set for right-to-left matching
+ i = matchExpr["needsContext"].test( selector ) ? 0 : tokens.length;
+ while ( i-- ) {
+ token = tokens[i];
+
+ // Abort if we hit a combinator
+ if ( Expr.relative[ (type = token.type) ] ) {
+ break;
+ }
+ if ( (find = Expr.find[ type ]) ) {
+ // Search, expanding context for leading sibling combinators
+ if ( (seed = find(
+ token.matches[0].replace( runescape, funescape ),
+ rsibling.test( tokens[0].type ) && testContext( context.parentNode ) || context
+ )) ) {
+
+ // If seed is empty or no tokens remain, we can return early
+ tokens.splice( i, 1 );
+ selector = seed.length && toSelector( tokens );
+ if ( !selector ) {
+ push.apply( results, seed );
+ return results;
+ }
+
+ break;
+ }
+ }
+ }
+ }
+
+ // Compile and execute a filtering function if one is not provided
+ // Provide `match` to avoid retokenization if we modified the selector above
+ ( compiled || compile( selector, match ) )(
+ seed,
+ context,
+ !documentIsHTML,
+ results,
+ !context || rsibling.test( selector ) && testContext( context.parentNode ) || context
+ );
+ return results;
+};
+
+// One-time assignments
+
+// Sort stability
+support.sortStable = expando.split("").sort( sortOrder ).join("") === expando;
+
+// Support: Chrome 14-35+
+// Always assume duplicates if they aren't passed to the comparison function
+support.detectDuplicates = !!hasDuplicate;
+
+// Initialize against the default document
+setDocument();
+
+// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27)
+// Detached nodes confoundingly follow *each other*
+support.sortDetached = assert(function( el ) {
+ // Should return 1, but returns 4 (following)
+ return el.compareDocumentPosition( document.createElement("fieldset") ) & 1;
+});
+
+// Support: IE<8
+// Prevent attribute/property "interpolation"
+// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
+if ( !assert(function( el ) {
+ el.innerHTML = "<a href='#'></a>";
+ return el.firstChild.getAttribute("href") === "#" ;
+}) ) {
+ addHandle( "type|href|height|width", function( elem, name, isXML ) {
+ if ( !isXML ) {
+ return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 );
+ }
+ });
+}
+
+// Support: IE<9
+// Use defaultValue in place of getAttribute("value")
+if ( !support.attributes || !assert(function( el ) {
+ el.innerHTML = "<input/>";
+ el.firstChild.setAttribute( "value", "" );
+ return el.firstChild.getAttribute( "value" ) === "";
+}) ) {
+ addHandle( "value", function( elem, name, isXML ) {
+ if ( !isXML && elem.nodeName.toLowerCase() === "input" ) {
+ return elem.defaultValue;
+ }
+ });
+}
+
+// Support: IE<9
+// Use getAttributeNode to fetch booleans when getAttribute lies
+if ( !assert(function( el ) {
+ return el.getAttribute("disabled") == null;
+}) ) {
+ addHandle( booleans, function( elem, name, isXML ) {
+ var val;
+ if ( !isXML ) {
+ return elem[ name ] === true ? name.toLowerCase() :
+ (val = elem.getAttributeNode( name )) && val.specified ?
+ val.value :
+ null;
+ }
+ });
+}
+
+return Sizzle;
+
+})( window );
+
+
+
+jQuery.find = Sizzle;
+jQuery.expr = Sizzle.selectors;
+
+// Deprecated
+jQuery.expr[ ":" ] = jQuery.expr.pseudos;
+jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort;
+jQuery.text = Sizzle.getText;
+jQuery.isXMLDoc = Sizzle.isXML;
+jQuery.contains = Sizzle.contains;
+jQuery.escapeSelector = Sizzle.escape;
+
+
+
+
+var dir = function( elem, dir, until ) {
+ var matched = [],
+ truncate = until !== undefined;
+
+ while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) {
+ if ( elem.nodeType === 1 ) {
+ if ( truncate && jQuery( elem ).is( until ) ) {
+ break;
+ }
+ matched.push( elem );
+ }
+ }
+ return matched;
+};
+
+
+var siblings = function( n, elem ) {
+ var matched = [];
+
+ for ( ; n; n = n.nextSibling ) {
+ if ( n.nodeType === 1 && n !== elem ) {
+ matched.push( n );
+ }
+ }
+
+ return matched;
+};
+
+
+var rneedsContext = jQuery.expr.match.needsContext;
+
+
+
+function nodeName( elem, name ) {
+
+ return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
+
+};
+var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i );
+
+
+
+// Implement the identical functionality for filter and not
+function winnow( elements, qualifier, not ) {
+ if ( isFunction( qualifier ) ) {
+ return jQuery.grep( elements, function( elem, i ) {
+ return !!qualifier.call( elem, i, elem ) !== not;
+ } );
+ }
+
+ // Single element
+ if ( qualifier.nodeType ) {
+ return jQuery.grep( elements, function( elem ) {
+ return ( elem === qualifier ) !== not;
+ } );
+ }
+
+ // Arraylike of elements (jQuery, arguments, Array)
+ if ( typeof qualifier !== "string" ) {
+ return jQuery.grep( elements, function( elem ) {
+ return ( indexOf.call( qualifier, elem ) > -1 ) !== not;
+ } );
+ }
+
+ // Filtered directly for both simple and complex selectors
+ return jQuery.filter( qualifier, elements, not );
+}
+
+jQuery.filter = function( expr, elems, not ) {
+ var elem = elems[ 0 ];
+
+ if ( not ) {
+ expr = ":not(" + expr + ")";
+ }
+
+ if ( elems.length === 1 && elem.nodeType === 1 ) {
+ return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : [];
+ }
+
+ return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) {
+ return elem.nodeType === 1;
+ } ) );
+};
+
+jQuery.fn.extend( {
+ find: function( selector ) {
+ var i, ret,
+ len = this.length,
+ self = this;
+
+ if ( typeof selector !== "string" ) {
+ return this.pushStack( jQuery( selector ).filter( function() {
+ for ( i = 0; i < len; i++ ) {
+ if ( jQuery.contains( self[ i ], this ) ) {
+ return true;
+ }
+ }
+ } ) );
+ }
+
+ ret = this.pushStack( [] );
+
+ for ( i = 0; i < len; i++ ) {
+ jQuery.find( selector, self[ i ], ret );
+ }
+
+ return len > 1 ? jQuery.uniqueSort( ret ) : ret;
+ },
+ filter: function( selector ) {
+ return this.pushStack( winnow( this, selector || [], false ) );
+ },
+ not: function( selector ) {
+ return this.pushStack( winnow( this, selector || [], true ) );
+ },
+ is: function( selector ) {
+ return !!winnow(
+ this,
+
+ // If this is a positional/relative selector, check membership in the returned set
+ // so $("p:first").is("p:last") won't return true for a doc with two "p".
+ typeof selector === "string" && rneedsContext.test( selector ) ?
+ jQuery( selector ) :
+ selector || [],
+ false
+ ).length;
+ }
+} );
+
+
+// Initialize a jQuery object
+
+
+// A central reference to the root jQuery(document)
+var rootjQuery,
+
+ // A simple way to check for HTML strings
+ // Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
+ // Strict HTML recognition (#11290: must start with <)
+ // Shortcut simple #id case for speed
+ rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/,
+
+ init = jQuery.fn.init = function( selector, context, root ) {
+ var match, elem;
+
+ // HANDLE: $(""), $(null), $(undefined), $(false)
+ if ( !selector ) {
+ return this;
+ }
+
+ // Method init() accepts an alternate rootjQuery
+ // so migrate can support jQuery.sub (gh-2101)
+ root = root || rootjQuery;
+
+ // Handle HTML strings
+ if ( typeof selector === "string" ) {
+ if ( selector[ 0 ] === "<" &&
+ selector[ selector.length - 1 ] === ">" &&
+ selector.length >= 3 ) {
+
+ // Assume that strings that start and end with <> are HTML and skip the regex check
+ match = [ null, selector, null ];
+
+ } else {
+ match = rquickExpr.exec( selector );
+ }
+
+ // Match html or make sure no context is specified for #id
+ if ( match && ( match[ 1 ] || !context ) ) {
+
+ // HANDLE: $(html) -> $(array)
+ if ( match[ 1 ] ) {
+ context = context instanceof jQuery ? context[ 0 ] : context;
+
+ // Option to run scripts is true for back-compat
+ // Intentionally let the error be thrown if parseHTML is not present
+ jQuery.merge( this, jQuery.parseHTML(
+ match[ 1 ],
+ context && context.nodeType ? context.ownerDocument || context : document,
+ true
+ ) );
+
+ // HANDLE: $(html, props)
+ if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) {
+ for ( match in context ) {
+
+ // Properties of context are called as methods if possible
+ if ( isFunction( this[ match ] ) ) {
+ this[ match ]( context[ match ] );
+
+ // ...and otherwise set as attributes
+ } else {
+ this.attr( match, context[ match ] );
+ }
+ }
+ }
+
+ return this;
+
+ // HANDLE: $(#id)
+ } else {
+ elem = document.getElementById( match[ 2 ] );
+
+ if ( elem ) {
+
+ // Inject the element directly into the jQuery object
+ this[ 0 ] = elem;
+ this.length = 1;
+ }
+ return this;
+ }
+
+ // HANDLE: $(expr, $(...))
+ } else if ( !context || context.jquery ) {
+ return ( context || root ).find( selector );
+
+ // HANDLE: $(expr, context)
+ // (which is just equivalent to: $(context).find(expr)
+ } else {
+ return this.constructor( context ).find( selector );
+ }
+
+ // HANDLE: $(DOMElement)
+ } else if ( selector.nodeType ) {
+ this[ 0 ] = selector;
+ this.length = 1;
+ return this;
+
+ // HANDLE: $(function)
+ // Shortcut for document ready
+ } else if ( isFunction( selector ) ) {
+ return root.ready !== undefined ?
+ root.ready( selector ) :
+
+ // Execute immediately if ready is not present
+ selector( jQuery );
+ }
+
+ return jQuery.makeArray( selector, this );
+ };
+
+// Give the init function the jQuery prototype for later instantiation
+init.prototype = jQuery.fn;
+
+// Initialize central reference
+rootjQuery = jQuery( document );
+
+
+var rparentsprev = /^(?:parents|prev(?:Until|All))/,
+
+ // Methods guaranteed to produce a unique set when starting from a unique set
+ guaranteedUnique = {
+ children: true,
+ contents: true,
+ next: true,
+ prev: true
+ };
+
+jQuery.fn.extend( {
+ has: function( target ) {
+ var targets = jQuery( target, this ),
+ l = targets.length;
+
+ return this.filter( function() {
+ var i = 0;
+ for ( ; i < l; i++ ) {
+ if ( jQuery.contains( this, targets[ i ] ) ) {
+ return true;
+ }
+ }
+ } );
+ },
+
+ closest: function( selectors, context ) {
+ var cur,
+ i = 0,
+ l = this.length,
+ matched = [],
+ targets = typeof selectors !== "string" && jQuery( selectors );
+
+ // Positional selectors never match, since there's no _selection_ context
+ if ( !rneedsContext.test( selectors ) ) {
+ for ( ; i < l; i++ ) {
+ for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) {
+
+ // Always skip document fragments
+ if ( cur.nodeType < 11 && ( targets ?
+ targets.index( cur ) > -1 :
+
+ // Don't pass non-elements to Sizzle
+ cur.nodeType === 1 &&
+ jQuery.find.matchesSelector( cur, selectors ) ) ) {
+
+ matched.push( cur );
+ break;
+ }
+ }
+ }
+ }
+
+ return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched );
+ },
+
+ // Determine the position of an element within the set
+ index: function( elem ) {
+
+ // No argument, return index in parent
+ if ( !elem ) {
+ return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1;
+ }
+
+ // Index in selector
+ if ( typeof elem === "string" ) {
+ return indexOf.call( jQuery( elem ), this[ 0 ] );
+ }
+
+ // Locate the position of the desired element
+ return indexOf.call( this,
+
+ // If it receives a jQuery object, the first element is used
+ elem.jquery ? elem[ 0 ] : elem
+ );
+ },
+
+ add: function( selector, context ) {
+ return this.pushStack(
+ jQuery.uniqueSort(
+ jQuery.merge( this.get(), jQuery( selector, context ) )
+ )
+ );
+ },
+
+ addBack: function( selector ) {
+ return this.add( selector == null ?
+ this.prevObject : this.prevObject.filter( selector )
+ );
+ }
+} );
+
+function sibling( cur, dir ) {
+ while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {}
+ return cur;
+}
+
+jQuery.each( {
+ parent: function( elem ) {
+ var parent = elem.parentNode;
+ return parent && parent.nodeType !== 11 ? parent : null;
+ },
+ parents: function( elem ) {
+ return dir( elem, "parentNode" );
+ },
+ parentsUntil: function( elem, i, until ) {
+ return dir( elem, "parentNode", until );
+ },
+ next: function( elem ) {
+ return sibling( elem, "nextSibling" );
+ },
+ prev: function( elem ) {
+ return sibling( elem, "previousSibling" );
+ },
+ nextAll: function( elem ) {
+ return dir( elem, "nextSibling" );
+ },
+ prevAll: function( elem ) {
+ return dir( elem, "previousSibling" );
+ },
+ nextUntil: function( elem, i, until ) {
+ return dir( elem, "nextSibling", until );
+ },
+ prevUntil: function( elem, i, until ) {
+ return dir( elem, "previousSibling", until );
+ },
+ siblings: function( elem ) {
+ return siblings( ( elem.parentNode || {} ).firstChild, elem );
+ },
+ children: function( elem ) {
+ return siblings( elem.firstChild );
+ },
+ contents: function( elem ) {
+ if ( nodeName( elem, "iframe" ) ) {
+ return elem.contentDocument;
+ }
+
+ // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only
+ // Treat the template element as a regular one in browsers that
+ // don't support it.
+ if ( nodeName( elem, "template" ) ) {
+ elem = elem.content || elem;
+ }
+
+ return jQuery.merge( [], elem.childNodes );
+ }
+}, function( name, fn ) {
+ jQuery.fn[ name ] = function( until, selector ) {
+ var matched = jQuery.map( this, fn, until );
+
+ if ( name.slice( -5 ) !== "Until" ) {
+ selector = until;
+ }
+
+ if ( selector && typeof selector === "string" ) {
+ matched = jQuery.filter( selector, matched );
+ }
+
+ if ( this.length > 1 ) {
+
+ // Remove duplicates
+ if ( !guaranteedUnique[ name ] ) {
+ jQuery.uniqueSort( matched );
+ }
+
+ // Reverse order for parents* and prev-derivatives
+ if ( rparentsprev.test( name ) ) {
+ matched.reverse();
+ }
+ }
+
+ return this.pushStack( matched );
+ };
+} );
+var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g );
+
+
+
+// Convert String-formatted options into Object-formatted ones
+function createOptions( options ) {
+ var object = {};
+ jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) {
+ object[ flag ] = true;
+ } );
+ return object;
+}
+
+/*
+ * Create a callback list using the following parameters:
+ *
+ * options: an optional list of space-separated options that will change how
+ * the callback list behaves or a more traditional option object
+ *
+ * By default a callback list will act like an event callback list and can be
+ * "fired" multiple times.
+ *
+ * Possible options:
+ *
+ * once: will ensure the callback list can only be fired once (like a Deferred)
+ *
+ * memory: will keep track of previous values and will call any callback added
+ * after the list has been fired right away with the latest "memorized"
+ * values (like a Deferred)
+ *
+ * unique: will ensure a callback can only be added once (no duplicate in the list)
+ *
+ * stopOnFalse: interrupt callings when a callback returns false
+ *
+ */
+jQuery.Callbacks = function( options ) {
+
+ // Convert options from String-formatted to Object-formatted if needed
+ // (we check in cache first)
+ options = typeof options === "string" ?
+ createOptions( options ) :
+ jQuery.extend( {}, options );
+
+ var // Flag to know if list is currently firing
+ firing,
+
+ // Last fire value for non-forgettable lists
+ memory,
+
+ // Flag to know if list was already fired
+ fired,
+
+ // Flag to prevent firing
+ locked,
+
+ // Actual callback list
+ list = [],
+
+ // Queue of execution data for repeatable lists
+ queue = [],
+
+ // Index of currently firing callback (modified by add/remove as needed)
+ firingIndex = -1,
+
+ // Fire callbacks
+ fire = function() {
+
+ // Enforce single-firing
+ locked = locked || options.once;
+
+ // Execute callbacks for all pending executions,
+ // respecting firingIndex overrides and runtime changes
+ fired = firing = true;
+ for ( ; queue.length; firingIndex = -1 ) {
+ memory = queue.shift();
+ while ( ++firingIndex < list.length ) {
+
+ // Run callback and check for early termination
+ if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false &&
+ options.stopOnFalse ) {
+
+ // Jump to end and forget the data so .add doesn't re-fire
+ firingIndex = list.length;
+ memory = false;
+ }
+ }
+ }
+
+ // Forget the data if we're done with it
+ if ( !options.memory ) {
+ memory = false;
+ }
+
+ firing = false;
+
+ // Clean up if we're done firing for good
+ if ( locked ) {
+
+ // Keep an empty list if we have data for future add calls
+ if ( memory ) {
+ list = [];
+
+ // Otherwise, this object is spent
+ } else {
+ list = "";
+ }
+ }
+ },
+
+ // Actual Callbacks object
+ self = {
+
+ // Add a callback or a collection of callbacks to the list
+ add: function() {
+ if ( list ) {
+
+ // If we have memory from a past run, we should fire after adding
+ if ( memory && !firing ) {
+ firingIndex = list.length - 1;
+ queue.push( memory );
+ }
+
+ ( function add( args ) {
+ jQuery.each( args, function( _, arg ) {
+ if ( isFunction( arg ) ) {
+ if ( !options.unique || !self.has( arg ) ) {
+ list.push( arg );
+ }
+ } else if ( arg && arg.length && toType( arg ) !== "string" ) {
+
+ // Inspect recursively
+ add( arg );
+ }
+ } );
+ } )( arguments );
+
+ if ( memory && !firing ) {
+ fire();
+ }
+ }
+ return this;
+ },
+
+ // Remove a callback from the list
+ remove: function() {
+ jQuery.each( arguments, function( _, arg ) {
+ var index;
+ while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {
+ list.splice( index, 1 );
+
+ // Handle firing indexes
+ if ( index <= firingIndex ) {
+ firingIndex--;
+ }
+ }
+ } );
+ return this;
+ },
+
+ // Check if a given callback is in the list.
+ // If no argument is given, return whether or not list has callbacks attached.
+ has: function( fn ) {
+ return fn ?
+ jQuery.inArray( fn, list ) > -1 :
+ list.length > 0;
+ },
+
+ // Remove all callbacks from the list
+ empty: function() {
+ if ( list ) {
+ list = [];
+ }
+ return this;
+ },
+
+ // Disable .fire and .add
+ // Abort any current/pending executions
+ // Clear all callbacks and values
+ disable: function() {
+ locked = queue = [];
+ list = memory = "";
+ return this;
+ },
+ disabled: function() {
+ return !list;
+ },
+
+ // Disable .fire
+ // Also disable .add unless we have memory (since it would have no effect)
+ // Abort any pending executions
+ lock: function() {
+ locked = queue = [];
+ if ( !memory && !firing ) {
+ list = memory = "";
+ }
+ return this;
+ },
+ locked: function() {
+ return !!locked;
+ },
+
+ // Call all callbacks with the given context and arguments
+ fireWith: function( context, args ) {
+ if ( !locked ) {
+ args = args || [];
+ args = [ context, args.slice ? args.slice() : args ];
+ queue.push( args );
+ if ( !firing ) {
+ fire();
+ }
+ }
+ return this;
+ },
+
+ // Call all the callbacks with the given arguments
+ fire: function() {
+ self.fireWith( this, arguments );
+ return this;
+ },
+
+ // To know if the callbacks have already been called at least once
+ fired: function() {
+ return !!fired;
+ }
+ };
+
+ return self;
+};
+
+
+function Identity( v ) {
+ return v;
+}
+function Thrower( ex ) {
+ throw ex;
+}
+
+function adoptValue( value, resolve, reject, noValue ) {
+ var method;
+
+ try {
+
+ // Check for promise aspect first to privilege synchronous behavior
+ if ( value && isFunction( ( method = value.promise ) ) ) {
+ method.call( value ).done( resolve ).fail( reject );
+
+ // Other thenables
+ } else if ( value && isFunction( ( method = value.then ) ) ) {
+ method.call( value, resolve, reject );
+
+ // Other non-thenables
+ } else {
+
+ // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer:
+ // * false: [ value ].slice( 0 ) => resolve( value )
+ // * true: [ value ].slice( 1 ) => resolve()
+ resolve.apply( undefined, [ value ].slice( noValue ) );
+ }
+
+ // For Promises/A+, convert exceptions into rejections
+ // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in
+ // Deferred#then to conditionally suppress rejection.
+ } catch ( value ) {
+
+ // Support: Android 4.0 only
+ // Strict mode functions invoked without .call/.apply get global-object context
+ reject.apply( undefined, [ value ] );
+ }
+}
+
+jQuery.extend( {
+
+ Deferred: function( func ) {
+ var tuples = [
+
+ // action, add listener, callbacks,
+ // ... .then handlers, argument index, [final state]
+ [ "notify", "progress", jQuery.Callbacks( "memory" ),
+ jQuery.Callbacks( "memory" ), 2 ],
+ [ "resolve", "done", jQuery.Callbacks( "once memory" ),
+ jQuery.Callbacks( "once memory" ), 0, "resolved" ],
+ [ "reject", "fail", jQuery.Callbacks( "once memory" ),
+ jQuery.Callbacks( "once memory" ), 1, "rejected" ]
+ ],
+ state = "pending",
+ promise = {
+ state: function() {
+ return state;
+ },
+ always: function() {
+ deferred.done( arguments ).fail( arguments );
+ return this;
+ },
+ "catch": function( fn ) {
+ return promise.then( null, fn );
+ },
+
+ // Keep pipe for back-compat
+ pipe: function( /* fnDone, fnFail, fnProgress */ ) {
+ var fns = arguments;
+
+ return jQuery.Deferred( function( newDefer ) {
+ jQuery.each( tuples, function( i, tuple ) {
+
+ // Map tuples (progress, done, fail) to arguments (done, fail, progress)
+ var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ];
+
+ // deferred.progress(function() { bind to newDefer or newDefer.notify })
+ // deferred.done(function() { bind to newDefer or newDefer.resolve })
+ // deferred.fail(function() { bind to newDefer or newDefer.reject })
+ deferred[ tuple[ 1 ] ]( function() {
+ var returned = fn && fn.apply( this, arguments );
+ if ( returned && isFunction( returned.promise ) ) {
+ returned.promise()
+ .progress( newDefer.notify )
+ .done( newDefer.resolve )
+ .fail( newDefer.reject );
+ } else {
+ newDefer[ tuple[ 0 ] + "With" ](
+ this,
+ fn ? [ returned ] : arguments
+ );
+ }
+ } );
+ } );
+ fns = null;
+ } ).promise();
+ },
+ then: function( onFulfilled, onRejected, onProgress ) {
+ var maxDepth = 0;
+ function resolve( depth, deferred, handler, special ) {
+ return function() {
+ var that = this,
+ args = arguments,
+ mightThrow = function() {
+ var returned, then;
+
+ // Support: Promises/A+ section 2.3.3.3.3
+ // https://promisesaplus.com/#point-59
+ // Ignore double-resolution attempts
+ if ( depth < maxDepth ) {
+ return;
+ }
+
+ returned = handler.apply( that, args );
+
+ // Support: Promises/A+ section 2.3.1
+ // https://promisesaplus.com/#point-48
+ if ( returned === deferred.promise() ) {
+ throw new TypeError( "Thenable self-resolution" );
+ }
+
+ // Support: Promises/A+ sections 2.3.3.1, 3.5
+ // https://promisesaplus.com/#point-54
+ // https://promisesaplus.com/#point-75
+ // Retrieve `then` only once
+ then = returned &&
+
+ // Support: Promises/A+ section 2.3.4
+ // https://promisesaplus.com/#point-64
+ // Only check objects and functions for thenability
+ ( typeof returned === "object" ||
+ typeof returned === "function" ) &&
+ returned.then;
+
+ // Handle a returned thenable
+ if ( isFunction( then ) ) {
+
+ // Special processors (notify) just wait for resolution
+ if ( special ) {
+ then.call(
+ returned,
+ resolve( maxDepth, deferred, Identity, special ),
+ resolve( maxDepth, deferred, Thrower, special )
+ );
+
+ // Normal processors (resolve) also hook into progress
+ } else {
+
+ // ...and disregard older resolution values
+ maxDepth++;
+
+ then.call(
+ returned,
+ resolve( maxDepth, deferred, Identity, special ),
+ resolve( maxDepth, deferred, Thrower, special ),
+ resolve( maxDepth, deferred, Identity,
+ deferred.notifyWith )
+ );
+ }
+
+ // Handle all other returned values
+ } else {
+
+ // Only substitute handlers pass on context
+ // and multiple values (non-spec behavior)
+ if ( handler !== Identity ) {
+ that = undefined;
+ args = [ returned ];
+ }
+
+ // Process the value(s)
+ // Default process is resolve
+ ( special || deferred.resolveWith )( that, args );
+ }
+ },
+
+ // Only normal processors (resolve) catch and reject exceptions
+ process = special ?
+ mightThrow :
+ function() {
+ try {
+ mightThrow();
+ } catch ( e ) {
+
+ if ( jQuery.Deferred.exceptionHook ) {
+ jQuery.Deferred.exceptionHook( e,
+ process.stackTrace );
+ }
+
+ // Support: Promises/A+ section 2.3.3.3.4.1
+ // https://promisesaplus.com/#point-61
+ // Ignore post-resolution exceptions
+ if ( depth + 1 >= maxDepth ) {
+
+ // Only substitute handlers pass on context
+ // and multiple values (non-spec behavior)
+ if ( handler !== Thrower ) {
+ that = undefined;
+ args = [ e ];
+ }
+
+ deferred.rejectWith( that, args );
+ }
+ }
+ };
+
+ // Support: Promises/A+ section 2.3.3.3.1
+ // https://promisesaplus.com/#point-57
+ // Re-resolve promises immediately to dodge false rejection from
+ // subsequent errors
+ if ( depth ) {
+ process();
+ } else {
+
+ // Call an optional hook to record the stack, in case of exception
+ // since it's otherwise lost when execution goes async
+ if ( jQuery.Deferred.getStackHook ) {
+ process.stackTrace = jQuery.Deferred.getStackHook();
+ }
+ window.setTimeout( process );
+ }
+ };
+ }
+
+ return jQuery.Deferred( function( newDefer ) {
+
+ // progress_handlers.add( ... )
+ tuples[ 0 ][ 3 ].add(
+ resolve(
+ 0,
+ newDefer,
+ isFunction( onProgress ) ?
+ onProgress :
+ Identity,
+ newDefer.notifyWith
+ )
+ );
+
+ // fulfilled_handlers.add( ... )
+ tuples[ 1 ][ 3 ].add(
+ resolve(
+ 0,
+ newDefer,
+ isFunction( onFulfilled ) ?
+ onFulfilled :
+ Identity
+ )
+ );
+
+ // rejected_handlers.add( ... )
+ tuples[ 2 ][ 3 ].add(
+ resolve(
+ 0,
+ newDefer,
+ isFunction( onRejected ) ?
+ onRejected :
+ Thrower
+ )
+ );
+ } ).promise();
+ },
+
+ // Get a promise for this deferred
+ // If obj is provided, the promise aspect is added to the object
+ promise: function( obj ) {
+ return obj != null ? jQuery.extend( obj, promise ) : promise;
+ }
+ },
+ deferred = {};
+
+ // Add list-specific methods
+ jQuery.each( tuples, function( i, tuple ) {
+ var list = tuple[ 2 ],
+ stateString = tuple[ 5 ];
+
+ // promise.progress = list.add
+ // promise.done = list.add
+ // promise.fail = list.add
+ promise[ tuple[ 1 ] ] = list.add;
+
+ // Handle state
+ if ( stateString ) {
+ list.add(
+ function() {
+
+ // state = "resolved" (i.e., fulfilled)
+ // state = "rejected"
+ state = stateString;
+ },
+
+ // rejected_callbacks.disable
+ // fulfilled_callbacks.disable
+ tuples[ 3 - i ][ 2 ].disable,
+
+ // rejected_handlers.disable
+ // fulfilled_handlers.disable
+ tuples[ 3 - i ][ 3 ].disable,
+
+ // progress_callbacks.lock
+ tuples[ 0 ][ 2 ].lock,
+
+ // progress_handlers.lock
+ tuples[ 0 ][ 3 ].lock
+ );
+ }
+
+ // progress_handlers.fire
+ // fulfilled_handlers.fire
+ // rejected_handlers.fire
+ list.add( tuple[ 3 ].fire );
+
+ // deferred.notify = function() { deferred.notifyWith(...) }
+ // deferred.resolve = function() { deferred.resolveWith(...) }
+ // deferred.reject = function() { deferred.rejectWith(...) }
+ deferred[ tuple[ 0 ] ] = function() {
+ deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments );
+ return this;
+ };
+
+ // deferred.notifyWith = list.fireWith
+ // deferred.resolveWith = list.fireWith
+ // deferred.rejectWith = list.fireWith
+ deferred[ tuple[ 0 ] + "With" ] = list.fireWith;
+ } );
+
+ // Make the deferred a promise
+ promise.promise( deferred );
+
+ // Call given func if any
+ if ( func ) {
+ func.call( deferred, deferred );
+ }
+
+ // All done!
+ return deferred;
+ },
+
+ // Deferred helper
+ when: function( singleValue ) {
+ var
+
+ // count of uncompleted subordinates
+ remaining = arguments.length,
+
+ // count of unprocessed arguments
+ i = remaining,
+
+ // subordinate fulfillment data
+ resolveContexts = Array( i ),
+ resolveValues = slice.call( arguments ),
+
+ // the master Deferred
+ master = jQuery.Deferred(),
+
+ // subordinate callback factory
+ updateFunc = function( i ) {
+ return function( value ) {
+ resolveContexts[ i ] = this;
+ resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value;
+ if ( !( --remaining ) ) {
+ master.resolveWith( resolveContexts, resolveValues );
+ }
+ };
+ };
+
+ // Single- and empty arguments are adopted like Promise.resolve
+ if ( remaining <= 1 ) {
+ adoptValue( singleValue, master.done( updateFunc( i ) ).resolve, master.reject,
+ !remaining );
+
+ // Use .then() to unwrap secondary thenables (cf. gh-3000)
+ if ( master.state() === "pending" ||
+ isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) {
+
+ return master.then();
+ }
+ }
+
+ // Multiple arguments are aggregated like Promise.all array elements
+ while ( i-- ) {
+ adoptValue( resolveValues[ i ], updateFunc( i ), master.reject );
+ }
+
+ return master.promise();
+ }
+} );
+
+
+// These usually indicate a programmer mistake during development,
+// warn about them ASAP rather than swallowing them by default.
+var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;
+
+jQuery.Deferred.exceptionHook = function( error, stack ) {
+
+ // Support: IE 8 - 9 only
+ // Console exists when dev tools are open, which can happen at any time
+ if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) {
+ window.console.warn( "jQuery.Deferred exception: " + error.message, error.stack, stack );
+ }
+};
+
+
+
+
+jQuery.readyException = function( error ) {
+ window.setTimeout( function() {
+ throw error;
+ } );
+};
+
+
+
+
+// The deferred used on DOM ready
+var readyList = jQuery.Deferred();
+
+jQuery.fn.ready = function( fn ) {
+
+ readyList
+ .then( fn )
+
+ // Wrap jQuery.readyException in a function so that the lookup
+ // happens at the time of error handling instead of callback
+ // registration.
+ .catch( function( error ) {
+ jQuery.readyException( error );
+ } );
+
+ return this;
+};
+
+jQuery.extend( {
+
+ // Is the DOM ready to be used? Set to true once it occurs.
+ isReady: false,
+
+ // A counter to track how many items to wait for before
+ // the ready event fires. See #6781
+ readyWait: 1,
+
+ // Handle when the DOM is ready
+ ready: function( wait ) {
+
+ // Abort if there are pending holds or we're already ready
+ if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {
+ return;
+ }
+
+ // Remember that the DOM is ready
+ jQuery.isReady = true;
+
+ // If a normal DOM Ready event fired, decrement, and wait if need be
+ if ( wait !== true && --jQuery.readyWait > 0 ) {
+ return;
+ }
+
+ // If there are functions bound, to execute
+ readyList.resolveWith( document, [ jQuery ] );
+ }
+} );
+
+jQuery.ready.then = readyList.then;
+
+// The ready event handler and self cleanup method
+function completed() {
+ document.removeEventListener( "DOMContentLoaded", completed );
+ window.removeEventListener( "load", completed );
+ jQuery.ready();
+}
+
+// Catch cases where $(document).ready() is called
+// after the browser event has already occurred.
+// Support: IE <=9 - 10 only
+// Older IE sometimes signals "interactive" too soon
+if ( document.readyState === "complete" ||
+ ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) {
+
+ // Handle it asynchronously to allow scripts the opportunity to delay ready
+ window.setTimeout( jQuery.ready );
+
+} else {
+
+ // Use the handy event callback
+ document.addEventListener( "DOMContentLoaded", completed );
+
+ // A fallback to window.onload, that will always work
+ window.addEventListener( "load", completed );
+}
+
+
+
+
+// Multifunctional method to get and set values of a collection
+// The value/s can optionally be executed if it's a function
+var access = function( elems, fn, key, value, chainable, emptyGet, raw ) {
+ var i = 0,
+ len = elems.length,
+ bulk = key == null;
+
+ // Sets many values
+ if ( toType( key ) === "object" ) {
+ chainable = true;
+ for ( i in key ) {
+ access( elems, fn, i, key[ i ], true, emptyGet, raw );
+ }
+
+ // Sets one value
+ } else if ( value !== undefined ) {
+ chainable = true;
+
+ if ( !isFunction( value ) ) {
+ raw = true;
+ }
+
+ if ( bulk ) {
+
+ // Bulk operations run against the entire set
+ if ( raw ) {
+ fn.call( elems, value );
+ fn = null;
+
+ // ...except when executing function values
+ } else {
+ bulk = fn;
+ fn = function( elem, key, value ) {
+ return bulk.call( jQuery( elem ), value );
+ };
+ }
+ }
+
+ if ( fn ) {
+ for ( ; i < len; i++ ) {
+ fn(
+ elems[ i ], key, raw ?
+ value :
+ value.call( elems[ i ], i, fn( elems[ i ], key ) )
+ );
+ }
+ }
+ }
+
+ if ( chainable ) {
+ return elems;
+ }
+
+ // Gets
+ if ( bulk ) {
+ return fn.call( elems );
+ }
+
+ return len ? fn( elems[ 0 ], key ) : emptyGet;
+};
+
+
+// Matches dashed string for camelizing
+var rmsPrefix = /^-ms-/,
+ rdashAlpha = /-([a-z])/g;
+
+// Used by camelCase as callback to replace()
+function fcamelCase( all, letter ) {
+ return letter.toUpperCase();
+}
+
+// Convert dashed to camelCase; used by the css and data modules
+// Support: IE <=9 - 11, Edge 12 - 15
+// Microsoft forgot to hump their vendor prefix (#9572)
+function camelCase( string ) {
+ return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase );
+}
+var acceptData = function( owner ) {
+
+ // Accepts only:
+ // - Node
+ // - Node.ELEMENT_NODE
+ // - Node.DOCUMENT_NODE
+ // - Object
+ // - Any
+ return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType );
+};
+
+
+
+
+function Data() {
+ this.expando = jQuery.expando + Data.uid++;
+}
+
+Data.uid = 1;
+
+Data.prototype = {
+
+ cache: function( owner ) {
+
+ // Check if the owner object already has a cache
+ var value = owner[ this.expando ];
+
+ // If not, create one
+ if ( !value ) {
+ value = {};
+
+ // We can accept data for non-element nodes in modern browsers,
+ // but we should not, see #8335.
+ // Always return an empty object.
+ if ( acceptData( owner ) ) {
+
+ // If it is a node unlikely to be stringify-ed or looped over
+ // use plain assignment
+ if ( owner.nodeType ) {
+ owner[ this.expando ] = value;
+
+ // Otherwise secure it in a non-enumerable property
+ // configurable must be true to allow the property to be
+ // deleted when data is removed
+ } else {
+ Object.defineProperty( owner, this.expando, {
+ value: value,
+ configurable: true
+ } );
+ }
+ }
+ }
+
+ return value;
+ },
+ set: function( owner, data, value ) {
+ var prop,
+ cache = this.cache( owner );
+
+ // Handle: [ owner, key, value ] args
+ // Always use camelCase key (gh-2257)
+ if ( typeof data === "string" ) {
+ cache[ camelCase( data ) ] = value;
+
+ // Handle: [ owner, { properties } ] args
+ } else {
+
+ // Copy the properties one-by-one to the cache object
+ for ( prop in data ) {
+ cache[ camelCase( prop ) ] = data[ prop ];
+ }
+ }
+ return cache;
+ },
+ get: function( owner, key ) {
+ return key === undefined ?
+ this.cache( owner ) :
+
+ // Always use camelCase key (gh-2257)
+ owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ];
+ },
+ access: function( owner, key, value ) {
+
+ // In cases where either:
+ //
+ // 1. No key was specified
+ // 2. A string key was specified, but no value provided
+ //
+ // Take the "read" path and allow the get method to determine
+ // which value to return, respectively either:
+ //
+ // 1. The entire cache object
+ // 2. The data stored at the key
+ //
+ if ( key === undefined ||
+ ( ( key && typeof key === "string" ) && value === undefined ) ) {
+
+ return this.get( owner, key );
+ }
+
+ // When the key is not a string, or both a key and value
+ // are specified, set or extend (existing objects) with either:
+ //
+ // 1. An object of properties
+ // 2. A key and value
+ //
+ this.set( owner, key, value );
+
+ // Since the "set" path can have two possible entry points
+ // return the expected data based on which path was taken[*]
+ return value !== undefined ? value : key;
+ },
+ remove: function( owner, key ) {
+ var i,
+ cache = owner[ this.expando ];
+
+ if ( cache === undefined ) {
+ return;
+ }
+
+ if ( key !== undefined ) {
+
+ // Support array or space separated string of keys
+ if ( Array.isArray( key ) ) {
+
+ // If key is an array of keys...
+ // We always set camelCase keys, so remove that.
+ key = key.map( camelCase );
+ } else {
+ key = camelCase( key );
+
+ // If a key with the spaces exists, use it.
+ // Otherwise, create an array by matching non-whitespace
+ key = key in cache ?
+ [ key ] :
+ ( key.match( rnothtmlwhite ) || [] );
+ }
+
+ i = key.length;
+
+ while ( i-- ) {
+ delete cache[ key[ i ] ];
+ }
+ }
+
+ // Remove the expando if there's no more data
+ if ( key === undefined || jQuery.isEmptyObject( cache ) ) {
+
+ // Support: Chrome <=35 - 45
+ // Webkit & Blink performance suffers when deleting properties
+ // from DOM nodes, so set to undefined instead
+ // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted)
+ if ( owner.nodeType ) {
+ owner[ this.expando ] = undefined;
+ } else {
+ delete owner[ this.expando ];
+ }
+ }
+ },
+ hasData: function( owner ) {
+ var cache = owner[ this.expando ];
+ return cache !== undefined && !jQuery.isEmptyObject( cache );
+ }
+};
+var dataPriv = new Data();
+
+var dataUser = new Data();
+
+
+
+// Implementation Summary
+//
+// 1. Enforce API surface and semantic compatibility with 1.9.x branch
+// 2. Improve the module's maintainability by reducing the storage
+// paths to a single mechanism.
+// 3. Use the same single mechanism to support "private" and "user" data.
+// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData)
+// 5. Avoid exposing implementation details on user objects (eg. expando properties)
+// 6. Provide a clear path for implementation upgrade to WeakMap in 2014
+
+var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,
+ rmultiDash = /[A-Z]/g;
+
+function getData( data ) {
+ if ( data === "true" ) {
+ return true;
+ }
+
+ if ( data === "false" ) {
+ return false;
+ }
+
+ if ( data === "null" ) {
+ return null;
+ }
+
+ // Only convert to a number if it doesn't change the string
+ if ( data === +data + "" ) {
+ return +data;
+ }
+
+ if ( rbrace.test( data ) ) {
+ return JSON.parse( data );
+ }
+
+ return data;
+}
+
+function dataAttr( elem, key, data ) {
+ var name;
+
+ // If nothing was found internally, try to fetch any
+ // data from the HTML5 data-* attribute
+ if ( data === undefined && elem.nodeType === 1 ) {
+ name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase();
+ data = elem.getAttribute( name );
+
+ if ( typeof data === "string" ) {
+ try {
+ data = getData( data );
+ } catch ( e ) {}
+
+ // Make sure we set the data so it isn't changed later
+ dataUser.set( elem, key, data );
+ } else {
+ data = undefined;
+ }
+ }
+ return data;
+}
+
+jQuery.extend( {
+ hasData: function( elem ) {
+ return dataUser.hasData( elem ) || dataPriv.hasData( elem );
+ },
+
+ data: function( elem, name, data ) {
+ return dataUser.access( elem, name, data );
+ },
+
+ removeData: function( elem, name ) {
+ dataUser.remove( elem, name );
+ },
+
+ // TODO: Now that all calls to _data and _removeData have been replaced
+ // with direct calls to dataPriv methods, these can be deprecated.
+ _data: function( elem, name, data ) {
+ return dataPriv.access( elem, name, data );
+ },
+
+ _removeData: function( elem, name ) {
+ dataPriv.remove( elem, name );
+ }
+} );
+
+jQuery.fn.extend( {
+ data: function( key, value ) {
+ var i, name, data,
+ elem = this[ 0 ],
+ attrs = elem && elem.attributes;
+
+ // Gets all values
+ if ( key === undefined ) {
+ if ( this.length ) {
+ data = dataUser.get( elem );
+
+ if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) {
+ i = attrs.length;
+ while ( i-- ) {
+
+ // Support: IE 11 only
+ // The attrs elements can be null (#14894)
+ if ( attrs[ i ] ) {
+ name = attrs[ i ].name;
+ if ( name.indexOf( "data-" ) === 0 ) {
+ name = camelCase( name.slice( 5 ) );
+ dataAttr( elem, name, data[ name ] );
+ }
+ }
+ }
+ dataPriv.set( elem, "hasDataAttrs", true );
+ }
+ }
+
+ return data;
+ }
+
+ // Sets multiple values
+ if ( typeof key === "object" ) {
+ return this.each( function() {
+ dataUser.set( this, key );
+ } );
+ }
+
+ return access( this, function( value ) {
+ var data;
+
+ // The calling jQuery object (element matches) is not empty
+ // (and therefore has an element appears at this[ 0 ]) and the
+ // `value` parameter was not undefined. An empty jQuery object
+ // will result in `undefined` for elem = this[ 0 ] which will
+ // throw an exception if an attempt to read a data cache is made.
+ if ( elem && value === undefined ) {
+
+ // Attempt to get data from the cache
+ // The key will always be camelCased in Data
+ data = dataUser.get( elem, key );
+ if ( data !== undefined ) {
+ return data;
+ }
+
+ // Attempt to "discover" the data in
+ // HTML5 custom data-* attrs
+ data = dataAttr( elem, key );
+ if ( data !== undefined ) {
+ return data;
+ }
+
+ // We tried really hard, but the data doesn't exist.
+ return;
+ }
+
+ // Set the data...
+ this.each( function() {
+
+ // We always store the camelCased key
+ dataUser.set( this, key, value );
+ } );
+ }, null, value, arguments.length > 1, null, true );
+ },
+
+ removeData: function( key ) {
+ return this.each( function() {
+ dataUser.remove( this, key );
+ } );
+ }
+} );
+
+
+jQuery.extend( {
+ queue: function( elem, type, data ) {
+ var queue;
+
+ if ( elem ) {
+ type = ( type || "fx" ) + "queue";
+ queue = dataPriv.get( elem, type );
+
+ // Speed up dequeue by getting out quickly if this is just a lookup
+ if ( data ) {
+ if ( !queue || Array.isArray( data ) ) {
+ queue = dataPriv.access( elem, type, jQuery.makeArray( data ) );
+ } else {
+ queue.push( data );
+ }
+ }
+ return queue || [];
+ }
+ },
+
+ dequeue: function( elem, type ) {
+ type = type || "fx";
+
+ var queue = jQuery.queue( elem, type ),
+ startLength = queue.length,
+ fn = queue.shift(),
+ hooks = jQuery._queueHooks( elem, type ),
+ next = function() {
+ jQuery.dequeue( elem, type );
+ };
+
+ // If the fx queue is dequeued, always remove the progress sentinel
+ if ( fn === "inprogress" ) {
+ fn = queue.shift();
+ startLength--;
+ }
+
+ if ( fn ) {
+
+ // Add a progress sentinel to prevent the fx queue from being
+ // automatically dequeued
+ if ( type === "fx" ) {
+ queue.unshift( "inprogress" );
+ }
+
+ // Clear up the last queue stop function
+ delete hooks.stop;
+ fn.call( elem, next, hooks );
+ }
+
+ if ( !startLength && hooks ) {
+ hooks.empty.fire();
+ }
+ },
+
+ // Not public - generate a queueHooks object, or return the current one
+ _queueHooks: function( elem, type ) {
+ var key = type + "queueHooks";
+ return dataPriv.get( elem, key ) || dataPriv.access( elem, key, {
+ empty: jQuery.Callbacks( "once memory" ).add( function() {
+ dataPriv.remove( elem, [ type + "queue", key ] );
+ } )
+ } );
+ }
+} );
+
+jQuery.fn.extend( {
+ queue: function( type, data ) {
+ var setter = 2;
+
+ if ( typeof type !== "string" ) {
+ data = type;
+ type = "fx";
+ setter--;
+ }
+
+ if ( arguments.length < setter ) {
+ return jQuery.queue( this[ 0 ], type );
+ }
+
+ return data === undefined ?
+ this :
+ this.each( function() {
+ var queue = jQuery.queue( this, type, data );
+
+ // Ensure a hooks for this queue
+ jQuery._queueHooks( this, type );
+
+ if ( type === "fx" && queue[ 0 ] !== "inprogress" ) {
+ jQuery.dequeue( this, type );
+ }
+ } );
+ },
+ dequeue: function( type ) {
+ return this.each( function() {
+ jQuery.dequeue( this, type );
+ } );
+ },
+ clearQueue: function( type ) {
+ return this.queue( type || "fx", [] );
+ },
+
+ // Get a promise resolved when queues of a certain type
+ // are emptied (fx is the type by default)
+ promise: function( type, obj ) {
+ var tmp,
+ count = 1,
+ defer = jQuery.Deferred(),
+ elements = this,
+ i = this.length,
+ resolve = function() {
+ if ( !( --count ) ) {
+ defer.resolveWith( elements, [ elements ] );
+ }
+ };
+
+ if ( typeof type !== "string" ) {
+ obj = type;
+ type = undefined;
+ }
+ type = type || "fx";
+
+ while ( i-- ) {
+ tmp = dataPriv.get( elements[ i ], type + "queueHooks" );
+ if ( tmp && tmp.empty ) {
+ count++;
+ tmp.empty.add( resolve );
+ }
+ }
+ resolve();
+ return defer.promise( obj );
+ }
+} );
+var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source;
+
+var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" );
+
+
+var cssExpand = [ "Top", "Right", "Bottom", "Left" ];
+
+var isHiddenWithinTree = function( elem, el ) {
+
+ // isHiddenWithinTree might be called from jQuery#filter function;
+ // in that case, element will be second argument
+ elem = el || elem;
+
+ // Inline style trumps all
+ return elem.style.display === "none" ||
+ elem.style.display === "" &&
+
+ // Otherwise, check computed style
+ // Support: Firefox <=43 - 45
+ // Disconnected elements can have computed display: none, so first confirm that elem is
+ // in the document.
+ jQuery.contains( elem.ownerDocument, elem ) &&
+
+ jQuery.css( elem, "display" ) === "none";
+ };
+
+var swap = function( elem, options, callback, args ) {
+ var ret, name,
+ old = {};
+
+ // Remember the old values, and insert the new ones
+ for ( name in options ) {
+ old[ name ] = elem.style[ name ];
+ elem.style[ name ] = options[ name ];
+ }
+
+ ret = callback.apply( elem, args || [] );
+
+ // Revert the old values
+ for ( name in options ) {
+ elem.style[ name ] = old[ name ];
+ }
+
+ return ret;
+};
+
+
+
+
+function adjustCSS( elem, prop, valueParts, tween ) {
+ var adjusted, scale,
+ maxIterations = 20,
+ currentValue = tween ?
+ function() {
+ return tween.cur();
+ } :
+ function() {
+ return jQuery.css( elem, prop, "" );
+ },
+ initial = currentValue(),
+ unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ),
+
+ // Starting value computation is required for potential unit mismatches
+ initialInUnit = ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) &&
+ rcssNum.exec( jQuery.css( elem, prop ) );
+
+ if ( initialInUnit && initialInUnit[ 3 ] !== unit ) {
+
+ // Support: Firefox <=54
+ // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144)
+ initial = initial / 2;
+
+ // Trust units reported by jQuery.css
+ unit = unit || initialInUnit[ 3 ];
+
+ // Iteratively approximate from a nonzero starting point
+ initialInUnit = +initial || 1;
+
+ while ( maxIterations-- ) {
+
+ // Evaluate and update our best guess (doubling guesses that zero out).
+ // Finish if the scale equals or crosses 1 (making the old*new product non-positive).
+ jQuery.style( elem, prop, initialInUnit + unit );
+ if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) {
+ maxIterations = 0;
+ }
+ initialInUnit = initialInUnit / scale;
+
+ }
+
+ initialInUnit = initialInUnit * 2;
+ jQuery.style( elem, prop, initialInUnit + unit );
+
+ // Make sure we update the tween properties later on
+ valueParts = valueParts || [];
+ }
+
+ if ( valueParts ) {
+ initialInUnit = +initialInUnit || +initial || 0;
+
+ // Apply relative offset (+=/-=) if specified
+ adjusted = valueParts[ 1 ] ?
+ initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] :
+ +valueParts[ 2 ];
+ if ( tween ) {
+ tween.unit = unit;
+ tween.start = initialInUnit;
+ tween.end = adjusted;
+ }
+ }
+ return adjusted;
+}
+
+
+var defaultDisplayMap = {};
+
+function getDefaultDisplay( elem ) {
+ var temp,
+ doc = elem.ownerDocument,
+ nodeName = elem.nodeName,
+ display = defaultDisplayMap[ nodeName ];
+
+ if ( display ) {
+ return display;
+ }
+
+ temp = doc.body.appendChild( doc.createElement( nodeName ) );
+ display = jQuery.css( temp, "display" );
+
+ temp.parentNode.removeChild( temp );
+
+ if ( display === "none" ) {
+ display = "block";
+ }
+ defaultDisplayMap[ nodeName ] = display;
+
+ return display;
+}
+
+function showHide( elements, show ) {
+ var display, elem,
+ values = [],
+ index = 0,
+ length = elements.length;
+
+ // Determine new display value for elements that need to change
+ for ( ; index < length; index++ ) {
+ elem = elements[ index ];
+ if ( !elem.style ) {
+ continue;
+ }
+
+ display = elem.style.display;
+ if ( show ) {
+
+ // Since we force visibility upon cascade-hidden elements, an immediate (and slow)
+ // check is required in this first loop unless we have a nonempty display value (either
+ // inline or about-to-be-restored)
+ if ( display === "none" ) {
+ values[ index ] = dataPriv.get( elem, "display" ) || null;
+ if ( !values[ index ] ) {
+ elem.style.display = "";
+ }
+ }
+ if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) {
+ values[ index ] = getDefaultDisplay( elem );
+ }
+ } else {
+ if ( display !== "none" ) {
+ values[ index ] = "none";
+
+ // Remember what we're overwriting
+ dataPriv.set( elem, "display", display );
+ }
+ }
+ }
+
+ // Set the display of the elements in a second loop to avoid constant reflow
+ for ( index = 0; index < length; index++ ) {
+ if ( values[ index ] != null ) {
+ elements[ index ].style.display = values[ index ];
+ }
+ }
+
+ return elements;
+}
+
+jQuery.fn.extend( {
+ show: function() {
+ return showHide( this, true );
+ },
+ hide: function() {
+ return showHide( this );
+ },
+ toggle: function( state ) {
+ if ( typeof state === "boolean" ) {
+ return state ? this.show() : this.hide();
+ }
+
+ return this.each( function() {
+ if ( isHiddenWithinTree( this ) ) {
+ jQuery( this ).show();
+ } else {
+ jQuery( this ).hide();
+ }
+ } );
+ }
+} );
+var rcheckableType = ( /^(?:checkbox|radio)$/i );
+
+var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]+)/i );
+
+var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i );
+
+
+
+// We have to close these tags to support XHTML (#13200)
+var wrapMap = {
+
+ // Support: IE <=9 only
+ option: [ 1, "<select multiple='multiple'>", "</select>" ],
+
+ // XHTML parsers do not magically insert elements in the
+ // same way that tag soup parsers do. So we cannot shorten
+ // this by omitting <tbody> or other required elements.
+ thead: [ 1, "<table>", "</table>" ],
+ col: [ 2, "<table><colgroup>", "</colgroup></table>" ],
+ tr: [ 2, "<table><tbody>", "</tbody></table>" ],
+ td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
+
+ _default: [ 0, "", "" ]
+};
+
+// Support: IE <=9 only
+wrapMap.optgroup = wrapMap.option;
+
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
+
+
+function getAll( context, tag ) {
+
+ // Support: IE <=9 - 11 only
+ // Use typeof to avoid zero-argument method invocation on host objects (#15151)
+ var ret;
+
+ if ( typeof context.getElementsByTagName !== "undefined" ) {
+ ret = context.getElementsByTagName( tag || "*" );
+
+ } else if ( typeof context.querySelectorAll !== "undefined" ) {
+ ret = context.querySelectorAll( tag || "*" );
+
+ } else {
+ ret = [];
+ }
+
+ if ( tag === undefined || tag && nodeName( context, tag ) ) {
+ return jQuery.merge( [ context ], ret );
+ }
+
+ return ret;
+}
+
+
+// Mark scripts as having already been evaluated
+function setGlobalEval( elems, refElements ) {
+ var i = 0,
+ l = elems.length;
+
+ for ( ; i < l; i++ ) {
+ dataPriv.set(
+ elems[ i ],
+ "globalEval",
+ !refElements || dataPriv.get( refElements[ i ], "globalEval" )
+ );
+ }
+}
+
+
+var rhtml = /<|&#?\w+;/;
+
+function buildFragment( elems, context, scripts, selection, ignored ) {
+ var elem, tmp, tag, wrap, contains, j,
+ fragment = context.createDocumentFragment(),
+ nodes = [],
+ i = 0,
+ l = elems.length;
+
+ for ( ; i < l; i++ ) {
+ elem = elems[ i ];
+
+ if ( elem || elem === 0 ) {
+
+ // Add nodes directly
+ if ( toType( elem ) === "object" ) {
+
+ // Support: Android <=4.0 only, PhantomJS 1 only
+ // push.apply(_, arraylike) throws on ancient WebKit
+ jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem );
+
+ // Convert non-html into a text node
+ } else if ( !rhtml.test( elem ) ) {
+ nodes.push( context.createTextNode( elem ) );
+
+ // Convert html into DOM nodes
+ } else {
+ tmp = tmp || fragment.appendChild( context.createElement( "div" ) );
+
+ // Deserialize a standard representation
+ tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase();
+ wrap = wrapMap[ tag ] || wrapMap._default;
+ tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ];
+
+ // Descend through wrappers to the right content
+ j = wrap[ 0 ];
+ while ( j-- ) {
+ tmp = tmp.lastChild;
+ }
+
+ // Support: Android <=4.0 only, PhantomJS 1 only
+ // push.apply(_, arraylike) throws on ancient WebKit
+ jQuery.merge( nodes, tmp.childNodes );
+
+ // Remember the top-level container
+ tmp = fragment.firstChild;
+
+ // Ensure the created nodes are orphaned (#12392)
+ tmp.textContent = "";
+ }
+ }
+ }
+
+ // Remove wrapper from fragment
+ fragment.textContent = "";
+
+ i = 0;
+ while ( ( elem = nodes[ i++ ] ) ) {
+
+ // Skip elements already in the context collection (trac-4087)
+ if ( selection && jQuery.inArray( elem, selection ) > -1 ) {
+ if ( ignored ) {
+ ignored.push( elem );
+ }
+ continue;
+ }
+
+ contains = jQuery.contains( elem.ownerDocument, elem );
+
+ // Append to fragment
+ tmp = getAll( fragment.appendChild( elem ), "script" );
+
+ // Preserve script evaluation history
+ if ( contains ) {
+ setGlobalEval( tmp );
+ }
+
+ // Capture executables
+ if ( scripts ) {
+ j = 0;
+ while ( ( elem = tmp[ j++ ] ) ) {
+ if ( rscriptType.test( elem.type || "" ) ) {
+ scripts.push( elem );
+ }
+ }
+ }
+ }
+
+ return fragment;
+}
+
+
+( function() {
+ var fragment = document.createDocumentFragment(),
+ div = fragment.appendChild( document.createElement( "div" ) ),
+ input = document.createElement( "input" );
+
+ // Support: Android 4.0 - 4.3 only
+ // Check state lost if the name is set (#11217)
+ // Support: Windows Web Apps (WWA)
+ // `name` and `type` must use .setAttribute for WWA (#14901)
+ input.setAttribute( "type", "radio" );
+ input.setAttribute( "checked", "checked" );
+ input.setAttribute( "name", "t" );
+
+ div.appendChild( input );
+
+ // Support: Android <=4.1 only
+ // Older WebKit doesn't clone checked state correctly in fragments
+ support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked;
+
+ // Support: IE <=11 only
+ // Make sure textarea (and checkbox) defaultValue is properly cloned
+ div.innerHTML = "<textarea>x</textarea>";
+ support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue;
+} )();
+var documentElement = document.documentElement;
+
+
+
+var
+ rkeyEvent = /^key/,
+ rmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/,
+ rtypenamespace = /^([^.]*)(?:\.(.+)|)/;
+
+function returnTrue() {
+ return true;
+}
+
+function returnFalse() {
+ return false;
+}
+
+// Support: IE <=9 only
+// See #13393 for more info
+function safeActiveElement() {
+ try {
+ return document.activeElement;
+ } catch ( err ) { }
+}
+
+function on( elem, types, selector, data, fn, one ) {
+ var origFn, type;
+
+ // Types can be a map of types/handlers
+ if ( typeof types === "object" ) {
+
+ // ( types-Object, selector, data )
+ if ( typeof selector !== "string" ) {
+
+ // ( types-Object, data )
+ data = data || selector;
+ selector = undefined;
+ }
+ for ( type in types ) {
+ on( elem, type, selector, data, types[ type ], one );
+ }
+ return elem;
+ }
+
+ if ( data == null && fn == null ) {
+
+ // ( types, fn )
+ fn = selector;
+ data = selector = undefined;
+ } else if ( fn == null ) {
+ if ( typeof selector === "string" ) {
+
+ // ( types, selector, fn )
+ fn = data;
+ data = undefined;
+ } else {
+
+ // ( types, data, fn )
+ fn = data;
+ data = selector;
+ selector = undefined;
+ }
+ }
+ if ( fn === false ) {
+ fn = returnFalse;
+ } else if ( !fn ) {
+ return elem;
+ }
+
+ if ( one === 1 ) {
+ origFn = fn;
+ fn = function( event ) {
+
+ // Can use an empty set, since event contains the info
+ jQuery().off( event );
+ return origFn.apply( this, arguments );
+ };
+
+ // Use same guid so caller can remove using origFn
+ fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
+ }
+ return elem.each( function() {
+ jQuery.event.add( this, types, fn, data, selector );
+ } );
+}
+
+/*
+ * Helper functions for managing events -- not part of the public interface.
+ * Props to Dean Edwards' addEvent library for many of the ideas.
+ */
+jQuery.event = {
+
+ global: {},
+
+ add: function( elem, types, handler, data, selector ) {
+
+ var handleObjIn, eventHandle, tmp,
+ events, t, handleObj,
+ special, handlers, type, namespaces, origType,
+ elemData = dataPriv.get( elem );
+
+ // Don't attach events to noData or text/comment nodes (but allow plain objects)
+ if ( !elemData ) {
+ return;
+ }
+
+ // Caller can pass in an object of custom data in lieu of the handler
+ if ( handler.handler ) {
+ handleObjIn = handler;
+ handler = handleObjIn.handler;
+ selector = handleObjIn.selector;
+ }
+
+ // Ensure that invalid selectors throw exceptions at attach time
+ // Evaluate against documentElement in case elem is a non-element node (e.g., document)
+ if ( selector ) {
+ jQuery.find.matchesSelector( documentElement, selector );
+ }
+
+ // Make sure that the handler has a unique ID, used to find/remove it later
+ if ( !handler.guid ) {
+ handler.guid = jQuery.guid++;
+ }
+
+ // Init the element's event structure and main handler, if this is the first
+ if ( !( events = elemData.events ) ) {
+ events = elemData.events = {};
+ }
+ if ( !( eventHandle = elemData.handle ) ) {
+ eventHandle = elemData.handle = function( e ) {
+
+ // Discard the second event of a jQuery.event.trigger() and
+ // when an event is called after a page has unloaded
+ return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ?
+ jQuery.event.dispatch.apply( elem, arguments ) : undefined;
+ };
+ }
+
+ // Handle multiple events separated by a space
+ types = ( types || "" ).match( rnothtmlwhite ) || [ "" ];
+ t = types.length;
+ while ( t-- ) {
+ tmp = rtypenamespace.exec( types[ t ] ) || [];
+ type = origType = tmp[ 1 ];
+ namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort();
+
+ // There *must* be a type, no attaching namespace-only handlers
+ if ( !type ) {
+ continue;
+ }
+
+ // If event changes its type, use the special event handlers for the changed type
+ special = jQuery.event.special[ type ] || {};
+
+ // If selector defined, determine special event api type, otherwise given type
+ type = ( selector ? special.delegateType : special.bindType ) || type;
+
+ // Update special based on newly reset type
+ special = jQuery.event.special[ type ] || {};
+
+ // handleObj is passed to all event handlers
+ handleObj = jQuery.extend( {
+ type: type,
+ origType: origType,
+ data: data,
+ handler: handler,
+ guid: handler.guid,
+ selector: selector,
+ needsContext: selector && jQuery.expr.match.needsContext.test( selector ),
+ namespace: namespaces.join( "." )
+ }, handleObjIn );
+
+ // Init the event handler queue if we're the first
+ if ( !( handlers = events[ type ] ) ) {
+ handlers = events[ type ] = [];
+ handlers.delegateCount = 0;
+
+ // Only use addEventListener if the special events handler returns false
+ if ( !special.setup ||
+ special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+
+ if ( elem.addEventListener ) {
+ elem.addEventListener( type, eventHandle );
+ }
+ }
+ }
+
+ if ( special.add ) {
+ special.add.call( elem, handleObj );
+
+ if ( !handleObj.handler.guid ) {
+ handleObj.handler.guid = handler.guid;
+ }
+ }
+
+ // Add to the element's handler list, delegates in front
+ if ( selector ) {
+ handlers.splice( handlers.delegateCount++, 0, handleObj );
+ } else {
+ handlers.push( handleObj );
+ }
+
+ // Keep track of which events have ever been used, for event optimization
+ jQuery.event.global[ type ] = true;
+ }
+
+ },
+
+ // Detach an event or set of events from an element
+ remove: function( elem, types, handler, selector, mappedTypes ) {
+
+ var j, origCount, tmp,
+ events, t, handleObj,
+ special, handlers, type, namespaces, origType,
+ elemData = dataPriv.hasData( elem ) && dataPriv.get( elem );
+
+ if ( !elemData || !( events = elemData.events ) ) {
+ return;
+ }
+
+ // Once for each type.namespace in types; type may be omitted
+ types = ( types || "" ).match( rnothtmlwhite ) || [ "" ];
+ t = types.length;
+ while ( t-- ) {
+ tmp = rtypenamespace.exec( types[ t ] ) || [];
+ type = origType = tmp[ 1 ];
+ namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort();
+
+ // Unbind all events (on this namespace, if provided) for the element
+ if ( !type ) {
+ for ( type in events ) {
+ jQuery.event.remove( elem, type + types[ t ], handler, selector, true );
+ }
+ continue;
+ }
+
+ special = jQuery.event.special[ type ] || {};
+ type = ( selector ? special.delegateType : special.bindType ) || type;
+ handlers = events[ type ] || [];
+ tmp = tmp[ 2 ] &&
+ new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" );
+
+ // Remove matching events
+ origCount = j = handlers.length;
+ while ( j-- ) {
+ handleObj = handlers[ j ];
+
+ if ( ( mappedTypes || origType === handleObj.origType ) &&
+ ( !handler || handler.guid === handleObj.guid ) &&
+ ( !tmp || tmp.test( handleObj.namespace ) ) &&
+ ( !selector || selector === handleObj.selector ||
+ selector === "**" && handleObj.selector ) ) {
+ handlers.splice( j, 1 );
+
+ if ( handleObj.selector ) {
+ handlers.delegateCount--;
+ }
+ if ( special.remove ) {
+ special.remove.call( elem, handleObj );
+ }
+ }
+ }
+
+ // Remove generic event handler if we removed something and no more handlers exist
+ // (avoids potential for endless recursion during removal of special event handlers)
+ if ( origCount && !handlers.length ) {
+ if ( !special.teardown ||
+ special.teardown.call( elem, namespaces, elemData.handle ) === false ) {
+
+ jQuery.removeEvent( elem, type, elemData.handle );
+ }
+
+ delete events[ type ];
+ }
+ }
+
+ // Remove data and the expando if it's no longer used
+ if ( jQuery.isEmptyObject( events ) ) {
+ dataPriv.remove( elem, "handle events" );
+ }
+ },
+
+ dispatch: function( nativeEvent ) {
+
+ // Make a writable jQuery.Event from the native event object
+ var event = jQuery.event.fix( nativeEvent );
+
+ var i, j, ret, matched, handleObj, handlerQueue,
+ args = new Array( arguments.length ),
+ handlers = ( dataPriv.get( this, "events" ) || {} )[ event.type ] || [],
+ special = jQuery.event.special[ event.type ] || {};
+
+ // Use the fix-ed jQuery.Event rather than the (read-only) native event
+ args[ 0 ] = event;
+
+ for ( i = 1; i < arguments.length; i++ ) {
+ args[ i ] = arguments[ i ];
+ }
+
+ event.delegateTarget = this;
+
+ // Call the preDispatch hook for the mapped type, and let it bail if desired
+ if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {
+ return;
+ }
+
+ // Determine handlers
+ handlerQueue = jQuery.event.handlers.call( this, event, handlers );
+
+ // Run delegates first; they may want to stop propagation beneath us
+ i = 0;
+ while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) {
+ event.currentTarget = matched.elem;
+
+ j = 0;
+ while ( ( handleObj = matched.handlers[ j++ ] ) &&
+ !event.isImmediatePropagationStopped() ) {
+
+ // Triggered event must either 1) have no namespace, or 2) have namespace(s)
+ // a subset or equal to those in the bound event (both can have no namespace).
+ if ( !event.rnamespace || event.rnamespace.test( handleObj.namespace ) ) {
+
+ event.handleObj = handleObj;
+ event.data = handleObj.data;
+
+ ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle ||
+ handleObj.handler ).apply( matched.elem, args );
+
+ if ( ret !== undefined ) {
+ if ( ( event.result = ret ) === false ) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ }
+ }
+ }
+ }
+
+ // Call the postDispatch hook for the mapped type
+ if ( special.postDispatch ) {
+ special.postDispatch.call( this, event );
+ }
+
+ return event.result;
+ },
+
+ handlers: function( event, handlers ) {
+ var i, handleObj, sel, matchedHandlers, matchedSelectors,
+ handlerQueue = [],
+ delegateCount = handlers.delegateCount,
+ cur = event.target;
+
+ // Find delegate handlers
+ if ( delegateCount &&
+
+ // Support: IE <=9
+ // Black-hole SVG <use> instance trees (trac-13180)
+ cur.nodeType &&
+
+ // Support: Firefox <=42
+ // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861)
+ // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click
+ // Support: IE 11 only
+ // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343)
+ !( event.type === "click" && event.button >= 1 ) ) {
+
+ for ( ; cur !== this; cur = cur.parentNode || this ) {
+
+ // Don't check non-elements (#13208)
+ // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)
+ if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) {
+ matchedHandlers = [];
+ matchedSelectors = {};
+ for ( i = 0; i < delegateCount; i++ ) {
+ handleObj = handlers[ i ];
+
+ // Don't conflict with Object.prototype properties (#13203)
+ sel = handleObj.selector + " ";
+
+ if ( matchedSelectors[ sel ] === undefined ) {
+ matchedSelectors[ sel ] = handleObj.needsContext ?
+ jQuery( sel, this ).index( cur ) > -1 :
+ jQuery.find( sel, this, null, [ cur ] ).length;
+ }
+ if ( matchedSelectors[ sel ] ) {
+ matchedHandlers.push( handleObj );
+ }
+ }
+ if ( matchedHandlers.length ) {
+ handlerQueue.push( { elem: cur, handlers: matchedHandlers } );
+ }
+ }
+ }
+ }
+
+ // Add the remaining (directly-bound) handlers
+ cur = this;
+ if ( delegateCount < handlers.length ) {
+ handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } );
+ }
+
+ return handlerQueue;
+ },
+
+ addProp: function( name, hook ) {
+ Object.defineProperty( jQuery.Event.prototype, name, {
+ enumerable: true,
+ configurable: true,
+
+ get: isFunction( hook ) ?
+ function() {
+ if ( this.originalEvent ) {
+ return hook( this.originalEvent );
+ }
+ } :
+ function() {
+ if ( this.originalEvent ) {
+ return this.originalEvent[ name ];
+ }
+ },
+
+ set: function( value ) {
+ Object.defineProperty( this, name, {
+ enumerable: true,
+ configurable: true,
+ writable: true,
+ value: value
+ } );
+ }
+ } );
+ },
+
+ fix: function( originalEvent ) {
+ return originalEvent[ jQuery.expando ] ?
+ originalEvent :
+ new jQuery.Event( originalEvent );
+ },
+
+ special: {
+ load: {
+
+ // Prevent triggered image.load events from bubbling to window.load
+ noBubble: true
+ },
+ focus: {
+
+ // Fire native event if possible so blur/focus sequence is correct
+ trigger: function() {
+ if ( this !== safeActiveElement() && this.focus ) {
+ this.focus();
+ return false;
+ }
+ },
+ delegateType: "focusin"
+ },
+ blur: {
+ trigger: function() {
+ if ( this === safeActiveElement() && this.blur ) {
+ this.blur();
+ return false;
+ }
+ },
+ delegateType: "focusout"
+ },
+ click: {
+
+ // For checkbox, fire native event so checked state will be right
+ trigger: function() {
+ if ( this.type === "checkbox" && this.click && nodeName( this, "input" ) ) {
+ this.click();
+ return false;
+ }
+ },
+
+ // For cross-browser consistency, don't fire native .click() on links
+ _default: function( event ) {
+ return nodeName( event.target, "a" );
+ }
+ },
+
+ beforeunload: {
+ postDispatch: function( event ) {
+
+ // Support: Firefox 20+
+ // Firefox doesn't alert if the returnValue field is not set.
+ if ( event.result !== undefined && event.originalEvent ) {
+ event.originalEvent.returnValue = event.result;
+ }
+ }
+ }
+ }
+};
+
+jQuery.removeEvent = function( elem, type, handle ) {
+
+ // This "if" is needed for plain objects
+ if ( elem.removeEventListener ) {
+ elem.removeEventListener( type, handle );
+ }
+};
+
+jQuery.Event = function( src, props ) {
+
+ // Allow instantiation without the 'new' keyword
+ if ( !( this instanceof jQuery.Event ) ) {
+ return new jQuery.Event( src, props );
+ }
+
+ // Event object
+ if ( src && src.type ) {
+ this.originalEvent = src;
+ this.type = src.type;
+
+ // Events bubbling up the document may have been marked as prevented
+ // by a handler lower down the tree; reflect the correct value.
+ this.isDefaultPrevented = src.defaultPrevented ||
+ src.defaultPrevented === undefined &&
+
+ // Support: Android <=2.3 only
+ src.returnValue === false ?
+ returnTrue :
+ returnFalse;
+
+ // Create target properties
+ // Support: Safari <=6 - 7 only
+ // Target should not be a text node (#504, #13143)
+ this.target = ( src.target && src.target.nodeType === 3 ) ?
+ src.target.parentNode :
+ src.target;
+
+ this.currentTarget = src.currentTarget;
+ this.relatedTarget = src.relatedTarget;
+
+ // Event type
+ } else {
+ this.type = src;
+ }
+
+ // Put explicitly provided properties onto the event object
+ if ( props ) {
+ jQuery.extend( this, props );
+ }
+
+ // Create a timestamp if incoming event doesn't have one
+ this.timeStamp = src && src.timeStamp || Date.now();
+
+ // Mark it as fixed
+ this[ jQuery.expando ] = true;
+};
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+ constructor: jQuery.Event,
+ isDefaultPrevented: returnFalse,
+ isPropagationStopped: returnFalse,
+ isImmediatePropagationStopped: returnFalse,
+ isSimulated: false,
+
+ preventDefault: function() {
+ var e = this.originalEvent;
+
+ this.isDefaultPrevented = returnTrue;
+
+ if ( e && !this.isSimulated ) {
+ e.preventDefault();
+ }
+ },
+ stopPropagation: function() {
+ var e = this.originalEvent;
+
+ this.isPropagationStopped = returnTrue;
+
+ if ( e && !this.isSimulated ) {
+ e.stopPropagation();
+ }
+ },
+ stopImmediatePropagation: function() {
+ var e = this.originalEvent;
+
+ this.isImmediatePropagationStopped = returnTrue;
+
+ if ( e && !this.isSimulated ) {
+ e.stopImmediatePropagation();
+ }
+
+ this.stopPropagation();
+ }
+};
+
+// Includes all common event props including KeyEvent and MouseEvent specific props
+jQuery.each( {
+ altKey: true,
+ bubbles: true,
+ cancelable: true,
+ changedTouches: true,
+ ctrlKey: true,
+ detail: true,
+ eventPhase: true,
+ metaKey: true,
+ pageX: true,
+ pageY: true,
+ shiftKey: true,
+ view: true,
+ "char": true,
+ charCode: true,
+ key: true,
+ keyCode: true,
+ button: true,
+ buttons: true,
+ clientX: true,
+ clientY: true,
+ offsetX: true,
+ offsetY: true,
+ pointerId: true,
+ pointerType: true,
+ screenX: true,
+ screenY: true,
+ targetTouches: true,
+ toElement: true,
+ touches: true,
+
+ which: function( event ) {
+ var button = event.button;
+
+ // Add which for key events
+ if ( event.which == null && rkeyEvent.test( event.type ) ) {
+ return event.charCode != null ? event.charCode : event.keyCode;
+ }
+
+ // Add which for click: 1 === left; 2 === middle; 3 === right
+ if ( !event.which && button !== undefined && rmouseEvent.test( event.type ) ) {
+ if ( button & 1 ) {
+ return 1;
+ }
+
+ if ( button & 2 ) {
+ return 3;
+ }
+
+ if ( button & 4 ) {
+ return 2;
+ }
+
+ return 0;
+ }
+
+ return event.which;
+ }
+}, jQuery.event.addProp );
+
+// Create mouseenter/leave events using mouseover/out and event-time checks
+// so that event delegation works in jQuery.
+// Do the same for pointerenter/pointerleave and pointerover/pointerout
+//
+// Support: Safari 7 only
+// Safari sends mouseenter too often; see:
+// https://bugs.chromium.org/p/chromium/issues/detail?id=470258
+// for the description of the bug (it existed in older Chrome versions as well).
+jQuery.each( {
+ mouseenter: "mouseover",
+ mouseleave: "mouseout",
+ pointerenter: "pointerover",
+ pointerleave: "pointerout"
+}, function( orig, fix ) {
+ jQuery.event.special[ orig ] = {
+ delegateType: fix,
+ bindType: fix,
+
+ handle: function( event ) {
+ var ret,
+ target = this,
+ related = event.relatedTarget,
+ handleObj = event.handleObj;
+
+ // For mouseenter/leave call the handler if related is outside the target.
+ // NB: No relatedTarget if the mouse left/entered the browser window
+ if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) {
+ event.type = handleObj.origType;
+ ret = handleObj.handler.apply( this, arguments );
+ event.type = fix;
+ }
+ return ret;
+ }
+ };
+} );
+
+jQuery.fn.extend( {
+
+ on: function( types, selector, data, fn ) {
+ return on( this, types, selector, data, fn );
+ },
+ one: function( types, selector, data, fn ) {
+ return on( this, types, selector, data, fn, 1 );
+ },
+ off: function( types, selector, fn ) {
+ var handleObj, type;
+ if ( types && types.preventDefault && types.handleObj ) {
+
+ // ( event ) dispatched jQuery.Event
+ handleObj = types.handleObj;
+ jQuery( types.delegateTarget ).off(
+ handleObj.namespace ?
+ handleObj.origType + "." + handleObj.namespace :
+ handleObj.origType,
+ handleObj.selector,
+ handleObj.handler
+ );
+ return this;
+ }
+ if ( typeof types === "object" ) {
+
+ // ( types-object [, selector] )
+ for ( type in types ) {
+ this.off( type, selector, types[ type ] );
+ }
+ return this;
+ }
+ if ( selector === false || typeof selector === "function" ) {
+
+ // ( types [, fn] )
+ fn = selector;
+ selector = undefined;
+ }
+ if ( fn === false ) {
+ fn = returnFalse;
+ }
+ return this.each( function() {
+ jQuery.event.remove( this, types, fn, selector );
+ } );
+ }
+} );
+
+
+var
+
+ /* eslint-disable max-len */
+
+ // See https://github.com/eslint/eslint/issues/3229
+ rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi,
+
+ /* eslint-enable */
+
+ // Support: IE <=10 - 11, Edge 12 - 13 only
+ // In IE/Edge using regex groups here causes severe slowdowns.
+ // See https://connect.microsoft.com/IE/feedback/details/1736512/
+ rnoInnerhtml = /<script|<style|<link/i,
+
+ // checked="checked" or checked
+ rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
+ rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g;
+
+// Prefer a tbody over its parent table for containing new rows
+function manipulationTarget( elem, content ) {
+ if ( nodeName( elem, "table" ) &&
+ nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) {
+
+ return jQuery( elem ).children( "tbody" )[ 0 ] || elem;
+ }
+
+ return elem;
+}
+
+// Replace/restore the type attribute of script elements for safe DOM manipulation
+function disableScript( elem ) {
+ elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type;
+ return elem;
+}
+function restoreScript( elem ) {
+ if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) {
+ elem.type = elem.type.slice( 5 );
+ } else {
+ elem.removeAttribute( "type" );
+ }
+
+ return elem;
+}
+
+function cloneCopyEvent( src, dest ) {
+ var i, l, type, pdataOld, pdataCur, udataOld, udataCur, events;
+
+ if ( dest.nodeType !== 1 ) {
+ return;
+ }
+
+ // 1. Copy private data: events, handlers, etc.
+ if ( dataPriv.hasData( src ) ) {
+ pdataOld = dataPriv.access( src );
+ pdataCur = dataPriv.set( dest, pdataOld );
+ events = pdataOld.events;
+
+ if ( events ) {
+ delete pdataCur.handle;
+ pdataCur.events = {};
+
+ for ( type in events ) {
+ for ( i = 0, l = events[ type ].length; i < l; i++ ) {
+ jQuery.event.add( dest, type, events[ type ][ i ] );
+ }
+ }
+ }
+ }
+
+ // 2. Copy user data
+ if ( dataUser.hasData( src ) ) {
+ udataOld = dataUser.access( src );
+ udataCur = jQuery.extend( {}, udataOld );
+
+ dataUser.set( dest, udataCur );
+ }
+}
+
+// Fix IE bugs, see support tests
+function fixInput( src, dest ) {
+ var nodeName = dest.nodeName.toLowerCase();
+
+ // Fails to persist the checked state of a cloned checkbox or radio button.
+ if ( nodeName === "input" && rcheckableType.test( src.type ) ) {
+ dest.checked = src.checked;
+
+ // Fails to return the selected option to the default selected state when cloning options
+ } else if ( nodeName === "input" || nodeName === "textarea" ) {
+ dest.defaultValue = src.defaultValue;
+ }
+}
+
+function domManip( collection, args, callback, ignored ) {
+
+ // Flatten any nested arrays
+ args = concat.apply( [], args );
+
+ var fragment, first, scripts, hasScripts, node, doc,
+ i = 0,
+ l = collection.length,
+ iNoClone = l - 1,
+ value = args[ 0 ],
+ valueIsFunction = isFunction( value );
+
+ // We can't cloneNode fragments that contain checked, in WebKit
+ if ( valueIsFunction ||
+ ( l > 1 && typeof value === "string" &&
+ !support.checkClone && rchecked.test( value ) ) ) {
+ return collection.each( function( index ) {
+ var self = collection.eq( index );
+ if ( valueIsFunction ) {
+ args[ 0 ] = value.call( this, index, self.html() );
+ }
+ domManip( self, args, callback, ignored );
+ } );
+ }
+
+ if ( l ) {
+ fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored );
+ first = fragment.firstChild;
+
+ if ( fragment.childNodes.length === 1 ) {
+ fragment = first;
+ }
+
+ // Require either new content or an interest in ignored elements to invoke the callback
+ if ( first || ignored ) {
+ scripts = jQuery.map( getAll( fragment, "script" ), disableScript );
+ hasScripts = scripts.length;
+
+ // Use the original fragment for the last item
+ // instead of the first because it can end up
+ // being emptied incorrectly in certain situations (#8070).
+ for ( ; i < l; i++ ) {
+ node = fragment;
+
+ if ( i !== iNoClone ) {
+ node = jQuery.clone( node, true, true );
+
+ // Keep references to cloned scripts for later restoration
+ if ( hasScripts ) {
+
+ // Support: Android <=4.0 only, PhantomJS 1 only
+ // push.apply(_, arraylike) throws on ancient WebKit
+ jQuery.merge( scripts, getAll( node, "script" ) );
+ }
+ }
+
+ callback.call( collection[ i ], node, i );
+ }
+
+ if ( hasScripts ) {
+ doc = scripts[ scripts.length - 1 ].ownerDocument;
+
+ // Reenable scripts
+ jQuery.map( scripts, restoreScript );
+
+ // Evaluate executable scripts on first document insertion
+ for ( i = 0; i < hasScripts; i++ ) {
+ node = scripts[ i ];
+ if ( rscriptType.test( node.type || "" ) &&
+ !dataPriv.access( node, "globalEval" ) &&
+ jQuery.contains( doc, node ) ) {
+
+ if ( node.src && ( node.type || "" ).toLowerCase() !== "module" ) {
+
+ // Optional AJAX dependency, but won't run scripts if not present
+ if ( jQuery._evalUrl ) {
+ jQuery._evalUrl( node.src );
+ }
+ } else {
+ DOMEval( node.textContent.replace( rcleanScript, "" ), doc, node );
+ }
+ }
+ }
+ }
+ }
+ }
+
+ return collection;
+}
+
+function remove( elem, selector, keepData ) {
+ var node,
+ nodes = selector ? jQuery.filter( selector, elem ) : elem,
+ i = 0;
+
+ for ( ; ( node = nodes[ i ] ) != null; i++ ) {
+ if ( !keepData && node.nodeType === 1 ) {
+ jQuery.cleanData( getAll( node ) );
+ }
+
+ if ( node.parentNode ) {
+ if ( keepData && jQuery.contains( node.ownerDocument, node ) ) {
+ setGlobalEval( getAll( node, "script" ) );
+ }
+ node.parentNode.removeChild( node );
+ }
+ }
+
+ return elem;
+}
+
+jQuery.extend( {
+ htmlPrefilter: function( html ) {
+ return html.replace( rxhtmlTag, "<$1></$2>" );
+ },
+
+ clone: function( elem, dataAndEvents, deepDataAndEvents ) {
+ var i, l, srcElements, destElements,
+ clone = elem.cloneNode( true ),
+ inPage = jQuery.contains( elem.ownerDocument, elem );
+
+ // Fix IE cloning issues
+ if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) &&
+ !jQuery.isXMLDoc( elem ) ) {
+
+ // We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2
+ destElements = getAll( clone );
+ srcElements = getAll( elem );
+
+ for ( i = 0, l = srcElements.length; i < l; i++ ) {
+ fixInput( srcElements[ i ], destElements[ i ] );
+ }
+ }
+
+ // Copy the events from the original to the clone
+ if ( dataAndEvents ) {
+ if ( deepDataAndEvents ) {
+ srcElements = srcElements || getAll( elem );
+ destElements = destElements || getAll( clone );
+
+ for ( i = 0, l = srcElements.length; i < l; i++ ) {
+ cloneCopyEvent( srcElements[ i ], destElements[ i ] );
+ }
+ } else {
+ cloneCopyEvent( elem, clone );
+ }
+ }
+
+ // Preserve script evaluation history
+ destElements = getAll( clone, "script" );
+ if ( destElements.length > 0 ) {
+ setGlobalEval( destElements, !inPage && getAll( elem, "script" ) );
+ }
+
+ // Return the cloned set
+ return clone;
+ },
+
+ cleanData: function( elems ) {
+ var data, elem, type,
+ special = jQuery.event.special,
+ i = 0;
+
+ for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) {
+ if ( acceptData( elem ) ) {
+ if ( ( data = elem[ dataPriv.expando ] ) ) {
+ if ( data.events ) {
+ for ( type in data.events ) {
+ if ( special[ type ] ) {
+ jQuery.event.remove( elem, type );
+
+ // This is a shortcut to avoid jQuery.event.remove's overhead
+ } else {
+ jQuery.removeEvent( elem, type, data.handle );
+ }
+ }
+ }
+
+ // Support: Chrome <=35 - 45+
+ // Assign undefined instead of using delete, see Data#remove
+ elem[ dataPriv.expando ] = undefined;
+ }
+ if ( elem[ dataUser.expando ] ) {
+
+ // Support: Chrome <=35 - 45+
+ // Assign undefined instead of using delete, see Data#remove
+ elem[ dataUser.expando ] = undefined;
+ }
+ }
+ }
+ }
+} );
+
+jQuery.fn.extend( {
+ detach: function( selector ) {
+ return remove( this, selector, true );
+ },
+
+ remove: function( selector ) {
+ return remove( this, selector );
+ },
+
+ text: function( value ) {
+ return access( this, function( value ) {
+ return value === undefined ?
+ jQuery.text( this ) :
+ this.empty().each( function() {
+ if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+ this.textContent = value;
+ }
+ } );
+ }, null, value, arguments.length );
+ },
+
+ append: function() {
+ return domManip( this, arguments, function( elem ) {
+ if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+ var target = manipulationTarget( this, elem );
+ target.appendChild( elem );
+ }
+ } );
+ },
+
+ prepend: function() {
+ return domManip( this, arguments, function( elem ) {
+ if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+ var target = manipulationTarget( this, elem );
+ target.insertBefore( elem, target.firstChild );
+ }
+ } );
+ },
+
+ before: function() {
+ return domManip( this, arguments, function( elem ) {
+ if ( this.parentNode ) {
+ this.parentNode.insertBefore( elem, this );
+ }
+ } );
+ },
+
+ after: function() {
+ return domManip( this, arguments, function( elem ) {
+ if ( this.parentNode ) {
+ this.parentNode.insertBefore( elem, this.nextSibling );
+ }
+ } );
+ },
+
+ empty: function() {
+ var elem,
+ i = 0;
+
+ for ( ; ( elem = this[ i ] ) != null; i++ ) {
+ if ( elem.nodeType === 1 ) {
+
+ // Prevent memory leaks
+ jQuery.cleanData( getAll( elem, false ) );
+
+ // Remove any remaining nodes
+ elem.textContent = "";
+ }
+ }
+
+ return this;
+ },
+
+ clone: function( dataAndEvents, deepDataAndEvents ) {
+ dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
+ deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
+
+ return this.map( function() {
+ return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
+ } );
+ },
+
+ html: function( value ) {
+ return access( this, function( value ) {
+ var elem = this[ 0 ] || {},
+ i = 0,
+ l = this.length;
+
+ if ( value === undefined && elem.nodeType === 1 ) {
+ return elem.innerHTML;
+ }
+
+ // See if we can take a shortcut and just use innerHTML
+ if ( typeof value === "string" && !rnoInnerhtml.test( value ) &&
+ !wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) {
+
+ value = jQuery.htmlPrefilter( value );
+
+ try {
+ for ( ; i < l; i++ ) {
+ elem = this[ i ] || {};
+
+ // Remove element nodes and prevent memory leaks
+ if ( elem.nodeType === 1 ) {
+ jQuery.cleanData( getAll( elem, false ) );
+ elem.innerHTML = value;
+ }
+ }
+
+ elem = 0;
+
+ // If using innerHTML throws an exception, use the fallback method
+ } catch ( e ) {}
+ }
+
+ if ( elem ) {
+ this.empty().append( value );
+ }
+ }, null, value, arguments.length );
+ },
+
+ replaceWith: function() {
+ var ignored = [];
+
+ // Make the changes, replacing each non-ignored context element with the new content
+ return domManip( this, arguments, function( elem ) {
+ var parent = this.parentNode;
+
+ if ( jQuery.inArray( this, ignored ) < 0 ) {
+ jQuery.cleanData( getAll( this ) );
+ if ( parent ) {
+ parent.replaceChild( elem, this );
+ }
+ }
+
+ // Force callback invocation
+ }, ignored );
+ }
+} );
+
+jQuery.each( {
+ appendTo: "append",
+ prependTo: "prepend",
+ insertBefore: "before",
+ insertAfter: "after",
+ replaceAll: "replaceWith"
+}, function( name, original ) {
+ jQuery.fn[ name ] = function( selector ) {
+ var elems,
+ ret = [],
+ insert = jQuery( selector ),
+ last = insert.length - 1,
+ i = 0;
+
+ for ( ; i <= last; i++ ) {
+ elems = i === last ? this : this.clone( true );
+ jQuery( insert[ i ] )[ original ]( elems );
+
+ // Support: Android <=4.0 only, PhantomJS 1 only
+ // .get() because push.apply(_, arraylike) throws on ancient WebKit
+ push.apply( ret, elems.get() );
+ }
+
+ return this.pushStack( ret );
+ };
+} );
+var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" );
+
+var getStyles = function( elem ) {
+
+ // Support: IE <=11 only, Firefox <=30 (#15098, #14150)
+ // IE throws on elements created in popups
+ // FF meanwhile throws on frame elements through "defaultView.getComputedStyle"
+ var view = elem.ownerDocument.defaultView;
+
+ if ( !view || !view.opener ) {
+ view = window;
+ }
+
+ return view.getComputedStyle( elem );
+ };
+
+var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" );
+
+
+
+( function() {
+
+ // Executing both pixelPosition & boxSizingReliable tests require only one layout
+ // so they're executed at the same time to save the second computation.
+ function computeStyleTests() {
+
+ // This is a singleton, we need to execute it only once
+ if ( !div ) {
+ return;
+ }
+
+ container.style.cssText = "position:absolute;left:-11111px;width:60px;" +
+ "margin-top:1px;padding:0;border:0";
+ div.style.cssText =
+ "position:relative;display:block;box-sizing:border-box;overflow:scroll;" +
+ "margin:auto;border:1px;padding:1px;" +
+ "width:60%;top:1%";
+ documentElement.appendChild( container ).appendChild( div );
+
+ var divStyle = window.getComputedStyle( div );
+ pixelPositionVal = divStyle.top !== "1%";
+
+ // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44
+ reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12;
+
+ // Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3
+ // Some styles come back with percentage values, even though they shouldn't
+ div.style.right = "60%";
+ pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36;
+
+ // Support: IE 9 - 11 only
+ // Detect misreporting of content dimensions for box-sizing:border-box elements
+ boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36;
+
+ // Support: IE 9 only
+ // Detect overflow:scroll screwiness (gh-3699)
+ div.style.position = "absolute";
+ scrollboxSizeVal = div.offsetWidth === 36 || "absolute";
+
+ documentElement.removeChild( container );
+
+ // Nullify the div so it wouldn't be stored in the memory and
+ // it will also be a sign that checks already performed
+ div = null;
+ }
+
+ function roundPixelMeasures( measure ) {
+ return Math.round( parseFloat( measure ) );
+ }
+
+ var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal,
+ reliableMarginLeftVal,
+ container = document.createElement( "div" ),
+ div = document.createElement( "div" );
+
+ // Finish early in limited (non-browser) environments
+ if ( !div.style ) {
+ return;
+ }
+
+ // Support: IE <=9 - 11 only
+ // Style of cloned element affects source element cloned (#8908)
+ div.style.backgroundClip = "content-box";
+ div.cloneNode( true ).style.backgroundClip = "";
+ support.clearCloneStyle = div.style.backgroundClip === "content-box";
+
+ jQuery.extend( support, {
+ boxSizingReliable: function() {
+ computeStyleTests();
+ return boxSizingReliableVal;
+ },
+ pixelBoxStyles: function() {
+ computeStyleTests();
+ return pixelBoxStylesVal;
+ },
+ pixelPosition: function() {
+ computeStyleTests();
+ return pixelPositionVal;
+ },
+ reliableMarginLeft: function() {
+ computeStyleTests();
+ return reliableMarginLeftVal;
+ },
+ scrollboxSize: function() {
+ computeStyleTests();
+ return scrollboxSizeVal;
+ }
+ } );
+} )();
+
+
+function curCSS( elem, name, computed ) {
+ var width, minWidth, maxWidth, ret,
+
+ // Support: Firefox 51+
+ // Retrieving style before computed somehow
+ // fixes an issue with getting wrong values
+ // on detached elements
+ style = elem.style;
+
+ computed = computed || getStyles( elem );
+
+ // getPropertyValue is needed for:
+ // .css('filter') (IE 9 only, #12537)
+ // .css('--customProperty) (#3144)
+ if ( computed ) {
+ ret = computed.getPropertyValue( name ) || computed[ name ];
+
+ if ( ret === "" && !jQuery.contains( elem.ownerDocument, elem ) ) {
+ ret = jQuery.style( elem, name );
+ }
+
+ // A tribute to the "awesome hack by Dean Edwards"
+ // Android Browser returns percentage for some values,
+ // but width seems to be reliably pixels.
+ // This is against the CSSOM draft spec:
+ // https://drafts.csswg.org/cssom/#resolved-values
+ if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) {
+
+ // Remember the original values
+ width = style.width;
+ minWidth = style.minWidth;
+ maxWidth = style.maxWidth;
+
+ // Put in the new values to get a computed value out
+ style.minWidth = style.maxWidth = style.width = ret;
+ ret = computed.width;
+
+ // Revert the changed values
+ style.width = width;
+ style.minWidth = minWidth;
+ style.maxWidth = maxWidth;
+ }
+ }
+
+ return ret !== undefined ?
+
+ // Support: IE <=9 - 11 only
+ // IE returns zIndex value as an integer.
+ ret + "" :
+ ret;
+}
+
+
+function addGetHookIf( conditionFn, hookFn ) {
+
+ // Define the hook, we'll check on the first run if it's really needed.
+ return {
+ get: function() {
+ if ( conditionFn() ) {
+
+ // Hook not needed (or it's not possible to use it due
+ // to missing dependency), remove it.
+ delete this.get;
+ return;
+ }
+
+ // Hook needed; redefine it so that the support test is not executed again.
+ return ( this.get = hookFn ).apply( this, arguments );
+ }
+ };
+}
+
+
+var
+
+ // Swappable if display is none or starts with table
+ // except "table", "table-cell", or "table-caption"
+ // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display
+ rdisplayswap = /^(none|table(?!-c[ea]).+)/,
+ rcustomProp = /^--/,
+ cssShow = { position: "absolute", visibility: "hidden", display: "block" },
+ cssNormalTransform = {
+ letterSpacing: "0",
+ fontWeight: "400"
+ },
+
+ cssPrefixes = [ "Webkit", "Moz", "ms" ],
+ emptyStyle = document.createElement( "div" ).style;
+
+// Return a css property mapped to a potentially vendor prefixed property
+function vendorPropName( name ) {
+
+ // Shortcut for names that are not vendor prefixed
+ if ( name in emptyStyle ) {
+ return name;
+ }
+
+ // Check for vendor prefixed names
+ var capName = name[ 0 ].toUpperCase() + name.slice( 1 ),
+ i = cssPrefixes.length;
+
+ while ( i-- ) {
+ name = cssPrefixes[ i ] + capName;
+ if ( name in emptyStyle ) {
+ return name;
+ }
+ }
+}
+
+// Return a property mapped along what jQuery.cssProps suggests or to
+// a vendor prefixed property.
+function finalPropName( name ) {
+ var ret = jQuery.cssProps[ name ];
+ if ( !ret ) {
+ ret = jQuery.cssProps[ name ] = vendorPropName( name ) || name;
+ }
+ return ret;
+}
+
+function setPositiveNumber( elem, value, subtract ) {
+
+ // Any relative (+/-) values have already been
+ // normalized at this point
+ var matches = rcssNum.exec( value );
+ return matches ?
+
+ // Guard against undefined "subtract", e.g., when used as in cssHooks
+ Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) :
+ value;
+}
+
+function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) {
+ var i = dimension === "width" ? 1 : 0,
+ extra = 0,
+ delta = 0;
+
+ // Adjustment may not be necessary
+ if ( box === ( isBorderBox ? "border" : "content" ) ) {
+ return 0;
+ }
+
+ for ( ; i < 4; i += 2 ) {
+
+ // Both box models exclude margin
+ if ( box === "margin" ) {
+ delta += jQuery.css( elem, box + cssExpand[ i ], true, styles );
+ }
+
+ // If we get here with a content-box, we're seeking "padding" or "border" or "margin"
+ if ( !isBorderBox ) {
+
+ // Add padding
+ delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
+
+ // For "border" or "margin", add border
+ if ( box !== "padding" ) {
+ delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+
+ // But still keep track of it otherwise
+ } else {
+ extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+ }
+
+ // If we get here with a border-box (content + padding + border), we're seeking "content" or
+ // "padding" or "margin"
+ } else {
+
+ // For "content", subtract padding
+ if ( box === "content" ) {
+ delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
+ }
+
+ // For "content" or "padding", subtract border
+ if ( box !== "margin" ) {
+ delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+ }
+ }
+ }
+
+ // Account for positive content-box scroll gutter when requested by providing computedVal
+ if ( !isBorderBox && computedVal >= 0 ) {
+
+ // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border
+ // Assuming integer scroll gutter, subtract the rest and round down
+ delta += Math.max( 0, Math.ceil(
+ elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] -
+ computedVal -
+ delta -
+ extra -
+ 0.5
+ ) );
+ }
+
+ return delta;
+}
+
+function getWidthOrHeight( elem, dimension, extra ) {
+
+ // Start with computed style
+ var styles = getStyles( elem ),
+ val = curCSS( elem, dimension, styles ),
+ isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box",
+ valueIsBorderBox = isBorderBox;
+
+ // Support: Firefox <=54
+ // Return a confounding non-pixel value or feign ignorance, as appropriate.
+ if ( rnumnonpx.test( val ) ) {
+ if ( !extra ) {
+ return val;
+ }
+ val = "auto";
+ }
+
+ // Check for style in case a browser which returns unreliable values
+ // for getComputedStyle silently falls back to the reliable elem.style
+ valueIsBorderBox = valueIsBorderBox &&
+ ( support.boxSizingReliable() || val === elem.style[ dimension ] );
+
+ // Fall back to offsetWidth/offsetHeight when value is "auto"
+ // This happens for inline elements with no explicit setting (gh-3571)
+ // Support: Android <=4.1 - 4.3 only
+ // Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602)
+ if ( val === "auto" ||
+ !parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) {
+
+ val = elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ];
+
+ // offsetWidth/offsetHeight provide border-box values
+ valueIsBorderBox = true;
+ }
+
+ // Normalize "" and auto
+ val = parseFloat( val ) || 0;
+
+ // Adjust for the element's box model
+ return ( val +
+ boxModelAdjustment(
+ elem,
+ dimension,
+ extra || ( isBorderBox ? "border" : "content" ),
+ valueIsBorderBox,
+ styles,
+
+ // Provide the current computed size to request scroll gutter calculation (gh-3589)
+ val
+ )
+ ) + "px";
+}
+
+jQuery.extend( {
+
+ // Add in style property hooks for overriding the default
+ // behavior of getting and setting a style property
+ cssHooks: {
+ opacity: {
+ get: function( elem, computed ) {
+ if ( computed ) {
+
+ // We should always get a number back from opacity
+ var ret = curCSS( elem, "opacity" );
+ return ret === "" ? "1" : ret;
+ }
+ }
+ }
+ },
+
+ // Don't automatically add "px" to these possibly-unitless properties
+ cssNumber: {
+ "animationIterationCount": true,
+ "columnCount": true,
+ "fillOpacity": true,
+ "flexGrow": true,
+ "flexShrink": true,
+ "fontWeight": true,
+ "lineHeight": true,
+ "opacity": true,
+ "order": true,
+ "orphans": true,
+ "widows": true,
+ "zIndex": true,
+ "zoom": true
+ },
+
+ // Add in properties whose names you wish to fix before
+ // setting or getting the value
+ cssProps: {},
+
+ // Get and set the style property on a DOM Node
+ style: function( elem, name, value, extra ) {
+
+ // Don't set styles on text and comment nodes
+ if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
+ return;
+ }
+
+ // Make sure that we're working with the right name
+ var ret, type, hooks,
+ origName = camelCase( name ),
+ isCustomProp = rcustomProp.test( name ),
+ style = elem.style;
+
+ // Make sure that we're working with the right name. We don't
+ // want to query the value if it is a CSS custom property
+ // since they are user-defined.
+ if ( !isCustomProp ) {
+ name = finalPropName( origName );
+ }
+
+ // Gets hook for the prefixed version, then unprefixed version
+ hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
+
+ // Check if we're setting a value
+ if ( value !== undefined ) {
+ type = typeof value;
+
+ // Convert "+=" or "-=" to relative numbers (#7345)
+ if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) {
+ value = adjustCSS( elem, name, ret );
+
+ // Fixes bug #9237
+ type = "number";
+ }
+
+ // Make sure that null and NaN values aren't set (#7116)
+ if ( value == null || value !== value ) {
+ return;
+ }
+
+ // If a number was passed in, add the unit (except for certain CSS properties)
+ if ( type === "number" ) {
+ value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" );
+ }
+
+ // background-* props affect original clone's values
+ if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) {
+ style[ name ] = "inherit";
+ }
+
+ // If a hook was provided, use that value, otherwise just set the specified value
+ if ( !hooks || !( "set" in hooks ) ||
+ ( value = hooks.set( elem, value, extra ) ) !== undefined ) {
+
+ if ( isCustomProp ) {
+ style.setProperty( name, value );
+ } else {
+ style[ name ] = value;
+ }
+ }
+
+ } else {
+
+ // If a hook was provided get the non-computed value from there
+ if ( hooks && "get" in hooks &&
+ ( ret = hooks.get( elem, false, extra ) ) !== undefined ) {
+
+ return ret;
+ }
+
+ // Otherwise just get the value from the style object
+ return style[ name ];
+ }
+ },
+
+ css: function( elem, name, extra, styles ) {
+ var val, num, hooks,
+ origName = camelCase( name ),
+ isCustomProp = rcustomProp.test( name );
+
+ // Make sure that we're working with the right name. We don't
+ // want to modify the value if it is a CSS custom property
+ // since they are user-defined.
+ if ( !isCustomProp ) {
+ name = finalPropName( origName );
+ }
+
+ // Try prefixed name followed by the unprefixed name
+ hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
+
+ // If a hook was provided get the computed value from there
+ if ( hooks && "get" in hooks ) {
+ val = hooks.get( elem, true, extra );
+ }
+
+ // Otherwise, if a way to get the computed value exists, use that
+ if ( val === undefined ) {
+ val = curCSS( elem, name, styles );
+ }
+
+ // Convert "normal" to computed value
+ if ( val === "normal" && name in cssNormalTransform ) {
+ val = cssNormalTransform[ name ];
+ }
+
+ // Make numeric if forced or a qualifier was provided and val looks numeric
+ if ( extra === "" || extra ) {
+ num = parseFloat( val );
+ return extra === true || isFinite( num ) ? num || 0 : val;
+ }
+
+ return val;
+ }
+} );
+
+jQuery.each( [ "height", "width" ], function( i, dimension ) {
+ jQuery.cssHooks[ dimension ] = {
+ get: function( elem, computed, extra ) {
+ if ( computed ) {
+
+ // Certain elements can have dimension info if we invisibly show them
+ // but it must have a current display style that would benefit
+ return rdisplayswap.test( jQuery.css( elem, "display" ) ) &&
+
+ // Support: Safari 8+
+ // Table columns in Safari have non-zero offsetWidth & zero
+ // getBoundingClientRect().width unless display is changed.
+ // Support: IE <=11 only
+ // Running getBoundingClientRect on a disconnected node
+ // in IE throws an error.
+ ( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ?
+ swap( elem, cssShow, function() {
+ return getWidthOrHeight( elem, dimension, extra );
+ } ) :
+ getWidthOrHeight( elem, dimension, extra );
+ }
+ },
+
+ set: function( elem, value, extra ) {
+ var matches,
+ styles = getStyles( elem ),
+ isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box",
+ subtract = extra && boxModelAdjustment(
+ elem,
+ dimension,
+ extra,
+ isBorderBox,
+ styles
+ );
+
+ // Account for unreliable border-box dimensions by comparing offset* to computed and
+ // faking a content-box to get border and padding (gh-3699)
+ if ( isBorderBox && support.scrollboxSize() === styles.position ) {
+ subtract -= Math.ceil(
+ elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] -
+ parseFloat( styles[ dimension ] ) -
+ boxModelAdjustment( elem, dimension, "border", false, styles ) -
+ 0.5
+ );
+ }
+
+ // Convert to pixels if value adjustment is needed
+ if ( subtract && ( matches = rcssNum.exec( value ) ) &&
+ ( matches[ 3 ] || "px" ) !== "px" ) {
+
+ elem.style[ dimension ] = value;
+ value = jQuery.css( elem, dimension );
+ }
+
+ return setPositiveNumber( elem, value, subtract );
+ }
+ };
+} );
+
+jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft,
+ function( elem, computed ) {
+ if ( computed ) {
+ return ( parseFloat( curCSS( elem, "marginLeft" ) ) ||
+ elem.getBoundingClientRect().left -
+ swap( elem, { marginLeft: 0 }, function() {
+ return elem.getBoundingClientRect().left;
+ } )
+ ) + "px";
+ }
+ }
+);
+
+// These hooks are used by animate to expand properties
+jQuery.each( {
+ margin: "",
+ padding: "",
+ border: "Width"
+}, function( prefix, suffix ) {
+ jQuery.cssHooks[ prefix + suffix ] = {
+ expand: function( value ) {
+ var i = 0,
+ expanded = {},
+
+ // Assumes a single number if not a string
+ parts = typeof value === "string" ? value.split( " " ) : [ value ];
+
+ for ( ; i < 4; i++ ) {
+ expanded[ prefix + cssExpand[ i ] + suffix ] =
+ parts[ i ] || parts[ i - 2 ] || parts[ 0 ];
+ }
+
+ return expanded;
+ }
+ };
+
+ if ( prefix !== "margin" ) {
+ jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber;
+ }
+} );
+
+jQuery.fn.extend( {
+ css: function( name, value ) {
+ return access( this, function( elem, name, value ) {
+ var styles, len,
+ map = {},
+ i = 0;
+
+ if ( Array.isArray( name ) ) {
+ styles = getStyles( elem );
+ len = name.length;
+
+ for ( ; i < len; i++ ) {
+ map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles );
+ }
+
+ return map;
+ }
+
+ return value !== undefined ?
+ jQuery.style( elem, name, value ) :
+ jQuery.css( elem, name );
+ }, name, value, arguments.length > 1 );
+ }
+} );
+
+
+function Tween( elem, options, prop, end, easing ) {
+ return new Tween.prototype.init( elem, options, prop, end, easing );
+}
+jQuery.Tween = Tween;
+
+Tween.prototype = {
+ constructor: Tween,
+ init: function( elem, options, prop, end, easing, unit ) {
+ this.elem = elem;
+ this.prop = prop;
+ this.easing = easing || jQuery.easing._default;
+ this.options = options;
+ this.start = this.now = this.cur();
+ this.end = end;
+ this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" );
+ },
+ cur: function() {
+ var hooks = Tween.propHooks[ this.prop ];
+
+ return hooks && hooks.get ?
+ hooks.get( this ) :
+ Tween.propHooks._default.get( this );
+ },
+ run: function( percent ) {
+ var eased,
+ hooks = Tween.propHooks[ this.prop ];
+
+ if ( this.options.duration ) {
+ this.pos = eased = jQuery.easing[ this.easing ](
+ percent, this.options.duration * percent, 0, 1, this.options.duration
+ );
+ } else {
+ this.pos = eased = percent;
+ }
+ this.now = ( this.end - this.start ) * eased + this.start;
+
+ if ( this.options.step ) {
+ this.options.step.call( this.elem, this.now, this );
+ }
+
+ if ( hooks && hooks.set ) {
+ hooks.set( this );
+ } else {
+ Tween.propHooks._default.set( this );
+ }
+ return this;
+ }
+};
+
+Tween.prototype.init.prototype = Tween.prototype;
+
+Tween.propHooks = {
+ _default: {
+ get: function( tween ) {
+ var result;
+
+ // Use a property on the element directly when it is not a DOM element,
+ // or when there is no matching style property that exists.
+ if ( tween.elem.nodeType !== 1 ||
+ tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) {
+ return tween.elem[ tween.prop ];
+ }
+
+ // Passing an empty string as a 3rd parameter to .css will automatically
+ // attempt a parseFloat and fallback to a string if the parse fails.
+ // Simple values such as "10px" are parsed to Float;
+ // complex values such as "rotate(1rad)" are returned as-is.
+ result = jQuery.css( tween.elem, tween.prop, "" );
+
+ // Empty strings, null, undefined and "auto" are converted to 0.
+ return !result || result === "auto" ? 0 : result;
+ },
+ set: function( tween ) {
+
+ // Use step hook for back compat.
+ // Use cssHook if its there.
+ // Use .style if available and use plain properties where available.
+ if ( jQuery.fx.step[ tween.prop ] ) {
+ jQuery.fx.step[ tween.prop ]( tween );
+ } else if ( tween.elem.nodeType === 1 &&
+ ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null ||
+ jQuery.cssHooks[ tween.prop ] ) ) {
+ jQuery.style( tween.elem, tween.prop, tween.now + tween.unit );
+ } else {
+ tween.elem[ tween.prop ] = tween.now;
+ }
+ }
+ }
+};
+
+// Support: IE <=9 only
+// Panic based approach to setting things on disconnected nodes
+Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
+ set: function( tween ) {
+ if ( tween.elem.nodeType && tween.elem.parentNode ) {
+ tween.elem[ tween.prop ] = tween.now;
+ }
+ }
+};
+
+jQuery.easing = {
+ linear: function( p ) {
+ return p;
+ },
+ swing: function( p ) {
+ return 0.5 - Math.cos( p * Math.PI ) / 2;
+ },
+ _default: "swing"
+};
+
+jQuery.fx = Tween.prototype.init;
+
+// Back compat <1.8 extension point
+jQuery.fx.step = {};
+
+
+
+
+var
+ fxNow, inProgress,
+ rfxtypes = /^(?:toggle|show|hide)$/,
+ rrun = /queueHooks$/;
+
+function schedule() {
+ if ( inProgress ) {
+ if ( document.hidden === false && window.requestAnimationFrame ) {
+ window.requestAnimationFrame( schedule );
+ } else {
+ window.setTimeout( schedule, jQuery.fx.interval );
+ }
+
+ jQuery.fx.tick();
+ }
+}
+
+// Animations created synchronously will run synchronously
+function createFxNow() {
+ window.setTimeout( function() {
+ fxNow = undefined;
+ } );
+ return ( fxNow = Date.now() );
+}
+
+// Generate parameters to create a standard animation
+function genFx( type, includeWidth ) {
+ var which,
+ i = 0,
+ attrs = { height: type };
+
+ // If we include width, step value is 1 to do all cssExpand values,
+ // otherwise step value is 2 to skip over Left and Right
+ includeWidth = includeWidth ? 1 : 0;
+ for ( ; i < 4; i += 2 - includeWidth ) {
+ which = cssExpand[ i ];
+ attrs[ "margin" + which ] = attrs[ "padding" + which ] = type;
+ }
+
+ if ( includeWidth ) {
+ attrs.opacity = attrs.width = type;
+ }
+
+ return attrs;
+}
+
+function createTween( value, prop, animation ) {
+ var tween,
+ collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ),
+ index = 0,
+ length = collection.length;
+ for ( ; index < length; index++ ) {
+ if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) {
+
+ // We're done with this property
+ return tween;
+ }
+ }
+}
+
+function defaultPrefilter( elem, props, opts ) {
+ var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display,
+ isBox = "width" in props || "height" in props,
+ anim = this,
+ orig = {},
+ style = elem.style,
+ hidden = elem.nodeType && isHiddenWithinTree( elem ),
+ dataShow = dataPriv.get( elem, "fxshow" );
+
+ // Queue-skipping animations hijack the fx hooks
+ if ( !opts.queue ) {
+ hooks = jQuery._queueHooks( elem, "fx" );
+ if ( hooks.unqueued == null ) {
+ hooks.unqueued = 0;
+ oldfire = hooks.empty.fire;
+ hooks.empty.fire = function() {
+ if ( !hooks.unqueued ) {
+ oldfire();
+ }
+ };
+ }
+ hooks.unqueued++;
+
+ anim.always( function() {
+
+ // Ensure the complete handler is called before this completes
+ anim.always( function() {
+ hooks.unqueued--;
+ if ( !jQuery.queue( elem, "fx" ).length ) {
+ hooks.empty.fire();
+ }
+ } );
+ } );
+ }
+
+ // Detect show/hide animations
+ for ( prop in props ) {
+ value = props[ prop ];
+ if ( rfxtypes.test( value ) ) {
+ delete props[ prop ];
+ toggle = toggle || value === "toggle";
+ if ( value === ( hidden ? "hide" : "show" ) ) {
+
+ // Pretend to be hidden if this is a "show" and
+ // there is still data from a stopped show/hide
+ if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) {
+ hidden = true;
+
+ // Ignore all other no-op show/hide data
+ } else {
+ continue;
+ }
+ }
+ orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop );
+ }
+ }
+
+ // Bail out if this is a no-op like .hide().hide()
+ propTween = !jQuery.isEmptyObject( props );
+ if ( !propTween && jQuery.isEmptyObject( orig ) ) {
+ return;
+ }
+
+ // Restrict "overflow" and "display" styles during box animations
+ if ( isBox && elem.nodeType === 1 ) {
+
+ // Support: IE <=9 - 11, Edge 12 - 15
+ // Record all 3 overflow attributes because IE does not infer the shorthand
+ // from identically-valued overflowX and overflowY and Edge just mirrors
+ // the overflowX value there.
+ opts.overflow = [ style.overflow, style.overflowX, style.overflowY ];
+
+ // Identify a display type, preferring old show/hide data over the CSS cascade
+ restoreDisplay = dataShow && dataShow.display;
+ if ( restoreDisplay == null ) {
+ restoreDisplay = dataPriv.get( elem, "display" );
+ }
+ display = jQuery.css( elem, "display" );
+ if ( display === "none" ) {
+ if ( restoreDisplay ) {
+ display = restoreDisplay;
+ } else {
+
+ // Get nonempty value(s) by temporarily forcing visibility
+ showHide( [ elem ], true );
+ restoreDisplay = elem.style.display || restoreDisplay;
+ display = jQuery.css( elem, "display" );
+ showHide( [ elem ] );
+ }
+ }
+
+ // Animate inline elements as inline-block
+ if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) {
+ if ( jQuery.css( elem, "float" ) === "none" ) {
+
+ // Restore the original display value at the end of pure show/hide animations
+ if ( !propTween ) {
+ anim.done( function() {
+ style.display = restoreDisplay;
+ } );
+ if ( restoreDisplay == null ) {
+ display = style.display;
+ restoreDisplay = display === "none" ? "" : display;
+ }
+ }
+ style.display = "inline-block";
+ }
+ }
+ }
+
+ if ( opts.overflow ) {
+ style.overflow = "hidden";
+ anim.always( function() {
+ style.overflow = opts.overflow[ 0 ];
+ style.overflowX = opts.overflow[ 1 ];
+ style.overflowY = opts.overflow[ 2 ];
+ } );
+ }
+
+ // Implement show/hide animations
+ propTween = false;
+ for ( prop in orig ) {
+
+ // General show/hide setup for this element animation
+ if ( !propTween ) {
+ if ( dataShow ) {
+ if ( "hidden" in dataShow ) {
+ hidden = dataShow.hidden;
+ }
+ } else {
+ dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } );
+ }
+
+ // Store hidden/visible for toggle so `.stop().toggle()` "reverses"
+ if ( toggle ) {
+ dataShow.hidden = !hidden;
+ }
+
+ // Show elements before animating them
+ if ( hidden ) {
+ showHide( [ elem ], true );
+ }
+
+ /* eslint-disable no-loop-func */
+
+ anim.done( function() {
+
+ /* eslint-enable no-loop-func */
+
+ // The final step of a "hide" animation is actually hiding the element
+ if ( !hidden ) {
+ showHide( [ elem ] );
+ }
+ dataPriv.remove( elem, "fxshow" );
+ for ( prop in orig ) {
+ jQuery.style( elem, prop, orig[ prop ] );
+ }
+ } );
+ }
+
+ // Per-property setup
+ propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim );
+ if ( !( prop in dataShow ) ) {
+ dataShow[ prop ] = propTween.start;
+ if ( hidden ) {
+ propTween.end = propTween.start;
+ propTween.start = 0;
+ }
+ }
+ }
+}
+
+function propFilter( props, specialEasing ) {
+ var index, name, easing, value, hooks;
+
+ // camelCase, specialEasing and expand cssHook pass
+ for ( index in props ) {
+ name = camelCase( index );
+ easing = specialEasing[ name ];
+ value = props[ index ];
+ if ( Array.isArray( value ) ) {
+ easing = value[ 1 ];
+ value = props[ index ] = value[ 0 ];
+ }
+
+ if ( index !== name ) {
+ props[ name ] = value;
+ delete props[ index ];
+ }
+
+ hooks = jQuery.cssHooks[ name ];
+ if ( hooks && "expand" in hooks ) {
+ value = hooks.expand( value );
+ delete props[ name ];
+
+ // Not quite $.extend, this won't overwrite existing keys.
+ // Reusing 'index' because we have the correct "name"
+ for ( index in value ) {
+ if ( !( index in props ) ) {
+ props[ index ] = value[ index ];
+ specialEasing[ index ] = easing;
+ }
+ }
+ } else {
+ specialEasing[ name ] = easing;
+ }
+ }
+}
+
+function Animation( elem, properties, options ) {
+ var result,
+ stopped,
+ index = 0,
+ length = Animation.prefilters.length,
+ deferred = jQuery.Deferred().always( function() {
+
+ // Don't match elem in the :animated selector
+ delete tick.elem;
+ } ),
+ tick = function() {
+ if ( stopped ) {
+ return false;
+ }
+ var currentTime = fxNow || createFxNow(),
+ remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ),
+
+ // Support: Android 2.3 only
+ // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497)
+ temp = remaining / animation.duration || 0,
+ percent = 1 - temp,
+ index = 0,
+ length = animation.tweens.length;
+
+ for ( ; index < length; index++ ) {
+ animation.tweens[ index ].run( percent );
+ }
+
+ deferred.notifyWith( elem, [ animation, percent, remaining ] );
+
+ // If there's more to do, yield
+ if ( percent < 1 && length ) {
+ return remaining;
+ }
+
+ // If this was an empty animation, synthesize a final progress notification
+ if ( !length ) {
+ deferred.notifyWith( elem, [ animation, 1, 0 ] );
+ }
+
+ // Resolve the animation and report its conclusion
+ deferred.resolveWith( elem, [ animation ] );
+ return false;
+ },
+ animation = deferred.promise( {
+ elem: elem,
+ props: jQuery.extend( {}, properties ),
+ opts: jQuery.extend( true, {
+ specialEasing: {},
+ easing: jQuery.easing._default
+ }, options ),
+ originalProperties: properties,
+ originalOptions: options,
+ startTime: fxNow || createFxNow(),
+ duration: options.duration,
+ tweens: [],
+ createTween: function( prop, end ) {
+ var tween = jQuery.Tween( elem, animation.opts, prop, end,
+ animation.opts.specialEasing[ prop ] || animation.opts.easing );
+ animation.tweens.push( tween );
+ return tween;
+ },
+ stop: function( gotoEnd ) {
+ var index = 0,
+
+ // If we are going to the end, we want to run all the tweens
+ // otherwise we skip this part
+ length = gotoEnd ? animation.tweens.length : 0;
+ if ( stopped ) {
+ return this;
+ }
+ stopped = true;
+ for ( ; index < length; index++ ) {
+ animation.tweens[ index ].run( 1 );
+ }
+
+ // Resolve when we played the last frame; otherwise, reject
+ if ( gotoEnd ) {
+ deferred.notifyWith( elem, [ animation, 1, 0 ] );
+ deferred.resolveWith( elem, [ animation, gotoEnd ] );
+ } else {
+ deferred.rejectWith( elem, [ animation, gotoEnd ] );
+ }
+ return this;
+ }
+ } ),
+ props = animation.props;
+
+ propFilter( props, animation.opts.specialEasing );
+
+ for ( ; index < length; index++ ) {
+ result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts );
+ if ( result ) {
+ if ( isFunction( result.stop ) ) {
+ jQuery._queueHooks( animation.elem, animation.opts.queue ).stop =
+ result.stop.bind( result );
+ }
+ return result;
+ }
+ }
+
+ jQuery.map( props, createTween, animation );
+
+ if ( isFunction( animation.opts.start ) ) {
+ animation.opts.start.call( elem, animation );
+ }
+
+ // Attach callbacks from options
+ animation
+ .progress( animation.opts.progress )
+ .done( animation.opts.done, animation.opts.complete )
+ .fail( animation.opts.fail )
+ .always( animation.opts.always );
+
+ jQuery.fx.timer(
+ jQuery.extend( tick, {
+ elem: elem,
+ anim: animation,
+ queue: animation.opts.queue
+ } )
+ );
+
+ return animation;
+}
+
+jQuery.Animation = jQuery.extend( Animation, {
+
+ tweeners: {
+ "*": [ function( prop, value ) {
+ var tween = this.createTween( prop, value );
+ adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween );
+ return tween;
+ } ]
+ },
+
+ tweener: function( props, callback ) {
+ if ( isFunction( props ) ) {
+ callback = props;
+ props = [ "*" ];
+ } else {
+ props = props.match( rnothtmlwhite );
+ }
+
+ var prop,
+ index = 0,
+ length = props.length;
+
+ for ( ; index < length; index++ ) {
+ prop = props[ index ];
+ Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || [];
+ Animation.tweeners[ prop ].unshift( callback );
+ }
+ },
+
+ prefilters: [ defaultPrefilter ],
+
+ prefilter: function( callback, prepend ) {
+ if ( prepend ) {
+ Animation.prefilters.unshift( callback );
+ } else {
+ Animation.prefilters.push( callback );
+ }
+ }
+} );
+
+jQuery.speed = function( speed, easing, fn ) {
+ var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : {
+ complete: fn || !fn && easing ||
+ isFunction( speed ) && speed,
+ duration: speed,
+ easing: fn && easing || easing && !isFunction( easing ) && easing
+ };
+
+ // Go to the end state if fx are off
+ if ( jQuery.fx.off ) {
+ opt.duration = 0;
+
+ } else {
+ if ( typeof opt.duration !== "number" ) {
+ if ( opt.duration in jQuery.fx.speeds ) {
+ opt.duration = jQuery.fx.speeds[ opt.duration ];
+
+ } else {
+ opt.duration = jQuery.fx.speeds._default;
+ }
+ }
+ }
+
+ // Normalize opt.queue - true/undefined/null -> "fx"
+ if ( opt.queue == null || opt.queue === true ) {
+ opt.queue = "fx";
+ }
+
+ // Queueing
+ opt.old = opt.complete;
+
+ opt.complete = function() {
+ if ( isFunction( opt.old ) ) {
+ opt.old.call( this );
+ }
+
+ if ( opt.queue ) {
+ jQuery.dequeue( this, opt.queue );
+ }
+ };
+
+ return opt;
+};
+
+jQuery.fn.extend( {
+ fadeTo: function( speed, to, easing, callback ) {
+
+ // Show any hidden elements after setting opacity to 0
+ return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show()
+
+ // Animate to the value specified
+ .end().animate( { opacity: to }, speed, easing, callback );
+ },
+ animate: function( prop, speed, easing, callback ) {
+ var empty = jQuery.isEmptyObject( prop ),
+ optall = jQuery.speed( speed, easing, callback ),
+ doAnimation = function() {
+
+ // Operate on a copy of prop so per-property easing won't be lost
+ var anim = Animation( this, jQuery.extend( {}, prop ), optall );
+
+ // Empty animations, or finishing resolves immediately
+ if ( empty || dataPriv.get( this, "finish" ) ) {
+ anim.stop( true );
+ }
+ };
+ doAnimation.finish = doAnimation;
+
+ return empty || optall.queue === false ?
+ this.each( doAnimation ) :
+ this.queue( optall.queue, doAnimation );
+ },
+ stop: function( type, clearQueue, gotoEnd ) {
+ var stopQueue = function( hooks ) {
+ var stop = hooks.stop;
+ delete hooks.stop;
+ stop( gotoEnd );
+ };
+
+ if ( typeof type !== "string" ) {
+ gotoEnd = clearQueue;
+ clearQueue = type;
+ type = undefined;
+ }
+ if ( clearQueue && type !== false ) {
+ this.queue( type || "fx", [] );
+ }
+
+ return this.each( function() {
+ var dequeue = true,
+ index = type != null && type + "queueHooks",
+ timers = jQuery.timers,
+ data = dataPriv.get( this );
+
+ if ( index ) {
+ if ( data[ index ] && data[ index ].stop ) {
+ stopQueue( data[ index ] );
+ }
+ } else {
+ for ( index in data ) {
+ if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) {
+ stopQueue( data[ index ] );
+ }
+ }
+ }
+
+ for ( index = timers.length; index--; ) {
+ if ( timers[ index ].elem === this &&
+ ( type == null || timers[ index ].queue === type ) ) {
+
+ timers[ index ].anim.stop( gotoEnd );
+ dequeue = false;
+ timers.splice( index, 1 );
+ }
+ }
+
+ // Start the next in the queue if the last step wasn't forced.
+ // Timers currently will call their complete callbacks, which
+ // will dequeue but only if they were gotoEnd.
+ if ( dequeue || !gotoEnd ) {
+ jQuery.dequeue( this, type );
+ }
+ } );
+ },
+ finish: function( type ) {
+ if ( type !== false ) {
+ type = type || "fx";
+ }
+ return this.each( function() {
+ var index,
+ data = dataPriv.get( this ),
+ queue = data[ type + "queue" ],
+ hooks = data[ type + "queueHooks" ],
+ timers = jQuery.timers,
+ length = queue ? queue.length : 0;
+
+ // Enable finishing flag on private data
+ data.finish = true;
+
+ // Empty the queue first
+ jQuery.queue( this, type, [] );
+
+ if ( hooks && hooks.stop ) {
+ hooks.stop.call( this, true );
+ }
+
+ // Look for any active animations, and finish them
+ for ( index = timers.length; index--; ) {
+ if ( timers[ index ].elem === this && timers[ index ].queue === type ) {
+ timers[ index ].anim.stop( true );
+ timers.splice( index, 1 );
+ }
+ }
+
+ // Look for any animations in the old queue and finish them
+ for ( index = 0; index < length; index++ ) {
+ if ( queue[ index ] && queue[ index ].finish ) {
+ queue[ index ].finish.call( this );
+ }
+ }
+
+ // Turn off finishing flag
+ delete data.finish;
+ } );
+ }
+} );
+
+jQuery.each( [ "toggle", "show", "hide" ], function( i, name ) {
+ var cssFn = jQuery.fn[ name ];
+ jQuery.fn[ name ] = function( speed, easing, callback ) {
+ return speed == null || typeof speed === "boolean" ?
+ cssFn.apply( this, arguments ) :
+ this.animate( genFx( name, true ), speed, easing, callback );
+ };
+} );
+
+// Generate shortcuts for custom animations
+jQuery.each( {
+ slideDown: genFx( "show" ),
+ slideUp: genFx( "hide" ),
+ slideToggle: genFx( "toggle" ),
+ fadeIn: { opacity: "show" },
+ fadeOut: { opacity: "hide" },
+ fadeToggle: { opacity: "toggle" }
+}, function( name, props ) {
+ jQuery.fn[ name ] = function( speed, easing, callback ) {
+ return this.animate( props, speed, easing, callback );
+ };
+} );
+
+jQuery.timers = [];
+jQuery.fx.tick = function() {
+ var timer,
+ i = 0,
+ timers = jQuery.timers;
+
+ fxNow = Date.now();
+
+ for ( ; i < timers.length; i++ ) {
+ timer = timers[ i ];
+
+ // Run the timer and safely remove it when done (allowing for external removal)
+ if ( !timer() && timers[ i ] === timer ) {
+ timers.splice( i--, 1 );
+ }
+ }
+
+ if ( !timers.length ) {
+ jQuery.fx.stop();
+ }
+ fxNow = undefined;
+};
+
+jQuery.fx.timer = function( timer ) {
+ jQuery.timers.push( timer );
+ jQuery.fx.start();
+};
+
+jQuery.fx.interval = 13;
+jQuery.fx.start = function() {
+ if ( inProgress ) {
+ return;
+ }
+
+ inProgress = true;
+ schedule();
+};
+
+jQuery.fx.stop = function() {
+ inProgress = null;
+};
+
+jQuery.fx.speeds = {
+ slow: 600,
+ fast: 200,
+
+ // Default speed
+ _default: 400
+};
+
+
+// Based off of the plugin by Clint Helfers, with permission.
+// https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/
+jQuery.fn.delay = function( time, type ) {
+ time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time;
+ type = type || "fx";
+
+ return this.queue( type, function( next, hooks ) {
+ var timeout = window.setTimeout( next, time );
+ hooks.stop = function() {
+ window.clearTimeout( timeout );
+ };
+ } );
+};
+
+
+( function() {
+ var input = document.createElement( "input" ),
+ select = document.createElement( "select" ),
+ opt = select.appendChild( document.createElement( "option" ) );
+
+ input.type = "checkbox";
+
+ // Support: Android <=4.3 only
+ // Default value for a checkbox should be "on"
+ support.checkOn = input.value !== "";
+
+ // Support: IE <=11 only
+ // Must access selectedIndex to make default options select
+ support.optSelected = opt.selected;
+
+ // Support: IE <=11 only
+ // An input loses its value after becoming a radio
+ input = document.createElement( "input" );
+ input.value = "t";
+ input.type = "radio";
+ support.radioValue = input.value === "t";
+} )();
+
+
+var boolHook,
+ attrHandle = jQuery.expr.attrHandle;
+
+jQuery.fn.extend( {
+ attr: function( name, value ) {
+ return access( this, jQuery.attr, name, value, arguments.length > 1 );
+ },
+
+ removeAttr: function( name ) {
+ return this.each( function() {
+ jQuery.removeAttr( this, name );
+ } );
+ }
+} );
+
+jQuery.extend( {
+ attr: function( elem, name, value ) {
+ var ret, hooks,
+ nType = elem.nodeType;
+
+ // Don't get/set attributes on text, comment and attribute nodes
+ if ( nType === 3 || nType === 8 || nType === 2 ) {
+ return;
+ }
+
+ // Fallback to prop when attributes are not supported
+ if ( typeof elem.getAttribute === "undefined" ) {
+ return jQuery.prop( elem, name, value );
+ }
+
+ // Attribute hooks are determined by the lowercase version
+ // Grab necessary hook if one is defined
+ if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {
+ hooks = jQuery.attrHooks[ name.toLowerCase() ] ||
+ ( jQuery.expr.match.bool.test( name ) ? boolHook : undefined );
+ }
+
+ if ( value !== undefined ) {
+ if ( value === null ) {
+ jQuery.removeAttr( elem, name );
+ return;
+ }
+
+ if ( hooks && "set" in hooks &&
+ ( ret = hooks.set( elem, value, name ) ) !== undefined ) {
+ return ret;
+ }
+
+ elem.setAttribute( name, value + "" );
+ return value;
+ }
+
+ if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {
+ return ret;
+ }
+
+ ret = jQuery.find.attr( elem, name );
+
+ // Non-existent attributes return null, we normalize to undefined
+ return ret == null ? undefined : ret;
+ },
+
+ attrHooks: {
+ type: {
+ set: function( elem, value ) {
+ if ( !support.radioValue && value === "radio" &&
+ nodeName( elem, "input" ) ) {
+ var val = elem.value;
+ elem.setAttribute( "type", value );
+ if ( val ) {
+ elem.value = val;
+ }
+ return value;
+ }
+ }
+ }
+ },
+
+ removeAttr: function( elem, value ) {
+ var name,
+ i = 0,
+
+ // Attribute names can contain non-HTML whitespace characters
+ // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2
+ attrNames = value && value.match( rnothtmlwhite );
+
+ if ( attrNames && elem.nodeType === 1 ) {
+ while ( ( name = attrNames[ i++ ] ) ) {
+ elem.removeAttribute( name );
+ }
+ }
+ }
+} );
+
+// Hooks for boolean attributes
+boolHook = {
+ set: function( elem, value, name ) {
+ if ( value === false ) {
+
+ // Remove boolean attributes when set to false
+ jQuery.removeAttr( elem, name );
+ } else {
+ elem.setAttribute( name, name );
+ }
+ return name;
+ }
+};
+
+jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( i, name ) {
+ var getter = attrHandle[ name ] || jQuery.find.attr;
+
+ attrHandle[ name ] = function( elem, name, isXML ) {
+ var ret, handle,
+ lowercaseName = name.toLowerCase();
+
+ if ( !isXML ) {
+
+ // Avoid an infinite loop by temporarily removing this function from the getter
+ handle = attrHandle[ lowercaseName ];
+ attrHandle[ lowercaseName ] = ret;
+ ret = getter( elem, name, isXML ) != null ?
+ lowercaseName :
+ null;
+ attrHandle[ lowercaseName ] = handle;
+ }
+ return ret;
+ };
+} );
+
+
+
+
+var rfocusable = /^(?:input|select|textarea|button)$/i,
+ rclickable = /^(?:a|area)$/i;
+
+jQuery.fn.extend( {
+ prop: function( name, value ) {
+ return access( this, jQuery.prop, name, value, arguments.length > 1 );
+ },
+
+ removeProp: function( name ) {
+ return this.each( function() {
+ delete this[ jQuery.propFix[ name ] || name ];
+ } );
+ }
+} );
+
+jQuery.extend( {
+ prop: function( elem, name, value ) {
+ var ret, hooks,
+ nType = elem.nodeType;
+
+ // Don't get/set properties on text, comment and attribute nodes
+ if ( nType === 3 || nType === 8 || nType === 2 ) {
+ return;
+ }
+
+ if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {
+
+ // Fix name and attach hooks
+ name = jQuery.propFix[ name ] || name;
+ hooks = jQuery.propHooks[ name ];
+ }
+
+ if ( value !== undefined ) {
+ if ( hooks && "set" in hooks &&
+ ( ret = hooks.set( elem, value, name ) ) !== undefined ) {
+ return ret;
+ }
+
+ return ( elem[ name ] = value );
+ }
+
+ if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {
+ return ret;
+ }
+
+ return elem[ name ];
+ },
+
+ propHooks: {
+ tabIndex: {
+ get: function( elem ) {
+
+ // Support: IE <=9 - 11 only
+ // elem.tabIndex doesn't always return the
+ // correct value when it hasn't been explicitly set
+ // https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+ // Use proper attribute retrieval(#12072)
+ var tabindex = jQuery.find.attr( elem, "tabindex" );
+
+ if ( tabindex ) {
+ return parseInt( tabindex, 10 );
+ }
+
+ if (
+ rfocusable.test( elem.nodeName ) ||
+ rclickable.test( elem.nodeName ) &&
+ elem.href
+ ) {
+ return 0;
+ }
+
+ return -1;
+ }
+ }
+ },
+
+ propFix: {
+ "for": "htmlFor",
+ "class": "className"
+ }
+} );
+
+// Support: IE <=11 only
+// Accessing the selectedIndex property
+// forces the browser to respect setting selected
+// on the option
+// The getter ensures a default option is selected
+// when in an optgroup
+// eslint rule "no-unused-expressions" is disabled for this code
+// since it considers such accessions noop
+if ( !support.optSelected ) {
+ jQuery.propHooks.selected = {
+ get: function( elem ) {
+
+ /* eslint no-unused-expressions: "off" */
+
+ var parent = elem.parentNode;
+ if ( parent && parent.parentNode ) {
+ parent.parentNode.selectedIndex;
+ }
+ return null;
+ },
+ set: function( elem ) {
+
+ /* eslint no-unused-expressions: "off" */
+
+ var parent = elem.parentNode;
+ if ( parent ) {
+ parent.selectedIndex;
+
+ if ( parent.parentNode ) {
+ parent.parentNode.selectedIndex;
+ }
+ }
+ }
+ };
+}
+
+jQuery.each( [
+ "tabIndex",
+ "readOnly",
+ "maxLength",
+ "cellSpacing",
+ "cellPadding",
+ "rowSpan",
+ "colSpan",
+ "useMap",
+ "frameBorder",
+ "contentEditable"
+], function() {
+ jQuery.propFix[ this.toLowerCase() ] = this;
+} );
+
+
+
+
+ // Strip and collapse whitespace according to HTML spec
+ // https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace
+ function stripAndCollapse( value ) {
+ var tokens = value.match( rnothtmlwhite ) || [];
+ return tokens.join( " " );
+ }
+
+
+function getClass( elem ) {
+ return elem.getAttribute && elem.getAttribute( "class" ) || "";
+}
+
+function classesToArray( value ) {
+ if ( Array.isArray( value ) ) {
+ return value;
+ }
+ if ( typeof value === "string" ) {
+ return value.match( rnothtmlwhite ) || [];
+ }
+ return [];
+}
+
+jQuery.fn.extend( {
+ addClass: function( value ) {
+ var classes, elem, cur, curValue, clazz, j, finalValue,
+ i = 0;
+
+ if ( isFunction( value ) ) {
+ return this.each( function( j ) {
+ jQuery( this ).addClass( value.call( this, j, getClass( this ) ) );
+ } );
+ }
+
+ classes = classesToArray( value );
+
+ if ( classes.length ) {
+ while ( ( elem = this[ i++ ] ) ) {
+ curValue = getClass( elem );
+ cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " );
+
+ if ( cur ) {
+ j = 0;
+ while ( ( clazz = classes[ j++ ] ) ) {
+ if ( cur.indexOf( " " + clazz + " " ) < 0 ) {
+ cur += clazz + " ";
+ }
+ }
+
+ // Only assign if different to avoid unneeded rendering.
+ finalValue = stripAndCollapse( cur );
+ if ( curValue !== finalValue ) {
+ elem.setAttribute( "class", finalValue );
+ }
+ }
+ }
+ }
+
+ return this;
+ },
+
+ removeClass: function( value ) {
+ var classes, elem, cur, curValue, clazz, j, finalValue,
+ i = 0;
+
+ if ( isFunction( value ) ) {
+ return this.each( function( j ) {
+ jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) );
+ } );
+ }
+
+ if ( !arguments.length ) {
+ return this.attr( "class", "" );
+ }
+
+ classes = classesToArray( value );
+
+ if ( classes.length ) {
+ while ( ( elem = this[ i++ ] ) ) {
+ curValue = getClass( elem );
+
+ // This expression is here for better compressibility (see addClass)
+ cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " );
+
+ if ( cur ) {
+ j = 0;
+ while ( ( clazz = classes[ j++ ] ) ) {
+
+ // Remove *all* instances
+ while ( cur.indexOf( " " + clazz + " " ) > -1 ) {
+ cur = cur.replace( " " + clazz + " ", " " );
+ }
+ }
+
+ // Only assign if different to avoid unneeded rendering.
+ finalValue = stripAndCollapse( cur );
+ if ( curValue !== finalValue ) {
+ elem.setAttribute( "class", finalValue );
+ }
+ }
+ }
+ }
+
+ return this;
+ },
+
+ toggleClass: function( value, stateVal ) {
+ var type = typeof value,
+ isValidValue = type === "string" || Array.isArray( value );
+
+ if ( typeof stateVal === "boolean" && isValidValue ) {
+ return stateVal ? this.addClass( value ) : this.removeClass( value );
+ }
+
+ if ( isFunction( value ) ) {
+ return this.each( function( i ) {
+ jQuery( this ).toggleClass(
+ value.call( this, i, getClass( this ), stateVal ),
+ stateVal
+ );
+ } );
+ }
+
+ return this.each( function() {
+ var className, i, self, classNames;
+
+ if ( isValidValue ) {
+
+ // Toggle individual class names
+ i = 0;
+ self = jQuery( this );
+ classNames = classesToArray( value );
+
+ while ( ( className = classNames[ i++ ] ) ) {
+
+ // Check each className given, space separated list
+ if ( self.hasClass( className ) ) {
+ self.removeClass( className );
+ } else {
+ self.addClass( className );
+ }
+ }
+
+ // Toggle whole class name
+ } else if ( value === undefined || type === "boolean" ) {
+ className = getClass( this );
+ if ( className ) {
+
+ // Store className if set
+ dataPriv.set( this, "__className__", className );
+ }
+
+ // If the element has a class name or if we're passed `false`,
+ // then remove the whole classname (if there was one, the above saved it).
+ // Otherwise bring back whatever was previously saved (if anything),
+ // falling back to the empty string if nothing was stored.
+ if ( this.setAttribute ) {
+ this.setAttribute( "class",
+ className || value === false ?
+ "" :
+ dataPriv.get( this, "__className__" ) || ""
+ );
+ }
+ }
+ } );
+ },
+
+ hasClass: function( selector ) {
+ var className, elem,
+ i = 0;
+
+ className = " " + selector + " ";
+ while ( ( elem = this[ i++ ] ) ) {
+ if ( elem.nodeType === 1 &&
+ ( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) {
+ return true;
+ }
+ }
+
+ return false;
+ }
+} );
+
+
+
+
+var rreturn = /\r/g;
+
+jQuery.fn.extend( {
+ val: function( value ) {
+ var hooks, ret, valueIsFunction,
+ elem = this[ 0 ];
+
+ if ( !arguments.length ) {
+ if ( elem ) {
+ hooks = jQuery.valHooks[ elem.type ] ||
+ jQuery.valHooks[ elem.nodeName.toLowerCase() ];
+
+ if ( hooks &&
+ "get" in hooks &&
+ ( ret = hooks.get( elem, "value" ) ) !== undefined
+ ) {
+ return ret;
+ }
+
+ ret = elem.value;
+
+ // Handle most common string cases
+ if ( typeof ret === "string" ) {
+ return ret.replace( rreturn, "" );
+ }
+
+ // Handle cases where value is null/undef or number
+ return ret == null ? "" : ret;
+ }
+
+ return;
+ }
+
+ valueIsFunction = isFunction( value );
+
+ return this.each( function( i ) {
+ var val;
+
+ if ( this.nodeType !== 1 ) {
+ return;
+ }
+
+ if ( valueIsFunction ) {
+ val = value.call( this, i, jQuery( this ).val() );
+ } else {
+ val = value;
+ }
+
+ // Treat null/undefined as ""; convert numbers to string
+ if ( val == null ) {
+ val = "";
+
+ } else if ( typeof val === "number" ) {
+ val += "";
+
+ } else if ( Array.isArray( val ) ) {
+ val = jQuery.map( val, function( value ) {
+ return value == null ? "" : value + "";
+ } );
+ }
+
+ hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ];
+
+ // If set returns undefined, fall back to normal setting
+ if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) {
+ this.value = val;
+ }
+ } );
+ }
+} );
+
+jQuery.extend( {
+ valHooks: {
+ option: {
+ get: function( elem ) {
+
+ var val = jQuery.find.attr( elem, "value" );
+ return val != null ?
+ val :
+
+ // Support: IE <=10 - 11 only
+ // option.text throws exceptions (#14686, #14858)
+ // Strip and collapse whitespace
+ // https://html.spec.whatwg.org/#strip-and-collapse-whitespace
+ stripAndCollapse( jQuery.text( elem ) );
+ }
+ },
+ select: {
+ get: function( elem ) {
+ var value, option, i,
+ options = elem.options,
+ index = elem.selectedIndex,
+ one = elem.type === "select-one",
+ values = one ? null : [],
+ max = one ? index + 1 : options.length;
+
+ if ( index < 0 ) {
+ i = max;
+
+ } else {
+ i = one ? index : 0;
+ }
+
+ // Loop through all the selected options
+ for ( ; i < max; i++ ) {
+ option = options[ i ];
+
+ // Support: IE <=9 only
+ // IE8-9 doesn't update selected after form reset (#2551)
+ if ( ( option.selected || i === index ) &&
+
+ // Don't return options that are disabled or in a disabled optgroup
+ !option.disabled &&
+ ( !option.parentNode.disabled ||
+ !nodeName( option.parentNode, "optgroup" ) ) ) {
+
+ // Get the specific value for the option
+ value = jQuery( option ).val();
+
+ // We don't need an array for one selects
+ if ( one ) {
+ return value;
+ }
+
+ // Multi-Selects return an array
+ values.push( value );
+ }
+ }
+
+ return values;
+ },
+
+ set: function( elem, value ) {
+ var optionSet, option,
+ options = elem.options,
+ values = jQuery.makeArray( value ),
+ i = options.length;
+
+ while ( i-- ) {
+ option = options[ i ];
+
+ /* eslint-disable no-cond-assign */
+
+ if ( option.selected =
+ jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1
+ ) {
+ optionSet = true;
+ }
+
+ /* eslint-enable no-cond-assign */
+ }
+
+ // Force browsers to behave consistently when non-matching value is set
+ if ( !optionSet ) {
+ elem.selectedIndex = -1;
+ }
+ return values;
+ }
+ }
+ }
+} );
+
+// Radios and checkboxes getter/setter
+jQuery.each( [ "radio", "checkbox" ], function() {
+ jQuery.valHooks[ this ] = {
+ set: function( elem, value ) {
+ if ( Array.isArray( value ) ) {
+ return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 );
+ }
+ }
+ };
+ if ( !support.checkOn ) {
+ jQuery.valHooks[ this ].get = function( elem ) {
+ return elem.getAttribute( "value" ) === null ? "on" : elem.value;
+ };
+ }
+} );
+
+
+
+
+// Return jQuery for attributes-only inclusion
+
+
+support.focusin = "onfocusin" in window;
+
+
+var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
+ stopPropagationCallback = function( e ) {
+ e.stopPropagation();
+ };
+
+jQuery.extend( jQuery.event, {
+
+ trigger: function( event, data, elem, onlyHandlers ) {
+
+ var i, cur, tmp, bubbleType, ontype, handle, special, lastElement,
+ eventPath = [ elem || document ],
+ type = hasOwn.call( event, "type" ) ? event.type : event,
+ namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : [];
+
+ cur = lastElement = tmp = elem = elem || document;
+
+ // Don't do events on text and comment nodes
+ if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+ return;
+ }
+
+ // focus/blur morphs to focusin/out; ensure we're not firing them right now
+ if ( rfocusMorph.test( type + jQuery.event.triggered ) ) {
+ return;
+ }
+
+ if ( type.indexOf( "." ) > -1 ) {
+
+ // Namespaced trigger; create a regexp to match event type in handle()
+ namespaces = type.split( "." );
+ type = namespaces.shift();
+ namespaces.sort();
+ }
+ ontype = type.indexOf( ":" ) < 0 && "on" + type;
+
+ // Caller can pass in a jQuery.Event object, Object, or just an event type string
+ event = event[ jQuery.expando ] ?
+ event :
+ new jQuery.Event( type, typeof event === "object" && event );
+
+ // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)
+ event.isTrigger = onlyHandlers ? 2 : 3;
+ event.namespace = namespaces.join( "." );
+ event.rnamespace = event.namespace ?
+ new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) :
+ null;
+
+ // Clean up the event in case it is being reused
+ event.result = undefined;
+ if ( !event.target ) {
+ event.target = elem;
+ }
+
+ // Clone any incoming data and prepend the event, creating the handler arg list
+ data = data == null ?
+ [ event ] :
+ jQuery.makeArray( data, [ event ] );
+
+ // Allow special events to draw outside the lines
+ special = jQuery.event.special[ type ] || {};
+ if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) {
+ return;
+ }
+
+ // Determine event propagation path in advance, per W3C events spec (#9951)
+ // Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
+ if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) {
+
+ bubbleType = special.delegateType || type;
+ if ( !rfocusMorph.test( bubbleType + type ) ) {
+ cur = cur.parentNode;
+ }
+ for ( ; cur; cur = cur.parentNode ) {
+ eventPath.push( cur );
+ tmp = cur;
+ }
+
+ // Only add window if we got to document (e.g., not plain obj or detached DOM)
+ if ( tmp === ( elem.ownerDocument || document ) ) {
+ eventPath.push( tmp.defaultView || tmp.parentWindow || window );
+ }
+ }
+
+ // Fire handlers on the event path
+ i = 0;
+ while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) {
+ lastElement = cur;
+ event.type = i > 1 ?
+ bubbleType :
+ special.bindType || type;
+
+ // jQuery handler
+ handle = ( dataPriv.get( cur, "events" ) || {} )[ event.type ] &&
+ dataPriv.get( cur, "handle" );
+ if ( handle ) {
+ handle.apply( cur, data );
+ }
+
+ // Native handler
+ handle = ontype && cur[ ontype ];
+ if ( handle && handle.apply && acceptData( cur ) ) {
+ event.result = handle.apply( cur, data );
+ if ( event.result === false ) {
+ event.preventDefault();
+ }
+ }
+ }
+ event.type = type;
+
+ // If nobody prevented the default action, do it now
+ if ( !onlyHandlers && !event.isDefaultPrevented() ) {
+
+ if ( ( !special._default ||
+ special._default.apply( eventPath.pop(), data ) === false ) &&
+ acceptData( elem ) ) {
+
+ // Call a native DOM method on the target with the same name as the event.
+ // Don't do default actions on window, that's where global variables be (#6170)
+ if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) {
+
+ // Don't re-trigger an onFOO event when we call its FOO() method
+ tmp = elem[ ontype ];
+
+ if ( tmp ) {
+ elem[ ontype ] = null;
+ }
+
+ // Prevent re-triggering of the same event, since we already bubbled it above
+ jQuery.event.triggered = type;
+
+ if ( event.isPropagationStopped() ) {
+ lastElement.addEventListener( type, stopPropagationCallback );
+ }
+
+ elem[ type ]();
+
+ if ( event.isPropagationStopped() ) {
+ lastElement.removeEventListener( type, stopPropagationCallback );
+ }
+
+ jQuery.event.triggered = undefined;
+
+ if ( tmp ) {
+ elem[ ontype ] = tmp;
+ }
+ }
+ }
+ }
+
+ return event.result;
+ },
+
+ // Piggyback on a donor event to simulate a different one
+ // Used only for `focus(in | out)` events
+ simulate: function( type, elem, event ) {
+ var e = jQuery.extend(
+ new jQuery.Event(),
+ event,
+ {
+ type: type,
+ isSimulated: true
+ }
+ );
+
+ jQuery.event.trigger( e, null, elem );
+ }
+
+} );
+
+jQuery.fn.extend( {
+
+ trigger: function( type, data ) {
+ return this.each( function() {
+ jQuery.event.trigger( type, data, this );
+ } );
+ },
+ triggerHandler: function( type, data ) {
+ var elem = this[ 0 ];
+ if ( elem ) {
+ return jQuery.event.trigger( type, data, elem, true );
+ }
+ }
+} );
+
+
+// Support: Firefox <=44
+// Firefox doesn't have focus(in | out) events
+// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787
+//
+// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1
+// focus(in | out) events fire after focus & blur events,
+// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order
+// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857
+if ( !support.focusin ) {
+ jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) {
+
+ // Attach a single capturing handler on the document while someone wants focusin/focusout
+ var handler = function( event ) {
+ jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) );
+ };
+
+ jQuery.event.special[ fix ] = {
+ setup: function() {
+ var doc = this.ownerDocument || this,
+ attaches = dataPriv.access( doc, fix );
+
+ if ( !attaches ) {
+ doc.addEventListener( orig, handler, true );
+ }
+ dataPriv.access( doc, fix, ( attaches || 0 ) + 1 );
+ },
+ teardown: function() {
+ var doc = this.ownerDocument || this,
+ attaches = dataPriv.access( doc, fix ) - 1;
+
+ if ( !attaches ) {
+ doc.removeEventListener( orig, handler, true );
+ dataPriv.remove( doc, fix );
+
+ } else {
+ dataPriv.access( doc, fix, attaches );
+ }
+ }
+ };
+ } );
+}
+var location = window.location;
+
+var nonce = Date.now();
+
+var rquery = ( /\?/ );
+
+
+
+// Cross-browser xml parsing
+jQuery.parseXML = function( data ) {
+ var xml;
+ if ( !data || typeof data !== "string" ) {
+ return null;
+ }
+
+ // Support: IE 9 - 11 only
+ // IE throws on parseFromString with invalid input.
+ try {
+ xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" );
+ } catch ( e ) {
+ xml = undefined;
+ }
+
+ if ( !xml || xml.getElementsByTagName( "parsererror" ).length ) {
+ jQuery.error( "Invalid XML: " + data );
+ }
+ return xml;
+};
+
+
+var
+ rbracket = /\[\]$/,
+ rCRLF = /\r?\n/g,
+ rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i,
+ rsubmittable = /^(?:input|select|textarea|keygen)/i;
+
+function buildParams( prefix, obj, traditional, add ) {
+ var name;
+
+ if ( Array.isArray( obj ) ) {
+
+ // Serialize array item.
+ jQuery.each( obj, function( i, v ) {
+ if ( traditional || rbracket.test( prefix ) ) {
+
+ // Treat each array item as a scalar.
+ add( prefix, v );
+
+ } else {
+
+ // Item is non-scalar (array or object), encode its numeric index.
+ buildParams(
+ prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]",
+ v,
+ traditional,
+ add
+ );
+ }
+ } );
+
+ } else if ( !traditional && toType( obj ) === "object" ) {
+
+ // Serialize object item.
+ for ( name in obj ) {
+ buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
+ }
+
+ } else {
+
+ // Serialize scalar item.
+ add( prefix, obj );
+ }
+}
+
+// Serialize an array of form elements or a set of
+// key/values into a query string
+jQuery.param = function( a, traditional ) {
+ var prefix,
+ s = [],
+ add = function( key, valueOrFunction ) {
+
+ // If value is a function, invoke it and use its return value
+ var value = isFunction( valueOrFunction ) ?
+ valueOrFunction() :
+ valueOrFunction;
+
+ s[ s.length ] = encodeURIComponent( key ) + "=" +
+ encodeURIComponent( value == null ? "" : value );
+ };
+
+ // If an array was passed in, assume that it is an array of form elements.
+ if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
+
+ // Serialize the form elements
+ jQuery.each( a, function() {
+ add( this.name, this.value );
+ } );
+
+ } else {
+
+ // If traditional, encode the "old" way (the way 1.3.2 or older
+ // did it), otherwise encode params recursively.
+ for ( prefix in a ) {
+ buildParams( prefix, a[ prefix ], traditional, add );
+ }
+ }
+
+ // Return the resulting serialization
+ return s.join( "&" );
+};
+
+jQuery.fn.extend( {
+ serialize: function() {
+ return jQuery.param( this.serializeArray() );
+ },
+ serializeArray: function() {
+ return this.map( function() {
+
+ // Can add propHook for "elements" to filter or add form elements
+ var elements = jQuery.prop( this, "elements" );
+ return elements ? jQuery.makeArray( elements ) : this;
+ } )
+ .filter( function() {
+ var type = this.type;
+
+ // Use .is( ":disabled" ) so that fieldset[disabled] works
+ return this.name && !jQuery( this ).is( ":disabled" ) &&
+ rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) &&
+ ( this.checked || !rcheckableType.test( type ) );
+ } )
+ .map( function( i, elem ) {
+ var val = jQuery( this ).val();
+
+ if ( val == null ) {
+ return null;
+ }
+
+ if ( Array.isArray( val ) ) {
+ return jQuery.map( val, function( val ) {
+ return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+ } );
+ }
+
+ return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+ } ).get();
+ }
+} );
+
+
+var
+ r20 = /%20/g,
+ rhash = /#.*$/,
+ rantiCache = /([?&])_=[^&]*/,
+ rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg,
+
+ // #7653, #8125, #8152: local protocol detection
+ rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/,
+ rnoContent = /^(?:GET|HEAD)$/,
+ rprotocol = /^\/\//,
+
+ /* Prefilters
+ * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
+ * 2) These are called:
+ * - BEFORE asking for a transport
+ * - AFTER param serialization (s.data is a string if s.processData is true)
+ * 3) key is the dataType
+ * 4) the catchall symbol "*" can be used
+ * 5) execution will start with transport dataType and THEN continue down to "*" if needed
+ */
+ prefilters = {},
+
+ /* Transports bindings
+ * 1) key is the dataType
+ * 2) the catchall symbol "*" can be used
+ * 3) selection will start with transport dataType and THEN go to "*" if needed
+ */
+ transports = {},
+
+ // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
+ allTypes = "*/".concat( "*" ),
+
+ // Anchor tag for parsing the document origin
+ originAnchor = document.createElement( "a" );
+ originAnchor.href = location.href;
+
+// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
+function addToPrefiltersOrTransports( structure ) {
+
+ // dataTypeExpression is optional and defaults to "*"
+ return function( dataTypeExpression, func ) {
+
+ if ( typeof dataTypeExpression !== "string" ) {
+ func = dataTypeExpression;
+ dataTypeExpression = "*";
+ }
+
+ var dataType,
+ i = 0,
+ dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || [];
+
+ if ( isFunction( func ) ) {
+
+ // For each dataType in the dataTypeExpression
+ while ( ( dataType = dataTypes[ i++ ] ) ) {
+
+ // Prepend if requested
+ if ( dataType[ 0 ] === "+" ) {
+ dataType = dataType.slice( 1 ) || "*";
+ ( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func );
+
+ // Otherwise append
+ } else {
+ ( structure[ dataType ] = structure[ dataType ] || [] ).push( func );
+ }
+ }
+ }
+ };
+}
+
+// Base inspection function for prefilters and transports
+function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) {
+
+ var inspected = {},
+ seekingTransport = ( structure === transports );
+
+ function inspect( dataType ) {
+ var selected;
+ inspected[ dataType ] = true;
+ jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) {
+ var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR );
+ if ( typeof dataTypeOrTransport === "string" &&
+ !seekingTransport && !inspected[ dataTypeOrTransport ] ) {
+
+ options.dataTypes.unshift( dataTypeOrTransport );
+ inspect( dataTypeOrTransport );
+ return false;
+ } else if ( seekingTransport ) {
+ return !( selected = dataTypeOrTransport );
+ }
+ } );
+ return selected;
+ }
+
+ return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" );
+}
+
+// A special extend for ajax options
+// that takes "flat" options (not to be deep extended)
+// Fixes #9887
+function ajaxExtend( target, src ) {
+ var key, deep,
+ flatOptions = jQuery.ajaxSettings.flatOptions || {};
+
+ for ( key in src ) {
+ if ( src[ key ] !== undefined ) {
+ ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ];
+ }
+ }
+ if ( deep ) {
+ jQuery.extend( true, target, deep );
+ }
+
+ return target;
+}
+
+/* Handles responses to an ajax request:
+ * - finds the right dataType (mediates between content-type and expected dataType)
+ * - returns the corresponding response
+ */
+function ajaxHandleResponses( s, jqXHR, responses ) {
+
+ var ct, type, finalDataType, firstDataType,
+ contents = s.contents,
+ dataTypes = s.dataTypes;
+
+ // Remove auto dataType and get content-type in the process
+ while ( dataTypes[ 0 ] === "*" ) {
+ dataTypes.shift();
+ if ( ct === undefined ) {
+ ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" );
+ }
+ }
+
+ // Check if we're dealing with a known content-type
+ if ( ct ) {
+ for ( type in contents ) {
+ if ( contents[ type ] && contents[ type ].test( ct ) ) {
+ dataTypes.unshift( type );
+ break;
+ }
+ }
+ }
+
+ // Check to see if we have a response for the expected dataType
+ if ( dataTypes[ 0 ] in responses ) {
+ finalDataType = dataTypes[ 0 ];
+ } else {
+
+ // Try convertible dataTypes
+ for ( type in responses ) {
+ if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) {
+ finalDataType = type;
+ break;
+ }
+ if ( !firstDataType ) {
+ firstDataType = type;
+ }
+ }
+
+ // Or just use first one
+ finalDataType = finalDataType || firstDataType;
+ }
+
+ // If we found a dataType
+ // We add the dataType to the list if needed
+ // and return the corresponding response
+ if ( finalDataType ) {
+ if ( finalDataType !== dataTypes[ 0 ] ) {
+ dataTypes.unshift( finalDataType );
+ }
+ return responses[ finalDataType ];
+ }
+}
+
+/* Chain conversions given the request and the original response
+ * Also sets the responseXXX fields on the jqXHR instance
+ */
+function ajaxConvert( s, response, jqXHR, isSuccess ) {
+ var conv2, current, conv, tmp, prev,
+ converters = {},
+
+ // Work with a copy of dataTypes in case we need to modify it for conversion
+ dataTypes = s.dataTypes.slice();
+
+ // Create converters map with lowercased keys
+ if ( dataTypes[ 1 ] ) {
+ for ( conv in s.converters ) {
+ converters[ conv.toLowerCase() ] = s.converters[ conv ];
+ }
+ }
+
+ current = dataTypes.shift();
+
+ // Convert to each sequential dataType
+ while ( current ) {
+
+ if ( s.responseFields[ current ] ) {
+ jqXHR[ s.responseFields[ current ] ] = response;
+ }
+
+ // Apply the dataFilter if provided
+ if ( !prev && isSuccess && s.dataFilter ) {
+ response = s.dataFilter( response, s.dataType );
+ }
+
+ prev = current;
+ current = dataTypes.shift();
+
+ if ( current ) {
+
+ // There's only work to do if current dataType is non-auto
+ if ( current === "*" ) {
+
+ current = prev;
+
+ // Convert response if prev dataType is non-auto and differs from current
+ } else if ( prev !== "*" && prev !== current ) {
+
+ // Seek a direct converter
+ conv = converters[ prev + " " + current ] || converters[ "* " + current ];
+
+ // If none found, seek a pair
+ if ( !conv ) {
+ for ( conv2 in converters ) {
+
+ // If conv2 outputs current
+ tmp = conv2.split( " " );
+ if ( tmp[ 1 ] === current ) {
+
+ // If prev can be converted to accepted input
+ conv = converters[ prev + " " + tmp[ 0 ] ] ||
+ converters[ "* " + tmp[ 0 ] ];
+ if ( conv ) {
+
+ // Condense equivalence converters
+ if ( conv === true ) {
+ conv = converters[ conv2 ];
+
+ // Otherwise, insert the intermediate dataType
+ } else if ( converters[ conv2 ] !== true ) {
+ current = tmp[ 0 ];
+ dataTypes.unshift( tmp[ 1 ] );
+ }
+ break;
+ }
+ }
+ }
+ }
+
+ // Apply converter (if not an equivalence)
+ if ( conv !== true ) {
+
+ // Unless errors are allowed to bubble, catch and return them
+ if ( conv && s.throws ) {
+ response = conv( response );
+ } else {
+ try {
+ response = conv( response );
+ } catch ( e ) {
+ return {
+ state: "parsererror",
+ error: conv ? e : "No conversion from " + prev + " to " + current
+ };
+ }
+ }
+ }
+ }
+ }
+ }
+
+ return { state: "success", data: response };
+}
+
+jQuery.extend( {
+
+ // Counter for holding the number of active queries
+ active: 0,
+
+ // Last-Modified header cache for next request
+ lastModified: {},
+ etag: {},
+
+ ajaxSettings: {
+ url: location.href,
+ type: "GET",
+ isLocal: rlocalProtocol.test( location.protocol ),
+ global: true,
+ processData: true,
+ async: true,
+ contentType: "application/x-www-form-urlencoded; charset=UTF-8",
+
+ /*
+ timeout: 0,
+ data: null,
+ dataType: null,
+ username: null,
+ password: null,
+ cache: null,
+ throws: false,
+ traditional: false,
+ headers: {},
+ */
+
+ accepts: {
+ "*": allTypes,
+ text: "text/plain",
+ html: "text/html",
+ xml: "application/xml, text/xml",
+ json: "application/json, text/javascript"
+ },
+
+ contents: {
+ xml: /\bxml\b/,
+ html: /\bhtml/,
+ json: /\bjson\b/
+ },
+
+ responseFields: {
+ xml: "responseXML",
+ text: "responseText",
+ json: "responseJSON"
+ },
+
+ // Data converters
+ // Keys separate source (or catchall "*") and destination types with a single space
+ converters: {
+
+ // Convert anything to text
+ "* text": String,
+
+ // Text to html (true = no transformation)
+ "text html": true,
+
+ // Evaluate text as a json expression
+ "text json": JSON.parse,
+
+ // Parse text as xml
+ "text xml": jQuery.parseXML
+ },
+
+ // For options that shouldn't be deep extended:
+ // you can add your own custom options here if
+ // and when you create one that shouldn't be
+ // deep extended (see ajaxExtend)
+ flatOptions: {
+ url: true,
+ context: true
+ }
+ },
+
+ // Creates a full fledged settings object into target
+ // with both ajaxSettings and settings fields.
+ // If target is omitted, writes into ajaxSettings.
+ ajaxSetup: function( target, settings ) {
+ return settings ?
+
+ // Building a settings object
+ ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) :
+
+ // Extending ajaxSettings
+ ajaxExtend( jQuery.ajaxSettings, target );
+ },
+
+ ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
+ ajaxTransport: addToPrefiltersOrTransports( transports ),
+
+ // Main method
+ ajax: function( url, options ) {
+
+ // If url is an object, simulate pre-1.5 signature
+ if ( typeof url === "object" ) {
+ options = url;
+ url = undefined;
+ }
+
+ // Force options to be an object
+ options = options || {};
+
+ var transport,
+
+ // URL without anti-cache param
+ cacheURL,
+
+ // Response headers
+ responseHeadersString,
+ responseHeaders,
+
+ // timeout handle
+ timeoutTimer,
+
+ // Url cleanup var
+ urlAnchor,
+
+ // Request state (becomes false upon send and true upon completion)
+ completed,
+
+ // To know if global events are to be dispatched
+ fireGlobals,
+
+ // Loop variable
+ i,
+
+ // uncached part of the url
+ uncached,
+
+ // Create the final options object
+ s = jQuery.ajaxSetup( {}, options ),
+
+ // Callbacks context
+ callbackContext = s.context || s,
+
+ // Context for global events is callbackContext if it is a DOM node or jQuery collection
+ globalEventContext = s.context &&
+ ( callbackContext.nodeType || callbackContext.jquery ) ?
+ jQuery( callbackContext ) :
+ jQuery.event,
+
+ // Deferreds
+ deferred = jQuery.Deferred(),
+ completeDeferred = jQuery.Callbacks( "once memory" ),
+
+ // Status-dependent callbacks
+ statusCode = s.statusCode || {},
+
+ // Headers (they are sent all at once)
+ requestHeaders = {},
+ requestHeadersNames = {},
+
+ // Default abort message
+ strAbort = "canceled",
+
+ // Fake xhr
+ jqXHR = {
+ readyState: 0,
+
+ // Builds headers hashtable if needed
+ getResponseHeader: function( key ) {
+ var match;
+ if ( completed ) {
+ if ( !responseHeaders ) {
+ responseHeaders = {};
+ while ( ( match = rheaders.exec( responseHeadersString ) ) ) {
+ responseHeaders[ match[ 1 ].toLowerCase() ] = match[ 2 ];
+ }
+ }
+ match = responseHeaders[ key.toLowerCase() ];
+ }
+ return match == null ? null : match;
+ },
+
+ // Raw string
+ getAllResponseHeaders: function() {
+ return completed ? responseHeadersString : null;
+ },
+
+ // Caches the header
+ setRequestHeader: function( name, value ) {
+ if ( completed == null ) {
+ name = requestHeadersNames[ name.toLowerCase() ] =
+ requestHeadersNames[ name.toLowerCase() ] || name;
+ requestHeaders[ name ] = value;
+ }
+ return this;
+ },
+
+ // Overrides response content-type header
+ overrideMimeType: function( type ) {
+ if ( completed == null ) {
+ s.mimeType = type;
+ }
+ return this;
+ },
+
+ // Status-dependent callbacks
+ statusCode: function( map ) {
+ var code;
+ if ( map ) {
+ if ( completed ) {
+
+ // Execute the appropriate callbacks
+ jqXHR.always( map[ jqXHR.status ] );
+ } else {
+
+ // Lazy-add the new callbacks in a way that preserves old ones
+ for ( code in map ) {
+ statusCode[ code ] = [ statusCode[ code ], map[ code ] ];
+ }
+ }
+ }
+ return this;
+ },
+
+ // Cancel the request
+ abort: function( statusText ) {
+ var finalText = statusText || strAbort;
+ if ( transport ) {
+ transport.abort( finalText );
+ }
+ done( 0, finalText );
+ return this;
+ }
+ };
+
+ // Attach deferreds
+ deferred.promise( jqXHR );
+
+ // Add protocol if not provided (prefilters might expect it)
+ // Handle falsy url in the settings object (#10093: consistency with old signature)
+ // We also use the url parameter if available
+ s.url = ( ( url || s.url || location.href ) + "" )
+ .replace( rprotocol, location.protocol + "//" );
+
+ // Alias method option to type as per ticket #12004
+ s.type = options.method || options.type || s.method || s.type;
+
+ // Extract dataTypes list
+ s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ];
+
+ // A cross-domain request is in order when the origin doesn't match the current origin.
+ if ( s.crossDomain == null ) {
+ urlAnchor = document.createElement( "a" );
+
+ // Support: IE <=8 - 11, Edge 12 - 15
+ // IE throws exception on accessing the href property if url is malformed,
+ // e.g. http://example.com:80x/
+ try {
+ urlAnchor.href = s.url;
+
+ // Support: IE <=8 - 11 only
+ // Anchor's host property isn't correctly set when s.url is relative
+ urlAnchor.href = urlAnchor.href;
+ s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !==
+ urlAnchor.protocol + "//" + urlAnchor.host;
+ } catch ( e ) {
+
+ // If there is an error parsing the URL, assume it is crossDomain,
+ // it can be rejected by the transport if it is invalid
+ s.crossDomain = true;
+ }
+ }
+
+ // Convert data if not already a string
+ if ( s.data && s.processData && typeof s.data !== "string" ) {
+ s.data = jQuery.param( s.data, s.traditional );
+ }
+
+ // Apply prefilters
+ inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
+
+ // If request was aborted inside a prefilter, stop there
+ if ( completed ) {
+ return jqXHR;
+ }
+
+ // We can fire global events as of now if asked to
+ // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118)
+ fireGlobals = jQuery.event && s.global;
+
+ // Watch for a new set of requests
+ if ( fireGlobals && jQuery.active++ === 0 ) {
+ jQuery.event.trigger( "ajaxStart" );
+ }
+
+ // Uppercase the type
+ s.type = s.type.toUpperCase();
+
+ // Determine if request has content
+ s.hasContent = !rnoContent.test( s.type );
+
+ // Save the URL in case we're toying with the If-Modified-Since
+ // and/or If-None-Match header later on
+ // Remove hash to simplify url manipulation
+ cacheURL = s.url.replace( rhash, "" );
+
+ // More options handling for requests with no content
+ if ( !s.hasContent ) {
+
+ // Remember the hash so we can put it back
+ uncached = s.url.slice( cacheURL.length );
+
+ // If data is available and should be processed, append data to url
+ if ( s.data && ( s.processData || typeof s.data === "string" ) ) {
+ cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data;
+
+ // #9682: remove data so that it's not used in an eventual retry
+ delete s.data;
+ }
+
+ // Add or update anti-cache param if needed
+ if ( s.cache === false ) {
+ cacheURL = cacheURL.replace( rantiCache, "$1" );
+ uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce++ ) + uncached;
+ }
+
+ // Put hash and anti-cache on the URL that will be requested (gh-1732)
+ s.url = cacheURL + uncached;
+
+ // Change '%20' to '+' if this is encoded form body content (gh-2658)
+ } else if ( s.data && s.processData &&
+ ( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) {
+ s.data = s.data.replace( r20, "+" );
+ }
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
+ if ( jQuery.lastModified[ cacheURL ] ) {
+ jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] );
+ }
+ if ( jQuery.etag[ cacheURL ] ) {
+ jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] );
+ }
+ }
+
+ // Set the correct header, if data is being sent
+ if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
+ jqXHR.setRequestHeader( "Content-Type", s.contentType );
+ }
+
+ // Set the Accepts header for the server, depending on the dataType
+ jqXHR.setRequestHeader(
+ "Accept",
+ s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ?
+ s.accepts[ s.dataTypes[ 0 ] ] +
+ ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
+ s.accepts[ "*" ]
+ );
+
+ // Check for headers option
+ for ( i in s.headers ) {
+ jqXHR.setRequestHeader( i, s.headers[ i ] );
+ }
+
+ // Allow custom headers/mimetypes and early abort
+ if ( s.beforeSend &&
+ ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) {
+
+ // Abort if not done already and return
+ return jqXHR.abort();
+ }
+
+ // Aborting is no longer a cancellation
+ strAbort = "abort";
+
+ // Install callbacks on deferreds
+ completeDeferred.add( s.complete );
+ jqXHR.done( s.success );
+ jqXHR.fail( s.error );
+
+ // Get transport
+ transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
+
+ // If no transport, we auto-abort
+ if ( !transport ) {
+ done( -1, "No Transport" );
+ } else {
+ jqXHR.readyState = 1;
+
+ // Send global event
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
+ }
+
+ // If request was aborted inside ajaxSend, stop there
+ if ( completed ) {
+ return jqXHR;
+ }
+
+ // Timeout
+ if ( s.async && s.timeout > 0 ) {
+ timeoutTimer = window.setTimeout( function() {
+ jqXHR.abort( "timeout" );
+ }, s.timeout );
+ }
+
+ try {
+ completed = false;
+ transport.send( requestHeaders, done );
+ } catch ( e ) {
+
+ // Rethrow post-completion exceptions
+ if ( completed ) {
+ throw e;
+ }
+
+ // Propagate others as results
+ done( -1, e );
+ }
+ }
+
+ // Callback for when everything is done
+ function done( status, nativeStatusText, responses, headers ) {
+ var isSuccess, success, error, response, modified,
+ statusText = nativeStatusText;
+
+ // Ignore repeat invocations
+ if ( completed ) {
+ return;
+ }
+
+ completed = true;
+
+ // Clear timeout if it exists
+ if ( timeoutTimer ) {
+ window.clearTimeout( timeoutTimer );
+ }
+
+ // Dereference transport for early garbage collection
+ // (no matter how long the jqXHR object will be used)
+ transport = undefined;
+
+ // Cache response headers
+ responseHeadersString = headers || "";
+
+ // Set readyState
+ jqXHR.readyState = status > 0 ? 4 : 0;
+
+ // Determine if successful
+ isSuccess = status >= 200 && status < 300 || status === 304;
+
+ // Get response data
+ if ( responses ) {
+ response = ajaxHandleResponses( s, jqXHR, responses );
+ }
+
+ // Convert no matter what (that way responseXXX fields are always set)
+ response = ajaxConvert( s, response, jqXHR, isSuccess );
+
+ // If successful, handle type chaining
+ if ( isSuccess ) {
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
+ modified = jqXHR.getResponseHeader( "Last-Modified" );
+ if ( modified ) {
+ jQuery.lastModified[ cacheURL ] = modified;
+ }
+ modified = jqXHR.getResponseHeader( "etag" );
+ if ( modified ) {
+ jQuery.etag[ cacheURL ] = modified;
+ }
+ }
+
+ // if no content
+ if ( status === 204 || s.type === "HEAD" ) {
+ statusText = "nocontent";
+
+ // if not modified
+ } else if ( status === 304 ) {
+ statusText = "notmodified";
+
+ // If we have data, let's convert it
+ } else {
+ statusText = response.state;
+ success = response.data;
+ error = response.error;
+ isSuccess = !error;
+ }
+ } else {
+
+ // Extract error from statusText and normalize for non-aborts
+ error = statusText;
+ if ( status || !statusText ) {
+ statusText = "error";
+ if ( status < 0 ) {
+ status = 0;
+ }
+ }
+ }
+
+ // Set data for the fake xhr object
+ jqXHR.status = status;
+ jqXHR.statusText = ( nativeStatusText || statusText ) + "";
+
+ // Success/Error
+ if ( isSuccess ) {
+ deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
+ } else {
+ deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
+ }
+
+ // Status-dependent callbacks
+ jqXHR.statusCode( statusCode );
+ statusCode = undefined;
+
+ if ( fireGlobals ) {
+ globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError",
+ [ jqXHR, s, isSuccess ? success : error ] );
+ }
+
+ // Complete
+ completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );
+
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] );
+
+ // Handle the global AJAX counter
+ if ( !( --jQuery.active ) ) {
+ jQuery.event.trigger( "ajaxStop" );
+ }
+ }
+ }
+
+ return jqXHR;
+ },
+
+ getJSON: function( url, data, callback ) {
+ return jQuery.get( url, data, callback, "json" );
+ },
+
+ getScript: function( url, callback ) {
+ return jQuery.get( url, undefined, callback, "script" );
+ }
+} );
+
+jQuery.each( [ "get", "post" ], function( i, method ) {
+ jQuery[ method ] = function( url, data, callback, type ) {
+
+ // Shift arguments if data argument was omitted
+ if ( isFunction( data ) ) {
+ type = type || callback;
+ callback = data;
+ data = undefined;
+ }
+
+ // The url can be an options object (which then must have .url)
+ return jQuery.ajax( jQuery.extend( {
+ url: url,
+ type: method,
+ dataType: type,
+ data: data,
+ success: callback
+ }, jQuery.isPlainObject( url ) && url ) );
+ };
+} );
+
+
+jQuery._evalUrl = function( url ) {
+ return jQuery.ajax( {
+ url: url,
+
+ // Make this explicit, since user can override this through ajaxSetup (#11264)
+ type: "GET",
+ dataType: "script",
+ cache: true,
+ async: false,
+ global: false,
+ "throws": true
+ } );
+};
+
+
+jQuery.fn.extend( {
+ wrapAll: function( html ) {
+ var wrap;
+
+ if ( this[ 0 ] ) {
+ if ( isFunction( html ) ) {
+ html = html.call( this[ 0 ] );
+ }
+
+ // The elements to wrap the target around
+ wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true );
+
+ if ( this[ 0 ].parentNode ) {
+ wrap.insertBefore( this[ 0 ] );
+ }
+
+ wrap.map( function() {
+ var elem = this;
+
+ while ( elem.firstElementChild ) {
+ elem = elem.firstElementChild;
+ }
+
+ return elem;
+ } ).append( this );
+ }
+
+ return this;
+ },
+
+ wrapInner: function( html ) {
+ if ( isFunction( html ) ) {
+ return this.each( function( i ) {
+ jQuery( this ).wrapInner( html.call( this, i ) );
+ } );
+ }
+
+ return this.each( function() {
+ var self = jQuery( this ),
+ contents = self.contents();
+
+ if ( contents.length ) {
+ contents.wrapAll( html );
+
+ } else {
+ self.append( html );
+ }
+ } );
+ },
+
+ wrap: function( html ) {
+ var htmlIsFunction = isFunction( html );
+
+ return this.each( function( i ) {
+ jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html );
+ } );
+ },
+
+ unwrap: function( selector ) {
+ this.parent( selector ).not( "body" ).each( function() {
+ jQuery( this ).replaceWith( this.childNodes );
+ } );
+ return this;
+ }
+} );
+
+
+jQuery.expr.pseudos.hidden = function( elem ) {
+ return !jQuery.expr.pseudos.visible( elem );
+};
+jQuery.expr.pseudos.visible = function( elem ) {
+ return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length );
+};
+
+
+
+
+jQuery.ajaxSettings.xhr = function() {
+ try {
+ return new window.XMLHttpRequest();
+ } catch ( e ) {}
+};
+
+var xhrSuccessStatus = {
+
+ // File protocol always yields status code 0, assume 200
+ 0: 200,
+
+ // Support: IE <=9 only
+ // #1450: sometimes IE returns 1223 when it should be 204
+ 1223: 204
+ },
+ xhrSupported = jQuery.ajaxSettings.xhr();
+
+support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported );
+support.ajax = xhrSupported = !!xhrSupported;
+
+jQuery.ajaxTransport( function( options ) {
+ var callback, errorCallback;
+
+ // Cross domain only allowed if supported through XMLHttpRequest
+ if ( support.cors || xhrSupported && !options.crossDomain ) {
+ return {
+ send: function( headers, complete ) {
+ var i,
+ xhr = options.xhr();
+
+ xhr.open(
+ options.type,
+ options.url,
+ options.async,
+ options.username,
+ options.password
+ );
+
+ // Apply custom fields if provided
+ if ( options.xhrFields ) {
+ for ( i in options.xhrFields ) {
+ xhr[ i ] = options.xhrFields[ i ];
+ }
+ }
+
+ // Override mime type if needed
+ if ( options.mimeType && xhr.overrideMimeType ) {
+ xhr.overrideMimeType( options.mimeType );
+ }
+
+ // X-Requested-With header
+ // For cross-domain requests, seeing as conditions for a preflight are
+ // akin to a jigsaw puzzle, we simply never set it to be sure.
+ // (it can always be set on a per-request basis or even using ajaxSetup)
+ // For same-domain requests, won't change header if already provided.
+ if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) {
+ headers[ "X-Requested-With" ] = "XMLHttpRequest";
+ }
+
+ // Set headers
+ for ( i in headers ) {
+ xhr.setRequestHeader( i, headers[ i ] );
+ }
+
+ // Callback
+ callback = function( type ) {
+ return function() {
+ if ( callback ) {
+ callback = errorCallback = xhr.onload =
+ xhr.onerror = xhr.onabort = xhr.ontimeout =
+ xhr.onreadystatechange = null;
+
+ if ( type === "abort" ) {
+ xhr.abort();
+ } else if ( type === "error" ) {
+
+ // Support: IE <=9 only
+ // On a manual native abort, IE9 throws
+ // errors on any property access that is not readyState
+ if ( typeof xhr.status !== "number" ) {
+ complete( 0, "error" );
+ } else {
+ complete(
+
+ // File: protocol always yields status 0; see #8605, #14207
+ xhr.status,
+ xhr.statusText
+ );
+ }
+ } else {
+ complete(
+ xhrSuccessStatus[ xhr.status ] || xhr.status,
+ xhr.statusText,
+
+ // Support: IE <=9 only
+ // IE9 has no XHR2 but throws on binary (trac-11426)
+ // For XHR2 non-text, let the caller handle it (gh-2498)
+ ( xhr.responseType || "text" ) !== "text" ||
+ typeof xhr.responseText !== "string" ?
+ { binary: xhr.response } :
+ { text: xhr.responseText },
+ xhr.getAllResponseHeaders()
+ );
+ }
+ }
+ };
+ };
+
+ // Listen to events
+ xhr.onload = callback();
+ errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" );
+
+ // Support: IE 9 only
+ // Use onreadystatechange to replace onabort
+ // to handle uncaught aborts
+ if ( xhr.onabort !== undefined ) {
+ xhr.onabort = errorCallback;
+ } else {
+ xhr.onreadystatechange = function() {
+
+ // Check readyState before timeout as it changes
+ if ( xhr.readyState === 4 ) {
+
+ // Allow onerror to be called first,
+ // but that will not handle a native abort
+ // Also, save errorCallback to a variable
+ // as xhr.onerror cannot be accessed
+ window.setTimeout( function() {
+ if ( callback ) {
+ errorCallback();
+ }
+ } );
+ }
+ };
+ }
+
+ // Create the abort callback
+ callback = callback( "abort" );
+
+ try {
+
+ // Do send the request (this may raise an exception)
+ xhr.send( options.hasContent && options.data || null );
+ } catch ( e ) {
+
+ // #14683: Only rethrow if this hasn't been notified as an error yet
+ if ( callback ) {
+ throw e;
+ }
+ }
+ },
+
+ abort: function() {
+ if ( callback ) {
+ callback();
+ }
+ }
+ };
+ }
+} );
+
+
+
+
+// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432)
+jQuery.ajaxPrefilter( function( s ) {
+ if ( s.crossDomain ) {
+ s.contents.script = false;
+ }
+} );
+
+// Install script dataType
+jQuery.ajaxSetup( {
+ accepts: {
+ script: "text/javascript, application/javascript, " +
+ "application/ecmascript, application/x-ecmascript"
+ },
+ contents: {
+ script: /\b(?:java|ecma)script\b/
+ },
+ converters: {
+ "text script": function( text ) {
+ jQuery.globalEval( text );
+ return text;
+ }
+ }
+} );
+
+// Handle cache's special case and crossDomain
+jQuery.ajaxPrefilter( "script", function( s ) {
+ if ( s.cache === undefined ) {
+ s.cache = false;
+ }
+ if ( s.crossDomain ) {
+ s.type = "GET";
+ }
+} );
+
+// Bind script tag hack transport
+jQuery.ajaxTransport( "script", function( s ) {
+
+ // This transport only deals with cross domain requests
+ if ( s.crossDomain ) {
+ var script, callback;
+ return {
+ send: function( _, complete ) {
+ script = jQuery( "<script>" ).prop( {
+ charset: s.scriptCharset,
+ src: s.url
+ } ).on(
+ "load error",
+ callback = function( evt ) {
+ script.remove();
+ callback = null;
+ if ( evt ) {
+ complete( evt.type === "error" ? 404 : 200, evt.type );
+ }
+ }
+ );
+
+ // Use native DOM manipulation to avoid our domManip AJAX trickery
+ document.head.appendChild( script[ 0 ] );
+ },
+ abort: function() {
+ if ( callback ) {
+ callback();
+ }
+ }
+ };
+ }
+} );
+
+
+
+
+var oldCallbacks = [],
+ rjsonp = /(=)\?(?=&|$)|\?\?/;
+
+// Default jsonp settings
+jQuery.ajaxSetup( {
+ jsonp: "callback",
+ jsonpCallback: function() {
+ var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) );
+ this[ callback ] = true;
+ return callback;
+ }
+} );
+
+// Detect, normalize options and install callbacks for jsonp requests
+jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
+
+ var callbackName, overwritten, responseContainer,
+ jsonProp = s.jsonp !== false && ( rjsonp.test( s.url ) ?
+ "url" :
+ typeof s.data === "string" &&
+ ( s.contentType || "" )
+ .indexOf( "application/x-www-form-urlencoded" ) === 0 &&
+ rjsonp.test( s.data ) && "data"
+ );
+
+ // Handle iff the expected data type is "jsonp" or we have a parameter to set
+ if ( jsonProp || s.dataTypes[ 0 ] === "jsonp" ) {
+
+ // Get callback name, remembering preexisting value associated with it
+ callbackName = s.jsonpCallback = isFunction( s.jsonpCallback ) ?
+ s.jsonpCallback() :
+ s.jsonpCallback;
+
+ // Insert callback into url or form data
+ if ( jsonProp ) {
+ s[ jsonProp ] = s[ jsonProp ].replace( rjsonp, "$1" + callbackName );
+ } else if ( s.jsonp !== false ) {
+ s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName;
+ }
+
+ // Use data converter to retrieve json after script execution
+ s.converters[ "script json" ] = function() {
+ if ( !responseContainer ) {
+ jQuery.error( callbackName + " was not called" );
+ }
+ return responseContainer[ 0 ];
+ };
+
+ // Force json dataType
+ s.dataTypes[ 0 ] = "json";
+
+ // Install callback
+ overwritten = window[ callbackName ];
+ window[ callbackName ] = function() {
+ responseContainer = arguments;
+ };
+
+ // Clean-up function (fires after converters)
+ jqXHR.always( function() {
+
+ // If previous value didn't exist - remove it
+ if ( overwritten === undefined ) {
+ jQuery( window ).removeProp( callbackName );
+
+ // Otherwise restore preexisting value
+ } else {
+ window[ callbackName ] = overwritten;
+ }
+
+ // Save back as free
+ if ( s[ callbackName ] ) {
+
+ // Make sure that re-using the options doesn't screw things around
+ s.jsonpCallback = originalSettings.jsonpCallback;
+
+ // Save the callback name for future use
+ oldCallbacks.push( callbackName );
+ }
+
+ // Call if it was a function and we have a response
+ if ( responseContainer && isFunction( overwritten ) ) {
+ overwritten( responseContainer[ 0 ] );
+ }
+
+ responseContainer = overwritten = undefined;
+ } );
+
+ // Delegate to script
+ return "script";
+ }
+} );
+
+
+
+
+// Support: Safari 8 only
+// In Safari 8 documents created via document.implementation.createHTMLDocument
+// collapse sibling forms: the second one becomes a child of the first one.
+// Because of that, this security measure has to be disabled in Safari 8.
+// https://bugs.webkit.org/show_bug.cgi?id=137337
+support.createHTMLDocument = ( function() {
+ var body = document.implementation.createHTMLDocument( "" ).body;
+ body.innerHTML = "<form></form><form></form>";
+ return body.childNodes.length === 2;
+} )();
+
+
+// Argument "data" should be string of html
+// context (optional): If specified, the fragment will be created in this context,
+// defaults to document
+// keepScripts (optional): If true, will include scripts passed in the html string
+jQuery.parseHTML = function( data, context, keepScripts ) {
+ if ( typeof data !== "string" ) {
+ return [];
+ }
+ if ( typeof context === "boolean" ) {
+ keepScripts = context;
+ context = false;
+ }
+
+ var base, parsed, scripts;
+
+ if ( !context ) {
+
+ // Stop scripts or inline event handlers from being executed immediately
+ // by using document.implementation
+ if ( support.createHTMLDocument ) {
+ context = document.implementation.createHTMLDocument( "" );
+
+ // Set the base href for the created document
+ // so any parsed elements with URLs
+ // are based on the document's URL (gh-2965)
+ base = context.createElement( "base" );
+ base.href = document.location.href;
+ context.head.appendChild( base );
+ } else {
+ context = document;
+ }
+ }
+
+ parsed = rsingleTag.exec( data );
+ scripts = !keepScripts && [];
+
+ // Single tag
+ if ( parsed ) {
+ return [ context.createElement( parsed[ 1 ] ) ];
+ }
+
+ parsed = buildFragment( [ data ], context, scripts );
+
+ if ( scripts && scripts.length ) {
+ jQuery( scripts ).remove();
+ }
+
+ return jQuery.merge( [], parsed.childNodes );
+};
+
+
+/**
+ * Load a url into a page
+ */
+jQuery.fn.load = function( url, params, callback ) {
+ var selector, type, response,
+ self = this,
+ off = url.indexOf( " " );
+
+ if ( off > -1 ) {
+ selector = stripAndCollapse( url.slice( off ) );
+ url = url.slice( 0, off );
+ }
+
+ // If it's a function
+ if ( isFunction( params ) ) {
+
+ // We assume that it's the callback
+ callback = params;
+ params = undefined;
+
+ // Otherwise, build a param string
+ } else if ( params && typeof params === "object" ) {
+ type = "POST";
+ }
+
+ // If we have elements to modify, make the request
+ if ( self.length > 0 ) {
+ jQuery.ajax( {
+ url: url,
+
+ // If "type" variable is undefined, then "GET" method will be used.
+ // Make value of this field explicit since
+ // user can override it through ajaxSetup method
+ type: type || "GET",
+ dataType: "html",
+ data: params
+ } ).done( function( responseText ) {
+
+ // Save response for use in complete callback
+ response = arguments;
+
+ self.html( selector ?
+
+ // If a selector was specified, locate the right elements in a dummy div
+ // Exclude scripts to avoid IE 'Permission Denied' errors
+ jQuery( "<div>" ).append( jQuery.parseHTML( responseText ) ).find( selector ) :
+
+ // Otherwise use the full result
+ responseText );
+
+ // If the request succeeds, this function gets "data", "status", "jqXHR"
+ // but they are ignored because response was set above.
+ // If it fails, this function gets "jqXHR", "status", "error"
+ } ).always( callback && function( jqXHR, status ) {
+ self.each( function() {
+ callback.apply( this, response || [ jqXHR.responseText, status, jqXHR ] );
+ } );
+ } );
+ }
+
+ return this;
+};
+
+
+
+
+// Attach a bunch of functions for handling common AJAX events
+jQuery.each( [
+ "ajaxStart",
+ "ajaxStop",
+ "ajaxComplete",
+ "ajaxError",
+ "ajaxSuccess",
+ "ajaxSend"
+], function( i, type ) {
+ jQuery.fn[ type ] = function( fn ) {
+ return this.on( type, fn );
+ };
+} );
+
+
+
+
+jQuery.expr.pseudos.animated = function( elem ) {
+ return jQuery.grep( jQuery.timers, function( fn ) {
+ return elem === fn.elem;
+ } ).length;
+};
+
+
+
+
+jQuery.offset = {
+ setOffset: function( elem, options, i ) {
+ var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition,
+ position = jQuery.css( elem, "position" ),
+ curElem = jQuery( elem ),
+ props = {};
+
+ // Set position first, in-case top/left are set even on static elem
+ if ( position === "static" ) {
+ elem.style.position = "relative";
+ }
+
+ curOffset = curElem.offset();
+ curCSSTop = jQuery.css( elem, "top" );
+ curCSSLeft = jQuery.css( elem, "left" );
+ calculatePosition = ( position === "absolute" || position === "fixed" ) &&
+ ( curCSSTop + curCSSLeft ).indexOf( "auto" ) > -1;
+
+ // Need to be able to calculate position if either
+ // top or left is auto and position is either absolute or fixed
+ if ( calculatePosition ) {
+ curPosition = curElem.position();
+ curTop = curPosition.top;
+ curLeft = curPosition.left;
+
+ } else {
+ curTop = parseFloat( curCSSTop ) || 0;
+ curLeft = parseFloat( curCSSLeft ) || 0;
+ }
+
+ if ( isFunction( options ) ) {
+
+ // Use jQuery.extend here to allow modification of coordinates argument (gh-1848)
+ options = options.call( elem, i, jQuery.extend( {}, curOffset ) );
+ }
+
+ if ( options.top != null ) {
+ props.top = ( options.top - curOffset.top ) + curTop;
+ }
+ if ( options.left != null ) {
+ props.left = ( options.left - curOffset.left ) + curLeft;
+ }
+
+ if ( "using" in options ) {
+ options.using.call( elem, props );
+
+ } else {
+ curElem.css( props );
+ }
+ }
+};
+
+jQuery.fn.extend( {
+
+ // offset() relates an element's border box to the document origin
+ offset: function( options ) {
+
+ // Preserve chaining for setter
+ if ( arguments.length ) {
+ return options === undefined ?
+ this :
+ this.each( function( i ) {
+ jQuery.offset.setOffset( this, options, i );
+ } );
+ }
+
+ var rect, win,
+ elem = this[ 0 ];
+
+ if ( !elem ) {
+ return;
+ }
+
+ // Return zeros for disconnected and hidden (display: none) elements (gh-2310)
+ // Support: IE <=11 only
+ // Running getBoundingClientRect on a
+ // disconnected node in IE throws an error
+ if ( !elem.getClientRects().length ) {
+ return { top: 0, left: 0 };
+ }
+
+ // Get document-relative position by adding viewport scroll to viewport-relative gBCR
+ rect = elem.getBoundingClientRect();
+ win = elem.ownerDocument.defaultView;
+ return {
+ top: rect.top + win.pageYOffset,
+ left: rect.left + win.pageXOffset
+ };
+ },
+
+ // position() relates an element's margin box to its offset parent's padding box
+ // This corresponds to the behavior of CSS absolute positioning
+ position: function() {
+ if ( !this[ 0 ] ) {
+ return;
+ }
+
+ var offsetParent, offset, doc,
+ elem = this[ 0 ],
+ parentOffset = { top: 0, left: 0 };
+
+ // position:fixed elements are offset from the viewport, which itself always has zero offset
+ if ( jQuery.css( elem, "position" ) === "fixed" ) {
+
+ // Assume position:fixed implies availability of getBoundingClientRect
+ offset = elem.getBoundingClientRect();
+
+ } else {
+ offset = this.offset();
+
+ // Account for the *real* offset parent, which can be the document or its root element
+ // when a statically positioned element is identified
+ doc = elem.ownerDocument;
+ offsetParent = elem.offsetParent || doc.documentElement;
+ while ( offsetParent &&
+ ( offsetParent === doc.body || offsetParent === doc.documentElement ) &&
+ jQuery.css( offsetParent, "position" ) === "static" ) {
+
+ offsetParent = offsetParent.parentNode;
+ }
+ if ( offsetParent && offsetParent !== elem && offsetParent.nodeType === 1 ) {
+
+ // Incorporate borders into its offset, since they are outside its content origin
+ parentOffset = jQuery( offsetParent ).offset();
+ parentOffset.top += jQuery.css( offsetParent, "borderTopWidth", true );
+ parentOffset.left += jQuery.css( offsetParent, "borderLeftWidth", true );
+ }
+ }
+
+ // Subtract parent offsets and element margins
+ return {
+ top: offset.top - parentOffset.top - jQuery.css( elem, "marginTop", true ),
+ left: offset.left - parentOffset.left - jQuery.css( elem, "marginLeft", true )
+ };
+ },
+
+ // This method will return documentElement in the following cases:
+ // 1) For the element inside the iframe without offsetParent, this method will return
+ // documentElement of the parent window
+ // 2) For the hidden or detached element
+ // 3) For body or html element, i.e. in case of the html node - it will return itself
+ //
+ // but those exceptions were never presented as a real life use-cases
+ // and might be considered as more preferable results.
+ //
+ // This logic, however, is not guaranteed and can change at any point in the future
+ offsetParent: function() {
+ return this.map( function() {
+ var offsetParent = this.offsetParent;
+
+ while ( offsetParent && jQuery.css( offsetParent, "position" ) === "static" ) {
+ offsetParent = offsetParent.offsetParent;
+ }
+
+ return offsetParent || documentElement;
+ } );
+ }
+} );
+
+// Create scrollLeft and scrollTop methods
+jQuery.each( { scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function( method, prop ) {
+ var top = "pageYOffset" === prop;
+
+ jQuery.fn[ method ] = function( val ) {
+ return access( this, function( elem, method, val ) {
+
+ // Coalesce documents and windows
+ var win;
+ if ( isWindow( elem ) ) {
+ win = elem;
+ } else if ( elem.nodeType === 9 ) {
+ win = elem.defaultView;
+ }
+
+ if ( val === undefined ) {
+ return win ? win[ prop ] : elem[ method ];
+ }
+
+ if ( win ) {
+ win.scrollTo(
+ !top ? val : win.pageXOffset,
+ top ? val : win.pageYOffset
+ );
+
+ } else {
+ elem[ method ] = val;
+ }
+ }, method, val, arguments.length );
+ };
+} );
+
+// Support: Safari <=7 - 9.1, Chrome <=37 - 49
+// Add the top/left cssHooks using jQuery.fn.position
+// Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
+// Blink bug: https://bugs.chromium.org/p/chromium/issues/detail?id=589347
+// getComputedStyle returns percent when specified for top/left/bottom/right;
+// rather than make the css module depend on the offset module, just check for it here
+jQuery.each( [ "top", "left" ], function( i, prop ) {
+ jQuery.cssHooks[ prop ] = addGetHookIf( support.pixelPosition,
+ function( elem, computed ) {
+ if ( computed ) {
+ computed = curCSS( elem, prop );
+
+ // If curCSS returns percentage, fallback to offset
+ return rnumnonpx.test( computed ) ?
+ jQuery( elem ).position()[ prop ] + "px" :
+ computed;
+ }
+ }
+ );
+} );
+
+
+// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
+jQuery.each( { Height: "height", Width: "width" }, function( name, type ) {
+ jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name },
+ function( defaultExtra, funcName ) {
+
+ // Margin is only for outerHeight, outerWidth
+ jQuery.fn[ funcName ] = function( margin, value ) {
+ var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ),
+ extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" );
+
+ return access( this, function( elem, type, value ) {
+ var doc;
+
+ if ( isWindow( elem ) ) {
+
+ // $( window ).outerWidth/Height return w/h including scrollbars (gh-1729)
+ return funcName.indexOf( "outer" ) === 0 ?
+ elem[ "inner" + name ] :
+ elem.document.documentElement[ "client" + name ];
+ }
+
+ // Get document width or height
+ if ( elem.nodeType === 9 ) {
+ doc = elem.documentElement;
+
+ // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height],
+ // whichever is greatest
+ return Math.max(
+ elem.body[ "scroll" + name ], doc[ "scroll" + name ],
+ elem.body[ "offset" + name ], doc[ "offset" + name ],
+ doc[ "client" + name ]
+ );
+ }
+
+ return value === undefined ?
+
+ // Get width or height on the element, requesting but not forcing parseFloat
+ jQuery.css( elem, type, extra ) :
+
+ // Set width or height on the element
+ jQuery.style( elem, type, value, extra );
+ }, type, chainable ? margin : undefined, chainable );
+ };
+ } );
+} );
+
+
+jQuery.each( ( "blur focus focusin focusout resize scroll click dblclick " +
+ "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+ "change select submit keydown keypress keyup contextmenu" ).split( " " ),
+ function( i, name ) {
+
+ // Handle event binding
+ jQuery.fn[ name ] = function( data, fn ) {
+ return arguments.length > 0 ?
+ this.on( name, null, data, fn ) :
+ this.trigger( name );
+ };
+} );
+
+jQuery.fn.extend( {
+ hover: function( fnOver, fnOut ) {
+ return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
+ }
+} );
+
+
+
+
+jQuery.fn.extend( {
+
+ bind: function( types, data, fn ) {
+ return this.on( types, null, data, fn );
+ },
+ unbind: function( types, fn ) {
+ return this.off( types, null, fn );
+ },
+
+ delegate: function( selector, types, data, fn ) {
+ return this.on( types, selector, data, fn );
+ },
+ undelegate: function( selector, types, fn ) {
+
+ // ( namespace ) or ( selector, types [, fn] )
+ return arguments.length === 1 ?
+ this.off( selector, "**" ) :
+ this.off( types, selector || "**", fn );
+ }
+} );
+
+// Bind a function to a context, optionally partially applying any
+// arguments.
+// jQuery.proxy is deprecated to promote standards (specifically Function#bind)
+// However, it is not slated for removal any time soon
+jQuery.proxy = function( fn, context ) {
+ var tmp, args, proxy;
+
+ if ( typeof context === "string" ) {
+ tmp = fn[ context ];
+ context = fn;
+ fn = tmp;
+ }
+
+ // Quick check to determine if target is callable, in the spec
+ // this throws a TypeError, but we will just return undefined.
+ if ( !isFunction( fn ) ) {
+ return undefined;
+ }
+
+ // Simulated bind
+ args = slice.call( arguments, 2 );
+ proxy = function() {
+ return fn.apply( context || this, args.concat( slice.call( arguments ) ) );
+ };
+
+ // Set the guid of unique handler to the same of original handler, so it can be removed
+ proxy.guid = fn.guid = fn.guid || jQuery.guid++;
+
+ return proxy;
+};
+
+jQuery.holdReady = function( hold ) {
+ if ( hold ) {
+ jQuery.readyWait++;
+ } else {
+ jQuery.ready( true );
+ }
+};
+jQuery.isArray = Array.isArray;
+jQuery.parseJSON = JSON.parse;
+jQuery.nodeName = nodeName;
+jQuery.isFunction = isFunction;
+jQuery.isWindow = isWindow;
+jQuery.camelCase = camelCase;
+jQuery.type = toType;
+
+jQuery.now = Date.now;
+
+jQuery.isNumeric = function( obj ) {
+
+ // As of jQuery 3.0, isNumeric is limited to
+ // strings and numbers (primitives or objects)
+ // that can be coerced to finite numbers (gh-2662)
+ var type = jQuery.type( obj );
+ return ( type === "number" || type === "string" ) &&
+
+ // parseFloat NaNs numeric-cast false positives ("")
+ // ...but misinterprets leading-number strings, particularly hex literals ("0x...")
+ // subtraction forces infinities to NaN
+ !isNaN( obj - parseFloat( obj ) );
+};
+
+
+
+
+// Register as a named AMD module, since jQuery can be concatenated with other
+// files that may use define, but not via a proper concatenation script that
+// understands anonymous AMD modules. A named AMD is safest and most robust
+// way to register. Lowercase jquery is used because AMD module names are
+// derived from file names, and jQuery is normally delivered in a lowercase
+// file name. Do this after creating the global so that if an AMD module wants
+// to call noConflict to hide this version of jQuery, it will work.
+
+// Note that for maximum portability, libraries that are not jQuery should
+// declare themselves as anonymous modules, and avoid setting a global if an
+// AMD loader is present. jQuery is a special case. For more information, see
+// https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon
+
+if ( true ) {
+ !(__WEBPACK_AMD_DEFINE_ARRAY__ = [], __WEBPACK_AMD_DEFINE_RESULT__ = (function() {
+ return jQuery;
+ }).apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__),
+ __WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));
+}
+
+
+
+
+var
+
+ // Map over jQuery in case of overwrite
+ _jQuery = window.jQuery,
+
+ // Map over the $ in case of overwrite
+ _$ = window.$;
+
+jQuery.noConflict = function( deep ) {
+ if ( window.$ === jQuery ) {
+ window.$ = _$;
+ }
+
+ if ( deep && window.jQuery === jQuery ) {
+ window.jQuery = _jQuery;
+ }
+
+ return jQuery;
+};
+
+// Expose jQuery and $ identifiers, even in AMD
+// (#7102#comment:10, https://github.com/jquery/jquery/pull/557)
+// and CommonJS for browser emulators (#13566)
+if ( !noGlobal ) {
+ window.jQuery = window.$ = jQuery;
+}
+
+
+
+
+return jQuery;
+} );
+
+
+/***/ }),
+
+/***/ "./node_modules/lodash/lodash.js":
+/*!***************************************!*\
+ !*** ./node_modules/lodash/lodash.js ***!
+ \***************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+/* WEBPACK VAR INJECTION */(function(global, module) {var __WEBPACK_AMD_DEFINE_RESULT__;/**
+ * @license
+ * Lodash <https://lodash.com/>
+ * Copyright JS Foundation and other contributors <https://js.foundation/>
+ * Released under MIT license <https://lodash.com/license>
+ * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
+ * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
+ */
+;(function() {
+
+ /** Used as a safe reference for `undefined` in pre-ES5 environments. */
+ var undefined;
+
+ /** Used as the semantic version number. */
+ var VERSION = '4.17.11';
+
+ /** Used as the size to enable large array optimizations. */
+ var LARGE_ARRAY_SIZE = 200;
+
+ /** Error message constants. */
+ var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.',
+ FUNC_ERROR_TEXT = 'Expected a function';
+
+ /** Used to stand-in for `undefined` hash values. */
+ var HASH_UNDEFINED = '__lodash_hash_undefined__';
+
+ /** Used as the maximum memoize cache size. */
+ var MAX_MEMOIZE_SIZE = 500;
+
+ /** Used as the internal argument placeholder. */
+ var PLACEHOLDER = '__lodash_placeholder__';
+
+ /** Used to compose bitmasks for cloning. */
+ var CLONE_DEEP_FLAG = 1,
+ CLONE_FLAT_FLAG = 2,
+ CLONE_SYMBOLS_FLAG = 4;
+
+ /** Used to compose bitmasks for value comparisons. */
+ var COMPARE_PARTIAL_FLAG = 1,
+ COMPARE_UNORDERED_FLAG = 2;
+
+ /** Used to compose bitmasks for function metadata. */
+ var WRAP_BIND_FLAG = 1,
+ WRAP_BIND_KEY_FLAG = 2,
+ WRAP_CURRY_BOUND_FLAG = 4,
+ WRAP_CURRY_FLAG = 8,
+ WRAP_CURRY_RIGHT_FLAG = 16,
+ WRAP_PARTIAL_FLAG = 32,
+ WRAP_PARTIAL_RIGHT_FLAG = 64,
+ WRAP_ARY_FLAG = 128,
+ WRAP_REARG_FLAG = 256,
+ WRAP_FLIP_FLAG = 512;
+
+ /** Used as default options for `_.truncate`. */
+ var DEFAULT_TRUNC_LENGTH = 30,
+ DEFAULT_TRUNC_OMISSION = '...';
+
+ /** Used to detect hot functions by number of calls within a span of milliseconds. */
+ var HOT_COUNT = 800,
+ HOT_SPAN = 16;
+
+ /** Used to indicate the type of lazy iteratees. */
+ var LAZY_FILTER_FLAG = 1,
+ LAZY_MAP_FLAG = 2,
+ LAZY_WHILE_FLAG = 3;
+
+ /** Used as references for various `Number` constants. */
+ var INFINITY = 1 / 0,
+ MAX_SAFE_INTEGER = 9007199254740991,
+ MAX_INTEGER = 1.7976931348623157e+308,
+ NAN = 0 / 0;
+
+ /** Used as references for the maximum length and index of an array. */
+ var MAX_ARRAY_LENGTH = 4294967295,
+ MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1,
+ HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1;
+
+ /** Used to associate wrap methods with their bit flags. */
+ var wrapFlags = [
+ ['ary', WRAP_ARY_FLAG],
+ ['bind', WRAP_BIND_FLAG],
+ ['bindKey', WRAP_BIND_KEY_FLAG],
+ ['curry', WRAP_CURRY_FLAG],
+ ['curryRight', WRAP_CURRY_RIGHT_FLAG],
+ ['flip', WRAP_FLIP_FLAG],
+ ['partial', WRAP_PARTIAL_FLAG],
+ ['partialRight', WRAP_PARTIAL_RIGHT_FLAG],
+ ['rearg', WRAP_REARG_FLAG]
+ ];
+
+ /** `Object#toString` result references. */
+ var argsTag = '[object Arguments]',
+ arrayTag = '[object Array]',
+ asyncTag = '[object AsyncFunction]',
+ boolTag = '[object Boolean]',
+ dateTag = '[object Date]',
+ domExcTag = '[object DOMException]',
+ errorTag = '[object Error]',
+ funcTag = '[object Function]',
+ genTag = '[object GeneratorFunction]',
+ mapTag = '[object Map]',
+ numberTag = '[object Number]',
+ nullTag = '[object Null]',
+ objectTag = '[object Object]',
+ promiseTag = '[object Promise]',
+ proxyTag = '[object Proxy]',
+ regexpTag = '[object RegExp]',
+ setTag = '[object Set]',
+ stringTag = '[object String]',
+ symbolTag = '[object Symbol]',
+ undefinedTag = '[object Undefined]',
+ weakMapTag = '[object WeakMap]',
+ weakSetTag = '[object WeakSet]';
+
+ var arrayBufferTag = '[object ArrayBuffer]',
+ dataViewTag = '[object DataView]',
+ float32Tag = '[object Float32Array]',
+ float64Tag = '[object Float64Array]',
+ int8Tag = '[object Int8Array]',
+ int16Tag = '[object Int16Array]',
+ int32Tag = '[object Int32Array]',
+ uint8Tag = '[object Uint8Array]',
+ uint8ClampedTag = '[object Uint8ClampedArray]',
+ uint16Tag = '[object Uint16Array]',
+ uint32Tag = '[object Uint32Array]';
+
+ /** Used to match empty string literals in compiled template source. */
+ var reEmptyStringLeading = /\b__p \+= '';/g,
+ reEmptyStringMiddle = /\b(__p \+=) '' \+/g,
+ reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g;
+
+ /** Used to match HTML entities and HTML characters. */
+ var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g,
+ reUnescapedHtml = /[&<>"']/g,
+ reHasEscapedHtml = RegExp(reEscapedHtml.source),
+ reHasUnescapedHtml = RegExp(reUnescapedHtml.source);
+
+ /** Used to match template delimiters. */
+ var reEscape = /<%-([\s\S]+?)%>/g,
+ reEvaluate = /<%([\s\S]+?)%>/g,
+ reInterpolate = /<%=([\s\S]+?)%>/g;
+
+ /** Used to match property names within property paths. */
+ var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/,
+ reIsPlainProp = /^\w*$/,
+ rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g;
+
+ /**
+ * Used to match `RegExp`
+ * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).
+ */
+ var reRegExpChar = /[\\^$.*+?()[\]{}|]/g,
+ reHasRegExpChar = RegExp(reRegExpChar.source);
+
+ /** Used to match leading and trailing whitespace. */
+ var reTrim = /^\s+|\s+$/g,
+ reTrimStart = /^\s+/,
+ reTrimEnd = /\s+$/;
+
+ /** Used to match wrap detail comments. */
+ var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/,
+ reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/,
+ reSplitDetails = /,? & /;
+
+ /** Used to match words composed of alphanumeric characters. */
+ var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g;
+
+ /** Used to match backslashes in property paths. */
+ var reEscapeChar = /\\(\\)?/g;
+
+ /**
+ * Used to match
+ * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components).
+ */
+ var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g;
+
+ /** Used to match `RegExp` flags from their coerced string values. */
+ var reFlags = /\w*$/;
+
+ /** Used to detect bad signed hexadecimal string values. */
+ var reIsBadHex = /^[-+]0x[0-9a-f]+$/i;
+
+ /** Used to detect binary string values. */
+ var reIsBinary = /^0b[01]+$/i;
+
+ /** Used to detect host constructors (Safari). */
+ var reIsHostCtor = /^\[object .+?Constructor\]$/;
+
+ /** Used to detect octal string values. */
+ var reIsOctal = /^0o[0-7]+$/i;
+
+ /** Used to detect unsigned integer values. */
+ var reIsUint = /^(?:0|[1-9]\d*)$/;
+
+ /** Used to match Latin Unicode letters (excluding mathematical operators). */
+ var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g;
+
+ /** Used to ensure capturing order of template delimiters. */
+ var reNoMatch = /($^)/;
+
+ /** Used to match unescaped characters in compiled string literals. */
+ var reUnescapedString = /['\n\r\u2028\u2029\\]/g;
+
+ /** Used to compose unicode character classes. */
+ var rsAstralRange = '\\ud800-\\udfff',
+ rsComboMarksRange = '\\u0300-\\u036f',
+ reComboHalfMarksRange = '\\ufe20-\\ufe2f',
+ rsComboSymbolsRange = '\\u20d0-\\u20ff',
+ rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange,
+ rsDingbatRange = '\\u2700-\\u27bf',
+ rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff',
+ rsMathOpRange = '\\xac\\xb1\\xd7\\xf7',
+ rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf',
+ rsPunctuationRange = '\\u2000-\\u206f',
+ rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000',
+ rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde',
+ rsVarRange = '\\ufe0e\\ufe0f',
+ rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange;
+
+ /** Used to compose unicode capture groups. */
+ var rsApos = "['\u2019]",
+ rsAstral = '[' + rsAstralRange + ']',
+ rsBreak = '[' + rsBreakRange + ']',
+ rsCombo = '[' + rsComboRange + ']',
+ rsDigits = '\\d+',
+ rsDingbat = '[' + rsDingbatRange + ']',
+ rsLower = '[' + rsLowerRange + ']',
+ rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']',
+ rsFitz = '\\ud83c[\\udffb-\\udfff]',
+ rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')',
+ rsNonAstral = '[^' + rsAstralRange + ']',
+ rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}',
+ rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]',
+ rsUpper = '[' + rsUpperRange + ']',
+ rsZWJ = '\\u200d';
+
+ /** Used to compose unicode regexes. */
+ var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')',
+ rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')',
+ rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?',
+ rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?',
+ reOptMod = rsModifier + '?',
+ rsOptVar = '[' + rsVarRange + ']?',
+ rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*',
+ rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])',
+ rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])',
+ rsSeq = rsOptVar + reOptMod + rsOptJoin,
+ rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq,
+ rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')';
+
+ /** Used to match apostrophes. */
+ var reApos = RegExp(rsApos, 'g');
+
+ /**
+ * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and
+ * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols).
+ */
+ var reComboMark = RegExp(rsCombo, 'g');
+
+ /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */
+ var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g');
+
+ /** Used to match complex or compound words. */
+ var reUnicodeWord = RegExp([
+ rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')',
+ rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')',
+ rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower,
+ rsUpper + '+' + rsOptContrUpper,
+ rsOrdUpper,
+ rsOrdLower,
+ rsDigits,
+ rsEmoji
+ ].join('|'), 'g');
+
+ /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */
+ var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']');
+
+ /** Used to detect strings that need a more robust regexp to match words. */
+ var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/;
+
+ /** Used to assign default `context` object properties. */
+ var contextProps = [
+ 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array',
+ 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object',
+ 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array',
+ 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap',
+ '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout'
+ ];
+
+ /** Used to make template sourceURLs easier to identify. */
+ var templateCounter = -1;
+
+ /** Used to identify `toStringTag` values of typed arrays. */
+ var typedArrayTags = {};
+ typedArrayTags[float32Tag] = typedArrayTags[float64Tag] =
+ typedArrayTags[int8Tag] = typedArrayTags[int16Tag] =
+ typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] =
+ typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] =
+ typedArrayTags[uint32Tag] = true;
+ typedArrayTags[argsTag] = typedArrayTags[arrayTag] =
+ typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] =
+ typedArrayTags[dataViewTag] = typedArrayTags[dateTag] =
+ typedArrayTags[errorTag] = typedArrayTags[funcTag] =
+ typedArrayTags[mapTag] = typedArrayTags[numberTag] =
+ typedArrayTags[objectTag] = typedArrayTags[regexpTag] =
+ typedArrayTags[setTag] = typedArrayTags[stringTag] =
+ typedArrayTags[weakMapTag] = false;
+
+ /** Used to identify `toStringTag` values supported by `_.clone`. */
+ var cloneableTags = {};
+ cloneableTags[argsTag] = cloneableTags[arrayTag] =
+ cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] =
+ cloneableTags[boolTag] = cloneableTags[dateTag] =
+ cloneableTags[float32Tag] = cloneableTags[float64Tag] =
+ cloneableTags[int8Tag] = cloneableTags[int16Tag] =
+ cloneableTags[int32Tag] = cloneableTags[mapTag] =
+ cloneableTags[numberTag] = cloneableTags[objectTag] =
+ cloneableTags[regexpTag] = cloneableTags[setTag] =
+ cloneableTags[stringTag] = cloneableTags[symbolTag] =
+ cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] =
+ cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;
+ cloneableTags[errorTag] = cloneableTags[funcTag] =
+ cloneableTags[weakMapTag] = false;
+
+ /** Used to map Latin Unicode letters to basic Latin letters. */
+ var deburredLetters = {
+ // Latin-1 Supplement block.
+ '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A',
+ '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a',
+ '\xc7': 'C', '\xe7': 'c',
+ '\xd0': 'D', '\xf0': 'd',
+ '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E',
+ '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e',
+ '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I',
+ '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i',
+ '\xd1': 'N', '\xf1': 'n',
+ '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O',
+ '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o',
+ '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U',
+ '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u',
+ '\xdd': 'Y', '\xfd': 'y', '\xff': 'y',
+ '\xc6': 'Ae', '\xe6': 'ae',
+ '\xde': 'Th', '\xfe': 'th',
+ '\xdf': 'ss',
+ // Latin Extended-A block.
+ '\u0100': 'A', '\u0102': 'A', '\u0104': 'A',
+ '\u0101': 'a', '\u0103': 'a', '\u0105': 'a',
+ '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C',
+ '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c',
+ '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd',
+ '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E',
+ '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e',
+ '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G',
+ '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g',
+ '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h',
+ '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I',
+ '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i',
+ '\u0134': 'J', '\u0135': 'j',
+ '\u0136': 'K', '\u0137': 'k', '\u0138': 'k',
+ '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L',
+ '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l',
+ '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N',
+ '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n',
+ '\u014c': 'O', '\u014e': 'O', '\u0150': 'O',
+ '\u014d': 'o', '\u014f': 'o', '\u0151': 'o',
+ '\u0154': 'R', '\u0156': 'R', '\u0158': 'R',
+ '\u0155': 'r', '\u0157': 'r', '\u0159': 'r',
+ '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S',
+ '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's',
+ '\u0162': 'T', '\u0164': 'T', '\u0166': 'T',
+ '\u0163': 't', '\u0165': 't', '\u0167': 't',
+ '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U',
+ '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u',
+ '\u0174': 'W', '\u0175': 'w',
+ '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y',
+ '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z',
+ '\u017a': 'z', '\u017c': 'z', '\u017e': 'z',
+ '\u0132': 'IJ', '\u0133': 'ij',
+ '\u0152': 'Oe', '\u0153': 'oe',
+ '\u0149': "'n", '\u017f': 's'
+ };
+
+ /** Used to map characters to HTML entities. */
+ var htmlEscapes = {
+ '&': '&',
+ '<': '<',
+ '>': '>',
+ '"': '"',
+ "'": '''
+ };
+
+ /** Used to map HTML entities to characters. */
+ var htmlUnescapes = {
+ '&': '&',
+ '<': '<',
+ '>': '>',
+ '"': '"',
+ ''': "'"
+ };
+
+ /** Used to escape characters for inclusion in compiled string literals. */
+ var stringEscapes = {
+ '\\': '\\',
+ "'": "'",
+ '\n': 'n',
+ '\r': 'r',
+ '\u2028': 'u2028',
+ '\u2029': 'u2029'
+ };
+
+ /** Built-in method references without a dependency on `root`. */
+ var freeParseFloat = parseFloat,
+ freeParseInt = parseInt;
+
+ /** Detect free variable `global` from Node.js. */
+ var freeGlobal = typeof global == 'object' && global && global.Object === Object && global;
+
+ /** Detect free variable `self`. */
+ var freeSelf = typeof self == 'object' && self && self.Object === Object && self;
+
+ /** Used as a reference to the global object. */
+ var root = freeGlobal || freeSelf || Function('return this')();
+
+ /** Detect free variable `exports`. */
+ var freeExports = true && exports && !exports.nodeType && exports;
+
+ /** Detect free variable `module`. */
+ var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module;
+
+ /** Detect the popular CommonJS extension `module.exports`. */
+ var moduleExports = freeModule && freeModule.exports === freeExports;
+
+ /** Detect free variable `process` from Node.js. */
+ var freeProcess = moduleExports && freeGlobal.process;
+
+ /** Used to access faster Node.js helpers. */
+ var nodeUtil = (function() {
+ try {
+ // Use `util.types` for Node.js 10+.
+ var types = freeModule && freeModule.require && freeModule.require('util').types;
+
+ if (types) {
+ return types;
+ }
+
+ // Legacy `process.binding('util')` for Node.js < 10.
+ return freeProcess && freeProcess.binding && freeProcess.binding('util');
+ } catch (e) {}
+ }());
+
+ /* Node.js helper references. */
+ var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer,
+ nodeIsDate = nodeUtil && nodeUtil.isDate,
+ nodeIsMap = nodeUtil && nodeUtil.isMap,
+ nodeIsRegExp = nodeUtil && nodeUtil.isRegExp,
+ nodeIsSet = nodeUtil && nodeUtil.isSet,
+ nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * A faster alternative to `Function#apply`, this function invokes `func`
+ * with the `this` binding of `thisArg` and the arguments of `args`.
+ *
+ * @private
+ * @param {Function} func The function to invoke.
+ * @param {*} thisArg The `this` binding of `func`.
+ * @param {Array} args The arguments to invoke `func` with.
+ * @returns {*} Returns the result of `func`.
+ */
+ function apply(func, thisArg, args) {
+ switch (args.length) {
+ case 0: return func.call(thisArg);
+ case 1: return func.call(thisArg, args[0]);
+ case 2: return func.call(thisArg, args[0], args[1]);
+ case 3: return func.call(thisArg, args[0], args[1], args[2]);
+ }
+ return func.apply(thisArg, args);
+ }
+
+ /**
+ * A specialized version of `baseAggregator` for arrays.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} setter The function to set `accumulator` values.
+ * @param {Function} iteratee The iteratee to transform keys.
+ * @param {Object} accumulator The initial aggregated object.
+ * @returns {Function} Returns `accumulator`.
+ */
+ function arrayAggregator(array, setter, iteratee, accumulator) {
+ var index = -1,
+ length = array == null ? 0 : array.length;
+
+ while (++index < length) {
+ var value = array[index];
+ setter(accumulator, value, iteratee(value), array);
+ }
+ return accumulator;
+ }
+
+ /**
+ * A specialized version of `_.forEach` for arrays without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Array} Returns `array`.
+ */
+ function arrayEach(array, iteratee) {
+ var index = -1,
+ length = array == null ? 0 : array.length;
+
+ while (++index < length) {
+ if (iteratee(array[index], index, array) === false) {
+ break;
+ }
+ }
+ return array;
+ }
+
+ /**
+ * A specialized version of `_.forEachRight` for arrays without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Array} Returns `array`.
+ */
+ function arrayEachRight(array, iteratee) {
+ var length = array == null ? 0 : array.length;
+
+ while (length--) {
+ if (iteratee(array[length], length, array) === false) {
+ break;
+ }
+ }
+ return array;
+ }
+
+ /**
+ * A specialized version of `_.every` for arrays without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} predicate The function invoked per iteration.
+ * @returns {boolean} Returns `true` if all elements pass the predicate check,
+ * else `false`.
+ */
+ function arrayEvery(array, predicate) {
+ var index = -1,
+ length = array == null ? 0 : array.length;
+
+ while (++index < length) {
+ if (!predicate(array[index], index, array)) {
+ return false;
+ }
+ }
+ return true;
+ }
+
+ /**
+ * A specialized version of `_.filter` for arrays without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} predicate The function invoked per iteration.
+ * @returns {Array} Returns the new filtered array.
+ */
+ function arrayFilter(array, predicate) {
+ var index = -1,
+ length = array == null ? 0 : array.length,
+ resIndex = 0,
+ result = [];
+
+ while (++index < length) {
+ var value = array[index];
+ if (predicate(value, index, array)) {
+ result[resIndex++] = value;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * A specialized version of `_.includes` for arrays without support for
+ * specifying an index to search from.
+ *
+ * @private
+ * @param {Array} [array] The array to inspect.
+ * @param {*} target The value to search for.
+ * @returns {boolean} Returns `true` if `target` is found, else `false`.
+ */
+ function arrayIncludes(array, value) {
+ var length = array == null ? 0 : array.length;
+ return !!length && baseIndexOf(array, value, 0) > -1;
+ }
+
+ /**
+ * This function is like `arrayIncludes` except that it accepts a comparator.
+ *
+ * @private
+ * @param {Array} [array] The array to inspect.
+ * @param {*} target The value to search for.
+ * @param {Function} comparator The comparator invoked per element.
+ * @returns {boolean} Returns `true` if `target` is found, else `false`.
+ */
+ function arrayIncludesWith(array, value, comparator) {
+ var index = -1,
+ length = array == null ? 0 : array.length;
+
+ while (++index < length) {
+ if (comparator(value, array[index])) {
+ return true;
+ }
+ }
+ return false;
+ }
+
+ /**
+ * A specialized version of `_.map` for arrays without support for iteratee
+ * shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Array} Returns the new mapped array.
+ */
+ function arrayMap(array, iteratee) {
+ var index = -1,
+ length = array == null ? 0 : array.length,
+ result = Array(length);
+
+ while (++index < length) {
+ result[index] = iteratee(array[index], index, array);
+ }
+ return result;
+ }
+
+ /**
+ * Appends the elements of `values` to `array`.
+ *
+ * @private
+ * @param {Array} array The array to modify.
+ * @param {Array} values The values to append.
+ * @returns {Array} Returns `array`.
+ */
+ function arrayPush(array, values) {
+ var index = -1,
+ length = values.length,
+ offset = array.length;
+
+ while (++index < length) {
+ array[offset + index] = values[index];
+ }
+ return array;
+ }
+
+ /**
+ * A specialized version of `_.reduce` for arrays without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @param {*} [accumulator] The initial value.
+ * @param {boolean} [initAccum] Specify using the first element of `array` as
+ * the initial value.
+ * @returns {*} Returns the accumulated value.
+ */
+ function arrayReduce(array, iteratee, accumulator, initAccum) {
+ var index = -1,
+ length = array == null ? 0 : array.length;
+
+ if (initAccum && length) {
+ accumulator = array[++index];
+ }
+ while (++index < length) {
+ accumulator = iteratee(accumulator, array[index], index, array);
+ }
+ return accumulator;
+ }
+
+ /**
+ * A specialized version of `_.reduceRight` for arrays without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @param {*} [accumulator] The initial value.
+ * @param {boolean} [initAccum] Specify using the last element of `array` as
+ * the initial value.
+ * @returns {*} Returns the accumulated value.
+ */
+ function arrayReduceRight(array, iteratee, accumulator, initAccum) {
+ var length = array == null ? 0 : array.length;
+ if (initAccum && length) {
+ accumulator = array[--length];
+ }
+ while (length--) {
+ accumulator = iteratee(accumulator, array[length], length, array);
+ }
+ return accumulator;
+ }
+
+ /**
+ * A specialized version of `_.some` for arrays without support for iteratee
+ * shorthands.
+ *
+ * @private
+ * @param {Array} [array] The array to iterate over.
+ * @param {Function} predicate The function invoked per iteration.
+ * @returns {boolean} Returns `true` if any element passes the predicate check,
+ * else `false`.
+ */
+ function arraySome(array, predicate) {
+ var index = -1,
+ length = array == null ? 0 : array.length;
+
+ while (++index < length) {
+ if (predicate(array[index], index, array)) {
+ return true;
+ }
+ }
+ return false;
+ }
+
+ /**
+ * Gets the size of an ASCII `string`.
+ *
+ * @private
+ * @param {string} string The string inspect.
+ * @returns {number} Returns the string size.
+ */
+ var asciiSize = baseProperty('length');
+
+ /**
+ * Converts an ASCII `string` to an array.
+ *
+ * @private
+ * @param {string} string The string to convert.
+ * @returns {Array} Returns the converted array.
+ */
+ function asciiToArray(string) {
+ return string.split('');
+ }
+
+ /**
+ * Splits an ASCII `string` into an array of its words.
+ *
+ * @private
+ * @param {string} The string to inspect.
+ * @returns {Array} Returns the words of `string`.
+ */
+ function asciiWords(string) {
+ return string.match(reAsciiWord) || [];
+ }
+
+ /**
+ * The base implementation of methods like `_.findKey` and `_.findLastKey`,
+ * without support for iteratee shorthands, which iterates over `collection`
+ * using `eachFunc`.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to inspect.
+ * @param {Function} predicate The function invoked per iteration.
+ * @param {Function} eachFunc The function to iterate over `collection`.
+ * @returns {*} Returns the found element or its key, else `undefined`.
+ */
+ function baseFindKey(collection, predicate, eachFunc) {
+ var result;
+ eachFunc(collection, function(value, key, collection) {
+ if (predicate(value, key, collection)) {
+ result = key;
+ return false;
+ }
+ });
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.findIndex` and `_.findLastIndex` without
+ * support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {Function} predicate The function invoked per iteration.
+ * @param {number} fromIndex The index to search from.
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ */
+ function baseFindIndex(array, predicate, fromIndex, fromRight) {
+ var length = array.length,
+ index = fromIndex + (fromRight ? 1 : -1);
+
+ while ((fromRight ? index-- : ++index < length)) {
+ if (predicate(array[index], index, array)) {
+ return index;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * The base implementation of `_.indexOf` without `fromIndex` bounds checks.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @param {number} fromIndex The index to search from.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ */
+ function baseIndexOf(array, value, fromIndex) {
+ return value === value
+ ? strictIndexOf(array, value, fromIndex)
+ : baseFindIndex(array, baseIsNaN, fromIndex);
+ }
+
+ /**
+ * This function is like `baseIndexOf` except that it accepts a comparator.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @param {number} fromIndex The index to search from.
+ * @param {Function} comparator The comparator invoked per element.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ */
+ function baseIndexOfWith(array, value, fromIndex, comparator) {
+ var index = fromIndex - 1,
+ length = array.length;
+
+ while (++index < length) {
+ if (comparator(array[index], value)) {
+ return index;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * The base implementation of `_.isNaN` without support for number objects.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.
+ */
+ function baseIsNaN(value) {
+ return value !== value;
+ }
+
+ /**
+ * The base implementation of `_.mean` and `_.meanBy` without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} array The array to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {number} Returns the mean.
+ */
+ function baseMean(array, iteratee) {
+ var length = array == null ? 0 : array.length;
+ return length ? (baseSum(array, iteratee) / length) : NAN;
+ }
+
+ /**
+ * The base implementation of `_.property` without support for deep paths.
+ *
+ * @private
+ * @param {string} key The key of the property to get.
+ * @returns {Function} Returns the new accessor function.
+ */
+ function baseProperty(key) {
+ return function(object) {
+ return object == null ? undefined : object[key];
+ };
+ }
+
+ /**
+ * The base implementation of `_.propertyOf` without support for deep paths.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Function} Returns the new accessor function.
+ */
+ function basePropertyOf(object) {
+ return function(key) {
+ return object == null ? undefined : object[key];
+ };
+ }
+
+ /**
+ * The base implementation of `_.reduce` and `_.reduceRight`, without support
+ * for iteratee shorthands, which iterates over `collection` using `eachFunc`.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @param {*} accumulator The initial value.
+ * @param {boolean} initAccum Specify using the first or last element of
+ * `collection` as the initial value.
+ * @param {Function} eachFunc The function to iterate over `collection`.
+ * @returns {*} Returns the accumulated value.
+ */
+ function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) {
+ eachFunc(collection, function(value, index, collection) {
+ accumulator = initAccum
+ ? (initAccum = false, value)
+ : iteratee(accumulator, value, index, collection);
+ });
+ return accumulator;
+ }
+
+ /**
+ * The base implementation of `_.sortBy` which uses `comparer` to define the
+ * sort order of `array` and replaces criteria objects with their corresponding
+ * values.
+ *
+ * @private
+ * @param {Array} array The array to sort.
+ * @param {Function} comparer The function to define sort order.
+ * @returns {Array} Returns `array`.
+ */
+ function baseSortBy(array, comparer) {
+ var length = array.length;
+
+ array.sort(comparer);
+ while (length--) {
+ array[length] = array[length].value;
+ }
+ return array;
+ }
+
+ /**
+ * The base implementation of `_.sum` and `_.sumBy` without support for
+ * iteratee shorthands.
+ *
+ * @private
+ * @param {Array} array The array to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {number} Returns the sum.
+ */
+ function baseSum(array, iteratee) {
+ var result,
+ index = -1,
+ length = array.length;
+
+ while (++index < length) {
+ var current = iteratee(array[index]);
+ if (current !== undefined) {
+ result = result === undefined ? current : (result + current);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.times` without support for iteratee shorthands
+ * or max array length checks.
+ *
+ * @private
+ * @param {number} n The number of times to invoke `iteratee`.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Array} Returns the array of results.
+ */
+ function baseTimes(n, iteratee) {
+ var index = -1,
+ result = Array(n);
+
+ while (++index < n) {
+ result[index] = iteratee(index);
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array
+ * of key-value pairs for `object` corresponding to the property names of `props`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {Array} props The property names to get values for.
+ * @returns {Object} Returns the key-value pairs.
+ */
+ function baseToPairs(object, props) {
+ return arrayMap(props, function(key) {
+ return [key, object[key]];
+ });
+ }
+
+ /**
+ * The base implementation of `_.unary` without support for storing metadata.
+ *
+ * @private
+ * @param {Function} func The function to cap arguments for.
+ * @returns {Function} Returns the new capped function.
+ */
+ function baseUnary(func) {
+ return function(value) {
+ return func(value);
+ };
+ }
+
+ /**
+ * The base implementation of `_.values` and `_.valuesIn` which creates an
+ * array of `object` property values corresponding to the property names
+ * of `props`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {Array} props The property names to get values for.
+ * @returns {Object} Returns the array of property values.
+ */
+ function baseValues(object, props) {
+ return arrayMap(props, function(key) {
+ return object[key];
+ });
+ }
+
+ /**
+ * Checks if a `cache` value for `key` exists.
+ *
+ * @private
+ * @param {Object} cache The cache to query.
+ * @param {string} key The key of the entry to check.
+ * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
+ */
+ function cacheHas(cache, key) {
+ return cache.has(key);
+ }
+
+ /**
+ * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol
+ * that is not found in the character symbols.
+ *
+ * @private
+ * @param {Array} strSymbols The string symbols to inspect.
+ * @param {Array} chrSymbols The character symbols to find.
+ * @returns {number} Returns the index of the first unmatched string symbol.
+ */
+ function charsStartIndex(strSymbols, chrSymbols) {
+ var index = -1,
+ length = strSymbols.length;
+
+ while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}
+ return index;
+ }
+
+ /**
+ * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol
+ * that is not found in the character symbols.
+ *
+ * @private
+ * @param {Array} strSymbols The string symbols to inspect.
+ * @param {Array} chrSymbols The character symbols to find.
+ * @returns {number} Returns the index of the last unmatched string symbol.
+ */
+ function charsEndIndex(strSymbols, chrSymbols) {
+ var index = strSymbols.length;
+
+ while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}
+ return index;
+ }
+
+ /**
+ * Gets the number of `placeholder` occurrences in `array`.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {*} placeholder The placeholder to search for.
+ * @returns {number} Returns the placeholder count.
+ */
+ function countHolders(array, placeholder) {
+ var length = array.length,
+ result = 0;
+
+ while (length--) {
+ if (array[length] === placeholder) {
+ ++result;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A
+ * letters to basic Latin letters.
+ *
+ * @private
+ * @param {string} letter The matched letter to deburr.
+ * @returns {string} Returns the deburred letter.
+ */
+ var deburrLetter = basePropertyOf(deburredLetters);
+
+ /**
+ * Used by `_.escape` to convert characters to HTML entities.
+ *
+ * @private
+ * @param {string} chr The matched character to escape.
+ * @returns {string} Returns the escaped character.
+ */
+ var escapeHtmlChar = basePropertyOf(htmlEscapes);
+
+ /**
+ * Used by `_.template` to escape characters for inclusion in compiled string literals.
+ *
+ * @private
+ * @param {string} chr The matched character to escape.
+ * @returns {string} Returns the escaped character.
+ */
+ function escapeStringChar(chr) {
+ return '\\' + stringEscapes[chr];
+ }
+
+ /**
+ * Gets the value at `key` of `object`.
+ *
+ * @private
+ * @param {Object} [object] The object to query.
+ * @param {string} key The key of the property to get.
+ * @returns {*} Returns the property value.
+ */
+ function getValue(object, key) {
+ return object == null ? undefined : object[key];
+ }
+
+ /**
+ * Checks if `string` contains Unicode symbols.
+ *
+ * @private
+ * @param {string} string The string to inspect.
+ * @returns {boolean} Returns `true` if a symbol is found, else `false`.
+ */
+ function hasUnicode(string) {
+ return reHasUnicode.test(string);
+ }
+
+ /**
+ * Checks if `string` contains a word composed of Unicode symbols.
+ *
+ * @private
+ * @param {string} string The string to inspect.
+ * @returns {boolean} Returns `true` if a word is found, else `false`.
+ */
+ function hasUnicodeWord(string) {
+ return reHasUnicodeWord.test(string);
+ }
+
+ /**
+ * Converts `iterator` to an array.
+ *
+ * @private
+ * @param {Object} iterator The iterator to convert.
+ * @returns {Array} Returns the converted array.
+ */
+ function iteratorToArray(iterator) {
+ var data,
+ result = [];
+
+ while (!(data = iterator.next()).done) {
+ result.push(data.value);
+ }
+ return result;
+ }
+
+ /**
+ * Converts `map` to its key-value pairs.
+ *
+ * @private
+ * @param {Object} map The map to convert.
+ * @returns {Array} Returns the key-value pairs.
+ */
+ function mapToArray(map) {
+ var index = -1,
+ result = Array(map.size);
+
+ map.forEach(function(value, key) {
+ result[++index] = [key, value];
+ });
+ return result;
+ }
+
+ /**
+ * Creates a unary function that invokes `func` with its argument transformed.
+ *
+ * @private
+ * @param {Function} func The function to wrap.
+ * @param {Function} transform The argument transform.
+ * @returns {Function} Returns the new function.
+ */
+ function overArg(func, transform) {
+ return function(arg) {
+ return func(transform(arg));
+ };
+ }
+
+ /**
+ * Replaces all `placeholder` elements in `array` with an internal placeholder
+ * and returns an array of their indexes.
+ *
+ * @private
+ * @param {Array} array The array to modify.
+ * @param {*} placeholder The placeholder to replace.
+ * @returns {Array} Returns the new array of placeholder indexes.
+ */
+ function replaceHolders(array, placeholder) {
+ var index = -1,
+ length = array.length,
+ resIndex = 0,
+ result = [];
+
+ while (++index < length) {
+ var value = array[index];
+ if (value === placeholder || value === PLACEHOLDER) {
+ array[index] = PLACEHOLDER;
+ result[resIndex++] = index;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Converts `set` to an array of its values.
+ *
+ * @private
+ * @param {Object} set The set to convert.
+ * @returns {Array} Returns the values.
+ */
+ function setToArray(set) {
+ var index = -1,
+ result = Array(set.size);
+
+ set.forEach(function(value) {
+ result[++index] = value;
+ });
+ return result;
+ }
+
+ /**
+ * Converts `set` to its value-value pairs.
+ *
+ * @private
+ * @param {Object} set The set to convert.
+ * @returns {Array} Returns the value-value pairs.
+ */
+ function setToPairs(set) {
+ var index = -1,
+ result = Array(set.size);
+
+ set.forEach(function(value) {
+ result[++index] = [value, value];
+ });
+ return result;
+ }
+
+ /**
+ * A specialized version of `_.indexOf` which performs strict equality
+ * comparisons of values, i.e. `===`.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @param {number} fromIndex The index to search from.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ */
+ function strictIndexOf(array, value, fromIndex) {
+ var index = fromIndex - 1,
+ length = array.length;
+
+ while (++index < length) {
+ if (array[index] === value) {
+ return index;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * A specialized version of `_.lastIndexOf` which performs strict equality
+ * comparisons of values, i.e. `===`.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @param {number} fromIndex The index to search from.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ */
+ function strictLastIndexOf(array, value, fromIndex) {
+ var index = fromIndex + 1;
+ while (index--) {
+ if (array[index] === value) {
+ return index;
+ }
+ }
+ return index;
+ }
+
+ /**
+ * Gets the number of symbols in `string`.
+ *
+ * @private
+ * @param {string} string The string to inspect.
+ * @returns {number} Returns the string size.
+ */
+ function stringSize(string) {
+ return hasUnicode(string)
+ ? unicodeSize(string)
+ : asciiSize(string);
+ }
+
+ /**
+ * Converts `string` to an array.
+ *
+ * @private
+ * @param {string} string The string to convert.
+ * @returns {Array} Returns the converted array.
+ */
+ function stringToArray(string) {
+ return hasUnicode(string)
+ ? unicodeToArray(string)
+ : asciiToArray(string);
+ }
+
+ /**
+ * Used by `_.unescape` to convert HTML entities to characters.
+ *
+ * @private
+ * @param {string} chr The matched character to unescape.
+ * @returns {string} Returns the unescaped character.
+ */
+ var unescapeHtmlChar = basePropertyOf(htmlUnescapes);
+
+ /**
+ * Gets the size of a Unicode `string`.
+ *
+ * @private
+ * @param {string} string The string inspect.
+ * @returns {number} Returns the string size.
+ */
+ function unicodeSize(string) {
+ var result = reUnicode.lastIndex = 0;
+ while (reUnicode.test(string)) {
+ ++result;
+ }
+ return result;
+ }
+
+ /**
+ * Converts a Unicode `string` to an array.
+ *
+ * @private
+ * @param {string} string The string to convert.
+ * @returns {Array} Returns the converted array.
+ */
+ function unicodeToArray(string) {
+ return string.match(reUnicode) || [];
+ }
+
+ /**
+ * Splits a Unicode `string` into an array of its words.
+ *
+ * @private
+ * @param {string} The string to inspect.
+ * @returns {Array} Returns the words of `string`.
+ */
+ function unicodeWords(string) {
+ return string.match(reUnicodeWord) || [];
+ }
+
+ /*--------------------------------------------------------------------------*/
+
+ /**
+ * Create a new pristine `lodash` function using the `context` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.1.0
+ * @category Util
+ * @param {Object} [context=root] The context object.
+ * @returns {Function} Returns a new `lodash` function.
+ * @example
+ *
+ * _.mixin({ 'foo': _.constant('foo') });
+ *
+ * var lodash = _.runInContext();
+ * lodash.mixin({ 'bar': lodash.constant('bar') });
+ *
+ * _.isFunction(_.foo);
+ * // => true
+ * _.isFunction(_.bar);
+ * // => false
+ *
+ * lodash.isFunction(lodash.foo);
+ * // => false
+ * lodash.isFunction(lodash.bar);
+ * // => true
+ *
+ * // Create a suped-up `defer` in Node.js.
+ * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer;
+ */
+ var runInContext = (function runInContext(context) {
+ context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps));
+
+ /** Built-in constructor references. */
+ var Array = context.Array,
+ Date = context.Date,
+ Error = context.Error,
+ Function = context.Function,
+ Math = context.Math,
+ Object = context.Object,
+ RegExp = context.RegExp,
+ String = context.String,
+ TypeError = context.TypeError;
+
+ /** Used for built-in method references. */
+ var arrayProto = Array.prototype,
+ funcProto = Function.prototype,
+ objectProto = Object.prototype;
+
+ /** Used to detect overreaching core-js shims. */
+ var coreJsData = context['__core-js_shared__'];
+
+ /** Used to resolve the decompiled source of functions. */
+ var funcToString = funcProto.toString;
+
+ /** Used to check objects for own properties. */
+ var hasOwnProperty = objectProto.hasOwnProperty;
+
+ /** Used to generate unique IDs. */
+ var idCounter = 0;
+
+ /** Used to detect methods masquerading as native. */
+ var maskSrcKey = (function() {
+ var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');
+ return uid ? ('Symbol(src)_1.' + uid) : '';
+ }());
+
+ /**
+ * Used to resolve the
+ * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)
+ * of values.
+ */
+ var nativeObjectToString = objectProto.toString;
+
+ /** Used to infer the `Object` constructor. */
+ var objectCtorString = funcToString.call(Object);
+
+ /** Used to restore the original `_` reference in `_.noConflict`. */
+ var oldDash = root._;
+
+ /** Used to detect if a method is native. */
+ var reIsNative = RegExp('^' +
+ funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&')
+ .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$'
+ );
+
+ /** Built-in value references. */
+ var Buffer = moduleExports ? context.Buffer : undefined,
+ Symbol = context.Symbol,
+ Uint8Array = context.Uint8Array,
+ allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined,
+ getPrototype = overArg(Object.getPrototypeOf, Object),
+ objectCreate = Object.create,
+ propertyIsEnumerable = objectProto.propertyIsEnumerable,
+ splice = arrayProto.splice,
+ spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined,
+ symIterator = Symbol ? Symbol.iterator : undefined,
+ symToStringTag = Symbol ? Symbol.toStringTag : undefined;
+
+ var defineProperty = (function() {
+ try {
+ var func = getNative(Object, 'defineProperty');
+ func({}, '', {});
+ return func;
+ } catch (e) {}
+ }());
+
+ /** Mocked built-ins. */
+ var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout,
+ ctxNow = Date && Date.now !== root.Date.now && Date.now,
+ ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout;
+
+ /* Built-in method references for those with the same name as other `lodash` methods. */
+ var nativeCeil = Math.ceil,
+ nativeFloor = Math.floor,
+ nativeGetSymbols = Object.getOwnPropertySymbols,
+ nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined,
+ nativeIsFinite = context.isFinite,
+ nativeJoin = arrayProto.join,
+ nativeKeys = overArg(Object.keys, Object),
+ nativeMax = Math.max,
+ nativeMin = Math.min,
+ nativeNow = Date.now,
+ nativeParseInt = context.parseInt,
+ nativeRandom = Math.random,
+ nativeReverse = arrayProto.reverse;
+
+ /* Built-in method references that are verified to be native. */
+ var DataView = getNative(context, 'DataView'),
+ Map = getNative(context, 'Map'),
+ Promise = getNative(context, 'Promise'),
+ Set = getNative(context, 'Set'),
+ WeakMap = getNative(context, 'WeakMap'),
+ nativeCreate = getNative(Object, 'create');
+
+ /** Used to store function metadata. */
+ var metaMap = WeakMap && new WeakMap;
+
+ /** Used to lookup unminified function names. */
+ var realNames = {};
+
+ /** Used to detect maps, sets, and weakmaps. */
+ var dataViewCtorString = toSource(DataView),
+ mapCtorString = toSource(Map),
+ promiseCtorString = toSource(Promise),
+ setCtorString = toSource(Set),
+ weakMapCtorString = toSource(WeakMap);
+
+ /** Used to convert symbols to primitives and strings. */
+ var symbolProto = Symbol ? Symbol.prototype : undefined,
+ symbolValueOf = symbolProto ? symbolProto.valueOf : undefined,
+ symbolToString = symbolProto ? symbolProto.toString : undefined;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates a `lodash` object which wraps `value` to enable implicit method
+ * chain sequences. Methods that operate on and return arrays, collections,
+ * and functions can be chained together. Methods that retrieve a single value
+ * or may return a primitive value will automatically end the chain sequence
+ * and return the unwrapped value. Otherwise, the value must be unwrapped
+ * with `_#value`.
+ *
+ * Explicit chain sequences, which must be unwrapped with `_#value`, may be
+ * enabled using `_.chain`.
+ *
+ * The execution of chained methods is lazy, that is, it's deferred until
+ * `_#value` is implicitly or explicitly called.
+ *
+ * Lazy evaluation allows several methods to support shortcut fusion.
+ * Shortcut fusion is an optimization to merge iteratee calls; this avoids
+ * the creation of intermediate arrays and can greatly reduce the number of
+ * iteratee executions. Sections of a chain sequence qualify for shortcut
+ * fusion if the section is applied to an array and iteratees accept only
+ * one argument. The heuristic for whether a section qualifies for shortcut
+ * fusion is subject to change.
+ *
+ * Chaining is supported in custom builds as long as the `_#value` method is
+ * directly or indirectly included in the build.
+ *
+ * In addition to lodash methods, wrappers have `Array` and `String` methods.
+ *
+ * The wrapper `Array` methods are:
+ * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift`
+ *
+ * The wrapper `String` methods are:
+ * `replace` and `split`
+ *
+ * The wrapper methods that support shortcut fusion are:
+ * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`,
+ * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`,
+ * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray`
+ *
+ * The chainable wrapper methods are:
+ * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`,
+ * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`,
+ * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`,
+ * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`,
+ * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`,
+ * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`,
+ * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`,
+ * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`,
+ * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`,
+ * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`,
+ * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`,
+ * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`,
+ * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`,
+ * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`,
+ * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`,
+ * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`,
+ * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`,
+ * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`,
+ * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`,
+ * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`,
+ * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`,
+ * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`,
+ * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`,
+ * `zipObject`, `zipObjectDeep`, and `zipWith`
+ *
+ * The wrapper methods that are **not** chainable by default are:
+ * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`,
+ * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`,
+ * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`,
+ * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`,
+ * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`,
+ * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`,
+ * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`,
+ * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`,
+ * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`,
+ * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`,
+ * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`,
+ * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`,
+ * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`,
+ * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`,
+ * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`,
+ * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`,
+ * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`,
+ * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`,
+ * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`,
+ * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`,
+ * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`,
+ * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`,
+ * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`,
+ * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`,
+ * `upperFirst`, `value`, and `words`
+ *
+ * @name _
+ * @constructor
+ * @category Seq
+ * @param {*} value The value to wrap in a `lodash` instance.
+ * @returns {Object} Returns the new `lodash` wrapper instance.
+ * @example
+ *
+ * function square(n) {
+ * return n * n;
+ * }
+ *
+ * var wrapped = _([1, 2, 3]);
+ *
+ * // Returns an unwrapped value.
+ * wrapped.reduce(_.add);
+ * // => 6
+ *
+ * // Returns a wrapped value.
+ * var squares = wrapped.map(square);
+ *
+ * _.isArray(squares);
+ * // => false
+ *
+ * _.isArray(squares.value());
+ * // => true
+ */
+ function lodash(value) {
+ if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) {
+ if (value instanceof LodashWrapper) {
+ return value;
+ }
+ if (hasOwnProperty.call(value, '__wrapped__')) {
+ return wrapperClone(value);
+ }
+ }
+ return new LodashWrapper(value);
+ }
+
+ /**
+ * The base implementation of `_.create` without support for assigning
+ * properties to the created object.
+ *
+ * @private
+ * @param {Object} proto The object to inherit from.
+ * @returns {Object} Returns the new object.
+ */
+ var baseCreate = (function() {
+ function object() {}
+ return function(proto) {
+ if (!isObject(proto)) {
+ return {};
+ }
+ if (objectCreate) {
+ return objectCreate(proto);
+ }
+ object.prototype = proto;
+ var result = new object;
+ object.prototype = undefined;
+ return result;
+ };
+ }());
+
+ /**
+ * The function whose prototype chain sequence wrappers inherit from.
+ *
+ * @private
+ */
+ function baseLodash() {
+ // No operation performed.
+ }
+
+ /**
+ * The base constructor for creating `lodash` wrapper objects.
+ *
+ * @private
+ * @param {*} value The value to wrap.
+ * @param {boolean} [chainAll] Enable explicit method chain sequences.
+ */
+ function LodashWrapper(value, chainAll) {
+ this.__wrapped__ = value;
+ this.__actions__ = [];
+ this.__chain__ = !!chainAll;
+ this.__index__ = 0;
+ this.__values__ = undefined;
+ }
+
+ /**
+ * By default, the template delimiters used by lodash are like those in
+ * embedded Ruby (ERB) as well as ES2015 template strings. Change the
+ * following template settings to use alternative delimiters.
+ *
+ * @static
+ * @memberOf _
+ * @type {Object}
+ */
+ lodash.templateSettings = {
+
+ /**
+ * Used to detect `data` property values to be HTML-escaped.
+ *
+ * @memberOf _.templateSettings
+ * @type {RegExp}
+ */
+ 'escape': reEscape,
+
+ /**
+ * Used to detect code to be evaluated.
+ *
+ * @memberOf _.templateSettings
+ * @type {RegExp}
+ */
+ 'evaluate': reEvaluate,
+
+ /**
+ * Used to detect `data` property values to inject.
+ *
+ * @memberOf _.templateSettings
+ * @type {RegExp}
+ */
+ 'interpolate': reInterpolate,
+
+ /**
+ * Used to reference the data object in the template text.
+ *
+ * @memberOf _.templateSettings
+ * @type {string}
+ */
+ 'variable': '',
+
+ /**
+ * Used to import variables into the compiled template.
+ *
+ * @memberOf _.templateSettings
+ * @type {Object}
+ */
+ 'imports': {
+
+ /**
+ * A reference to the `lodash` function.
+ *
+ * @memberOf _.templateSettings.imports
+ * @type {Function}
+ */
+ '_': lodash
+ }
+ };
+
+ // Ensure wrappers are instances of `baseLodash`.
+ lodash.prototype = baseLodash.prototype;
+ lodash.prototype.constructor = lodash;
+
+ LodashWrapper.prototype = baseCreate(baseLodash.prototype);
+ LodashWrapper.prototype.constructor = LodashWrapper;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation.
+ *
+ * @private
+ * @constructor
+ * @param {*} value The value to wrap.
+ */
+ function LazyWrapper(value) {
+ this.__wrapped__ = value;
+ this.__actions__ = [];
+ this.__dir__ = 1;
+ this.__filtered__ = false;
+ this.__iteratees__ = [];
+ this.__takeCount__ = MAX_ARRAY_LENGTH;
+ this.__views__ = [];
+ }
+
+ /**
+ * Creates a clone of the lazy wrapper object.
+ *
+ * @private
+ * @name clone
+ * @memberOf LazyWrapper
+ * @returns {Object} Returns the cloned `LazyWrapper` object.
+ */
+ function lazyClone() {
+ var result = new LazyWrapper(this.__wrapped__);
+ result.__actions__ = copyArray(this.__actions__);
+ result.__dir__ = this.__dir__;
+ result.__filtered__ = this.__filtered__;
+ result.__iteratees__ = copyArray(this.__iteratees__);
+ result.__takeCount__ = this.__takeCount__;
+ result.__views__ = copyArray(this.__views__);
+ return result;
+ }
+
+ /**
+ * Reverses the direction of lazy iteration.
+ *
+ * @private
+ * @name reverse
+ * @memberOf LazyWrapper
+ * @returns {Object} Returns the new reversed `LazyWrapper` object.
+ */
+ function lazyReverse() {
+ if (this.__filtered__) {
+ var result = new LazyWrapper(this);
+ result.__dir__ = -1;
+ result.__filtered__ = true;
+ } else {
+ result = this.clone();
+ result.__dir__ *= -1;
+ }
+ return result;
+ }
+
+ /**
+ * Extracts the unwrapped value from its lazy wrapper.
+ *
+ * @private
+ * @name value
+ * @memberOf LazyWrapper
+ * @returns {*} Returns the unwrapped value.
+ */
+ function lazyValue() {
+ var array = this.__wrapped__.value(),
+ dir = this.__dir__,
+ isArr = isArray(array),
+ isRight = dir < 0,
+ arrLength = isArr ? array.length : 0,
+ view = getView(0, arrLength, this.__views__),
+ start = view.start,
+ end = view.end,
+ length = end - start,
+ index = isRight ? end : (start - 1),
+ iteratees = this.__iteratees__,
+ iterLength = iteratees.length,
+ resIndex = 0,
+ takeCount = nativeMin(length, this.__takeCount__);
+
+ if (!isArr || (!isRight && arrLength == length && takeCount == length)) {
+ return baseWrapperValue(array, this.__actions__);
+ }
+ var result = [];
+
+ outer:
+ while (length-- && resIndex < takeCount) {
+ index += dir;
+
+ var iterIndex = -1,
+ value = array[index];
+
+ while (++iterIndex < iterLength) {
+ var data = iteratees[iterIndex],
+ iteratee = data.iteratee,
+ type = data.type,
+ computed = iteratee(value);
+
+ if (type == LAZY_MAP_FLAG) {
+ value = computed;
+ } else if (!computed) {
+ if (type == LAZY_FILTER_FLAG) {
+ continue outer;
+ } else {
+ break outer;
+ }
+ }
+ }
+ result[resIndex++] = value;
+ }
+ return result;
+ }
+
+ // Ensure `LazyWrapper` is an instance of `baseLodash`.
+ LazyWrapper.prototype = baseCreate(baseLodash.prototype);
+ LazyWrapper.prototype.constructor = LazyWrapper;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates a hash object.
+ *
+ * @private
+ * @constructor
+ * @param {Array} [entries] The key-value pairs to cache.
+ */
+ function Hash(entries) {
+ var index = -1,
+ length = entries == null ? 0 : entries.length;
+
+ this.clear();
+ while (++index < length) {
+ var entry = entries[index];
+ this.set(entry[0], entry[1]);
+ }
+ }
+
+ /**
+ * Removes all key-value entries from the hash.
+ *
+ * @private
+ * @name clear
+ * @memberOf Hash
+ */
+ function hashClear() {
+ this.__data__ = nativeCreate ? nativeCreate(null) : {};
+ this.size = 0;
+ }
+
+ /**
+ * Removes `key` and its value from the hash.
+ *
+ * @private
+ * @name delete
+ * @memberOf Hash
+ * @param {Object} hash The hash to modify.
+ * @param {string} key The key of the value to remove.
+ * @returns {boolean} Returns `true` if the entry was removed, else `false`.
+ */
+ function hashDelete(key) {
+ var result = this.has(key) && delete this.__data__[key];
+ this.size -= result ? 1 : 0;
+ return result;
+ }
+
+ /**
+ * Gets the hash value for `key`.
+ *
+ * @private
+ * @name get
+ * @memberOf Hash
+ * @param {string} key The key of the value to get.
+ * @returns {*} Returns the entry value.
+ */
+ function hashGet(key) {
+ var data = this.__data__;
+ if (nativeCreate) {
+ var result = data[key];
+ return result === HASH_UNDEFINED ? undefined : result;
+ }
+ return hasOwnProperty.call(data, key) ? data[key] : undefined;
+ }
+
+ /**
+ * Checks if a hash value for `key` exists.
+ *
+ * @private
+ * @name has
+ * @memberOf Hash
+ * @param {string} key The key of the entry to check.
+ * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
+ */
+ function hashHas(key) {
+ var data = this.__data__;
+ return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key);
+ }
+
+ /**
+ * Sets the hash `key` to `value`.
+ *
+ * @private
+ * @name set
+ * @memberOf Hash
+ * @param {string} key The key of the value to set.
+ * @param {*} value The value to set.
+ * @returns {Object} Returns the hash instance.
+ */
+ function hashSet(key, value) {
+ var data = this.__data__;
+ this.size += this.has(key) ? 0 : 1;
+ data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;
+ return this;
+ }
+
+ // Add methods to `Hash`.
+ Hash.prototype.clear = hashClear;
+ Hash.prototype['delete'] = hashDelete;
+ Hash.prototype.get = hashGet;
+ Hash.prototype.has = hashHas;
+ Hash.prototype.set = hashSet;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates an list cache object.
+ *
+ * @private
+ * @constructor
+ * @param {Array} [entries] The key-value pairs to cache.
+ */
+ function ListCache(entries) {
+ var index = -1,
+ length = entries == null ? 0 : entries.length;
+
+ this.clear();
+ while (++index < length) {
+ var entry = entries[index];
+ this.set(entry[0], entry[1]);
+ }
+ }
+
+ /**
+ * Removes all key-value entries from the list cache.
+ *
+ * @private
+ * @name clear
+ * @memberOf ListCache
+ */
+ function listCacheClear() {
+ this.__data__ = [];
+ this.size = 0;
+ }
+
+ /**
+ * Removes `key` and its value from the list cache.
+ *
+ * @private
+ * @name delete
+ * @memberOf ListCache
+ * @param {string} key The key of the value to remove.
+ * @returns {boolean} Returns `true` if the entry was removed, else `false`.
+ */
+ function listCacheDelete(key) {
+ var data = this.__data__,
+ index = assocIndexOf(data, key);
+
+ if (index < 0) {
+ return false;
+ }
+ var lastIndex = data.length - 1;
+ if (index == lastIndex) {
+ data.pop();
+ } else {
+ splice.call(data, index, 1);
+ }
+ --this.size;
+ return true;
+ }
+
+ /**
+ * Gets the list cache value for `key`.
+ *
+ * @private
+ * @name get
+ * @memberOf ListCache
+ * @param {string} key The key of the value to get.
+ * @returns {*} Returns the entry value.
+ */
+ function listCacheGet(key) {
+ var data = this.__data__,
+ index = assocIndexOf(data, key);
+
+ return index < 0 ? undefined : data[index][1];
+ }
+
+ /**
+ * Checks if a list cache value for `key` exists.
+ *
+ * @private
+ * @name has
+ * @memberOf ListCache
+ * @param {string} key The key of the entry to check.
+ * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
+ */
+ function listCacheHas(key) {
+ return assocIndexOf(this.__data__, key) > -1;
+ }
+
+ /**
+ * Sets the list cache `key` to `value`.
+ *
+ * @private
+ * @name set
+ * @memberOf ListCache
+ * @param {string} key The key of the value to set.
+ * @param {*} value The value to set.
+ * @returns {Object} Returns the list cache instance.
+ */
+ function listCacheSet(key, value) {
+ var data = this.__data__,
+ index = assocIndexOf(data, key);
+
+ if (index < 0) {
+ ++this.size;
+ data.push([key, value]);
+ } else {
+ data[index][1] = value;
+ }
+ return this;
+ }
+
+ // Add methods to `ListCache`.
+ ListCache.prototype.clear = listCacheClear;
+ ListCache.prototype['delete'] = listCacheDelete;
+ ListCache.prototype.get = listCacheGet;
+ ListCache.prototype.has = listCacheHas;
+ ListCache.prototype.set = listCacheSet;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates a map cache object to store key-value pairs.
+ *
+ * @private
+ * @constructor
+ * @param {Array} [entries] The key-value pairs to cache.
+ */
+ function MapCache(entries) {
+ var index = -1,
+ length = entries == null ? 0 : entries.length;
+
+ this.clear();
+ while (++index < length) {
+ var entry = entries[index];
+ this.set(entry[0], entry[1]);
+ }
+ }
+
+ /**
+ * Removes all key-value entries from the map.
+ *
+ * @private
+ * @name clear
+ * @memberOf MapCache
+ */
+ function mapCacheClear() {
+ this.size = 0;
+ this.__data__ = {
+ 'hash': new Hash,
+ 'map': new (Map || ListCache),
+ 'string': new Hash
+ };
+ }
+
+ /**
+ * Removes `key` and its value from the map.
+ *
+ * @private
+ * @name delete
+ * @memberOf MapCache
+ * @param {string} key The key of the value to remove.
+ * @returns {boolean} Returns `true` if the entry was removed, else `false`.
+ */
+ function mapCacheDelete(key) {
+ var result = getMapData(this, key)['delete'](key);
+ this.size -= result ? 1 : 0;
+ return result;
+ }
+
+ /**
+ * Gets the map value for `key`.
+ *
+ * @private
+ * @name get
+ * @memberOf MapCache
+ * @param {string} key The key of the value to get.
+ * @returns {*} Returns the entry value.
+ */
+ function mapCacheGet(key) {
+ return getMapData(this, key).get(key);
+ }
+
+ /**
+ * Checks if a map value for `key` exists.
+ *
+ * @private
+ * @name has
+ * @memberOf MapCache
+ * @param {string} key The key of the entry to check.
+ * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
+ */
+ function mapCacheHas(key) {
+ return getMapData(this, key).has(key);
+ }
+
+ /**
+ * Sets the map `key` to `value`.
+ *
+ * @private
+ * @name set
+ * @memberOf MapCache
+ * @param {string} key The key of the value to set.
+ * @param {*} value The value to set.
+ * @returns {Object} Returns the map cache instance.
+ */
+ function mapCacheSet(key, value) {
+ var data = getMapData(this, key),
+ size = data.size;
+
+ data.set(key, value);
+ this.size += data.size == size ? 0 : 1;
+ return this;
+ }
+
+ // Add methods to `MapCache`.
+ MapCache.prototype.clear = mapCacheClear;
+ MapCache.prototype['delete'] = mapCacheDelete;
+ MapCache.prototype.get = mapCacheGet;
+ MapCache.prototype.has = mapCacheHas;
+ MapCache.prototype.set = mapCacheSet;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ *
+ * Creates an array cache object to store unique values.
+ *
+ * @private
+ * @constructor
+ * @param {Array} [values] The values to cache.
+ */
+ function SetCache(values) {
+ var index = -1,
+ length = values == null ? 0 : values.length;
+
+ this.__data__ = new MapCache;
+ while (++index < length) {
+ this.add(values[index]);
+ }
+ }
+
+ /**
+ * Adds `value` to the array cache.
+ *
+ * @private
+ * @name add
+ * @memberOf SetCache
+ * @alias push
+ * @param {*} value The value to cache.
+ * @returns {Object} Returns the cache instance.
+ */
+ function setCacheAdd(value) {
+ this.__data__.set(value, HASH_UNDEFINED);
+ return this;
+ }
+
+ /**
+ * Checks if `value` is in the array cache.
+ *
+ * @private
+ * @name has
+ * @memberOf SetCache
+ * @param {*} value The value to search for.
+ * @returns {number} Returns `true` if `value` is found, else `false`.
+ */
+ function setCacheHas(value) {
+ return this.__data__.has(value);
+ }
+
+ // Add methods to `SetCache`.
+ SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;
+ SetCache.prototype.has = setCacheHas;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates a stack cache object to store key-value pairs.
+ *
+ * @private
+ * @constructor
+ * @param {Array} [entries] The key-value pairs to cache.
+ */
+ function Stack(entries) {
+ var data = this.__data__ = new ListCache(entries);
+ this.size = data.size;
+ }
+
+ /**
+ * Removes all key-value entries from the stack.
+ *
+ * @private
+ * @name clear
+ * @memberOf Stack
+ */
+ function stackClear() {
+ this.__data__ = new ListCache;
+ this.size = 0;
+ }
+
+ /**
+ * Removes `key` and its value from the stack.
+ *
+ * @private
+ * @name delete
+ * @memberOf Stack
+ * @param {string} key The key of the value to remove.
+ * @returns {boolean} Returns `true` if the entry was removed, else `false`.
+ */
+ function stackDelete(key) {
+ var data = this.__data__,
+ result = data['delete'](key);
+
+ this.size = data.size;
+ return result;
+ }
+
+ /**
+ * Gets the stack value for `key`.
+ *
+ * @private
+ * @name get
+ * @memberOf Stack
+ * @param {string} key The key of the value to get.
+ * @returns {*} Returns the entry value.
+ */
+ function stackGet(key) {
+ return this.__data__.get(key);
+ }
+
+ /**
+ * Checks if a stack value for `key` exists.
+ *
+ * @private
+ * @name has
+ * @memberOf Stack
+ * @param {string} key The key of the entry to check.
+ * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
+ */
+ function stackHas(key) {
+ return this.__data__.has(key);
+ }
+
+ /**
+ * Sets the stack `key` to `value`.
+ *
+ * @private
+ * @name set
+ * @memberOf Stack
+ * @param {string} key The key of the value to set.
+ * @param {*} value The value to set.
+ * @returns {Object} Returns the stack cache instance.
+ */
+ function stackSet(key, value) {
+ var data = this.__data__;
+ if (data instanceof ListCache) {
+ var pairs = data.__data__;
+ if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) {
+ pairs.push([key, value]);
+ this.size = ++data.size;
+ return this;
+ }
+ data = this.__data__ = new MapCache(pairs);
+ }
+ data.set(key, value);
+ this.size = data.size;
+ return this;
+ }
+
+ // Add methods to `Stack`.
+ Stack.prototype.clear = stackClear;
+ Stack.prototype['delete'] = stackDelete;
+ Stack.prototype.get = stackGet;
+ Stack.prototype.has = stackHas;
+ Stack.prototype.set = stackSet;
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates an array of the enumerable property names of the array-like `value`.
+ *
+ * @private
+ * @param {*} value The value to query.
+ * @param {boolean} inherited Specify returning inherited property names.
+ * @returns {Array} Returns the array of property names.
+ */
+ function arrayLikeKeys(value, inherited) {
+ var isArr = isArray(value),
+ isArg = !isArr && isArguments(value),
+ isBuff = !isArr && !isArg && isBuffer(value),
+ isType = !isArr && !isArg && !isBuff && isTypedArray(value),
+ skipIndexes = isArr || isArg || isBuff || isType,
+ result = skipIndexes ? baseTimes(value.length, String) : [],
+ length = result.length;
+
+ for (var key in value) {
+ if ((inherited || hasOwnProperty.call(value, key)) &&
+ !(skipIndexes && (
+ // Safari 9 has enumerable `arguments.length` in strict mode.
+ key == 'length' ||
+ // Node.js 0.10 has enumerable non-index properties on buffers.
+ (isBuff && (key == 'offset' || key == 'parent')) ||
+ // PhantomJS 2 has enumerable non-index properties on typed arrays.
+ (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) ||
+ // Skip index properties.
+ isIndex(key, length)
+ ))) {
+ result.push(key);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * A specialized version of `_.sample` for arrays.
+ *
+ * @private
+ * @param {Array} array The array to sample.
+ * @returns {*} Returns the random element.
+ */
+ function arraySample(array) {
+ var length = array.length;
+ return length ? array[baseRandom(0, length - 1)] : undefined;
+ }
+
+ /**
+ * A specialized version of `_.sampleSize` for arrays.
+ *
+ * @private
+ * @param {Array} array The array to sample.
+ * @param {number} n The number of elements to sample.
+ * @returns {Array} Returns the random elements.
+ */
+ function arraySampleSize(array, n) {
+ return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length));
+ }
+
+ /**
+ * A specialized version of `_.shuffle` for arrays.
+ *
+ * @private
+ * @param {Array} array The array to shuffle.
+ * @returns {Array} Returns the new shuffled array.
+ */
+ function arrayShuffle(array) {
+ return shuffleSelf(copyArray(array));
+ }
+
+ /**
+ * This function is like `assignValue` except that it doesn't assign
+ * `undefined` values.
+ *
+ * @private
+ * @param {Object} object The object to modify.
+ * @param {string} key The key of the property to assign.
+ * @param {*} value The value to assign.
+ */
+ function assignMergeValue(object, key, value) {
+ if ((value !== undefined && !eq(object[key], value)) ||
+ (value === undefined && !(key in object))) {
+ baseAssignValue(object, key, value);
+ }
+ }
+
+ /**
+ * Assigns `value` to `key` of `object` if the existing value is not equivalent
+ * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons.
+ *
+ * @private
+ * @param {Object} object The object to modify.
+ * @param {string} key The key of the property to assign.
+ * @param {*} value The value to assign.
+ */
+ function assignValue(object, key, value) {
+ var objValue = object[key];
+ if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) ||
+ (value === undefined && !(key in object))) {
+ baseAssignValue(object, key, value);
+ }
+ }
+
+ /**
+ * Gets the index at which the `key` is found in `array` of key-value pairs.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {*} key The key to search for.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ */
+ function assocIndexOf(array, key) {
+ var length = array.length;
+ while (length--) {
+ if (eq(array[length][0], key)) {
+ return length;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * Aggregates elements of `collection` on `accumulator` with keys transformed
+ * by `iteratee` and values set by `setter`.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} setter The function to set `accumulator` values.
+ * @param {Function} iteratee The iteratee to transform keys.
+ * @param {Object} accumulator The initial aggregated object.
+ * @returns {Function} Returns `accumulator`.
+ */
+ function baseAggregator(collection, setter, iteratee, accumulator) {
+ baseEach(collection, function(value, key, collection) {
+ setter(accumulator, value, iteratee(value), collection);
+ });
+ return accumulator;
+ }
+
+ /**
+ * The base implementation of `_.assign` without support for multiple sources
+ * or `customizer` functions.
+ *
+ * @private
+ * @param {Object} object The destination object.
+ * @param {Object} source The source object.
+ * @returns {Object} Returns `object`.
+ */
+ function baseAssign(object, source) {
+ return object && copyObject(source, keys(source), object);
+ }
+
+ /**
+ * The base implementation of `_.assignIn` without support for multiple sources
+ * or `customizer` functions.
+ *
+ * @private
+ * @param {Object} object The destination object.
+ * @param {Object} source The source object.
+ * @returns {Object} Returns `object`.
+ */
+ function baseAssignIn(object, source) {
+ return object && copyObject(source, keysIn(source), object);
+ }
+
+ /**
+ * The base implementation of `assignValue` and `assignMergeValue` without
+ * value checks.
+ *
+ * @private
+ * @param {Object} object The object to modify.
+ * @param {string} key The key of the property to assign.
+ * @param {*} value The value to assign.
+ */
+ function baseAssignValue(object, key, value) {
+ if (key == '__proto__' && defineProperty) {
+ defineProperty(object, key, {
+ 'configurable': true,
+ 'enumerable': true,
+ 'value': value,
+ 'writable': true
+ });
+ } else {
+ object[key] = value;
+ }
+ }
+
+ /**
+ * The base implementation of `_.at` without support for individual paths.
+ *
+ * @private
+ * @param {Object} object The object to iterate over.
+ * @param {string[]} paths The property paths to pick.
+ * @returns {Array} Returns the picked elements.
+ */
+ function baseAt(object, paths) {
+ var index = -1,
+ length = paths.length,
+ result = Array(length),
+ skip = object == null;
+
+ while (++index < length) {
+ result[index] = skip ? undefined : get(object, paths[index]);
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.clamp` which doesn't coerce arguments.
+ *
+ * @private
+ * @param {number} number The number to clamp.
+ * @param {number} [lower] The lower bound.
+ * @param {number} upper The upper bound.
+ * @returns {number} Returns the clamped number.
+ */
+ function baseClamp(number, lower, upper) {
+ if (number === number) {
+ if (upper !== undefined) {
+ number = number <= upper ? number : upper;
+ }
+ if (lower !== undefined) {
+ number = number >= lower ? number : lower;
+ }
+ }
+ return number;
+ }
+
+ /**
+ * The base implementation of `_.clone` and `_.cloneDeep` which tracks
+ * traversed objects.
+ *
+ * @private
+ * @param {*} value The value to clone.
+ * @param {boolean} bitmask The bitmask flags.
+ * 1 - Deep clone
+ * 2 - Flatten inherited properties
+ * 4 - Clone symbols
+ * @param {Function} [customizer] The function to customize cloning.
+ * @param {string} [key] The key of `value`.
+ * @param {Object} [object] The parent object of `value`.
+ * @param {Object} [stack] Tracks traversed objects and their clone counterparts.
+ * @returns {*} Returns the cloned value.
+ */
+ function baseClone(value, bitmask, customizer, key, object, stack) {
+ var result,
+ isDeep = bitmask & CLONE_DEEP_FLAG,
+ isFlat = bitmask & CLONE_FLAT_FLAG,
+ isFull = bitmask & CLONE_SYMBOLS_FLAG;
+
+ if (customizer) {
+ result = object ? customizer(value, key, object, stack) : customizer(value);
+ }
+ if (result !== undefined) {
+ return result;
+ }
+ if (!isObject(value)) {
+ return value;
+ }
+ var isArr = isArray(value);
+ if (isArr) {
+ result = initCloneArray(value);
+ if (!isDeep) {
+ return copyArray(value, result);
+ }
+ } else {
+ var tag = getTag(value),
+ isFunc = tag == funcTag || tag == genTag;
+
+ if (isBuffer(value)) {
+ return cloneBuffer(value, isDeep);
+ }
+ if (tag == objectTag || tag == argsTag || (isFunc && !object)) {
+ result = (isFlat || isFunc) ? {} : initCloneObject(value);
+ if (!isDeep) {
+ return isFlat
+ ? copySymbolsIn(value, baseAssignIn(result, value))
+ : copySymbols(value, baseAssign(result, value));
+ }
+ } else {
+ if (!cloneableTags[tag]) {
+ return object ? value : {};
+ }
+ result = initCloneByTag(value, tag, isDeep);
+ }
+ }
+ // Check for circular references and return its corresponding clone.
+ stack || (stack = new Stack);
+ var stacked = stack.get(value);
+ if (stacked) {
+ return stacked;
+ }
+ stack.set(value, result);
+
+ if (isSet(value)) {
+ value.forEach(function(subValue) {
+ result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack));
+ });
+
+ return result;
+ }
+
+ if (isMap(value)) {
+ value.forEach(function(subValue, key) {
+ result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack));
+ });
+
+ return result;
+ }
+
+ var keysFunc = isFull
+ ? (isFlat ? getAllKeysIn : getAllKeys)
+ : (isFlat ? keysIn : keys);
+
+ var props = isArr ? undefined : keysFunc(value);
+ arrayEach(props || value, function(subValue, key) {
+ if (props) {
+ key = subValue;
+ subValue = value[key];
+ }
+ // Recursively populate clone (susceptible to call stack limits).
+ assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack));
+ });
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.conforms` which doesn't clone `source`.
+ *
+ * @private
+ * @param {Object} source The object of property predicates to conform to.
+ * @returns {Function} Returns the new spec function.
+ */
+ function baseConforms(source) {
+ var props = keys(source);
+ return function(object) {
+ return baseConformsTo(object, source, props);
+ };
+ }
+
+ /**
+ * The base implementation of `_.conformsTo` which accepts `props` to check.
+ *
+ * @private
+ * @param {Object} object The object to inspect.
+ * @param {Object} source The object of property predicates to conform to.
+ * @returns {boolean} Returns `true` if `object` conforms, else `false`.
+ */
+ function baseConformsTo(object, source, props) {
+ var length = props.length;
+ if (object == null) {
+ return !length;
+ }
+ object = Object(object);
+ while (length--) {
+ var key = props[length],
+ predicate = source[key],
+ value = object[key];
+
+ if ((value === undefined && !(key in object)) || !predicate(value)) {
+ return false;
+ }
+ }
+ return true;
+ }
+
+ /**
+ * The base implementation of `_.delay` and `_.defer` which accepts `args`
+ * to provide to `func`.
+ *
+ * @private
+ * @param {Function} func The function to delay.
+ * @param {number} wait The number of milliseconds to delay invocation.
+ * @param {Array} args The arguments to provide to `func`.
+ * @returns {number|Object} Returns the timer id or timeout object.
+ */
+ function baseDelay(func, wait, args) {
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ return setTimeout(function() { func.apply(undefined, args); }, wait);
+ }
+
+ /**
+ * The base implementation of methods like `_.difference` without support
+ * for excluding multiple arrays or iteratee shorthands.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {Array} values The values to exclude.
+ * @param {Function} [iteratee] The iteratee invoked per element.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new array of filtered values.
+ */
+ function baseDifference(array, values, iteratee, comparator) {
+ var index = -1,
+ includes = arrayIncludes,
+ isCommon = true,
+ length = array.length,
+ result = [],
+ valuesLength = values.length;
+
+ if (!length) {
+ return result;
+ }
+ if (iteratee) {
+ values = arrayMap(values, baseUnary(iteratee));
+ }
+ if (comparator) {
+ includes = arrayIncludesWith;
+ isCommon = false;
+ }
+ else if (values.length >= LARGE_ARRAY_SIZE) {
+ includes = cacheHas;
+ isCommon = false;
+ values = new SetCache(values);
+ }
+ outer:
+ while (++index < length) {
+ var value = array[index],
+ computed = iteratee == null ? value : iteratee(value);
+
+ value = (comparator || value !== 0) ? value : 0;
+ if (isCommon && computed === computed) {
+ var valuesIndex = valuesLength;
+ while (valuesIndex--) {
+ if (values[valuesIndex] === computed) {
+ continue outer;
+ }
+ }
+ result.push(value);
+ }
+ else if (!includes(values, computed, comparator)) {
+ result.push(value);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.forEach` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Array|Object} Returns `collection`.
+ */
+ var baseEach = createBaseEach(baseForOwn);
+
+ /**
+ * The base implementation of `_.forEachRight` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Array|Object} Returns `collection`.
+ */
+ var baseEachRight = createBaseEach(baseForOwnRight, true);
+
+ /**
+ * The base implementation of `_.every` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} predicate The function invoked per iteration.
+ * @returns {boolean} Returns `true` if all elements pass the predicate check,
+ * else `false`
+ */
+ function baseEvery(collection, predicate) {
+ var result = true;
+ baseEach(collection, function(value, index, collection) {
+ result = !!predicate(value, index, collection);
+ return result;
+ });
+ return result;
+ }
+
+ /**
+ * The base implementation of methods like `_.max` and `_.min` which accepts a
+ * `comparator` to determine the extremum value.
+ *
+ * @private
+ * @param {Array} array The array to iterate over.
+ * @param {Function} iteratee The iteratee invoked per iteration.
+ * @param {Function} comparator The comparator used to compare values.
+ * @returns {*} Returns the extremum value.
+ */
+ function baseExtremum(array, iteratee, comparator) {
+ var index = -1,
+ length = array.length;
+
+ while (++index < length) {
+ var value = array[index],
+ current = iteratee(value);
+
+ if (current != null && (computed === undefined
+ ? (current === current && !isSymbol(current))
+ : comparator(current, computed)
+ )) {
+ var computed = current,
+ result = value;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.fill` without an iteratee call guard.
+ *
+ * @private
+ * @param {Array} array The array to fill.
+ * @param {*} value The value to fill `array` with.
+ * @param {number} [start=0] The start position.
+ * @param {number} [end=array.length] The end position.
+ * @returns {Array} Returns `array`.
+ */
+ function baseFill(array, value, start, end) {
+ var length = array.length;
+
+ start = toInteger(start);
+ if (start < 0) {
+ start = -start > length ? 0 : (length + start);
+ }
+ end = (end === undefined || end > length) ? length : toInteger(end);
+ if (end < 0) {
+ end += length;
+ }
+ end = start > end ? 0 : toLength(end);
+ while (start < end) {
+ array[start++] = value;
+ }
+ return array;
+ }
+
+ /**
+ * The base implementation of `_.filter` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} predicate The function invoked per iteration.
+ * @returns {Array} Returns the new filtered array.
+ */
+ function baseFilter(collection, predicate) {
+ var result = [];
+ baseEach(collection, function(value, index, collection) {
+ if (predicate(value, index, collection)) {
+ result.push(value);
+ }
+ });
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.flatten` with support for restricting flattening.
+ *
+ * @private
+ * @param {Array} array The array to flatten.
+ * @param {number} depth The maximum recursion depth.
+ * @param {boolean} [predicate=isFlattenable] The function invoked per iteration.
+ * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks.
+ * @param {Array} [result=[]] The initial result value.
+ * @returns {Array} Returns the new flattened array.
+ */
+ function baseFlatten(array, depth, predicate, isStrict, result) {
+ var index = -1,
+ length = array.length;
+
+ predicate || (predicate = isFlattenable);
+ result || (result = []);
+
+ while (++index < length) {
+ var value = array[index];
+ if (depth > 0 && predicate(value)) {
+ if (depth > 1) {
+ // Recursively flatten arrays (susceptible to call stack limits).
+ baseFlatten(value, depth - 1, predicate, isStrict, result);
+ } else {
+ arrayPush(result, value);
+ }
+ } else if (!isStrict) {
+ result[result.length] = value;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `baseForOwn` which iterates over `object`
+ * properties returned by `keysFunc` and invokes `iteratee` for each property.
+ * Iteratee functions may exit iteration early by explicitly returning `false`.
+ *
+ * @private
+ * @param {Object} object The object to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @param {Function} keysFunc The function to get the keys of `object`.
+ * @returns {Object} Returns `object`.
+ */
+ var baseFor = createBaseFor();
+
+ /**
+ * This function is like `baseFor` except that it iterates over properties
+ * in the opposite order.
+ *
+ * @private
+ * @param {Object} object The object to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @param {Function} keysFunc The function to get the keys of `object`.
+ * @returns {Object} Returns `object`.
+ */
+ var baseForRight = createBaseFor(true);
+
+ /**
+ * The base implementation of `_.forOwn` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Object} object The object to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Object} Returns `object`.
+ */
+ function baseForOwn(object, iteratee) {
+ return object && baseFor(object, iteratee, keys);
+ }
+
+ /**
+ * The base implementation of `_.forOwnRight` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Object} object The object to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Object} Returns `object`.
+ */
+ function baseForOwnRight(object, iteratee) {
+ return object && baseForRight(object, iteratee, keys);
+ }
+
+ /**
+ * The base implementation of `_.functions` which creates an array of
+ * `object` function property names filtered from `props`.
+ *
+ * @private
+ * @param {Object} object The object to inspect.
+ * @param {Array} props The property names to filter.
+ * @returns {Array} Returns the function names.
+ */
+ function baseFunctions(object, props) {
+ return arrayFilter(props, function(key) {
+ return isFunction(object[key]);
+ });
+ }
+
+ /**
+ * The base implementation of `_.get` without support for default values.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path of the property to get.
+ * @returns {*} Returns the resolved value.
+ */
+ function baseGet(object, path) {
+ path = castPath(path, object);
+
+ var index = 0,
+ length = path.length;
+
+ while (object != null && index < length) {
+ object = object[toKey(path[index++])];
+ }
+ return (index && index == length) ? object : undefined;
+ }
+
+ /**
+ * The base implementation of `getAllKeys` and `getAllKeysIn` which uses
+ * `keysFunc` and `symbolsFunc` to get the enumerable property names and
+ * symbols of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {Function} keysFunc The function to get the keys of `object`.
+ * @param {Function} symbolsFunc The function to get the symbols of `object`.
+ * @returns {Array} Returns the array of property names and symbols.
+ */
+ function baseGetAllKeys(object, keysFunc, symbolsFunc) {
+ var result = keysFunc(object);
+ return isArray(object) ? result : arrayPush(result, symbolsFunc(object));
+ }
+
+ /**
+ * The base implementation of `getTag` without fallbacks for buggy environments.
+ *
+ * @private
+ * @param {*} value The value to query.
+ * @returns {string} Returns the `toStringTag`.
+ */
+ function baseGetTag(value) {
+ if (value == null) {
+ return value === undefined ? undefinedTag : nullTag;
+ }
+ return (symToStringTag && symToStringTag in Object(value))
+ ? getRawTag(value)
+ : objectToString(value);
+ }
+
+ /**
+ * The base implementation of `_.gt` which doesn't coerce arguments.
+ *
+ * @private
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if `value` is greater than `other`,
+ * else `false`.
+ */
+ function baseGt(value, other) {
+ return value > other;
+ }
+
+ /**
+ * The base implementation of `_.has` without support for deep paths.
+ *
+ * @private
+ * @param {Object} [object] The object to query.
+ * @param {Array|string} key The key to check.
+ * @returns {boolean} Returns `true` if `key` exists, else `false`.
+ */
+ function baseHas(object, key) {
+ return object != null && hasOwnProperty.call(object, key);
+ }
+
+ /**
+ * The base implementation of `_.hasIn` without support for deep paths.
+ *
+ * @private
+ * @param {Object} [object] The object to query.
+ * @param {Array|string} key The key to check.
+ * @returns {boolean} Returns `true` if `key` exists, else `false`.
+ */
+ function baseHasIn(object, key) {
+ return object != null && key in Object(object);
+ }
+
+ /**
+ * The base implementation of `_.inRange` which doesn't coerce arguments.
+ *
+ * @private
+ * @param {number} number The number to check.
+ * @param {number} start The start of the range.
+ * @param {number} end The end of the range.
+ * @returns {boolean} Returns `true` if `number` is in the range, else `false`.
+ */
+ function baseInRange(number, start, end) {
+ return number >= nativeMin(start, end) && number < nativeMax(start, end);
+ }
+
+ /**
+ * The base implementation of methods like `_.intersection`, without support
+ * for iteratee shorthands, that accepts an array of arrays to inspect.
+ *
+ * @private
+ * @param {Array} arrays The arrays to inspect.
+ * @param {Function} [iteratee] The iteratee invoked per element.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new array of shared values.
+ */
+ function baseIntersection(arrays, iteratee, comparator) {
+ var includes = comparator ? arrayIncludesWith : arrayIncludes,
+ length = arrays[0].length,
+ othLength = arrays.length,
+ othIndex = othLength,
+ caches = Array(othLength),
+ maxLength = Infinity,
+ result = [];
+
+ while (othIndex--) {
+ var array = arrays[othIndex];
+ if (othIndex && iteratee) {
+ array = arrayMap(array, baseUnary(iteratee));
+ }
+ maxLength = nativeMin(array.length, maxLength);
+ caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120))
+ ? new SetCache(othIndex && array)
+ : undefined;
+ }
+ array = arrays[0];
+
+ var index = -1,
+ seen = caches[0];
+
+ outer:
+ while (++index < length && result.length < maxLength) {
+ var value = array[index],
+ computed = iteratee ? iteratee(value) : value;
+
+ value = (comparator || value !== 0) ? value : 0;
+ if (!(seen
+ ? cacheHas(seen, computed)
+ : includes(result, computed, comparator)
+ )) {
+ othIndex = othLength;
+ while (--othIndex) {
+ var cache = caches[othIndex];
+ if (!(cache
+ ? cacheHas(cache, computed)
+ : includes(arrays[othIndex], computed, comparator))
+ ) {
+ continue outer;
+ }
+ }
+ if (seen) {
+ seen.push(computed);
+ }
+ result.push(value);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.invert` and `_.invertBy` which inverts
+ * `object` with values transformed by `iteratee` and set by `setter`.
+ *
+ * @private
+ * @param {Object} object The object to iterate over.
+ * @param {Function} setter The function to set `accumulator` values.
+ * @param {Function} iteratee The iteratee to transform values.
+ * @param {Object} accumulator The initial inverted object.
+ * @returns {Function} Returns `accumulator`.
+ */
+ function baseInverter(object, setter, iteratee, accumulator) {
+ baseForOwn(object, function(value, key, object) {
+ setter(accumulator, iteratee(value), key, object);
+ });
+ return accumulator;
+ }
+
+ /**
+ * The base implementation of `_.invoke` without support for individual
+ * method arguments.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path of the method to invoke.
+ * @param {Array} args The arguments to invoke the method with.
+ * @returns {*} Returns the result of the invoked method.
+ */
+ function baseInvoke(object, path, args) {
+ path = castPath(path, object);
+ object = parent(object, path);
+ var func = object == null ? object : object[toKey(last(path))];
+ return func == null ? undefined : apply(func, object, args);
+ }
+
+ /**
+ * The base implementation of `_.isArguments`.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an `arguments` object,
+ */
+ function baseIsArguments(value) {
+ return isObjectLike(value) && baseGetTag(value) == argsTag;
+ }
+
+ /**
+ * The base implementation of `_.isArrayBuffer` without Node.js optimizations.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.
+ */
+ function baseIsArrayBuffer(value) {
+ return isObjectLike(value) && baseGetTag(value) == arrayBufferTag;
+ }
+
+ /**
+ * The base implementation of `_.isDate` without Node.js optimizations.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a date object, else `false`.
+ */
+ function baseIsDate(value) {
+ return isObjectLike(value) && baseGetTag(value) == dateTag;
+ }
+
+ /**
+ * The base implementation of `_.isEqual` which supports partial comparisons
+ * and tracks traversed objects.
+ *
+ * @private
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @param {boolean} bitmask The bitmask flags.
+ * 1 - Unordered comparison
+ * 2 - Partial comparison
+ * @param {Function} [customizer] The function to customize comparisons.
+ * @param {Object} [stack] Tracks traversed `value` and `other` objects.
+ * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
+ */
+ function baseIsEqual(value, other, bitmask, customizer, stack) {
+ if (value === other) {
+ return true;
+ }
+ if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) {
+ return value !== value && other !== other;
+ }
+ return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);
+ }
+
+ /**
+ * A specialized version of `baseIsEqual` for arrays and objects which performs
+ * deep comparisons and tracks traversed objects enabling objects with circular
+ * references to be compared.
+ *
+ * @private
+ * @param {Object} object The object to compare.
+ * @param {Object} other The other object to compare.
+ * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
+ * @param {Function} customizer The function to customize comparisons.
+ * @param {Function} equalFunc The function to determine equivalents of values.
+ * @param {Object} [stack] Tracks traversed `object` and `other` objects.
+ * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
+ */
+ function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {
+ var objIsArr = isArray(object),
+ othIsArr = isArray(other),
+ objTag = objIsArr ? arrayTag : getTag(object),
+ othTag = othIsArr ? arrayTag : getTag(other);
+
+ objTag = objTag == argsTag ? objectTag : objTag;
+ othTag = othTag == argsTag ? objectTag : othTag;
+
+ var objIsObj = objTag == objectTag,
+ othIsObj = othTag == objectTag,
+ isSameTag = objTag == othTag;
+
+ if (isSameTag && isBuffer(object)) {
+ if (!isBuffer(other)) {
+ return false;
+ }
+ objIsArr = true;
+ objIsObj = false;
+ }
+ if (isSameTag && !objIsObj) {
+ stack || (stack = new Stack);
+ return (objIsArr || isTypedArray(object))
+ ? equalArrays(object, other, bitmask, customizer, equalFunc, stack)
+ : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);
+ }
+ if (!(bitmask & COMPARE_PARTIAL_FLAG)) {
+ var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),
+ othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');
+
+ if (objIsWrapped || othIsWrapped) {
+ var objUnwrapped = objIsWrapped ? object.value() : object,
+ othUnwrapped = othIsWrapped ? other.value() : other;
+
+ stack || (stack = new Stack);
+ return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);
+ }
+ }
+ if (!isSameTag) {
+ return false;
+ }
+ stack || (stack = new Stack);
+ return equalObjects(object, other, bitmask, customizer, equalFunc, stack);
+ }
+
+ /**
+ * The base implementation of `_.isMap` without Node.js optimizations.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a map, else `false`.
+ */
+ function baseIsMap(value) {
+ return isObjectLike(value) && getTag(value) == mapTag;
+ }
+
+ /**
+ * The base implementation of `_.isMatch` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Object} object The object to inspect.
+ * @param {Object} source The object of property values to match.
+ * @param {Array} matchData The property names, values, and compare flags to match.
+ * @param {Function} [customizer] The function to customize comparisons.
+ * @returns {boolean} Returns `true` if `object` is a match, else `false`.
+ */
+ function baseIsMatch(object, source, matchData, customizer) {
+ var index = matchData.length,
+ length = index,
+ noCustomizer = !customizer;
+
+ if (object == null) {
+ return !length;
+ }
+ object = Object(object);
+ while (index--) {
+ var data = matchData[index];
+ if ((noCustomizer && data[2])
+ ? data[1] !== object[data[0]]
+ : !(data[0] in object)
+ ) {
+ return false;
+ }
+ }
+ while (++index < length) {
+ data = matchData[index];
+ var key = data[0],
+ objValue = object[key],
+ srcValue = data[1];
+
+ if (noCustomizer && data[2]) {
+ if (objValue === undefined && !(key in object)) {
+ return false;
+ }
+ } else {
+ var stack = new Stack;
+ if (customizer) {
+ var result = customizer(objValue, srcValue, key, object, source, stack);
+ }
+ if (!(result === undefined
+ ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack)
+ : result
+ )) {
+ return false;
+ }
+ }
+ }
+ return true;
+ }
+
+ /**
+ * The base implementation of `_.isNative` without bad shim checks.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a native function,
+ * else `false`.
+ */
+ function baseIsNative(value) {
+ if (!isObject(value) || isMasked(value)) {
+ return false;
+ }
+ var pattern = isFunction(value) ? reIsNative : reIsHostCtor;
+ return pattern.test(toSource(value));
+ }
+
+ /**
+ * The base implementation of `_.isRegExp` without Node.js optimizations.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.
+ */
+ function baseIsRegExp(value) {
+ return isObjectLike(value) && baseGetTag(value) == regexpTag;
+ }
+
+ /**
+ * The base implementation of `_.isSet` without Node.js optimizations.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a set, else `false`.
+ */
+ function baseIsSet(value) {
+ return isObjectLike(value) && getTag(value) == setTag;
+ }
+
+ /**
+ * The base implementation of `_.isTypedArray` without Node.js optimizations.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
+ */
+ function baseIsTypedArray(value) {
+ return isObjectLike(value) &&
+ isLength(value.length) && !!typedArrayTags[baseGetTag(value)];
+ }
+
+ /**
+ * The base implementation of `_.iteratee`.
+ *
+ * @private
+ * @param {*} [value=_.identity] The value to convert to an iteratee.
+ * @returns {Function} Returns the iteratee.
+ */
+ function baseIteratee(value) {
+ // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9.
+ // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details.
+ if (typeof value == 'function') {
+ return value;
+ }
+ if (value == null) {
+ return identity;
+ }
+ if (typeof value == 'object') {
+ return isArray(value)
+ ? baseMatchesProperty(value[0], value[1])
+ : baseMatches(value);
+ }
+ return property(value);
+ }
+
+ /**
+ * The base implementation of `_.keys` which doesn't treat sparse arrays as dense.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names.
+ */
+ function baseKeys(object) {
+ if (!isPrototype(object)) {
+ return nativeKeys(object);
+ }
+ var result = [];
+ for (var key in Object(object)) {
+ if (hasOwnProperty.call(object, key) && key != 'constructor') {
+ result.push(key);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names.
+ */
+ function baseKeysIn(object) {
+ if (!isObject(object)) {
+ return nativeKeysIn(object);
+ }
+ var isProto = isPrototype(object),
+ result = [];
+
+ for (var key in object) {
+ if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) {
+ result.push(key);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.lt` which doesn't coerce arguments.
+ *
+ * @private
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if `value` is less than `other`,
+ * else `false`.
+ */
+ function baseLt(value, other) {
+ return value < other;
+ }
+
+ /**
+ * The base implementation of `_.map` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} iteratee The function invoked per iteration.
+ * @returns {Array} Returns the new mapped array.
+ */
+ function baseMap(collection, iteratee) {
+ var index = -1,
+ result = isArrayLike(collection) ? Array(collection.length) : [];
+
+ baseEach(collection, function(value, key, collection) {
+ result[++index] = iteratee(value, key, collection);
+ });
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.matches` which doesn't clone `source`.
+ *
+ * @private
+ * @param {Object} source The object of property values to match.
+ * @returns {Function} Returns the new spec function.
+ */
+ function baseMatches(source) {
+ var matchData = getMatchData(source);
+ if (matchData.length == 1 && matchData[0][2]) {
+ return matchesStrictComparable(matchData[0][0], matchData[0][1]);
+ }
+ return function(object) {
+ return object === source || baseIsMatch(object, source, matchData);
+ };
+ }
+
+ /**
+ * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`.
+ *
+ * @private
+ * @param {string} path The path of the property to get.
+ * @param {*} srcValue The value to match.
+ * @returns {Function} Returns the new spec function.
+ */
+ function baseMatchesProperty(path, srcValue) {
+ if (isKey(path) && isStrictComparable(srcValue)) {
+ return matchesStrictComparable(toKey(path), srcValue);
+ }
+ return function(object) {
+ var objValue = get(object, path);
+ return (objValue === undefined && objValue === srcValue)
+ ? hasIn(object, path)
+ : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG);
+ };
+ }
+
+ /**
+ * The base implementation of `_.merge` without support for multiple sources.
+ *
+ * @private
+ * @param {Object} object The destination object.
+ * @param {Object} source The source object.
+ * @param {number} srcIndex The index of `source`.
+ * @param {Function} [customizer] The function to customize merged values.
+ * @param {Object} [stack] Tracks traversed source values and their merged
+ * counterparts.
+ */
+ function baseMerge(object, source, srcIndex, customizer, stack) {
+ if (object === source) {
+ return;
+ }
+ baseFor(source, function(srcValue, key) {
+ if (isObject(srcValue)) {
+ stack || (stack = new Stack);
+ baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack);
+ }
+ else {
+ var newValue = customizer
+ ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack)
+ : undefined;
+
+ if (newValue === undefined) {
+ newValue = srcValue;
+ }
+ assignMergeValue(object, key, newValue);
+ }
+ }, keysIn);
+ }
+
+ /**
+ * A specialized version of `baseMerge` for arrays and objects which performs
+ * deep merges and tracks traversed objects enabling objects with circular
+ * references to be merged.
+ *
+ * @private
+ * @param {Object} object The destination object.
+ * @param {Object} source The source object.
+ * @param {string} key The key of the value to merge.
+ * @param {number} srcIndex The index of `source`.
+ * @param {Function} mergeFunc The function to merge values.
+ * @param {Function} [customizer] The function to customize assigned values.
+ * @param {Object} [stack] Tracks traversed source values and their merged
+ * counterparts.
+ */
+ function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) {
+ var objValue = safeGet(object, key),
+ srcValue = safeGet(source, key),
+ stacked = stack.get(srcValue);
+
+ if (stacked) {
+ assignMergeValue(object, key, stacked);
+ return;
+ }
+ var newValue = customizer
+ ? customizer(objValue, srcValue, (key + ''), object, source, stack)
+ : undefined;
+
+ var isCommon = newValue === undefined;
+
+ if (isCommon) {
+ var isArr = isArray(srcValue),
+ isBuff = !isArr && isBuffer(srcValue),
+ isTyped = !isArr && !isBuff && isTypedArray(srcValue);
+
+ newValue = srcValue;
+ if (isArr || isBuff || isTyped) {
+ if (isArray(objValue)) {
+ newValue = objValue;
+ }
+ else if (isArrayLikeObject(objValue)) {
+ newValue = copyArray(objValue);
+ }
+ else if (isBuff) {
+ isCommon = false;
+ newValue = cloneBuffer(srcValue, true);
+ }
+ else if (isTyped) {
+ isCommon = false;
+ newValue = cloneTypedArray(srcValue, true);
+ }
+ else {
+ newValue = [];
+ }
+ }
+ else if (isPlainObject(srcValue) || isArguments(srcValue)) {
+ newValue = objValue;
+ if (isArguments(objValue)) {
+ newValue = toPlainObject(objValue);
+ }
+ else if (!isObject(objValue) || isFunction(objValue)) {
+ newValue = initCloneObject(srcValue);
+ }
+ }
+ else {
+ isCommon = false;
+ }
+ }
+ if (isCommon) {
+ // Recursively merge objects and arrays (susceptible to call stack limits).
+ stack.set(srcValue, newValue);
+ mergeFunc(newValue, srcValue, srcIndex, customizer, stack);
+ stack['delete'](srcValue);
+ }
+ assignMergeValue(object, key, newValue);
+ }
+
+ /**
+ * The base implementation of `_.nth` which doesn't coerce arguments.
+ *
+ * @private
+ * @param {Array} array The array to query.
+ * @param {number} n The index of the element to return.
+ * @returns {*} Returns the nth element of `array`.
+ */
+ function baseNth(array, n) {
+ var length = array.length;
+ if (!length) {
+ return;
+ }
+ n += n < 0 ? length : 0;
+ return isIndex(n, length) ? array[n] : undefined;
+ }
+
+ /**
+ * The base implementation of `_.orderBy` without param guards.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by.
+ * @param {string[]} orders The sort orders of `iteratees`.
+ * @returns {Array} Returns the new sorted array.
+ */
+ function baseOrderBy(collection, iteratees, orders) {
+ var index = -1;
+ iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee()));
+
+ var result = baseMap(collection, function(value, key, collection) {
+ var criteria = arrayMap(iteratees, function(iteratee) {
+ return iteratee(value);
+ });
+ return { 'criteria': criteria, 'index': ++index, 'value': value };
+ });
+
+ return baseSortBy(result, function(object, other) {
+ return compareMultiple(object, other, orders);
+ });
+ }
+
+ /**
+ * The base implementation of `_.pick` without support for individual
+ * property identifiers.
+ *
+ * @private
+ * @param {Object} object The source object.
+ * @param {string[]} paths The property paths to pick.
+ * @returns {Object} Returns the new object.
+ */
+ function basePick(object, paths) {
+ return basePickBy(object, paths, function(value, path) {
+ return hasIn(object, path);
+ });
+ }
+
+ /**
+ * The base implementation of `_.pickBy` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Object} object The source object.
+ * @param {string[]} paths The property paths to pick.
+ * @param {Function} predicate The function invoked per property.
+ * @returns {Object} Returns the new object.
+ */
+ function basePickBy(object, paths, predicate) {
+ var index = -1,
+ length = paths.length,
+ result = {};
+
+ while (++index < length) {
+ var path = paths[index],
+ value = baseGet(object, path);
+
+ if (predicate(value, path)) {
+ baseSet(result, castPath(path, object), value);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * A specialized version of `baseProperty` which supports deep paths.
+ *
+ * @private
+ * @param {Array|string} path The path of the property to get.
+ * @returns {Function} Returns the new accessor function.
+ */
+ function basePropertyDeep(path) {
+ return function(object) {
+ return baseGet(object, path);
+ };
+ }
+
+ /**
+ * The base implementation of `_.pullAllBy` without support for iteratee
+ * shorthands.
+ *
+ * @private
+ * @param {Array} array The array to modify.
+ * @param {Array} values The values to remove.
+ * @param {Function} [iteratee] The iteratee invoked per element.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns `array`.
+ */
+ function basePullAll(array, values, iteratee, comparator) {
+ var indexOf = comparator ? baseIndexOfWith : baseIndexOf,
+ index = -1,
+ length = values.length,
+ seen = array;
+
+ if (array === values) {
+ values = copyArray(values);
+ }
+ if (iteratee) {
+ seen = arrayMap(array, baseUnary(iteratee));
+ }
+ while (++index < length) {
+ var fromIndex = 0,
+ value = values[index],
+ computed = iteratee ? iteratee(value) : value;
+
+ while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) {
+ if (seen !== array) {
+ splice.call(seen, fromIndex, 1);
+ }
+ splice.call(array, fromIndex, 1);
+ }
+ }
+ return array;
+ }
+
+ /**
+ * The base implementation of `_.pullAt` without support for individual
+ * indexes or capturing the removed elements.
+ *
+ * @private
+ * @param {Array} array The array to modify.
+ * @param {number[]} indexes The indexes of elements to remove.
+ * @returns {Array} Returns `array`.
+ */
+ function basePullAt(array, indexes) {
+ var length = array ? indexes.length : 0,
+ lastIndex = length - 1;
+
+ while (length--) {
+ var index = indexes[length];
+ if (length == lastIndex || index !== previous) {
+ var previous = index;
+ if (isIndex(index)) {
+ splice.call(array, index, 1);
+ } else {
+ baseUnset(array, index);
+ }
+ }
+ }
+ return array;
+ }
+
+ /**
+ * The base implementation of `_.random` without support for returning
+ * floating-point numbers.
+ *
+ * @private
+ * @param {number} lower The lower bound.
+ * @param {number} upper The upper bound.
+ * @returns {number} Returns the random number.
+ */
+ function baseRandom(lower, upper) {
+ return lower + nativeFloor(nativeRandom() * (upper - lower + 1));
+ }
+
+ /**
+ * The base implementation of `_.range` and `_.rangeRight` which doesn't
+ * coerce arguments.
+ *
+ * @private
+ * @param {number} start The start of the range.
+ * @param {number} end The end of the range.
+ * @param {number} step The value to increment or decrement by.
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {Array} Returns the range of numbers.
+ */
+ function baseRange(start, end, step, fromRight) {
+ var index = -1,
+ length = nativeMax(nativeCeil((end - start) / (step || 1)), 0),
+ result = Array(length);
+
+ while (length--) {
+ result[fromRight ? length : ++index] = start;
+ start += step;
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.repeat` which doesn't coerce arguments.
+ *
+ * @private
+ * @param {string} string The string to repeat.
+ * @param {number} n The number of times to repeat the string.
+ * @returns {string} Returns the repeated string.
+ */
+ function baseRepeat(string, n) {
+ var result = '';
+ if (!string || n < 1 || n > MAX_SAFE_INTEGER) {
+ return result;
+ }
+ // Leverage the exponentiation by squaring algorithm for a faster repeat.
+ // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details.
+ do {
+ if (n % 2) {
+ result += string;
+ }
+ n = nativeFloor(n / 2);
+ if (n) {
+ string += string;
+ }
+ } while (n);
+
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.rest` which doesn't validate or coerce arguments.
+ *
+ * @private
+ * @param {Function} func The function to apply a rest parameter to.
+ * @param {number} [start=func.length-1] The start position of the rest parameter.
+ * @returns {Function} Returns the new function.
+ */
+ function baseRest(func, start) {
+ return setToString(overRest(func, start, identity), func + '');
+ }
+
+ /**
+ * The base implementation of `_.sample`.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to sample.
+ * @returns {*} Returns the random element.
+ */
+ function baseSample(collection) {
+ return arraySample(values(collection));
+ }
+
+ /**
+ * The base implementation of `_.sampleSize` without param guards.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to sample.
+ * @param {number} n The number of elements to sample.
+ * @returns {Array} Returns the random elements.
+ */
+ function baseSampleSize(collection, n) {
+ var array = values(collection);
+ return shuffleSelf(array, baseClamp(n, 0, array.length));
+ }
+
+ /**
+ * The base implementation of `_.set`.
+ *
+ * @private
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The path of the property to set.
+ * @param {*} value The value to set.
+ * @param {Function} [customizer] The function to customize path creation.
+ * @returns {Object} Returns `object`.
+ */
+ function baseSet(object, path, value, customizer) {
+ if (!isObject(object)) {
+ return object;
+ }
+ path = castPath(path, object);
+
+ var index = -1,
+ length = path.length,
+ lastIndex = length - 1,
+ nested = object;
+
+ while (nested != null && ++index < length) {
+ var key = toKey(path[index]),
+ newValue = value;
+
+ if (index != lastIndex) {
+ var objValue = nested[key];
+ newValue = customizer ? customizer(objValue, key, nested) : undefined;
+ if (newValue === undefined) {
+ newValue = isObject(objValue)
+ ? objValue
+ : (isIndex(path[index + 1]) ? [] : {});
+ }
+ }
+ assignValue(nested, key, newValue);
+ nested = nested[key];
+ }
+ return object;
+ }
+
+ /**
+ * The base implementation of `setData` without support for hot loop shorting.
+ *
+ * @private
+ * @param {Function} func The function to associate metadata with.
+ * @param {*} data The metadata.
+ * @returns {Function} Returns `func`.
+ */
+ var baseSetData = !metaMap ? identity : function(func, data) {
+ metaMap.set(func, data);
+ return func;
+ };
+
+ /**
+ * The base implementation of `setToString` without support for hot loop shorting.
+ *
+ * @private
+ * @param {Function} func The function to modify.
+ * @param {Function} string The `toString` result.
+ * @returns {Function} Returns `func`.
+ */
+ var baseSetToString = !defineProperty ? identity : function(func, string) {
+ return defineProperty(func, 'toString', {
+ 'configurable': true,
+ 'enumerable': false,
+ 'value': constant(string),
+ 'writable': true
+ });
+ };
+
+ /**
+ * The base implementation of `_.shuffle`.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to shuffle.
+ * @returns {Array} Returns the new shuffled array.
+ */
+ function baseShuffle(collection) {
+ return shuffleSelf(values(collection));
+ }
+
+ /**
+ * The base implementation of `_.slice` without an iteratee call guard.
+ *
+ * @private
+ * @param {Array} array The array to slice.
+ * @param {number} [start=0] The start position.
+ * @param {number} [end=array.length] The end position.
+ * @returns {Array} Returns the slice of `array`.
+ */
+ function baseSlice(array, start, end) {
+ var index = -1,
+ length = array.length;
+
+ if (start < 0) {
+ start = -start > length ? 0 : (length + start);
+ }
+ end = end > length ? length : end;
+ if (end < 0) {
+ end += length;
+ }
+ length = start > end ? 0 : ((end - start) >>> 0);
+ start >>>= 0;
+
+ var result = Array(length);
+ while (++index < length) {
+ result[index] = array[index + start];
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.some` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} predicate The function invoked per iteration.
+ * @returns {boolean} Returns `true` if any element passes the predicate check,
+ * else `false`.
+ */
+ function baseSome(collection, predicate) {
+ var result;
+
+ baseEach(collection, function(value, index, collection) {
+ result = predicate(value, index, collection);
+ return !result;
+ });
+ return !!result;
+ }
+
+ /**
+ * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which
+ * performs a binary search of `array` to determine the index at which `value`
+ * should be inserted into `array` in order to maintain its sort order.
+ *
+ * @private
+ * @param {Array} array The sorted array to inspect.
+ * @param {*} value The value to evaluate.
+ * @param {boolean} [retHighest] Specify returning the highest qualified index.
+ * @returns {number} Returns the index at which `value` should be inserted
+ * into `array`.
+ */
+ function baseSortedIndex(array, value, retHighest) {
+ var low = 0,
+ high = array == null ? low : array.length;
+
+ if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) {
+ while (low < high) {
+ var mid = (low + high) >>> 1,
+ computed = array[mid];
+
+ if (computed !== null && !isSymbol(computed) &&
+ (retHighest ? (computed <= value) : (computed < value))) {
+ low = mid + 1;
+ } else {
+ high = mid;
+ }
+ }
+ return high;
+ }
+ return baseSortedIndexBy(array, value, identity, retHighest);
+ }
+
+ /**
+ * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy`
+ * which invokes `iteratee` for `value` and each element of `array` to compute
+ * their sort ranking. The iteratee is invoked with one argument; (value).
+ *
+ * @private
+ * @param {Array} array The sorted array to inspect.
+ * @param {*} value The value to evaluate.
+ * @param {Function} iteratee The iteratee invoked per element.
+ * @param {boolean} [retHighest] Specify returning the highest qualified index.
+ * @returns {number} Returns the index at which `value` should be inserted
+ * into `array`.
+ */
+ function baseSortedIndexBy(array, value, iteratee, retHighest) {
+ value = iteratee(value);
+
+ var low = 0,
+ high = array == null ? 0 : array.length,
+ valIsNaN = value !== value,
+ valIsNull = value === null,
+ valIsSymbol = isSymbol(value),
+ valIsUndefined = value === undefined;
+
+ while (low < high) {
+ var mid = nativeFloor((low + high) / 2),
+ computed = iteratee(array[mid]),
+ othIsDefined = computed !== undefined,
+ othIsNull = computed === null,
+ othIsReflexive = computed === computed,
+ othIsSymbol = isSymbol(computed);
+
+ if (valIsNaN) {
+ var setLow = retHighest || othIsReflexive;
+ } else if (valIsUndefined) {
+ setLow = othIsReflexive && (retHighest || othIsDefined);
+ } else if (valIsNull) {
+ setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull);
+ } else if (valIsSymbol) {
+ setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol);
+ } else if (othIsNull || othIsSymbol) {
+ setLow = false;
+ } else {
+ setLow = retHighest ? (computed <= value) : (computed < value);
+ }
+ if (setLow) {
+ low = mid + 1;
+ } else {
+ high = mid;
+ }
+ }
+ return nativeMin(high, MAX_ARRAY_INDEX);
+ }
+
+ /**
+ * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without
+ * support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {Function} [iteratee] The iteratee invoked per element.
+ * @returns {Array} Returns the new duplicate free array.
+ */
+ function baseSortedUniq(array, iteratee) {
+ var index = -1,
+ length = array.length,
+ resIndex = 0,
+ result = [];
+
+ while (++index < length) {
+ var value = array[index],
+ computed = iteratee ? iteratee(value) : value;
+
+ if (!index || !eq(computed, seen)) {
+ var seen = computed;
+ result[resIndex++] = value === 0 ? 0 : value;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.toNumber` which doesn't ensure correct
+ * conversions of binary, hexadecimal, or octal string values.
+ *
+ * @private
+ * @param {*} value The value to process.
+ * @returns {number} Returns the number.
+ */
+ function baseToNumber(value) {
+ if (typeof value == 'number') {
+ return value;
+ }
+ if (isSymbol(value)) {
+ return NAN;
+ }
+ return +value;
+ }
+
+ /**
+ * The base implementation of `_.toString` which doesn't convert nullish
+ * values to empty strings.
+ *
+ * @private
+ * @param {*} value The value to process.
+ * @returns {string} Returns the string.
+ */
+ function baseToString(value) {
+ // Exit early for strings to avoid a performance hit in some environments.
+ if (typeof value == 'string') {
+ return value;
+ }
+ if (isArray(value)) {
+ // Recursively convert values (susceptible to call stack limits).
+ return arrayMap(value, baseToString) + '';
+ }
+ if (isSymbol(value)) {
+ return symbolToString ? symbolToString.call(value) : '';
+ }
+ var result = (value + '');
+ return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;
+ }
+
+ /**
+ * The base implementation of `_.uniqBy` without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {Function} [iteratee] The iteratee invoked per element.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new duplicate free array.
+ */
+ function baseUniq(array, iteratee, comparator) {
+ var index = -1,
+ includes = arrayIncludes,
+ length = array.length,
+ isCommon = true,
+ result = [],
+ seen = result;
+
+ if (comparator) {
+ isCommon = false;
+ includes = arrayIncludesWith;
+ }
+ else if (length >= LARGE_ARRAY_SIZE) {
+ var set = iteratee ? null : createSet(array);
+ if (set) {
+ return setToArray(set);
+ }
+ isCommon = false;
+ includes = cacheHas;
+ seen = new SetCache;
+ }
+ else {
+ seen = iteratee ? [] : result;
+ }
+ outer:
+ while (++index < length) {
+ var value = array[index],
+ computed = iteratee ? iteratee(value) : value;
+
+ value = (comparator || value !== 0) ? value : 0;
+ if (isCommon && computed === computed) {
+ var seenIndex = seen.length;
+ while (seenIndex--) {
+ if (seen[seenIndex] === computed) {
+ continue outer;
+ }
+ }
+ if (iteratee) {
+ seen.push(computed);
+ }
+ result.push(value);
+ }
+ else if (!includes(seen, computed, comparator)) {
+ if (seen !== result) {
+ seen.push(computed);
+ }
+ result.push(value);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * The base implementation of `_.unset`.
+ *
+ * @private
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The property path to unset.
+ * @returns {boolean} Returns `true` if the property is deleted, else `false`.
+ */
+ function baseUnset(object, path) {
+ path = castPath(path, object);
+ object = parent(object, path);
+ return object == null || delete object[toKey(last(path))];
+ }
+
+ /**
+ * The base implementation of `_.update`.
+ *
+ * @private
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The path of the property to update.
+ * @param {Function} updater The function to produce the updated value.
+ * @param {Function} [customizer] The function to customize path creation.
+ * @returns {Object} Returns `object`.
+ */
+ function baseUpdate(object, path, updater, customizer) {
+ return baseSet(object, path, updater(baseGet(object, path)), customizer);
+ }
+
+ /**
+ * The base implementation of methods like `_.dropWhile` and `_.takeWhile`
+ * without support for iteratee shorthands.
+ *
+ * @private
+ * @param {Array} array The array to query.
+ * @param {Function} predicate The function invoked per iteration.
+ * @param {boolean} [isDrop] Specify dropping elements instead of taking them.
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {Array} Returns the slice of `array`.
+ */
+ function baseWhile(array, predicate, isDrop, fromRight) {
+ var length = array.length,
+ index = fromRight ? length : -1;
+
+ while ((fromRight ? index-- : ++index < length) &&
+ predicate(array[index], index, array)) {}
+
+ return isDrop
+ ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length))
+ : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index));
+ }
+
+ /**
+ * The base implementation of `wrapperValue` which returns the result of
+ * performing a sequence of actions on the unwrapped `value`, where each
+ * successive action is supplied the return value of the previous.
+ *
+ * @private
+ * @param {*} value The unwrapped value.
+ * @param {Array} actions Actions to perform to resolve the unwrapped value.
+ * @returns {*} Returns the resolved value.
+ */
+ function baseWrapperValue(value, actions) {
+ var result = value;
+ if (result instanceof LazyWrapper) {
+ result = result.value();
+ }
+ return arrayReduce(actions, function(result, action) {
+ return action.func.apply(action.thisArg, arrayPush([result], action.args));
+ }, result);
+ }
+
+ /**
+ * The base implementation of methods like `_.xor`, without support for
+ * iteratee shorthands, that accepts an array of arrays to inspect.
+ *
+ * @private
+ * @param {Array} arrays The arrays to inspect.
+ * @param {Function} [iteratee] The iteratee invoked per element.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new array of values.
+ */
+ function baseXor(arrays, iteratee, comparator) {
+ var length = arrays.length;
+ if (length < 2) {
+ return length ? baseUniq(arrays[0]) : [];
+ }
+ var index = -1,
+ result = Array(length);
+
+ while (++index < length) {
+ var array = arrays[index],
+ othIndex = -1;
+
+ while (++othIndex < length) {
+ if (othIndex != index) {
+ result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator);
+ }
+ }
+ }
+ return baseUniq(baseFlatten(result, 1), iteratee, comparator);
+ }
+
+ /**
+ * This base implementation of `_.zipObject` which assigns values using `assignFunc`.
+ *
+ * @private
+ * @param {Array} props The property identifiers.
+ * @param {Array} values The property values.
+ * @param {Function} assignFunc The function to assign values.
+ * @returns {Object} Returns the new object.
+ */
+ function baseZipObject(props, values, assignFunc) {
+ var index = -1,
+ length = props.length,
+ valsLength = values.length,
+ result = {};
+
+ while (++index < length) {
+ var value = index < valsLength ? values[index] : undefined;
+ assignFunc(result, props[index], value);
+ }
+ return result;
+ }
+
+ /**
+ * Casts `value` to an empty array if it's not an array like object.
+ *
+ * @private
+ * @param {*} value The value to inspect.
+ * @returns {Array|Object} Returns the cast array-like object.
+ */
+ function castArrayLikeObject(value) {
+ return isArrayLikeObject(value) ? value : [];
+ }
+
+ /**
+ * Casts `value` to `identity` if it's not a function.
+ *
+ * @private
+ * @param {*} value The value to inspect.
+ * @returns {Function} Returns cast function.
+ */
+ function castFunction(value) {
+ return typeof value == 'function' ? value : identity;
+ }
+
+ /**
+ * Casts `value` to a path array if it's not one.
+ *
+ * @private
+ * @param {*} value The value to inspect.
+ * @param {Object} [object] The object to query keys on.
+ * @returns {Array} Returns the cast property path array.
+ */
+ function castPath(value, object) {
+ if (isArray(value)) {
+ return value;
+ }
+ return isKey(value, object) ? [value] : stringToPath(toString(value));
+ }
+
+ /**
+ * A `baseRest` alias which can be replaced with `identity` by module
+ * replacement plugins.
+ *
+ * @private
+ * @type {Function}
+ * @param {Function} func The function to apply a rest parameter to.
+ * @returns {Function} Returns the new function.
+ */
+ var castRest = baseRest;
+
+ /**
+ * Casts `array` to a slice if it's needed.
+ *
+ * @private
+ * @param {Array} array The array to inspect.
+ * @param {number} start The start position.
+ * @param {number} [end=array.length] The end position.
+ * @returns {Array} Returns the cast slice.
+ */
+ function castSlice(array, start, end) {
+ var length = array.length;
+ end = end === undefined ? length : end;
+ return (!start && end >= length) ? array : baseSlice(array, start, end);
+ }
+
+ /**
+ * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout).
+ *
+ * @private
+ * @param {number|Object} id The timer id or timeout object of the timer to clear.
+ */
+ var clearTimeout = ctxClearTimeout || function(id) {
+ return root.clearTimeout(id);
+ };
+
+ /**
+ * Creates a clone of `buffer`.
+ *
+ * @private
+ * @param {Buffer} buffer The buffer to clone.
+ * @param {boolean} [isDeep] Specify a deep clone.
+ * @returns {Buffer} Returns the cloned buffer.
+ */
+ function cloneBuffer(buffer, isDeep) {
+ if (isDeep) {
+ return buffer.slice();
+ }
+ var length = buffer.length,
+ result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length);
+
+ buffer.copy(result);
+ return result;
+ }
+
+ /**
+ * Creates a clone of `arrayBuffer`.
+ *
+ * @private
+ * @param {ArrayBuffer} arrayBuffer The array buffer to clone.
+ * @returns {ArrayBuffer} Returns the cloned array buffer.
+ */
+ function cloneArrayBuffer(arrayBuffer) {
+ var result = new arrayBuffer.constructor(arrayBuffer.byteLength);
+ new Uint8Array(result).set(new Uint8Array(arrayBuffer));
+ return result;
+ }
+
+ /**
+ * Creates a clone of `dataView`.
+ *
+ * @private
+ * @param {Object} dataView The data view to clone.
+ * @param {boolean} [isDeep] Specify a deep clone.
+ * @returns {Object} Returns the cloned data view.
+ */
+ function cloneDataView(dataView, isDeep) {
+ var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;
+ return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength);
+ }
+
+ /**
+ * Creates a clone of `regexp`.
+ *
+ * @private
+ * @param {Object} regexp The regexp to clone.
+ * @returns {Object} Returns the cloned regexp.
+ */
+ function cloneRegExp(regexp) {
+ var result = new regexp.constructor(regexp.source, reFlags.exec(regexp));
+ result.lastIndex = regexp.lastIndex;
+ return result;
+ }
+
+ /**
+ * Creates a clone of the `symbol` object.
+ *
+ * @private
+ * @param {Object} symbol The symbol object to clone.
+ * @returns {Object} Returns the cloned symbol object.
+ */
+ function cloneSymbol(symbol) {
+ return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {};
+ }
+
+ /**
+ * Creates a clone of `typedArray`.
+ *
+ * @private
+ * @param {Object} typedArray The typed array to clone.
+ * @param {boolean} [isDeep] Specify a deep clone.
+ * @returns {Object} Returns the cloned typed array.
+ */
+ function cloneTypedArray(typedArray, isDeep) {
+ var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;
+ return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length);
+ }
+
+ /**
+ * Compares values to sort them in ascending order.
+ *
+ * @private
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {number} Returns the sort order indicator for `value`.
+ */
+ function compareAscending(value, other) {
+ if (value !== other) {
+ var valIsDefined = value !== undefined,
+ valIsNull = value === null,
+ valIsReflexive = value === value,
+ valIsSymbol = isSymbol(value);
+
+ var othIsDefined = other !== undefined,
+ othIsNull = other === null,
+ othIsReflexive = other === other,
+ othIsSymbol = isSymbol(other);
+
+ if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) ||
+ (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) ||
+ (valIsNull && othIsDefined && othIsReflexive) ||
+ (!valIsDefined && othIsReflexive) ||
+ !valIsReflexive) {
+ return 1;
+ }
+ if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) ||
+ (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) ||
+ (othIsNull && valIsDefined && valIsReflexive) ||
+ (!othIsDefined && valIsReflexive) ||
+ !othIsReflexive) {
+ return -1;
+ }
+ }
+ return 0;
+ }
+
+ /**
+ * Used by `_.orderBy` to compare multiple properties of a value to another
+ * and stable sort them.
+ *
+ * If `orders` is unspecified, all values are sorted in ascending order. Otherwise,
+ * specify an order of "desc" for descending or "asc" for ascending sort order
+ * of corresponding values.
+ *
+ * @private
+ * @param {Object} object The object to compare.
+ * @param {Object} other The other object to compare.
+ * @param {boolean[]|string[]} orders The order to sort by for each property.
+ * @returns {number} Returns the sort order indicator for `object`.
+ */
+ function compareMultiple(object, other, orders) {
+ var index = -1,
+ objCriteria = object.criteria,
+ othCriteria = other.criteria,
+ length = objCriteria.length,
+ ordersLength = orders.length;
+
+ while (++index < length) {
+ var result = compareAscending(objCriteria[index], othCriteria[index]);
+ if (result) {
+ if (index >= ordersLength) {
+ return result;
+ }
+ var order = orders[index];
+ return result * (order == 'desc' ? -1 : 1);
+ }
+ }
+ // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications
+ // that causes it, under certain circumstances, to provide the same value for
+ // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247
+ // for more details.
+ //
+ // This also ensures a stable sort in V8 and other engines.
+ // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details.
+ return object.index - other.index;
+ }
+
+ /**
+ * Creates an array that is the composition of partially applied arguments,
+ * placeholders, and provided arguments into a single array of arguments.
+ *
+ * @private
+ * @param {Array} args The provided arguments.
+ * @param {Array} partials The arguments to prepend to those provided.
+ * @param {Array} holders The `partials` placeholder indexes.
+ * @params {boolean} [isCurried] Specify composing for a curried function.
+ * @returns {Array} Returns the new array of composed arguments.
+ */
+ function composeArgs(args, partials, holders, isCurried) {
+ var argsIndex = -1,
+ argsLength = args.length,
+ holdersLength = holders.length,
+ leftIndex = -1,
+ leftLength = partials.length,
+ rangeLength = nativeMax(argsLength - holdersLength, 0),
+ result = Array(leftLength + rangeLength),
+ isUncurried = !isCurried;
+
+ while (++leftIndex < leftLength) {
+ result[leftIndex] = partials[leftIndex];
+ }
+ while (++argsIndex < holdersLength) {
+ if (isUncurried || argsIndex < argsLength) {
+ result[holders[argsIndex]] = args[argsIndex];
+ }
+ }
+ while (rangeLength--) {
+ result[leftIndex++] = args[argsIndex++];
+ }
+ return result;
+ }
+
+ /**
+ * This function is like `composeArgs` except that the arguments composition
+ * is tailored for `_.partialRight`.
+ *
+ * @private
+ * @param {Array} args The provided arguments.
+ * @param {Array} partials The arguments to append to those provided.
+ * @param {Array} holders The `partials` placeholder indexes.
+ * @params {boolean} [isCurried] Specify composing for a curried function.
+ * @returns {Array} Returns the new array of composed arguments.
+ */
+ function composeArgsRight(args, partials, holders, isCurried) {
+ var argsIndex = -1,
+ argsLength = args.length,
+ holdersIndex = -1,
+ holdersLength = holders.length,
+ rightIndex = -1,
+ rightLength = partials.length,
+ rangeLength = nativeMax(argsLength - holdersLength, 0),
+ result = Array(rangeLength + rightLength),
+ isUncurried = !isCurried;
+
+ while (++argsIndex < rangeLength) {
+ result[argsIndex] = args[argsIndex];
+ }
+ var offset = argsIndex;
+ while (++rightIndex < rightLength) {
+ result[offset + rightIndex] = partials[rightIndex];
+ }
+ while (++holdersIndex < holdersLength) {
+ if (isUncurried || argsIndex < argsLength) {
+ result[offset + holders[holdersIndex]] = args[argsIndex++];
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Copies the values of `source` to `array`.
+ *
+ * @private
+ * @param {Array} source The array to copy values from.
+ * @param {Array} [array=[]] The array to copy values to.
+ * @returns {Array} Returns `array`.
+ */
+ function copyArray(source, array) {
+ var index = -1,
+ length = source.length;
+
+ array || (array = Array(length));
+ while (++index < length) {
+ array[index] = source[index];
+ }
+ return array;
+ }
+
+ /**
+ * Copies properties of `source` to `object`.
+ *
+ * @private
+ * @param {Object} source The object to copy properties from.
+ * @param {Array} props The property identifiers to copy.
+ * @param {Object} [object={}] The object to copy properties to.
+ * @param {Function} [customizer] The function to customize copied values.
+ * @returns {Object} Returns `object`.
+ */
+ function copyObject(source, props, object, customizer) {
+ var isNew = !object;
+ object || (object = {});
+
+ var index = -1,
+ length = props.length;
+
+ while (++index < length) {
+ var key = props[index];
+
+ var newValue = customizer
+ ? customizer(object[key], source[key], key, object, source)
+ : undefined;
+
+ if (newValue === undefined) {
+ newValue = source[key];
+ }
+ if (isNew) {
+ baseAssignValue(object, key, newValue);
+ } else {
+ assignValue(object, key, newValue);
+ }
+ }
+ return object;
+ }
+
+ /**
+ * Copies own symbols of `source` to `object`.
+ *
+ * @private
+ * @param {Object} source The object to copy symbols from.
+ * @param {Object} [object={}] The object to copy symbols to.
+ * @returns {Object} Returns `object`.
+ */
+ function copySymbols(source, object) {
+ return copyObject(source, getSymbols(source), object);
+ }
+
+ /**
+ * Copies own and inherited symbols of `source` to `object`.
+ *
+ * @private
+ * @param {Object} source The object to copy symbols from.
+ * @param {Object} [object={}] The object to copy symbols to.
+ * @returns {Object} Returns `object`.
+ */
+ function copySymbolsIn(source, object) {
+ return copyObject(source, getSymbolsIn(source), object);
+ }
+
+ /**
+ * Creates a function like `_.groupBy`.
+ *
+ * @private
+ * @param {Function} setter The function to set accumulator values.
+ * @param {Function} [initializer] The accumulator object initializer.
+ * @returns {Function} Returns the new aggregator function.
+ */
+ function createAggregator(setter, initializer) {
+ return function(collection, iteratee) {
+ var func = isArray(collection) ? arrayAggregator : baseAggregator,
+ accumulator = initializer ? initializer() : {};
+
+ return func(collection, setter, getIteratee(iteratee, 2), accumulator);
+ };
+ }
+
+ /**
+ * Creates a function like `_.assign`.
+ *
+ * @private
+ * @param {Function} assigner The function to assign values.
+ * @returns {Function} Returns the new assigner function.
+ */
+ function createAssigner(assigner) {
+ return baseRest(function(object, sources) {
+ var index = -1,
+ length = sources.length,
+ customizer = length > 1 ? sources[length - 1] : undefined,
+ guard = length > 2 ? sources[2] : undefined;
+
+ customizer = (assigner.length > 3 && typeof customizer == 'function')
+ ? (length--, customizer)
+ : undefined;
+
+ if (guard && isIterateeCall(sources[0], sources[1], guard)) {
+ customizer = length < 3 ? undefined : customizer;
+ length = 1;
+ }
+ object = Object(object);
+ while (++index < length) {
+ var source = sources[index];
+ if (source) {
+ assigner(object, source, index, customizer);
+ }
+ }
+ return object;
+ });
+ }
+
+ /**
+ * Creates a `baseEach` or `baseEachRight` function.
+ *
+ * @private
+ * @param {Function} eachFunc The function to iterate over a collection.
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {Function} Returns the new base function.
+ */
+ function createBaseEach(eachFunc, fromRight) {
+ return function(collection, iteratee) {
+ if (collection == null) {
+ return collection;
+ }
+ if (!isArrayLike(collection)) {
+ return eachFunc(collection, iteratee);
+ }
+ var length = collection.length,
+ index = fromRight ? length : -1,
+ iterable = Object(collection);
+
+ while ((fromRight ? index-- : ++index < length)) {
+ if (iteratee(iterable[index], index, iterable) === false) {
+ break;
+ }
+ }
+ return collection;
+ };
+ }
+
+ /**
+ * Creates a base function for methods like `_.forIn` and `_.forOwn`.
+ *
+ * @private
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {Function} Returns the new base function.
+ */
+ function createBaseFor(fromRight) {
+ return function(object, iteratee, keysFunc) {
+ var index = -1,
+ iterable = Object(object),
+ props = keysFunc(object),
+ length = props.length;
+
+ while (length--) {
+ var key = props[fromRight ? length : ++index];
+ if (iteratee(iterable[key], key, iterable) === false) {
+ break;
+ }
+ }
+ return object;
+ };
+ }
+
+ /**
+ * Creates a function that wraps `func` to invoke it with the optional `this`
+ * binding of `thisArg`.
+ *
+ * @private
+ * @param {Function} func The function to wrap.
+ * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
+ * @param {*} [thisArg] The `this` binding of `func`.
+ * @returns {Function} Returns the new wrapped function.
+ */
+ function createBind(func, bitmask, thisArg) {
+ var isBind = bitmask & WRAP_BIND_FLAG,
+ Ctor = createCtor(func);
+
+ function wrapper() {
+ var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
+ return fn.apply(isBind ? thisArg : this, arguments);
+ }
+ return wrapper;
+ }
+
+ /**
+ * Creates a function like `_.lowerFirst`.
+ *
+ * @private
+ * @param {string} methodName The name of the `String` case method to use.
+ * @returns {Function} Returns the new case function.
+ */
+ function createCaseFirst(methodName) {
+ return function(string) {
+ string = toString(string);
+
+ var strSymbols = hasUnicode(string)
+ ? stringToArray(string)
+ : undefined;
+
+ var chr = strSymbols
+ ? strSymbols[0]
+ : string.charAt(0);
+
+ var trailing = strSymbols
+ ? castSlice(strSymbols, 1).join('')
+ : string.slice(1);
+
+ return chr[methodName]() + trailing;
+ };
+ }
+
+ /**
+ * Creates a function like `_.camelCase`.
+ *
+ * @private
+ * @param {Function} callback The function to combine each word.
+ * @returns {Function} Returns the new compounder function.
+ */
+ function createCompounder(callback) {
+ return function(string) {
+ return arrayReduce(words(deburr(string).replace(reApos, '')), callback, '');
+ };
+ }
+
+ /**
+ * Creates a function that produces an instance of `Ctor` regardless of
+ * whether it was invoked as part of a `new` expression or by `call` or `apply`.
+ *
+ * @private
+ * @param {Function} Ctor The constructor to wrap.
+ * @returns {Function} Returns the new wrapped function.
+ */
+ function createCtor(Ctor) {
+ return function() {
+ // Use a `switch` statement to work with class constructors. See
+ // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist
+ // for more details.
+ var args = arguments;
+ switch (args.length) {
+ case 0: return new Ctor;
+ case 1: return new Ctor(args[0]);
+ case 2: return new Ctor(args[0], args[1]);
+ case 3: return new Ctor(args[0], args[1], args[2]);
+ case 4: return new Ctor(args[0], args[1], args[2], args[3]);
+ case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]);
+ case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]);
+ case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]);
+ }
+ var thisBinding = baseCreate(Ctor.prototype),
+ result = Ctor.apply(thisBinding, args);
+
+ // Mimic the constructor's `return` behavior.
+ // See https://es5.github.io/#x13.2.2 for more details.
+ return isObject(result) ? result : thisBinding;
+ };
+ }
+
+ /**
+ * Creates a function that wraps `func` to enable currying.
+ *
+ * @private
+ * @param {Function} func The function to wrap.
+ * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
+ * @param {number} arity The arity of `func`.
+ * @returns {Function} Returns the new wrapped function.
+ */
+ function createCurry(func, bitmask, arity) {
+ var Ctor = createCtor(func);
+
+ function wrapper() {
+ var length = arguments.length,
+ args = Array(length),
+ index = length,
+ placeholder = getHolder(wrapper);
+
+ while (index--) {
+ args[index] = arguments[index];
+ }
+ var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder)
+ ? []
+ : replaceHolders(args, placeholder);
+
+ length -= holders.length;
+ if (length < arity) {
+ return createRecurry(
+ func, bitmask, createHybrid, wrapper.placeholder, undefined,
+ args, holders, undefined, undefined, arity - length);
+ }
+ var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
+ return apply(fn, this, args);
+ }
+ return wrapper;
+ }
+
+ /**
+ * Creates a `_.find` or `_.findLast` function.
+ *
+ * @private
+ * @param {Function} findIndexFunc The function to find the collection index.
+ * @returns {Function} Returns the new find function.
+ */
+ function createFind(findIndexFunc) {
+ return function(collection, predicate, fromIndex) {
+ var iterable = Object(collection);
+ if (!isArrayLike(collection)) {
+ var iteratee = getIteratee(predicate, 3);
+ collection = keys(collection);
+ predicate = function(key) { return iteratee(iterable[key], key, iterable); };
+ }
+ var index = findIndexFunc(collection, predicate, fromIndex);
+ return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined;
+ };
+ }
+
+ /**
+ * Creates a `_.flow` or `_.flowRight` function.
+ *
+ * @private
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {Function} Returns the new flow function.
+ */
+ function createFlow(fromRight) {
+ return flatRest(function(funcs) {
+ var length = funcs.length,
+ index = length,
+ prereq = LodashWrapper.prototype.thru;
+
+ if (fromRight) {
+ funcs.reverse();
+ }
+ while (index--) {
+ var func = funcs[index];
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ if (prereq && !wrapper && getFuncName(func) == 'wrapper') {
+ var wrapper = new LodashWrapper([], true);
+ }
+ }
+ index = wrapper ? index : length;
+ while (++index < length) {
+ func = funcs[index];
+
+ var funcName = getFuncName(func),
+ data = funcName == 'wrapper' ? getData(func) : undefined;
+
+ if (data && isLaziable(data[0]) &&
+ data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) &&
+ !data[4].length && data[9] == 1
+ ) {
+ wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]);
+ } else {
+ wrapper = (func.length == 1 && isLaziable(func))
+ ? wrapper[funcName]()
+ : wrapper.thru(func);
+ }
+ }
+ return function() {
+ var args = arguments,
+ value = args[0];
+
+ if (wrapper && args.length == 1 && isArray(value)) {
+ return wrapper.plant(value).value();
+ }
+ var index = 0,
+ result = length ? funcs[index].apply(this, args) : value;
+
+ while (++index < length) {
+ result = funcs[index].call(this, result);
+ }
+ return result;
+ };
+ });
+ }
+
+ /**
+ * Creates a function that wraps `func` to invoke it with optional `this`
+ * binding of `thisArg`, partial application, and currying.
+ *
+ * @private
+ * @param {Function|string} func The function or method name to wrap.
+ * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
+ * @param {*} [thisArg] The `this` binding of `func`.
+ * @param {Array} [partials] The arguments to prepend to those provided to
+ * the new function.
+ * @param {Array} [holders] The `partials` placeholder indexes.
+ * @param {Array} [partialsRight] The arguments to append to those provided
+ * to the new function.
+ * @param {Array} [holdersRight] The `partialsRight` placeholder indexes.
+ * @param {Array} [argPos] The argument positions of the new function.
+ * @param {number} [ary] The arity cap of `func`.
+ * @param {number} [arity] The arity of `func`.
+ * @returns {Function} Returns the new wrapped function.
+ */
+ function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) {
+ var isAry = bitmask & WRAP_ARY_FLAG,
+ isBind = bitmask & WRAP_BIND_FLAG,
+ isBindKey = bitmask & WRAP_BIND_KEY_FLAG,
+ isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG),
+ isFlip = bitmask & WRAP_FLIP_FLAG,
+ Ctor = isBindKey ? undefined : createCtor(func);
+
+ function wrapper() {
+ var length = arguments.length,
+ args = Array(length),
+ index = length;
+
+ while (index--) {
+ args[index] = arguments[index];
+ }
+ if (isCurried) {
+ var placeholder = getHolder(wrapper),
+ holdersCount = countHolders(args, placeholder);
+ }
+ if (partials) {
+ args = composeArgs(args, partials, holders, isCurried);
+ }
+ if (partialsRight) {
+ args = composeArgsRight(args, partialsRight, holdersRight, isCurried);
+ }
+ length -= holdersCount;
+ if (isCurried && length < arity) {
+ var newHolders = replaceHolders(args, placeholder);
+ return createRecurry(
+ func, bitmask, createHybrid, wrapper.placeholder, thisArg,
+ args, newHolders, argPos, ary, arity - length
+ );
+ }
+ var thisBinding = isBind ? thisArg : this,
+ fn = isBindKey ? thisBinding[func] : func;
+
+ length = args.length;
+ if (argPos) {
+ args = reorder(args, argPos);
+ } else if (isFlip && length > 1) {
+ args.reverse();
+ }
+ if (isAry && ary < length) {
+ args.length = ary;
+ }
+ if (this && this !== root && this instanceof wrapper) {
+ fn = Ctor || createCtor(fn);
+ }
+ return fn.apply(thisBinding, args);
+ }
+ return wrapper;
+ }
+
+ /**
+ * Creates a function like `_.invertBy`.
+ *
+ * @private
+ * @param {Function} setter The function to set accumulator values.
+ * @param {Function} toIteratee The function to resolve iteratees.
+ * @returns {Function} Returns the new inverter function.
+ */
+ function createInverter(setter, toIteratee) {
+ return function(object, iteratee) {
+ return baseInverter(object, setter, toIteratee(iteratee), {});
+ };
+ }
+
+ /**
+ * Creates a function that performs a mathematical operation on two values.
+ *
+ * @private
+ * @param {Function} operator The function to perform the operation.
+ * @param {number} [defaultValue] The value used for `undefined` arguments.
+ * @returns {Function} Returns the new mathematical operation function.
+ */
+ function createMathOperation(operator, defaultValue) {
+ return function(value, other) {
+ var result;
+ if (value === undefined && other === undefined) {
+ return defaultValue;
+ }
+ if (value !== undefined) {
+ result = value;
+ }
+ if (other !== undefined) {
+ if (result === undefined) {
+ return other;
+ }
+ if (typeof value == 'string' || typeof other == 'string') {
+ value = baseToString(value);
+ other = baseToString(other);
+ } else {
+ value = baseToNumber(value);
+ other = baseToNumber(other);
+ }
+ result = operator(value, other);
+ }
+ return result;
+ };
+ }
+
+ /**
+ * Creates a function like `_.over`.
+ *
+ * @private
+ * @param {Function} arrayFunc The function to iterate over iteratees.
+ * @returns {Function} Returns the new over function.
+ */
+ function createOver(arrayFunc) {
+ return flatRest(function(iteratees) {
+ iteratees = arrayMap(iteratees, baseUnary(getIteratee()));
+ return baseRest(function(args) {
+ var thisArg = this;
+ return arrayFunc(iteratees, function(iteratee) {
+ return apply(iteratee, thisArg, args);
+ });
+ });
+ });
+ }
+
+ /**
+ * Creates the padding for `string` based on `length`. The `chars` string
+ * is truncated if the number of characters exceeds `length`.
+ *
+ * @private
+ * @param {number} length The padding length.
+ * @param {string} [chars=' '] The string used as padding.
+ * @returns {string} Returns the padding for `string`.
+ */
+ function createPadding(length, chars) {
+ chars = chars === undefined ? ' ' : baseToString(chars);
+
+ var charsLength = chars.length;
+ if (charsLength < 2) {
+ return charsLength ? baseRepeat(chars, length) : chars;
+ }
+ var result = baseRepeat(chars, nativeCeil(length / stringSize(chars)));
+ return hasUnicode(chars)
+ ? castSlice(stringToArray(result), 0, length).join('')
+ : result.slice(0, length);
+ }
+
+ /**
+ * Creates a function that wraps `func` to invoke it with the `this` binding
+ * of `thisArg` and `partials` prepended to the arguments it receives.
+ *
+ * @private
+ * @param {Function} func The function to wrap.
+ * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
+ * @param {*} thisArg The `this` binding of `func`.
+ * @param {Array} partials The arguments to prepend to those provided to
+ * the new function.
+ * @returns {Function} Returns the new wrapped function.
+ */
+ function createPartial(func, bitmask, thisArg, partials) {
+ var isBind = bitmask & WRAP_BIND_FLAG,
+ Ctor = createCtor(func);
+
+ function wrapper() {
+ var argsIndex = -1,
+ argsLength = arguments.length,
+ leftIndex = -1,
+ leftLength = partials.length,
+ args = Array(leftLength + argsLength),
+ fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;
+
+ while (++leftIndex < leftLength) {
+ args[leftIndex] = partials[leftIndex];
+ }
+ while (argsLength--) {
+ args[leftIndex++] = arguments[++argsIndex];
+ }
+ return apply(fn, isBind ? thisArg : this, args);
+ }
+ return wrapper;
+ }
+
+ /**
+ * Creates a `_.range` or `_.rangeRight` function.
+ *
+ * @private
+ * @param {boolean} [fromRight] Specify iterating from right to left.
+ * @returns {Function} Returns the new range function.
+ */
+ function createRange(fromRight) {
+ return function(start, end, step) {
+ if (step && typeof step != 'number' && isIterateeCall(start, end, step)) {
+ end = step = undefined;
+ }
+ // Ensure the sign of `-0` is preserved.
+ start = toFinite(start);
+ if (end === undefined) {
+ end = start;
+ start = 0;
+ } else {
+ end = toFinite(end);
+ }
+ step = step === undefined ? (start < end ? 1 : -1) : toFinite(step);
+ return baseRange(start, end, step, fromRight);
+ };
+ }
+
+ /**
+ * Creates a function that performs a relational operation on two values.
+ *
+ * @private
+ * @param {Function} operator The function to perform the operation.
+ * @returns {Function} Returns the new relational operation function.
+ */
+ function createRelationalOperation(operator) {
+ return function(value, other) {
+ if (!(typeof value == 'string' && typeof other == 'string')) {
+ value = toNumber(value);
+ other = toNumber(other);
+ }
+ return operator(value, other);
+ };
+ }
+
+ /**
+ * Creates a function that wraps `func` to continue currying.
+ *
+ * @private
+ * @param {Function} func The function to wrap.
+ * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
+ * @param {Function} wrapFunc The function to create the `func` wrapper.
+ * @param {*} placeholder The placeholder value.
+ * @param {*} [thisArg] The `this` binding of `func`.
+ * @param {Array} [partials] The arguments to prepend to those provided to
+ * the new function.
+ * @param {Array} [holders] The `partials` placeholder indexes.
+ * @param {Array} [argPos] The argument positions of the new function.
+ * @param {number} [ary] The arity cap of `func`.
+ * @param {number} [arity] The arity of `func`.
+ * @returns {Function} Returns the new wrapped function.
+ */
+ function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) {
+ var isCurry = bitmask & WRAP_CURRY_FLAG,
+ newHolders = isCurry ? holders : undefined,
+ newHoldersRight = isCurry ? undefined : holders,
+ newPartials = isCurry ? partials : undefined,
+ newPartialsRight = isCurry ? undefined : partials;
+
+ bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG);
+ bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG);
+
+ if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) {
+ bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG);
+ }
+ var newData = [
+ func, bitmask, thisArg, newPartials, newHolders, newPartialsRight,
+ newHoldersRight, argPos, ary, arity
+ ];
+
+ var result = wrapFunc.apply(undefined, newData);
+ if (isLaziable(func)) {
+ setData(result, newData);
+ }
+ result.placeholder = placeholder;
+ return setWrapToString(result, func, bitmask);
+ }
+
+ /**
+ * Creates a function like `_.round`.
+ *
+ * @private
+ * @param {string} methodName The name of the `Math` method to use when rounding.
+ * @returns {Function} Returns the new round function.
+ */
+ function createRound(methodName) {
+ var func = Math[methodName];
+ return function(number, precision) {
+ number = toNumber(number);
+ precision = precision == null ? 0 : nativeMin(toInteger(precision), 292);
+ if (precision) {
+ // Shift with exponential notation to avoid floating-point issues.
+ // See [MDN](https://mdn.io/round#Examples) for more details.
+ var pair = (toString(number) + 'e').split('e'),
+ value = func(pair[0] + 'e' + (+pair[1] + precision));
+
+ pair = (toString(value) + 'e').split('e');
+ return +(pair[0] + 'e' + (+pair[1] - precision));
+ }
+ return func(number);
+ };
+ }
+
+ /**
+ * Creates a set object of `values`.
+ *
+ * @private
+ * @param {Array} values The values to add to the set.
+ * @returns {Object} Returns the new set.
+ */
+ var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) {
+ return new Set(values);
+ };
+
+ /**
+ * Creates a `_.toPairs` or `_.toPairsIn` function.
+ *
+ * @private
+ * @param {Function} keysFunc The function to get the keys of a given object.
+ * @returns {Function} Returns the new pairs function.
+ */
+ function createToPairs(keysFunc) {
+ return function(object) {
+ var tag = getTag(object);
+ if (tag == mapTag) {
+ return mapToArray(object);
+ }
+ if (tag == setTag) {
+ return setToPairs(object);
+ }
+ return baseToPairs(object, keysFunc(object));
+ };
+ }
+
+ /**
+ * Creates a function that either curries or invokes `func` with optional
+ * `this` binding and partially applied arguments.
+ *
+ * @private
+ * @param {Function|string} func The function or method name to wrap.
+ * @param {number} bitmask The bitmask flags.
+ * 1 - `_.bind`
+ * 2 - `_.bindKey`
+ * 4 - `_.curry` or `_.curryRight` of a bound function
+ * 8 - `_.curry`
+ * 16 - `_.curryRight`
+ * 32 - `_.partial`
+ * 64 - `_.partialRight`
+ * 128 - `_.rearg`
+ * 256 - `_.ary`
+ * 512 - `_.flip`
+ * @param {*} [thisArg] The `this` binding of `func`.
+ * @param {Array} [partials] The arguments to be partially applied.
+ * @param {Array} [holders] The `partials` placeholder indexes.
+ * @param {Array} [argPos] The argument positions of the new function.
+ * @param {number} [ary] The arity cap of `func`.
+ * @param {number} [arity] The arity of `func`.
+ * @returns {Function} Returns the new wrapped function.
+ */
+ function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) {
+ var isBindKey = bitmask & WRAP_BIND_KEY_FLAG;
+ if (!isBindKey && typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ var length = partials ? partials.length : 0;
+ if (!length) {
+ bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG);
+ partials = holders = undefined;
+ }
+ ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0);
+ arity = arity === undefined ? arity : toInteger(arity);
+ length -= holders ? holders.length : 0;
+
+ if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) {
+ var partialsRight = partials,
+ holdersRight = holders;
+
+ partials = holders = undefined;
+ }
+ var data = isBindKey ? undefined : getData(func);
+
+ var newData = [
+ func, bitmask, thisArg, partials, holders, partialsRight, holdersRight,
+ argPos, ary, arity
+ ];
+
+ if (data) {
+ mergeData(newData, data);
+ }
+ func = newData[0];
+ bitmask = newData[1];
+ thisArg = newData[2];
+ partials = newData[3];
+ holders = newData[4];
+ arity = newData[9] = newData[9] === undefined
+ ? (isBindKey ? 0 : func.length)
+ : nativeMax(newData[9] - length, 0);
+
+ if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) {
+ bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG);
+ }
+ if (!bitmask || bitmask == WRAP_BIND_FLAG) {
+ var result = createBind(func, bitmask, thisArg);
+ } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) {
+ result = createCurry(func, bitmask, arity);
+ } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) {
+ result = createPartial(func, bitmask, thisArg, partials);
+ } else {
+ result = createHybrid.apply(undefined, newData);
+ }
+ var setter = data ? baseSetData : setData;
+ return setWrapToString(setter(result, newData), func, bitmask);
+ }
+
+ /**
+ * Used by `_.defaults` to customize its `_.assignIn` use to assign properties
+ * of source objects to the destination object for all destination properties
+ * that resolve to `undefined`.
+ *
+ * @private
+ * @param {*} objValue The destination value.
+ * @param {*} srcValue The source value.
+ * @param {string} key The key of the property to assign.
+ * @param {Object} object The parent object of `objValue`.
+ * @returns {*} Returns the value to assign.
+ */
+ function customDefaultsAssignIn(objValue, srcValue, key, object) {
+ if (objValue === undefined ||
+ (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) {
+ return srcValue;
+ }
+ return objValue;
+ }
+
+ /**
+ * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source
+ * objects into destination objects that are passed thru.
+ *
+ * @private
+ * @param {*} objValue The destination value.
+ * @param {*} srcValue The source value.
+ * @param {string} key The key of the property to merge.
+ * @param {Object} object The parent object of `objValue`.
+ * @param {Object} source The parent object of `srcValue`.
+ * @param {Object} [stack] Tracks traversed source values and their merged
+ * counterparts.
+ * @returns {*} Returns the value to assign.
+ */
+ function customDefaultsMerge(objValue, srcValue, key, object, source, stack) {
+ if (isObject(objValue) && isObject(srcValue)) {
+ // Recursively merge objects and arrays (susceptible to call stack limits).
+ stack.set(srcValue, objValue);
+ baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack);
+ stack['delete'](srcValue);
+ }
+ return objValue;
+ }
+
+ /**
+ * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain
+ * objects.
+ *
+ * @private
+ * @param {*} value The value to inspect.
+ * @param {string} key The key of the property to inspect.
+ * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`.
+ */
+ function customOmitClone(value) {
+ return isPlainObject(value) ? undefined : value;
+ }
+
+ /**
+ * A specialized version of `baseIsEqualDeep` for arrays with support for
+ * partial deep comparisons.
+ *
+ * @private
+ * @param {Array} array The array to compare.
+ * @param {Array} other The other array to compare.
+ * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
+ * @param {Function} customizer The function to customize comparisons.
+ * @param {Function} equalFunc The function to determine equivalents of values.
+ * @param {Object} stack Tracks traversed `array` and `other` objects.
+ * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.
+ */
+ function equalArrays(array, other, bitmask, customizer, equalFunc, stack) {
+ var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
+ arrLength = array.length,
+ othLength = other.length;
+
+ if (arrLength != othLength && !(isPartial && othLength > arrLength)) {
+ return false;
+ }
+ // Assume cyclic values are equal.
+ var stacked = stack.get(array);
+ if (stacked && stack.get(other)) {
+ return stacked == other;
+ }
+ var index = -1,
+ result = true,
+ seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined;
+
+ stack.set(array, other);
+ stack.set(other, array);
+
+ // Ignore non-index properties.
+ while (++index < arrLength) {
+ var arrValue = array[index],
+ othValue = other[index];
+
+ if (customizer) {
+ var compared = isPartial
+ ? customizer(othValue, arrValue, index, other, array, stack)
+ : customizer(arrValue, othValue, index, array, other, stack);
+ }
+ if (compared !== undefined) {
+ if (compared) {
+ continue;
+ }
+ result = false;
+ break;
+ }
+ // Recursively compare arrays (susceptible to call stack limits).
+ if (seen) {
+ if (!arraySome(other, function(othValue, othIndex) {
+ if (!cacheHas(seen, othIndex) &&
+ (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {
+ return seen.push(othIndex);
+ }
+ })) {
+ result = false;
+ break;
+ }
+ } else if (!(
+ arrValue === othValue ||
+ equalFunc(arrValue, othValue, bitmask, customizer, stack)
+ )) {
+ result = false;
+ break;
+ }
+ }
+ stack['delete'](array);
+ stack['delete'](other);
+ return result;
+ }
+
+ /**
+ * A specialized version of `baseIsEqualDeep` for comparing objects of
+ * the same `toStringTag`.
+ *
+ * **Note:** This function only supports comparing values with tags of
+ * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.
+ *
+ * @private
+ * @param {Object} object The object to compare.
+ * @param {Object} other The other object to compare.
+ * @param {string} tag The `toStringTag` of the objects to compare.
+ * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
+ * @param {Function} customizer The function to customize comparisons.
+ * @param {Function} equalFunc The function to determine equivalents of values.
+ * @param {Object} stack Tracks traversed `object` and `other` objects.
+ * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
+ */
+ function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {
+ switch (tag) {
+ case dataViewTag:
+ if ((object.byteLength != other.byteLength) ||
+ (object.byteOffset != other.byteOffset)) {
+ return false;
+ }
+ object = object.buffer;
+ other = other.buffer;
+
+ case arrayBufferTag:
+ if ((object.byteLength != other.byteLength) ||
+ !equalFunc(new Uint8Array(object), new Uint8Array(other))) {
+ return false;
+ }
+ return true;
+
+ case boolTag:
+ case dateTag:
+ case numberTag:
+ // Coerce booleans to `1` or `0` and dates to milliseconds.
+ // Invalid dates are coerced to `NaN`.
+ return eq(+object, +other);
+
+ case errorTag:
+ return object.name == other.name && object.message == other.message;
+
+ case regexpTag:
+ case stringTag:
+ // Coerce regexes to strings and treat strings, primitives and objects,
+ // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring
+ // for more details.
+ return object == (other + '');
+
+ case mapTag:
+ var convert = mapToArray;
+
+ case setTag:
+ var isPartial = bitmask & COMPARE_PARTIAL_FLAG;
+ convert || (convert = setToArray);
+
+ if (object.size != other.size && !isPartial) {
+ return false;
+ }
+ // Assume cyclic values are equal.
+ var stacked = stack.get(object);
+ if (stacked) {
+ return stacked == other;
+ }
+ bitmask |= COMPARE_UNORDERED_FLAG;
+
+ // Recursively compare objects (susceptible to call stack limits).
+ stack.set(object, other);
+ var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);
+ stack['delete'](object);
+ return result;
+
+ case symbolTag:
+ if (symbolValueOf) {
+ return symbolValueOf.call(object) == symbolValueOf.call(other);
+ }
+ }
+ return false;
+ }
+
+ /**
+ * A specialized version of `baseIsEqualDeep` for objects with support for
+ * partial deep comparisons.
+ *
+ * @private
+ * @param {Object} object The object to compare.
+ * @param {Object} other The other object to compare.
+ * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
+ * @param {Function} customizer The function to customize comparisons.
+ * @param {Function} equalFunc The function to determine equivalents of values.
+ * @param {Object} stack Tracks traversed `object` and `other` objects.
+ * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
+ */
+ function equalObjects(object, other, bitmask, customizer, equalFunc, stack) {
+ var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
+ objProps = getAllKeys(object),
+ objLength = objProps.length,
+ othProps = getAllKeys(other),
+ othLength = othProps.length;
+
+ if (objLength != othLength && !isPartial) {
+ return false;
+ }
+ var index = objLength;
+ while (index--) {
+ var key = objProps[index];
+ if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {
+ return false;
+ }
+ }
+ // Assume cyclic values are equal.
+ var stacked = stack.get(object);
+ if (stacked && stack.get(other)) {
+ return stacked == other;
+ }
+ var result = true;
+ stack.set(object, other);
+ stack.set(other, object);
+
+ var skipCtor = isPartial;
+ while (++index < objLength) {
+ key = objProps[index];
+ var objValue = object[key],
+ othValue = other[key];
+
+ if (customizer) {
+ var compared = isPartial
+ ? customizer(othValue, objValue, key, other, object, stack)
+ : customizer(objValue, othValue, key, object, other, stack);
+ }
+ // Recursively compare objects (susceptible to call stack limits).
+ if (!(compared === undefined
+ ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack))
+ : compared
+ )) {
+ result = false;
+ break;
+ }
+ skipCtor || (skipCtor = key == 'constructor');
+ }
+ if (result && !skipCtor) {
+ var objCtor = object.constructor,
+ othCtor = other.constructor;
+
+ // Non `Object` object instances with different constructors are not equal.
+ if (objCtor != othCtor &&
+ ('constructor' in object && 'constructor' in other) &&
+ !(typeof objCtor == 'function' && objCtor instanceof objCtor &&
+ typeof othCtor == 'function' && othCtor instanceof othCtor)) {
+ result = false;
+ }
+ }
+ stack['delete'](object);
+ stack['delete'](other);
+ return result;
+ }
+
+ /**
+ * A specialized version of `baseRest` which flattens the rest array.
+ *
+ * @private
+ * @param {Function} func The function to apply a rest parameter to.
+ * @returns {Function} Returns the new function.
+ */
+ function flatRest(func) {
+ return setToString(overRest(func, undefined, flatten), func + '');
+ }
+
+ /**
+ * Creates an array of own enumerable property names and symbols of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names and symbols.
+ */
+ function getAllKeys(object) {
+ return baseGetAllKeys(object, keys, getSymbols);
+ }
+
+ /**
+ * Creates an array of own and inherited enumerable property names and
+ * symbols of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names and symbols.
+ */
+ function getAllKeysIn(object) {
+ return baseGetAllKeys(object, keysIn, getSymbolsIn);
+ }
+
+ /**
+ * Gets metadata for `func`.
+ *
+ * @private
+ * @param {Function} func The function to query.
+ * @returns {*} Returns the metadata for `func`.
+ */
+ var getData = !metaMap ? noop : function(func) {
+ return metaMap.get(func);
+ };
+
+ /**
+ * Gets the name of `func`.
+ *
+ * @private
+ * @param {Function} func The function to query.
+ * @returns {string} Returns the function name.
+ */
+ function getFuncName(func) {
+ var result = (func.name + ''),
+ array = realNames[result],
+ length = hasOwnProperty.call(realNames, result) ? array.length : 0;
+
+ while (length--) {
+ var data = array[length],
+ otherFunc = data.func;
+ if (otherFunc == null || otherFunc == func) {
+ return data.name;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Gets the argument placeholder value for `func`.
+ *
+ * @private
+ * @param {Function} func The function to inspect.
+ * @returns {*} Returns the placeholder value.
+ */
+ function getHolder(func) {
+ var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func;
+ return object.placeholder;
+ }
+
+ /**
+ * Gets the appropriate "iteratee" function. If `_.iteratee` is customized,
+ * this function returns the custom method, otherwise it returns `baseIteratee`.
+ * If arguments are provided, the chosen function is invoked with them and
+ * its result is returned.
+ *
+ * @private
+ * @param {*} [value] The value to convert to an iteratee.
+ * @param {number} [arity] The arity of the created iteratee.
+ * @returns {Function} Returns the chosen function or its result.
+ */
+ function getIteratee() {
+ var result = lodash.iteratee || iteratee;
+ result = result === iteratee ? baseIteratee : result;
+ return arguments.length ? result(arguments[0], arguments[1]) : result;
+ }
+
+ /**
+ * Gets the data for `map`.
+ *
+ * @private
+ * @param {Object} map The map to query.
+ * @param {string} key The reference key.
+ * @returns {*} Returns the map data.
+ */
+ function getMapData(map, key) {
+ var data = map.__data__;
+ return isKeyable(key)
+ ? data[typeof key == 'string' ? 'string' : 'hash']
+ : data.map;
+ }
+
+ /**
+ * Gets the property names, values, and compare flags of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the match data of `object`.
+ */
+ function getMatchData(object) {
+ var result = keys(object),
+ length = result.length;
+
+ while (length--) {
+ var key = result[length],
+ value = object[key];
+
+ result[length] = [key, value, isStrictComparable(value)];
+ }
+ return result;
+ }
+
+ /**
+ * Gets the native function at `key` of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {string} key The key of the method to get.
+ * @returns {*} Returns the function if it's native, else `undefined`.
+ */
+ function getNative(object, key) {
+ var value = getValue(object, key);
+ return baseIsNative(value) ? value : undefined;
+ }
+
+ /**
+ * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.
+ *
+ * @private
+ * @param {*} value The value to query.
+ * @returns {string} Returns the raw `toStringTag`.
+ */
+ function getRawTag(value) {
+ var isOwn = hasOwnProperty.call(value, symToStringTag),
+ tag = value[symToStringTag];
+
+ try {
+ value[symToStringTag] = undefined;
+ var unmasked = true;
+ } catch (e) {}
+
+ var result = nativeObjectToString.call(value);
+ if (unmasked) {
+ if (isOwn) {
+ value[symToStringTag] = tag;
+ } else {
+ delete value[symToStringTag];
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Creates an array of the own enumerable symbols of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of symbols.
+ */
+ var getSymbols = !nativeGetSymbols ? stubArray : function(object) {
+ if (object == null) {
+ return [];
+ }
+ object = Object(object);
+ return arrayFilter(nativeGetSymbols(object), function(symbol) {
+ return propertyIsEnumerable.call(object, symbol);
+ });
+ };
+
+ /**
+ * Creates an array of the own and inherited enumerable symbols of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of symbols.
+ */
+ var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) {
+ var result = [];
+ while (object) {
+ arrayPush(result, getSymbols(object));
+ object = getPrototype(object);
+ }
+ return result;
+ };
+
+ /**
+ * Gets the `toStringTag` of `value`.
+ *
+ * @private
+ * @param {*} value The value to query.
+ * @returns {string} Returns the `toStringTag`.
+ */
+ var getTag = baseGetTag;
+
+ // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.
+ if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) ||
+ (Map && getTag(new Map) != mapTag) ||
+ (Promise && getTag(Promise.resolve()) != promiseTag) ||
+ (Set && getTag(new Set) != setTag) ||
+ (WeakMap && getTag(new WeakMap) != weakMapTag)) {
+ getTag = function(value) {
+ var result = baseGetTag(value),
+ Ctor = result == objectTag ? value.constructor : undefined,
+ ctorString = Ctor ? toSource(Ctor) : '';
+
+ if (ctorString) {
+ switch (ctorString) {
+ case dataViewCtorString: return dataViewTag;
+ case mapCtorString: return mapTag;
+ case promiseCtorString: return promiseTag;
+ case setCtorString: return setTag;
+ case weakMapCtorString: return weakMapTag;
+ }
+ }
+ return result;
+ };
+ }
+
+ /**
+ * Gets the view, applying any `transforms` to the `start` and `end` positions.
+ *
+ * @private
+ * @param {number} start The start of the view.
+ * @param {number} end The end of the view.
+ * @param {Array} transforms The transformations to apply to the view.
+ * @returns {Object} Returns an object containing the `start` and `end`
+ * positions of the view.
+ */
+ function getView(start, end, transforms) {
+ var index = -1,
+ length = transforms.length;
+
+ while (++index < length) {
+ var data = transforms[index],
+ size = data.size;
+
+ switch (data.type) {
+ case 'drop': start += size; break;
+ case 'dropRight': end -= size; break;
+ case 'take': end = nativeMin(end, start + size); break;
+ case 'takeRight': start = nativeMax(start, end - size); break;
+ }
+ }
+ return { 'start': start, 'end': end };
+ }
+
+ /**
+ * Extracts wrapper details from the `source` body comment.
+ *
+ * @private
+ * @param {string} source The source to inspect.
+ * @returns {Array} Returns the wrapper details.
+ */
+ function getWrapDetails(source) {
+ var match = source.match(reWrapDetails);
+ return match ? match[1].split(reSplitDetails) : [];
+ }
+
+ /**
+ * Checks if `path` exists on `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path to check.
+ * @param {Function} hasFunc The function to check properties.
+ * @returns {boolean} Returns `true` if `path` exists, else `false`.
+ */
+ function hasPath(object, path, hasFunc) {
+ path = castPath(path, object);
+
+ var index = -1,
+ length = path.length,
+ result = false;
+
+ while (++index < length) {
+ var key = toKey(path[index]);
+ if (!(result = object != null && hasFunc(object, key))) {
+ break;
+ }
+ object = object[key];
+ }
+ if (result || ++index != length) {
+ return result;
+ }
+ length = object == null ? 0 : object.length;
+ return !!length && isLength(length) && isIndex(key, length) &&
+ (isArray(object) || isArguments(object));
+ }
+
+ /**
+ * Initializes an array clone.
+ *
+ * @private
+ * @param {Array} array The array to clone.
+ * @returns {Array} Returns the initialized clone.
+ */
+ function initCloneArray(array) {
+ var length = array.length,
+ result = new array.constructor(length);
+
+ // Add properties assigned by `RegExp#exec`.
+ if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) {
+ result.index = array.index;
+ result.input = array.input;
+ }
+ return result;
+ }
+
+ /**
+ * Initializes an object clone.
+ *
+ * @private
+ * @param {Object} object The object to clone.
+ * @returns {Object} Returns the initialized clone.
+ */
+ function initCloneObject(object) {
+ return (typeof object.constructor == 'function' && !isPrototype(object))
+ ? baseCreate(getPrototype(object))
+ : {};
+ }
+
+ /**
+ * Initializes an object clone based on its `toStringTag`.
+ *
+ * **Note:** This function only supports cloning values with tags of
+ * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`.
+ *
+ * @private
+ * @param {Object} object The object to clone.
+ * @param {string} tag The `toStringTag` of the object to clone.
+ * @param {boolean} [isDeep] Specify a deep clone.
+ * @returns {Object} Returns the initialized clone.
+ */
+ function initCloneByTag(object, tag, isDeep) {
+ var Ctor = object.constructor;
+ switch (tag) {
+ case arrayBufferTag:
+ return cloneArrayBuffer(object);
+
+ case boolTag:
+ case dateTag:
+ return new Ctor(+object);
+
+ case dataViewTag:
+ return cloneDataView(object, isDeep);
+
+ case float32Tag: case float64Tag:
+ case int8Tag: case int16Tag: case int32Tag:
+ case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag:
+ return cloneTypedArray(object, isDeep);
+
+ case mapTag:
+ return new Ctor;
+
+ case numberTag:
+ case stringTag:
+ return new Ctor(object);
+
+ case regexpTag:
+ return cloneRegExp(object);
+
+ case setTag:
+ return new Ctor;
+
+ case symbolTag:
+ return cloneSymbol(object);
+ }
+ }
+
+ /**
+ * Inserts wrapper `details` in a comment at the top of the `source` body.
+ *
+ * @private
+ * @param {string} source The source to modify.
+ * @returns {Array} details The details to insert.
+ * @returns {string} Returns the modified source.
+ */
+ function insertWrapDetails(source, details) {
+ var length = details.length;
+ if (!length) {
+ return source;
+ }
+ var lastIndex = length - 1;
+ details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex];
+ details = details.join(length > 2 ? ', ' : ' ');
+ return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n');
+ }
+
+ /**
+ * Checks if `value` is a flattenable `arguments` object or array.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is flattenable, else `false`.
+ */
+ function isFlattenable(value) {
+ return isArray(value) || isArguments(value) ||
+ !!(spreadableSymbol && value && value[spreadableSymbol]);
+ }
+
+ /**
+ * Checks if `value` is a valid array-like index.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.
+ * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.
+ */
+ function isIndex(value, length) {
+ var type = typeof value;
+ length = length == null ? MAX_SAFE_INTEGER : length;
+
+ return !!length &&
+ (type == 'number' ||
+ (type != 'symbol' && reIsUint.test(value))) &&
+ (value > -1 && value % 1 == 0 && value < length);
+ }
+
+ /**
+ * Checks if the given arguments are from an iteratee call.
+ *
+ * @private
+ * @param {*} value The potential iteratee value argument.
+ * @param {*} index The potential iteratee index or key argument.
+ * @param {*} object The potential iteratee object argument.
+ * @returns {boolean} Returns `true` if the arguments are from an iteratee call,
+ * else `false`.
+ */
+ function isIterateeCall(value, index, object) {
+ if (!isObject(object)) {
+ return false;
+ }
+ var type = typeof index;
+ if (type == 'number'
+ ? (isArrayLike(object) && isIndex(index, object.length))
+ : (type == 'string' && index in object)
+ ) {
+ return eq(object[index], value);
+ }
+ return false;
+ }
+
+ /**
+ * Checks if `value` is a property name and not a property path.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @param {Object} [object] The object to query keys on.
+ * @returns {boolean} Returns `true` if `value` is a property name, else `false`.
+ */
+ function isKey(value, object) {
+ if (isArray(value)) {
+ return false;
+ }
+ var type = typeof value;
+ if (type == 'number' || type == 'symbol' || type == 'boolean' ||
+ value == null || isSymbol(value)) {
+ return true;
+ }
+ return reIsPlainProp.test(value) || !reIsDeepProp.test(value) ||
+ (object != null && value in Object(object));
+ }
+
+ /**
+ * Checks if `value` is suitable for use as unique object key.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is suitable, else `false`.
+ */
+ function isKeyable(value) {
+ var type = typeof value;
+ return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')
+ ? (value !== '__proto__')
+ : (value === null);
+ }
+
+ /**
+ * Checks if `func` has a lazy counterpart.
+ *
+ * @private
+ * @param {Function} func The function to check.
+ * @returns {boolean} Returns `true` if `func` has a lazy counterpart,
+ * else `false`.
+ */
+ function isLaziable(func) {
+ var funcName = getFuncName(func),
+ other = lodash[funcName];
+
+ if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) {
+ return false;
+ }
+ if (func === other) {
+ return true;
+ }
+ var data = getData(other);
+ return !!data && func === data[0];
+ }
+
+ /**
+ * Checks if `func` has its source masked.
+ *
+ * @private
+ * @param {Function} func The function to check.
+ * @returns {boolean} Returns `true` if `func` is masked, else `false`.
+ */
+ function isMasked(func) {
+ return !!maskSrcKey && (maskSrcKey in func);
+ }
+
+ /**
+ * Checks if `func` is capable of being masked.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `func` is maskable, else `false`.
+ */
+ var isMaskable = coreJsData ? isFunction : stubFalse;
+
+ /**
+ * Checks if `value` is likely a prototype object.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a prototype, else `false`.
+ */
+ function isPrototype(value) {
+ var Ctor = value && value.constructor,
+ proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto;
+
+ return value === proto;
+ }
+
+ /**
+ * Checks if `value` is suitable for strict equality comparisons, i.e. `===`.
+ *
+ * @private
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` if suitable for strict
+ * equality comparisons, else `false`.
+ */
+ function isStrictComparable(value) {
+ return value === value && !isObject(value);
+ }
+
+ /**
+ * A specialized version of `matchesProperty` for source values suitable
+ * for strict equality comparisons, i.e. `===`.
+ *
+ * @private
+ * @param {string} key The key of the property to get.
+ * @param {*} srcValue The value to match.
+ * @returns {Function} Returns the new spec function.
+ */
+ function matchesStrictComparable(key, srcValue) {
+ return function(object) {
+ if (object == null) {
+ return false;
+ }
+ return object[key] === srcValue &&
+ (srcValue !== undefined || (key in Object(object)));
+ };
+ }
+
+ /**
+ * A specialized version of `_.memoize` which clears the memoized function's
+ * cache when it exceeds `MAX_MEMOIZE_SIZE`.
+ *
+ * @private
+ * @param {Function} func The function to have its output memoized.
+ * @returns {Function} Returns the new memoized function.
+ */
+ function memoizeCapped(func) {
+ var result = memoize(func, function(key) {
+ if (cache.size === MAX_MEMOIZE_SIZE) {
+ cache.clear();
+ }
+ return key;
+ });
+
+ var cache = result.cache;
+ return result;
+ }
+
+ /**
+ * Merges the function metadata of `source` into `data`.
+ *
+ * Merging metadata reduces the number of wrappers used to invoke a function.
+ * This is possible because methods like `_.bind`, `_.curry`, and `_.partial`
+ * may be applied regardless of execution order. Methods like `_.ary` and
+ * `_.rearg` modify function arguments, making the order in which they are
+ * executed important, preventing the merging of metadata. However, we make
+ * an exception for a safe combined case where curried functions have `_.ary`
+ * and or `_.rearg` applied.
+ *
+ * @private
+ * @param {Array} data The destination metadata.
+ * @param {Array} source The source metadata.
+ * @returns {Array} Returns `data`.
+ */
+ function mergeData(data, source) {
+ var bitmask = data[1],
+ srcBitmask = source[1],
+ newBitmask = bitmask | srcBitmask,
+ isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG);
+
+ var isCombo =
+ ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) ||
+ ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) ||
+ ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG));
+
+ // Exit early if metadata can't be merged.
+ if (!(isCommon || isCombo)) {
+ return data;
+ }
+ // Use source `thisArg` if available.
+ if (srcBitmask & WRAP_BIND_FLAG) {
+ data[2] = source[2];
+ // Set when currying a bound function.
+ newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG;
+ }
+ // Compose partial arguments.
+ var value = source[3];
+ if (value) {
+ var partials = data[3];
+ data[3] = partials ? composeArgs(partials, value, source[4]) : value;
+ data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4];
+ }
+ // Compose partial right arguments.
+ value = source[5];
+ if (value) {
+ partials = data[5];
+ data[5] = partials ? composeArgsRight(partials, value, source[6]) : value;
+ data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6];
+ }
+ // Use source `argPos` if available.
+ value = source[7];
+ if (value) {
+ data[7] = value;
+ }
+ // Use source `ary` if it's smaller.
+ if (srcBitmask & WRAP_ARY_FLAG) {
+ data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]);
+ }
+ // Use source `arity` if one is not provided.
+ if (data[9] == null) {
+ data[9] = source[9];
+ }
+ // Use source `func` and merge bitmasks.
+ data[0] = source[0];
+ data[1] = newBitmask;
+
+ return data;
+ }
+
+ /**
+ * This function is like
+ * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
+ * except that it includes inherited enumerable properties.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names.
+ */
+ function nativeKeysIn(object) {
+ var result = [];
+ if (object != null) {
+ for (var key in Object(object)) {
+ result.push(key);
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Converts `value` to a string using `Object.prototype.toString`.
+ *
+ * @private
+ * @param {*} value The value to convert.
+ * @returns {string} Returns the converted string.
+ */
+ function objectToString(value) {
+ return nativeObjectToString.call(value);
+ }
+
+ /**
+ * A specialized version of `baseRest` which transforms the rest array.
+ *
+ * @private
+ * @param {Function} func The function to apply a rest parameter to.
+ * @param {number} [start=func.length-1] The start position of the rest parameter.
+ * @param {Function} transform The rest array transform.
+ * @returns {Function} Returns the new function.
+ */
+ function overRest(func, start, transform) {
+ start = nativeMax(start === undefined ? (func.length - 1) : start, 0);
+ return function() {
+ var args = arguments,
+ index = -1,
+ length = nativeMax(args.length - start, 0),
+ array = Array(length);
+
+ while (++index < length) {
+ array[index] = args[start + index];
+ }
+ index = -1;
+ var otherArgs = Array(start + 1);
+ while (++index < start) {
+ otherArgs[index] = args[index];
+ }
+ otherArgs[start] = transform(array);
+ return apply(func, this, otherArgs);
+ };
+ }
+
+ /**
+ * Gets the parent value at `path` of `object`.
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {Array} path The path to get the parent value of.
+ * @returns {*} Returns the parent value.
+ */
+ function parent(object, path) {
+ return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1));
+ }
+
+ /**
+ * Reorder `array` according to the specified indexes where the element at
+ * the first index is assigned as the first element, the element at
+ * the second index is assigned as the second element, and so on.
+ *
+ * @private
+ * @param {Array} array The array to reorder.
+ * @param {Array} indexes The arranged array indexes.
+ * @returns {Array} Returns `array`.
+ */
+ function reorder(array, indexes) {
+ var arrLength = array.length,
+ length = nativeMin(indexes.length, arrLength),
+ oldArray = copyArray(array);
+
+ while (length--) {
+ var index = indexes[length];
+ array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined;
+ }
+ return array;
+ }
+
+ /**
+ * Gets the value at `key`, unless `key` is "__proto__".
+ *
+ * @private
+ * @param {Object} object The object to query.
+ * @param {string} key The key of the property to get.
+ * @returns {*} Returns the property value.
+ */
+ function safeGet(object, key) {
+ if (key == '__proto__') {
+ return;
+ }
+
+ return object[key];
+ }
+
+ /**
+ * Sets metadata for `func`.
+ *
+ * **Note:** If this function becomes hot, i.e. is invoked a lot in a short
+ * period of time, it will trip its breaker and transition to an identity
+ * function to avoid garbage collection pauses in V8. See
+ * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070)
+ * for more details.
+ *
+ * @private
+ * @param {Function} func The function to associate metadata with.
+ * @param {*} data The metadata.
+ * @returns {Function} Returns `func`.
+ */
+ var setData = shortOut(baseSetData);
+
+ /**
+ * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout).
+ *
+ * @private
+ * @param {Function} func The function to delay.
+ * @param {number} wait The number of milliseconds to delay invocation.
+ * @returns {number|Object} Returns the timer id or timeout object.
+ */
+ var setTimeout = ctxSetTimeout || function(func, wait) {
+ return root.setTimeout(func, wait);
+ };
+
+ /**
+ * Sets the `toString` method of `func` to return `string`.
+ *
+ * @private
+ * @param {Function} func The function to modify.
+ * @param {Function} string The `toString` result.
+ * @returns {Function} Returns `func`.
+ */
+ var setToString = shortOut(baseSetToString);
+
+ /**
+ * Sets the `toString` method of `wrapper` to mimic the source of `reference`
+ * with wrapper details in a comment at the top of the source body.
+ *
+ * @private
+ * @param {Function} wrapper The function to modify.
+ * @param {Function} reference The reference function.
+ * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
+ * @returns {Function} Returns `wrapper`.
+ */
+ function setWrapToString(wrapper, reference, bitmask) {
+ var source = (reference + '');
+ return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask)));
+ }
+
+ /**
+ * Creates a function that'll short out and invoke `identity` instead
+ * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN`
+ * milliseconds.
+ *
+ * @private
+ * @param {Function} func The function to restrict.
+ * @returns {Function} Returns the new shortable function.
+ */
+ function shortOut(func) {
+ var count = 0,
+ lastCalled = 0;
+
+ return function() {
+ var stamp = nativeNow(),
+ remaining = HOT_SPAN - (stamp - lastCalled);
+
+ lastCalled = stamp;
+ if (remaining > 0) {
+ if (++count >= HOT_COUNT) {
+ return arguments[0];
+ }
+ } else {
+ count = 0;
+ }
+ return func.apply(undefined, arguments);
+ };
+ }
+
+ /**
+ * A specialized version of `_.shuffle` which mutates and sets the size of `array`.
+ *
+ * @private
+ * @param {Array} array The array to shuffle.
+ * @param {number} [size=array.length] The size of `array`.
+ * @returns {Array} Returns `array`.
+ */
+ function shuffleSelf(array, size) {
+ var index = -1,
+ length = array.length,
+ lastIndex = length - 1;
+
+ size = size === undefined ? length : size;
+ while (++index < size) {
+ var rand = baseRandom(index, lastIndex),
+ value = array[rand];
+
+ array[rand] = array[index];
+ array[index] = value;
+ }
+ array.length = size;
+ return array;
+ }
+
+ /**
+ * Converts `string` to a property path array.
+ *
+ * @private
+ * @param {string} string The string to convert.
+ * @returns {Array} Returns the property path array.
+ */
+ var stringToPath = memoizeCapped(function(string) {
+ var result = [];
+ if (string.charCodeAt(0) === 46 /* . */) {
+ result.push('');
+ }
+ string.replace(rePropName, function(match, number, quote, subString) {
+ result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match));
+ });
+ return result;
+ });
+
+ /**
+ * Converts `value` to a string key if it's not a string or symbol.
+ *
+ * @private
+ * @param {*} value The value to inspect.
+ * @returns {string|symbol} Returns the key.
+ */
+ function toKey(value) {
+ if (typeof value == 'string' || isSymbol(value)) {
+ return value;
+ }
+ var result = (value + '');
+ return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;
+ }
+
+ /**
+ * Converts `func` to its source code.
+ *
+ * @private
+ * @param {Function} func The function to convert.
+ * @returns {string} Returns the source code.
+ */
+ function toSource(func) {
+ if (func != null) {
+ try {
+ return funcToString.call(func);
+ } catch (e) {}
+ try {
+ return (func + '');
+ } catch (e) {}
+ }
+ return '';
+ }
+
+ /**
+ * Updates wrapper `details` based on `bitmask` flags.
+ *
+ * @private
+ * @returns {Array} details The details to modify.
+ * @param {number} bitmask The bitmask flags. See `createWrap` for more details.
+ * @returns {Array} Returns `details`.
+ */
+ function updateWrapDetails(details, bitmask) {
+ arrayEach(wrapFlags, function(pair) {
+ var value = '_.' + pair[0];
+ if ((bitmask & pair[1]) && !arrayIncludes(details, value)) {
+ details.push(value);
+ }
+ });
+ return details.sort();
+ }
+
+ /**
+ * Creates a clone of `wrapper`.
+ *
+ * @private
+ * @param {Object} wrapper The wrapper to clone.
+ * @returns {Object} Returns the cloned wrapper.
+ */
+ function wrapperClone(wrapper) {
+ if (wrapper instanceof LazyWrapper) {
+ return wrapper.clone();
+ }
+ var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__);
+ result.__actions__ = copyArray(wrapper.__actions__);
+ result.__index__ = wrapper.__index__;
+ result.__values__ = wrapper.__values__;
+ return result;
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates an array of elements split into groups the length of `size`.
+ * If `array` can't be split evenly, the final chunk will be the remaining
+ * elements.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to process.
+ * @param {number} [size=1] The length of each chunk
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Array} Returns the new array of chunks.
+ * @example
+ *
+ * _.chunk(['a', 'b', 'c', 'd'], 2);
+ * // => [['a', 'b'], ['c', 'd']]
+ *
+ * _.chunk(['a', 'b', 'c', 'd'], 3);
+ * // => [['a', 'b', 'c'], ['d']]
+ */
+ function chunk(array, size, guard) {
+ if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) {
+ size = 1;
+ } else {
+ size = nativeMax(toInteger(size), 0);
+ }
+ var length = array == null ? 0 : array.length;
+ if (!length || size < 1) {
+ return [];
+ }
+ var index = 0,
+ resIndex = 0,
+ result = Array(nativeCeil(length / size));
+
+ while (index < length) {
+ result[resIndex++] = baseSlice(array, index, (index += size));
+ }
+ return result;
+ }
+
+ /**
+ * Creates an array with all falsey values removed. The values `false`, `null`,
+ * `0`, `""`, `undefined`, and `NaN` are falsey.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to compact.
+ * @returns {Array} Returns the new array of filtered values.
+ * @example
+ *
+ * _.compact([0, 1, false, 2, '', 3]);
+ * // => [1, 2, 3]
+ */
+ function compact(array) {
+ var index = -1,
+ length = array == null ? 0 : array.length,
+ resIndex = 0,
+ result = [];
+
+ while (++index < length) {
+ var value = array[index];
+ if (value) {
+ result[resIndex++] = value;
+ }
+ }
+ return result;
+ }
+
+ /**
+ * Creates a new array concatenating `array` with any additional arrays
+ * and/or values.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to concatenate.
+ * @param {...*} [values] The values to concatenate.
+ * @returns {Array} Returns the new concatenated array.
+ * @example
+ *
+ * var array = [1];
+ * var other = _.concat(array, 2, [3], [[4]]);
+ *
+ * console.log(other);
+ * // => [1, 2, 3, [4]]
+ *
+ * console.log(array);
+ * // => [1]
+ */
+ function concat() {
+ var length = arguments.length;
+ if (!length) {
+ return [];
+ }
+ var args = Array(length - 1),
+ array = arguments[0],
+ index = length;
+
+ while (index--) {
+ args[index - 1] = arguments[index];
+ }
+ return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1));
+ }
+
+ /**
+ * Creates an array of `array` values not included in the other given arrays
+ * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons. The order and references of result values are
+ * determined by the first array.
+ *
+ * **Note:** Unlike `_.pullAll`, this method returns a new array.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {...Array} [values] The values to exclude.
+ * @returns {Array} Returns the new array of filtered values.
+ * @see _.without, _.xor
+ * @example
+ *
+ * _.difference([2, 1], [2, 3]);
+ * // => [1]
+ */
+ var difference = baseRest(function(array, values) {
+ return isArrayLikeObject(array)
+ ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true))
+ : [];
+ });
+
+ /**
+ * This method is like `_.difference` except that it accepts `iteratee` which
+ * is invoked for each element of `array` and `values` to generate the criterion
+ * by which they're compared. The order and references of result values are
+ * determined by the first array. The iteratee is invoked with one argument:
+ * (value).
+ *
+ * **Note:** Unlike `_.pullAllBy`, this method returns a new array.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {...Array} [values] The values to exclude.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {Array} Returns the new array of filtered values.
+ * @example
+ *
+ * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor);
+ * // => [1.2]
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x');
+ * // => [{ 'x': 2 }]
+ */
+ var differenceBy = baseRest(function(array, values) {
+ var iteratee = last(values);
+ if (isArrayLikeObject(iteratee)) {
+ iteratee = undefined;
+ }
+ return isArrayLikeObject(array)
+ ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2))
+ : [];
+ });
+
+ /**
+ * This method is like `_.difference` except that it accepts `comparator`
+ * which is invoked to compare elements of `array` to `values`. The order and
+ * references of result values are determined by the first array. The comparator
+ * is invoked with two arguments: (arrVal, othVal).
+ *
+ * **Note:** Unlike `_.pullAllWith`, this method returns a new array.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {...Array} [values] The values to exclude.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new array of filtered values.
+ * @example
+ *
+ * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
+ *
+ * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual);
+ * // => [{ 'x': 2, 'y': 1 }]
+ */
+ var differenceWith = baseRest(function(array, values) {
+ var comparator = last(values);
+ if (isArrayLikeObject(comparator)) {
+ comparator = undefined;
+ }
+ return isArrayLikeObject(array)
+ ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator)
+ : [];
+ });
+
+ /**
+ * Creates a slice of `array` with `n` elements dropped from the beginning.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.5.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {number} [n=1] The number of elements to drop.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * _.drop([1, 2, 3]);
+ * // => [2, 3]
+ *
+ * _.drop([1, 2, 3], 2);
+ * // => [3]
+ *
+ * _.drop([1, 2, 3], 5);
+ * // => []
+ *
+ * _.drop([1, 2, 3], 0);
+ * // => [1, 2, 3]
+ */
+ function drop(array, n, guard) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return [];
+ }
+ n = (guard || n === undefined) ? 1 : toInteger(n);
+ return baseSlice(array, n < 0 ? 0 : n, length);
+ }
+
+ /**
+ * Creates a slice of `array` with `n` elements dropped from the end.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {number} [n=1] The number of elements to drop.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * _.dropRight([1, 2, 3]);
+ * // => [1, 2]
+ *
+ * _.dropRight([1, 2, 3], 2);
+ * // => [1]
+ *
+ * _.dropRight([1, 2, 3], 5);
+ * // => []
+ *
+ * _.dropRight([1, 2, 3], 0);
+ * // => [1, 2, 3]
+ */
+ function dropRight(array, n, guard) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return [];
+ }
+ n = (guard || n === undefined) ? 1 : toInteger(n);
+ n = length - n;
+ return baseSlice(array, 0, n < 0 ? 0 : n);
+ }
+
+ /**
+ * Creates a slice of `array` excluding elements dropped from the end.
+ * Elements are dropped until `predicate` returns falsey. The predicate is
+ * invoked with three arguments: (value, index, array).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'active': true },
+ * { 'user': 'fred', 'active': false },
+ * { 'user': 'pebbles', 'active': false }
+ * ];
+ *
+ * _.dropRightWhile(users, function(o) { return !o.active; });
+ * // => objects for ['barney']
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false });
+ * // => objects for ['barney', 'fred']
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.dropRightWhile(users, ['active', false]);
+ * // => objects for ['barney']
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.dropRightWhile(users, 'active');
+ * // => objects for ['barney', 'fred', 'pebbles']
+ */
+ function dropRightWhile(array, predicate) {
+ return (array && array.length)
+ ? baseWhile(array, getIteratee(predicate, 3), true, true)
+ : [];
+ }
+
+ /**
+ * Creates a slice of `array` excluding elements dropped from the beginning.
+ * Elements are dropped until `predicate` returns falsey. The predicate is
+ * invoked with three arguments: (value, index, array).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'active': false },
+ * { 'user': 'fred', 'active': false },
+ * { 'user': 'pebbles', 'active': true }
+ * ];
+ *
+ * _.dropWhile(users, function(o) { return !o.active; });
+ * // => objects for ['pebbles']
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.dropWhile(users, { 'user': 'barney', 'active': false });
+ * // => objects for ['fred', 'pebbles']
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.dropWhile(users, ['active', false]);
+ * // => objects for ['pebbles']
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.dropWhile(users, 'active');
+ * // => objects for ['barney', 'fred', 'pebbles']
+ */
+ function dropWhile(array, predicate) {
+ return (array && array.length)
+ ? baseWhile(array, getIteratee(predicate, 3), true)
+ : [];
+ }
+
+ /**
+ * Fills elements of `array` with `value` from `start` up to, but not
+ * including, `end`.
+ *
+ * **Note:** This method mutates `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.2.0
+ * @category Array
+ * @param {Array} array The array to fill.
+ * @param {*} value The value to fill `array` with.
+ * @param {number} [start=0] The start position.
+ * @param {number} [end=array.length] The end position.
+ * @returns {Array} Returns `array`.
+ * @example
+ *
+ * var array = [1, 2, 3];
+ *
+ * _.fill(array, 'a');
+ * console.log(array);
+ * // => ['a', 'a', 'a']
+ *
+ * _.fill(Array(3), 2);
+ * // => [2, 2, 2]
+ *
+ * _.fill([4, 6, 8, 10], '*', 1, 3);
+ * // => [4, '*', '*', 10]
+ */
+ function fill(array, value, start, end) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return [];
+ }
+ if (start && typeof start != 'number' && isIterateeCall(array, value, start)) {
+ start = 0;
+ end = length;
+ }
+ return baseFill(array, value, start, end);
+ }
+
+ /**
+ * This method is like `_.find` except that it returns the index of the first
+ * element `predicate` returns truthy for instead of the element itself.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.1.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @param {number} [fromIndex=0] The index to search from.
+ * @returns {number} Returns the index of the found element, else `-1`.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'active': false },
+ * { 'user': 'fred', 'active': false },
+ * { 'user': 'pebbles', 'active': true }
+ * ];
+ *
+ * _.findIndex(users, function(o) { return o.user == 'barney'; });
+ * // => 0
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.findIndex(users, { 'user': 'fred', 'active': false });
+ * // => 1
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.findIndex(users, ['active', false]);
+ * // => 0
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.findIndex(users, 'active');
+ * // => 2
+ */
+ function findIndex(array, predicate, fromIndex) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return -1;
+ }
+ var index = fromIndex == null ? 0 : toInteger(fromIndex);
+ if (index < 0) {
+ index = nativeMax(length + index, 0);
+ }
+ return baseFindIndex(array, getIteratee(predicate, 3), index);
+ }
+
+ /**
+ * This method is like `_.findIndex` except that it iterates over elements
+ * of `collection` from right to left.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @param {number} [fromIndex=array.length-1] The index to search from.
+ * @returns {number} Returns the index of the found element, else `-1`.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'active': true },
+ * { 'user': 'fred', 'active': false },
+ * { 'user': 'pebbles', 'active': false }
+ * ];
+ *
+ * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; });
+ * // => 2
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.findLastIndex(users, { 'user': 'barney', 'active': true });
+ * // => 0
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.findLastIndex(users, ['active', false]);
+ * // => 2
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.findLastIndex(users, 'active');
+ * // => 0
+ */
+ function findLastIndex(array, predicate, fromIndex) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return -1;
+ }
+ var index = length - 1;
+ if (fromIndex !== undefined) {
+ index = toInteger(fromIndex);
+ index = fromIndex < 0
+ ? nativeMax(length + index, 0)
+ : nativeMin(index, length - 1);
+ }
+ return baseFindIndex(array, getIteratee(predicate, 3), index, true);
+ }
+
+ /**
+ * Flattens `array` a single level deep.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to flatten.
+ * @returns {Array} Returns the new flattened array.
+ * @example
+ *
+ * _.flatten([1, [2, [3, [4]], 5]]);
+ * // => [1, 2, [3, [4]], 5]
+ */
+ function flatten(array) {
+ var length = array == null ? 0 : array.length;
+ return length ? baseFlatten(array, 1) : [];
+ }
+
+ /**
+ * Recursively flattens `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to flatten.
+ * @returns {Array} Returns the new flattened array.
+ * @example
+ *
+ * _.flattenDeep([1, [2, [3, [4]], 5]]);
+ * // => [1, 2, 3, 4, 5]
+ */
+ function flattenDeep(array) {
+ var length = array == null ? 0 : array.length;
+ return length ? baseFlatten(array, INFINITY) : [];
+ }
+
+ /**
+ * Recursively flatten `array` up to `depth` times.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.4.0
+ * @category Array
+ * @param {Array} array The array to flatten.
+ * @param {number} [depth=1] The maximum recursion depth.
+ * @returns {Array} Returns the new flattened array.
+ * @example
+ *
+ * var array = [1, [2, [3, [4]], 5]];
+ *
+ * _.flattenDepth(array, 1);
+ * // => [1, 2, [3, [4]], 5]
+ *
+ * _.flattenDepth(array, 2);
+ * // => [1, 2, 3, [4], 5]
+ */
+ function flattenDepth(array, depth) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return [];
+ }
+ depth = depth === undefined ? 1 : toInteger(depth);
+ return baseFlatten(array, depth);
+ }
+
+ /**
+ * The inverse of `_.toPairs`; this method returns an object composed
+ * from key-value `pairs`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} pairs The key-value pairs.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * _.fromPairs([['a', 1], ['b', 2]]);
+ * // => { 'a': 1, 'b': 2 }
+ */
+ function fromPairs(pairs) {
+ var index = -1,
+ length = pairs == null ? 0 : pairs.length,
+ result = {};
+
+ while (++index < length) {
+ var pair = pairs[index];
+ result[pair[0]] = pair[1];
+ }
+ return result;
+ }
+
+ /**
+ * Gets the first element of `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @alias first
+ * @category Array
+ * @param {Array} array The array to query.
+ * @returns {*} Returns the first element of `array`.
+ * @example
+ *
+ * _.head([1, 2, 3]);
+ * // => 1
+ *
+ * _.head([]);
+ * // => undefined
+ */
+ function head(array) {
+ return (array && array.length) ? array[0] : undefined;
+ }
+
+ /**
+ * Gets the index at which the first occurrence of `value` is found in `array`
+ * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons. If `fromIndex` is negative, it's used as the
+ * offset from the end of `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @param {number} [fromIndex=0] The index to search from.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ * @example
+ *
+ * _.indexOf([1, 2, 1, 2], 2);
+ * // => 1
+ *
+ * // Search from the `fromIndex`.
+ * _.indexOf([1, 2, 1, 2], 2, 2);
+ * // => 3
+ */
+ function indexOf(array, value, fromIndex) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return -1;
+ }
+ var index = fromIndex == null ? 0 : toInteger(fromIndex);
+ if (index < 0) {
+ index = nativeMax(length + index, 0);
+ }
+ return baseIndexOf(array, value, index);
+ }
+
+ /**
+ * Gets all but the last element of `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * _.initial([1, 2, 3]);
+ * // => [1, 2]
+ */
+ function initial(array) {
+ var length = array == null ? 0 : array.length;
+ return length ? baseSlice(array, 0, -1) : [];
+ }
+
+ /**
+ * Creates an array of unique values that are included in all given arrays
+ * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons. The order and references of result values are
+ * determined by the first array.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @returns {Array} Returns the new array of intersecting values.
+ * @example
+ *
+ * _.intersection([2, 1], [2, 3]);
+ * // => [2]
+ */
+ var intersection = baseRest(function(arrays) {
+ var mapped = arrayMap(arrays, castArrayLikeObject);
+ return (mapped.length && mapped[0] === arrays[0])
+ ? baseIntersection(mapped)
+ : [];
+ });
+
+ /**
+ * This method is like `_.intersection` except that it accepts `iteratee`
+ * which is invoked for each element of each `arrays` to generate the criterion
+ * by which they're compared. The order and references of result values are
+ * determined by the first array. The iteratee is invoked with one argument:
+ * (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {Array} Returns the new array of intersecting values.
+ * @example
+ *
+ * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor);
+ * // => [2.1]
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
+ * // => [{ 'x': 1 }]
+ */
+ var intersectionBy = baseRest(function(arrays) {
+ var iteratee = last(arrays),
+ mapped = arrayMap(arrays, castArrayLikeObject);
+
+ if (iteratee === last(mapped)) {
+ iteratee = undefined;
+ } else {
+ mapped.pop();
+ }
+ return (mapped.length && mapped[0] === arrays[0])
+ ? baseIntersection(mapped, getIteratee(iteratee, 2))
+ : [];
+ });
+
+ /**
+ * This method is like `_.intersection` except that it accepts `comparator`
+ * which is invoked to compare elements of `arrays`. The order and references
+ * of result values are determined by the first array. The comparator is
+ * invoked with two arguments: (arrVal, othVal).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new array of intersecting values.
+ * @example
+ *
+ * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
+ * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
+ *
+ * _.intersectionWith(objects, others, _.isEqual);
+ * // => [{ 'x': 1, 'y': 2 }]
+ */
+ var intersectionWith = baseRest(function(arrays) {
+ var comparator = last(arrays),
+ mapped = arrayMap(arrays, castArrayLikeObject);
+
+ comparator = typeof comparator == 'function' ? comparator : undefined;
+ if (comparator) {
+ mapped.pop();
+ }
+ return (mapped.length && mapped[0] === arrays[0])
+ ? baseIntersection(mapped, undefined, comparator)
+ : [];
+ });
+
+ /**
+ * Converts all elements in `array` into a string separated by `separator`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to convert.
+ * @param {string} [separator=','] The element separator.
+ * @returns {string} Returns the joined string.
+ * @example
+ *
+ * _.join(['a', 'b', 'c'], '~');
+ * // => 'a~b~c'
+ */
+ function join(array, separator) {
+ return array == null ? '' : nativeJoin.call(array, separator);
+ }
+
+ /**
+ * Gets the last element of `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @returns {*} Returns the last element of `array`.
+ * @example
+ *
+ * _.last([1, 2, 3]);
+ * // => 3
+ */
+ function last(array) {
+ var length = array == null ? 0 : array.length;
+ return length ? array[length - 1] : undefined;
+ }
+
+ /**
+ * This method is like `_.indexOf` except that it iterates over elements of
+ * `array` from right to left.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @param {number} [fromIndex=array.length-1] The index to search from.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ * @example
+ *
+ * _.lastIndexOf([1, 2, 1, 2], 2);
+ * // => 3
+ *
+ * // Search from the `fromIndex`.
+ * _.lastIndexOf([1, 2, 1, 2], 2, 2);
+ * // => 1
+ */
+ function lastIndexOf(array, value, fromIndex) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return -1;
+ }
+ var index = length;
+ if (fromIndex !== undefined) {
+ index = toInteger(fromIndex);
+ index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1);
+ }
+ return value === value
+ ? strictLastIndexOf(array, value, index)
+ : baseFindIndex(array, baseIsNaN, index, true);
+ }
+
+ /**
+ * Gets the element at index `n` of `array`. If `n` is negative, the nth
+ * element from the end is returned.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.11.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {number} [n=0] The index of the element to return.
+ * @returns {*} Returns the nth element of `array`.
+ * @example
+ *
+ * var array = ['a', 'b', 'c', 'd'];
+ *
+ * _.nth(array, 1);
+ * // => 'b'
+ *
+ * _.nth(array, -2);
+ * // => 'c';
+ */
+ function nth(array, n) {
+ return (array && array.length) ? baseNth(array, toInteger(n)) : undefined;
+ }
+
+ /**
+ * Removes all given values from `array` using
+ * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons.
+ *
+ * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove`
+ * to remove elements from an array by predicate.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Array
+ * @param {Array} array The array to modify.
+ * @param {...*} [values] The values to remove.
+ * @returns {Array} Returns `array`.
+ * @example
+ *
+ * var array = ['a', 'b', 'c', 'a', 'b', 'c'];
+ *
+ * _.pull(array, 'a', 'c');
+ * console.log(array);
+ * // => ['b', 'b']
+ */
+ var pull = baseRest(pullAll);
+
+ /**
+ * This method is like `_.pull` except that it accepts an array of values to remove.
+ *
+ * **Note:** Unlike `_.difference`, this method mutates `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to modify.
+ * @param {Array} values The values to remove.
+ * @returns {Array} Returns `array`.
+ * @example
+ *
+ * var array = ['a', 'b', 'c', 'a', 'b', 'c'];
+ *
+ * _.pullAll(array, ['a', 'c']);
+ * console.log(array);
+ * // => ['b', 'b']
+ */
+ function pullAll(array, values) {
+ return (array && array.length && values && values.length)
+ ? basePullAll(array, values)
+ : array;
+ }
+
+ /**
+ * This method is like `_.pullAll` except that it accepts `iteratee` which is
+ * invoked for each element of `array` and `values` to generate the criterion
+ * by which they're compared. The iteratee is invoked with one argument: (value).
+ *
+ * **Note:** Unlike `_.differenceBy`, this method mutates `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to modify.
+ * @param {Array} values The values to remove.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {Array} Returns `array`.
+ * @example
+ *
+ * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }];
+ *
+ * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x');
+ * console.log(array);
+ * // => [{ 'x': 2 }]
+ */
+ function pullAllBy(array, values, iteratee) {
+ return (array && array.length && values && values.length)
+ ? basePullAll(array, values, getIteratee(iteratee, 2))
+ : array;
+ }
+
+ /**
+ * This method is like `_.pullAll` except that it accepts `comparator` which
+ * is invoked to compare elements of `array` to `values`. The comparator is
+ * invoked with two arguments: (arrVal, othVal).
+ *
+ * **Note:** Unlike `_.differenceWith`, this method mutates `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.6.0
+ * @category Array
+ * @param {Array} array The array to modify.
+ * @param {Array} values The values to remove.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns `array`.
+ * @example
+ *
+ * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }];
+ *
+ * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual);
+ * console.log(array);
+ * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }]
+ */
+ function pullAllWith(array, values, comparator) {
+ return (array && array.length && values && values.length)
+ ? basePullAll(array, values, undefined, comparator)
+ : array;
+ }
+
+ /**
+ * Removes elements from `array` corresponding to `indexes` and returns an
+ * array of removed elements.
+ *
+ * **Note:** Unlike `_.at`, this method mutates `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to modify.
+ * @param {...(number|number[])} [indexes] The indexes of elements to remove.
+ * @returns {Array} Returns the new array of removed elements.
+ * @example
+ *
+ * var array = ['a', 'b', 'c', 'd'];
+ * var pulled = _.pullAt(array, [1, 3]);
+ *
+ * console.log(array);
+ * // => ['a', 'c']
+ *
+ * console.log(pulled);
+ * // => ['b', 'd']
+ */
+ var pullAt = flatRest(function(array, indexes) {
+ var length = array == null ? 0 : array.length,
+ result = baseAt(array, indexes);
+
+ basePullAt(array, arrayMap(indexes, function(index) {
+ return isIndex(index, length) ? +index : index;
+ }).sort(compareAscending));
+
+ return result;
+ });
+
+ /**
+ * Removes all elements from `array` that `predicate` returns truthy for
+ * and returns an array of the removed elements. The predicate is invoked
+ * with three arguments: (value, index, array).
+ *
+ * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull`
+ * to pull elements from an array by value.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Array
+ * @param {Array} array The array to modify.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the new array of removed elements.
+ * @example
+ *
+ * var array = [1, 2, 3, 4];
+ * var evens = _.remove(array, function(n) {
+ * return n % 2 == 0;
+ * });
+ *
+ * console.log(array);
+ * // => [1, 3]
+ *
+ * console.log(evens);
+ * // => [2, 4]
+ */
+ function remove(array, predicate) {
+ var result = [];
+ if (!(array && array.length)) {
+ return result;
+ }
+ var index = -1,
+ indexes = [],
+ length = array.length;
+
+ predicate = getIteratee(predicate, 3);
+ while (++index < length) {
+ var value = array[index];
+ if (predicate(value, index, array)) {
+ result.push(value);
+ indexes.push(index);
+ }
+ }
+ basePullAt(array, indexes);
+ return result;
+ }
+
+ /**
+ * Reverses `array` so that the first element becomes the last, the second
+ * element becomes the second to last, and so on.
+ *
+ * **Note:** This method mutates `array` and is based on
+ * [`Array#reverse`](https://mdn.io/Array/reverse).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to modify.
+ * @returns {Array} Returns `array`.
+ * @example
+ *
+ * var array = [1, 2, 3];
+ *
+ * _.reverse(array);
+ * // => [3, 2, 1]
+ *
+ * console.log(array);
+ * // => [3, 2, 1]
+ */
+ function reverse(array) {
+ return array == null ? array : nativeReverse.call(array);
+ }
+
+ /**
+ * Creates a slice of `array` from `start` up to, but not including, `end`.
+ *
+ * **Note:** This method is used instead of
+ * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are
+ * returned.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to slice.
+ * @param {number} [start=0] The start position.
+ * @param {number} [end=array.length] The end position.
+ * @returns {Array} Returns the slice of `array`.
+ */
+ function slice(array, start, end) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return [];
+ }
+ if (end && typeof end != 'number' && isIterateeCall(array, start, end)) {
+ start = 0;
+ end = length;
+ }
+ else {
+ start = start == null ? 0 : toInteger(start);
+ end = end === undefined ? length : toInteger(end);
+ }
+ return baseSlice(array, start, end);
+ }
+
+ /**
+ * Uses a binary search to determine the lowest index at which `value`
+ * should be inserted into `array` in order to maintain its sort order.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The sorted array to inspect.
+ * @param {*} value The value to evaluate.
+ * @returns {number} Returns the index at which `value` should be inserted
+ * into `array`.
+ * @example
+ *
+ * _.sortedIndex([30, 50], 40);
+ * // => 1
+ */
+ function sortedIndex(array, value) {
+ return baseSortedIndex(array, value);
+ }
+
+ /**
+ * This method is like `_.sortedIndex` except that it accepts `iteratee`
+ * which is invoked for `value` and each element of `array` to compute their
+ * sort ranking. The iteratee is invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The sorted array to inspect.
+ * @param {*} value The value to evaluate.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {number} Returns the index at which `value` should be inserted
+ * into `array`.
+ * @example
+ *
+ * var objects = [{ 'x': 4 }, { 'x': 5 }];
+ *
+ * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });
+ * // => 0
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.sortedIndexBy(objects, { 'x': 4 }, 'x');
+ * // => 0
+ */
+ function sortedIndexBy(array, value, iteratee) {
+ return baseSortedIndexBy(array, value, getIteratee(iteratee, 2));
+ }
+
+ /**
+ * This method is like `_.indexOf` except that it performs a binary
+ * search on a sorted `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ * @example
+ *
+ * _.sortedIndexOf([4, 5, 5, 5, 6], 5);
+ * // => 1
+ */
+ function sortedIndexOf(array, value) {
+ var length = array == null ? 0 : array.length;
+ if (length) {
+ var index = baseSortedIndex(array, value);
+ if (index < length && eq(array[index], value)) {
+ return index;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * This method is like `_.sortedIndex` except that it returns the highest
+ * index at which `value` should be inserted into `array` in order to
+ * maintain its sort order.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The sorted array to inspect.
+ * @param {*} value The value to evaluate.
+ * @returns {number} Returns the index at which `value` should be inserted
+ * into `array`.
+ * @example
+ *
+ * _.sortedLastIndex([4, 5, 5, 5, 6], 5);
+ * // => 4
+ */
+ function sortedLastIndex(array, value) {
+ return baseSortedIndex(array, value, true);
+ }
+
+ /**
+ * This method is like `_.sortedLastIndex` except that it accepts `iteratee`
+ * which is invoked for `value` and each element of `array` to compute their
+ * sort ranking. The iteratee is invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The sorted array to inspect.
+ * @param {*} value The value to evaluate.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {number} Returns the index at which `value` should be inserted
+ * into `array`.
+ * @example
+ *
+ * var objects = [{ 'x': 4 }, { 'x': 5 }];
+ *
+ * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });
+ * // => 1
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x');
+ * // => 1
+ */
+ function sortedLastIndexBy(array, value, iteratee) {
+ return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true);
+ }
+
+ /**
+ * This method is like `_.lastIndexOf` except that it performs a binary
+ * search on a sorted `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {*} value The value to search for.
+ * @returns {number} Returns the index of the matched value, else `-1`.
+ * @example
+ *
+ * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5);
+ * // => 3
+ */
+ function sortedLastIndexOf(array, value) {
+ var length = array == null ? 0 : array.length;
+ if (length) {
+ var index = baseSortedIndex(array, value, true) - 1;
+ if (eq(array[index], value)) {
+ return index;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * This method is like `_.uniq` except that it's designed and optimized
+ * for sorted arrays.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @returns {Array} Returns the new duplicate free array.
+ * @example
+ *
+ * _.sortedUniq([1, 1, 2]);
+ * // => [1, 2]
+ */
+ function sortedUniq(array) {
+ return (array && array.length)
+ ? baseSortedUniq(array)
+ : [];
+ }
+
+ /**
+ * This method is like `_.uniqBy` except that it's designed and optimized
+ * for sorted arrays.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {Function} [iteratee] The iteratee invoked per element.
+ * @returns {Array} Returns the new duplicate free array.
+ * @example
+ *
+ * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor);
+ * // => [1.1, 2.3]
+ */
+ function sortedUniqBy(array, iteratee) {
+ return (array && array.length)
+ ? baseSortedUniq(array, getIteratee(iteratee, 2))
+ : [];
+ }
+
+ /**
+ * Gets all but the first element of `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * _.tail([1, 2, 3]);
+ * // => [2, 3]
+ */
+ function tail(array) {
+ var length = array == null ? 0 : array.length;
+ return length ? baseSlice(array, 1, length) : [];
+ }
+
+ /**
+ * Creates a slice of `array` with `n` elements taken from the beginning.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {number} [n=1] The number of elements to take.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * _.take([1, 2, 3]);
+ * // => [1]
+ *
+ * _.take([1, 2, 3], 2);
+ * // => [1, 2]
+ *
+ * _.take([1, 2, 3], 5);
+ * // => [1, 2, 3]
+ *
+ * _.take([1, 2, 3], 0);
+ * // => []
+ */
+ function take(array, n, guard) {
+ if (!(array && array.length)) {
+ return [];
+ }
+ n = (guard || n === undefined) ? 1 : toInteger(n);
+ return baseSlice(array, 0, n < 0 ? 0 : n);
+ }
+
+ /**
+ * Creates a slice of `array` with `n` elements taken from the end.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {number} [n=1] The number of elements to take.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * _.takeRight([1, 2, 3]);
+ * // => [3]
+ *
+ * _.takeRight([1, 2, 3], 2);
+ * // => [2, 3]
+ *
+ * _.takeRight([1, 2, 3], 5);
+ * // => [1, 2, 3]
+ *
+ * _.takeRight([1, 2, 3], 0);
+ * // => []
+ */
+ function takeRight(array, n, guard) {
+ var length = array == null ? 0 : array.length;
+ if (!length) {
+ return [];
+ }
+ n = (guard || n === undefined) ? 1 : toInteger(n);
+ n = length - n;
+ return baseSlice(array, n < 0 ? 0 : n, length);
+ }
+
+ /**
+ * Creates a slice of `array` with elements taken from the end. Elements are
+ * taken until `predicate` returns falsey. The predicate is invoked with
+ * three arguments: (value, index, array).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'active': true },
+ * { 'user': 'fred', 'active': false },
+ * { 'user': 'pebbles', 'active': false }
+ * ];
+ *
+ * _.takeRightWhile(users, function(o) { return !o.active; });
+ * // => objects for ['fred', 'pebbles']
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false });
+ * // => objects for ['pebbles']
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.takeRightWhile(users, ['active', false]);
+ * // => objects for ['fred', 'pebbles']
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.takeRightWhile(users, 'active');
+ * // => []
+ */
+ function takeRightWhile(array, predicate) {
+ return (array && array.length)
+ ? baseWhile(array, getIteratee(predicate, 3), false, true)
+ : [];
+ }
+
+ /**
+ * Creates a slice of `array` with elements taken from the beginning. Elements
+ * are taken until `predicate` returns falsey. The predicate is invoked with
+ * three arguments: (value, index, array).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Array
+ * @param {Array} array The array to query.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the slice of `array`.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'active': false },
+ * { 'user': 'fred', 'active': false },
+ * { 'user': 'pebbles', 'active': true }
+ * ];
+ *
+ * _.takeWhile(users, function(o) { return !o.active; });
+ * // => objects for ['barney', 'fred']
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.takeWhile(users, { 'user': 'barney', 'active': false });
+ * // => objects for ['barney']
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.takeWhile(users, ['active', false]);
+ * // => objects for ['barney', 'fred']
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.takeWhile(users, 'active');
+ * // => []
+ */
+ function takeWhile(array, predicate) {
+ return (array && array.length)
+ ? baseWhile(array, getIteratee(predicate, 3))
+ : [];
+ }
+
+ /**
+ * Creates an array of unique values, in order, from all given arrays using
+ * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @returns {Array} Returns the new array of combined values.
+ * @example
+ *
+ * _.union([2], [1, 2]);
+ * // => [2, 1]
+ */
+ var union = baseRest(function(arrays) {
+ return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true));
+ });
+
+ /**
+ * This method is like `_.union` except that it accepts `iteratee` which is
+ * invoked for each element of each `arrays` to generate the criterion by
+ * which uniqueness is computed. Result values are chosen from the first
+ * array in which the value occurs. The iteratee is invoked with one argument:
+ * (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {Array} Returns the new array of combined values.
+ * @example
+ *
+ * _.unionBy([2.1], [1.2, 2.3], Math.floor);
+ * // => [2.1, 1.2]
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
+ * // => [{ 'x': 1 }, { 'x': 2 }]
+ */
+ var unionBy = baseRest(function(arrays) {
+ var iteratee = last(arrays);
+ if (isArrayLikeObject(iteratee)) {
+ iteratee = undefined;
+ }
+ return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2));
+ });
+
+ /**
+ * This method is like `_.union` except that it accepts `comparator` which
+ * is invoked to compare elements of `arrays`. Result values are chosen from
+ * the first array in which the value occurs. The comparator is invoked
+ * with two arguments: (arrVal, othVal).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new array of combined values.
+ * @example
+ *
+ * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
+ * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
+ *
+ * _.unionWith(objects, others, _.isEqual);
+ * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]
+ */
+ var unionWith = baseRest(function(arrays) {
+ var comparator = last(arrays);
+ comparator = typeof comparator == 'function' ? comparator : undefined;
+ return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator);
+ });
+
+ /**
+ * Creates a duplicate-free version of an array, using
+ * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons, in which only the first occurrence of each element
+ * is kept. The order of result values is determined by the order they occur
+ * in the array.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @returns {Array} Returns the new duplicate free array.
+ * @example
+ *
+ * _.uniq([2, 1, 2]);
+ * // => [2, 1]
+ */
+ function uniq(array) {
+ return (array && array.length) ? baseUniq(array) : [];
+ }
+
+ /**
+ * This method is like `_.uniq` except that it accepts `iteratee` which is
+ * invoked for each element in `array` to generate the criterion by which
+ * uniqueness is computed. The order of result values is determined by the
+ * order they occur in the array. The iteratee is invoked with one argument:
+ * (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {Array} Returns the new duplicate free array.
+ * @example
+ *
+ * _.uniqBy([2.1, 1.2, 2.3], Math.floor);
+ * // => [2.1, 1.2]
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x');
+ * // => [{ 'x': 1 }, { 'x': 2 }]
+ */
+ function uniqBy(array, iteratee) {
+ return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : [];
+ }
+
+ /**
+ * This method is like `_.uniq` except that it accepts `comparator` which
+ * is invoked to compare elements of `array`. The order of result values is
+ * determined by the order they occur in the array.The comparator is invoked
+ * with two arguments: (arrVal, othVal).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new duplicate free array.
+ * @example
+ *
+ * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }];
+ *
+ * _.uniqWith(objects, _.isEqual);
+ * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]
+ */
+ function uniqWith(array, comparator) {
+ comparator = typeof comparator == 'function' ? comparator : undefined;
+ return (array && array.length) ? baseUniq(array, undefined, comparator) : [];
+ }
+
+ /**
+ * This method is like `_.zip` except that it accepts an array of grouped
+ * elements and creates an array regrouping the elements to their pre-zip
+ * configuration.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.2.0
+ * @category Array
+ * @param {Array} array The array of grouped elements to process.
+ * @returns {Array} Returns the new array of regrouped elements.
+ * @example
+ *
+ * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]);
+ * // => [['a', 1, true], ['b', 2, false]]
+ *
+ * _.unzip(zipped);
+ * // => [['a', 'b'], [1, 2], [true, false]]
+ */
+ function unzip(array) {
+ if (!(array && array.length)) {
+ return [];
+ }
+ var length = 0;
+ array = arrayFilter(array, function(group) {
+ if (isArrayLikeObject(group)) {
+ length = nativeMax(group.length, length);
+ return true;
+ }
+ });
+ return baseTimes(length, function(index) {
+ return arrayMap(array, baseProperty(index));
+ });
+ }
+
+ /**
+ * This method is like `_.unzip` except that it accepts `iteratee` to specify
+ * how regrouped values should be combined. The iteratee is invoked with the
+ * elements of each group: (...group).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.8.0
+ * @category Array
+ * @param {Array} array The array of grouped elements to process.
+ * @param {Function} [iteratee=_.identity] The function to combine
+ * regrouped values.
+ * @returns {Array} Returns the new array of regrouped elements.
+ * @example
+ *
+ * var zipped = _.zip([1, 2], [10, 20], [100, 200]);
+ * // => [[1, 10, 100], [2, 20, 200]]
+ *
+ * _.unzipWith(zipped, _.add);
+ * // => [3, 30, 300]
+ */
+ function unzipWith(array, iteratee) {
+ if (!(array && array.length)) {
+ return [];
+ }
+ var result = unzip(array);
+ if (iteratee == null) {
+ return result;
+ }
+ return arrayMap(result, function(group) {
+ return apply(iteratee, undefined, group);
+ });
+ }
+
+ /**
+ * Creates an array excluding all given values using
+ * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * for equality comparisons.
+ *
+ * **Note:** Unlike `_.pull`, this method returns a new array.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {Array} array The array to inspect.
+ * @param {...*} [values] The values to exclude.
+ * @returns {Array} Returns the new array of filtered values.
+ * @see _.difference, _.xor
+ * @example
+ *
+ * _.without([2, 1, 2, 3], 1, 2);
+ * // => [3]
+ */
+ var without = baseRest(function(array, values) {
+ return isArrayLikeObject(array)
+ ? baseDifference(array, values)
+ : [];
+ });
+
+ /**
+ * Creates an array of unique values that is the
+ * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference)
+ * of the given arrays. The order of result values is determined by the order
+ * they occur in the arrays.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.4.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @returns {Array} Returns the new array of filtered values.
+ * @see _.difference, _.without
+ * @example
+ *
+ * _.xor([2, 1], [2, 3]);
+ * // => [1, 3]
+ */
+ var xor = baseRest(function(arrays) {
+ return baseXor(arrayFilter(arrays, isArrayLikeObject));
+ });
+
+ /**
+ * This method is like `_.xor` except that it accepts `iteratee` which is
+ * invoked for each element of each `arrays` to generate the criterion by
+ * which by which they're compared. The order of result values is determined
+ * by the order they occur in the arrays. The iteratee is invoked with one
+ * argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {Array} Returns the new array of filtered values.
+ * @example
+ *
+ * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor);
+ * // => [1.2, 3.4]
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');
+ * // => [{ 'x': 2 }]
+ */
+ var xorBy = baseRest(function(arrays) {
+ var iteratee = last(arrays);
+ if (isArrayLikeObject(iteratee)) {
+ iteratee = undefined;
+ }
+ return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2));
+ });
+
+ /**
+ * This method is like `_.xor` except that it accepts `comparator` which is
+ * invoked to compare elements of `arrays`. The order of result values is
+ * determined by the order they occur in the arrays. The comparator is invoked
+ * with two arguments: (arrVal, othVal).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to inspect.
+ * @param {Function} [comparator] The comparator invoked per element.
+ * @returns {Array} Returns the new array of filtered values.
+ * @example
+ *
+ * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];
+ * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];
+ *
+ * _.xorWith(objects, others, _.isEqual);
+ * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]
+ */
+ var xorWith = baseRest(function(arrays) {
+ var comparator = last(arrays);
+ comparator = typeof comparator == 'function' ? comparator : undefined;
+ return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator);
+ });
+
+ /**
+ * Creates an array of grouped elements, the first of which contains the
+ * first elements of the given arrays, the second of which contains the
+ * second elements of the given arrays, and so on.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to process.
+ * @returns {Array} Returns the new array of grouped elements.
+ * @example
+ *
+ * _.zip(['a', 'b'], [1, 2], [true, false]);
+ * // => [['a', 1, true], ['b', 2, false]]
+ */
+ var zip = baseRest(unzip);
+
+ /**
+ * This method is like `_.fromPairs` except that it accepts two arrays,
+ * one of property identifiers and one of corresponding values.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.4.0
+ * @category Array
+ * @param {Array} [props=[]] The property identifiers.
+ * @param {Array} [values=[]] The property values.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * _.zipObject(['a', 'b'], [1, 2]);
+ * // => { 'a': 1, 'b': 2 }
+ */
+ function zipObject(props, values) {
+ return baseZipObject(props || [], values || [], assignValue);
+ }
+
+ /**
+ * This method is like `_.zipObject` except that it supports property paths.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.1.0
+ * @category Array
+ * @param {Array} [props=[]] The property identifiers.
+ * @param {Array} [values=[]] The property values.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]);
+ * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } }
+ */
+ function zipObjectDeep(props, values) {
+ return baseZipObject(props || [], values || [], baseSet);
+ }
+
+ /**
+ * This method is like `_.zip` except that it accepts `iteratee` to specify
+ * how grouped values should be combined. The iteratee is invoked with the
+ * elements of each group: (...group).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.8.0
+ * @category Array
+ * @param {...Array} [arrays] The arrays to process.
+ * @param {Function} [iteratee=_.identity] The function to combine
+ * grouped values.
+ * @returns {Array} Returns the new array of grouped elements.
+ * @example
+ *
+ * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) {
+ * return a + b + c;
+ * });
+ * // => [111, 222]
+ */
+ var zipWith = baseRest(function(arrays) {
+ var length = arrays.length,
+ iteratee = length > 1 ? arrays[length - 1] : undefined;
+
+ iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined;
+ return unzipWith(arrays, iteratee);
+ });
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates a `lodash` wrapper instance that wraps `value` with explicit method
+ * chain sequences enabled. The result of such sequences must be unwrapped
+ * with `_#value`.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.3.0
+ * @category Seq
+ * @param {*} value The value to wrap.
+ * @returns {Object} Returns the new `lodash` wrapper instance.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36 },
+ * { 'user': 'fred', 'age': 40 },
+ * { 'user': 'pebbles', 'age': 1 }
+ * ];
+ *
+ * var youngest = _
+ * .chain(users)
+ * .sortBy('age')
+ * .map(function(o) {
+ * return o.user + ' is ' + o.age;
+ * })
+ * .head()
+ * .value();
+ * // => 'pebbles is 1'
+ */
+ function chain(value) {
+ var result = lodash(value);
+ result.__chain__ = true;
+ return result;
+ }
+
+ /**
+ * This method invokes `interceptor` and returns `value`. The interceptor
+ * is invoked with one argument; (value). The purpose of this method is to
+ * "tap into" a method chain sequence in order to modify intermediate results.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Seq
+ * @param {*} value The value to provide to `interceptor`.
+ * @param {Function} interceptor The function to invoke.
+ * @returns {*} Returns `value`.
+ * @example
+ *
+ * _([1, 2, 3])
+ * .tap(function(array) {
+ * // Mutate input array.
+ * array.pop();
+ * })
+ * .reverse()
+ * .value();
+ * // => [2, 1]
+ */
+ function tap(value, interceptor) {
+ interceptor(value);
+ return value;
+ }
+
+ /**
+ * This method is like `_.tap` except that it returns the result of `interceptor`.
+ * The purpose of this method is to "pass thru" values replacing intermediate
+ * results in a method chain sequence.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Seq
+ * @param {*} value The value to provide to `interceptor`.
+ * @param {Function} interceptor The function to invoke.
+ * @returns {*} Returns the result of `interceptor`.
+ * @example
+ *
+ * _(' abc ')
+ * .chain()
+ * .trim()
+ * .thru(function(value) {
+ * return [value];
+ * })
+ * .value();
+ * // => ['abc']
+ */
+ function thru(value, interceptor) {
+ return interceptor(value);
+ }
+
+ /**
+ * This method is the wrapper version of `_.at`.
+ *
+ * @name at
+ * @memberOf _
+ * @since 1.0.0
+ * @category Seq
+ * @param {...(string|string[])} [paths] The property paths to pick.
+ * @returns {Object} Returns the new `lodash` wrapper instance.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };
+ *
+ * _(object).at(['a[0].b.c', 'a[1]']).value();
+ * // => [3, 4]
+ */
+ var wrapperAt = flatRest(function(paths) {
+ var length = paths.length,
+ start = length ? paths[0] : 0,
+ value = this.__wrapped__,
+ interceptor = function(object) { return baseAt(object, paths); };
+
+ if (length > 1 || this.__actions__.length ||
+ !(value instanceof LazyWrapper) || !isIndex(start)) {
+ return this.thru(interceptor);
+ }
+ value = value.slice(start, +start + (length ? 1 : 0));
+ value.__actions__.push({
+ 'func': thru,
+ 'args': [interceptor],
+ 'thisArg': undefined
+ });
+ return new LodashWrapper(value, this.__chain__).thru(function(array) {
+ if (length && !array.length) {
+ array.push(undefined);
+ }
+ return array;
+ });
+ });
+
+ /**
+ * Creates a `lodash` wrapper instance with explicit method chain sequences enabled.
+ *
+ * @name chain
+ * @memberOf _
+ * @since 0.1.0
+ * @category Seq
+ * @returns {Object} Returns the new `lodash` wrapper instance.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36 },
+ * { 'user': 'fred', 'age': 40 }
+ * ];
+ *
+ * // A sequence without explicit chaining.
+ * _(users).head();
+ * // => { 'user': 'barney', 'age': 36 }
+ *
+ * // A sequence with explicit chaining.
+ * _(users)
+ * .chain()
+ * .head()
+ * .pick('user')
+ * .value();
+ * // => { 'user': 'barney' }
+ */
+ function wrapperChain() {
+ return chain(this);
+ }
+
+ /**
+ * Executes the chain sequence and returns the wrapped result.
+ *
+ * @name commit
+ * @memberOf _
+ * @since 3.2.0
+ * @category Seq
+ * @returns {Object} Returns the new `lodash` wrapper instance.
+ * @example
+ *
+ * var array = [1, 2];
+ * var wrapped = _(array).push(3);
+ *
+ * console.log(array);
+ * // => [1, 2]
+ *
+ * wrapped = wrapped.commit();
+ * console.log(array);
+ * // => [1, 2, 3]
+ *
+ * wrapped.last();
+ * // => 3
+ *
+ * console.log(array);
+ * // => [1, 2, 3]
+ */
+ function wrapperCommit() {
+ return new LodashWrapper(this.value(), this.__chain__);
+ }
+
+ /**
+ * Gets the next value on a wrapped object following the
+ * [iterator protocol](https://mdn.io/iteration_protocols#iterator).
+ *
+ * @name next
+ * @memberOf _
+ * @since 4.0.0
+ * @category Seq
+ * @returns {Object} Returns the next iterator value.
+ * @example
+ *
+ * var wrapped = _([1, 2]);
+ *
+ * wrapped.next();
+ * // => { 'done': false, 'value': 1 }
+ *
+ * wrapped.next();
+ * // => { 'done': false, 'value': 2 }
+ *
+ * wrapped.next();
+ * // => { 'done': true, 'value': undefined }
+ */
+ function wrapperNext() {
+ if (this.__values__ === undefined) {
+ this.__values__ = toArray(this.value());
+ }
+ var done = this.__index__ >= this.__values__.length,
+ value = done ? undefined : this.__values__[this.__index__++];
+
+ return { 'done': done, 'value': value };
+ }
+
+ /**
+ * Enables the wrapper to be iterable.
+ *
+ * @name Symbol.iterator
+ * @memberOf _
+ * @since 4.0.0
+ * @category Seq
+ * @returns {Object} Returns the wrapper object.
+ * @example
+ *
+ * var wrapped = _([1, 2]);
+ *
+ * wrapped[Symbol.iterator]() === wrapped;
+ * // => true
+ *
+ * Array.from(wrapped);
+ * // => [1, 2]
+ */
+ function wrapperToIterator() {
+ return this;
+ }
+
+ /**
+ * Creates a clone of the chain sequence planting `value` as the wrapped value.
+ *
+ * @name plant
+ * @memberOf _
+ * @since 3.2.0
+ * @category Seq
+ * @param {*} value The value to plant.
+ * @returns {Object} Returns the new `lodash` wrapper instance.
+ * @example
+ *
+ * function square(n) {
+ * return n * n;
+ * }
+ *
+ * var wrapped = _([1, 2]).map(square);
+ * var other = wrapped.plant([3, 4]);
+ *
+ * other.value();
+ * // => [9, 16]
+ *
+ * wrapped.value();
+ * // => [1, 4]
+ */
+ function wrapperPlant(value) {
+ var result,
+ parent = this;
+
+ while (parent instanceof baseLodash) {
+ var clone = wrapperClone(parent);
+ clone.__index__ = 0;
+ clone.__values__ = undefined;
+ if (result) {
+ previous.__wrapped__ = clone;
+ } else {
+ result = clone;
+ }
+ var previous = clone;
+ parent = parent.__wrapped__;
+ }
+ previous.__wrapped__ = value;
+ return result;
+ }
+
+ /**
+ * This method is the wrapper version of `_.reverse`.
+ *
+ * **Note:** This method mutates the wrapped array.
+ *
+ * @name reverse
+ * @memberOf _
+ * @since 0.1.0
+ * @category Seq
+ * @returns {Object} Returns the new `lodash` wrapper instance.
+ * @example
+ *
+ * var array = [1, 2, 3];
+ *
+ * _(array).reverse().value()
+ * // => [3, 2, 1]
+ *
+ * console.log(array);
+ * // => [3, 2, 1]
+ */
+ function wrapperReverse() {
+ var value = this.__wrapped__;
+ if (value instanceof LazyWrapper) {
+ var wrapped = value;
+ if (this.__actions__.length) {
+ wrapped = new LazyWrapper(this);
+ }
+ wrapped = wrapped.reverse();
+ wrapped.__actions__.push({
+ 'func': thru,
+ 'args': [reverse],
+ 'thisArg': undefined
+ });
+ return new LodashWrapper(wrapped, this.__chain__);
+ }
+ return this.thru(reverse);
+ }
+
+ /**
+ * Executes the chain sequence to resolve the unwrapped value.
+ *
+ * @name value
+ * @memberOf _
+ * @since 0.1.0
+ * @alias toJSON, valueOf
+ * @category Seq
+ * @returns {*} Returns the resolved unwrapped value.
+ * @example
+ *
+ * _([1, 2, 3]).value();
+ * // => [1, 2, 3]
+ */
+ function wrapperValue() {
+ return baseWrapperValue(this.__wrapped__, this.__actions__);
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Creates an object composed of keys generated from the results of running
+ * each element of `collection` thru `iteratee`. The corresponding value of
+ * each key is the number of times the key was returned by `iteratee`. The
+ * iteratee is invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.5.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The iteratee to transform keys.
+ * @returns {Object} Returns the composed aggregate object.
+ * @example
+ *
+ * _.countBy([6.1, 4.2, 6.3], Math.floor);
+ * // => { '4': 1, '6': 2 }
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.countBy(['one', 'two', 'three'], 'length');
+ * // => { '3': 2, '5': 1 }
+ */
+ var countBy = createAggregator(function(result, value, key) {
+ if (hasOwnProperty.call(result, key)) {
+ ++result[key];
+ } else {
+ baseAssignValue(result, key, 1);
+ }
+ });
+
+ /**
+ * Checks if `predicate` returns truthy for **all** elements of `collection`.
+ * Iteration is stopped once `predicate` returns falsey. The predicate is
+ * invoked with three arguments: (value, index|key, collection).
+ *
+ * **Note:** This method returns `true` for
+ * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because
+ * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of
+ * elements of empty collections.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {boolean} Returns `true` if all elements pass the predicate check,
+ * else `false`.
+ * @example
+ *
+ * _.every([true, 1, null, 'yes'], Boolean);
+ * // => false
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36, 'active': false },
+ * { 'user': 'fred', 'age': 40, 'active': false }
+ * ];
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.every(users, { 'user': 'barney', 'active': false });
+ * // => false
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.every(users, ['active', false]);
+ * // => true
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.every(users, 'active');
+ * // => false
+ */
+ function every(collection, predicate, guard) {
+ var func = isArray(collection) ? arrayEvery : baseEvery;
+ if (guard && isIterateeCall(collection, predicate, guard)) {
+ predicate = undefined;
+ }
+ return func(collection, getIteratee(predicate, 3));
+ }
+
+ /**
+ * Iterates over elements of `collection`, returning an array of all elements
+ * `predicate` returns truthy for. The predicate is invoked with three
+ * arguments: (value, index|key, collection).
+ *
+ * **Note:** Unlike `_.remove`, this method returns a new array.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the new filtered array.
+ * @see _.reject
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36, 'active': true },
+ * { 'user': 'fred', 'age': 40, 'active': false }
+ * ];
+ *
+ * _.filter(users, function(o) { return !o.active; });
+ * // => objects for ['fred']
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.filter(users, { 'age': 36, 'active': true });
+ * // => objects for ['barney']
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.filter(users, ['active', false]);
+ * // => objects for ['fred']
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.filter(users, 'active');
+ * // => objects for ['barney']
+ */
+ function filter(collection, predicate) {
+ var func = isArray(collection) ? arrayFilter : baseFilter;
+ return func(collection, getIteratee(predicate, 3));
+ }
+
+ /**
+ * Iterates over elements of `collection`, returning the first element
+ * `predicate` returns truthy for. The predicate is invoked with three
+ * arguments: (value, index|key, collection).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to inspect.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @param {number} [fromIndex=0] The index to search from.
+ * @returns {*} Returns the matched element, else `undefined`.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36, 'active': true },
+ * { 'user': 'fred', 'age': 40, 'active': false },
+ * { 'user': 'pebbles', 'age': 1, 'active': true }
+ * ];
+ *
+ * _.find(users, function(o) { return o.age < 40; });
+ * // => object for 'barney'
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.find(users, { 'age': 1, 'active': true });
+ * // => object for 'pebbles'
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.find(users, ['active', false]);
+ * // => object for 'fred'
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.find(users, 'active');
+ * // => object for 'barney'
+ */
+ var find = createFind(findIndex);
+
+ /**
+ * This method is like `_.find` except that it iterates over elements of
+ * `collection` from right to left.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to inspect.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @param {number} [fromIndex=collection.length-1] The index to search from.
+ * @returns {*} Returns the matched element, else `undefined`.
+ * @example
+ *
+ * _.findLast([1, 2, 3, 4], function(n) {
+ * return n % 2 == 1;
+ * });
+ * // => 3
+ */
+ var findLast = createFind(findLastIndex);
+
+ /**
+ * Creates a flattened array of values by running each element in `collection`
+ * thru `iteratee` and flattening the mapped results. The iteratee is invoked
+ * with three arguments: (value, index|key, collection).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the new flattened array.
+ * @example
+ *
+ * function duplicate(n) {
+ * return [n, n];
+ * }
+ *
+ * _.flatMap([1, 2], duplicate);
+ * // => [1, 1, 2, 2]
+ */
+ function flatMap(collection, iteratee) {
+ return baseFlatten(map(collection, iteratee), 1);
+ }
+
+ /**
+ * This method is like `_.flatMap` except that it recursively flattens the
+ * mapped results.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.7.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the new flattened array.
+ * @example
+ *
+ * function duplicate(n) {
+ * return [[[n, n]]];
+ * }
+ *
+ * _.flatMapDeep([1, 2], duplicate);
+ * // => [1, 1, 2, 2]
+ */
+ function flatMapDeep(collection, iteratee) {
+ return baseFlatten(map(collection, iteratee), INFINITY);
+ }
+
+ /**
+ * This method is like `_.flatMap` except that it recursively flattens the
+ * mapped results up to `depth` times.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.7.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @param {number} [depth=1] The maximum recursion depth.
+ * @returns {Array} Returns the new flattened array.
+ * @example
+ *
+ * function duplicate(n) {
+ * return [[[n, n]]];
+ * }
+ *
+ * _.flatMapDepth([1, 2], duplicate, 2);
+ * // => [[1, 1], [2, 2]]
+ */
+ function flatMapDepth(collection, iteratee, depth) {
+ depth = depth === undefined ? 1 : toInteger(depth);
+ return baseFlatten(map(collection, iteratee), depth);
+ }
+
+ /**
+ * Iterates over elements of `collection` and invokes `iteratee` for each element.
+ * The iteratee is invoked with three arguments: (value, index|key, collection).
+ * Iteratee functions may exit iteration early by explicitly returning `false`.
+ *
+ * **Note:** As with other "Collections" methods, objects with a "length"
+ * property are iterated like arrays. To avoid this behavior use `_.forIn`
+ * or `_.forOwn` for object iteration.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @alias each
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Array|Object} Returns `collection`.
+ * @see _.forEachRight
+ * @example
+ *
+ * _.forEach([1, 2], function(value) {
+ * console.log(value);
+ * });
+ * // => Logs `1` then `2`.
+ *
+ * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) {
+ * console.log(key);
+ * });
+ * // => Logs 'a' then 'b' (iteration order is not guaranteed).
+ */
+ function forEach(collection, iteratee) {
+ var func = isArray(collection) ? arrayEach : baseEach;
+ return func(collection, getIteratee(iteratee, 3));
+ }
+
+ /**
+ * This method is like `_.forEach` except that it iterates over elements of
+ * `collection` from right to left.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @alias eachRight
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Array|Object} Returns `collection`.
+ * @see _.forEach
+ * @example
+ *
+ * _.forEachRight([1, 2], function(value) {
+ * console.log(value);
+ * });
+ * // => Logs `2` then `1`.
+ */
+ function forEachRight(collection, iteratee) {
+ var func = isArray(collection) ? arrayEachRight : baseEachRight;
+ return func(collection, getIteratee(iteratee, 3));
+ }
+
+ /**
+ * Creates an object composed of keys generated from the results of running
+ * each element of `collection` thru `iteratee`. The order of grouped values
+ * is determined by the order they occur in `collection`. The corresponding
+ * value of each key is an array of elements responsible for generating the
+ * key. The iteratee is invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The iteratee to transform keys.
+ * @returns {Object} Returns the composed aggregate object.
+ * @example
+ *
+ * _.groupBy([6.1, 4.2, 6.3], Math.floor);
+ * // => { '4': [4.2], '6': [6.1, 6.3] }
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.groupBy(['one', 'two', 'three'], 'length');
+ * // => { '3': ['one', 'two'], '5': ['three'] }
+ */
+ var groupBy = createAggregator(function(result, value, key) {
+ if (hasOwnProperty.call(result, key)) {
+ result[key].push(value);
+ } else {
+ baseAssignValue(result, key, [value]);
+ }
+ });
+
+ /**
+ * Checks if `value` is in `collection`. If `collection` is a string, it's
+ * checked for a substring of `value`, otherwise
+ * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * is used for equality comparisons. If `fromIndex` is negative, it's used as
+ * the offset from the end of `collection`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object|string} collection The collection to inspect.
+ * @param {*} value The value to search for.
+ * @param {number} [fromIndex=0] The index to search from.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.
+ * @returns {boolean} Returns `true` if `value` is found, else `false`.
+ * @example
+ *
+ * _.includes([1, 2, 3], 1);
+ * // => true
+ *
+ * _.includes([1, 2, 3], 1, 2);
+ * // => false
+ *
+ * _.includes({ 'a': 1, 'b': 2 }, 1);
+ * // => true
+ *
+ * _.includes('abcd', 'bc');
+ * // => true
+ */
+ function includes(collection, value, fromIndex, guard) {
+ collection = isArrayLike(collection) ? collection : values(collection);
+ fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0;
+
+ var length = collection.length;
+ if (fromIndex < 0) {
+ fromIndex = nativeMax(length + fromIndex, 0);
+ }
+ return isString(collection)
+ ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1)
+ : (!!length && baseIndexOf(collection, value, fromIndex) > -1);
+ }
+
+ /**
+ * Invokes the method at `path` of each element in `collection`, returning
+ * an array of the results of each invoked method. Any additional arguments
+ * are provided to each invoked method. If `path` is a function, it's invoked
+ * for, and `this` bound to, each element in `collection`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Array|Function|string} path The path of the method to invoke or
+ * the function invoked per iteration.
+ * @param {...*} [args] The arguments to invoke each method with.
+ * @returns {Array} Returns the array of results.
+ * @example
+ *
+ * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort');
+ * // => [[1, 5, 7], [1, 2, 3]]
+ *
+ * _.invokeMap([123, 456], String.prototype.split, '');
+ * // => [['1', '2', '3'], ['4', '5', '6']]
+ */
+ var invokeMap = baseRest(function(collection, path, args) {
+ var index = -1,
+ isFunc = typeof path == 'function',
+ result = isArrayLike(collection) ? Array(collection.length) : [];
+
+ baseEach(collection, function(value) {
+ result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args);
+ });
+ return result;
+ });
+
+ /**
+ * Creates an object composed of keys generated from the results of running
+ * each element of `collection` thru `iteratee`. The corresponding value of
+ * each key is the last element responsible for generating the key. The
+ * iteratee is invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The iteratee to transform keys.
+ * @returns {Object} Returns the composed aggregate object.
+ * @example
+ *
+ * var array = [
+ * { 'dir': 'left', 'code': 97 },
+ * { 'dir': 'right', 'code': 100 }
+ * ];
+ *
+ * _.keyBy(array, function(o) {
+ * return String.fromCharCode(o.code);
+ * });
+ * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } }
+ *
+ * _.keyBy(array, 'dir');
+ * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } }
+ */
+ var keyBy = createAggregator(function(result, value, key) {
+ baseAssignValue(result, key, value);
+ });
+
+ /**
+ * Creates an array of values by running each element in `collection` thru
+ * `iteratee`. The iteratee is invoked with three arguments:
+ * (value, index|key, collection).
+ *
+ * Many lodash methods are guarded to work as iteratees for methods like
+ * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`.
+ *
+ * The guarded methods are:
+ * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`,
+ * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`,
+ * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`,
+ * `template`, `trim`, `trimEnd`, `trimStart`, and `words`
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the new mapped array.
+ * @example
+ *
+ * function square(n) {
+ * return n * n;
+ * }
+ *
+ * _.map([4, 8], square);
+ * // => [16, 64]
+ *
+ * _.map({ 'a': 4, 'b': 8 }, square);
+ * // => [16, 64] (iteration order is not guaranteed)
+ *
+ * var users = [
+ * { 'user': 'barney' },
+ * { 'user': 'fred' }
+ * ];
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.map(users, 'user');
+ * // => ['barney', 'fred']
+ */
+ function map(collection, iteratee) {
+ var func = isArray(collection) ? arrayMap : baseMap;
+ return func(collection, getIteratee(iteratee, 3));
+ }
+
+ /**
+ * This method is like `_.sortBy` except that it allows specifying the sort
+ * orders of the iteratees to sort by. If `orders` is unspecified, all values
+ * are sorted in ascending order. Otherwise, specify an order of "desc" for
+ * descending or "asc" for ascending sort order of corresponding values.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]]
+ * The iteratees to sort by.
+ * @param {string[]} [orders] The sort orders of `iteratees`.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.
+ * @returns {Array} Returns the new sorted array.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'fred', 'age': 48 },
+ * { 'user': 'barney', 'age': 34 },
+ * { 'user': 'fred', 'age': 40 },
+ * { 'user': 'barney', 'age': 36 }
+ * ];
+ *
+ * // Sort by `user` in ascending order and by `age` in descending order.
+ * _.orderBy(users, ['user', 'age'], ['asc', 'desc']);
+ * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]
+ */
+ function orderBy(collection, iteratees, orders, guard) {
+ if (collection == null) {
+ return [];
+ }
+ if (!isArray(iteratees)) {
+ iteratees = iteratees == null ? [] : [iteratees];
+ }
+ orders = guard ? undefined : orders;
+ if (!isArray(orders)) {
+ orders = orders == null ? [] : [orders];
+ }
+ return baseOrderBy(collection, iteratees, orders);
+ }
+
+ /**
+ * Creates an array of elements split into two groups, the first of which
+ * contains elements `predicate` returns truthy for, the second of which
+ * contains elements `predicate` returns falsey for. The predicate is
+ * invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the array of grouped elements.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36, 'active': false },
+ * { 'user': 'fred', 'age': 40, 'active': true },
+ * { 'user': 'pebbles', 'age': 1, 'active': false }
+ * ];
+ *
+ * _.partition(users, function(o) { return o.active; });
+ * // => objects for [['fred'], ['barney', 'pebbles']]
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.partition(users, { 'age': 1, 'active': false });
+ * // => objects for [['pebbles'], ['barney', 'fred']]
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.partition(users, ['active', false]);
+ * // => objects for [['barney', 'pebbles'], ['fred']]
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.partition(users, 'active');
+ * // => objects for [['fred'], ['barney', 'pebbles']]
+ */
+ var partition = createAggregator(function(result, value, key) {
+ result[key ? 0 : 1].push(value);
+ }, function() { return [[], []]; });
+
+ /**
+ * Reduces `collection` to a value which is the accumulated result of running
+ * each element in `collection` thru `iteratee`, where each successive
+ * invocation is supplied the return value of the previous. If `accumulator`
+ * is not given, the first element of `collection` is used as the initial
+ * value. The iteratee is invoked with four arguments:
+ * (accumulator, value, index|key, collection).
+ *
+ * Many lodash methods are guarded to work as iteratees for methods like
+ * `_.reduce`, `_.reduceRight`, and `_.transform`.
+ *
+ * The guarded methods are:
+ * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`,
+ * and `sortBy`
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @param {*} [accumulator] The initial value.
+ * @returns {*} Returns the accumulated value.
+ * @see _.reduceRight
+ * @example
+ *
+ * _.reduce([1, 2], function(sum, n) {
+ * return sum + n;
+ * }, 0);
+ * // => 3
+ *
+ * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {
+ * (result[value] || (result[value] = [])).push(key);
+ * return result;
+ * }, {});
+ * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed)
+ */
+ function reduce(collection, iteratee, accumulator) {
+ var func = isArray(collection) ? arrayReduce : baseReduce,
+ initAccum = arguments.length < 3;
+
+ return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach);
+ }
+
+ /**
+ * This method is like `_.reduce` except that it iterates over elements of
+ * `collection` from right to left.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @param {*} [accumulator] The initial value.
+ * @returns {*} Returns the accumulated value.
+ * @see _.reduce
+ * @example
+ *
+ * var array = [[0, 1], [2, 3], [4, 5]];
+ *
+ * _.reduceRight(array, function(flattened, other) {
+ * return flattened.concat(other);
+ * }, []);
+ * // => [4, 5, 2, 3, 0, 1]
+ */
+ function reduceRight(collection, iteratee, accumulator) {
+ var func = isArray(collection) ? arrayReduceRight : baseReduce,
+ initAccum = arguments.length < 3;
+
+ return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight);
+ }
+
+ /**
+ * The opposite of `_.filter`; this method returns the elements of `collection`
+ * that `predicate` does **not** return truthy for.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the new filtered array.
+ * @see _.filter
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36, 'active': false },
+ * { 'user': 'fred', 'age': 40, 'active': true }
+ * ];
+ *
+ * _.reject(users, function(o) { return !o.active; });
+ * // => objects for ['fred']
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.reject(users, { 'age': 40, 'active': true });
+ * // => objects for ['barney']
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.reject(users, ['active', false]);
+ * // => objects for ['fred']
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.reject(users, 'active');
+ * // => objects for ['barney']
+ */
+ function reject(collection, predicate) {
+ var func = isArray(collection) ? arrayFilter : baseFilter;
+ return func(collection, negate(getIteratee(predicate, 3)));
+ }
+
+ /**
+ * Gets a random element from `collection`.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to sample.
+ * @returns {*} Returns the random element.
+ * @example
+ *
+ * _.sample([1, 2, 3, 4]);
+ * // => 2
+ */
+ function sample(collection) {
+ var func = isArray(collection) ? arraySample : baseSample;
+ return func(collection);
+ }
+
+ /**
+ * Gets `n` random elements at unique keys from `collection` up to the
+ * size of `collection`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to sample.
+ * @param {number} [n=1] The number of elements to sample.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Array} Returns the random elements.
+ * @example
+ *
+ * _.sampleSize([1, 2, 3], 2);
+ * // => [3, 1]
+ *
+ * _.sampleSize([1, 2, 3], 4);
+ * // => [2, 3, 1]
+ */
+ function sampleSize(collection, n, guard) {
+ if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) {
+ n = 1;
+ } else {
+ n = toInteger(n);
+ }
+ var func = isArray(collection) ? arraySampleSize : baseSampleSize;
+ return func(collection, n);
+ }
+
+ /**
+ * Creates an array of shuffled values, using a version of the
+ * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to shuffle.
+ * @returns {Array} Returns the new shuffled array.
+ * @example
+ *
+ * _.shuffle([1, 2, 3, 4]);
+ * // => [4, 1, 3, 2]
+ */
+ function shuffle(collection) {
+ var func = isArray(collection) ? arrayShuffle : baseShuffle;
+ return func(collection);
+ }
+
+ /**
+ * Gets the size of `collection` by returning its length for array-like
+ * values or the number of own enumerable string keyed properties for objects.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object|string} collection The collection to inspect.
+ * @returns {number} Returns the collection size.
+ * @example
+ *
+ * _.size([1, 2, 3]);
+ * // => 3
+ *
+ * _.size({ 'a': 1, 'b': 2 });
+ * // => 2
+ *
+ * _.size('pebbles');
+ * // => 7
+ */
+ function size(collection) {
+ if (collection == null) {
+ return 0;
+ }
+ if (isArrayLike(collection)) {
+ return isString(collection) ? stringSize(collection) : collection.length;
+ }
+ var tag = getTag(collection);
+ if (tag == mapTag || tag == setTag) {
+ return collection.size;
+ }
+ return baseKeys(collection).length;
+ }
+
+ /**
+ * Checks if `predicate` returns truthy for **any** element of `collection`.
+ * Iteration is stopped once `predicate` returns truthy. The predicate is
+ * invoked with three arguments: (value, index|key, collection).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {boolean} Returns `true` if any element passes the predicate check,
+ * else `false`.
+ * @example
+ *
+ * _.some([null, 0, 'yes', false], Boolean);
+ * // => true
+ *
+ * var users = [
+ * { 'user': 'barney', 'active': true },
+ * { 'user': 'fred', 'active': false }
+ * ];
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.some(users, { 'user': 'barney', 'active': false });
+ * // => false
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.some(users, ['active', false]);
+ * // => true
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.some(users, 'active');
+ * // => true
+ */
+ function some(collection, predicate, guard) {
+ var func = isArray(collection) ? arraySome : baseSome;
+ if (guard && isIterateeCall(collection, predicate, guard)) {
+ predicate = undefined;
+ }
+ return func(collection, getIteratee(predicate, 3));
+ }
+
+ /**
+ * Creates an array of elements, sorted in ascending order by the results of
+ * running each element in a collection thru each iteratee. This method
+ * performs a stable sort, that is, it preserves the original sort order of
+ * equal elements. The iteratees are invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Collection
+ * @param {Array|Object} collection The collection to iterate over.
+ * @param {...(Function|Function[])} [iteratees=[_.identity]]
+ * The iteratees to sort by.
+ * @returns {Array} Returns the new sorted array.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'fred', 'age': 48 },
+ * { 'user': 'barney', 'age': 36 },
+ * { 'user': 'fred', 'age': 40 },
+ * { 'user': 'barney', 'age': 34 }
+ * ];
+ *
+ * _.sortBy(users, [function(o) { return o.user; }]);
+ * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]
+ *
+ * _.sortBy(users, ['user', 'age']);
+ * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]]
+ */
+ var sortBy = baseRest(function(collection, iteratees) {
+ if (collection == null) {
+ return [];
+ }
+ var length = iteratees.length;
+ if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) {
+ iteratees = [];
+ } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) {
+ iteratees = [iteratees[0]];
+ }
+ return baseOrderBy(collection, baseFlatten(iteratees, 1), []);
+ });
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Gets the timestamp of the number of milliseconds that have elapsed since
+ * the Unix epoch (1 January 1970 00:00:00 UTC).
+ *
+ * @static
+ * @memberOf _
+ * @since 2.4.0
+ * @category Date
+ * @returns {number} Returns the timestamp.
+ * @example
+ *
+ * _.defer(function(stamp) {
+ * console.log(_.now() - stamp);
+ * }, _.now());
+ * // => Logs the number of milliseconds it took for the deferred invocation.
+ */
+ var now = ctxNow || function() {
+ return root.Date.now();
+ };
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * The opposite of `_.before`; this method creates a function that invokes
+ * `func` once it's called `n` or more times.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {number} n The number of calls before `func` is invoked.
+ * @param {Function} func The function to restrict.
+ * @returns {Function} Returns the new restricted function.
+ * @example
+ *
+ * var saves = ['profile', 'settings'];
+ *
+ * var done = _.after(saves.length, function() {
+ * console.log('done saving!');
+ * });
+ *
+ * _.forEach(saves, function(type) {
+ * asyncSave({ 'type': type, 'complete': done });
+ * });
+ * // => Logs 'done saving!' after the two async saves have completed.
+ */
+ function after(n, func) {
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ n = toInteger(n);
+ return function() {
+ if (--n < 1) {
+ return func.apply(this, arguments);
+ }
+ };
+ }
+
+ /**
+ * Creates a function that invokes `func`, with up to `n` arguments,
+ * ignoring any additional arguments.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Function
+ * @param {Function} func The function to cap arguments for.
+ * @param {number} [n=func.length] The arity cap.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Function} Returns the new capped function.
+ * @example
+ *
+ * _.map(['6', '8', '10'], _.ary(parseInt, 1));
+ * // => [6, 8, 10]
+ */
+ function ary(func, n, guard) {
+ n = guard ? undefined : n;
+ n = (func && n == null) ? func.length : n;
+ return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n);
+ }
+
+ /**
+ * Creates a function that invokes `func`, with the `this` binding and arguments
+ * of the created function, while it's called less than `n` times. Subsequent
+ * calls to the created function return the result of the last `func` invocation.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Function
+ * @param {number} n The number of calls at which `func` is no longer invoked.
+ * @param {Function} func The function to restrict.
+ * @returns {Function} Returns the new restricted function.
+ * @example
+ *
+ * jQuery(element).on('click', _.before(5, addContactToList));
+ * // => Allows adding up to 4 contacts to the list.
+ */
+ function before(n, func) {
+ var result;
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ n = toInteger(n);
+ return function() {
+ if (--n > 0) {
+ result = func.apply(this, arguments);
+ }
+ if (n <= 1) {
+ func = undefined;
+ }
+ return result;
+ };
+ }
+
+ /**
+ * Creates a function that invokes `func` with the `this` binding of `thisArg`
+ * and `partials` prepended to the arguments it receives.
+ *
+ * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds,
+ * may be used as a placeholder for partially applied arguments.
+ *
+ * **Note:** Unlike native `Function#bind`, this method doesn't set the "length"
+ * property of bound functions.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {Function} func The function to bind.
+ * @param {*} thisArg The `this` binding of `func`.
+ * @param {...*} [partials] The arguments to be partially applied.
+ * @returns {Function} Returns the new bound function.
+ * @example
+ *
+ * function greet(greeting, punctuation) {
+ * return greeting + ' ' + this.user + punctuation;
+ * }
+ *
+ * var object = { 'user': 'fred' };
+ *
+ * var bound = _.bind(greet, object, 'hi');
+ * bound('!');
+ * // => 'hi fred!'
+ *
+ * // Bound with placeholders.
+ * var bound = _.bind(greet, object, _, '!');
+ * bound('hi');
+ * // => 'hi fred!'
+ */
+ var bind = baseRest(function(func, thisArg, partials) {
+ var bitmask = WRAP_BIND_FLAG;
+ if (partials.length) {
+ var holders = replaceHolders(partials, getHolder(bind));
+ bitmask |= WRAP_PARTIAL_FLAG;
+ }
+ return createWrap(func, bitmask, thisArg, partials, holders);
+ });
+
+ /**
+ * Creates a function that invokes the method at `object[key]` with `partials`
+ * prepended to the arguments it receives.
+ *
+ * This method differs from `_.bind` by allowing bound functions to reference
+ * methods that may be redefined or don't yet exist. See
+ * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern)
+ * for more details.
+ *
+ * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic
+ * builds, may be used as a placeholder for partially applied arguments.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.10.0
+ * @category Function
+ * @param {Object} object The object to invoke the method on.
+ * @param {string} key The key of the method.
+ * @param {...*} [partials] The arguments to be partially applied.
+ * @returns {Function} Returns the new bound function.
+ * @example
+ *
+ * var object = {
+ * 'user': 'fred',
+ * 'greet': function(greeting, punctuation) {
+ * return greeting + ' ' + this.user + punctuation;
+ * }
+ * };
+ *
+ * var bound = _.bindKey(object, 'greet', 'hi');
+ * bound('!');
+ * // => 'hi fred!'
+ *
+ * object.greet = function(greeting, punctuation) {
+ * return greeting + 'ya ' + this.user + punctuation;
+ * };
+ *
+ * bound('!');
+ * // => 'hiya fred!'
+ *
+ * // Bound with placeholders.
+ * var bound = _.bindKey(object, 'greet', _, '!');
+ * bound('hi');
+ * // => 'hiya fred!'
+ */
+ var bindKey = baseRest(function(object, key, partials) {
+ var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG;
+ if (partials.length) {
+ var holders = replaceHolders(partials, getHolder(bindKey));
+ bitmask |= WRAP_PARTIAL_FLAG;
+ }
+ return createWrap(key, bitmask, object, partials, holders);
+ });
+
+ /**
+ * Creates a function that accepts arguments of `func` and either invokes
+ * `func` returning its result, if at least `arity` number of arguments have
+ * been provided, or returns a function that accepts the remaining `func`
+ * arguments, and so on. The arity of `func` may be specified if `func.length`
+ * is not sufficient.
+ *
+ * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds,
+ * may be used as a placeholder for provided arguments.
+ *
+ * **Note:** This method doesn't set the "length" property of curried functions.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Function
+ * @param {Function} func The function to curry.
+ * @param {number} [arity=func.length] The arity of `func`.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Function} Returns the new curried function.
+ * @example
+ *
+ * var abc = function(a, b, c) {
+ * return [a, b, c];
+ * };
+ *
+ * var curried = _.curry(abc);
+ *
+ * curried(1)(2)(3);
+ * // => [1, 2, 3]
+ *
+ * curried(1, 2)(3);
+ * // => [1, 2, 3]
+ *
+ * curried(1, 2, 3);
+ * // => [1, 2, 3]
+ *
+ * // Curried with placeholders.
+ * curried(1)(_, 3)(2);
+ * // => [1, 2, 3]
+ */
+ function curry(func, arity, guard) {
+ arity = guard ? undefined : arity;
+ var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity);
+ result.placeholder = curry.placeholder;
+ return result;
+ }
+
+ /**
+ * This method is like `_.curry` except that arguments are applied to `func`
+ * in the manner of `_.partialRight` instead of `_.partial`.
+ *
+ * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic
+ * builds, may be used as a placeholder for provided arguments.
+ *
+ * **Note:** This method doesn't set the "length" property of curried functions.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Function
+ * @param {Function} func The function to curry.
+ * @param {number} [arity=func.length] The arity of `func`.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Function} Returns the new curried function.
+ * @example
+ *
+ * var abc = function(a, b, c) {
+ * return [a, b, c];
+ * };
+ *
+ * var curried = _.curryRight(abc);
+ *
+ * curried(3)(2)(1);
+ * // => [1, 2, 3]
+ *
+ * curried(2, 3)(1);
+ * // => [1, 2, 3]
+ *
+ * curried(1, 2, 3);
+ * // => [1, 2, 3]
+ *
+ * // Curried with placeholders.
+ * curried(3)(1, _)(2);
+ * // => [1, 2, 3]
+ */
+ function curryRight(func, arity, guard) {
+ arity = guard ? undefined : arity;
+ var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity);
+ result.placeholder = curryRight.placeholder;
+ return result;
+ }
+
+ /**
+ * Creates a debounced function that delays invoking `func` until after `wait`
+ * milliseconds have elapsed since the last time the debounced function was
+ * invoked. The debounced function comes with a `cancel` method to cancel
+ * delayed `func` invocations and a `flush` method to immediately invoke them.
+ * Provide `options` to indicate whether `func` should be invoked on the
+ * leading and/or trailing edge of the `wait` timeout. The `func` is invoked
+ * with the last arguments provided to the debounced function. Subsequent
+ * calls to the debounced function return the result of the last `func`
+ * invocation.
+ *
+ * **Note:** If `leading` and `trailing` options are `true`, `func` is
+ * invoked on the trailing edge of the timeout only if the debounced function
+ * is invoked more than once during the `wait` timeout.
+ *
+ * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred
+ * until to the next tick, similar to `setTimeout` with a timeout of `0`.
+ *
+ * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)
+ * for details over the differences between `_.debounce` and `_.throttle`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {Function} func The function to debounce.
+ * @param {number} [wait=0] The number of milliseconds to delay.
+ * @param {Object} [options={}] The options object.
+ * @param {boolean} [options.leading=false]
+ * Specify invoking on the leading edge of the timeout.
+ * @param {number} [options.maxWait]
+ * The maximum time `func` is allowed to be delayed before it's invoked.
+ * @param {boolean} [options.trailing=true]
+ * Specify invoking on the trailing edge of the timeout.
+ * @returns {Function} Returns the new debounced function.
+ * @example
+ *
+ * // Avoid costly calculations while the window size is in flux.
+ * jQuery(window).on('resize', _.debounce(calculateLayout, 150));
+ *
+ * // Invoke `sendMail` when clicked, debouncing subsequent calls.
+ * jQuery(element).on('click', _.debounce(sendMail, 300, {
+ * 'leading': true,
+ * 'trailing': false
+ * }));
+ *
+ * // Ensure `batchLog` is invoked once after 1 second of debounced calls.
+ * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 });
+ * var source = new EventSource('/stream');
+ * jQuery(source).on('message', debounced);
+ *
+ * // Cancel the trailing debounced invocation.
+ * jQuery(window).on('popstate', debounced.cancel);
+ */
+ function debounce(func, wait, options) {
+ var lastArgs,
+ lastThis,
+ maxWait,
+ result,
+ timerId,
+ lastCallTime,
+ lastInvokeTime = 0,
+ leading = false,
+ maxing = false,
+ trailing = true;
+
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ wait = toNumber(wait) || 0;
+ if (isObject(options)) {
+ leading = !!options.leading;
+ maxing = 'maxWait' in options;
+ maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;
+ trailing = 'trailing' in options ? !!options.trailing : trailing;
+ }
+
+ function invokeFunc(time) {
+ var args = lastArgs,
+ thisArg = lastThis;
+
+ lastArgs = lastThis = undefined;
+ lastInvokeTime = time;
+ result = func.apply(thisArg, args);
+ return result;
+ }
+
+ function leadingEdge(time) {
+ // Reset any `maxWait` timer.
+ lastInvokeTime = time;
+ // Start the timer for the trailing edge.
+ timerId = setTimeout(timerExpired, wait);
+ // Invoke the leading edge.
+ return leading ? invokeFunc(time) : result;
+ }
+
+ function remainingWait(time) {
+ var timeSinceLastCall = time - lastCallTime,
+ timeSinceLastInvoke = time - lastInvokeTime,
+ timeWaiting = wait - timeSinceLastCall;
+
+ return maxing
+ ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke)
+ : timeWaiting;
+ }
+
+ function shouldInvoke(time) {
+ var timeSinceLastCall = time - lastCallTime,
+ timeSinceLastInvoke = time - lastInvokeTime;
+
+ // Either this is the first call, activity has stopped and we're at the
+ // trailing edge, the system time has gone backwards and we're treating
+ // it as the trailing edge, or we've hit the `maxWait` limit.
+ return (lastCallTime === undefined || (timeSinceLastCall >= wait) ||
+ (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait));
+ }
+
+ function timerExpired() {
+ var time = now();
+ if (shouldInvoke(time)) {
+ return trailingEdge(time);
+ }
+ // Restart the timer.
+ timerId = setTimeout(timerExpired, remainingWait(time));
+ }
+
+ function trailingEdge(time) {
+ timerId = undefined;
+
+ // Only invoke if we have `lastArgs` which means `func` has been
+ // debounced at least once.
+ if (trailing && lastArgs) {
+ return invokeFunc(time);
+ }
+ lastArgs = lastThis = undefined;
+ return result;
+ }
+
+ function cancel() {
+ if (timerId !== undefined) {
+ clearTimeout(timerId);
+ }
+ lastInvokeTime = 0;
+ lastArgs = lastCallTime = lastThis = timerId = undefined;
+ }
+
+ function flush() {
+ return timerId === undefined ? result : trailingEdge(now());
+ }
+
+ function debounced() {
+ var time = now(),
+ isInvoking = shouldInvoke(time);
+
+ lastArgs = arguments;
+ lastThis = this;
+ lastCallTime = time;
+
+ if (isInvoking) {
+ if (timerId === undefined) {
+ return leadingEdge(lastCallTime);
+ }
+ if (maxing) {
+ // Handle invocations in a tight loop.
+ timerId = setTimeout(timerExpired, wait);
+ return invokeFunc(lastCallTime);
+ }
+ }
+ if (timerId === undefined) {
+ timerId = setTimeout(timerExpired, wait);
+ }
+ return result;
+ }
+ debounced.cancel = cancel;
+ debounced.flush = flush;
+ return debounced;
+ }
+
+ /**
+ * Defers invoking the `func` until the current call stack has cleared. Any
+ * additional arguments are provided to `func` when it's invoked.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {Function} func The function to defer.
+ * @param {...*} [args] The arguments to invoke `func` with.
+ * @returns {number} Returns the timer id.
+ * @example
+ *
+ * _.defer(function(text) {
+ * console.log(text);
+ * }, 'deferred');
+ * // => Logs 'deferred' after one millisecond.
+ */
+ var defer = baseRest(function(func, args) {
+ return baseDelay(func, 1, args);
+ });
+
+ /**
+ * Invokes `func` after `wait` milliseconds. Any additional arguments are
+ * provided to `func` when it's invoked.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {Function} func The function to delay.
+ * @param {number} wait The number of milliseconds to delay invocation.
+ * @param {...*} [args] The arguments to invoke `func` with.
+ * @returns {number} Returns the timer id.
+ * @example
+ *
+ * _.delay(function(text) {
+ * console.log(text);
+ * }, 1000, 'later');
+ * // => Logs 'later' after one second.
+ */
+ var delay = baseRest(function(func, wait, args) {
+ return baseDelay(func, toNumber(wait) || 0, args);
+ });
+
+ /**
+ * Creates a function that invokes `func` with arguments reversed.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Function
+ * @param {Function} func The function to flip arguments for.
+ * @returns {Function} Returns the new flipped function.
+ * @example
+ *
+ * var flipped = _.flip(function() {
+ * return _.toArray(arguments);
+ * });
+ *
+ * flipped('a', 'b', 'c', 'd');
+ * // => ['d', 'c', 'b', 'a']
+ */
+ function flip(func) {
+ return createWrap(func, WRAP_FLIP_FLAG);
+ }
+
+ /**
+ * Creates a function that memoizes the result of `func`. If `resolver` is
+ * provided, it determines the cache key for storing the result based on the
+ * arguments provided to the memoized function. By default, the first argument
+ * provided to the memoized function is used as the map cache key. The `func`
+ * is invoked with the `this` binding of the memoized function.
+ *
+ * **Note:** The cache is exposed as the `cache` property on the memoized
+ * function. Its creation may be customized by replacing the `_.memoize.Cache`
+ * constructor with one whose instances implement the
+ * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)
+ * method interface of `clear`, `delete`, `get`, `has`, and `set`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {Function} func The function to have its output memoized.
+ * @param {Function} [resolver] The function to resolve the cache key.
+ * @returns {Function} Returns the new memoized function.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': 2 };
+ * var other = { 'c': 3, 'd': 4 };
+ *
+ * var values = _.memoize(_.values);
+ * values(object);
+ * // => [1, 2]
+ *
+ * values(other);
+ * // => [3, 4]
+ *
+ * object.a = 2;
+ * values(object);
+ * // => [1, 2]
+ *
+ * // Modify the result cache.
+ * values.cache.set(object, ['a', 'b']);
+ * values(object);
+ * // => ['a', 'b']
+ *
+ * // Replace `_.memoize.Cache`.
+ * _.memoize.Cache = WeakMap;
+ */
+ function memoize(func, resolver) {
+ if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ var memoized = function() {
+ var args = arguments,
+ key = resolver ? resolver.apply(this, args) : args[0],
+ cache = memoized.cache;
+
+ if (cache.has(key)) {
+ return cache.get(key);
+ }
+ var result = func.apply(this, args);
+ memoized.cache = cache.set(key, result) || cache;
+ return result;
+ };
+ memoized.cache = new (memoize.Cache || MapCache);
+ return memoized;
+ }
+
+ // Expose `MapCache`.
+ memoize.Cache = MapCache;
+
+ /**
+ * Creates a function that negates the result of the predicate `func`. The
+ * `func` predicate is invoked with the `this` binding and arguments of the
+ * created function.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Function
+ * @param {Function} predicate The predicate to negate.
+ * @returns {Function} Returns the new negated function.
+ * @example
+ *
+ * function isEven(n) {
+ * return n % 2 == 0;
+ * }
+ *
+ * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven));
+ * // => [1, 3, 5]
+ */
+ function negate(predicate) {
+ if (typeof predicate != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ return function() {
+ var args = arguments;
+ switch (args.length) {
+ case 0: return !predicate.call(this);
+ case 1: return !predicate.call(this, args[0]);
+ case 2: return !predicate.call(this, args[0], args[1]);
+ case 3: return !predicate.call(this, args[0], args[1], args[2]);
+ }
+ return !predicate.apply(this, args);
+ };
+ }
+
+ /**
+ * Creates a function that is restricted to invoking `func` once. Repeat calls
+ * to the function return the value of the first invocation. The `func` is
+ * invoked with the `this` binding and arguments of the created function.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {Function} func The function to restrict.
+ * @returns {Function} Returns the new restricted function.
+ * @example
+ *
+ * var initialize = _.once(createApplication);
+ * initialize();
+ * initialize();
+ * // => `createApplication` is invoked once
+ */
+ function once(func) {
+ return before(2, func);
+ }
+
+ /**
+ * Creates a function that invokes `func` with its arguments transformed.
+ *
+ * @static
+ * @since 4.0.0
+ * @memberOf _
+ * @category Function
+ * @param {Function} func The function to wrap.
+ * @param {...(Function|Function[])} [transforms=[_.identity]]
+ * The argument transforms.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * function doubled(n) {
+ * return n * 2;
+ * }
+ *
+ * function square(n) {
+ * return n * n;
+ * }
+ *
+ * var func = _.overArgs(function(x, y) {
+ * return [x, y];
+ * }, [square, doubled]);
+ *
+ * func(9, 3);
+ * // => [81, 6]
+ *
+ * func(10, 5);
+ * // => [100, 10]
+ */
+ var overArgs = castRest(function(func, transforms) {
+ transforms = (transforms.length == 1 && isArray(transforms[0]))
+ ? arrayMap(transforms[0], baseUnary(getIteratee()))
+ : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee()));
+
+ var funcsLength = transforms.length;
+ return baseRest(function(args) {
+ var index = -1,
+ length = nativeMin(args.length, funcsLength);
+
+ while (++index < length) {
+ args[index] = transforms[index].call(this, args[index]);
+ }
+ return apply(func, this, args);
+ });
+ });
+
+ /**
+ * Creates a function that invokes `func` with `partials` prepended to the
+ * arguments it receives. This method is like `_.bind` except it does **not**
+ * alter the `this` binding.
+ *
+ * The `_.partial.placeholder` value, which defaults to `_` in monolithic
+ * builds, may be used as a placeholder for partially applied arguments.
+ *
+ * **Note:** This method doesn't set the "length" property of partially
+ * applied functions.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.2.0
+ * @category Function
+ * @param {Function} func The function to partially apply arguments to.
+ * @param {...*} [partials] The arguments to be partially applied.
+ * @returns {Function} Returns the new partially applied function.
+ * @example
+ *
+ * function greet(greeting, name) {
+ * return greeting + ' ' + name;
+ * }
+ *
+ * var sayHelloTo = _.partial(greet, 'hello');
+ * sayHelloTo('fred');
+ * // => 'hello fred'
+ *
+ * // Partially applied with placeholders.
+ * var greetFred = _.partial(greet, _, 'fred');
+ * greetFred('hi');
+ * // => 'hi fred'
+ */
+ var partial = baseRest(function(func, partials) {
+ var holders = replaceHolders(partials, getHolder(partial));
+ return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders);
+ });
+
+ /**
+ * This method is like `_.partial` except that partially applied arguments
+ * are appended to the arguments it receives.
+ *
+ * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic
+ * builds, may be used as a placeholder for partially applied arguments.
+ *
+ * **Note:** This method doesn't set the "length" property of partially
+ * applied functions.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.0.0
+ * @category Function
+ * @param {Function} func The function to partially apply arguments to.
+ * @param {...*} [partials] The arguments to be partially applied.
+ * @returns {Function} Returns the new partially applied function.
+ * @example
+ *
+ * function greet(greeting, name) {
+ * return greeting + ' ' + name;
+ * }
+ *
+ * var greetFred = _.partialRight(greet, 'fred');
+ * greetFred('hi');
+ * // => 'hi fred'
+ *
+ * // Partially applied with placeholders.
+ * var sayHelloTo = _.partialRight(greet, 'hello', _);
+ * sayHelloTo('fred');
+ * // => 'hello fred'
+ */
+ var partialRight = baseRest(function(func, partials) {
+ var holders = replaceHolders(partials, getHolder(partialRight));
+ return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders);
+ });
+
+ /**
+ * Creates a function that invokes `func` with arguments arranged according
+ * to the specified `indexes` where the argument value at the first index is
+ * provided as the first argument, the argument value at the second index is
+ * provided as the second argument, and so on.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Function
+ * @param {Function} func The function to rearrange arguments for.
+ * @param {...(number|number[])} indexes The arranged argument indexes.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * var rearged = _.rearg(function(a, b, c) {
+ * return [a, b, c];
+ * }, [2, 0, 1]);
+ *
+ * rearged('b', 'c', 'a')
+ * // => ['a', 'b', 'c']
+ */
+ var rearg = flatRest(function(func, indexes) {
+ return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes);
+ });
+
+ /**
+ * Creates a function that invokes `func` with the `this` binding of the
+ * created function and arguments from `start` and beyond provided as
+ * an array.
+ *
+ * **Note:** This method is based on the
+ * [rest parameter](https://mdn.io/rest_parameters).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Function
+ * @param {Function} func The function to apply a rest parameter to.
+ * @param {number} [start=func.length-1] The start position of the rest parameter.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * var say = _.rest(function(what, names) {
+ * return what + ' ' + _.initial(names).join(', ') +
+ * (_.size(names) > 1 ? ', & ' : '') + _.last(names);
+ * });
+ *
+ * say('hello', 'fred', 'barney', 'pebbles');
+ * // => 'hello fred, barney, & pebbles'
+ */
+ function rest(func, start) {
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ start = start === undefined ? start : toInteger(start);
+ return baseRest(func, start);
+ }
+
+ /**
+ * Creates a function that invokes `func` with the `this` binding of the
+ * create function and an array of arguments much like
+ * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply).
+ *
+ * **Note:** This method is based on the
+ * [spread operator](https://mdn.io/spread_operator).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.2.0
+ * @category Function
+ * @param {Function} func The function to spread arguments over.
+ * @param {number} [start=0] The start position of the spread.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * var say = _.spread(function(who, what) {
+ * return who + ' says ' + what;
+ * });
+ *
+ * say(['fred', 'hello']);
+ * // => 'fred says hello'
+ *
+ * var numbers = Promise.all([
+ * Promise.resolve(40),
+ * Promise.resolve(36)
+ * ]);
+ *
+ * numbers.then(_.spread(function(x, y) {
+ * return x + y;
+ * }));
+ * // => a Promise of 76
+ */
+ function spread(func, start) {
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ start = start == null ? 0 : nativeMax(toInteger(start), 0);
+ return baseRest(function(args) {
+ var array = args[start],
+ otherArgs = castSlice(args, 0, start);
+
+ if (array) {
+ arrayPush(otherArgs, array);
+ }
+ return apply(func, this, otherArgs);
+ });
+ }
+
+ /**
+ * Creates a throttled function that only invokes `func` at most once per
+ * every `wait` milliseconds. The throttled function comes with a `cancel`
+ * method to cancel delayed `func` invocations and a `flush` method to
+ * immediately invoke them. Provide `options` to indicate whether `func`
+ * should be invoked on the leading and/or trailing edge of the `wait`
+ * timeout. The `func` is invoked with the last arguments provided to the
+ * throttled function. Subsequent calls to the throttled function return the
+ * result of the last `func` invocation.
+ *
+ * **Note:** If `leading` and `trailing` options are `true`, `func` is
+ * invoked on the trailing edge of the timeout only if the throttled function
+ * is invoked more than once during the `wait` timeout.
+ *
+ * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred
+ * until to the next tick, similar to `setTimeout` with a timeout of `0`.
+ *
+ * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)
+ * for details over the differences between `_.throttle` and `_.debounce`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {Function} func The function to throttle.
+ * @param {number} [wait=0] The number of milliseconds to throttle invocations to.
+ * @param {Object} [options={}] The options object.
+ * @param {boolean} [options.leading=true]
+ * Specify invoking on the leading edge of the timeout.
+ * @param {boolean} [options.trailing=true]
+ * Specify invoking on the trailing edge of the timeout.
+ * @returns {Function} Returns the new throttled function.
+ * @example
+ *
+ * // Avoid excessively updating the position while scrolling.
+ * jQuery(window).on('scroll', _.throttle(updatePosition, 100));
+ *
+ * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes.
+ * var throttled = _.throttle(renewToken, 300000, { 'trailing': false });
+ * jQuery(element).on('click', throttled);
+ *
+ * // Cancel the trailing throttled invocation.
+ * jQuery(window).on('popstate', throttled.cancel);
+ */
+ function throttle(func, wait, options) {
+ var leading = true,
+ trailing = true;
+
+ if (typeof func != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ if (isObject(options)) {
+ leading = 'leading' in options ? !!options.leading : leading;
+ trailing = 'trailing' in options ? !!options.trailing : trailing;
+ }
+ return debounce(func, wait, {
+ 'leading': leading,
+ 'maxWait': wait,
+ 'trailing': trailing
+ });
+ }
+
+ /**
+ * Creates a function that accepts up to one argument, ignoring any
+ * additional arguments.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Function
+ * @param {Function} func The function to cap arguments for.
+ * @returns {Function} Returns the new capped function.
+ * @example
+ *
+ * _.map(['6', '8', '10'], _.unary(parseInt));
+ * // => [6, 8, 10]
+ */
+ function unary(func) {
+ return ary(func, 1);
+ }
+
+ /**
+ * Creates a function that provides `value` to `wrapper` as its first
+ * argument. Any additional arguments provided to the function are appended
+ * to those provided to the `wrapper`. The wrapper is invoked with the `this`
+ * binding of the created function.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Function
+ * @param {*} value The value to wrap.
+ * @param {Function} [wrapper=identity] The wrapper function.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * var p = _.wrap(_.escape, function(func, text) {
+ * return '<p>' + func(text) + '</p>';
+ * });
+ *
+ * p('fred, barney, & pebbles');
+ * // => '<p>fred, barney, & pebbles</p>'
+ */
+ function wrap(value, wrapper) {
+ return partial(castFunction(wrapper), value);
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Casts `value` as an array if it's not one.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.4.0
+ * @category Lang
+ * @param {*} value The value to inspect.
+ * @returns {Array} Returns the cast array.
+ * @example
+ *
+ * _.castArray(1);
+ * // => [1]
+ *
+ * _.castArray({ 'a': 1 });
+ * // => [{ 'a': 1 }]
+ *
+ * _.castArray('abc');
+ * // => ['abc']
+ *
+ * _.castArray(null);
+ * // => [null]
+ *
+ * _.castArray(undefined);
+ * // => [undefined]
+ *
+ * _.castArray();
+ * // => []
+ *
+ * var array = [1, 2, 3];
+ * console.log(_.castArray(array) === array);
+ * // => true
+ */
+ function castArray() {
+ if (!arguments.length) {
+ return [];
+ }
+ var value = arguments[0];
+ return isArray(value) ? value : [value];
+ }
+
+ /**
+ * Creates a shallow clone of `value`.
+ *
+ * **Note:** This method is loosely based on the
+ * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm)
+ * and supports cloning arrays, array buffers, booleans, date objects, maps,
+ * numbers, `Object` objects, regexes, sets, strings, symbols, and typed
+ * arrays. The own enumerable properties of `arguments` objects are cloned
+ * as plain objects. An empty object is returned for uncloneable values such
+ * as error objects, functions, DOM nodes, and WeakMaps.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to clone.
+ * @returns {*} Returns the cloned value.
+ * @see _.cloneDeep
+ * @example
+ *
+ * var objects = [{ 'a': 1 }, { 'b': 2 }];
+ *
+ * var shallow = _.clone(objects);
+ * console.log(shallow[0] === objects[0]);
+ * // => true
+ */
+ function clone(value) {
+ return baseClone(value, CLONE_SYMBOLS_FLAG);
+ }
+
+ /**
+ * This method is like `_.clone` except that it accepts `customizer` which
+ * is invoked to produce the cloned value. If `customizer` returns `undefined`,
+ * cloning is handled by the method instead. The `customizer` is invoked with
+ * up to four arguments; (value [, index|key, object, stack]).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to clone.
+ * @param {Function} [customizer] The function to customize cloning.
+ * @returns {*} Returns the cloned value.
+ * @see _.cloneDeepWith
+ * @example
+ *
+ * function customizer(value) {
+ * if (_.isElement(value)) {
+ * return value.cloneNode(false);
+ * }
+ * }
+ *
+ * var el = _.cloneWith(document.body, customizer);
+ *
+ * console.log(el === document.body);
+ * // => false
+ * console.log(el.nodeName);
+ * // => 'BODY'
+ * console.log(el.childNodes.length);
+ * // => 0
+ */
+ function cloneWith(value, customizer) {
+ customizer = typeof customizer == 'function' ? customizer : undefined;
+ return baseClone(value, CLONE_SYMBOLS_FLAG, customizer);
+ }
+
+ /**
+ * This method is like `_.clone` except that it recursively clones `value`.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.0.0
+ * @category Lang
+ * @param {*} value The value to recursively clone.
+ * @returns {*} Returns the deep cloned value.
+ * @see _.clone
+ * @example
+ *
+ * var objects = [{ 'a': 1 }, { 'b': 2 }];
+ *
+ * var deep = _.cloneDeep(objects);
+ * console.log(deep[0] === objects[0]);
+ * // => false
+ */
+ function cloneDeep(value) {
+ return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG);
+ }
+
+ /**
+ * This method is like `_.cloneWith` except that it recursively clones `value`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to recursively clone.
+ * @param {Function} [customizer] The function to customize cloning.
+ * @returns {*} Returns the deep cloned value.
+ * @see _.cloneWith
+ * @example
+ *
+ * function customizer(value) {
+ * if (_.isElement(value)) {
+ * return value.cloneNode(true);
+ * }
+ * }
+ *
+ * var el = _.cloneDeepWith(document.body, customizer);
+ *
+ * console.log(el === document.body);
+ * // => false
+ * console.log(el.nodeName);
+ * // => 'BODY'
+ * console.log(el.childNodes.length);
+ * // => 20
+ */
+ function cloneDeepWith(value, customizer) {
+ customizer = typeof customizer == 'function' ? customizer : undefined;
+ return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer);
+ }
+
+ /**
+ * Checks if `object` conforms to `source` by invoking the predicate
+ * properties of `source` with the corresponding property values of `object`.
+ *
+ * **Note:** This method is equivalent to `_.conforms` when `source` is
+ * partially applied.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.14.0
+ * @category Lang
+ * @param {Object} object The object to inspect.
+ * @param {Object} source The object of property predicates to conform to.
+ * @returns {boolean} Returns `true` if `object` conforms, else `false`.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': 2 };
+ *
+ * _.conformsTo(object, { 'b': function(n) { return n > 1; } });
+ * // => true
+ *
+ * _.conformsTo(object, { 'b': function(n) { return n > 2; } });
+ * // => false
+ */
+ function conformsTo(object, source) {
+ return source == null || baseConformsTo(object, source, keys(source));
+ }
+
+ /**
+ * Performs a
+ * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
+ * comparison between two values to determine if they are equivalent.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
+ * @example
+ *
+ * var object = { 'a': 1 };
+ * var other = { 'a': 1 };
+ *
+ * _.eq(object, object);
+ * // => true
+ *
+ * _.eq(object, other);
+ * // => false
+ *
+ * _.eq('a', 'a');
+ * // => true
+ *
+ * _.eq('a', Object('a'));
+ * // => false
+ *
+ * _.eq(NaN, NaN);
+ * // => true
+ */
+ function eq(value, other) {
+ return value === other || (value !== value && other !== other);
+ }
+
+ /**
+ * Checks if `value` is greater than `other`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.9.0
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if `value` is greater than `other`,
+ * else `false`.
+ * @see _.lt
+ * @example
+ *
+ * _.gt(3, 1);
+ * // => true
+ *
+ * _.gt(3, 3);
+ * // => false
+ *
+ * _.gt(1, 3);
+ * // => false
+ */
+ var gt = createRelationalOperation(baseGt);
+
+ /**
+ * Checks if `value` is greater than or equal to `other`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.9.0
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if `value` is greater than or equal to
+ * `other`, else `false`.
+ * @see _.lte
+ * @example
+ *
+ * _.gte(3, 1);
+ * // => true
+ *
+ * _.gte(3, 3);
+ * // => true
+ *
+ * _.gte(1, 3);
+ * // => false
+ */
+ var gte = createRelationalOperation(function(value, other) {
+ return value >= other;
+ });
+
+ /**
+ * Checks if `value` is likely an `arguments` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an `arguments` object,
+ * else `false`.
+ * @example
+ *
+ * _.isArguments(function() { return arguments; }());
+ * // => true
+ *
+ * _.isArguments([1, 2, 3]);
+ * // => false
+ */
+ var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) {
+ return isObjectLike(value) && hasOwnProperty.call(value, 'callee') &&
+ !propertyIsEnumerable.call(value, 'callee');
+ };
+
+ /**
+ * Checks if `value` is classified as an `Array` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an array, else `false`.
+ * @example
+ *
+ * _.isArray([1, 2, 3]);
+ * // => true
+ *
+ * _.isArray(document.body.children);
+ * // => false
+ *
+ * _.isArray('abc');
+ * // => false
+ *
+ * _.isArray(_.noop);
+ * // => false
+ */
+ var isArray = Array.isArray;
+
+ /**
+ * Checks if `value` is classified as an `ArrayBuffer` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.3.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.
+ * @example
+ *
+ * _.isArrayBuffer(new ArrayBuffer(2));
+ * // => true
+ *
+ * _.isArrayBuffer(new Array(2));
+ * // => false
+ */
+ var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer;
+
+ /**
+ * Checks if `value` is array-like. A value is considered array-like if it's
+ * not a function and has a `value.length` that's an integer greater than or
+ * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is array-like, else `false`.
+ * @example
+ *
+ * _.isArrayLike([1, 2, 3]);
+ * // => true
+ *
+ * _.isArrayLike(document.body.children);
+ * // => true
+ *
+ * _.isArrayLike('abc');
+ * // => true
+ *
+ * _.isArrayLike(_.noop);
+ * // => false
+ */
+ function isArrayLike(value) {
+ return value != null && isLength(value.length) && !isFunction(value);
+ }
+
+ /**
+ * This method is like `_.isArrayLike` except that it also checks if `value`
+ * is an object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an array-like object,
+ * else `false`.
+ * @example
+ *
+ * _.isArrayLikeObject([1, 2, 3]);
+ * // => true
+ *
+ * _.isArrayLikeObject(document.body.children);
+ * // => true
+ *
+ * _.isArrayLikeObject('abc');
+ * // => false
+ *
+ * _.isArrayLikeObject(_.noop);
+ * // => false
+ */
+ function isArrayLikeObject(value) {
+ return isObjectLike(value) && isArrayLike(value);
+ }
+
+ /**
+ * Checks if `value` is classified as a boolean primitive or object.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a boolean, else `false`.
+ * @example
+ *
+ * _.isBoolean(false);
+ * // => true
+ *
+ * _.isBoolean(null);
+ * // => false
+ */
+ function isBoolean(value) {
+ return value === true || value === false ||
+ (isObjectLike(value) && baseGetTag(value) == boolTag);
+ }
+
+ /**
+ * Checks if `value` is a buffer.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.3.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a buffer, else `false`.
+ * @example
+ *
+ * _.isBuffer(new Buffer(2));
+ * // => true
+ *
+ * _.isBuffer(new Uint8Array(2));
+ * // => false
+ */
+ var isBuffer = nativeIsBuffer || stubFalse;
+
+ /**
+ * Checks if `value` is classified as a `Date` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a date object, else `false`.
+ * @example
+ *
+ * _.isDate(new Date);
+ * // => true
+ *
+ * _.isDate('Mon April 23 2012');
+ * // => false
+ */
+ var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate;
+
+ /**
+ * Checks if `value` is likely a DOM element.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`.
+ * @example
+ *
+ * _.isElement(document.body);
+ * // => true
+ *
+ * _.isElement('<body>');
+ * // => false
+ */
+ function isElement(value) {
+ return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value);
+ }
+
+ /**
+ * Checks if `value` is an empty object, collection, map, or set.
+ *
+ * Objects are considered empty if they have no own enumerable string keyed
+ * properties.
+ *
+ * Array-like values such as `arguments` objects, arrays, buffers, strings, or
+ * jQuery-like collections are considered empty if they have a `length` of `0`.
+ * Similarly, maps and sets are considered empty if they have a `size` of `0`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is empty, else `false`.
+ * @example
+ *
+ * _.isEmpty(null);
+ * // => true
+ *
+ * _.isEmpty(true);
+ * // => true
+ *
+ * _.isEmpty(1);
+ * // => true
+ *
+ * _.isEmpty([1, 2, 3]);
+ * // => false
+ *
+ * _.isEmpty({ 'a': 1 });
+ * // => false
+ */
+ function isEmpty(value) {
+ if (value == null) {
+ return true;
+ }
+ if (isArrayLike(value) &&
+ (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' ||
+ isBuffer(value) || isTypedArray(value) || isArguments(value))) {
+ return !value.length;
+ }
+ var tag = getTag(value);
+ if (tag == mapTag || tag == setTag) {
+ return !value.size;
+ }
+ if (isPrototype(value)) {
+ return !baseKeys(value).length;
+ }
+ for (var key in value) {
+ if (hasOwnProperty.call(value, key)) {
+ return false;
+ }
+ }
+ return true;
+ }
+
+ /**
+ * Performs a deep comparison between two values to determine if they are
+ * equivalent.
+ *
+ * **Note:** This method supports comparing arrays, array buffers, booleans,
+ * date objects, error objects, maps, numbers, `Object` objects, regexes,
+ * sets, strings, symbols, and typed arrays. `Object` objects are compared
+ * by their own, not inherited, enumerable properties. Functions and DOM
+ * nodes are compared by strict equality, i.e. `===`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
+ * @example
+ *
+ * var object = { 'a': 1 };
+ * var other = { 'a': 1 };
+ *
+ * _.isEqual(object, other);
+ * // => true
+ *
+ * object === other;
+ * // => false
+ */
+ function isEqual(value, other) {
+ return baseIsEqual(value, other);
+ }
+
+ /**
+ * This method is like `_.isEqual` except that it accepts `customizer` which
+ * is invoked to compare values. If `customizer` returns `undefined`, comparisons
+ * are handled by the method instead. The `customizer` is invoked with up to
+ * six arguments: (objValue, othValue [, index|key, object, other, stack]).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @param {Function} [customizer] The function to customize comparisons.
+ * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
+ * @example
+ *
+ * function isGreeting(value) {
+ * return /^h(?:i|ello)$/.test(value);
+ * }
+ *
+ * function customizer(objValue, othValue) {
+ * if (isGreeting(objValue) && isGreeting(othValue)) {
+ * return true;
+ * }
+ * }
+ *
+ * var array = ['hello', 'goodbye'];
+ * var other = ['hi', 'goodbye'];
+ *
+ * _.isEqualWith(array, other, customizer);
+ * // => true
+ */
+ function isEqualWith(value, other, customizer) {
+ customizer = typeof customizer == 'function' ? customizer : undefined;
+ var result = customizer ? customizer(value, other) : undefined;
+ return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result;
+ }
+
+ /**
+ * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`,
+ * `SyntaxError`, `TypeError`, or `URIError` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an error object, else `false`.
+ * @example
+ *
+ * _.isError(new Error);
+ * // => true
+ *
+ * _.isError(Error);
+ * // => false
+ */
+ function isError(value) {
+ if (!isObjectLike(value)) {
+ return false;
+ }
+ var tag = baseGetTag(value);
+ return tag == errorTag || tag == domExcTag ||
+ (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value));
+ }
+
+ /**
+ * Checks if `value` is a finite primitive number.
+ *
+ * **Note:** This method is based on
+ * [`Number.isFinite`](https://mdn.io/Number/isFinite).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a finite number, else `false`.
+ * @example
+ *
+ * _.isFinite(3);
+ * // => true
+ *
+ * _.isFinite(Number.MIN_VALUE);
+ * // => true
+ *
+ * _.isFinite(Infinity);
+ * // => false
+ *
+ * _.isFinite('3');
+ * // => false
+ */
+ function isFinite(value) {
+ return typeof value == 'number' && nativeIsFinite(value);
+ }
+
+ /**
+ * Checks if `value` is classified as a `Function` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a function, else `false`.
+ * @example
+ *
+ * _.isFunction(_);
+ * // => true
+ *
+ * _.isFunction(/abc/);
+ * // => false
+ */
+ function isFunction(value) {
+ if (!isObject(value)) {
+ return false;
+ }
+ // The use of `Object#toString` avoids issues with the `typeof` operator
+ // in Safari 9 which returns 'object' for typed arrays and other constructors.
+ var tag = baseGetTag(value);
+ return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;
+ }
+
+ /**
+ * Checks if `value` is an integer.
+ *
+ * **Note:** This method is based on
+ * [`Number.isInteger`](https://mdn.io/Number/isInteger).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an integer, else `false`.
+ * @example
+ *
+ * _.isInteger(3);
+ * // => true
+ *
+ * _.isInteger(Number.MIN_VALUE);
+ * // => false
+ *
+ * _.isInteger(Infinity);
+ * // => false
+ *
+ * _.isInteger('3');
+ * // => false
+ */
+ function isInteger(value) {
+ return typeof value == 'number' && value == toInteger(value);
+ }
+
+ /**
+ * Checks if `value` is a valid array-like length.
+ *
+ * **Note:** This method is loosely based on
+ * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
+ * @example
+ *
+ * _.isLength(3);
+ * // => true
+ *
+ * _.isLength(Number.MIN_VALUE);
+ * // => false
+ *
+ * _.isLength(Infinity);
+ * // => false
+ *
+ * _.isLength('3');
+ * // => false
+ */
+ function isLength(value) {
+ return typeof value == 'number' &&
+ value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
+ }
+
+ /**
+ * Checks if `value` is the
+ * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)
+ * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is an object, else `false`.
+ * @example
+ *
+ * _.isObject({});
+ * // => true
+ *
+ * _.isObject([1, 2, 3]);
+ * // => true
+ *
+ * _.isObject(_.noop);
+ * // => true
+ *
+ * _.isObject(null);
+ * // => false
+ */
+ function isObject(value) {
+ var type = typeof value;
+ return value != null && (type == 'object' || type == 'function');
+ }
+
+ /**
+ * Checks if `value` is object-like. A value is object-like if it's not `null`
+ * and has a `typeof` result of "object".
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is object-like, else `false`.
+ * @example
+ *
+ * _.isObjectLike({});
+ * // => true
+ *
+ * _.isObjectLike([1, 2, 3]);
+ * // => true
+ *
+ * _.isObjectLike(_.noop);
+ * // => false
+ *
+ * _.isObjectLike(null);
+ * // => false
+ */
+ function isObjectLike(value) {
+ return value != null && typeof value == 'object';
+ }
+
+ /**
+ * Checks if `value` is classified as a `Map` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.3.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a map, else `false`.
+ * @example
+ *
+ * _.isMap(new Map);
+ * // => true
+ *
+ * _.isMap(new WeakMap);
+ * // => false
+ */
+ var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap;
+
+ /**
+ * Performs a partial deep comparison between `object` and `source` to
+ * determine if `object` contains equivalent property values.
+ *
+ * **Note:** This method is equivalent to `_.matches` when `source` is
+ * partially applied.
+ *
+ * Partial comparisons will match empty array and empty object `source`
+ * values against any array or object value, respectively. See `_.isEqual`
+ * for a list of supported value comparisons.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Lang
+ * @param {Object} object The object to inspect.
+ * @param {Object} source The object of property values to match.
+ * @returns {boolean} Returns `true` if `object` is a match, else `false`.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': 2 };
+ *
+ * _.isMatch(object, { 'b': 2 });
+ * // => true
+ *
+ * _.isMatch(object, { 'b': 1 });
+ * // => false
+ */
+ function isMatch(object, source) {
+ return object === source || baseIsMatch(object, source, getMatchData(source));
+ }
+
+ /**
+ * This method is like `_.isMatch` except that it accepts `customizer` which
+ * is invoked to compare values. If `customizer` returns `undefined`, comparisons
+ * are handled by the method instead. The `customizer` is invoked with five
+ * arguments: (objValue, srcValue, index|key, object, source).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {Object} object The object to inspect.
+ * @param {Object} source The object of property values to match.
+ * @param {Function} [customizer] The function to customize comparisons.
+ * @returns {boolean} Returns `true` if `object` is a match, else `false`.
+ * @example
+ *
+ * function isGreeting(value) {
+ * return /^h(?:i|ello)$/.test(value);
+ * }
+ *
+ * function customizer(objValue, srcValue) {
+ * if (isGreeting(objValue) && isGreeting(srcValue)) {
+ * return true;
+ * }
+ * }
+ *
+ * var object = { 'greeting': 'hello' };
+ * var source = { 'greeting': 'hi' };
+ *
+ * _.isMatchWith(object, source, customizer);
+ * // => true
+ */
+ function isMatchWith(object, source, customizer) {
+ customizer = typeof customizer == 'function' ? customizer : undefined;
+ return baseIsMatch(object, source, getMatchData(source), customizer);
+ }
+
+ /**
+ * Checks if `value` is `NaN`.
+ *
+ * **Note:** This method is based on
+ * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as
+ * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for
+ * `undefined` and other non-number values.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.
+ * @example
+ *
+ * _.isNaN(NaN);
+ * // => true
+ *
+ * _.isNaN(new Number(NaN));
+ * // => true
+ *
+ * isNaN(undefined);
+ * // => true
+ *
+ * _.isNaN(undefined);
+ * // => false
+ */
+ function isNaN(value) {
+ // An `NaN` primitive is the only value that is not equal to itself.
+ // Perform the `toStringTag` check first to avoid errors with some
+ // ActiveX objects in IE.
+ return isNumber(value) && value != +value;
+ }
+
+ /**
+ * Checks if `value` is a pristine native function.
+ *
+ * **Note:** This method can't reliably detect native functions in the presence
+ * of the core-js package because core-js circumvents this kind of detection.
+ * Despite multiple requests, the core-js maintainer has made it clear: any
+ * attempt to fix the detection will be obstructed. As a result, we're left
+ * with little choice but to throw an error. Unfortunately, this also affects
+ * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill),
+ * which rely on core-js.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a native function,
+ * else `false`.
+ * @example
+ *
+ * _.isNative(Array.prototype.push);
+ * // => true
+ *
+ * _.isNative(_);
+ * // => false
+ */
+ function isNative(value) {
+ if (isMaskable(value)) {
+ throw new Error(CORE_ERROR_TEXT);
+ }
+ return baseIsNative(value);
+ }
+
+ /**
+ * Checks if `value` is `null`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is `null`, else `false`.
+ * @example
+ *
+ * _.isNull(null);
+ * // => true
+ *
+ * _.isNull(void 0);
+ * // => false
+ */
+ function isNull(value) {
+ return value === null;
+ }
+
+ /**
+ * Checks if `value` is `null` or `undefined`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is nullish, else `false`.
+ * @example
+ *
+ * _.isNil(null);
+ * // => true
+ *
+ * _.isNil(void 0);
+ * // => true
+ *
+ * _.isNil(NaN);
+ * // => false
+ */
+ function isNil(value) {
+ return value == null;
+ }
+
+ /**
+ * Checks if `value` is classified as a `Number` primitive or object.
+ *
+ * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are
+ * classified as numbers, use the `_.isFinite` method.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a number, else `false`.
+ * @example
+ *
+ * _.isNumber(3);
+ * // => true
+ *
+ * _.isNumber(Number.MIN_VALUE);
+ * // => true
+ *
+ * _.isNumber(Infinity);
+ * // => true
+ *
+ * _.isNumber('3');
+ * // => false
+ */
+ function isNumber(value) {
+ return typeof value == 'number' ||
+ (isObjectLike(value) && baseGetTag(value) == numberTag);
+ }
+
+ /**
+ * Checks if `value` is a plain object, that is, an object created by the
+ * `Object` constructor or one with a `[[Prototype]]` of `null`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.8.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a plain object, else `false`.
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * }
+ *
+ * _.isPlainObject(new Foo);
+ * // => false
+ *
+ * _.isPlainObject([1, 2, 3]);
+ * // => false
+ *
+ * _.isPlainObject({ 'x': 0, 'y': 0 });
+ * // => true
+ *
+ * _.isPlainObject(Object.create(null));
+ * // => true
+ */
+ function isPlainObject(value) {
+ if (!isObjectLike(value) || baseGetTag(value) != objectTag) {
+ return false;
+ }
+ var proto = getPrototype(value);
+ if (proto === null) {
+ return true;
+ }
+ var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor;
+ return typeof Ctor == 'function' && Ctor instanceof Ctor &&
+ funcToString.call(Ctor) == objectCtorString;
+ }
+
+ /**
+ * Checks if `value` is classified as a `RegExp` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.1.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.
+ * @example
+ *
+ * _.isRegExp(/abc/);
+ * // => true
+ *
+ * _.isRegExp('/abc/');
+ * // => false
+ */
+ var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp;
+
+ /**
+ * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754
+ * double precision number which isn't the result of a rounded unsafe integer.
+ *
+ * **Note:** This method is based on
+ * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`.
+ * @example
+ *
+ * _.isSafeInteger(3);
+ * // => true
+ *
+ * _.isSafeInteger(Number.MIN_VALUE);
+ * // => false
+ *
+ * _.isSafeInteger(Infinity);
+ * // => false
+ *
+ * _.isSafeInteger('3');
+ * // => false
+ */
+ function isSafeInteger(value) {
+ return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER;
+ }
+
+ /**
+ * Checks if `value` is classified as a `Set` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.3.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a set, else `false`.
+ * @example
+ *
+ * _.isSet(new Set);
+ * // => true
+ *
+ * _.isSet(new WeakSet);
+ * // => false
+ */
+ var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet;
+
+ /**
+ * Checks if `value` is classified as a `String` primitive or object.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a string, else `false`.
+ * @example
+ *
+ * _.isString('abc');
+ * // => true
+ *
+ * _.isString(1);
+ * // => false
+ */
+ function isString(value) {
+ return typeof value == 'string' ||
+ (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag);
+ }
+
+ /**
+ * Checks if `value` is classified as a `Symbol` primitive or object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a symbol, else `false`.
+ * @example
+ *
+ * _.isSymbol(Symbol.iterator);
+ * // => true
+ *
+ * _.isSymbol('abc');
+ * // => false
+ */
+ function isSymbol(value) {
+ return typeof value == 'symbol' ||
+ (isObjectLike(value) && baseGetTag(value) == symbolTag);
+ }
+
+ /**
+ * Checks if `value` is classified as a typed array.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
+ * @example
+ *
+ * _.isTypedArray(new Uint8Array);
+ * // => true
+ *
+ * _.isTypedArray([]);
+ * // => false
+ */
+ var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;
+
+ /**
+ * Checks if `value` is `undefined`.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`.
+ * @example
+ *
+ * _.isUndefined(void 0);
+ * // => true
+ *
+ * _.isUndefined(null);
+ * // => false
+ */
+ function isUndefined(value) {
+ return value === undefined;
+ }
+
+ /**
+ * Checks if `value` is classified as a `WeakMap` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.3.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a weak map, else `false`.
+ * @example
+ *
+ * _.isWeakMap(new WeakMap);
+ * // => true
+ *
+ * _.isWeakMap(new Map);
+ * // => false
+ */
+ function isWeakMap(value) {
+ return isObjectLike(value) && getTag(value) == weakMapTag;
+ }
+
+ /**
+ * Checks if `value` is classified as a `WeakSet` object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.3.0
+ * @category Lang
+ * @param {*} value The value to check.
+ * @returns {boolean} Returns `true` if `value` is a weak set, else `false`.
+ * @example
+ *
+ * _.isWeakSet(new WeakSet);
+ * // => true
+ *
+ * _.isWeakSet(new Set);
+ * // => false
+ */
+ function isWeakSet(value) {
+ return isObjectLike(value) && baseGetTag(value) == weakSetTag;
+ }
+
+ /**
+ * Checks if `value` is less than `other`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.9.0
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if `value` is less than `other`,
+ * else `false`.
+ * @see _.gt
+ * @example
+ *
+ * _.lt(1, 3);
+ * // => true
+ *
+ * _.lt(3, 3);
+ * // => false
+ *
+ * _.lt(3, 1);
+ * // => false
+ */
+ var lt = createRelationalOperation(baseLt);
+
+ /**
+ * Checks if `value` is less than or equal to `other`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.9.0
+ * @category Lang
+ * @param {*} value The value to compare.
+ * @param {*} other The other value to compare.
+ * @returns {boolean} Returns `true` if `value` is less than or equal to
+ * `other`, else `false`.
+ * @see _.gte
+ * @example
+ *
+ * _.lte(1, 3);
+ * // => true
+ *
+ * _.lte(3, 3);
+ * // => true
+ *
+ * _.lte(3, 1);
+ * // => false
+ */
+ var lte = createRelationalOperation(function(value, other) {
+ return value <= other;
+ });
+
+ /**
+ * Converts `value` to an array.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Lang
+ * @param {*} value The value to convert.
+ * @returns {Array} Returns the converted array.
+ * @example
+ *
+ * _.toArray({ 'a': 1, 'b': 2 });
+ * // => [1, 2]
+ *
+ * _.toArray('abc');
+ * // => ['a', 'b', 'c']
+ *
+ * _.toArray(1);
+ * // => []
+ *
+ * _.toArray(null);
+ * // => []
+ */
+ function toArray(value) {
+ if (!value) {
+ return [];
+ }
+ if (isArrayLike(value)) {
+ return isString(value) ? stringToArray(value) : copyArray(value);
+ }
+ if (symIterator && value[symIterator]) {
+ return iteratorToArray(value[symIterator]());
+ }
+ var tag = getTag(value),
+ func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values);
+
+ return func(value);
+ }
+
+ /**
+ * Converts `value` to a finite number.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.12.0
+ * @category Lang
+ * @param {*} value The value to convert.
+ * @returns {number} Returns the converted number.
+ * @example
+ *
+ * _.toFinite(3.2);
+ * // => 3.2
+ *
+ * _.toFinite(Number.MIN_VALUE);
+ * // => 5e-324
+ *
+ * _.toFinite(Infinity);
+ * // => 1.7976931348623157e+308
+ *
+ * _.toFinite('3.2');
+ * // => 3.2
+ */
+ function toFinite(value) {
+ if (!value) {
+ return value === 0 ? value : 0;
+ }
+ value = toNumber(value);
+ if (value === INFINITY || value === -INFINITY) {
+ var sign = (value < 0 ? -1 : 1);
+ return sign * MAX_INTEGER;
+ }
+ return value === value ? value : 0;
+ }
+
+ /**
+ * Converts `value` to an integer.
+ *
+ * **Note:** This method is loosely based on
+ * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to convert.
+ * @returns {number} Returns the converted integer.
+ * @example
+ *
+ * _.toInteger(3.2);
+ * // => 3
+ *
+ * _.toInteger(Number.MIN_VALUE);
+ * // => 0
+ *
+ * _.toInteger(Infinity);
+ * // => 1.7976931348623157e+308
+ *
+ * _.toInteger('3.2');
+ * // => 3
+ */
+ function toInteger(value) {
+ var result = toFinite(value),
+ remainder = result % 1;
+
+ return result === result ? (remainder ? result - remainder : result) : 0;
+ }
+
+ /**
+ * Converts `value` to an integer suitable for use as the length of an
+ * array-like object.
+ *
+ * **Note:** This method is based on
+ * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to convert.
+ * @returns {number} Returns the converted integer.
+ * @example
+ *
+ * _.toLength(3.2);
+ * // => 3
+ *
+ * _.toLength(Number.MIN_VALUE);
+ * // => 0
+ *
+ * _.toLength(Infinity);
+ * // => 4294967295
+ *
+ * _.toLength('3.2');
+ * // => 3
+ */
+ function toLength(value) {
+ return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0;
+ }
+
+ /**
+ * Converts `value` to a number.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to process.
+ * @returns {number} Returns the number.
+ * @example
+ *
+ * _.toNumber(3.2);
+ * // => 3.2
+ *
+ * _.toNumber(Number.MIN_VALUE);
+ * // => 5e-324
+ *
+ * _.toNumber(Infinity);
+ * // => Infinity
+ *
+ * _.toNumber('3.2');
+ * // => 3.2
+ */
+ function toNumber(value) {
+ if (typeof value == 'number') {
+ return value;
+ }
+ if (isSymbol(value)) {
+ return NAN;
+ }
+ if (isObject(value)) {
+ var other = typeof value.valueOf == 'function' ? value.valueOf() : value;
+ value = isObject(other) ? (other + '') : other;
+ }
+ if (typeof value != 'string') {
+ return value === 0 ? value : +value;
+ }
+ value = value.replace(reTrim, '');
+ var isBinary = reIsBinary.test(value);
+ return (isBinary || reIsOctal.test(value))
+ ? freeParseInt(value.slice(2), isBinary ? 2 : 8)
+ : (reIsBadHex.test(value) ? NAN : +value);
+ }
+
+ /**
+ * Converts `value` to a plain object flattening inherited enumerable string
+ * keyed properties of `value` to own properties of the plain object.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Lang
+ * @param {*} value The value to convert.
+ * @returns {Object} Returns the converted plain object.
+ * @example
+ *
+ * function Foo() {
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.assign({ 'a': 1 }, new Foo);
+ * // => { 'a': 1, 'b': 2 }
+ *
+ * _.assign({ 'a': 1 }, _.toPlainObject(new Foo));
+ * // => { 'a': 1, 'b': 2, 'c': 3 }
+ */
+ function toPlainObject(value) {
+ return copyObject(value, keysIn(value));
+ }
+
+ /**
+ * Converts `value` to a safe integer. A safe integer can be compared and
+ * represented correctly.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to convert.
+ * @returns {number} Returns the converted integer.
+ * @example
+ *
+ * _.toSafeInteger(3.2);
+ * // => 3
+ *
+ * _.toSafeInteger(Number.MIN_VALUE);
+ * // => 0
+ *
+ * _.toSafeInteger(Infinity);
+ * // => 9007199254740991
+ *
+ * _.toSafeInteger('3.2');
+ * // => 3
+ */
+ function toSafeInteger(value) {
+ return value
+ ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER)
+ : (value === 0 ? value : 0);
+ }
+
+ /**
+ * Converts `value` to a string. An empty string is returned for `null`
+ * and `undefined` values. The sign of `-0` is preserved.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Lang
+ * @param {*} value The value to convert.
+ * @returns {string} Returns the converted string.
+ * @example
+ *
+ * _.toString(null);
+ * // => ''
+ *
+ * _.toString(-0);
+ * // => '-0'
+ *
+ * _.toString([1, 2, 3]);
+ * // => '1,2,3'
+ */
+ function toString(value) {
+ return value == null ? '' : baseToString(value);
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Assigns own enumerable string keyed properties of source objects to the
+ * destination object. Source objects are applied from left to right.
+ * Subsequent sources overwrite property assignments of previous sources.
+ *
+ * **Note:** This method mutates `object` and is loosely based on
+ * [`Object.assign`](https://mdn.io/Object/assign).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.10.0
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} [sources] The source objects.
+ * @returns {Object} Returns `object`.
+ * @see _.assignIn
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * }
+ *
+ * function Bar() {
+ * this.c = 3;
+ * }
+ *
+ * Foo.prototype.b = 2;
+ * Bar.prototype.d = 4;
+ *
+ * _.assign({ 'a': 0 }, new Foo, new Bar);
+ * // => { 'a': 1, 'c': 3 }
+ */
+ var assign = createAssigner(function(object, source) {
+ if (isPrototype(source) || isArrayLike(source)) {
+ copyObject(source, keys(source), object);
+ return;
+ }
+ for (var key in source) {
+ if (hasOwnProperty.call(source, key)) {
+ assignValue(object, key, source[key]);
+ }
+ }
+ });
+
+ /**
+ * This method is like `_.assign` except that it iterates over own and
+ * inherited source properties.
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @alias extend
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} [sources] The source objects.
+ * @returns {Object} Returns `object`.
+ * @see _.assign
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * }
+ *
+ * function Bar() {
+ * this.c = 3;
+ * }
+ *
+ * Foo.prototype.b = 2;
+ * Bar.prototype.d = 4;
+ *
+ * _.assignIn({ 'a': 0 }, new Foo, new Bar);
+ * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 }
+ */
+ var assignIn = createAssigner(function(object, source) {
+ copyObject(source, keysIn(source), object);
+ });
+
+ /**
+ * This method is like `_.assignIn` except that it accepts `customizer`
+ * which is invoked to produce the assigned values. If `customizer` returns
+ * `undefined`, assignment is handled by the method instead. The `customizer`
+ * is invoked with five arguments: (objValue, srcValue, key, object, source).
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @alias extendWith
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} sources The source objects.
+ * @param {Function} [customizer] The function to customize assigned values.
+ * @returns {Object} Returns `object`.
+ * @see _.assignWith
+ * @example
+ *
+ * function customizer(objValue, srcValue) {
+ * return _.isUndefined(objValue) ? srcValue : objValue;
+ * }
+ *
+ * var defaults = _.partialRight(_.assignInWith, customizer);
+ *
+ * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
+ * // => { 'a': 1, 'b': 2 }
+ */
+ var assignInWith = createAssigner(function(object, source, srcIndex, customizer) {
+ copyObject(source, keysIn(source), object, customizer);
+ });
+
+ /**
+ * This method is like `_.assign` except that it accepts `customizer`
+ * which is invoked to produce the assigned values. If `customizer` returns
+ * `undefined`, assignment is handled by the method instead. The `customizer`
+ * is invoked with five arguments: (objValue, srcValue, key, object, source).
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} sources The source objects.
+ * @param {Function} [customizer] The function to customize assigned values.
+ * @returns {Object} Returns `object`.
+ * @see _.assignInWith
+ * @example
+ *
+ * function customizer(objValue, srcValue) {
+ * return _.isUndefined(objValue) ? srcValue : objValue;
+ * }
+ *
+ * var defaults = _.partialRight(_.assignWith, customizer);
+ *
+ * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
+ * // => { 'a': 1, 'b': 2 }
+ */
+ var assignWith = createAssigner(function(object, source, srcIndex, customizer) {
+ copyObject(source, keys(source), object, customizer);
+ });
+
+ /**
+ * Creates an array of values corresponding to `paths` of `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.0.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {...(string|string[])} [paths] The property paths to pick.
+ * @returns {Array} Returns the picked values.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };
+ *
+ * _.at(object, ['a[0].b.c', 'a[1]']);
+ * // => [3, 4]
+ */
+ var at = flatRest(baseAt);
+
+ /**
+ * Creates an object that inherits from the `prototype` object. If a
+ * `properties` object is given, its own enumerable string keyed properties
+ * are assigned to the created object.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.3.0
+ * @category Object
+ * @param {Object} prototype The object to inherit from.
+ * @param {Object} [properties] The properties to assign to the object.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * function Shape() {
+ * this.x = 0;
+ * this.y = 0;
+ * }
+ *
+ * function Circle() {
+ * Shape.call(this);
+ * }
+ *
+ * Circle.prototype = _.create(Shape.prototype, {
+ * 'constructor': Circle
+ * });
+ *
+ * var circle = new Circle;
+ * circle instanceof Circle;
+ * // => true
+ *
+ * circle instanceof Shape;
+ * // => true
+ */
+ function create(prototype, properties) {
+ var result = baseCreate(prototype);
+ return properties == null ? result : baseAssign(result, properties);
+ }
+
+ /**
+ * Assigns own and inherited enumerable string keyed properties of source
+ * objects to the destination object for all destination properties that
+ * resolve to `undefined`. Source objects are applied from left to right.
+ * Once a property is set, additional values of the same property are ignored.
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} [sources] The source objects.
+ * @returns {Object} Returns `object`.
+ * @see _.defaultsDeep
+ * @example
+ *
+ * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });
+ * // => { 'a': 1, 'b': 2 }
+ */
+ var defaults = baseRest(function(object, sources) {
+ object = Object(object);
+
+ var index = -1;
+ var length = sources.length;
+ var guard = length > 2 ? sources[2] : undefined;
+
+ if (guard && isIterateeCall(sources[0], sources[1], guard)) {
+ length = 1;
+ }
+
+ while (++index < length) {
+ var source = sources[index];
+ var props = keysIn(source);
+ var propsIndex = -1;
+ var propsLength = props.length;
+
+ while (++propsIndex < propsLength) {
+ var key = props[propsIndex];
+ var value = object[key];
+
+ if (value === undefined ||
+ (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) {
+ object[key] = source[key];
+ }
+ }
+ }
+
+ return object;
+ });
+
+ /**
+ * This method is like `_.defaults` except that it recursively assigns
+ * default properties.
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.10.0
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} [sources] The source objects.
+ * @returns {Object} Returns `object`.
+ * @see _.defaults
+ * @example
+ *
+ * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } });
+ * // => { 'a': { 'b': 2, 'c': 3 } }
+ */
+ var defaultsDeep = baseRest(function(args) {
+ args.push(undefined, customDefaultsMerge);
+ return apply(mergeWith, undefined, args);
+ });
+
+ /**
+ * This method is like `_.find` except that it returns the key of the first
+ * element `predicate` returns truthy for instead of the element itself.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.1.0
+ * @category Object
+ * @param {Object} object The object to inspect.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {string|undefined} Returns the key of the matched element,
+ * else `undefined`.
+ * @example
+ *
+ * var users = {
+ * 'barney': { 'age': 36, 'active': true },
+ * 'fred': { 'age': 40, 'active': false },
+ * 'pebbles': { 'age': 1, 'active': true }
+ * };
+ *
+ * _.findKey(users, function(o) { return o.age < 40; });
+ * // => 'barney' (iteration order is not guaranteed)
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.findKey(users, { 'age': 1, 'active': true });
+ * // => 'pebbles'
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.findKey(users, ['active', false]);
+ * // => 'fred'
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.findKey(users, 'active');
+ * // => 'barney'
+ */
+ function findKey(object, predicate) {
+ return baseFindKey(object, getIteratee(predicate, 3), baseForOwn);
+ }
+
+ /**
+ * This method is like `_.findKey` except that it iterates over elements of
+ * a collection in the opposite order.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Object
+ * @param {Object} object The object to inspect.
+ * @param {Function} [predicate=_.identity] The function invoked per iteration.
+ * @returns {string|undefined} Returns the key of the matched element,
+ * else `undefined`.
+ * @example
+ *
+ * var users = {
+ * 'barney': { 'age': 36, 'active': true },
+ * 'fred': { 'age': 40, 'active': false },
+ * 'pebbles': { 'age': 1, 'active': true }
+ * };
+ *
+ * _.findLastKey(users, function(o) { return o.age < 40; });
+ * // => returns 'pebbles' assuming `_.findKey` returns 'barney'
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.findLastKey(users, { 'age': 36, 'active': true });
+ * // => 'barney'
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.findLastKey(users, ['active', false]);
+ * // => 'fred'
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.findLastKey(users, 'active');
+ * // => 'pebbles'
+ */
+ function findLastKey(object, predicate) {
+ return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight);
+ }
+
+ /**
+ * Iterates over own and inherited enumerable string keyed properties of an
+ * object and invokes `iteratee` for each property. The iteratee is invoked
+ * with three arguments: (value, key, object). Iteratee functions may exit
+ * iteration early by explicitly returning `false`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.3.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Object} Returns `object`.
+ * @see _.forInRight
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.forIn(new Foo, function(value, key) {
+ * console.log(key);
+ * });
+ * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed).
+ */
+ function forIn(object, iteratee) {
+ return object == null
+ ? object
+ : baseFor(object, getIteratee(iteratee, 3), keysIn);
+ }
+
+ /**
+ * This method is like `_.forIn` except that it iterates over properties of
+ * `object` in the opposite order.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Object} Returns `object`.
+ * @see _.forIn
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.forInRight(new Foo, function(value, key) {
+ * console.log(key);
+ * });
+ * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'.
+ */
+ function forInRight(object, iteratee) {
+ return object == null
+ ? object
+ : baseForRight(object, getIteratee(iteratee, 3), keysIn);
+ }
+
+ /**
+ * Iterates over own enumerable string keyed properties of an object and
+ * invokes `iteratee` for each property. The iteratee is invoked with three
+ * arguments: (value, key, object). Iteratee functions may exit iteration
+ * early by explicitly returning `false`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.3.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Object} Returns `object`.
+ * @see _.forOwnRight
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.forOwn(new Foo, function(value, key) {
+ * console.log(key);
+ * });
+ * // => Logs 'a' then 'b' (iteration order is not guaranteed).
+ */
+ function forOwn(object, iteratee) {
+ return object && baseForOwn(object, getIteratee(iteratee, 3));
+ }
+
+ /**
+ * This method is like `_.forOwn` except that it iterates over properties of
+ * `object` in the opposite order.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.0.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Object} Returns `object`.
+ * @see _.forOwn
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.forOwnRight(new Foo, function(value, key) {
+ * console.log(key);
+ * });
+ * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'.
+ */
+ function forOwnRight(object, iteratee) {
+ return object && baseForOwnRight(object, getIteratee(iteratee, 3));
+ }
+
+ /**
+ * Creates an array of function property names from own enumerable properties
+ * of `object`.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The object to inspect.
+ * @returns {Array} Returns the function names.
+ * @see _.functionsIn
+ * @example
+ *
+ * function Foo() {
+ * this.a = _.constant('a');
+ * this.b = _.constant('b');
+ * }
+ *
+ * Foo.prototype.c = _.constant('c');
+ *
+ * _.functions(new Foo);
+ * // => ['a', 'b']
+ */
+ function functions(object) {
+ return object == null ? [] : baseFunctions(object, keys(object));
+ }
+
+ /**
+ * Creates an array of function property names from own and inherited
+ * enumerable properties of `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The object to inspect.
+ * @returns {Array} Returns the function names.
+ * @see _.functions
+ * @example
+ *
+ * function Foo() {
+ * this.a = _.constant('a');
+ * this.b = _.constant('b');
+ * }
+ *
+ * Foo.prototype.c = _.constant('c');
+ *
+ * _.functionsIn(new Foo);
+ * // => ['a', 'b', 'c']
+ */
+ function functionsIn(object) {
+ return object == null ? [] : baseFunctions(object, keysIn(object));
+ }
+
+ /**
+ * Gets the value at `path` of `object`. If the resolved value is
+ * `undefined`, the `defaultValue` is returned in its place.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.7.0
+ * @category Object
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path of the property to get.
+ * @param {*} [defaultValue] The value returned for `undefined` resolved values.
+ * @returns {*} Returns the resolved value.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c': 3 } }] };
+ *
+ * _.get(object, 'a[0].b.c');
+ * // => 3
+ *
+ * _.get(object, ['a', '0', 'b', 'c']);
+ * // => 3
+ *
+ * _.get(object, 'a.b.c', 'default');
+ * // => 'default'
+ */
+ function get(object, path, defaultValue) {
+ var result = object == null ? undefined : baseGet(object, path);
+ return result === undefined ? defaultValue : result;
+ }
+
+ /**
+ * Checks if `path` is a direct property of `object`.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path to check.
+ * @returns {boolean} Returns `true` if `path` exists, else `false`.
+ * @example
+ *
+ * var object = { 'a': { 'b': 2 } };
+ * var other = _.create({ 'a': _.create({ 'b': 2 }) });
+ *
+ * _.has(object, 'a');
+ * // => true
+ *
+ * _.has(object, 'a.b');
+ * // => true
+ *
+ * _.has(object, ['a', 'b']);
+ * // => true
+ *
+ * _.has(other, 'a');
+ * // => false
+ */
+ function has(object, path) {
+ return object != null && hasPath(object, path, baseHas);
+ }
+
+ /**
+ * Checks if `path` is a direct or inherited property of `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path to check.
+ * @returns {boolean} Returns `true` if `path` exists, else `false`.
+ * @example
+ *
+ * var object = _.create({ 'a': _.create({ 'b': 2 }) });
+ *
+ * _.hasIn(object, 'a');
+ * // => true
+ *
+ * _.hasIn(object, 'a.b');
+ * // => true
+ *
+ * _.hasIn(object, ['a', 'b']);
+ * // => true
+ *
+ * _.hasIn(object, 'b');
+ * // => false
+ */
+ function hasIn(object, path) {
+ return object != null && hasPath(object, path, baseHasIn);
+ }
+
+ /**
+ * Creates an object composed of the inverted keys and values of `object`.
+ * If `object` contains duplicate values, subsequent values overwrite
+ * property assignments of previous values.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.7.0
+ * @category Object
+ * @param {Object} object The object to invert.
+ * @returns {Object} Returns the new inverted object.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': 2, 'c': 1 };
+ *
+ * _.invert(object);
+ * // => { '1': 'c', '2': 'b' }
+ */
+ var invert = createInverter(function(result, value, key) {
+ if (value != null &&
+ typeof value.toString != 'function') {
+ value = nativeObjectToString.call(value);
+ }
+
+ result[value] = key;
+ }, constant(identity));
+
+ /**
+ * This method is like `_.invert` except that the inverted object is generated
+ * from the results of running each element of `object` thru `iteratee`. The
+ * corresponding inverted value of each inverted key is an array of keys
+ * responsible for generating the inverted value. The iteratee is invoked
+ * with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.1.0
+ * @category Object
+ * @param {Object} object The object to invert.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {Object} Returns the new inverted object.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': 2, 'c': 1 };
+ *
+ * _.invertBy(object);
+ * // => { '1': ['a', 'c'], '2': ['b'] }
+ *
+ * _.invertBy(object, function(value) {
+ * return 'group' + value;
+ * });
+ * // => { 'group1': ['a', 'c'], 'group2': ['b'] }
+ */
+ var invertBy = createInverter(function(result, value, key) {
+ if (value != null &&
+ typeof value.toString != 'function') {
+ value = nativeObjectToString.call(value);
+ }
+
+ if (hasOwnProperty.call(result, value)) {
+ result[value].push(key);
+ } else {
+ result[value] = [key];
+ }
+ }, getIteratee);
+
+ /**
+ * Invokes the method at `path` of `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path of the method to invoke.
+ * @param {...*} [args] The arguments to invoke the method with.
+ * @returns {*} Returns the result of the invoked method.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] };
+ *
+ * _.invoke(object, 'a[0].b.c.slice', 1, 3);
+ * // => [2, 3]
+ */
+ var invoke = baseRest(baseInvoke);
+
+ /**
+ * Creates an array of the own enumerable property names of `object`.
+ *
+ * **Note:** Non-object values are coerced to objects. See the
+ * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
+ * for more details.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names.
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.keys(new Foo);
+ * // => ['a', 'b'] (iteration order is not guaranteed)
+ *
+ * _.keys('hi');
+ * // => ['0', '1']
+ */
+ function keys(object) {
+ return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);
+ }
+
+ /**
+ * Creates an array of the own and inherited enumerable property names of `object`.
+ *
+ * **Note:** Non-object values are coerced to objects.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property names.
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.keysIn(new Foo);
+ * // => ['a', 'b', 'c'] (iteration order is not guaranteed)
+ */
+ function keysIn(object) {
+ return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object);
+ }
+
+ /**
+ * The opposite of `_.mapValues`; this method creates an object with the
+ * same values as `object` and keys generated by running each own enumerable
+ * string keyed property of `object` thru `iteratee`. The iteratee is invoked
+ * with three arguments: (value, key, object).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.8.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Object} Returns the new mapped object.
+ * @see _.mapValues
+ * @example
+ *
+ * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) {
+ * return key + value;
+ * });
+ * // => { 'a1': 1, 'b2': 2 }
+ */
+ function mapKeys(object, iteratee) {
+ var result = {};
+ iteratee = getIteratee(iteratee, 3);
+
+ baseForOwn(object, function(value, key, object) {
+ baseAssignValue(result, iteratee(value, key, object), value);
+ });
+ return result;
+ }
+
+ /**
+ * Creates an object with the same keys as `object` and values generated
+ * by running each own enumerable string keyed property of `object` thru
+ * `iteratee`. The iteratee is invoked with three arguments:
+ * (value, key, object).
+ *
+ * @static
+ * @memberOf _
+ * @since 2.4.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Object} Returns the new mapped object.
+ * @see _.mapKeys
+ * @example
+ *
+ * var users = {
+ * 'fred': { 'user': 'fred', 'age': 40 },
+ * 'pebbles': { 'user': 'pebbles', 'age': 1 }
+ * };
+ *
+ * _.mapValues(users, function(o) { return o.age; });
+ * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.mapValues(users, 'age');
+ * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)
+ */
+ function mapValues(object, iteratee) {
+ var result = {};
+ iteratee = getIteratee(iteratee, 3);
+
+ baseForOwn(object, function(value, key, object) {
+ baseAssignValue(result, key, iteratee(value, key, object));
+ });
+ return result;
+ }
+
+ /**
+ * This method is like `_.assign` except that it recursively merges own and
+ * inherited enumerable string keyed properties of source objects into the
+ * destination object. Source properties that resolve to `undefined` are
+ * skipped if a destination value exists. Array and plain object properties
+ * are merged recursively. Other objects and value types are overridden by
+ * assignment. Source objects are applied from left to right. Subsequent
+ * sources overwrite property assignments of previous sources.
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.5.0
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} [sources] The source objects.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * var object = {
+ * 'a': [{ 'b': 2 }, { 'd': 4 }]
+ * };
+ *
+ * var other = {
+ * 'a': [{ 'c': 3 }, { 'e': 5 }]
+ * };
+ *
+ * _.merge(object, other);
+ * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] }
+ */
+ var merge = createAssigner(function(object, source, srcIndex) {
+ baseMerge(object, source, srcIndex);
+ });
+
+ /**
+ * This method is like `_.merge` except that it accepts `customizer` which
+ * is invoked to produce the merged values of the destination and source
+ * properties. If `customizer` returns `undefined`, merging is handled by the
+ * method instead. The `customizer` is invoked with six arguments:
+ * (objValue, srcValue, key, object, source, stack).
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The destination object.
+ * @param {...Object} sources The source objects.
+ * @param {Function} customizer The function to customize assigned values.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * function customizer(objValue, srcValue) {
+ * if (_.isArray(objValue)) {
+ * return objValue.concat(srcValue);
+ * }
+ * }
+ *
+ * var object = { 'a': [1], 'b': [2] };
+ * var other = { 'a': [3], 'b': [4] };
+ *
+ * _.mergeWith(object, other, customizer);
+ * // => { 'a': [1, 3], 'b': [2, 4] }
+ */
+ var mergeWith = createAssigner(function(object, source, srcIndex, customizer) {
+ baseMerge(object, source, srcIndex, customizer);
+ });
+
+ /**
+ * The opposite of `_.pick`; this method creates an object composed of the
+ * own and inherited enumerable property paths of `object` that are not omitted.
+ *
+ * **Note:** This method is considerably slower than `_.pick`.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The source object.
+ * @param {...(string|string[])} [paths] The property paths to omit.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': '2', 'c': 3 };
+ *
+ * _.omit(object, ['a', 'c']);
+ * // => { 'b': '2' }
+ */
+ var omit = flatRest(function(object, paths) {
+ var result = {};
+ if (object == null) {
+ return result;
+ }
+ var isDeep = false;
+ paths = arrayMap(paths, function(path) {
+ path = castPath(path, object);
+ isDeep || (isDeep = path.length > 1);
+ return path;
+ });
+ copyObject(object, getAllKeysIn(object), result);
+ if (isDeep) {
+ result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone);
+ }
+ var length = paths.length;
+ while (length--) {
+ baseUnset(result, paths[length]);
+ }
+ return result;
+ });
+
+ /**
+ * The opposite of `_.pickBy`; this method creates an object composed of
+ * the own and inherited enumerable string keyed properties of `object` that
+ * `predicate` doesn't return truthy for. The predicate is invoked with two
+ * arguments: (value, key).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The source object.
+ * @param {Function} [predicate=_.identity] The function invoked per property.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': '2', 'c': 3 };
+ *
+ * _.omitBy(object, _.isNumber);
+ * // => { 'b': '2' }
+ */
+ function omitBy(object, predicate) {
+ return pickBy(object, negate(getIteratee(predicate)));
+ }
+
+ /**
+ * Creates an object composed of the picked `object` properties.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The source object.
+ * @param {...(string|string[])} [paths] The property paths to pick.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': '2', 'c': 3 };
+ *
+ * _.pick(object, ['a', 'c']);
+ * // => { 'a': 1, 'c': 3 }
+ */
+ var pick = flatRest(function(object, paths) {
+ return object == null ? {} : basePick(object, paths);
+ });
+
+ /**
+ * Creates an object composed of the `object` properties `predicate` returns
+ * truthy for. The predicate is invoked with two arguments: (value, key).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The source object.
+ * @param {Function} [predicate=_.identity] The function invoked per property.
+ * @returns {Object} Returns the new object.
+ * @example
+ *
+ * var object = { 'a': 1, 'b': '2', 'c': 3 };
+ *
+ * _.pickBy(object, _.isNumber);
+ * // => { 'a': 1, 'c': 3 }
+ */
+ function pickBy(object, predicate) {
+ if (object == null) {
+ return {};
+ }
+ var props = arrayMap(getAllKeysIn(object), function(prop) {
+ return [prop];
+ });
+ predicate = getIteratee(predicate);
+ return basePickBy(object, props, function(value, path) {
+ return predicate(value, path[0]);
+ });
+ }
+
+ /**
+ * This method is like `_.get` except that if the resolved value is a
+ * function it's invoked with the `this` binding of its parent object and
+ * its result is returned.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The object to query.
+ * @param {Array|string} path The path of the property to resolve.
+ * @param {*} [defaultValue] The value returned for `undefined` resolved values.
+ * @returns {*} Returns the resolved value.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] };
+ *
+ * _.result(object, 'a[0].b.c1');
+ * // => 3
+ *
+ * _.result(object, 'a[0].b.c2');
+ * // => 4
+ *
+ * _.result(object, 'a[0].b.c3', 'default');
+ * // => 'default'
+ *
+ * _.result(object, 'a[0].b.c3', _.constant('default'));
+ * // => 'default'
+ */
+ function result(object, path, defaultValue) {
+ path = castPath(path, object);
+
+ var index = -1,
+ length = path.length;
+
+ // Ensure the loop is entered when path is empty.
+ if (!length) {
+ length = 1;
+ object = undefined;
+ }
+ while (++index < length) {
+ var value = object == null ? undefined : object[toKey(path[index])];
+ if (value === undefined) {
+ index = length;
+ value = defaultValue;
+ }
+ object = isFunction(value) ? value.call(object) : value;
+ }
+ return object;
+ }
+
+ /**
+ * Sets the value at `path` of `object`. If a portion of `path` doesn't exist,
+ * it's created. Arrays are created for missing index properties while objects
+ * are created for all other missing properties. Use `_.setWith` to customize
+ * `path` creation.
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.7.0
+ * @category Object
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The path of the property to set.
+ * @param {*} value The value to set.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c': 3 } }] };
+ *
+ * _.set(object, 'a[0].b.c', 4);
+ * console.log(object.a[0].b.c);
+ * // => 4
+ *
+ * _.set(object, ['x', '0', 'y', 'z'], 5);
+ * console.log(object.x[0].y.z);
+ * // => 5
+ */
+ function set(object, path, value) {
+ return object == null ? object : baseSet(object, path, value);
+ }
+
+ /**
+ * This method is like `_.set` except that it accepts `customizer` which is
+ * invoked to produce the objects of `path`. If `customizer` returns `undefined`
+ * path creation is handled by the method instead. The `customizer` is invoked
+ * with three arguments: (nsValue, key, nsObject).
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The path of the property to set.
+ * @param {*} value The value to set.
+ * @param {Function} [customizer] The function to customize assigned values.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * var object = {};
+ *
+ * _.setWith(object, '[0][1]', 'a', Object);
+ * // => { '0': { '1': 'a' } }
+ */
+ function setWith(object, path, value, customizer) {
+ customizer = typeof customizer == 'function' ? customizer : undefined;
+ return object == null ? object : baseSet(object, path, value, customizer);
+ }
+
+ /**
+ * Creates an array of own enumerable string keyed-value pairs for `object`
+ * which can be consumed by `_.fromPairs`. If `object` is a map or set, its
+ * entries are returned.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @alias entries
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the key-value pairs.
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.toPairs(new Foo);
+ * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed)
+ */
+ var toPairs = createToPairs(keys);
+
+ /**
+ * Creates an array of own and inherited enumerable string keyed-value pairs
+ * for `object` which can be consumed by `_.fromPairs`. If `object` is a map
+ * or set, its entries are returned.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @alias entriesIn
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the key-value pairs.
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.toPairsIn(new Foo);
+ * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed)
+ */
+ var toPairsIn = createToPairs(keysIn);
+
+ /**
+ * An alternative to `_.reduce`; this method transforms `object` to a new
+ * `accumulator` object which is the result of running each of its own
+ * enumerable string keyed properties thru `iteratee`, with each invocation
+ * potentially mutating the `accumulator` object. If `accumulator` is not
+ * provided, a new object with the same `[[Prototype]]` will be used. The
+ * iteratee is invoked with four arguments: (accumulator, value, key, object).
+ * Iteratee functions may exit iteration early by explicitly returning `false`.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.3.0
+ * @category Object
+ * @param {Object} object The object to iterate over.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @param {*} [accumulator] The custom accumulator value.
+ * @returns {*} Returns the accumulated value.
+ * @example
+ *
+ * _.transform([2, 3, 4], function(result, n) {
+ * result.push(n *= n);
+ * return n % 2 == 0;
+ * }, []);
+ * // => [4, 9]
+ *
+ * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {
+ * (result[value] || (result[value] = [])).push(key);
+ * }, {});
+ * // => { '1': ['a', 'c'], '2': ['b'] }
+ */
+ function transform(object, iteratee, accumulator) {
+ var isArr = isArray(object),
+ isArrLike = isArr || isBuffer(object) || isTypedArray(object);
+
+ iteratee = getIteratee(iteratee, 4);
+ if (accumulator == null) {
+ var Ctor = object && object.constructor;
+ if (isArrLike) {
+ accumulator = isArr ? new Ctor : [];
+ }
+ else if (isObject(object)) {
+ accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {};
+ }
+ else {
+ accumulator = {};
+ }
+ }
+ (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) {
+ return iteratee(accumulator, value, index, object);
+ });
+ return accumulator;
+ }
+
+ /**
+ * Removes the property at `path` of `object`.
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Object
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The path of the property to unset.
+ * @returns {boolean} Returns `true` if the property is deleted, else `false`.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c': 7 } }] };
+ * _.unset(object, 'a[0].b.c');
+ * // => true
+ *
+ * console.log(object);
+ * // => { 'a': [{ 'b': {} }] };
+ *
+ * _.unset(object, ['a', '0', 'b', 'c']);
+ * // => true
+ *
+ * console.log(object);
+ * // => { 'a': [{ 'b': {} }] };
+ */
+ function unset(object, path) {
+ return object == null ? true : baseUnset(object, path);
+ }
+
+ /**
+ * This method is like `_.set` except that accepts `updater` to produce the
+ * value to set. Use `_.updateWith` to customize `path` creation. The `updater`
+ * is invoked with one argument: (value).
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.6.0
+ * @category Object
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The path of the property to set.
+ * @param {Function} updater The function to produce the updated value.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * var object = { 'a': [{ 'b': { 'c': 3 } }] };
+ *
+ * _.update(object, 'a[0].b.c', function(n) { return n * n; });
+ * console.log(object.a[0].b.c);
+ * // => 9
+ *
+ * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; });
+ * console.log(object.x[0].y.z);
+ * // => 0
+ */
+ function update(object, path, updater) {
+ return object == null ? object : baseUpdate(object, path, castFunction(updater));
+ }
+
+ /**
+ * This method is like `_.update` except that it accepts `customizer` which is
+ * invoked to produce the objects of `path`. If `customizer` returns `undefined`
+ * path creation is handled by the method instead. The `customizer` is invoked
+ * with three arguments: (nsValue, key, nsObject).
+ *
+ * **Note:** This method mutates `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.6.0
+ * @category Object
+ * @param {Object} object The object to modify.
+ * @param {Array|string} path The path of the property to set.
+ * @param {Function} updater The function to produce the updated value.
+ * @param {Function} [customizer] The function to customize assigned values.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * var object = {};
+ *
+ * _.updateWith(object, '[0][1]', _.constant('a'), Object);
+ * // => { '0': { '1': 'a' } }
+ */
+ function updateWith(object, path, updater, customizer) {
+ customizer = typeof customizer == 'function' ? customizer : undefined;
+ return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer);
+ }
+
+ /**
+ * Creates an array of the own enumerable string keyed property values of `object`.
+ *
+ * **Note:** Non-object values are coerced to objects.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property values.
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.values(new Foo);
+ * // => [1, 2] (iteration order is not guaranteed)
+ *
+ * _.values('hi');
+ * // => ['h', 'i']
+ */
+ function values(object) {
+ return object == null ? [] : baseValues(object, keys(object));
+ }
+
+ /**
+ * Creates an array of the own and inherited enumerable string keyed property
+ * values of `object`.
+ *
+ * **Note:** Non-object values are coerced to objects.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Object
+ * @param {Object} object The object to query.
+ * @returns {Array} Returns the array of property values.
+ * @example
+ *
+ * function Foo() {
+ * this.a = 1;
+ * this.b = 2;
+ * }
+ *
+ * Foo.prototype.c = 3;
+ *
+ * _.valuesIn(new Foo);
+ * // => [1, 2, 3] (iteration order is not guaranteed)
+ */
+ function valuesIn(object) {
+ return object == null ? [] : baseValues(object, keysIn(object));
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Clamps `number` within the inclusive `lower` and `upper` bounds.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Number
+ * @param {number} number The number to clamp.
+ * @param {number} [lower] The lower bound.
+ * @param {number} upper The upper bound.
+ * @returns {number} Returns the clamped number.
+ * @example
+ *
+ * _.clamp(-10, -5, 5);
+ * // => -5
+ *
+ * _.clamp(10, -5, 5);
+ * // => 5
+ */
+ function clamp(number, lower, upper) {
+ if (upper === undefined) {
+ upper = lower;
+ lower = undefined;
+ }
+ if (upper !== undefined) {
+ upper = toNumber(upper);
+ upper = upper === upper ? upper : 0;
+ }
+ if (lower !== undefined) {
+ lower = toNumber(lower);
+ lower = lower === lower ? lower : 0;
+ }
+ return baseClamp(toNumber(number), lower, upper);
+ }
+
+ /**
+ * Checks if `n` is between `start` and up to, but not including, `end`. If
+ * `end` is not specified, it's set to `start` with `start` then set to `0`.
+ * If `start` is greater than `end` the params are swapped to support
+ * negative ranges.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.3.0
+ * @category Number
+ * @param {number} number The number to check.
+ * @param {number} [start=0] The start of the range.
+ * @param {number} end The end of the range.
+ * @returns {boolean} Returns `true` if `number` is in the range, else `false`.
+ * @see _.range, _.rangeRight
+ * @example
+ *
+ * _.inRange(3, 2, 4);
+ * // => true
+ *
+ * _.inRange(4, 8);
+ * // => true
+ *
+ * _.inRange(4, 2);
+ * // => false
+ *
+ * _.inRange(2, 2);
+ * // => false
+ *
+ * _.inRange(1.2, 2);
+ * // => true
+ *
+ * _.inRange(5.2, 4);
+ * // => false
+ *
+ * _.inRange(-3, -2, -6);
+ * // => true
+ */
+ function inRange(number, start, end) {
+ start = toFinite(start);
+ if (end === undefined) {
+ end = start;
+ start = 0;
+ } else {
+ end = toFinite(end);
+ }
+ number = toNumber(number);
+ return baseInRange(number, start, end);
+ }
+
+ /**
+ * Produces a random number between the inclusive `lower` and `upper` bounds.
+ * If only one argument is provided a number between `0` and the given number
+ * is returned. If `floating` is `true`, or either `lower` or `upper` are
+ * floats, a floating-point number is returned instead of an integer.
+ *
+ * **Note:** JavaScript follows the IEEE-754 standard for resolving
+ * floating-point values which can produce unexpected results.
+ *
+ * @static
+ * @memberOf _
+ * @since 0.7.0
+ * @category Number
+ * @param {number} [lower=0] The lower bound.
+ * @param {number} [upper=1] The upper bound.
+ * @param {boolean} [floating] Specify returning a floating-point number.
+ * @returns {number} Returns the random number.
+ * @example
+ *
+ * _.random(0, 5);
+ * // => an integer between 0 and 5
+ *
+ * _.random(5);
+ * // => also an integer between 0 and 5
+ *
+ * _.random(5, true);
+ * // => a floating-point number between 0 and 5
+ *
+ * _.random(1.2, 5.2);
+ * // => a floating-point number between 1.2 and 5.2
+ */
+ function random(lower, upper, floating) {
+ if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) {
+ upper = floating = undefined;
+ }
+ if (floating === undefined) {
+ if (typeof upper == 'boolean') {
+ floating = upper;
+ upper = undefined;
+ }
+ else if (typeof lower == 'boolean') {
+ floating = lower;
+ lower = undefined;
+ }
+ }
+ if (lower === undefined && upper === undefined) {
+ lower = 0;
+ upper = 1;
+ }
+ else {
+ lower = toFinite(lower);
+ if (upper === undefined) {
+ upper = lower;
+ lower = 0;
+ } else {
+ upper = toFinite(upper);
+ }
+ }
+ if (lower > upper) {
+ var temp = lower;
+ lower = upper;
+ upper = temp;
+ }
+ if (floating || lower % 1 || upper % 1) {
+ var rand = nativeRandom();
+ return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper);
+ }
+ return baseRandom(lower, upper);
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the camel cased string.
+ * @example
+ *
+ * _.camelCase('Foo Bar');
+ * // => 'fooBar'
+ *
+ * _.camelCase('--foo-bar--');
+ * // => 'fooBar'
+ *
+ * _.camelCase('__FOO_BAR__');
+ * // => 'fooBar'
+ */
+ var camelCase = createCompounder(function(result, word, index) {
+ word = word.toLowerCase();
+ return result + (index ? capitalize(word) : word);
+ });
+
+ /**
+ * Converts the first character of `string` to upper case and the remaining
+ * to lower case.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to capitalize.
+ * @returns {string} Returns the capitalized string.
+ * @example
+ *
+ * _.capitalize('FRED');
+ * // => 'Fred'
+ */
+ function capitalize(string) {
+ return upperFirst(toString(string).toLowerCase());
+ }
+
+ /**
+ * Deburrs `string` by converting
+ * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table)
+ * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A)
+ * letters to basic Latin letters and removing
+ * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to deburr.
+ * @returns {string} Returns the deburred string.
+ * @example
+ *
+ * _.deburr('déjà vu');
+ * // => 'deja vu'
+ */
+ function deburr(string) {
+ string = toString(string);
+ return string && string.replace(reLatin, deburrLetter).replace(reComboMark, '');
+ }
+
+ /**
+ * Checks if `string` ends with the given target string.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to inspect.
+ * @param {string} [target] The string to search for.
+ * @param {number} [position=string.length] The position to search up to.
+ * @returns {boolean} Returns `true` if `string` ends with `target`,
+ * else `false`.
+ * @example
+ *
+ * _.endsWith('abc', 'c');
+ * // => true
+ *
+ * _.endsWith('abc', 'b');
+ * // => false
+ *
+ * _.endsWith('abc', 'b', 2);
+ * // => true
+ */
+ function endsWith(string, target, position) {
+ string = toString(string);
+ target = baseToString(target);
+
+ var length = string.length;
+ position = position === undefined
+ ? length
+ : baseClamp(toInteger(position), 0, length);
+
+ var end = position;
+ position -= target.length;
+ return position >= 0 && string.slice(position, end) == target;
+ }
+
+ /**
+ * Converts the characters "&", "<", ">", '"', and "'" in `string` to their
+ * corresponding HTML entities.
+ *
+ * **Note:** No other characters are escaped. To escape additional
+ * characters use a third-party library like [_he_](https://mths.be/he).
+ *
+ * Though the ">" character is escaped for symmetry, characters like
+ * ">" and "/" don't need escaping in HTML and have no special meaning
+ * unless they're part of a tag or unquoted attribute value. See
+ * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands)
+ * (under "semi-related fun fact") for more details.
+ *
+ * When working with HTML you should always
+ * [quote attribute values](http://wonko.com/post/html-escaping) to reduce
+ * XSS vectors.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category String
+ * @param {string} [string=''] The string to escape.
+ * @returns {string} Returns the escaped string.
+ * @example
+ *
+ * _.escape('fred, barney, & pebbles');
+ * // => 'fred, barney, & pebbles'
+ */
+ function escape(string) {
+ string = toString(string);
+ return (string && reHasUnescapedHtml.test(string))
+ ? string.replace(reUnescapedHtml, escapeHtmlChar)
+ : string;
+ }
+
+ /**
+ * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+",
+ * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to escape.
+ * @returns {string} Returns the escaped string.
+ * @example
+ *
+ * _.escapeRegExp('[lodash](https://lodash.com/)');
+ * // => '\[lodash\]\(https://lodash\.com/\)'
+ */
+ function escapeRegExp(string) {
+ string = toString(string);
+ return (string && reHasRegExpChar.test(string))
+ ? string.replace(reRegExpChar, '\\$&')
+ : string;
+ }
+
+ /**
+ * Converts `string` to
+ * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the kebab cased string.
+ * @example
+ *
+ * _.kebabCase('Foo Bar');
+ * // => 'foo-bar'
+ *
+ * _.kebabCase('fooBar');
+ * // => 'foo-bar'
+ *
+ * _.kebabCase('__FOO_BAR__');
+ * // => 'foo-bar'
+ */
+ var kebabCase = createCompounder(function(result, word, index) {
+ return result + (index ? '-' : '') + word.toLowerCase();
+ });
+
+ /**
+ * Converts `string`, as space separated words, to lower case.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the lower cased string.
+ * @example
+ *
+ * _.lowerCase('--Foo-Bar--');
+ * // => 'foo bar'
+ *
+ * _.lowerCase('fooBar');
+ * // => 'foo bar'
+ *
+ * _.lowerCase('__FOO_BAR__');
+ * // => 'foo bar'
+ */
+ var lowerCase = createCompounder(function(result, word, index) {
+ return result + (index ? ' ' : '') + word.toLowerCase();
+ });
+
+ /**
+ * Converts the first character of `string` to lower case.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the converted string.
+ * @example
+ *
+ * _.lowerFirst('Fred');
+ * // => 'fred'
+ *
+ * _.lowerFirst('FRED');
+ * // => 'fRED'
+ */
+ var lowerFirst = createCaseFirst('toLowerCase');
+
+ /**
+ * Pads `string` on the left and right sides if it's shorter than `length`.
+ * Padding characters are truncated if they can't be evenly divided by `length`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to pad.
+ * @param {number} [length=0] The padding length.
+ * @param {string} [chars=' '] The string used as padding.
+ * @returns {string} Returns the padded string.
+ * @example
+ *
+ * _.pad('abc', 8);
+ * // => ' abc '
+ *
+ * _.pad('abc', 8, '_-');
+ * // => '_-abc_-_'
+ *
+ * _.pad('abc', 3);
+ * // => 'abc'
+ */
+ function pad(string, length, chars) {
+ string = toString(string);
+ length = toInteger(length);
+
+ var strLength = length ? stringSize(string) : 0;
+ if (!length || strLength >= length) {
+ return string;
+ }
+ var mid = (length - strLength) / 2;
+ return (
+ createPadding(nativeFloor(mid), chars) +
+ string +
+ createPadding(nativeCeil(mid), chars)
+ );
+ }
+
+ /**
+ * Pads `string` on the right side if it's shorter than `length`. Padding
+ * characters are truncated if they exceed `length`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to pad.
+ * @param {number} [length=0] The padding length.
+ * @param {string} [chars=' '] The string used as padding.
+ * @returns {string} Returns the padded string.
+ * @example
+ *
+ * _.padEnd('abc', 6);
+ * // => 'abc '
+ *
+ * _.padEnd('abc', 6, '_-');
+ * // => 'abc_-_'
+ *
+ * _.padEnd('abc', 3);
+ * // => 'abc'
+ */
+ function padEnd(string, length, chars) {
+ string = toString(string);
+ length = toInteger(length);
+
+ var strLength = length ? stringSize(string) : 0;
+ return (length && strLength < length)
+ ? (string + createPadding(length - strLength, chars))
+ : string;
+ }
+
+ /**
+ * Pads `string` on the left side if it's shorter than `length`. Padding
+ * characters are truncated if they exceed `length`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to pad.
+ * @param {number} [length=0] The padding length.
+ * @param {string} [chars=' '] The string used as padding.
+ * @returns {string} Returns the padded string.
+ * @example
+ *
+ * _.padStart('abc', 6);
+ * // => ' abc'
+ *
+ * _.padStart('abc', 6, '_-');
+ * // => '_-_abc'
+ *
+ * _.padStart('abc', 3);
+ * // => 'abc'
+ */
+ function padStart(string, length, chars) {
+ string = toString(string);
+ length = toInteger(length);
+
+ var strLength = length ? stringSize(string) : 0;
+ return (length && strLength < length)
+ ? (createPadding(length - strLength, chars) + string)
+ : string;
+ }
+
+ /**
+ * Converts `string` to an integer of the specified radix. If `radix` is
+ * `undefined` or `0`, a `radix` of `10` is used unless `value` is a
+ * hexadecimal, in which case a `radix` of `16` is used.
+ *
+ * **Note:** This method aligns with the
+ * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`.
+ *
+ * @static
+ * @memberOf _
+ * @since 1.1.0
+ * @category String
+ * @param {string} string The string to convert.
+ * @param {number} [radix=10] The radix to interpret `value` by.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {number} Returns the converted integer.
+ * @example
+ *
+ * _.parseInt('08');
+ * // => 8
+ *
+ * _.map(['6', '08', '10'], _.parseInt);
+ * // => [6, 8, 10]
+ */
+ function parseInt(string, radix, guard) {
+ if (guard || radix == null) {
+ radix = 0;
+ } else if (radix) {
+ radix = +radix;
+ }
+ return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0);
+ }
+
+ /**
+ * Repeats the given string `n` times.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to repeat.
+ * @param {number} [n=1] The number of times to repeat the string.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {string} Returns the repeated string.
+ * @example
+ *
+ * _.repeat('*', 3);
+ * // => '***'
+ *
+ * _.repeat('abc', 2);
+ * // => 'abcabc'
+ *
+ * _.repeat('abc', 0);
+ * // => ''
+ */
+ function repeat(string, n, guard) {
+ if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) {
+ n = 1;
+ } else {
+ n = toInteger(n);
+ }
+ return baseRepeat(toString(string), n);
+ }
+
+ /**
+ * Replaces matches for `pattern` in `string` with `replacement`.
+ *
+ * **Note:** This method is based on
+ * [`String#replace`](https://mdn.io/String/replace).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to modify.
+ * @param {RegExp|string} pattern The pattern to replace.
+ * @param {Function|string} replacement The match replacement.
+ * @returns {string} Returns the modified string.
+ * @example
+ *
+ * _.replace('Hi Fred', 'Fred', 'Barney');
+ * // => 'Hi Barney'
+ */
+ function replace() {
+ var args = arguments,
+ string = toString(args[0]);
+
+ return args.length < 3 ? string : string.replace(args[1], args[2]);
+ }
+
+ /**
+ * Converts `string` to
+ * [snake case](https://en.wikipedia.org/wiki/Snake_case).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the snake cased string.
+ * @example
+ *
+ * _.snakeCase('Foo Bar');
+ * // => 'foo_bar'
+ *
+ * _.snakeCase('fooBar');
+ * // => 'foo_bar'
+ *
+ * _.snakeCase('--FOO-BAR--');
+ * // => 'foo_bar'
+ */
+ var snakeCase = createCompounder(function(result, word, index) {
+ return result + (index ? '_' : '') + word.toLowerCase();
+ });
+
+ /**
+ * Splits `string` by `separator`.
+ *
+ * **Note:** This method is based on
+ * [`String#split`](https://mdn.io/String/split).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to split.
+ * @param {RegExp|string} separator The separator pattern to split by.
+ * @param {number} [limit] The length to truncate results to.
+ * @returns {Array} Returns the string segments.
+ * @example
+ *
+ * _.split('a-b-c', '-', 2);
+ * // => ['a', 'b']
+ */
+ function split(string, separator, limit) {
+ if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) {
+ separator = limit = undefined;
+ }
+ limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0;
+ if (!limit) {
+ return [];
+ }
+ string = toString(string);
+ if (string && (
+ typeof separator == 'string' ||
+ (separator != null && !isRegExp(separator))
+ )) {
+ separator = baseToString(separator);
+ if (!separator && hasUnicode(string)) {
+ return castSlice(stringToArray(string), 0, limit);
+ }
+ }
+ return string.split(separator, limit);
+ }
+
+ /**
+ * Converts `string` to
+ * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage).
+ *
+ * @static
+ * @memberOf _
+ * @since 3.1.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the start cased string.
+ * @example
+ *
+ * _.startCase('--foo-bar--');
+ * // => 'Foo Bar'
+ *
+ * _.startCase('fooBar');
+ * // => 'Foo Bar'
+ *
+ * _.startCase('__FOO_BAR__');
+ * // => 'FOO BAR'
+ */
+ var startCase = createCompounder(function(result, word, index) {
+ return result + (index ? ' ' : '') + upperFirst(word);
+ });
+
+ /**
+ * Checks if `string` starts with the given target string.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to inspect.
+ * @param {string} [target] The string to search for.
+ * @param {number} [position=0] The position to search from.
+ * @returns {boolean} Returns `true` if `string` starts with `target`,
+ * else `false`.
+ * @example
+ *
+ * _.startsWith('abc', 'a');
+ * // => true
+ *
+ * _.startsWith('abc', 'b');
+ * // => false
+ *
+ * _.startsWith('abc', 'b', 1);
+ * // => true
+ */
+ function startsWith(string, target, position) {
+ string = toString(string);
+ position = position == null
+ ? 0
+ : baseClamp(toInteger(position), 0, string.length);
+
+ target = baseToString(target);
+ return string.slice(position, position + target.length) == target;
+ }
+
+ /**
+ * Creates a compiled template function that can interpolate data properties
+ * in "interpolate" delimiters, HTML-escape interpolated data properties in
+ * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data
+ * properties may be accessed as free variables in the template. If a setting
+ * object is given, it takes precedence over `_.templateSettings` values.
+ *
+ * **Note:** In the development build `_.template` utilizes
+ * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl)
+ * for easier debugging.
+ *
+ * For more information on precompiling templates see
+ * [lodash's custom builds documentation](https://lodash.com/custom-builds).
+ *
+ * For more information on Chrome extension sandboxes see
+ * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval).
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category String
+ * @param {string} [string=''] The template string.
+ * @param {Object} [options={}] The options object.
+ * @param {RegExp} [options.escape=_.templateSettings.escape]
+ * The HTML "escape" delimiter.
+ * @param {RegExp} [options.evaluate=_.templateSettings.evaluate]
+ * The "evaluate" delimiter.
+ * @param {Object} [options.imports=_.templateSettings.imports]
+ * An object to import into the template as free variables.
+ * @param {RegExp} [options.interpolate=_.templateSettings.interpolate]
+ * The "interpolate" delimiter.
+ * @param {string} [options.sourceURL='lodash.templateSources[n]']
+ * The sourceURL of the compiled template.
+ * @param {string} [options.variable='obj']
+ * The data object variable name.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Function} Returns the compiled template function.
+ * @example
+ *
+ * // Use the "interpolate" delimiter to create a compiled template.
+ * var compiled = _.template('hello <%= user %>!');
+ * compiled({ 'user': 'fred' });
+ * // => 'hello fred!'
+ *
+ * // Use the HTML "escape" delimiter to escape data property values.
+ * var compiled = _.template('<b><%- value %></b>');
+ * compiled({ 'value': '<script>' });
+ * // => '<b><script></b>'
+ *
+ * // Use the "evaluate" delimiter to execute JavaScript and generate HTML.
+ * var compiled = _.template('<% _.forEach(users, function(user) { %><li><%- user %></li><% }); %>');
+ * compiled({ 'users': ['fred', 'barney'] });
+ * // => '<li>fred</li><li>barney</li>'
+ *
+ * // Use the internal `print` function in "evaluate" delimiters.
+ * var compiled = _.template('<% print("hello " + user); %>!');
+ * compiled({ 'user': 'barney' });
+ * // => 'hello barney!'
+ *
+ * // Use the ES template literal delimiter as an "interpolate" delimiter.
+ * // Disable support by replacing the "interpolate" delimiter.
+ * var compiled = _.template('hello ${ user }!');
+ * compiled({ 'user': 'pebbles' });
+ * // => 'hello pebbles!'
+ *
+ * // Use backslashes to treat delimiters as plain text.
+ * var compiled = _.template('<%= "\\<%- value %\\>" %>');
+ * compiled({ 'value': 'ignored' });
+ * // => '<%- value %>'
+ *
+ * // Use the `imports` option to import `jQuery` as `jq`.
+ * var text = '<% jq.each(users, function(user) { %><li><%- user %></li><% }); %>';
+ * var compiled = _.template(text, { 'imports': { 'jq': jQuery } });
+ * compiled({ 'users': ['fred', 'barney'] });
+ * // => '<li>fred</li><li>barney</li>'
+ *
+ * // Use the `sourceURL` option to specify a custom sourceURL for the template.
+ * var compiled = _.template('hello <%= user %>!', { 'sourceURL': '/basic/greeting.jst' });
+ * compiled(data);
+ * // => Find the source of "greeting.jst" under the Sources tab or Resources panel of the web inspector.
+ *
+ * // Use the `variable` option to ensure a with-statement isn't used in the compiled template.
+ * var compiled = _.template('hi <%= data.user %>!', { 'variable': 'data' });
+ * compiled.source;
+ * // => function(data) {
+ * // var __t, __p = '';
+ * // __p += 'hi ' + ((__t = ( data.user )) == null ? '' : __t) + '!';
+ * // return __p;
+ * // }
+ *
+ * // Use custom template delimiters.
+ * _.templateSettings.interpolate = /{{([\s\S]+?)}}/g;
+ * var compiled = _.template('hello {{ user }}!');
+ * compiled({ 'user': 'mustache' });
+ * // => 'hello mustache!'
+ *
+ * // Use the `source` property to inline compiled templates for meaningful
+ * // line numbers in error messages and stack traces.
+ * fs.writeFileSync(path.join(process.cwd(), 'jst.js'), '\
+ * var JST = {\
+ * "main": ' + _.template(mainText).source + '\
+ * };\
+ * ');
+ */
+ function template(string, options, guard) {
+ // Based on John Resig's `tmpl` implementation
+ // (http://ejohn.org/blog/javascript-micro-templating/)
+ // and Laura Doktorova's doT.js (https://github.com/olado/doT).
+ var settings = lodash.templateSettings;
+
+ if (guard && isIterateeCall(string, options, guard)) {
+ options = undefined;
+ }
+ string = toString(string);
+ options = assignInWith({}, options, settings, customDefaultsAssignIn);
+
+ var imports = assignInWith({}, options.imports, settings.imports, customDefaultsAssignIn),
+ importsKeys = keys(imports),
+ importsValues = baseValues(imports, importsKeys);
+
+ var isEscaping,
+ isEvaluating,
+ index = 0,
+ interpolate = options.interpolate || reNoMatch,
+ source = "__p += '";
+
+ // Compile the regexp to match each delimiter.
+ var reDelimiters = RegExp(
+ (options.escape || reNoMatch).source + '|' +
+ interpolate.source + '|' +
+ (interpolate === reInterpolate ? reEsTemplate : reNoMatch).source + '|' +
+ (options.evaluate || reNoMatch).source + '|$'
+ , 'g');
+
+ // Use a sourceURL for easier debugging.
+ var sourceURL = '//# sourceURL=' +
+ ('sourceURL' in options
+ ? options.sourceURL
+ : ('lodash.templateSources[' + (++templateCounter) + ']')
+ ) + '\n';
+
+ string.replace(reDelimiters, function(match, escapeValue, interpolateValue, esTemplateValue, evaluateValue, offset) {
+ interpolateValue || (interpolateValue = esTemplateValue);
+
+ // Escape characters that can't be included in string literals.
+ source += string.slice(index, offset).replace(reUnescapedString, escapeStringChar);
+
+ // Replace delimiters with snippets.
+ if (escapeValue) {
+ isEscaping = true;
+ source += "' +\n__e(" + escapeValue + ") +\n'";
+ }
+ if (evaluateValue) {
+ isEvaluating = true;
+ source += "';\n" + evaluateValue + ";\n__p += '";
+ }
+ if (interpolateValue) {
+ source += "' +\n((__t = (" + interpolateValue + ")) == null ? '' : __t) +\n'";
+ }
+ index = offset + match.length;
+
+ // The JS engine embedded in Adobe products needs `match` returned in
+ // order to produce the correct `offset` value.
+ return match;
+ });
+
+ source += "';\n";
+
+ // If `variable` is not specified wrap a with-statement around the generated
+ // code to add the data object to the top of the scope chain.
+ var variable = options.variable;
+ if (!variable) {
+ source = 'with (obj) {\n' + source + '\n}\n';
+ }
+ // Cleanup code by stripping empty strings.
+ source = (isEvaluating ? source.replace(reEmptyStringLeading, '') : source)
+ .replace(reEmptyStringMiddle, '$1')
+ .replace(reEmptyStringTrailing, '$1;');
+
+ // Frame code as the function body.
+ source = 'function(' + (variable || 'obj') + ') {\n' +
+ (variable
+ ? ''
+ : 'obj || (obj = {});\n'
+ ) +
+ "var __t, __p = ''" +
+ (isEscaping
+ ? ', __e = _.escape'
+ : ''
+ ) +
+ (isEvaluating
+ ? ', __j = Array.prototype.join;\n' +
+ "function print() { __p += __j.call(arguments, '') }\n"
+ : ';\n'
+ ) +
+ source +
+ 'return __p\n}';
+
+ var result = attempt(function() {
+ return Function(importsKeys, sourceURL + 'return ' + source)
+ .apply(undefined, importsValues);
+ });
+
+ // Provide the compiled function's source by its `toString` method or
+ // the `source` property as a convenience for inlining compiled templates.
+ result.source = source;
+ if (isError(result)) {
+ throw result;
+ }
+ return result;
+ }
+
+ /**
+ * Converts `string`, as a whole, to lower case just like
+ * [String#toLowerCase](https://mdn.io/toLowerCase).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the lower cased string.
+ * @example
+ *
+ * _.toLower('--Foo-Bar--');
+ * // => '--foo-bar--'
+ *
+ * _.toLower('fooBar');
+ * // => 'foobar'
+ *
+ * _.toLower('__FOO_BAR__');
+ * // => '__foo_bar__'
+ */
+ function toLower(value) {
+ return toString(value).toLowerCase();
+ }
+
+ /**
+ * Converts `string`, as a whole, to upper case just like
+ * [String#toUpperCase](https://mdn.io/toUpperCase).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the upper cased string.
+ * @example
+ *
+ * _.toUpper('--foo-bar--');
+ * // => '--FOO-BAR--'
+ *
+ * _.toUpper('fooBar');
+ * // => 'FOOBAR'
+ *
+ * _.toUpper('__foo_bar__');
+ * // => '__FOO_BAR__'
+ */
+ function toUpper(value) {
+ return toString(value).toUpperCase();
+ }
+
+ /**
+ * Removes leading and trailing whitespace or specified characters from `string`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to trim.
+ * @param {string} [chars=whitespace] The characters to trim.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {string} Returns the trimmed string.
+ * @example
+ *
+ * _.trim(' abc ');
+ * // => 'abc'
+ *
+ * _.trim('-_-abc-_-', '_-');
+ * // => 'abc'
+ *
+ * _.map([' foo ', ' bar '], _.trim);
+ * // => ['foo', 'bar']
+ */
+ function trim(string, chars, guard) {
+ string = toString(string);
+ if (string && (guard || chars === undefined)) {
+ return string.replace(reTrim, '');
+ }
+ if (!string || !(chars = baseToString(chars))) {
+ return string;
+ }
+ var strSymbols = stringToArray(string),
+ chrSymbols = stringToArray(chars),
+ start = charsStartIndex(strSymbols, chrSymbols),
+ end = charsEndIndex(strSymbols, chrSymbols) + 1;
+
+ return castSlice(strSymbols, start, end).join('');
+ }
+
+ /**
+ * Removes trailing whitespace or specified characters from `string`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to trim.
+ * @param {string} [chars=whitespace] The characters to trim.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {string} Returns the trimmed string.
+ * @example
+ *
+ * _.trimEnd(' abc ');
+ * // => ' abc'
+ *
+ * _.trimEnd('-_-abc-_-', '_-');
+ * // => '-_-abc'
+ */
+ function trimEnd(string, chars, guard) {
+ string = toString(string);
+ if (string && (guard || chars === undefined)) {
+ return string.replace(reTrimEnd, '');
+ }
+ if (!string || !(chars = baseToString(chars))) {
+ return string;
+ }
+ var strSymbols = stringToArray(string),
+ end = charsEndIndex(strSymbols, stringToArray(chars)) + 1;
+
+ return castSlice(strSymbols, 0, end).join('');
+ }
+
+ /**
+ * Removes leading whitespace or specified characters from `string`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to trim.
+ * @param {string} [chars=whitespace] The characters to trim.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {string} Returns the trimmed string.
+ * @example
+ *
+ * _.trimStart(' abc ');
+ * // => 'abc '
+ *
+ * _.trimStart('-_-abc-_-', '_-');
+ * // => 'abc-_-'
+ */
+ function trimStart(string, chars, guard) {
+ string = toString(string);
+ if (string && (guard || chars === undefined)) {
+ return string.replace(reTrimStart, '');
+ }
+ if (!string || !(chars = baseToString(chars))) {
+ return string;
+ }
+ var strSymbols = stringToArray(string),
+ start = charsStartIndex(strSymbols, stringToArray(chars));
+
+ return castSlice(strSymbols, start).join('');
+ }
+
+ /**
+ * Truncates `string` if it's longer than the given maximum string length.
+ * The last characters of the truncated string are replaced with the omission
+ * string which defaults to "...".
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to truncate.
+ * @param {Object} [options={}] The options object.
+ * @param {number} [options.length=30] The maximum string length.
+ * @param {string} [options.omission='...'] The string to indicate text is omitted.
+ * @param {RegExp|string} [options.separator] The separator pattern to truncate to.
+ * @returns {string} Returns the truncated string.
+ * @example
+ *
+ * _.truncate('hi-diddly-ho there, neighborino');
+ * // => 'hi-diddly-ho there, neighbo...'
+ *
+ * _.truncate('hi-diddly-ho there, neighborino', {
+ * 'length': 24,
+ * 'separator': ' '
+ * });
+ * // => 'hi-diddly-ho there,...'
+ *
+ * _.truncate('hi-diddly-ho there, neighborino', {
+ * 'length': 24,
+ * 'separator': /,? +/
+ * });
+ * // => 'hi-diddly-ho there...'
+ *
+ * _.truncate('hi-diddly-ho there, neighborino', {
+ * 'omission': ' [...]'
+ * });
+ * // => 'hi-diddly-ho there, neig [...]'
+ */
+ function truncate(string, options) {
+ var length = DEFAULT_TRUNC_LENGTH,
+ omission = DEFAULT_TRUNC_OMISSION;
+
+ if (isObject(options)) {
+ var separator = 'separator' in options ? options.separator : separator;
+ length = 'length' in options ? toInteger(options.length) : length;
+ omission = 'omission' in options ? baseToString(options.omission) : omission;
+ }
+ string = toString(string);
+
+ var strLength = string.length;
+ if (hasUnicode(string)) {
+ var strSymbols = stringToArray(string);
+ strLength = strSymbols.length;
+ }
+ if (length >= strLength) {
+ return string;
+ }
+ var end = length - stringSize(omission);
+ if (end < 1) {
+ return omission;
+ }
+ var result = strSymbols
+ ? castSlice(strSymbols, 0, end).join('')
+ : string.slice(0, end);
+
+ if (separator === undefined) {
+ return result + omission;
+ }
+ if (strSymbols) {
+ end += (result.length - end);
+ }
+ if (isRegExp(separator)) {
+ if (string.slice(end).search(separator)) {
+ var match,
+ substring = result;
+
+ if (!separator.global) {
+ separator = RegExp(separator.source, toString(reFlags.exec(separator)) + 'g');
+ }
+ separator.lastIndex = 0;
+ while ((match = separator.exec(substring))) {
+ var newEnd = match.index;
+ }
+ result = result.slice(0, newEnd === undefined ? end : newEnd);
+ }
+ } else if (string.indexOf(baseToString(separator), end) != end) {
+ var index = result.lastIndexOf(separator);
+ if (index > -1) {
+ result = result.slice(0, index);
+ }
+ }
+ return result + omission;
+ }
+
+ /**
+ * The inverse of `_.escape`; this method converts the HTML entities
+ * `&`, `<`, `>`, `"`, and `'` in `string` to
+ * their corresponding characters.
+ *
+ * **Note:** No other HTML entities are unescaped. To unescape additional
+ * HTML entities use a third-party library like [_he_](https://mths.be/he).
+ *
+ * @static
+ * @memberOf _
+ * @since 0.6.0
+ * @category String
+ * @param {string} [string=''] The string to unescape.
+ * @returns {string} Returns the unescaped string.
+ * @example
+ *
+ * _.unescape('fred, barney, & pebbles');
+ * // => 'fred, barney, & pebbles'
+ */
+ function unescape(string) {
+ string = toString(string);
+ return (string && reHasEscapedHtml.test(string))
+ ? string.replace(reEscapedHtml, unescapeHtmlChar)
+ : string;
+ }
+
+ /**
+ * Converts `string`, as space separated words, to upper case.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the upper cased string.
+ * @example
+ *
+ * _.upperCase('--foo-bar');
+ * // => 'FOO BAR'
+ *
+ * _.upperCase('fooBar');
+ * // => 'FOO BAR'
+ *
+ * _.upperCase('__foo_bar__');
+ * // => 'FOO BAR'
+ */
+ var upperCase = createCompounder(function(result, word, index) {
+ return result + (index ? ' ' : '') + word.toUpperCase();
+ });
+
+ /**
+ * Converts the first character of `string` to upper case.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category String
+ * @param {string} [string=''] The string to convert.
+ * @returns {string} Returns the converted string.
+ * @example
+ *
+ * _.upperFirst('fred');
+ * // => 'Fred'
+ *
+ * _.upperFirst('FRED');
+ * // => 'FRED'
+ */
+ var upperFirst = createCaseFirst('toUpperCase');
+
+ /**
+ * Splits `string` into an array of its words.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category String
+ * @param {string} [string=''] The string to inspect.
+ * @param {RegExp|string} [pattern] The pattern to match words.
+ * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.
+ * @returns {Array} Returns the words of `string`.
+ * @example
+ *
+ * _.words('fred, barney, & pebbles');
+ * // => ['fred', 'barney', 'pebbles']
+ *
+ * _.words('fred, barney, & pebbles', /[^, ]+/g);
+ * // => ['fred', 'barney', '&', 'pebbles']
+ */
+ function words(string, pattern, guard) {
+ string = toString(string);
+ pattern = guard ? undefined : pattern;
+
+ if (pattern === undefined) {
+ return hasUnicodeWord(string) ? unicodeWords(string) : asciiWords(string);
+ }
+ return string.match(pattern) || [];
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Attempts to invoke `func`, returning either the result or the caught error
+ * object. Any additional arguments are provided to `func` when it's invoked.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Util
+ * @param {Function} func The function to attempt.
+ * @param {...*} [args] The arguments to invoke `func` with.
+ * @returns {*} Returns the `func` result or error object.
+ * @example
+ *
+ * // Avoid throwing errors for invalid selectors.
+ * var elements = _.attempt(function(selector) {
+ * return document.querySelectorAll(selector);
+ * }, '>_>');
+ *
+ * if (_.isError(elements)) {
+ * elements = [];
+ * }
+ */
+ var attempt = baseRest(function(func, args) {
+ try {
+ return apply(func, undefined, args);
+ } catch (e) {
+ return isError(e) ? e : new Error(e);
+ }
+ });
+
+ /**
+ * Binds methods of an object to the object itself, overwriting the existing
+ * method.
+ *
+ * **Note:** This method doesn't set the "length" property of bound functions.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Util
+ * @param {Object} object The object to bind and assign the bound methods to.
+ * @param {...(string|string[])} methodNames The object method names to bind.
+ * @returns {Object} Returns `object`.
+ * @example
+ *
+ * var view = {
+ * 'label': 'docs',
+ * 'click': function() {
+ * console.log('clicked ' + this.label);
+ * }
+ * };
+ *
+ * _.bindAll(view, ['click']);
+ * jQuery(element).on('click', view.click);
+ * // => Logs 'clicked docs' when clicked.
+ */
+ var bindAll = flatRest(function(object, methodNames) {
+ arrayEach(methodNames, function(key) {
+ key = toKey(key);
+ baseAssignValue(object, key, bind(object[key], object));
+ });
+ return object;
+ });
+
+ /**
+ * Creates a function that iterates over `pairs` and invokes the corresponding
+ * function of the first predicate to return truthy. The predicate-function
+ * pairs are invoked with the `this` binding and arguments of the created
+ * function.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Util
+ * @param {Array} pairs The predicate-function pairs.
+ * @returns {Function} Returns the new composite function.
+ * @example
+ *
+ * var func = _.cond([
+ * [_.matches({ 'a': 1 }), _.constant('matches A')],
+ * [_.conforms({ 'b': _.isNumber }), _.constant('matches B')],
+ * [_.stubTrue, _.constant('no match')]
+ * ]);
+ *
+ * func({ 'a': 1, 'b': 2 });
+ * // => 'matches A'
+ *
+ * func({ 'a': 0, 'b': 1 });
+ * // => 'matches B'
+ *
+ * func({ 'a': '1', 'b': '2' });
+ * // => 'no match'
+ */
+ function cond(pairs) {
+ var length = pairs == null ? 0 : pairs.length,
+ toIteratee = getIteratee();
+
+ pairs = !length ? [] : arrayMap(pairs, function(pair) {
+ if (typeof pair[1] != 'function') {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ return [toIteratee(pair[0]), pair[1]];
+ });
+
+ return baseRest(function(args) {
+ var index = -1;
+ while (++index < length) {
+ var pair = pairs[index];
+ if (apply(pair[0], this, args)) {
+ return apply(pair[1], this, args);
+ }
+ }
+ });
+ }
+
+ /**
+ * Creates a function that invokes the predicate properties of `source` with
+ * the corresponding property values of a given object, returning `true` if
+ * all predicates return truthy, else `false`.
+ *
+ * **Note:** The created function is equivalent to `_.conformsTo` with
+ * `source` partially applied.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Util
+ * @param {Object} source The object of property predicates to conform to.
+ * @returns {Function} Returns the new spec function.
+ * @example
+ *
+ * var objects = [
+ * { 'a': 2, 'b': 1 },
+ * { 'a': 1, 'b': 2 }
+ * ];
+ *
+ * _.filter(objects, _.conforms({ 'b': function(n) { return n > 1; } }));
+ * // => [{ 'a': 1, 'b': 2 }]
+ */
+ function conforms(source) {
+ return baseConforms(baseClone(source, CLONE_DEEP_FLAG));
+ }
+
+ /**
+ * Creates a function that returns `value`.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.4.0
+ * @category Util
+ * @param {*} value The value to return from the new function.
+ * @returns {Function} Returns the new constant function.
+ * @example
+ *
+ * var objects = _.times(2, _.constant({ 'a': 1 }));
+ *
+ * console.log(objects);
+ * // => [{ 'a': 1 }, { 'a': 1 }]
+ *
+ * console.log(objects[0] === objects[1]);
+ * // => true
+ */
+ function constant(value) {
+ return function() {
+ return value;
+ };
+ }
+
+ /**
+ * Checks `value` to determine whether a default value should be returned in
+ * its place. The `defaultValue` is returned if `value` is `NaN`, `null`,
+ * or `undefined`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.14.0
+ * @category Util
+ * @param {*} value The value to check.
+ * @param {*} defaultValue The default value.
+ * @returns {*} Returns the resolved value.
+ * @example
+ *
+ * _.defaultTo(1, 10);
+ * // => 1
+ *
+ * _.defaultTo(undefined, 10);
+ * // => 10
+ */
+ function defaultTo(value, defaultValue) {
+ return (value == null || value !== value) ? defaultValue : value;
+ }
+
+ /**
+ * Creates a function that returns the result of invoking the given functions
+ * with the `this` binding of the created function, where each successive
+ * invocation is supplied the return value of the previous.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Util
+ * @param {...(Function|Function[])} [funcs] The functions to invoke.
+ * @returns {Function} Returns the new composite function.
+ * @see _.flowRight
+ * @example
+ *
+ * function square(n) {
+ * return n * n;
+ * }
+ *
+ * var addSquare = _.flow([_.add, square]);
+ * addSquare(1, 2);
+ * // => 9
+ */
+ var flow = createFlow();
+
+ /**
+ * This method is like `_.flow` except that it creates a function that
+ * invokes the given functions from right to left.
+ *
+ * @static
+ * @since 3.0.0
+ * @memberOf _
+ * @category Util
+ * @param {...(Function|Function[])} [funcs] The functions to invoke.
+ * @returns {Function} Returns the new composite function.
+ * @see _.flow
+ * @example
+ *
+ * function square(n) {
+ * return n * n;
+ * }
+ *
+ * var addSquare = _.flowRight([square, _.add]);
+ * addSquare(1, 2);
+ * // => 9
+ */
+ var flowRight = createFlow(true);
+
+ /**
+ * This method returns the first argument it receives.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Util
+ * @param {*} value Any value.
+ * @returns {*} Returns `value`.
+ * @example
+ *
+ * var object = { 'a': 1 };
+ *
+ * console.log(_.identity(object) === object);
+ * // => true
+ */
+ function identity(value) {
+ return value;
+ }
+
+ /**
+ * Creates a function that invokes `func` with the arguments of the created
+ * function. If `func` is a property name, the created function returns the
+ * property value for a given element. If `func` is an array or object, the
+ * created function returns `true` for elements that contain the equivalent
+ * source properties, otherwise it returns `false`.
+ *
+ * @static
+ * @since 4.0.0
+ * @memberOf _
+ * @category Util
+ * @param {*} [func=_.identity] The value to convert to a callback.
+ * @returns {Function} Returns the callback.
+ * @example
+ *
+ * var users = [
+ * { 'user': 'barney', 'age': 36, 'active': true },
+ * { 'user': 'fred', 'age': 40, 'active': false }
+ * ];
+ *
+ * // The `_.matches` iteratee shorthand.
+ * _.filter(users, _.iteratee({ 'user': 'barney', 'active': true }));
+ * // => [{ 'user': 'barney', 'age': 36, 'active': true }]
+ *
+ * // The `_.matchesProperty` iteratee shorthand.
+ * _.filter(users, _.iteratee(['user', 'fred']));
+ * // => [{ 'user': 'fred', 'age': 40 }]
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.map(users, _.iteratee('user'));
+ * // => ['barney', 'fred']
+ *
+ * // Create custom iteratee shorthands.
+ * _.iteratee = _.wrap(_.iteratee, function(iteratee, func) {
+ * return !_.isRegExp(func) ? iteratee(func) : function(string) {
+ * return func.test(string);
+ * };
+ * });
+ *
+ * _.filter(['abc', 'def'], /ef/);
+ * // => ['def']
+ */
+ function iteratee(func) {
+ return baseIteratee(typeof func == 'function' ? func : baseClone(func, CLONE_DEEP_FLAG));
+ }
+
+ /**
+ * Creates a function that performs a partial deep comparison between a given
+ * object and `source`, returning `true` if the given object has equivalent
+ * property values, else `false`.
+ *
+ * **Note:** The created function is equivalent to `_.isMatch` with `source`
+ * partially applied.
+ *
+ * Partial comparisons will match empty array and empty object `source`
+ * values against any array or object value, respectively. See `_.isEqual`
+ * for a list of supported value comparisons.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Util
+ * @param {Object} source The object of property values to match.
+ * @returns {Function} Returns the new spec function.
+ * @example
+ *
+ * var objects = [
+ * { 'a': 1, 'b': 2, 'c': 3 },
+ * { 'a': 4, 'b': 5, 'c': 6 }
+ * ];
+ *
+ * _.filter(objects, _.matches({ 'a': 4, 'c': 6 }));
+ * // => [{ 'a': 4, 'b': 5, 'c': 6 }]
+ */
+ function matches(source) {
+ return baseMatches(baseClone(source, CLONE_DEEP_FLAG));
+ }
+
+ /**
+ * Creates a function that performs a partial deep comparison between the
+ * value at `path` of a given object to `srcValue`, returning `true` if the
+ * object value is equivalent, else `false`.
+ *
+ * **Note:** Partial comparisons will match empty array and empty object
+ * `srcValue` values against any array or object value, respectively. See
+ * `_.isEqual` for a list of supported value comparisons.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.2.0
+ * @category Util
+ * @param {Array|string} path The path of the property to get.
+ * @param {*} srcValue The value to match.
+ * @returns {Function} Returns the new spec function.
+ * @example
+ *
+ * var objects = [
+ * { 'a': 1, 'b': 2, 'c': 3 },
+ * { 'a': 4, 'b': 5, 'c': 6 }
+ * ];
+ *
+ * _.find(objects, _.matchesProperty('a', 4));
+ * // => { 'a': 4, 'b': 5, 'c': 6 }
+ */
+ function matchesProperty(path, srcValue) {
+ return baseMatchesProperty(path, baseClone(srcValue, CLONE_DEEP_FLAG));
+ }
+
+ /**
+ * Creates a function that invokes the method at `path` of a given object.
+ * Any additional arguments are provided to the invoked method.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.7.0
+ * @category Util
+ * @param {Array|string} path The path of the method to invoke.
+ * @param {...*} [args] The arguments to invoke the method with.
+ * @returns {Function} Returns the new invoker function.
+ * @example
+ *
+ * var objects = [
+ * { 'a': { 'b': _.constant(2) } },
+ * { 'a': { 'b': _.constant(1) } }
+ * ];
+ *
+ * _.map(objects, _.method('a.b'));
+ * // => [2, 1]
+ *
+ * _.map(objects, _.method(['a', 'b']));
+ * // => [2, 1]
+ */
+ var method = baseRest(function(path, args) {
+ return function(object) {
+ return baseInvoke(object, path, args);
+ };
+ });
+
+ /**
+ * The opposite of `_.method`; this method creates a function that invokes
+ * the method at a given path of `object`. Any additional arguments are
+ * provided to the invoked method.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.7.0
+ * @category Util
+ * @param {Object} object The object to query.
+ * @param {...*} [args] The arguments to invoke the method with.
+ * @returns {Function} Returns the new invoker function.
+ * @example
+ *
+ * var array = _.times(3, _.constant),
+ * object = { 'a': array, 'b': array, 'c': array };
+ *
+ * _.map(['a[2]', 'c[0]'], _.methodOf(object));
+ * // => [2, 0]
+ *
+ * _.map([['a', '2'], ['c', '0']], _.methodOf(object));
+ * // => [2, 0]
+ */
+ var methodOf = baseRest(function(object, args) {
+ return function(path) {
+ return baseInvoke(object, path, args);
+ };
+ });
+
+ /**
+ * Adds all own enumerable string keyed function properties of a source
+ * object to the destination object. If `object` is a function, then methods
+ * are added to its prototype as well.
+ *
+ * **Note:** Use `_.runInContext` to create a pristine `lodash` function to
+ * avoid conflicts caused by modifying the original.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Util
+ * @param {Function|Object} [object=lodash] The destination object.
+ * @param {Object} source The object of functions to add.
+ * @param {Object} [options={}] The options object.
+ * @param {boolean} [options.chain=true] Specify whether mixins are chainable.
+ * @returns {Function|Object} Returns `object`.
+ * @example
+ *
+ * function vowels(string) {
+ * return _.filter(string, function(v) {
+ * return /[aeiou]/i.test(v);
+ * });
+ * }
+ *
+ * _.mixin({ 'vowels': vowels });
+ * _.vowels('fred');
+ * // => ['e']
+ *
+ * _('fred').vowels().value();
+ * // => ['e']
+ *
+ * _.mixin({ 'vowels': vowels }, { 'chain': false });
+ * _('fred').vowels();
+ * // => ['e']
+ */
+ function mixin(object, source, options) {
+ var props = keys(source),
+ methodNames = baseFunctions(source, props);
+
+ if (options == null &&
+ !(isObject(source) && (methodNames.length || !props.length))) {
+ options = source;
+ source = object;
+ object = this;
+ methodNames = baseFunctions(source, keys(source));
+ }
+ var chain = !(isObject(options) && 'chain' in options) || !!options.chain,
+ isFunc = isFunction(object);
+
+ arrayEach(methodNames, function(methodName) {
+ var func = source[methodName];
+ object[methodName] = func;
+ if (isFunc) {
+ object.prototype[methodName] = function() {
+ var chainAll = this.__chain__;
+ if (chain || chainAll) {
+ var result = object(this.__wrapped__),
+ actions = result.__actions__ = copyArray(this.__actions__);
+
+ actions.push({ 'func': func, 'args': arguments, 'thisArg': object });
+ result.__chain__ = chainAll;
+ return result;
+ }
+ return func.apply(object, arrayPush([this.value()], arguments));
+ };
+ }
+ });
+
+ return object;
+ }
+
+ /**
+ * Reverts the `_` variable to its previous value and returns a reference to
+ * the `lodash` function.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Util
+ * @returns {Function} Returns the `lodash` function.
+ * @example
+ *
+ * var lodash = _.noConflict();
+ */
+ function noConflict() {
+ if (root._ === this) {
+ root._ = oldDash;
+ }
+ return this;
+ }
+
+ /**
+ * This method returns `undefined`.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.3.0
+ * @category Util
+ * @example
+ *
+ * _.times(2, _.noop);
+ * // => [undefined, undefined]
+ */
+ function noop() {
+ // No operation performed.
+ }
+
+ /**
+ * Creates a function that gets the argument at index `n`. If `n` is negative,
+ * the nth argument from the end is returned.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Util
+ * @param {number} [n=0] The index of the argument to return.
+ * @returns {Function} Returns the new pass-thru function.
+ * @example
+ *
+ * var func = _.nthArg(1);
+ * func('a', 'b', 'c', 'd');
+ * // => 'b'
+ *
+ * var func = _.nthArg(-2);
+ * func('a', 'b', 'c', 'd');
+ * // => 'c'
+ */
+ function nthArg(n) {
+ n = toInteger(n);
+ return baseRest(function(args) {
+ return baseNth(args, n);
+ });
+ }
+
+ /**
+ * Creates a function that invokes `iteratees` with the arguments it receives
+ * and returns their results.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Util
+ * @param {...(Function|Function[])} [iteratees=[_.identity]]
+ * The iteratees to invoke.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * var func = _.over([Math.max, Math.min]);
+ *
+ * func(1, 2, 3, 4);
+ * // => [4, 1]
+ */
+ var over = createOver(arrayMap);
+
+ /**
+ * Creates a function that checks if **all** of the `predicates` return
+ * truthy when invoked with the arguments it receives.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Util
+ * @param {...(Function|Function[])} [predicates=[_.identity]]
+ * The predicates to check.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * var func = _.overEvery([Boolean, isFinite]);
+ *
+ * func('1');
+ * // => true
+ *
+ * func(null);
+ * // => false
+ *
+ * func(NaN);
+ * // => false
+ */
+ var overEvery = createOver(arrayEvery);
+
+ /**
+ * Creates a function that checks if **any** of the `predicates` return
+ * truthy when invoked with the arguments it receives.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Util
+ * @param {...(Function|Function[])} [predicates=[_.identity]]
+ * The predicates to check.
+ * @returns {Function} Returns the new function.
+ * @example
+ *
+ * var func = _.overSome([Boolean, isFinite]);
+ *
+ * func('1');
+ * // => true
+ *
+ * func(null);
+ * // => true
+ *
+ * func(NaN);
+ * // => false
+ */
+ var overSome = createOver(arraySome);
+
+ /**
+ * Creates a function that returns the value at `path` of a given object.
+ *
+ * @static
+ * @memberOf _
+ * @since 2.4.0
+ * @category Util
+ * @param {Array|string} path The path of the property to get.
+ * @returns {Function} Returns the new accessor function.
+ * @example
+ *
+ * var objects = [
+ * { 'a': { 'b': 2 } },
+ * { 'a': { 'b': 1 } }
+ * ];
+ *
+ * _.map(objects, _.property('a.b'));
+ * // => [2, 1]
+ *
+ * _.map(_.sortBy(objects, _.property(['a', 'b'])), 'a.b');
+ * // => [1, 2]
+ */
+ function property(path) {
+ return isKey(path) ? baseProperty(toKey(path)) : basePropertyDeep(path);
+ }
+
+ /**
+ * The opposite of `_.property`; this method creates a function that returns
+ * the value at a given path of `object`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.0.0
+ * @category Util
+ * @param {Object} object The object to query.
+ * @returns {Function} Returns the new accessor function.
+ * @example
+ *
+ * var array = [0, 1, 2],
+ * object = { 'a': array, 'b': array, 'c': array };
+ *
+ * _.map(['a[2]', 'c[0]'], _.propertyOf(object));
+ * // => [2, 0]
+ *
+ * _.map([['a', '2'], ['c', '0']], _.propertyOf(object));
+ * // => [2, 0]
+ */
+ function propertyOf(object) {
+ return function(path) {
+ return object == null ? undefined : baseGet(object, path);
+ };
+ }
+
+ /**
+ * Creates an array of numbers (positive and/or negative) progressing from
+ * `start` up to, but not including, `end`. A step of `-1` is used if a negative
+ * `start` is specified without an `end` or `step`. If `end` is not specified,
+ * it's set to `start` with `start` then set to `0`.
+ *
+ * **Note:** JavaScript follows the IEEE-754 standard for resolving
+ * floating-point values which can produce unexpected results.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Util
+ * @param {number} [start=0] The start of the range.
+ * @param {number} end The end of the range.
+ * @param {number} [step=1] The value to increment or decrement by.
+ * @returns {Array} Returns the range of numbers.
+ * @see _.inRange, _.rangeRight
+ * @example
+ *
+ * _.range(4);
+ * // => [0, 1, 2, 3]
+ *
+ * _.range(-4);
+ * // => [0, -1, -2, -3]
+ *
+ * _.range(1, 5);
+ * // => [1, 2, 3, 4]
+ *
+ * _.range(0, 20, 5);
+ * // => [0, 5, 10, 15]
+ *
+ * _.range(0, -4, -1);
+ * // => [0, -1, -2, -3]
+ *
+ * _.range(1, 4, 0);
+ * // => [1, 1, 1]
+ *
+ * _.range(0);
+ * // => []
+ */
+ var range = createRange();
+
+ /**
+ * This method is like `_.range` except that it populates values in
+ * descending order.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Util
+ * @param {number} [start=0] The start of the range.
+ * @param {number} end The end of the range.
+ * @param {number} [step=1] The value to increment or decrement by.
+ * @returns {Array} Returns the range of numbers.
+ * @see _.inRange, _.range
+ * @example
+ *
+ * _.rangeRight(4);
+ * // => [3, 2, 1, 0]
+ *
+ * _.rangeRight(-4);
+ * // => [-3, -2, -1, 0]
+ *
+ * _.rangeRight(1, 5);
+ * // => [4, 3, 2, 1]
+ *
+ * _.rangeRight(0, 20, 5);
+ * // => [15, 10, 5, 0]
+ *
+ * _.rangeRight(0, -4, -1);
+ * // => [-3, -2, -1, 0]
+ *
+ * _.rangeRight(1, 4, 0);
+ * // => [1, 1, 1]
+ *
+ * _.rangeRight(0);
+ * // => []
+ */
+ var rangeRight = createRange(true);
+
+ /**
+ * This method returns a new empty array.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.13.0
+ * @category Util
+ * @returns {Array} Returns the new empty array.
+ * @example
+ *
+ * var arrays = _.times(2, _.stubArray);
+ *
+ * console.log(arrays);
+ * // => [[], []]
+ *
+ * console.log(arrays[0] === arrays[1]);
+ * // => false
+ */
+ function stubArray() {
+ return [];
+ }
+
+ /**
+ * This method returns `false`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.13.0
+ * @category Util
+ * @returns {boolean} Returns `false`.
+ * @example
+ *
+ * _.times(2, _.stubFalse);
+ * // => [false, false]
+ */
+ function stubFalse() {
+ return false;
+ }
+
+ /**
+ * This method returns a new empty object.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.13.0
+ * @category Util
+ * @returns {Object} Returns the new empty object.
+ * @example
+ *
+ * var objects = _.times(2, _.stubObject);
+ *
+ * console.log(objects);
+ * // => [{}, {}]
+ *
+ * console.log(objects[0] === objects[1]);
+ * // => false
+ */
+ function stubObject() {
+ return {};
+ }
+
+ /**
+ * This method returns an empty string.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.13.0
+ * @category Util
+ * @returns {string} Returns the empty string.
+ * @example
+ *
+ * _.times(2, _.stubString);
+ * // => ['', '']
+ */
+ function stubString() {
+ return '';
+ }
+
+ /**
+ * This method returns `true`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.13.0
+ * @category Util
+ * @returns {boolean} Returns `true`.
+ * @example
+ *
+ * _.times(2, _.stubTrue);
+ * // => [true, true]
+ */
+ function stubTrue() {
+ return true;
+ }
+
+ /**
+ * Invokes the iteratee `n` times, returning an array of the results of
+ * each invocation. The iteratee is invoked with one argument; (index).
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Util
+ * @param {number} n The number of times to invoke `iteratee`.
+ * @param {Function} [iteratee=_.identity] The function invoked per iteration.
+ * @returns {Array} Returns the array of results.
+ * @example
+ *
+ * _.times(3, String);
+ * // => ['0', '1', '2']
+ *
+ * _.times(4, _.constant(0));
+ * // => [0, 0, 0, 0]
+ */
+ function times(n, iteratee) {
+ n = toInteger(n);
+ if (n < 1 || n > MAX_SAFE_INTEGER) {
+ return [];
+ }
+ var index = MAX_ARRAY_LENGTH,
+ length = nativeMin(n, MAX_ARRAY_LENGTH);
+
+ iteratee = getIteratee(iteratee);
+ n -= MAX_ARRAY_LENGTH;
+
+ var result = baseTimes(length, iteratee);
+ while (++index < n) {
+ iteratee(index);
+ }
+ return result;
+ }
+
+ /**
+ * Converts `value` to a property path array.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Util
+ * @param {*} value The value to convert.
+ * @returns {Array} Returns the new property path array.
+ * @example
+ *
+ * _.toPath('a.b.c');
+ * // => ['a', 'b', 'c']
+ *
+ * _.toPath('a[0].b.c');
+ * // => ['a', '0', 'b', 'c']
+ */
+ function toPath(value) {
+ if (isArray(value)) {
+ return arrayMap(value, toKey);
+ }
+ return isSymbol(value) ? [value] : copyArray(stringToPath(toString(value)));
+ }
+
+ /**
+ * Generates a unique ID. If `prefix` is given, the ID is appended to it.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Util
+ * @param {string} [prefix=''] The value to prefix the ID with.
+ * @returns {string} Returns the unique ID.
+ * @example
+ *
+ * _.uniqueId('contact_');
+ * // => 'contact_104'
+ *
+ * _.uniqueId();
+ * // => '105'
+ */
+ function uniqueId(prefix) {
+ var id = ++idCounter;
+ return toString(prefix) + id;
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * Adds two numbers.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.4.0
+ * @category Math
+ * @param {number} augend The first number in an addition.
+ * @param {number} addend The second number in an addition.
+ * @returns {number} Returns the total.
+ * @example
+ *
+ * _.add(6, 4);
+ * // => 10
+ */
+ var add = createMathOperation(function(augend, addend) {
+ return augend + addend;
+ }, 0);
+
+ /**
+ * Computes `number` rounded up to `precision`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.10.0
+ * @category Math
+ * @param {number} number The number to round up.
+ * @param {number} [precision=0] The precision to round up to.
+ * @returns {number} Returns the rounded up number.
+ * @example
+ *
+ * _.ceil(4.006);
+ * // => 5
+ *
+ * _.ceil(6.004, 2);
+ * // => 6.01
+ *
+ * _.ceil(6040, -2);
+ * // => 6100
+ */
+ var ceil = createRound('ceil');
+
+ /**
+ * Divide two numbers.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.7.0
+ * @category Math
+ * @param {number} dividend The first number in a division.
+ * @param {number} divisor The second number in a division.
+ * @returns {number} Returns the quotient.
+ * @example
+ *
+ * _.divide(6, 4);
+ * // => 1.5
+ */
+ var divide = createMathOperation(function(dividend, divisor) {
+ return dividend / divisor;
+ }, 1);
+
+ /**
+ * Computes `number` rounded down to `precision`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.10.0
+ * @category Math
+ * @param {number} number The number to round down.
+ * @param {number} [precision=0] The precision to round down to.
+ * @returns {number} Returns the rounded down number.
+ * @example
+ *
+ * _.floor(4.006);
+ * // => 4
+ *
+ * _.floor(0.046, 2);
+ * // => 0.04
+ *
+ * _.floor(4060, -2);
+ * // => 4000
+ */
+ var floor = createRound('floor');
+
+ /**
+ * Computes the maximum value of `array`. If `array` is empty or falsey,
+ * `undefined` is returned.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Math
+ * @param {Array} array The array to iterate over.
+ * @returns {*} Returns the maximum value.
+ * @example
+ *
+ * _.max([4, 2, 8, 6]);
+ * // => 8
+ *
+ * _.max([]);
+ * // => undefined
+ */
+ function max(array) {
+ return (array && array.length)
+ ? baseExtremum(array, identity, baseGt)
+ : undefined;
+ }
+
+ /**
+ * This method is like `_.max` except that it accepts `iteratee` which is
+ * invoked for each element in `array` to generate the criterion by which
+ * the value is ranked. The iteratee is invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Math
+ * @param {Array} array The array to iterate over.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {*} Returns the maximum value.
+ * @example
+ *
+ * var objects = [{ 'n': 1 }, { 'n': 2 }];
+ *
+ * _.maxBy(objects, function(o) { return o.n; });
+ * // => { 'n': 2 }
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.maxBy(objects, 'n');
+ * // => { 'n': 2 }
+ */
+ function maxBy(array, iteratee) {
+ return (array && array.length)
+ ? baseExtremum(array, getIteratee(iteratee, 2), baseGt)
+ : undefined;
+ }
+
+ /**
+ * Computes the mean of the values in `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Math
+ * @param {Array} array The array to iterate over.
+ * @returns {number} Returns the mean.
+ * @example
+ *
+ * _.mean([4, 2, 8, 6]);
+ * // => 5
+ */
+ function mean(array) {
+ return baseMean(array, identity);
+ }
+
+ /**
+ * This method is like `_.mean` except that it accepts `iteratee` which is
+ * invoked for each element in `array` to generate the value to be averaged.
+ * The iteratee is invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.7.0
+ * @category Math
+ * @param {Array} array The array to iterate over.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {number} Returns the mean.
+ * @example
+ *
+ * var objects = [{ 'n': 4 }, { 'n': 2 }, { 'n': 8 }, { 'n': 6 }];
+ *
+ * _.meanBy(objects, function(o) { return o.n; });
+ * // => 5
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.meanBy(objects, 'n');
+ * // => 5
+ */
+ function meanBy(array, iteratee) {
+ return baseMean(array, getIteratee(iteratee, 2));
+ }
+
+ /**
+ * Computes the minimum value of `array`. If `array` is empty or falsey,
+ * `undefined` is returned.
+ *
+ * @static
+ * @since 0.1.0
+ * @memberOf _
+ * @category Math
+ * @param {Array} array The array to iterate over.
+ * @returns {*} Returns the minimum value.
+ * @example
+ *
+ * _.min([4, 2, 8, 6]);
+ * // => 2
+ *
+ * _.min([]);
+ * // => undefined
+ */
+ function min(array) {
+ return (array && array.length)
+ ? baseExtremum(array, identity, baseLt)
+ : undefined;
+ }
+
+ /**
+ * This method is like `_.min` except that it accepts `iteratee` which is
+ * invoked for each element in `array` to generate the criterion by which
+ * the value is ranked. The iteratee is invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Math
+ * @param {Array} array The array to iterate over.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {*} Returns the minimum value.
+ * @example
+ *
+ * var objects = [{ 'n': 1 }, { 'n': 2 }];
+ *
+ * _.minBy(objects, function(o) { return o.n; });
+ * // => { 'n': 1 }
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.minBy(objects, 'n');
+ * // => { 'n': 1 }
+ */
+ function minBy(array, iteratee) {
+ return (array && array.length)
+ ? baseExtremum(array, getIteratee(iteratee, 2), baseLt)
+ : undefined;
+ }
+
+ /**
+ * Multiply two numbers.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.7.0
+ * @category Math
+ * @param {number} multiplier The first number in a multiplication.
+ * @param {number} multiplicand The second number in a multiplication.
+ * @returns {number} Returns the product.
+ * @example
+ *
+ * _.multiply(6, 4);
+ * // => 24
+ */
+ var multiply = createMathOperation(function(multiplier, multiplicand) {
+ return multiplier * multiplicand;
+ }, 1);
+
+ /**
+ * Computes `number` rounded to `precision`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.10.0
+ * @category Math
+ * @param {number} number The number to round.
+ * @param {number} [precision=0] The precision to round to.
+ * @returns {number} Returns the rounded number.
+ * @example
+ *
+ * _.round(4.006);
+ * // => 4
+ *
+ * _.round(4.006, 2);
+ * // => 4.01
+ *
+ * _.round(4060, -2);
+ * // => 4100
+ */
+ var round = createRound('round');
+
+ /**
+ * Subtract two numbers.
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Math
+ * @param {number} minuend The first number in a subtraction.
+ * @param {number} subtrahend The second number in a subtraction.
+ * @returns {number} Returns the difference.
+ * @example
+ *
+ * _.subtract(6, 4);
+ * // => 2
+ */
+ var subtract = createMathOperation(function(minuend, subtrahend) {
+ return minuend - subtrahend;
+ }, 0);
+
+ /**
+ * Computes the sum of the values in `array`.
+ *
+ * @static
+ * @memberOf _
+ * @since 3.4.0
+ * @category Math
+ * @param {Array} array The array to iterate over.
+ * @returns {number} Returns the sum.
+ * @example
+ *
+ * _.sum([4, 2, 8, 6]);
+ * // => 20
+ */
+ function sum(array) {
+ return (array && array.length)
+ ? baseSum(array, identity)
+ : 0;
+ }
+
+ /**
+ * This method is like `_.sum` except that it accepts `iteratee` which is
+ * invoked for each element in `array` to generate the value to be summed.
+ * The iteratee is invoked with one argument: (value).
+ *
+ * @static
+ * @memberOf _
+ * @since 4.0.0
+ * @category Math
+ * @param {Array} array The array to iterate over.
+ * @param {Function} [iteratee=_.identity] The iteratee invoked per element.
+ * @returns {number} Returns the sum.
+ * @example
+ *
+ * var objects = [{ 'n': 4 }, { 'n': 2 }, { 'n': 8 }, { 'n': 6 }];
+ *
+ * _.sumBy(objects, function(o) { return o.n; });
+ * // => 20
+ *
+ * // The `_.property` iteratee shorthand.
+ * _.sumBy(objects, 'n');
+ * // => 20
+ */
+ function sumBy(array, iteratee) {
+ return (array && array.length)
+ ? baseSum(array, getIteratee(iteratee, 2))
+ : 0;
+ }
+
+ /*------------------------------------------------------------------------*/
+
+ // Add methods that return wrapped values in chain sequences.
+ lodash.after = after;
+ lodash.ary = ary;
+ lodash.assign = assign;
+ lodash.assignIn = assignIn;
+ lodash.assignInWith = assignInWith;
+ lodash.assignWith = assignWith;
+ lodash.at = at;
+ lodash.before = before;
+ lodash.bind = bind;
+ lodash.bindAll = bindAll;
+ lodash.bindKey = bindKey;
+ lodash.castArray = castArray;
+ lodash.chain = chain;
+ lodash.chunk = chunk;
+ lodash.compact = compact;
+ lodash.concat = concat;
+ lodash.cond = cond;
+ lodash.conforms = conforms;
+ lodash.constant = constant;
+ lodash.countBy = countBy;
+ lodash.create = create;
+ lodash.curry = curry;
+ lodash.curryRight = curryRight;
+ lodash.debounce = debounce;
+ lodash.defaults = defaults;
+ lodash.defaultsDeep = defaultsDeep;
+ lodash.defer = defer;
+ lodash.delay = delay;
+ lodash.difference = difference;
+ lodash.differenceBy = differenceBy;
+ lodash.differenceWith = differenceWith;
+ lodash.drop = drop;
+ lodash.dropRight = dropRight;
+ lodash.dropRightWhile = dropRightWhile;
+ lodash.dropWhile = dropWhile;
+ lodash.fill = fill;
+ lodash.filter = filter;
+ lodash.flatMap = flatMap;
+ lodash.flatMapDeep = flatMapDeep;
+ lodash.flatMapDepth = flatMapDepth;
+ lodash.flatten = flatten;
+ lodash.flattenDeep = flattenDeep;
+ lodash.flattenDepth = flattenDepth;
+ lodash.flip = flip;
+ lodash.flow = flow;
+ lodash.flowRight = flowRight;
+ lodash.fromPairs = fromPairs;
+ lodash.functions = functions;
+ lodash.functionsIn = functionsIn;
+ lodash.groupBy = groupBy;
+ lodash.initial = initial;
+ lodash.intersection = intersection;
+ lodash.intersectionBy = intersectionBy;
+ lodash.intersectionWith = intersectionWith;
+ lodash.invert = invert;
+ lodash.invertBy = invertBy;
+ lodash.invokeMap = invokeMap;
+ lodash.iteratee = iteratee;
+ lodash.keyBy = keyBy;
+ lodash.keys = keys;
+ lodash.keysIn = keysIn;
+ lodash.map = map;
+ lodash.mapKeys = mapKeys;
+ lodash.mapValues = mapValues;
+ lodash.matches = matches;
+ lodash.matchesProperty = matchesProperty;
+ lodash.memoize = memoize;
+ lodash.merge = merge;
+ lodash.mergeWith = mergeWith;
+ lodash.method = method;
+ lodash.methodOf = methodOf;
+ lodash.mixin = mixin;
+ lodash.negate = negate;
+ lodash.nthArg = nthArg;
+ lodash.omit = omit;
+ lodash.omitBy = omitBy;
+ lodash.once = once;
+ lodash.orderBy = orderBy;
+ lodash.over = over;
+ lodash.overArgs = overArgs;
+ lodash.overEvery = overEvery;
+ lodash.overSome = overSome;
+ lodash.partial = partial;
+ lodash.partialRight = partialRight;
+ lodash.partition = partition;
+ lodash.pick = pick;
+ lodash.pickBy = pickBy;
+ lodash.property = property;
+ lodash.propertyOf = propertyOf;
+ lodash.pull = pull;
+ lodash.pullAll = pullAll;
+ lodash.pullAllBy = pullAllBy;
+ lodash.pullAllWith = pullAllWith;
+ lodash.pullAt = pullAt;
+ lodash.range = range;
+ lodash.rangeRight = rangeRight;
+ lodash.rearg = rearg;
+ lodash.reject = reject;
+ lodash.remove = remove;
+ lodash.rest = rest;
+ lodash.reverse = reverse;
+ lodash.sampleSize = sampleSize;
+ lodash.set = set;
+ lodash.setWith = setWith;
+ lodash.shuffle = shuffle;
+ lodash.slice = slice;
+ lodash.sortBy = sortBy;
+ lodash.sortedUniq = sortedUniq;
+ lodash.sortedUniqBy = sortedUniqBy;
+ lodash.split = split;
+ lodash.spread = spread;
+ lodash.tail = tail;
+ lodash.take = take;
+ lodash.takeRight = takeRight;
+ lodash.takeRightWhile = takeRightWhile;
+ lodash.takeWhile = takeWhile;
+ lodash.tap = tap;
+ lodash.throttle = throttle;
+ lodash.thru = thru;
+ lodash.toArray = toArray;
+ lodash.toPairs = toPairs;
+ lodash.toPairsIn = toPairsIn;
+ lodash.toPath = toPath;
+ lodash.toPlainObject = toPlainObject;
+ lodash.transform = transform;
+ lodash.unary = unary;
+ lodash.union = union;
+ lodash.unionBy = unionBy;
+ lodash.unionWith = unionWith;
+ lodash.uniq = uniq;
+ lodash.uniqBy = uniqBy;
+ lodash.uniqWith = uniqWith;
+ lodash.unset = unset;
+ lodash.unzip = unzip;
+ lodash.unzipWith = unzipWith;
+ lodash.update = update;
+ lodash.updateWith = updateWith;
+ lodash.values = values;
+ lodash.valuesIn = valuesIn;
+ lodash.without = without;
+ lodash.words = words;
+ lodash.wrap = wrap;
+ lodash.xor = xor;
+ lodash.xorBy = xorBy;
+ lodash.xorWith = xorWith;
+ lodash.zip = zip;
+ lodash.zipObject = zipObject;
+ lodash.zipObjectDeep = zipObjectDeep;
+ lodash.zipWith = zipWith;
+
+ // Add aliases.
+ lodash.entries = toPairs;
+ lodash.entriesIn = toPairsIn;
+ lodash.extend = assignIn;
+ lodash.extendWith = assignInWith;
+
+ // Add methods to `lodash.prototype`.
+ mixin(lodash, lodash);
+
+ /*------------------------------------------------------------------------*/
+
+ // Add methods that return unwrapped values in chain sequences.
+ lodash.add = add;
+ lodash.attempt = attempt;
+ lodash.camelCase = camelCase;
+ lodash.capitalize = capitalize;
+ lodash.ceil = ceil;
+ lodash.clamp = clamp;
+ lodash.clone = clone;
+ lodash.cloneDeep = cloneDeep;
+ lodash.cloneDeepWith = cloneDeepWith;
+ lodash.cloneWith = cloneWith;
+ lodash.conformsTo = conformsTo;
+ lodash.deburr = deburr;
+ lodash.defaultTo = defaultTo;
+ lodash.divide = divide;
+ lodash.endsWith = endsWith;
+ lodash.eq = eq;
+ lodash.escape = escape;
+ lodash.escapeRegExp = escapeRegExp;
+ lodash.every = every;
+ lodash.find = find;
+ lodash.findIndex = findIndex;
+ lodash.findKey = findKey;
+ lodash.findLast = findLast;
+ lodash.findLastIndex = findLastIndex;
+ lodash.findLastKey = findLastKey;
+ lodash.floor = floor;
+ lodash.forEach = forEach;
+ lodash.forEachRight = forEachRight;
+ lodash.forIn = forIn;
+ lodash.forInRight = forInRight;
+ lodash.forOwn = forOwn;
+ lodash.forOwnRight = forOwnRight;
+ lodash.get = get;
+ lodash.gt = gt;
+ lodash.gte = gte;
+ lodash.has = has;
+ lodash.hasIn = hasIn;
+ lodash.head = head;
+ lodash.identity = identity;
+ lodash.includes = includes;
+ lodash.indexOf = indexOf;
+ lodash.inRange = inRange;
+ lodash.invoke = invoke;
+ lodash.isArguments = isArguments;
+ lodash.isArray = isArray;
+ lodash.isArrayBuffer = isArrayBuffer;
+ lodash.isArrayLike = isArrayLike;
+ lodash.isArrayLikeObject = isArrayLikeObject;
+ lodash.isBoolean = isBoolean;
+ lodash.isBuffer = isBuffer;
+ lodash.isDate = isDate;
+ lodash.isElement = isElement;
+ lodash.isEmpty = isEmpty;
+ lodash.isEqual = isEqual;
+ lodash.isEqualWith = isEqualWith;
+ lodash.isError = isError;
+ lodash.isFinite = isFinite;
+ lodash.isFunction = isFunction;
+ lodash.isInteger = isInteger;
+ lodash.isLength = isLength;
+ lodash.isMap = isMap;
+ lodash.isMatch = isMatch;
+ lodash.isMatchWith = isMatchWith;
+ lodash.isNaN = isNaN;
+ lodash.isNative = isNative;
+ lodash.isNil = isNil;
+ lodash.isNull = isNull;
+ lodash.isNumber = isNumber;
+ lodash.isObject = isObject;
+ lodash.isObjectLike = isObjectLike;
+ lodash.isPlainObject = isPlainObject;
+ lodash.isRegExp = isRegExp;
+ lodash.isSafeInteger = isSafeInteger;
+ lodash.isSet = isSet;
+ lodash.isString = isString;
+ lodash.isSymbol = isSymbol;
+ lodash.isTypedArray = isTypedArray;
+ lodash.isUndefined = isUndefined;
+ lodash.isWeakMap = isWeakMap;
+ lodash.isWeakSet = isWeakSet;
+ lodash.join = join;
+ lodash.kebabCase = kebabCase;
+ lodash.last = last;
+ lodash.lastIndexOf = lastIndexOf;
+ lodash.lowerCase = lowerCase;
+ lodash.lowerFirst = lowerFirst;
+ lodash.lt = lt;
+ lodash.lte = lte;
+ lodash.max = max;
+ lodash.maxBy = maxBy;
+ lodash.mean = mean;
+ lodash.meanBy = meanBy;
+ lodash.min = min;
+ lodash.minBy = minBy;
+ lodash.stubArray = stubArray;
+ lodash.stubFalse = stubFalse;
+ lodash.stubObject = stubObject;
+ lodash.stubString = stubString;
+ lodash.stubTrue = stubTrue;
+ lodash.multiply = multiply;
+ lodash.nth = nth;
+ lodash.noConflict = noConflict;
+ lodash.noop = noop;
+ lodash.now = now;
+ lodash.pad = pad;
+ lodash.padEnd = padEnd;
+ lodash.padStart = padStart;
+ lodash.parseInt = parseInt;
+ lodash.random = random;
+ lodash.reduce = reduce;
+ lodash.reduceRight = reduceRight;
+ lodash.repeat = repeat;
+ lodash.replace = replace;
+ lodash.result = result;
+ lodash.round = round;
+ lodash.runInContext = runInContext;
+ lodash.sample = sample;
+ lodash.size = size;
+ lodash.snakeCase = snakeCase;
+ lodash.some = some;
+ lodash.sortedIndex = sortedIndex;
+ lodash.sortedIndexBy = sortedIndexBy;
+ lodash.sortedIndexOf = sortedIndexOf;
+ lodash.sortedLastIndex = sortedLastIndex;
+ lodash.sortedLastIndexBy = sortedLastIndexBy;
+ lodash.sortedLastIndexOf = sortedLastIndexOf;
+ lodash.startCase = startCase;
+ lodash.startsWith = startsWith;
+ lodash.subtract = subtract;
+ lodash.sum = sum;
+ lodash.sumBy = sumBy;
+ lodash.template = template;
+ lodash.times = times;
+ lodash.toFinite = toFinite;
+ lodash.toInteger = toInteger;
+ lodash.toLength = toLength;
+ lodash.toLower = toLower;
+ lodash.toNumber = toNumber;
+ lodash.toSafeInteger = toSafeInteger;
+ lodash.toString = toString;
+ lodash.toUpper = toUpper;
+ lodash.trim = trim;
+ lodash.trimEnd = trimEnd;
+ lodash.trimStart = trimStart;
+ lodash.truncate = truncate;
+ lodash.unescape = unescape;
+ lodash.uniqueId = uniqueId;
+ lodash.upperCase = upperCase;
+ lodash.upperFirst = upperFirst;
+
+ // Add aliases.
+ lodash.each = forEach;
+ lodash.eachRight = forEachRight;
+ lodash.first = head;
+
+ mixin(lodash, (function() {
+ var source = {};
+ baseForOwn(lodash, function(func, methodName) {
+ if (!hasOwnProperty.call(lodash.prototype, methodName)) {
+ source[methodName] = func;
+ }
+ });
+ return source;
+ }()), { 'chain': false });
+
+ /*------------------------------------------------------------------------*/
+
+ /**
+ * The semantic version number.
+ *
+ * @static
+ * @memberOf _
+ * @type {string}
+ */
+ lodash.VERSION = VERSION;
+
+ // Assign default placeholders.
+ arrayEach(['bind', 'bindKey', 'curry', 'curryRight', 'partial', 'partialRight'], function(methodName) {
+ lodash[methodName].placeholder = lodash;
+ });
+
+ // Add `LazyWrapper` methods for `_.drop` and `_.take` variants.
+ arrayEach(['drop', 'take'], function(methodName, index) {
+ LazyWrapper.prototype[methodName] = function(n) {
+ n = n === undefined ? 1 : nativeMax(toInteger(n), 0);
+
+ var result = (this.__filtered__ && !index)
+ ? new LazyWrapper(this)
+ : this.clone();
+
+ if (result.__filtered__) {
+ result.__takeCount__ = nativeMin(n, result.__takeCount__);
+ } else {
+ result.__views__.push({
+ 'size': nativeMin(n, MAX_ARRAY_LENGTH),
+ 'type': methodName + (result.__dir__ < 0 ? 'Right' : '')
+ });
+ }
+ return result;
+ };
+
+ LazyWrapper.prototype[methodName + 'Right'] = function(n) {
+ return this.reverse()[methodName](n).reverse();
+ };
+ });
+
+ // Add `LazyWrapper` methods that accept an `iteratee` value.
+ arrayEach(['filter', 'map', 'takeWhile'], function(methodName, index) {
+ var type = index + 1,
+ isFilter = type == LAZY_FILTER_FLAG || type == LAZY_WHILE_FLAG;
+
+ LazyWrapper.prototype[methodName] = function(iteratee) {
+ var result = this.clone();
+ result.__iteratees__.push({
+ 'iteratee': getIteratee(iteratee, 3),
+ 'type': type
+ });
+ result.__filtered__ = result.__filtered__ || isFilter;
+ return result;
+ };
+ });
+
+ // Add `LazyWrapper` methods for `_.head` and `_.last`.
+ arrayEach(['head', 'last'], function(methodName, index) {
+ var takeName = 'take' + (index ? 'Right' : '');
+
+ LazyWrapper.prototype[methodName] = function() {
+ return this[takeName](1).value()[0];
+ };
+ });
+
+ // Add `LazyWrapper` methods for `_.initial` and `_.tail`.
+ arrayEach(['initial', 'tail'], function(methodName, index) {
+ var dropName = 'drop' + (index ? '' : 'Right');
+
+ LazyWrapper.prototype[methodName] = function() {
+ return this.__filtered__ ? new LazyWrapper(this) : this[dropName](1);
+ };
+ });
+
+ LazyWrapper.prototype.compact = function() {
+ return this.filter(identity);
+ };
+
+ LazyWrapper.prototype.find = function(predicate) {
+ return this.filter(predicate).head();
+ };
+
+ LazyWrapper.prototype.findLast = function(predicate) {
+ return this.reverse().find(predicate);
+ };
+
+ LazyWrapper.prototype.invokeMap = baseRest(function(path, args) {
+ if (typeof path == 'function') {
+ return new LazyWrapper(this);
+ }
+ return this.map(function(value) {
+ return baseInvoke(value, path, args);
+ });
+ });
+
+ LazyWrapper.prototype.reject = function(predicate) {
+ return this.filter(negate(getIteratee(predicate)));
+ };
+
+ LazyWrapper.prototype.slice = function(start, end) {
+ start = toInteger(start);
+
+ var result = this;
+ if (result.__filtered__ && (start > 0 || end < 0)) {
+ return new LazyWrapper(result);
+ }
+ if (start < 0) {
+ result = result.takeRight(-start);
+ } else if (start) {
+ result = result.drop(start);
+ }
+ if (end !== undefined) {
+ end = toInteger(end);
+ result = end < 0 ? result.dropRight(-end) : result.take(end - start);
+ }
+ return result;
+ };
+
+ LazyWrapper.prototype.takeRightWhile = function(predicate) {
+ return this.reverse().takeWhile(predicate).reverse();
+ };
+
+ LazyWrapper.prototype.toArray = function() {
+ return this.take(MAX_ARRAY_LENGTH);
+ };
+
+ // Add `LazyWrapper` methods to `lodash.prototype`.
+ baseForOwn(LazyWrapper.prototype, function(func, methodName) {
+ var checkIteratee = /^(?:filter|find|map|reject)|While$/.test(methodName),
+ isTaker = /^(?:head|last)$/.test(methodName),
+ lodashFunc = lodash[isTaker ? ('take' + (methodName == 'last' ? 'Right' : '')) : methodName],
+ retUnwrapped = isTaker || /^find/.test(methodName);
+
+ if (!lodashFunc) {
+ return;
+ }
+ lodash.prototype[methodName] = function() {
+ var value = this.__wrapped__,
+ args = isTaker ? [1] : arguments,
+ isLazy = value instanceof LazyWrapper,
+ iteratee = args[0],
+ useLazy = isLazy || isArray(value);
+
+ var interceptor = function(value) {
+ var result = lodashFunc.apply(lodash, arrayPush([value], args));
+ return (isTaker && chainAll) ? result[0] : result;
+ };
+
+ if (useLazy && checkIteratee && typeof iteratee == 'function' && iteratee.length != 1) {
+ // Avoid lazy use if the iteratee has a "length" value other than `1`.
+ isLazy = useLazy = false;
+ }
+ var chainAll = this.__chain__,
+ isHybrid = !!this.__actions__.length,
+ isUnwrapped = retUnwrapped && !chainAll,
+ onlyLazy = isLazy && !isHybrid;
+
+ if (!retUnwrapped && useLazy) {
+ value = onlyLazy ? value : new LazyWrapper(this);
+ var result = func.apply(value, args);
+ result.__actions__.push({ 'func': thru, 'args': [interceptor], 'thisArg': undefined });
+ return new LodashWrapper(result, chainAll);
+ }
+ if (isUnwrapped && onlyLazy) {
+ return func.apply(this, args);
+ }
+ result = this.thru(interceptor);
+ return isUnwrapped ? (isTaker ? result.value()[0] : result.value()) : result;
+ };
+ });
+
+ // Add `Array` methods to `lodash.prototype`.
+ arrayEach(['pop', 'push', 'shift', 'sort', 'splice', 'unshift'], function(methodName) {
+ var func = arrayProto[methodName],
+ chainName = /^(?:push|sort|unshift)$/.test(methodName) ? 'tap' : 'thru',
+ retUnwrapped = /^(?:pop|shift)$/.test(methodName);
+
+ lodash.prototype[methodName] = function() {
+ var args = arguments;
+ if (retUnwrapped && !this.__chain__) {
+ var value = this.value();
+ return func.apply(isArray(value) ? value : [], args);
+ }
+ return this[chainName](function(value) {
+ return func.apply(isArray(value) ? value : [], args);
+ });
+ };
+ });
+
+ // Map minified method names to their real names.
+ baseForOwn(LazyWrapper.prototype, function(func, methodName) {
+ var lodashFunc = lodash[methodName];
+ if (lodashFunc) {
+ var key = (lodashFunc.name + ''),
+ names = realNames[key] || (realNames[key] = []);
+
+ names.push({ 'name': methodName, 'func': lodashFunc });
+ }
+ });
+
+ realNames[createHybrid(undefined, WRAP_BIND_KEY_FLAG).name] = [{
+ 'name': 'wrapper',
+ 'func': undefined
+ }];
+
+ // Add methods to `LazyWrapper`.
+ LazyWrapper.prototype.clone = lazyClone;
+ LazyWrapper.prototype.reverse = lazyReverse;
+ LazyWrapper.prototype.value = lazyValue;
+
+ // Add chain sequence methods to the `lodash` wrapper.
+ lodash.prototype.at = wrapperAt;
+ lodash.prototype.chain = wrapperChain;
+ lodash.prototype.commit = wrapperCommit;
+ lodash.prototype.next = wrapperNext;
+ lodash.prototype.plant = wrapperPlant;
+ lodash.prototype.reverse = wrapperReverse;
+ lodash.prototype.toJSON = lodash.prototype.valueOf = lodash.prototype.value = wrapperValue;
+
+ // Add lazy aliases.
+ lodash.prototype.first = lodash.prototype.head;
+
+ if (symIterator) {
+ lodash.prototype[symIterator] = wrapperToIterator;
+ }
+ return lodash;
+ });
+
+ /*--------------------------------------------------------------------------*/
+
+ // Export lodash.
+ var _ = runInContext();
+
+ // Some AMD build optimizers, like r.js, check for condition patterns like:
+ if (true) {
+ // Expose Lodash on the global object to prevent errors when Lodash is
+ // loaded by a script tag in the presence of an AMD loader.
+ // See http://requirejs.org/docs/errors.html#mismatch for more details.
+ // Use `_.noConflict` to remove Lodash from the global object.
+ root._ = _;
+
+ // Define as an anonymous module so, through path mapping, it can be
+ // referenced as the "underscore" module.
+ !(__WEBPACK_AMD_DEFINE_RESULT__ = (function() {
+ return _;
+ }).call(exports, __webpack_require__, exports, module),
+ __WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));
+ }
+ // Check for `exports` after `define` in case a build optimizer adds it.
+ else {}
+}.call(this));
+
+/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(/*! ./../webpack/buildin/global.js */ "./node_modules/webpack/buildin/global.js"), __webpack_require__(/*! ./../webpack/buildin/module.js */ "./node_modules/webpack/buildin/module.js")(module)))
+
+/***/ }),
+
+/***/ "./node_modules/popper.js/dist/esm/popper.js":
+/*!***************************************************!*\
+ !*** ./node_modules/popper.js/dist/esm/popper.js ***!
+ \***************************************************/
+/*! exports provided: default */
+/***/ (function(module, __webpack_exports__, __webpack_require__) {
+
+"use strict";
+__webpack_require__.r(__webpack_exports__);
+/* WEBPACK VAR INJECTION */(function(global) {/**!
+ * @fileOverview Kickass library to create and place poppers near their reference elements.
+ * @version 1.14.7
+ * @license
+ * Copyright (c) 2016 Federico Zivolo and contributors
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining a copy
+ * of this software and associated documentation files (the "Software"), to deal
+ * in the Software without restriction, including without limitation the rights
+ * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+ * copies of the Software, and to permit persons to whom the Software is
+ * furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in all
+ * copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+ * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+ * SOFTWARE.
+ */
+var isBrowser = typeof window !== 'undefined' && typeof document !== 'undefined';
+
+var longerTimeoutBrowsers = ['Edge', 'Trident', 'Firefox'];
+var timeoutDuration = 0;
+for (var i = 0; i < longerTimeoutBrowsers.length; i += 1) {
+ if (isBrowser && navigator.userAgent.indexOf(longerTimeoutBrowsers[i]) >= 0) {
+ timeoutDuration = 1;
+ break;
+ }
+}
+
+function microtaskDebounce(fn) {
+ var called = false;
+ return function () {
+ if (called) {
+ return;
+ }
+ called = true;
+ window.Promise.resolve().then(function () {
+ called = false;
+ fn();
+ });
+ };
+}
+
+function taskDebounce(fn) {
+ var scheduled = false;
+ return function () {
+ if (!scheduled) {
+ scheduled = true;
+ setTimeout(function () {
+ scheduled = false;
+ fn();
+ }, timeoutDuration);
+ }
+ };
+}
+
+var supportsMicroTasks = isBrowser && window.Promise;
+
+/**
+* Create a debounced version of a method, that's asynchronously deferred
+* but called in the minimum time possible.
+*
+* @method
+* @memberof Popper.Utils
+* @argument {Function} fn
+* @returns {Function}
+*/
+var debounce = supportsMicroTasks ? microtaskDebounce : taskDebounce;
+
+/**
+ * Check if the given variable is a function
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Any} functionToCheck - variable to check
+ * @returns {Boolean} answer to: is a function?
+ */
+function isFunction(functionToCheck) {
+ var getType = {};
+ return functionToCheck && getType.toString.call(functionToCheck) === '[object Function]';
+}
+
+/**
+ * Get CSS computed property of the given element
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Eement} element
+ * @argument {String} property
+ */
+function getStyleComputedProperty(element, property) {
+ if (element.nodeType !== 1) {
+ return [];
+ }
+ // NOTE: 1 DOM access here
+ var window = element.ownerDocument.defaultView;
+ var css = window.getComputedStyle(element, null);
+ return property ? css[property] : css;
+}
+
+/**
+ * Returns the parentNode or the host of the element
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element
+ * @returns {Element} parent
+ */
+function getParentNode(element) {
+ if (element.nodeName === 'HTML') {
+ return element;
+ }
+ return element.parentNode || element.host;
+}
+
+/**
+ * Returns the scrolling parent of the given element
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element
+ * @returns {Element} scroll parent
+ */
+function getScrollParent(element) {
+ // Return body, `getScroll` will take care to get the correct `scrollTop` from it
+ if (!element) {
+ return document.body;
+ }
+
+ switch (element.nodeName) {
+ case 'HTML':
+ case 'BODY':
+ return element.ownerDocument.body;
+ case '#document':
+ return element.body;
+ }
+
+ // Firefox want us to check `-x` and `-y` variations as well
+
+ var _getStyleComputedProp = getStyleComputedProperty(element),
+ overflow = _getStyleComputedProp.overflow,
+ overflowX = _getStyleComputedProp.overflowX,
+ overflowY = _getStyleComputedProp.overflowY;
+
+ if (/(auto|scroll|overlay)/.test(overflow + overflowY + overflowX)) {
+ return element;
+ }
+
+ return getScrollParent(getParentNode(element));
+}
+
+var isIE11 = isBrowser && !!(window.MSInputMethodContext && document.documentMode);
+var isIE10 = isBrowser && /MSIE 10/.test(navigator.userAgent);
+
+/**
+ * Determines if the browser is Internet Explorer
+ * @method
+ * @memberof Popper.Utils
+ * @param {Number} version to check
+ * @returns {Boolean} isIE
+ */
+function isIE(version) {
+ if (version === 11) {
+ return isIE11;
+ }
+ if (version === 10) {
+ return isIE10;
+ }
+ return isIE11 || isIE10;
+}
+
+/**
+ * Returns the offset parent of the given element
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element
+ * @returns {Element} offset parent
+ */
+function getOffsetParent(element) {
+ if (!element) {
+ return document.documentElement;
+ }
+
+ var noOffsetParent = isIE(10) ? document.body : null;
+
+ // NOTE: 1 DOM access here
+ var offsetParent = element.offsetParent || null;
+ // Skip hidden elements which don't have an offsetParent
+ while (offsetParent === noOffsetParent && element.nextElementSibling) {
+ offsetParent = (element = element.nextElementSibling).offsetParent;
+ }
+
+ var nodeName = offsetParent && offsetParent.nodeName;
+
+ if (!nodeName || nodeName === 'BODY' || nodeName === 'HTML') {
+ return element ? element.ownerDocument.documentElement : document.documentElement;
+ }
+
+ // .offsetParent will return the closest TH, TD or TABLE in case
+ // no offsetParent is present, I hate this job...
+ if (['TH', 'TD', 'TABLE'].indexOf(offsetParent.nodeName) !== -1 && getStyleComputedProperty(offsetParent, 'position') === 'static') {
+ return getOffsetParent(offsetParent);
+ }
+
+ return offsetParent;
+}
+
+function isOffsetContainer(element) {
+ var nodeName = element.nodeName;
+
+ if (nodeName === 'BODY') {
+ return false;
+ }
+ return nodeName === 'HTML' || getOffsetParent(element.firstElementChild) === element;
+}
+
+/**
+ * Finds the root node (document, shadowDOM root) of the given element
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} node
+ * @returns {Element} root node
+ */
+function getRoot(node) {
+ if (node.parentNode !== null) {
+ return getRoot(node.parentNode);
+ }
+
+ return node;
+}
+
+/**
+ * Finds the offset parent common to the two provided nodes
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element1
+ * @argument {Element} element2
+ * @returns {Element} common offset parent
+ */
+function findCommonOffsetParent(element1, element2) {
+ // This check is needed to avoid errors in case one of the elements isn't defined for any reason
+ if (!element1 || !element1.nodeType || !element2 || !element2.nodeType) {
+ return document.documentElement;
+ }
+
+ // Here we make sure to give as "start" the element that comes first in the DOM
+ var order = element1.compareDocumentPosition(element2) & Node.DOCUMENT_POSITION_FOLLOWING;
+ var start = order ? element1 : element2;
+ var end = order ? element2 : element1;
+
+ // Get common ancestor container
+ var range = document.createRange();
+ range.setStart(start, 0);
+ range.setEnd(end, 0);
+ var commonAncestorContainer = range.commonAncestorContainer;
+
+ // Both nodes are inside #document
+
+ if (element1 !== commonAncestorContainer && element2 !== commonAncestorContainer || start.contains(end)) {
+ if (isOffsetContainer(commonAncestorContainer)) {
+ return commonAncestorContainer;
+ }
+
+ return getOffsetParent(commonAncestorContainer);
+ }
+
+ // one of the nodes is inside shadowDOM, find which one
+ var element1root = getRoot(element1);
+ if (element1root.host) {
+ return findCommonOffsetParent(element1root.host, element2);
+ } else {
+ return findCommonOffsetParent(element1, getRoot(element2).host);
+ }
+}
+
+/**
+ * Gets the scroll value of the given element in the given side (top and left)
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element
+ * @argument {String} side `top` or `left`
+ * @returns {number} amount of scrolled pixels
+ */
+function getScroll(element) {
+ var side = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'top';
+
+ var upperSide = side === 'top' ? 'scrollTop' : 'scrollLeft';
+ var nodeName = element.nodeName;
+
+ if (nodeName === 'BODY' || nodeName === 'HTML') {
+ var html = element.ownerDocument.documentElement;
+ var scrollingElement = element.ownerDocument.scrollingElement || html;
+ return scrollingElement[upperSide];
+ }
+
+ return element[upperSide];
+}
+
+/*
+ * Sum or subtract the element scroll values (left and top) from a given rect object
+ * @method
+ * @memberof Popper.Utils
+ * @param {Object} rect - Rect object you want to change
+ * @param {HTMLElement} element - The element from the function reads the scroll values
+ * @param {Boolean} subtract - set to true if you want to subtract the scroll values
+ * @return {Object} rect - The modifier rect object
+ */
+function includeScroll(rect, element) {
+ var subtract = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
+
+ var scrollTop = getScroll(element, 'top');
+ var scrollLeft = getScroll(element, 'left');
+ var modifier = subtract ? -1 : 1;
+ rect.top += scrollTop * modifier;
+ rect.bottom += scrollTop * modifier;
+ rect.left += scrollLeft * modifier;
+ rect.right += scrollLeft * modifier;
+ return rect;
+}
+
+/*
+ * Helper to detect borders of a given element
+ * @method
+ * @memberof Popper.Utils
+ * @param {CSSStyleDeclaration} styles
+ * Result of `getStyleComputedProperty` on the given element
+ * @param {String} axis - `x` or `y`
+ * @return {number} borders - The borders size of the given axis
+ */
+
+function getBordersSize(styles, axis) {
+ var sideA = axis === 'x' ? 'Left' : 'Top';
+ var sideB = sideA === 'Left' ? 'Right' : 'Bottom';
+
+ return parseFloat(styles['border' + sideA + 'Width'], 10) + parseFloat(styles['border' + sideB + 'Width'], 10);
+}
+
+function getSize(axis, body, html, computedStyle) {
+ return Math.max(body['offset' + axis], body['scroll' + axis], html['client' + axis], html['offset' + axis], html['scroll' + axis], isIE(10) ? parseInt(html['offset' + axis]) + parseInt(computedStyle['margin' + (axis === 'Height' ? 'Top' : 'Left')]) + parseInt(computedStyle['margin' + (axis === 'Height' ? 'Bottom' : 'Right')]) : 0);
+}
+
+function getWindowSizes(document) {
+ var body = document.body;
+ var html = document.documentElement;
+ var computedStyle = isIE(10) && getComputedStyle(html);
+
+ return {
+ height: getSize('Height', body, html, computedStyle),
+ width: getSize('Width', body, html, computedStyle)
+ };
+}
+
+var classCallCheck = function (instance, Constructor) {
+ if (!(instance instanceof Constructor)) {
+ throw new TypeError("Cannot call a class as a function");
+ }
+};
+
+var createClass = function () {
+ function defineProperties(target, props) {
+ for (var i = 0; i < props.length; i++) {
+ var descriptor = props[i];
+ descriptor.enumerable = descriptor.enumerable || false;
+ descriptor.configurable = true;
+ if ("value" in descriptor) descriptor.writable = true;
+ Object.defineProperty(target, descriptor.key, descriptor);
+ }
+ }
+
+ return function (Constructor, protoProps, staticProps) {
+ if (protoProps) defineProperties(Constructor.prototype, protoProps);
+ if (staticProps) defineProperties(Constructor, staticProps);
+ return Constructor;
+ };
+}();
+
+
+
+
+
+var defineProperty = function (obj, key, value) {
+ if (key in obj) {
+ Object.defineProperty(obj, key, {
+ value: value,
+ enumerable: true,
+ configurable: true,
+ writable: true
+ });
+ } else {
+ obj[key] = value;
+ }
+
+ return obj;
+};
+
+var _extends = Object.assign || function (target) {
+ for (var i = 1; i < arguments.length; i++) {
+ var source = arguments[i];
+
+ for (var key in source) {
+ if (Object.prototype.hasOwnProperty.call(source, key)) {
+ target[key] = source[key];
+ }
+ }
+ }
+
+ return target;
+};
+
+/**
+ * Given element offsets, generate an output similar to getBoundingClientRect
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Object} offsets
+ * @returns {Object} ClientRect like output
+ */
+function getClientRect(offsets) {
+ return _extends({}, offsets, {
+ right: offsets.left + offsets.width,
+ bottom: offsets.top + offsets.height
+ });
+}
+
+/**
+ * Get bounding client rect of given element
+ * @method
+ * @memberof Popper.Utils
+ * @param {HTMLElement} element
+ * @return {Object} client rect
+ */
+function getBoundingClientRect(element) {
+ var rect = {};
+
+ // IE10 10 FIX: Please, don't ask, the element isn't
+ // considered in DOM in some circumstances...
+ // This isn't reproducible in IE10 compatibility mode of IE11
+ try {
+ if (isIE(10)) {
+ rect = element.getBoundingClientRect();
+ var scrollTop = getScroll(element, 'top');
+ var scrollLeft = getScroll(element, 'left');
+ rect.top += scrollTop;
+ rect.left += scrollLeft;
+ rect.bottom += scrollTop;
+ rect.right += scrollLeft;
+ } else {
+ rect = element.getBoundingClientRect();
+ }
+ } catch (e) {}
+
+ var result = {
+ left: rect.left,
+ top: rect.top,
+ width: rect.right - rect.left,
+ height: rect.bottom - rect.top
+ };
+
+ // subtract scrollbar size from sizes
+ var sizes = element.nodeName === 'HTML' ? getWindowSizes(element.ownerDocument) : {};
+ var width = sizes.width || element.clientWidth || result.right - result.left;
+ var height = sizes.height || element.clientHeight || result.bottom - result.top;
+
+ var horizScrollbar = element.offsetWidth - width;
+ var vertScrollbar = element.offsetHeight - height;
+
+ // if an hypothetical scrollbar is detected, we must be sure it's not a `border`
+ // we make this check conditional for performance reasons
+ if (horizScrollbar || vertScrollbar) {
+ var styles = getStyleComputedProperty(element);
+ horizScrollbar -= getBordersSize(styles, 'x');
+ vertScrollbar -= getBordersSize(styles, 'y');
+
+ result.width -= horizScrollbar;
+ result.height -= vertScrollbar;
+ }
+
+ return getClientRect(result);
+}
+
+function getOffsetRectRelativeToArbitraryNode(children, parent) {
+ var fixedPosition = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
+
+ var isIE10 = isIE(10);
+ var isHTML = parent.nodeName === 'HTML';
+ var childrenRect = getBoundingClientRect(children);
+ var parentRect = getBoundingClientRect(parent);
+ var scrollParent = getScrollParent(children);
+
+ var styles = getStyleComputedProperty(parent);
+ var borderTopWidth = parseFloat(styles.borderTopWidth, 10);
+ var borderLeftWidth = parseFloat(styles.borderLeftWidth, 10);
+
+ // In cases where the parent is fixed, we must ignore negative scroll in offset calc
+ if (fixedPosition && isHTML) {
+ parentRect.top = Math.max(parentRect.top, 0);
+ parentRect.left = Math.max(parentRect.left, 0);
+ }
+ var offsets = getClientRect({
+ top: childrenRect.top - parentRect.top - borderTopWidth,
+ left: childrenRect.left - parentRect.left - borderLeftWidth,
+ width: childrenRect.width,
+ height: childrenRect.height
+ });
+ offsets.marginTop = 0;
+ offsets.marginLeft = 0;
+
+ // Subtract margins of documentElement in case it's being used as parent
+ // we do this only on HTML because it's the only element that behaves
+ // differently when margins are applied to it. The margins are included in
+ // the box of the documentElement, in the other cases not.
+ if (!isIE10 && isHTML) {
+ var marginTop = parseFloat(styles.marginTop, 10);
+ var marginLeft = parseFloat(styles.marginLeft, 10);
+
+ offsets.top -= borderTopWidth - marginTop;
+ offsets.bottom -= borderTopWidth - marginTop;
+ offsets.left -= borderLeftWidth - marginLeft;
+ offsets.right -= borderLeftWidth - marginLeft;
+
+ // Attach marginTop and marginLeft because in some circumstances we may need them
+ offsets.marginTop = marginTop;
+ offsets.marginLeft = marginLeft;
+ }
+
+ if (isIE10 && !fixedPosition ? parent.contains(scrollParent) : parent === scrollParent && scrollParent.nodeName !== 'BODY') {
+ offsets = includeScroll(offsets, parent);
+ }
+
+ return offsets;
+}
+
+function getViewportOffsetRectRelativeToArtbitraryNode(element) {
+ var excludeScroll = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
+
+ var html = element.ownerDocument.documentElement;
+ var relativeOffset = getOffsetRectRelativeToArbitraryNode(element, html);
+ var width = Math.max(html.clientWidth, window.innerWidth || 0);
+ var height = Math.max(html.clientHeight, window.innerHeight || 0);
+
+ var scrollTop = !excludeScroll ? getScroll(html) : 0;
+ var scrollLeft = !excludeScroll ? getScroll(html, 'left') : 0;
+
+ var offset = {
+ top: scrollTop - relativeOffset.top + relativeOffset.marginTop,
+ left: scrollLeft - relativeOffset.left + relativeOffset.marginLeft,
+ width: width,
+ height: height
+ };
+
+ return getClientRect(offset);
+}
+
+/**
+ * Check if the given element is fixed or is inside a fixed parent
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element
+ * @argument {Element} customContainer
+ * @returns {Boolean} answer to "isFixed?"
+ */
+function isFixed(element) {
+ var nodeName = element.nodeName;
+ if (nodeName === 'BODY' || nodeName === 'HTML') {
+ return false;
+ }
+ if (getStyleComputedProperty(element, 'position') === 'fixed') {
+ return true;
+ }
+ var parentNode = getParentNode(element);
+ if (!parentNode) {
+ return false;
+ }
+ return isFixed(parentNode);
+}
+
+/**
+ * Finds the first parent of an element that has a transformed property defined
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element
+ * @returns {Element} first transformed parent or documentElement
+ */
+
+function getFixedPositionOffsetParent(element) {
+ // This check is needed to avoid errors in case one of the elements isn't defined for any reason
+ if (!element || !element.parentElement || isIE()) {
+ return document.documentElement;
+ }
+ var el = element.parentElement;
+ while (el && getStyleComputedProperty(el, 'transform') === 'none') {
+ el = el.parentElement;
+ }
+ return el || document.documentElement;
+}
+
+/**
+ * Computed the boundaries limits and return them
+ * @method
+ * @memberof Popper.Utils
+ * @param {HTMLElement} popper
+ * @param {HTMLElement} reference
+ * @param {number} padding
+ * @param {HTMLElement} boundariesElement - Element used to define the boundaries
+ * @param {Boolean} fixedPosition - Is in fixed position mode
+ * @returns {Object} Coordinates of the boundaries
+ */
+function getBoundaries(popper, reference, padding, boundariesElement) {
+ var fixedPosition = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : false;
+
+ // NOTE: 1 DOM access here
+
+ var boundaries = { top: 0, left: 0 };
+ var offsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference);
+
+ // Handle viewport case
+ if (boundariesElement === 'viewport') {
+ boundaries = getViewportOffsetRectRelativeToArtbitraryNode(offsetParent, fixedPosition);
+ } else {
+ // Handle other cases based on DOM element used as boundaries
+ var boundariesNode = void 0;
+ if (boundariesElement === 'scrollParent') {
+ boundariesNode = getScrollParent(getParentNode(reference));
+ if (boundariesNode.nodeName === 'BODY') {
+ boundariesNode = popper.ownerDocument.documentElement;
+ }
+ } else if (boundariesElement === 'window') {
+ boundariesNode = popper.ownerDocument.documentElement;
+ } else {
+ boundariesNode = boundariesElement;
+ }
+
+ var offsets = getOffsetRectRelativeToArbitraryNode(boundariesNode, offsetParent, fixedPosition);
+
+ // In case of HTML, we need a different computation
+ if (boundariesNode.nodeName === 'HTML' && !isFixed(offsetParent)) {
+ var _getWindowSizes = getWindowSizes(popper.ownerDocument),
+ height = _getWindowSizes.height,
+ width = _getWindowSizes.width;
+
+ boundaries.top += offsets.top - offsets.marginTop;
+ boundaries.bottom = height + offsets.top;
+ boundaries.left += offsets.left - offsets.marginLeft;
+ boundaries.right = width + offsets.left;
+ } else {
+ // for all the other DOM elements, this one is good
+ boundaries = offsets;
+ }
+ }
+
+ // Add paddings
+ padding = padding || 0;
+ var isPaddingNumber = typeof padding === 'number';
+ boundaries.left += isPaddingNumber ? padding : padding.left || 0;
+ boundaries.top += isPaddingNumber ? padding : padding.top || 0;
+ boundaries.right -= isPaddingNumber ? padding : padding.right || 0;
+ boundaries.bottom -= isPaddingNumber ? padding : padding.bottom || 0;
+
+ return boundaries;
+}
+
+function getArea(_ref) {
+ var width = _ref.width,
+ height = _ref.height;
+
+ return width * height;
+}
+
+/**
+ * Utility used to transform the `auto` placement to the placement with more
+ * available space.
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Object} data - The data object generated by update method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function computeAutoPlacement(placement, refRect, popper, reference, boundariesElement) {
+ var padding = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : 0;
+
+ if (placement.indexOf('auto') === -1) {
+ return placement;
+ }
+
+ var boundaries = getBoundaries(popper, reference, padding, boundariesElement);
+
+ var rects = {
+ top: {
+ width: boundaries.width,
+ height: refRect.top - boundaries.top
+ },
+ right: {
+ width: boundaries.right - refRect.right,
+ height: boundaries.height
+ },
+ bottom: {
+ width: boundaries.width,
+ height: boundaries.bottom - refRect.bottom
+ },
+ left: {
+ width: refRect.left - boundaries.left,
+ height: boundaries.height
+ }
+ };
+
+ var sortedAreas = Object.keys(rects).map(function (key) {
+ return _extends({
+ key: key
+ }, rects[key], {
+ area: getArea(rects[key])
+ });
+ }).sort(function (a, b) {
+ return b.area - a.area;
+ });
+
+ var filteredAreas = sortedAreas.filter(function (_ref2) {
+ var width = _ref2.width,
+ height = _ref2.height;
+ return width >= popper.clientWidth && height >= popper.clientHeight;
+ });
+
+ var computedPlacement = filteredAreas.length > 0 ? filteredAreas[0].key : sortedAreas[0].key;
+
+ var variation = placement.split('-')[1];
+
+ return computedPlacement + (variation ? '-' + variation : '');
+}
+
+/**
+ * Get offsets to the reference element
+ * @method
+ * @memberof Popper.Utils
+ * @param {Object} state
+ * @param {Element} popper - the popper element
+ * @param {Element} reference - the reference element (the popper will be relative to this)
+ * @param {Element} fixedPosition - is in fixed position mode
+ * @returns {Object} An object containing the offsets which will be applied to the popper
+ */
+function getReferenceOffsets(state, popper, reference) {
+ var fixedPosition = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : null;
+
+ var commonOffsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference);
+ return getOffsetRectRelativeToArbitraryNode(reference, commonOffsetParent, fixedPosition);
+}
+
+/**
+ * Get the outer sizes of the given element (offset size + margins)
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element
+ * @returns {Object} object containing width and height properties
+ */
+function getOuterSizes(element) {
+ var window = element.ownerDocument.defaultView;
+ var styles = window.getComputedStyle(element);
+ var x = parseFloat(styles.marginTop || 0) + parseFloat(styles.marginBottom || 0);
+ var y = parseFloat(styles.marginLeft || 0) + parseFloat(styles.marginRight || 0);
+ var result = {
+ width: element.offsetWidth + y,
+ height: element.offsetHeight + x
+ };
+ return result;
+}
+
+/**
+ * Get the opposite placement of the given one
+ * @method
+ * @memberof Popper.Utils
+ * @argument {String} placement
+ * @returns {String} flipped placement
+ */
+function getOppositePlacement(placement) {
+ var hash = { left: 'right', right: 'left', bottom: 'top', top: 'bottom' };
+ return placement.replace(/left|right|bottom|top/g, function (matched) {
+ return hash[matched];
+ });
+}
+
+/**
+ * Get offsets to the popper
+ * @method
+ * @memberof Popper.Utils
+ * @param {Object} position - CSS position the Popper will get applied
+ * @param {HTMLElement} popper - the popper element
+ * @param {Object} referenceOffsets - the reference offsets (the popper will be relative to this)
+ * @param {String} placement - one of the valid placement options
+ * @returns {Object} popperOffsets - An object containing the offsets which will be applied to the popper
+ */
+function getPopperOffsets(popper, referenceOffsets, placement) {
+ placement = placement.split('-')[0];
+
+ // Get popper node sizes
+ var popperRect = getOuterSizes(popper);
+
+ // Add position, width and height to our offsets object
+ var popperOffsets = {
+ width: popperRect.width,
+ height: popperRect.height
+ };
+
+ // depending by the popper placement we have to compute its offsets slightly differently
+ var isHoriz = ['right', 'left'].indexOf(placement) !== -1;
+ var mainSide = isHoriz ? 'top' : 'left';
+ var secondarySide = isHoriz ? 'left' : 'top';
+ var measurement = isHoriz ? 'height' : 'width';
+ var secondaryMeasurement = !isHoriz ? 'height' : 'width';
+
+ popperOffsets[mainSide] = referenceOffsets[mainSide] + referenceOffsets[measurement] / 2 - popperRect[measurement] / 2;
+ if (placement === secondarySide) {
+ popperOffsets[secondarySide] = referenceOffsets[secondarySide] - popperRect[secondaryMeasurement];
+ } else {
+ popperOffsets[secondarySide] = referenceOffsets[getOppositePlacement(secondarySide)];
+ }
+
+ return popperOffsets;
+}
+
+/**
+ * Mimics the `find` method of Array
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Array} arr
+ * @argument prop
+ * @argument value
+ * @returns index or -1
+ */
+function find(arr, check) {
+ // use native find if supported
+ if (Array.prototype.find) {
+ return arr.find(check);
+ }
+
+ // use `filter` to obtain the same behavior of `find`
+ return arr.filter(check)[0];
+}
+
+/**
+ * Return the index of the matching object
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Array} arr
+ * @argument prop
+ * @argument value
+ * @returns index or -1
+ */
+function findIndex(arr, prop, value) {
+ // use native findIndex if supported
+ if (Array.prototype.findIndex) {
+ return arr.findIndex(function (cur) {
+ return cur[prop] === value;
+ });
+ }
+
+ // use `find` + `indexOf` if `findIndex` isn't supported
+ var match = find(arr, function (obj) {
+ return obj[prop] === value;
+ });
+ return arr.indexOf(match);
+}
+
+/**
+ * Loop trough the list of modifiers and run them in order,
+ * each of them will then edit the data object.
+ * @method
+ * @memberof Popper.Utils
+ * @param {dataObject} data
+ * @param {Array} modifiers
+ * @param {String} ends - Optional modifier name used as stopper
+ * @returns {dataObject}
+ */
+function runModifiers(modifiers, data, ends) {
+ var modifiersToRun = ends === undefined ? modifiers : modifiers.slice(0, findIndex(modifiers, 'name', ends));
+
+ modifiersToRun.forEach(function (modifier) {
+ if (modifier['function']) {
+ // eslint-disable-line dot-notation
+ console.warn('`modifier.function` is deprecated, use `modifier.fn`!');
+ }
+ var fn = modifier['function'] || modifier.fn; // eslint-disable-line dot-notation
+ if (modifier.enabled && isFunction(fn)) {
+ // Add properties to offsets to make them a complete clientRect object
+ // we do this before each modifier to make sure the previous one doesn't
+ // mess with these values
+ data.offsets.popper = getClientRect(data.offsets.popper);
+ data.offsets.reference = getClientRect(data.offsets.reference);
+
+ data = fn(data, modifier);
+ }
+ });
+
+ return data;
+}
+
+/**
+ * Updates the position of the popper, computing the new offsets and applying
+ * the new style.<br />
+ * Prefer `scheduleUpdate` over `update` because of performance reasons.
+ * @method
+ * @memberof Popper
+ */
+function update() {
+ // if popper is destroyed, don't perform any further update
+ if (this.state.isDestroyed) {
+ return;
+ }
+
+ var data = {
+ instance: this,
+ styles: {},
+ arrowStyles: {},
+ attributes: {},
+ flipped: false,
+ offsets: {}
+ };
+
+ // compute reference element offsets
+ data.offsets.reference = getReferenceOffsets(this.state, this.popper, this.reference, this.options.positionFixed);
+
+ // compute auto placement, store placement inside the data object,
+ // modifiers will be able to edit `placement` if needed
+ // and refer to originalPlacement to know the original value
+ data.placement = computeAutoPlacement(this.options.placement, data.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding);
+
+ // store the computed placement inside `originalPlacement`
+ data.originalPlacement = data.placement;
+
+ data.positionFixed = this.options.positionFixed;
+
+ // compute the popper offsets
+ data.offsets.popper = getPopperOffsets(this.popper, data.offsets.reference, data.placement);
+
+ data.offsets.popper.position = this.options.positionFixed ? 'fixed' : 'absolute';
+
+ // run the modifiers
+ data = runModifiers(this.modifiers, data);
+
+ // the first `update` will call `onCreate` callback
+ // the other ones will call `onUpdate` callback
+ if (!this.state.isCreated) {
+ this.state.isCreated = true;
+ this.options.onCreate(data);
+ } else {
+ this.options.onUpdate(data);
+ }
+}
+
+/**
+ * Helper used to know if the given modifier is enabled.
+ * @method
+ * @memberof Popper.Utils
+ * @returns {Boolean}
+ */
+function isModifierEnabled(modifiers, modifierName) {
+ return modifiers.some(function (_ref) {
+ var name = _ref.name,
+ enabled = _ref.enabled;
+ return enabled && name === modifierName;
+ });
+}
+
+/**
+ * Get the prefixed supported property name
+ * @method
+ * @memberof Popper.Utils
+ * @argument {String} property (camelCase)
+ * @returns {String} prefixed property (camelCase or PascalCase, depending on the vendor prefix)
+ */
+function getSupportedPropertyName(property) {
+ var prefixes = [false, 'ms', 'Webkit', 'Moz', 'O'];
+ var upperProp = property.charAt(0).toUpperCase() + property.slice(1);
+
+ for (var i = 0; i < prefixes.length; i++) {
+ var prefix = prefixes[i];
+ var toCheck = prefix ? '' + prefix + upperProp : property;
+ if (typeof document.body.style[toCheck] !== 'undefined') {
+ return toCheck;
+ }
+ }
+ return null;
+}
+
+/**
+ * Destroys the popper.
+ * @method
+ * @memberof Popper
+ */
+function destroy() {
+ this.state.isDestroyed = true;
+
+ // touch DOM only if `applyStyle` modifier is enabled
+ if (isModifierEnabled(this.modifiers, 'applyStyle')) {
+ this.popper.removeAttribute('x-placement');
+ this.popper.style.position = '';
+ this.popper.style.top = '';
+ this.popper.style.left = '';
+ this.popper.style.right = '';
+ this.popper.style.bottom = '';
+ this.popper.style.willChange = '';
+ this.popper.style[getSupportedPropertyName('transform')] = '';
+ }
+
+ this.disableEventListeners();
+
+ // remove the popper if user explicity asked for the deletion on destroy
+ // do not use `remove` because IE11 doesn't support it
+ if (this.options.removeOnDestroy) {
+ this.popper.parentNode.removeChild(this.popper);
+ }
+ return this;
+}
+
+/**
+ * Get the window associated with the element
+ * @argument {Element} element
+ * @returns {Window}
+ */
+function getWindow(element) {
+ var ownerDocument = element.ownerDocument;
+ return ownerDocument ? ownerDocument.defaultView : window;
+}
+
+function attachToScrollParents(scrollParent, event, callback, scrollParents) {
+ var isBody = scrollParent.nodeName === 'BODY';
+ var target = isBody ? scrollParent.ownerDocument.defaultView : scrollParent;
+ target.addEventListener(event, callback, { passive: true });
+
+ if (!isBody) {
+ attachToScrollParents(getScrollParent(target.parentNode), event, callback, scrollParents);
+ }
+ scrollParents.push(target);
+}
+
+/**
+ * Setup needed event listeners used to update the popper position
+ * @method
+ * @memberof Popper.Utils
+ * @private
+ */
+function setupEventListeners(reference, options, state, updateBound) {
+ // Resize event listener on window
+ state.updateBound = updateBound;
+ getWindow(reference).addEventListener('resize', state.updateBound, { passive: true });
+
+ // Scroll event listener on scroll parents
+ var scrollElement = getScrollParent(reference);
+ attachToScrollParents(scrollElement, 'scroll', state.updateBound, state.scrollParents);
+ state.scrollElement = scrollElement;
+ state.eventsEnabled = true;
+
+ return state;
+}
+
+/**
+ * It will add resize/scroll events and start recalculating
+ * position of the popper element when they are triggered.
+ * @method
+ * @memberof Popper
+ */
+function enableEventListeners() {
+ if (!this.state.eventsEnabled) {
+ this.state = setupEventListeners(this.reference, this.options, this.state, this.scheduleUpdate);
+ }
+}
+
+/**
+ * Remove event listeners used to update the popper position
+ * @method
+ * @memberof Popper.Utils
+ * @private
+ */
+function removeEventListeners(reference, state) {
+ // Remove resize event listener on window
+ getWindow(reference).removeEventListener('resize', state.updateBound);
+
+ // Remove scroll event listener on scroll parents
+ state.scrollParents.forEach(function (target) {
+ target.removeEventListener('scroll', state.updateBound);
+ });
+
+ // Reset state
+ state.updateBound = null;
+ state.scrollParents = [];
+ state.scrollElement = null;
+ state.eventsEnabled = false;
+ return state;
+}
+
+/**
+ * It will remove resize/scroll events and won't recalculate popper position
+ * when they are triggered. It also won't trigger `onUpdate` callback anymore,
+ * unless you call `update` method manually.
+ * @method
+ * @memberof Popper
+ */
+function disableEventListeners() {
+ if (this.state.eventsEnabled) {
+ cancelAnimationFrame(this.scheduleUpdate);
+ this.state = removeEventListeners(this.reference, this.state);
+ }
+}
+
+/**
+ * Tells if a given input is a number
+ * @method
+ * @memberof Popper.Utils
+ * @param {*} input to check
+ * @return {Boolean}
+ */
+function isNumeric(n) {
+ return n !== '' && !isNaN(parseFloat(n)) && isFinite(n);
+}
+
+/**
+ * Set the style to the given popper
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element - Element to apply the style to
+ * @argument {Object} styles
+ * Object with a list of properties and values which will be applied to the element
+ */
+function setStyles(element, styles) {
+ Object.keys(styles).forEach(function (prop) {
+ var unit = '';
+ // add unit if the value is numeric and is one of the following
+ if (['width', 'height', 'top', 'right', 'bottom', 'left'].indexOf(prop) !== -1 && isNumeric(styles[prop])) {
+ unit = 'px';
+ }
+ element.style[prop] = styles[prop] + unit;
+ });
+}
+
+/**
+ * Set the attributes to the given popper
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element - Element to apply the attributes to
+ * @argument {Object} styles
+ * Object with a list of properties and values which will be applied to the element
+ */
+function setAttributes(element, attributes) {
+ Object.keys(attributes).forEach(function (prop) {
+ var value = attributes[prop];
+ if (value !== false) {
+ element.setAttribute(prop, attributes[prop]);
+ } else {
+ element.removeAttribute(prop);
+ }
+ });
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by `update` method
+ * @argument {Object} data.styles - List of style properties - values to apply to popper element
+ * @argument {Object} data.attributes - List of attribute properties - values to apply to popper element
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The same data object
+ */
+function applyStyle(data) {
+ // any property present in `data.styles` will be applied to the popper,
+ // in this way we can make the 3rd party modifiers add custom styles to it
+ // Be aware, modifiers could override the properties defined in the previous
+ // lines of this modifier!
+ setStyles(data.instance.popper, data.styles);
+
+ // any property present in `data.attributes` will be applied to the popper,
+ // they will be set as HTML attributes of the element
+ setAttributes(data.instance.popper, data.attributes);
+
+ // if arrowElement is defined and arrowStyles has some properties
+ if (data.arrowElement && Object.keys(data.arrowStyles).length) {
+ setStyles(data.arrowElement, data.arrowStyles);
+ }
+
+ return data;
+}
+
+/**
+ * Set the x-placement attribute before everything else because it could be used
+ * to add margins to the popper margins needs to be calculated to get the
+ * correct popper offsets.
+ * @method
+ * @memberof Popper.modifiers
+ * @param {HTMLElement} reference - The reference element used to position the popper
+ * @param {HTMLElement} popper - The HTML element used as popper
+ * @param {Object} options - Popper.js options
+ */
+function applyStyleOnLoad(reference, popper, options, modifierOptions, state) {
+ // compute reference element offsets
+ var referenceOffsets = getReferenceOffsets(state, popper, reference, options.positionFixed);
+
+ // compute auto placement, store placement inside the data object,
+ // modifiers will be able to edit `placement` if needed
+ // and refer to originalPlacement to know the original value
+ var placement = computeAutoPlacement(options.placement, referenceOffsets, popper, reference, options.modifiers.flip.boundariesElement, options.modifiers.flip.padding);
+
+ popper.setAttribute('x-placement', placement);
+
+ // Apply `position` to popper before anything else because
+ // without the position applied we can't guarantee correct computations
+ setStyles(popper, { position: options.positionFixed ? 'fixed' : 'absolute' });
+
+ return options;
+}
+
+/**
+ * @function
+ * @memberof Popper.Utils
+ * @argument {Object} data - The data object generated by `update` method
+ * @argument {Boolean} shouldRound - If the offsets should be rounded at all
+ * @returns {Object} The popper's position offsets rounded
+ *
+ * The tale of pixel-perfect positioning. It's still not 100% perfect, but as
+ * good as it can be within reason.
+ * Discussion here: https://github.com/FezVrasta/popper.js/pull/715
+ *
+ * Low DPI screens cause a popper to be blurry if not using full pixels (Safari
+ * as well on High DPI screens).
+ *
+ * Firefox prefers no rounding for positioning and does not have blurriness on
+ * high DPI screens.
+ *
+ * Only horizontal placement and left/right values need to be considered.
+ */
+function getRoundedOffsets(data, shouldRound) {
+ var _data$offsets = data.offsets,
+ popper = _data$offsets.popper,
+ reference = _data$offsets.reference;
+ var round = Math.round,
+ floor = Math.floor;
+
+ var noRound = function noRound(v) {
+ return v;
+ };
+
+ var referenceWidth = round(reference.width);
+ var popperWidth = round(popper.width);
+
+ var isVertical = ['left', 'right'].indexOf(data.placement) !== -1;
+ var isVariation = data.placement.indexOf('-') !== -1;
+ var sameWidthParity = referenceWidth % 2 === popperWidth % 2;
+ var bothOddWidth = referenceWidth % 2 === 1 && popperWidth % 2 === 1;
+
+ var horizontalToInteger = !shouldRound ? noRound : isVertical || isVariation || sameWidthParity ? round : floor;
+ var verticalToInteger = !shouldRound ? noRound : round;
+
+ return {
+ left: horizontalToInteger(bothOddWidth && !isVariation && shouldRound ? popper.left - 1 : popper.left),
+ top: verticalToInteger(popper.top),
+ bottom: verticalToInteger(popper.bottom),
+ right: horizontalToInteger(popper.right)
+ };
+}
+
+var isFirefox = isBrowser && /Firefox/i.test(navigator.userAgent);
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by `update` method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function computeStyle(data, options) {
+ var x = options.x,
+ y = options.y;
+ var popper = data.offsets.popper;
+
+ // Remove this legacy support in Popper.js v2
+
+ var legacyGpuAccelerationOption = find(data.instance.modifiers, function (modifier) {
+ return modifier.name === 'applyStyle';
+ }).gpuAcceleration;
+ if (legacyGpuAccelerationOption !== undefined) {
+ console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!');
+ }
+ var gpuAcceleration = legacyGpuAccelerationOption !== undefined ? legacyGpuAccelerationOption : options.gpuAcceleration;
+
+ var offsetParent = getOffsetParent(data.instance.popper);
+ var offsetParentRect = getBoundingClientRect(offsetParent);
+
+ // Styles
+ var styles = {
+ position: popper.position
+ };
+
+ var offsets = getRoundedOffsets(data, window.devicePixelRatio < 2 || !isFirefox);
+
+ var sideA = x === 'bottom' ? 'top' : 'bottom';
+ var sideB = y === 'right' ? 'left' : 'right';
+
+ // if gpuAcceleration is set to `true` and transform is supported,
+ // we use `translate3d` to apply the position to the popper we
+ // automatically use the supported prefixed version if needed
+ var prefixedProperty = getSupportedPropertyName('transform');
+
+ // now, let's make a step back and look at this code closely (wtf?)
+ // If the content of the popper grows once it's been positioned, it
+ // may happen that the popper gets misplaced because of the new content
+ // overflowing its reference element
+ // To avoid this problem, we provide two options (x and y), which allow
+ // the consumer to define the offset origin.
+ // If we position a popper on top of a reference element, we can set
+ // `x` to `top` to make the popper grow towards its top instead of
+ // its bottom.
+ var left = void 0,
+ top = void 0;
+ if (sideA === 'bottom') {
+ // when offsetParent is <html> the positioning is relative to the bottom of the screen (excluding the scrollbar)
+ // and not the bottom of the html element
+ if (offsetParent.nodeName === 'HTML') {
+ top = -offsetParent.clientHeight + offsets.bottom;
+ } else {
+ top = -offsetParentRect.height + offsets.bottom;
+ }
+ } else {
+ top = offsets.top;
+ }
+ if (sideB === 'right') {
+ if (offsetParent.nodeName === 'HTML') {
+ left = -offsetParent.clientWidth + offsets.right;
+ } else {
+ left = -offsetParentRect.width + offsets.right;
+ }
+ } else {
+ left = offsets.left;
+ }
+ if (gpuAcceleration && prefixedProperty) {
+ styles[prefixedProperty] = 'translate3d(' + left + 'px, ' + top + 'px, 0)';
+ styles[sideA] = 0;
+ styles[sideB] = 0;
+ styles.willChange = 'transform';
+ } else {
+ // othwerise, we use the standard `top`, `left`, `bottom` and `right` properties
+ var invertTop = sideA === 'bottom' ? -1 : 1;
+ var invertLeft = sideB === 'right' ? -1 : 1;
+ styles[sideA] = top * invertTop;
+ styles[sideB] = left * invertLeft;
+ styles.willChange = sideA + ', ' + sideB;
+ }
+
+ // Attributes
+ var attributes = {
+ 'x-placement': data.placement
+ };
+
+ // Update `data` attributes, styles and arrowStyles
+ data.attributes = _extends({}, attributes, data.attributes);
+ data.styles = _extends({}, styles, data.styles);
+ data.arrowStyles = _extends({}, data.offsets.arrow, data.arrowStyles);
+
+ return data;
+}
+
+/**
+ * Helper used to know if the given modifier depends from another one.<br />
+ * It checks if the needed modifier is listed and enabled.
+ * @method
+ * @memberof Popper.Utils
+ * @param {Array} modifiers - list of modifiers
+ * @param {String} requestingName - name of requesting modifier
+ * @param {String} requestedName - name of requested modifier
+ * @returns {Boolean}
+ */
+function isModifierRequired(modifiers, requestingName, requestedName) {
+ var requesting = find(modifiers, function (_ref) {
+ var name = _ref.name;
+ return name === requestingName;
+ });
+
+ var isRequired = !!requesting && modifiers.some(function (modifier) {
+ return modifier.name === requestedName && modifier.enabled && modifier.order < requesting.order;
+ });
+
+ if (!isRequired) {
+ var _requesting = '`' + requestingName + '`';
+ var requested = '`' + requestedName + '`';
+ console.warn(requested + ' modifier is required by ' + _requesting + ' modifier in order to work, be sure to include it before ' + _requesting + '!');
+ }
+ return isRequired;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by update method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function arrow(data, options) {
+ var _data$offsets$arrow;
+
+ // arrow depends on keepTogether in order to work
+ if (!isModifierRequired(data.instance.modifiers, 'arrow', 'keepTogether')) {
+ return data;
+ }
+
+ var arrowElement = options.element;
+
+ // if arrowElement is a string, suppose it's a CSS selector
+ if (typeof arrowElement === 'string') {
+ arrowElement = data.instance.popper.querySelector(arrowElement);
+
+ // if arrowElement is not found, don't run the modifier
+ if (!arrowElement) {
+ return data;
+ }
+ } else {
+ // if the arrowElement isn't a query selector we must check that the
+ // provided DOM node is child of its popper node
+ if (!data.instance.popper.contains(arrowElement)) {
+ console.warn('WARNING: `arrow.element` must be child of its popper element!');
+ return data;
+ }
+ }
+
+ var placement = data.placement.split('-')[0];
+ var _data$offsets = data.offsets,
+ popper = _data$offsets.popper,
+ reference = _data$offsets.reference;
+
+ var isVertical = ['left', 'right'].indexOf(placement) !== -1;
+
+ var len = isVertical ? 'height' : 'width';
+ var sideCapitalized = isVertical ? 'Top' : 'Left';
+ var side = sideCapitalized.toLowerCase();
+ var altSide = isVertical ? 'left' : 'top';
+ var opSide = isVertical ? 'bottom' : 'right';
+ var arrowElementSize = getOuterSizes(arrowElement)[len];
+
+ //
+ // extends keepTogether behavior making sure the popper and its
+ // reference have enough pixels in conjunction
+ //
+
+ // top/left side
+ if (reference[opSide] - arrowElementSize < popper[side]) {
+ data.offsets.popper[side] -= popper[side] - (reference[opSide] - arrowElementSize);
+ }
+ // bottom/right side
+ if (reference[side] + arrowElementSize > popper[opSide]) {
+ data.offsets.popper[side] += reference[side] + arrowElementSize - popper[opSide];
+ }
+ data.offsets.popper = getClientRect(data.offsets.popper);
+
+ // compute center of the popper
+ var center = reference[side] + reference[len] / 2 - arrowElementSize / 2;
+
+ // Compute the sideValue using the updated popper offsets
+ // take popper margin in account because we don't have this info available
+ var css = getStyleComputedProperty(data.instance.popper);
+ var popperMarginSide = parseFloat(css['margin' + sideCapitalized], 10);
+ var popperBorderSide = parseFloat(css['border' + sideCapitalized + 'Width'], 10);
+ var sideValue = center - data.offsets.popper[side] - popperMarginSide - popperBorderSide;
+
+ // prevent arrowElement from being placed not contiguously to its popper
+ sideValue = Math.max(Math.min(popper[len] - arrowElementSize, sideValue), 0);
+
+ data.arrowElement = arrowElement;
+ data.offsets.arrow = (_data$offsets$arrow = {}, defineProperty(_data$offsets$arrow, side, Math.round(sideValue)), defineProperty(_data$offsets$arrow, altSide, ''), _data$offsets$arrow);
+
+ return data;
+}
+
+/**
+ * Get the opposite placement variation of the given one
+ * @method
+ * @memberof Popper.Utils
+ * @argument {String} placement variation
+ * @returns {String} flipped placement variation
+ */
+function getOppositeVariation(variation) {
+ if (variation === 'end') {
+ return 'start';
+ } else if (variation === 'start') {
+ return 'end';
+ }
+ return variation;
+}
+
+/**
+ * List of accepted placements to use as values of the `placement` option.<br />
+ * Valid placements are:
+ * - `auto`
+ * - `top`
+ * - `right`
+ * - `bottom`
+ * - `left`
+ *
+ * Each placement can have a variation from this list:
+ * - `-start`
+ * - `-end`
+ *
+ * Variations are interpreted easily if you think of them as the left to right
+ * written languages. Horizontally (`top` and `bottom`), `start` is left and `end`
+ * is right.<br />
+ * Vertically (`left` and `right`), `start` is top and `end` is bottom.
+ *
+ * Some valid examples are:
+ * - `top-end` (on top of reference, right aligned)
+ * - `right-start` (on right of reference, top aligned)
+ * - `bottom` (on bottom, centered)
+ * - `auto-end` (on the side with more space available, alignment depends by placement)
+ *
+ * @static
+ * @type {Array}
+ * @enum {String}
+ * @readonly
+ * @method placements
+ * @memberof Popper
+ */
+var placements = ['auto-start', 'auto', 'auto-end', 'top-start', 'top', 'top-end', 'right-start', 'right', 'right-end', 'bottom-end', 'bottom', 'bottom-start', 'left-end', 'left', 'left-start'];
+
+// Get rid of `auto` `auto-start` and `auto-end`
+var validPlacements = placements.slice(3);
+
+/**
+ * Given an initial placement, returns all the subsequent placements
+ * clockwise (or counter-clockwise).
+ *
+ * @method
+ * @memberof Popper.Utils
+ * @argument {String} placement - A valid placement (it accepts variations)
+ * @argument {Boolean} counter - Set to true to walk the placements counterclockwise
+ * @returns {Array} placements including their variations
+ */
+function clockwise(placement) {
+ var counter = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
+
+ var index = validPlacements.indexOf(placement);
+ var arr = validPlacements.slice(index + 1).concat(validPlacements.slice(0, index));
+ return counter ? arr.reverse() : arr;
+}
+
+var BEHAVIORS = {
+ FLIP: 'flip',
+ CLOCKWISE: 'clockwise',
+ COUNTERCLOCKWISE: 'counterclockwise'
+};
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by update method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function flip(data, options) {
+ // if `inner` modifier is enabled, we can't use the `flip` modifier
+ if (isModifierEnabled(data.instance.modifiers, 'inner')) {
+ return data;
+ }
+
+ if (data.flipped && data.placement === data.originalPlacement) {
+ // seems like flip is trying to loop, probably there's not enough space on any of the flippable sides
+ return data;
+ }
+
+ var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, options.boundariesElement, data.positionFixed);
+
+ var placement = data.placement.split('-')[0];
+ var placementOpposite = getOppositePlacement(placement);
+ var variation = data.placement.split('-')[1] || '';
+
+ var flipOrder = [];
+
+ switch (options.behavior) {
+ case BEHAVIORS.FLIP:
+ flipOrder = [placement, placementOpposite];
+ break;
+ case BEHAVIORS.CLOCKWISE:
+ flipOrder = clockwise(placement);
+ break;
+ case BEHAVIORS.COUNTERCLOCKWISE:
+ flipOrder = clockwise(placement, true);
+ break;
+ default:
+ flipOrder = options.behavior;
+ }
+
+ flipOrder.forEach(function (step, index) {
+ if (placement !== step || flipOrder.length === index + 1) {
+ return data;
+ }
+
+ placement = data.placement.split('-')[0];
+ placementOpposite = getOppositePlacement(placement);
+
+ var popperOffsets = data.offsets.popper;
+ var refOffsets = data.offsets.reference;
+
+ // using floor because the reference offsets may contain decimals we are not going to consider here
+ var floor = Math.floor;
+ var overlapsRef = placement === 'left' && floor(popperOffsets.right) > floor(refOffsets.left) || placement === 'right' && floor(popperOffsets.left) < floor(refOffsets.right) || placement === 'top' && floor(popperOffsets.bottom) > floor(refOffsets.top) || placement === 'bottom' && floor(popperOffsets.top) < floor(refOffsets.bottom);
+
+ var overflowsLeft = floor(popperOffsets.left) < floor(boundaries.left);
+ var overflowsRight = floor(popperOffsets.right) > floor(boundaries.right);
+ var overflowsTop = floor(popperOffsets.top) < floor(boundaries.top);
+ var overflowsBottom = floor(popperOffsets.bottom) > floor(boundaries.bottom);
+
+ var overflowsBoundaries = placement === 'left' && overflowsLeft || placement === 'right' && overflowsRight || placement === 'top' && overflowsTop || placement === 'bottom' && overflowsBottom;
+
+ // flip the variation if required
+ var isVertical = ['top', 'bottom'].indexOf(placement) !== -1;
+ var flippedVariation = !!options.flipVariations && (isVertical && variation === 'start' && overflowsLeft || isVertical && variation === 'end' && overflowsRight || !isVertical && variation === 'start' && overflowsTop || !isVertical && variation === 'end' && overflowsBottom);
+
+ if (overlapsRef || overflowsBoundaries || flippedVariation) {
+ // this boolean to detect any flip loop
+ data.flipped = true;
+
+ if (overlapsRef || overflowsBoundaries) {
+ placement = flipOrder[index + 1];
+ }
+
+ if (flippedVariation) {
+ variation = getOppositeVariation(variation);
+ }
+
+ data.placement = placement + (variation ? '-' + variation : '');
+
+ // this object contains `position`, we want to preserve it along with
+ // any additional property we may add in the future
+ data.offsets.popper = _extends({}, data.offsets.popper, getPopperOffsets(data.instance.popper, data.offsets.reference, data.placement));
+
+ data = runModifiers(data.instance.modifiers, data, 'flip');
+ }
+ });
+ return data;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by update method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function keepTogether(data) {
+ var _data$offsets = data.offsets,
+ popper = _data$offsets.popper,
+ reference = _data$offsets.reference;
+
+ var placement = data.placement.split('-')[0];
+ var floor = Math.floor;
+ var isVertical = ['top', 'bottom'].indexOf(placement) !== -1;
+ var side = isVertical ? 'right' : 'bottom';
+ var opSide = isVertical ? 'left' : 'top';
+ var measurement = isVertical ? 'width' : 'height';
+
+ if (popper[side] < floor(reference[opSide])) {
+ data.offsets.popper[opSide] = floor(reference[opSide]) - popper[measurement];
+ }
+ if (popper[opSide] > floor(reference[side])) {
+ data.offsets.popper[opSide] = floor(reference[side]);
+ }
+
+ return data;
+}
+
+/**
+ * Converts a string containing value + unit into a px value number
+ * @function
+ * @memberof {modifiers~offset}
+ * @private
+ * @argument {String} str - Value + unit string
+ * @argument {String} measurement - `height` or `width`
+ * @argument {Object} popperOffsets
+ * @argument {Object} referenceOffsets
+ * @returns {Number|String}
+ * Value in pixels, or original string if no values were extracted
+ */
+function toValue(str, measurement, popperOffsets, referenceOffsets) {
+ // separate value from unit
+ var split = str.match(/((?:\-|\+)?\d*\.?\d*)(.*)/);
+ var value = +split[1];
+ var unit = split[2];
+
+ // If it's not a number it's an operator, I guess
+ if (!value) {
+ return str;
+ }
+
+ if (unit.indexOf('%') === 0) {
+ var element = void 0;
+ switch (unit) {
+ case '%p':
+ element = popperOffsets;
+ break;
+ case '%':
+ case '%r':
+ default:
+ element = referenceOffsets;
+ }
+
+ var rect = getClientRect(element);
+ return rect[measurement] / 100 * value;
+ } else if (unit === 'vh' || unit === 'vw') {
+ // if is a vh or vw, we calculate the size based on the viewport
+ var size = void 0;
+ if (unit === 'vh') {
+ size = Math.max(document.documentElement.clientHeight, window.innerHeight || 0);
+ } else {
+ size = Math.max(document.documentElement.clientWidth, window.innerWidth || 0);
+ }
+ return size / 100 * value;
+ } else {
+ // if is an explicit pixel unit, we get rid of the unit and keep the value
+ // if is an implicit unit, it's px, and we return just the value
+ return value;
+ }
+}
+
+/**
+ * Parse an `offset` string to extrapolate `x` and `y` numeric offsets.
+ * @function
+ * @memberof {modifiers~offset}
+ * @private
+ * @argument {String} offset
+ * @argument {Object} popperOffsets
+ * @argument {Object} referenceOffsets
+ * @argument {String} basePlacement
+ * @returns {Array} a two cells array with x and y offsets in numbers
+ */
+function parseOffset(offset, popperOffsets, referenceOffsets, basePlacement) {
+ var offsets = [0, 0];
+
+ // Use height if placement is left or right and index is 0 otherwise use width
+ // in this way the first offset will use an axis and the second one
+ // will use the other one
+ var useHeight = ['right', 'left'].indexOf(basePlacement) !== -1;
+
+ // Split the offset string to obtain a list of values and operands
+ // The regex addresses values with the plus or minus sign in front (+10, -20, etc)
+ var fragments = offset.split(/(\+|\-)/).map(function (frag) {
+ return frag.trim();
+ });
+
+ // Detect if the offset string contains a pair of values or a single one
+ // they could be separated by comma or space
+ var divider = fragments.indexOf(find(fragments, function (frag) {
+ return frag.search(/,|\s/) !== -1;
+ }));
+
+ if (fragments[divider] && fragments[divider].indexOf(',') === -1) {
+ console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.');
+ }
+
+ // If divider is found, we divide the list of values and operands to divide
+ // them by ofset X and Y.
+ var splitRegex = /\s*,\s*|\s+/;
+ var ops = divider !== -1 ? [fragments.slice(0, divider).concat([fragments[divider].split(splitRegex)[0]]), [fragments[divider].split(splitRegex)[1]].concat(fragments.slice(divider + 1))] : [fragments];
+
+ // Convert the values with units to absolute pixels to allow our computations
+ ops = ops.map(function (op, index) {
+ // Most of the units rely on the orientation of the popper
+ var measurement = (index === 1 ? !useHeight : useHeight) ? 'height' : 'width';
+ var mergeWithPrevious = false;
+ return op
+ // This aggregates any `+` or `-` sign that aren't considered operators
+ // e.g.: 10 + +5 => [10, +, +5]
+ .reduce(function (a, b) {
+ if (a[a.length - 1] === '' && ['+', '-'].indexOf(b) !== -1) {
+ a[a.length - 1] = b;
+ mergeWithPrevious = true;
+ return a;
+ } else if (mergeWithPrevious) {
+ a[a.length - 1] += b;
+ mergeWithPrevious = false;
+ return a;
+ } else {
+ return a.concat(b);
+ }
+ }, [])
+ // Here we convert the string values into number values (in px)
+ .map(function (str) {
+ return toValue(str, measurement, popperOffsets, referenceOffsets);
+ });
+ });
+
+ // Loop trough the offsets arrays and execute the operations
+ ops.forEach(function (op, index) {
+ op.forEach(function (frag, index2) {
+ if (isNumeric(frag)) {
+ offsets[index] += frag * (op[index2 - 1] === '-' ? -1 : 1);
+ }
+ });
+ });
+ return offsets;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by update method
+ * @argument {Object} options - Modifiers configuration and options
+ * @argument {Number|String} options.offset=0
+ * The offset value as described in the modifier description
+ * @returns {Object} The data object, properly modified
+ */
+function offset(data, _ref) {
+ var offset = _ref.offset;
+ var placement = data.placement,
+ _data$offsets = data.offsets,
+ popper = _data$offsets.popper,
+ reference = _data$offsets.reference;
+
+ var basePlacement = placement.split('-')[0];
+
+ var offsets = void 0;
+ if (isNumeric(+offset)) {
+ offsets = [+offset, 0];
+ } else {
+ offsets = parseOffset(offset, popper, reference, basePlacement);
+ }
+
+ if (basePlacement === 'left') {
+ popper.top += offsets[0];
+ popper.left -= offsets[1];
+ } else if (basePlacement === 'right') {
+ popper.top += offsets[0];
+ popper.left += offsets[1];
+ } else if (basePlacement === 'top') {
+ popper.left += offsets[0];
+ popper.top -= offsets[1];
+ } else if (basePlacement === 'bottom') {
+ popper.left += offsets[0];
+ popper.top += offsets[1];
+ }
+
+ data.popper = popper;
+ return data;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by `update` method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function preventOverflow(data, options) {
+ var boundariesElement = options.boundariesElement || getOffsetParent(data.instance.popper);
+
+ // If offsetParent is the reference element, we really want to
+ // go one step up and use the next offsetParent as reference to
+ // avoid to make this modifier completely useless and look like broken
+ if (data.instance.reference === boundariesElement) {
+ boundariesElement = getOffsetParent(boundariesElement);
+ }
+
+ // NOTE: DOM access here
+ // resets the popper's position so that the document size can be calculated excluding
+ // the size of the popper element itself
+ var transformProp = getSupportedPropertyName('transform');
+ var popperStyles = data.instance.popper.style; // assignment to help minification
+ var top = popperStyles.top,
+ left = popperStyles.left,
+ transform = popperStyles[transformProp];
+
+ popperStyles.top = '';
+ popperStyles.left = '';
+ popperStyles[transformProp] = '';
+
+ var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, boundariesElement, data.positionFixed);
+
+ // NOTE: DOM access here
+ // restores the original style properties after the offsets have been computed
+ popperStyles.top = top;
+ popperStyles.left = left;
+ popperStyles[transformProp] = transform;
+
+ options.boundaries = boundaries;
+
+ var order = options.priority;
+ var popper = data.offsets.popper;
+
+ var check = {
+ primary: function primary(placement) {
+ var value = popper[placement];
+ if (popper[placement] < boundaries[placement] && !options.escapeWithReference) {
+ value = Math.max(popper[placement], boundaries[placement]);
+ }
+ return defineProperty({}, placement, value);
+ },
+ secondary: function secondary(placement) {
+ var mainSide = placement === 'right' ? 'left' : 'top';
+ var value = popper[mainSide];
+ if (popper[placement] > boundaries[placement] && !options.escapeWithReference) {
+ value = Math.min(popper[mainSide], boundaries[placement] - (placement === 'right' ? popper.width : popper.height));
+ }
+ return defineProperty({}, mainSide, value);
+ }
+ };
+
+ order.forEach(function (placement) {
+ var side = ['left', 'top'].indexOf(placement) !== -1 ? 'primary' : 'secondary';
+ popper = _extends({}, popper, check[side](placement));
+ });
+
+ data.offsets.popper = popper;
+
+ return data;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by `update` method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function shift(data) {
+ var placement = data.placement;
+ var basePlacement = placement.split('-')[0];
+ var shiftvariation = placement.split('-')[1];
+
+ // if shift shiftvariation is specified, run the modifier
+ if (shiftvariation) {
+ var _data$offsets = data.offsets,
+ reference = _data$offsets.reference,
+ popper = _data$offsets.popper;
+
+ var isVertical = ['bottom', 'top'].indexOf(basePlacement) !== -1;
+ var side = isVertical ? 'left' : 'top';
+ var measurement = isVertical ? 'width' : 'height';
+
+ var shiftOffsets = {
+ start: defineProperty({}, side, reference[side]),
+ end: defineProperty({}, side, reference[side] + reference[measurement] - popper[measurement])
+ };
+
+ data.offsets.popper = _extends({}, popper, shiftOffsets[shiftvariation]);
+ }
+
+ return data;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by update method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function hide(data) {
+ if (!isModifierRequired(data.instance.modifiers, 'hide', 'preventOverflow')) {
+ return data;
+ }
+
+ var refRect = data.offsets.reference;
+ var bound = find(data.instance.modifiers, function (modifier) {
+ return modifier.name === 'preventOverflow';
+ }).boundaries;
+
+ if (refRect.bottom < bound.top || refRect.left > bound.right || refRect.top > bound.bottom || refRect.right < bound.left) {
+ // Avoid unnecessary DOM access if visibility hasn't changed
+ if (data.hide === true) {
+ return data;
+ }
+
+ data.hide = true;
+ data.attributes['x-out-of-boundaries'] = '';
+ } else {
+ // Avoid unnecessary DOM access if visibility hasn't changed
+ if (data.hide === false) {
+ return data;
+ }
+
+ data.hide = false;
+ data.attributes['x-out-of-boundaries'] = false;
+ }
+
+ return data;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by `update` method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function inner(data) {
+ var placement = data.placement;
+ var basePlacement = placement.split('-')[0];
+ var _data$offsets = data.offsets,
+ popper = _data$offsets.popper,
+ reference = _data$offsets.reference;
+
+ var isHoriz = ['left', 'right'].indexOf(basePlacement) !== -1;
+
+ var subtractLength = ['top', 'left'].indexOf(basePlacement) === -1;
+
+ popper[isHoriz ? 'left' : 'top'] = reference[basePlacement] - (subtractLength ? popper[isHoriz ? 'width' : 'height'] : 0);
+
+ data.placement = getOppositePlacement(placement);
+ data.offsets.popper = getClientRect(popper);
+
+ return data;
+}
+
+/**
+ * Modifier function, each modifier can have a function of this type assigned
+ * to its `fn` property.<br />
+ * These functions will be called on each update, this means that you must
+ * make sure they are performant enough to avoid performance bottlenecks.
+ *
+ * @function ModifierFn
+ * @argument {dataObject} data - The data object generated by `update` method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {dataObject} The data object, properly modified
+ */
+
+/**
+ * Modifiers are plugins used to alter the behavior of your poppers.<br />
+ * Popper.js uses a set of 9 modifiers to provide all the basic functionalities
+ * needed by the library.
+ *
+ * Usually you don't want to override the `order`, `fn` and `onLoad` props.
+ * All the other properties are configurations that could be tweaked.
+ * @namespace modifiers
+ */
+var modifiers = {
+ /**
+ * Modifier used to shift the popper on the start or end of its reference
+ * element.<br />
+ * It will read the variation of the `placement` property.<br />
+ * It can be one either `-end` or `-start`.
+ * @memberof modifiers
+ * @inner
+ */
+ shift: {
+ /** @prop {number} order=100 - Index used to define the order of execution */
+ order: 100,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: shift
+ },
+
+ /**
+ * The `offset` modifier can shift your popper on both its axis.
+ *
+ * It accepts the following units:
+ * - `px` or unit-less, interpreted as pixels
+ * - `%` or `%r`, percentage relative to the length of the reference element
+ * - `%p`, percentage relative to the length of the popper element
+ * - `vw`, CSS viewport width unit
+ * - `vh`, CSS viewport height unit
+ *
+ * For length is intended the main axis relative to the placement of the popper.<br />
+ * This means that if the placement is `top` or `bottom`, the length will be the
+ * `width`. In case of `left` or `right`, it will be the `height`.
+ *
+ * You can provide a single value (as `Number` or `String`), or a pair of values
+ * as `String` divided by a comma or one (or more) white spaces.<br />
+ * The latter is a deprecated method because it leads to confusion and will be
+ * removed in v2.<br />
+ * Additionally, it accepts additions and subtractions between different units.
+ * Note that multiplications and divisions aren't supported.
+ *
+ * Valid examples are:
+ * ```
+ * 10
+ * '10%'
+ * '10, 10'
+ * '10%, 10'
+ * '10 + 10%'
+ * '10 - 5vh + 3%'
+ * '-10px + 5vh, 5px - 6%'
+ * ```
+ * > **NB**: If you desire to apply offsets to your poppers in a way that may make them overlap
+ * > with their reference element, unfortunately, you will have to disable the `flip` modifier.
+ * > You can read more on this at this [issue](https://github.com/FezVrasta/popper.js/issues/373).
+ *
+ * @memberof modifiers
+ * @inner
+ */
+ offset: {
+ /** @prop {number} order=200 - Index used to define the order of execution */
+ order: 200,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: offset,
+ /** @prop {Number|String} offset=0
+ * The offset value as described in the modifier description
+ */
+ offset: 0
+ },
+
+ /**
+ * Modifier used to prevent the popper from being positioned outside the boundary.
+ *
+ * A scenario exists where the reference itself is not within the boundaries.<br />
+ * We can say it has "escaped the boundaries" — or just "escaped".<br />
+ * In this case we need to decide whether the popper should either:
+ *
+ * - detach from the reference and remain "trapped" in the boundaries, or
+ * - if it should ignore the boundary and "escape with its reference"
+ *
+ * When `escapeWithReference` is set to`true` and reference is completely
+ * outside its boundaries, the popper will overflow (or completely leave)
+ * the boundaries in order to remain attached to the edge of the reference.
+ *
+ * @memberof modifiers
+ * @inner
+ */
+ preventOverflow: {
+ /** @prop {number} order=300 - Index used to define the order of execution */
+ order: 300,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: preventOverflow,
+ /**
+ * @prop {Array} [priority=['left','right','top','bottom']]
+ * Popper will try to prevent overflow following these priorities by default,
+ * then, it could overflow on the left and on top of the `boundariesElement`
+ */
+ priority: ['left', 'right', 'top', 'bottom'],
+ /**
+ * @prop {number} padding=5
+ * Amount of pixel used to define a minimum distance between the boundaries
+ * and the popper. This makes sure the popper always has a little padding
+ * between the edges of its container
+ */
+ padding: 5,
+ /**
+ * @prop {String|HTMLElement} boundariesElement='scrollParent'
+ * Boundaries used by the modifier. Can be `scrollParent`, `window`,
+ * `viewport` or any DOM element.
+ */
+ boundariesElement: 'scrollParent'
+ },
+
+ /**
+ * Modifier used to make sure the reference and its popper stay near each other
+ * without leaving any gap between the two. Especially useful when the arrow is
+ * enabled and you want to ensure that it points to its reference element.
+ * It cares only about the first axis. You can still have poppers with margin
+ * between the popper and its reference element.
+ * @memberof modifiers
+ * @inner
+ */
+ keepTogether: {
+ /** @prop {number} order=400 - Index used to define the order of execution */
+ order: 400,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: keepTogether
+ },
+
+ /**
+ * This modifier is used to move the `arrowElement` of the popper to make
+ * sure it is positioned between the reference element and its popper element.
+ * It will read the outer size of the `arrowElement` node to detect how many
+ * pixels of conjunction are needed.
+ *
+ * It has no effect if no `arrowElement` is provided.
+ * @memberof modifiers
+ * @inner
+ */
+ arrow: {
+ /** @prop {number} order=500 - Index used to define the order of execution */
+ order: 500,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: arrow,
+ /** @prop {String|HTMLElement} element='[x-arrow]' - Selector or node used as arrow */
+ element: '[x-arrow]'
+ },
+
+ /**
+ * Modifier used to flip the popper's placement when it starts to overlap its
+ * reference element.
+ *
+ * Requires the `preventOverflow` modifier before it in order to work.
+ *
+ * **NOTE:** this modifier will interrupt the current update cycle and will
+ * restart it if it detects the need to flip the placement.
+ * @memberof modifiers
+ * @inner
+ */
+ flip: {
+ /** @prop {number} order=600 - Index used to define the order of execution */
+ order: 600,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: flip,
+ /**
+ * @prop {String|Array} behavior='flip'
+ * The behavior used to change the popper's placement. It can be one of
+ * `flip`, `clockwise`, `counterclockwise` or an array with a list of valid
+ * placements (with optional variations)
+ */
+ behavior: 'flip',
+ /**
+ * @prop {number} padding=5
+ * The popper will flip if it hits the edges of the `boundariesElement`
+ */
+ padding: 5,
+ /**
+ * @prop {String|HTMLElement} boundariesElement='viewport'
+ * The element which will define the boundaries of the popper position.
+ * The popper will never be placed outside of the defined boundaries
+ * (except if `keepTogether` is enabled)
+ */
+ boundariesElement: 'viewport'
+ },
+
+ /**
+ * Modifier used to make the popper flow toward the inner of the reference element.
+ * By default, when this modifier is disabled, the popper will be placed outside
+ * the reference element.
+ * @memberof modifiers
+ * @inner
+ */
+ inner: {
+ /** @prop {number} order=700 - Index used to define the order of execution */
+ order: 700,
+ /** @prop {Boolean} enabled=false - Whether the modifier is enabled or not */
+ enabled: false,
+ /** @prop {ModifierFn} */
+ fn: inner
+ },
+
+ /**
+ * Modifier used to hide the popper when its reference element is outside of the
+ * popper boundaries. It will set a `x-out-of-boundaries` attribute which can
+ * be used to hide with a CSS selector the popper when its reference is
+ * out of boundaries.
+ *
+ * Requires the `preventOverflow` modifier before it in order to work.
+ * @memberof modifiers
+ * @inner
+ */
+ hide: {
+ /** @prop {number} order=800 - Index used to define the order of execution */
+ order: 800,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: hide
+ },
+
+ /**
+ * Computes the style that will be applied to the popper element to gets
+ * properly positioned.
+ *
+ * Note that this modifier will not touch the DOM, it just prepares the styles
+ * so that `applyStyle` modifier can apply it. This separation is useful
+ * in case you need to replace `applyStyle` with a custom implementation.
+ *
+ * This modifier has `850` as `order` value to maintain backward compatibility
+ * with previous versions of Popper.js. Expect the modifiers ordering method
+ * to change in future major versions of the library.
+ *
+ * @memberof modifiers
+ * @inner
+ */
+ computeStyle: {
+ /** @prop {number} order=850 - Index used to define the order of execution */
+ order: 850,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: computeStyle,
+ /**
+ * @prop {Boolean} gpuAcceleration=true
+ * If true, it uses the CSS 3D transformation to position the popper.
+ * Otherwise, it will use the `top` and `left` properties
+ */
+ gpuAcceleration: true,
+ /**
+ * @prop {string} [x='bottom']
+ * Where to anchor the X axis (`bottom` or `top`). AKA X offset origin.
+ * Change this if your popper should grow in a direction different from `bottom`
+ */
+ x: 'bottom',
+ /**
+ * @prop {string} [x='left']
+ * Where to anchor the Y axis (`left` or `right`). AKA Y offset origin.
+ * Change this if your popper should grow in a direction different from `right`
+ */
+ y: 'right'
+ },
+
+ /**
+ * Applies the computed styles to the popper element.
+ *
+ * All the DOM manipulations are limited to this modifier. This is useful in case
+ * you want to integrate Popper.js inside a framework or view library and you
+ * want to delegate all the DOM manipulations to it.
+ *
+ * Note that if you disable this modifier, you must make sure the popper element
+ * has its position set to `absolute` before Popper.js can do its work!
+ *
+ * Just disable this modifier and define your own to achieve the desired effect.
+ *
+ * @memberof modifiers
+ * @inner
+ */
+ applyStyle: {
+ /** @prop {number} order=900 - Index used to define the order of execution */
+ order: 900,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: applyStyle,
+ /** @prop {Function} */
+ onLoad: applyStyleOnLoad,
+ /**
+ * @deprecated since version 1.10.0, the property moved to `computeStyle` modifier
+ * @prop {Boolean} gpuAcceleration=true
+ * If true, it uses the CSS 3D transformation to position the popper.
+ * Otherwise, it will use the `top` and `left` properties
+ */
+ gpuAcceleration: undefined
+ }
+};
+
+/**
+ * The `dataObject` is an object containing all the information used by Popper.js.
+ * This object is passed to modifiers and to the `onCreate` and `onUpdate` callbacks.
+ * @name dataObject
+ * @property {Object} data.instance The Popper.js instance
+ * @property {String} data.placement Placement applied to popper
+ * @property {String} data.originalPlacement Placement originally defined on init
+ * @property {Boolean} data.flipped True if popper has been flipped by flip modifier
+ * @property {Boolean} data.hide True if the reference element is out of boundaries, useful to know when to hide the popper
+ * @property {HTMLElement} data.arrowElement Node used as arrow by arrow modifier
+ * @property {Object} data.styles Any CSS property defined here will be applied to the popper. It expects the JavaScript nomenclature (eg. `marginBottom`)
+ * @property {Object} data.arrowStyles Any CSS property defined here will be applied to the popper arrow. It expects the JavaScript nomenclature (eg. `marginBottom`)
+ * @property {Object} data.boundaries Offsets of the popper boundaries
+ * @property {Object} data.offsets The measurements of popper, reference and arrow elements
+ * @property {Object} data.offsets.popper `top`, `left`, `width`, `height` values
+ * @property {Object} data.offsets.reference `top`, `left`, `width`, `height` values
+ * @property {Object} data.offsets.arrow] `top` and `left` offsets, only one of them will be different from 0
+ */
+
+/**
+ * Default options provided to Popper.js constructor.<br />
+ * These can be overridden using the `options` argument of Popper.js.<br />
+ * To override an option, simply pass an object with the same
+ * structure of the `options` object, as the 3rd argument. For example:
+ * ```
+ * new Popper(ref, pop, {
+ * modifiers: {
+ * preventOverflow: { enabled: false }
+ * }
+ * })
+ * ```
+ * @type {Object}
+ * @static
+ * @memberof Popper
+ */
+var Defaults = {
+ /**
+ * Popper's placement.
+ * @prop {Popper.placements} placement='bottom'
+ */
+ placement: 'bottom',
+
+ /**
+ * Set this to true if you want popper to position it self in 'fixed' mode
+ * @prop {Boolean} positionFixed=false
+ */
+ positionFixed: false,
+
+ /**
+ * Whether events (resize, scroll) are initially enabled.
+ * @prop {Boolean} eventsEnabled=true
+ */
+ eventsEnabled: true,
+
+ /**
+ * Set to true if you want to automatically remove the popper when
+ * you call the `destroy` method.
+ * @prop {Boolean} removeOnDestroy=false
+ */
+ removeOnDestroy: false,
+
+ /**
+ * Callback called when the popper is created.<br />
+ * By default, it is set to no-op.<br />
+ * Access Popper.js instance with `data.instance`.
+ * @prop {onCreate}
+ */
+ onCreate: function onCreate() {},
+
+ /**
+ * Callback called when the popper is updated. This callback is not called
+ * on the initialization/creation of the popper, but only on subsequent
+ * updates.<br />
+ * By default, it is set to no-op.<br />
+ * Access Popper.js instance with `data.instance`.
+ * @prop {onUpdate}
+ */
+ onUpdate: function onUpdate() {},
+
+ /**
+ * List of modifiers used to modify the offsets before they are applied to the popper.
+ * They provide most of the functionalities of Popper.js.
+ * @prop {modifiers}
+ */
+ modifiers: modifiers
+};
+
+/**
+ * @callback onCreate
+ * @param {dataObject} data
+ */
+
+/**
+ * @callback onUpdate
+ * @param {dataObject} data
+ */
+
+// Utils
+// Methods
+var Popper = function () {
+ /**
+ * Creates a new Popper.js instance.
+ * @class Popper
+ * @param {HTMLElement|referenceObject} reference - The reference element used to position the popper
+ * @param {HTMLElement} popper - The HTML element used as the popper
+ * @param {Object} options - Your custom options to override the ones defined in [Defaults](#defaults)
+ * @return {Object} instance - The generated Popper.js instance
+ */
+ function Popper(reference, popper) {
+ var _this = this;
+
+ var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
+ classCallCheck(this, Popper);
+
+ this.scheduleUpdate = function () {
+ return requestAnimationFrame(_this.update);
+ };
+
+ // make update() debounced, so that it only runs at most once-per-tick
+ this.update = debounce(this.update.bind(this));
+
+ // with {} we create a new object with the options inside it
+ this.options = _extends({}, Popper.Defaults, options);
+
+ // init state
+ this.state = {
+ isDestroyed: false,
+ isCreated: false,
+ scrollParents: []
+ };
+
+ // get reference and popper elements (allow jQuery wrappers)
+ this.reference = reference && reference.jquery ? reference[0] : reference;
+ this.popper = popper && popper.jquery ? popper[0] : popper;
+
+ // Deep merge modifiers options
+ this.options.modifiers = {};
+ Object.keys(_extends({}, Popper.Defaults.modifiers, options.modifiers)).forEach(function (name) {
+ _this.options.modifiers[name] = _extends({}, Popper.Defaults.modifiers[name] || {}, options.modifiers ? options.modifiers[name] : {});
+ });
+
+ // Refactoring modifiers' list (Object => Array)
+ this.modifiers = Object.keys(this.options.modifiers).map(function (name) {
+ return _extends({
+ name: name
+ }, _this.options.modifiers[name]);
+ })
+ // sort the modifiers by order
+ .sort(function (a, b) {
+ return a.order - b.order;
+ });
+
+ // modifiers have the ability to execute arbitrary code when Popper.js get inited
+ // such code is executed in the same order of its modifier
+ // they could add new properties to their options configuration
+ // BE AWARE: don't add options to `options.modifiers.name` but to `modifierOptions`!
+ this.modifiers.forEach(function (modifierOptions) {
+ if (modifierOptions.enabled && isFunction(modifierOptions.onLoad)) {
+ modifierOptions.onLoad(_this.reference, _this.popper, _this.options, modifierOptions, _this.state);
+ }
+ });
+
+ // fire the first update to position the popper in the right place
+ this.update();
+
+ var eventsEnabled = this.options.eventsEnabled;
+ if (eventsEnabled) {
+ // setup event listeners, they will take care of update the position in specific situations
+ this.enableEventListeners();
+ }
+
+ this.state.eventsEnabled = eventsEnabled;
+ }
+
+ // We can't use class properties because they don't get listed in the
+ // class prototype and break stuff like Sinon stubs
+
+
+ createClass(Popper, [{
+ key: 'update',
+ value: function update$$1() {
+ return update.call(this);
+ }
+ }, {
+ key: 'destroy',
+ value: function destroy$$1() {
+ return destroy.call(this);
+ }
+ }, {
+ key: 'enableEventListeners',
+ value: function enableEventListeners$$1() {
+ return enableEventListeners.call(this);
+ }
+ }, {
+ key: 'disableEventListeners',
+ value: function disableEventListeners$$1() {
+ return disableEventListeners.call(this);
+ }
+
+ /**
+ * Schedules an update. It will run on the next UI update available.
+ * @method scheduleUpdate
+ * @memberof Popper
+ */
+
+
+ /**
+ * Collection of utilities useful when writing custom modifiers.
+ * Starting from version 1.7, this method is available only if you
+ * include `popper-utils.js` before `popper.js`.
+ *
+ * **DEPRECATION**: This way to access PopperUtils is deprecated
+ * and will be removed in v2! Use the PopperUtils module directly instead.
+ * Due to the high instability of the methods contained in Utils, we can't
+ * guarantee them to follow semver. Use them at your own risk!
+ * @static
+ * @private
+ * @type {Object}
+ * @deprecated since version 1.8
+ * @member Utils
+ * @memberof Popper
+ */
+
+ }]);
+ return Popper;
+}();
+
+/**
+ * The `referenceObject` is an object that provides an interface compatible with Popper.js
+ * and lets you use it as replacement of a real DOM node.<br />
+ * You can use this method to position a popper relatively to a set of coordinates
+ * in case you don't have a DOM node to use as reference.
+ *
+ * ```
+ * new Popper(referenceObject, popperNode);
+ * ```
+ *
+ * NB: This feature isn't supported in Internet Explorer 10.
+ * @name referenceObject
+ * @property {Function} data.getBoundingClientRect
+ * A function that returns a set of coordinates compatible with the native `getBoundingClientRect` method.
+ * @property {number} data.clientWidth
+ * An ES6 getter that will return the width of the virtual reference element.
+ * @property {number} data.clientHeight
+ * An ES6 getter that will return the height of the virtual reference element.
+ */
+
+
+Popper.Utils = (typeof window !== 'undefined' ? window : global).PopperUtils;
+Popper.placements = placements;
+Popper.Defaults = Defaults;
+
+/* harmony default export */ __webpack_exports__["default"] = (Popper);
+//# sourceMappingURL=popper.js.map
+
+/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(/*! ./../../../webpack/buildin/global.js */ "./node_modules/webpack/buildin/global.js")))
+
+/***/ }),
+
+/***/ "./node_modules/process/browser.js":
+/*!*****************************************!*\
+ !*** ./node_modules/process/browser.js ***!
+ \*****************************************/
+/*! no static exports found */
+/***/ (function(module, exports) {
+
+// shim for using process in browser
+var process = module.exports = {};
+
+// cached from whatever global is present so that test runners that stub it
+// don't break things. But we need to wrap it in a try catch in case it is
+// wrapped in strict mode code which doesn't define any globals. It's inside a
+// function because try/catches deoptimize in certain engines.
+
+var cachedSetTimeout;
+var cachedClearTimeout;
+
+function defaultSetTimout() {
+ throw new Error('setTimeout has not been defined');
+}
+function defaultClearTimeout () {
+ throw new Error('clearTimeout has not been defined');
+}
+(function () {
+ try {
+ if (typeof setTimeout === 'function') {
+ cachedSetTimeout = setTimeout;
+ } else {
+ cachedSetTimeout = defaultSetTimout;
+ }
+ } catch (e) {
+ cachedSetTimeout = defaultSetTimout;
+ }
+ try {
+ if (typeof clearTimeout === 'function') {
+ cachedClearTimeout = clearTimeout;
+ } else {
+ cachedClearTimeout = defaultClearTimeout;
+ }
+ } catch (e) {
+ cachedClearTimeout = defaultClearTimeout;
+ }
+} ())
+function runTimeout(fun) {
+ if (cachedSetTimeout === setTimeout) {
+ //normal enviroments in sane situations
+ return setTimeout(fun, 0);
+ }
+ // if setTimeout wasn't available but was latter defined
+ if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {
+ cachedSetTimeout = setTimeout;
+ return setTimeout(fun, 0);
+ }
+ try {
+ // when when somebody has screwed with setTimeout but no I.E. maddness
+ return cachedSetTimeout(fun, 0);
+ } catch(e){
+ try {
+ // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
+ return cachedSetTimeout.call(null, fun, 0);
+ } catch(e){
+ // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error
+ return cachedSetTimeout.call(this, fun, 0);
+ }
+ }
+
+
+}
+function runClearTimeout(marker) {
+ if (cachedClearTimeout === clearTimeout) {
+ //normal enviroments in sane situations
+ return clearTimeout(marker);
+ }
+ // if clearTimeout wasn't available but was latter defined
+ if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {
+ cachedClearTimeout = clearTimeout;
+ return clearTimeout(marker);
+ }
+ try {
+ // when when somebody has screwed with setTimeout but no I.E. maddness
+ return cachedClearTimeout(marker);
+ } catch (e){
+ try {
+ // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
+ return cachedClearTimeout.call(null, marker);
+ } catch (e){
+ // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.
+ // Some versions of I.E. have different rules for clearTimeout vs setTimeout
+ return cachedClearTimeout.call(this, marker);
+ }
+ }
+
+
+
+}
+var queue = [];
+var draining = false;
+var currentQueue;
+var queueIndex = -1;
+
+function cleanUpNextTick() {
+ if (!draining || !currentQueue) {
+ return;
+ }
+ draining = false;
+ if (currentQueue.length) {
+ queue = currentQueue.concat(queue);
+ } else {
+ queueIndex = -1;
+ }
+ if (queue.length) {
+ drainQueue();
+ }
+}
+
+function drainQueue() {
+ if (draining) {
+ return;
+ }
+ var timeout = runTimeout(cleanUpNextTick);
+ draining = true;
+
+ var len = queue.length;
+ while(len) {
+ currentQueue = queue;
+ queue = [];
+ while (++queueIndex < len) {
+ if (currentQueue) {
+ currentQueue[queueIndex].run();
+ }
+ }
+ queueIndex = -1;
+ len = queue.length;
+ }
+ currentQueue = null;
+ draining = false;
+ runClearTimeout(timeout);
+}
+
+process.nextTick = function (fun) {
+ var args = new Array(arguments.length - 1);
+ if (arguments.length > 1) {
+ for (var i = 1; i < arguments.length; i++) {
+ args[i - 1] = arguments[i];
+ }
+ }
+ queue.push(new Item(fun, args));
+ if (queue.length === 1 && !draining) {
+ runTimeout(drainQueue);
+ }
+};
+
+// v8 likes predictible objects
+function Item(fun, array) {
+ this.fun = fun;
+ this.array = array;
+}
+Item.prototype.run = function () {
+ this.fun.apply(null, this.array);
+};
+process.title = 'browser';
+process.browser = true;
+process.env = {};
+process.argv = [];
+process.version = ''; // empty string to avoid regexp issues
+process.versions = {};
+
+function noop() {}
+
+process.on = noop;
+process.addListener = noop;
+process.once = noop;
+process.off = noop;
+process.removeListener = noop;
+process.removeAllListeners = noop;
+process.emit = noop;
+process.prependListener = noop;
+process.prependOnceListener = noop;
+
+process.listeners = function (name) { return [] }
+
+process.binding = function (name) {
+ throw new Error('process.binding is not supported');
+};
+
+process.cwd = function () { return '/' };
+process.chdir = function (dir) {
+ throw new Error('process.chdir is not supported');
+};
+process.umask = function() { return 0; };
+
+
+/***/ }),
+
+/***/ "./node_modules/setimmediate/setImmediate.js":
+/*!***************************************************!*\
+ !*** ./node_modules/setimmediate/setImmediate.js ***!
+ \***************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+/* WEBPACK VAR INJECTION */(function(global, process) {(function (global, undefined) {
+ "use strict";
+
+ if (global.setImmediate) {
+ return;
+ }
+
+ var nextHandle = 1; // Spec says greater than zero
+ var tasksByHandle = {};
+ var currentlyRunningATask = false;
+ var doc = global.document;
+ var registerImmediate;
+
+ function setImmediate(callback) {
+ // Callback can either be a function or a string
+ if (typeof callback !== "function") {
+ callback = new Function("" + callback);
+ }
+ // Copy function arguments
+ var args = new Array(arguments.length - 1);
+ for (var i = 0; i < args.length; i++) {
+ args[i] = arguments[i + 1];
+ }
+ // Store and register the task
+ var task = { callback: callback, args: args };
+ tasksByHandle[nextHandle] = task;
+ registerImmediate(nextHandle);
+ return nextHandle++;
+ }
+
+ function clearImmediate(handle) {
+ delete tasksByHandle[handle];
+ }
+
+ function run(task) {
+ var callback = task.callback;
+ var args = task.args;
+ switch (args.length) {
+ case 0:
+ callback();
+ break;
+ case 1:
+ callback(args[0]);
+ break;
+ case 2:
+ callback(args[0], args[1]);
+ break;
+ case 3:
+ callback(args[0], args[1], args[2]);
+ break;
+ default:
+ callback.apply(undefined, args);
+ break;
+ }
+ }
+
+ function runIfPresent(handle) {
+ // From the spec: "Wait until any invocations of this algorithm started before this one have completed."
+ // So if we're currently running a task, we'll need to delay this invocation.
+ if (currentlyRunningATask) {
+ // Delay by doing a setTimeout. setImmediate was tried instead, but in Firefox 7 it generated a
+ // "too much recursion" error.
+ setTimeout(runIfPresent, 0, handle);
+ } else {
+ var task = tasksByHandle[handle];
+ if (task) {
+ currentlyRunningATask = true;
+ try {
+ run(task);
+ } finally {
+ clearImmediate(handle);
+ currentlyRunningATask = false;
+ }
+ }
+ }
+ }
+
+ function installNextTickImplementation() {
+ registerImmediate = function(handle) {
+ process.nextTick(function () { runIfPresent(handle); });
+ };
+ }
+
+ function canUsePostMessage() {
+ // The test against `importScripts` prevents this implementation from being installed inside a web worker,
+ // where `global.postMessage` means something completely different and can't be used for this purpose.
+ if (global.postMessage && !global.importScripts) {
+ var postMessageIsAsynchronous = true;
+ var oldOnMessage = global.onmessage;
+ global.onmessage = function() {
+ postMessageIsAsynchronous = false;
+ };
+ global.postMessage("", "*");
+ global.onmessage = oldOnMessage;
+ return postMessageIsAsynchronous;
+ }
+ }
+
+ function installPostMessageImplementation() {
+ // Installs an event handler on `global` for the `message` event: see
+ // * https://developer.mozilla.org/en/DOM/window.postMessage
+ // * http://www.whatwg.org/specs/web-apps/current-work/multipage/comms.html#crossDocumentMessages
+
+ var messagePrefix = "setImmediate$" + Math.random() + "$";
+ var onGlobalMessage = function(event) {
+ if (event.source === global &&
+ typeof event.data === "string" &&
+ event.data.indexOf(messagePrefix) === 0) {
+ runIfPresent(+event.data.slice(messagePrefix.length));
+ }
+ };
+
+ if (global.addEventListener) {
+ global.addEventListener("message", onGlobalMessage, false);
+ } else {
+ global.attachEvent("onmessage", onGlobalMessage);
+ }
+
+ registerImmediate = function(handle) {
+ global.postMessage(messagePrefix + handle, "*");
+ };
+ }
+
+ function installMessageChannelImplementation() {
+ var channel = new MessageChannel();
+ channel.port1.onmessage = function(event) {
+ var handle = event.data;
+ runIfPresent(handle);
+ };
+
+ registerImmediate = function(handle) {
+ channel.port2.postMessage(handle);
+ };
+ }
+
+ function installReadyStateChangeImplementation() {
+ var html = doc.documentElement;
+ registerImmediate = function(handle) {
+ // Create a <script> element; its readystatechange event will be fired asynchronously once it is inserted
+ // into the document. Do so, thus queuing up the task. Remember to clean up once it's been called.
+ var script = doc.createElement("script");
+ script.onreadystatechange = function () {
+ runIfPresent(handle);
+ script.onreadystatechange = null;
+ html.removeChild(script);
+ script = null;
+ };
+ html.appendChild(script);
+ };
+ }
+
+ function installSetTimeoutImplementation() {
+ registerImmediate = function(handle) {
+ setTimeout(runIfPresent, 0, handle);
+ };
+ }
+
+ // If supported, we should attach to the prototype of global, since that is where setTimeout et al. live.
+ var attachTo = Object.getPrototypeOf && Object.getPrototypeOf(global);
+ attachTo = attachTo && attachTo.setTimeout ? attachTo : global;
+
+ // Don't get fooled by e.g. browserify environments.
+ if ({}.toString.call(global.process) === "[object process]") {
+ // For Node.js before 0.9
+ installNextTickImplementation();
+
+ } else if (canUsePostMessage()) {
+ // For non-IE10 modern browsers
+ installPostMessageImplementation();
+
+ } else if (global.MessageChannel) {
+ // For web workers, where supported
+ installMessageChannelImplementation();
+
+ } else if (doc && "onreadystatechange" in doc.createElement("script")) {
+ // For IE 6–8
+ installReadyStateChangeImplementation();
+
+ } else {
+ // For older browsers
+ installSetTimeoutImplementation();
+ }
+
+ attachTo.setImmediate = setImmediate;
+ attachTo.clearImmediate = clearImmediate;
+}(typeof self === "undefined" ? typeof global === "undefined" ? this : global : self));
+
+/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(/*! ./../webpack/buildin/global.js */ "./node_modules/webpack/buildin/global.js"), __webpack_require__(/*! ./../process/browser.js */ "./node_modules/process/browser.js")))
+
+/***/ }),
+
+/***/ "./node_modules/timers-browserify/main.js":
+/*!************************************************!*\
+ !*** ./node_modules/timers-browserify/main.js ***!
+ \************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+/* WEBPACK VAR INJECTION */(function(global) {var scope = (typeof global !== "undefined" && global) ||
+ (typeof self !== "undefined" && self) ||
+ window;
+var apply = Function.prototype.apply;
+
+// DOM APIs, for completeness
+
+exports.setTimeout = function() {
+ return new Timeout(apply.call(setTimeout, scope, arguments), clearTimeout);
+};
+exports.setInterval = function() {
+ return new Timeout(apply.call(setInterval, scope, arguments), clearInterval);
+};
+exports.clearTimeout =
+exports.clearInterval = function(timeout) {
+ if (timeout) {
+ timeout.close();
+ }
+};
+
+function Timeout(id, clearFn) {
+ this._id = id;
+ this._clearFn = clearFn;
+}
+Timeout.prototype.unref = Timeout.prototype.ref = function() {};
+Timeout.prototype.close = function() {
+ this._clearFn.call(scope, this._id);
+};
+
+// Does not start the time, just sets up the members needed.
+exports.enroll = function(item, msecs) {
+ clearTimeout(item._idleTimeoutId);
+ item._idleTimeout = msecs;
+};
+
+exports.unenroll = function(item) {
+ clearTimeout(item._idleTimeoutId);
+ item._idleTimeout = -1;
+};
+
+exports._unrefActive = exports.active = function(item) {
+ clearTimeout(item._idleTimeoutId);
+
+ var msecs = item._idleTimeout;
+ if (msecs >= 0) {
+ item._idleTimeoutId = setTimeout(function onTimeout() {
+ if (item._onTimeout)
+ item._onTimeout();
+ }, msecs);
+ }
+};
+
+// setimmediate attaches itself to the global object
+__webpack_require__(/*! setimmediate */ "./node_modules/setimmediate/setImmediate.js");
+// On some exotic environments, it's not clear which object `setimmediate` was
+// able to install onto. Search each possibility in the same order as the
+// `setimmediate` library.
+exports.setImmediate = (typeof self !== "undefined" && self.setImmediate) ||
+ (typeof global !== "undefined" && global.setImmediate) ||
+ (this && this.setImmediate);
+exports.clearImmediate = (typeof self !== "undefined" && self.clearImmediate) ||
+ (typeof global !== "undefined" && global.clearImmediate) ||
+ (this && this.clearImmediate);
+
+/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(/*! ./../webpack/buildin/global.js */ "./node_modules/webpack/buildin/global.js")))
+
+/***/ }),
+
+/***/ "./node_modules/vue-loader/lib/loaders/templateLoader.js?!./node_modules/vue-loader/lib/index.js?!./resources/js/components/ExampleComponent.vue?vue&type=template&id=299e239e&":
+/*!*******************************************************************************************************************************************************************************************************************!*\
+ !*** ./node_modules/vue-loader/lib/loaders/templateLoader.js??vue-loader-options!./node_modules/vue-loader/lib??vue-loader-options!./resources/js/components/ExampleComponent.vue?vue&type=template&id=299e239e& ***!
+ \*******************************************************************************************************************************************************************************************************************/
+/*! exports provided: render, staticRenderFns */
+/***/ (function(module, __webpack_exports__, __webpack_require__) {
+
+"use strict";
+__webpack_require__.r(__webpack_exports__);
+/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "render", function() { return render; });
+/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "staticRenderFns", function() { return staticRenderFns; });
+var render = function() {
+ var _vm = this
+ var _h = _vm.$createElement
+ var _c = _vm._self._c || _h
+ return _vm._m(0)
+}
+var staticRenderFns = [
+ function() {
+ var _vm = this
+ var _h = _vm.$createElement
+ var _c = _vm._self._c || _h
+ return _c("div", { staticClass: "container" }, [
+ _c("div", { staticClass: "row justify-content-center" }, [
+ _c("div", { staticClass: "col-md-8" }, [
+ _c("div", { staticClass: "card" }, [
+ _c("div", { staticClass: "card-header" }, [
+ _vm._v("Example Component")
+ ]),
+ _vm._v(" "),
+ _c("div", { staticClass: "card-body" }, [
+ _vm._v(
+ "\n I'm an example component.\n "
+ )
+ ])
+ ])
+ ])
+ ])
+ ])
+ }
+]
+render._withStripped = true
+
+
+
+/***/ }),
+
+/***/ "./node_modules/vue-loader/lib/runtime/componentNormalizer.js":
+/*!********************************************************************!*\
+ !*** ./node_modules/vue-loader/lib/runtime/componentNormalizer.js ***!
+ \********************************************************************/
+/*! exports provided: default */
+/***/ (function(module, __webpack_exports__, __webpack_require__) {
+
+"use strict";
+__webpack_require__.r(__webpack_exports__);
+/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "default", function() { return normalizeComponent; });
+/* globals __VUE_SSR_CONTEXT__ */
+
+// IMPORTANT: Do NOT use ES2015 features in this file (except for modules).
+// This module is a runtime utility for cleaner component module output and will
+// be included in the final webpack user bundle.
+
+function normalizeComponent (
+ scriptExports,
+ render,
+ staticRenderFns,
+ functionalTemplate,
+ injectStyles,
+ scopeId,
+ moduleIdentifier, /* server only */
+ shadowMode /* vue-cli only */
+) {
+ // Vue.extend constructor export interop
+ var options = typeof scriptExports === 'function'
+ ? scriptExports.options
+ : scriptExports
+
+ // render functions
+ if (render) {
+ options.render = render
+ options.staticRenderFns = staticRenderFns
+ options._compiled = true
+ }
+
+ // functional template
+ if (functionalTemplate) {
+ options.functional = true
+ }
+
+ // scopedId
+ if (scopeId) {
+ options._scopeId = 'data-v-' + scopeId
+ }
+
+ var hook
+ if (moduleIdentifier) { // server build
+ hook = function (context) {
+ // 2.3 injection
+ context =
+ context || // cached call
+ (this.$vnode && this.$vnode.ssrContext) || // stateful
+ (this.parent && this.parent.$vnode && this.parent.$vnode.ssrContext) // functional
+ // 2.2 with runInNewContext: true
+ if (!context && typeof __VUE_SSR_CONTEXT__ !== 'undefined') {
+ context = __VUE_SSR_CONTEXT__
+ }
+ // inject component styles
+ if (injectStyles) {
+ injectStyles.call(this, context)
+ }
+ // register component module identifier for async chunk inferrence
+ if (context && context._registeredComponents) {
+ context._registeredComponents.add(moduleIdentifier)
+ }
+ }
+ // used by ssr in case component is cached and beforeCreate
+ // never gets called
+ options._ssrRegister = hook
+ } else if (injectStyles) {
+ hook = shadowMode
+ ? function () { injectStyles.call(this, this.$root.$options.shadowRoot) }
+ : injectStyles
+ }
+
+ if (hook) {
+ if (options.functional) {
+ // for template-only hot-reload because in that case the render fn doesn't
+ // go through the normalizer
+ options._injectStyles = hook
+ // register for functioal component in vue file
+ var originalRender = options.render
+ options.render = function renderWithStyleInjection (h, context) {
+ hook.call(context)
+ return originalRender(h, context)
+ }
+ } else {
+ // inject component registration as beforeCreate hook
+ var existing = options.beforeCreate
+ options.beforeCreate = existing
+ ? [].concat(existing, hook)
+ : [hook]
+ }
+ }
+
+ return {
+ exports: scriptExports,
+ options: options
+ }
+}
+
+
+/***/ }),
+
+/***/ "./node_modules/vue/dist/vue.common.dev.js":
+/*!*************************************************!*\
+ !*** ./node_modules/vue/dist/vue.common.dev.js ***!
+ \*************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+"use strict";
+/* WEBPACK VAR INJECTION */(function(global, setImmediate) {/*!
+ * Vue.js v2.6.10
+ * (c) 2014-2019 Evan You
+ * Released under the MIT License.
+ */
+
+
+/* */
+
+var emptyObject = Object.freeze({});
+
+// These helpers produce better VM code in JS engines due to their
+// explicitness and function inlining.
+function isUndef (v) {
+ return v === undefined || v === null
+}
+
+function isDef (v) {
+ return v !== undefined && v !== null
+}
+
+function isTrue (v) {
+ return v === true
+}
+
+function isFalse (v) {
+ return v === false
+}
+
+/**
+ * Check if value is primitive.
+ */
+function isPrimitive (value) {
+ return (
+ typeof value === 'string' ||
+ typeof value === 'number' ||
+ // $flow-disable-line
+ typeof value === 'symbol' ||
+ typeof value === 'boolean'
+ )
+}
+
+/**
+ * Quick object check - this is primarily used to tell
+ * Objects from primitive values when we know the value
+ * is a JSON-compliant type.
+ */
+function isObject (obj) {
+ return obj !== null && typeof obj === 'object'
+}
+
+/**
+ * Get the raw type string of a value, e.g., [object Object].
+ */
+var _toString = Object.prototype.toString;
+
+function toRawType (value) {
+ return _toString.call(value).slice(8, -1)
+}
+
+/**
+ * Strict object type check. Only returns true
+ * for plain JavaScript objects.
+ */
+function isPlainObject (obj) {
+ return _toString.call(obj) === '[object Object]'
+}
+
+function isRegExp (v) {
+ return _toString.call(v) === '[object RegExp]'
+}
+
+/**
+ * Check if val is a valid array index.
+ */
+function isValidArrayIndex (val) {
+ var n = parseFloat(String(val));
+ return n >= 0 && Math.floor(n) === n && isFinite(val)
+}
+
+function isPromise (val) {
+ return (
+ isDef(val) &&
+ typeof val.then === 'function' &&
+ typeof val.catch === 'function'
+ )
+}
+
+/**
+ * Convert a value to a string that is actually rendered.
+ */
+function toString (val) {
+ return val == null
+ ? ''
+ : Array.isArray(val) || (isPlainObject(val) && val.toString === _toString)
+ ? JSON.stringify(val, null, 2)
+ : String(val)
+}
+
+/**
+ * Convert an input value to a number for persistence.
+ * If the conversion fails, return original string.
+ */
+function toNumber (val) {
+ var n = parseFloat(val);
+ return isNaN(n) ? val : n
+}
+
+/**
+ * Make a map and return a function for checking if a key
+ * is in that map.
+ */
+function makeMap (
+ str,
+ expectsLowerCase
+) {
+ var map = Object.create(null);
+ var list = str.split(',');
+ for (var i = 0; i < list.length; i++) {
+ map[list[i]] = true;
+ }
+ return expectsLowerCase
+ ? function (val) { return map[val.toLowerCase()]; }
+ : function (val) { return map[val]; }
+}
+
+/**
+ * Check if a tag is a built-in tag.
+ */
+var isBuiltInTag = makeMap('slot,component', true);
+
+/**
+ * Check if an attribute is a reserved attribute.
+ */
+var isReservedAttribute = makeMap('key,ref,slot,slot-scope,is');
+
+/**
+ * Remove an item from an array.
+ */
+function remove (arr, item) {
+ if (arr.length) {
+ var index = arr.indexOf(item);
+ if (index > -1) {
+ return arr.splice(index, 1)
+ }
+ }
+}
+
+/**
+ * Check whether an object has the property.
+ */
+var hasOwnProperty = Object.prototype.hasOwnProperty;
+function hasOwn (obj, key) {
+ return hasOwnProperty.call(obj, key)
+}
+
+/**
+ * Create a cached version of a pure function.
+ */
+function cached (fn) {
+ var cache = Object.create(null);
+ return (function cachedFn (str) {
+ var hit = cache[str];
+ return hit || (cache[str] = fn(str))
+ })
+}
+
+/**
+ * Camelize a hyphen-delimited string.
+ */
+var camelizeRE = /-(\w)/g;
+var camelize = cached(function (str) {
+ return str.replace(camelizeRE, function (_, c) { return c ? c.toUpperCase() : ''; })
+});
+
+/**
+ * Capitalize a string.
+ */
+var capitalize = cached(function (str) {
+ return str.charAt(0).toUpperCase() + str.slice(1)
+});
+
+/**
+ * Hyphenate a camelCase string.
+ */
+var hyphenateRE = /\B([A-Z])/g;
+var hyphenate = cached(function (str) {
+ return str.replace(hyphenateRE, '-$1').toLowerCase()
+});
+
+/**
+ * Simple bind polyfill for environments that do not support it,
+ * e.g., PhantomJS 1.x. Technically, we don't need this anymore
+ * since native bind is now performant enough in most browsers.
+ * But removing it would mean breaking code that was able to run in
+ * PhantomJS 1.x, so this must be kept for backward compatibility.
+ */
+
+/* istanbul ignore next */
+function polyfillBind (fn, ctx) {
+ function boundFn (a) {
+ var l = arguments.length;
+ return l
+ ? l > 1
+ ? fn.apply(ctx, arguments)
+ : fn.call(ctx, a)
+ : fn.call(ctx)
+ }
+
+ boundFn._length = fn.length;
+ return boundFn
+}
+
+function nativeBind (fn, ctx) {
+ return fn.bind(ctx)
+}
+
+var bind = Function.prototype.bind
+ ? nativeBind
+ : polyfillBind;
+
+/**
+ * Convert an Array-like object to a real Array.
+ */
+function toArray (list, start) {
+ start = start || 0;
+ var i = list.length - start;
+ var ret = new Array(i);
+ while (i--) {
+ ret[i] = list[i + start];
+ }
+ return ret
+}
+
+/**
+ * Mix properties into target object.
+ */
+function extend (to, _from) {
+ for (var key in _from) {
+ to[key] = _from[key];
+ }
+ return to
+}
+
+/**
+ * Merge an Array of Objects into a single Object.
+ */
+function toObject (arr) {
+ var res = {};
+ for (var i = 0; i < arr.length; i++) {
+ if (arr[i]) {
+ extend(res, arr[i]);
+ }
+ }
+ return res
+}
+
+/* eslint-disable no-unused-vars */
+
+/**
+ * Perform no operation.
+ * Stubbing args to make Flow happy without leaving useless transpiled code
+ * with ...rest (https://flow.org/blog/2017/05/07/Strict-Function-Call-Arity/).
+ */
+function noop (a, b, c) {}
+
+/**
+ * Always return false.
+ */
+var no = function (a, b, c) { return false; };
+
+/* eslint-enable no-unused-vars */
+
+/**
+ * Return the same value.
+ */
+var identity = function (_) { return _; };
+
+/**
+ * Generate a string containing static keys from compiler modules.
+ */
+function genStaticKeys (modules) {
+ return modules.reduce(function (keys, m) {
+ return keys.concat(m.staticKeys || [])
+ }, []).join(',')
+}
+
+/**
+ * Check if two values are loosely equal - that is,
+ * if they are plain objects, do they have the same shape?
+ */
+function looseEqual (a, b) {
+ if (a === b) { return true }
+ var isObjectA = isObject(a);
+ var isObjectB = isObject(b);
+ if (isObjectA && isObjectB) {
+ try {
+ var isArrayA = Array.isArray(a);
+ var isArrayB = Array.isArray(b);
+ if (isArrayA && isArrayB) {
+ return a.length === b.length && a.every(function (e, i) {
+ return looseEqual(e, b[i])
+ })
+ } else if (a instanceof Date && b instanceof Date) {
+ return a.getTime() === b.getTime()
+ } else if (!isArrayA && !isArrayB) {
+ var keysA = Object.keys(a);
+ var keysB = Object.keys(b);
+ return keysA.length === keysB.length && keysA.every(function (key) {
+ return looseEqual(a[key], b[key])
+ })
+ } else {
+ /* istanbul ignore next */
+ return false
+ }
+ } catch (e) {
+ /* istanbul ignore next */
+ return false
+ }
+ } else if (!isObjectA && !isObjectB) {
+ return String(a) === String(b)
+ } else {
+ return false
+ }
+}
+
+/**
+ * Return the first index at which a loosely equal value can be
+ * found in the array (if value is a plain object, the array must
+ * contain an object of the same shape), or -1 if it is not present.
+ */
+function looseIndexOf (arr, val) {
+ for (var i = 0; i < arr.length; i++) {
+ if (looseEqual(arr[i], val)) { return i }
+ }
+ return -1
+}
+
+/**
+ * Ensure a function is called only once.
+ */
+function once (fn) {
+ var called = false;
+ return function () {
+ if (!called) {
+ called = true;
+ fn.apply(this, arguments);
+ }
+ }
+}
+
+var SSR_ATTR = 'data-server-rendered';
+
+var ASSET_TYPES = [
+ 'component',
+ 'directive',
+ 'filter'
+];
+
+var LIFECYCLE_HOOKS = [
+ 'beforeCreate',
+ 'created',
+ 'beforeMount',
+ 'mounted',
+ 'beforeUpdate',
+ 'updated',
+ 'beforeDestroy',
+ 'destroyed',
+ 'activated',
+ 'deactivated',
+ 'errorCaptured',
+ 'serverPrefetch'
+];
+
+/* */
+
+
+
+var config = ({
+ /**
+ * Option merge strategies (used in core/util/options)
+ */
+ // $flow-disable-line
+ optionMergeStrategies: Object.create(null),
+
+ /**
+ * Whether to suppress warnings.
+ */
+ silent: false,
+
+ /**
+ * Show production mode tip message on boot?
+ */
+ productionTip: "development" !== 'production',
+
+ /**
+ * Whether to enable devtools
+ */
+ devtools: "development" !== 'production',
+
+ /**
+ * Whether to record perf
+ */
+ performance: false,
+
+ /**
+ * Error handler for watcher errors
+ */
+ errorHandler: null,
+
+ /**
+ * Warn handler for watcher warns
+ */
+ warnHandler: null,
+
+ /**
+ * Ignore certain custom elements
+ */
+ ignoredElements: [],
+
+ /**
+ * Custom user key aliases for v-on
+ */
+ // $flow-disable-line
+ keyCodes: Object.create(null),
+
+ /**
+ * Check if a tag is reserved so that it cannot be registered as a
+ * component. This is platform-dependent and may be overwritten.
+ */
+ isReservedTag: no,
+
+ /**
+ * Check if an attribute is reserved so that it cannot be used as a component
+ * prop. This is platform-dependent and may be overwritten.
+ */
+ isReservedAttr: no,
+
+ /**
+ * Check if a tag is an unknown element.
+ * Platform-dependent.
+ */
+ isUnknownElement: no,
+
+ /**
+ * Get the namespace of an element
+ */
+ getTagNamespace: noop,
+
+ /**
+ * Parse the real tag name for the specific platform.
+ */
+ parsePlatformTagName: identity,
+
+ /**
+ * Check if an attribute must be bound using property, e.g. value
+ * Platform-dependent.
+ */
+ mustUseProp: no,
+
+ /**
+ * Perform updates asynchronously. Intended to be used by Vue Test Utils
+ * This will significantly reduce performance if set to false.
+ */
+ async: true,
+
+ /**
+ * Exposed for legacy reasons
+ */
+ _lifecycleHooks: LIFECYCLE_HOOKS
+});
+
+/* */
+
+/**
+ * unicode letters used for parsing html tags, component names and property paths.
+ * using https://www.w3.org/TR/html53/semantics-scripting.html#potentialcustomelementname
+ * skipping \u10000-\uEFFFF due to it freezing up PhantomJS
+ */
+var unicodeRegExp = /a-zA-Z\u00B7\u00C0-\u00D6\u00D8-\u00F6\u00F8-\u037D\u037F-\u1FFF\u200C-\u200D\u203F-\u2040\u2070-\u218F\u2C00-\u2FEF\u3001-\uD7FF\uF900-\uFDCF\uFDF0-\uFFFD/;
+
+/**
+ * Check if a string starts with $ or _
+ */
+function isReserved (str) {
+ var c = (str + '').charCodeAt(0);
+ return c === 0x24 || c === 0x5F
+}
+
+/**
+ * Define a property.
+ */
+function def (obj, key, val, enumerable) {
+ Object.defineProperty(obj, key, {
+ value: val,
+ enumerable: !!enumerable,
+ writable: true,
+ configurable: true
+ });
+}
+
+/**
+ * Parse simple path.
+ */
+var bailRE = new RegExp(("[^" + (unicodeRegExp.source) + ".$_\\d]"));
+function parsePath (path) {
+ if (bailRE.test(path)) {
+ return
+ }
+ var segments = path.split('.');
+ return function (obj) {
+ for (var i = 0; i < segments.length; i++) {
+ if (!obj) { return }
+ obj = obj[segments[i]];
+ }
+ return obj
+ }
+}
+
+/* */
+
+// can we use __proto__?
+var hasProto = '__proto__' in {};
+
+// Browser environment sniffing
+var inBrowser = typeof window !== 'undefined';
+var inWeex = typeof WXEnvironment !== 'undefined' && !!WXEnvironment.platform;
+var weexPlatform = inWeex && WXEnvironment.platform.toLowerCase();
+var UA = inBrowser && window.navigator.userAgent.toLowerCase();
+var isIE = UA && /msie|trident/.test(UA);
+var isIE9 = UA && UA.indexOf('msie 9.0') > 0;
+var isEdge = UA && UA.indexOf('edge/') > 0;
+var isAndroid = (UA && UA.indexOf('android') > 0) || (weexPlatform === 'android');
+var isIOS = (UA && /iphone|ipad|ipod|ios/.test(UA)) || (weexPlatform === 'ios');
+var isChrome = UA && /chrome\/\d+/.test(UA) && !isEdge;
+var isPhantomJS = UA && /phantomjs/.test(UA);
+var isFF = UA && UA.match(/firefox\/(\d+)/);
+
+// Firefox has a "watch" function on Object.prototype...
+var nativeWatch = ({}).watch;
+
+var supportsPassive = false;
+if (inBrowser) {
+ try {
+ var opts = {};
+ Object.defineProperty(opts, 'passive', ({
+ get: function get () {
+ /* istanbul ignore next */
+ supportsPassive = true;
+ }
+ })); // https://github.com/facebook/flow/issues/285
+ window.addEventListener('test-passive', null, opts);
+ } catch (e) {}
+}
+
+// this needs to be lazy-evaled because vue may be required before
+// vue-server-renderer can set VUE_ENV
+var _isServer;
+var isServerRendering = function () {
+ if (_isServer === undefined) {
+ /* istanbul ignore if */
+ if (!inBrowser && !inWeex && typeof global !== 'undefined') {
+ // detect presence of vue-server-renderer and avoid
+ // Webpack shimming the process
+ _isServer = global['process'] && global['process'].env.VUE_ENV === 'server';
+ } else {
+ _isServer = false;
+ }
+ }
+ return _isServer
+};
+
+// detect devtools
+var devtools = inBrowser && window.__VUE_DEVTOOLS_GLOBAL_HOOK__;
+
+/* istanbul ignore next */
+function isNative (Ctor) {
+ return typeof Ctor === 'function' && /native code/.test(Ctor.toString())
+}
+
+var hasSymbol =
+ typeof Symbol !== 'undefined' && isNative(Symbol) &&
+ typeof Reflect !== 'undefined' && isNative(Reflect.ownKeys);
+
+var _Set;
+/* istanbul ignore if */ // $flow-disable-line
+if (typeof Set !== 'undefined' && isNative(Set)) {
+ // use native Set when available.
+ _Set = Set;
+} else {
+ // a non-standard Set polyfill that only works with primitive keys.
+ _Set = /*@__PURE__*/(function () {
+ function Set () {
+ this.set = Object.create(null);
+ }
+ Set.prototype.has = function has (key) {
+ return this.set[key] === true
+ };
+ Set.prototype.add = function add (key) {
+ this.set[key] = true;
+ };
+ Set.prototype.clear = function clear () {
+ this.set = Object.create(null);
+ };
+
+ return Set;
+ }());
+}
+
+/* */
+
+var warn = noop;
+var tip = noop;
+var generateComponentTrace = (noop); // work around flow check
+var formatComponentName = (noop);
+
+{
+ var hasConsole = typeof console !== 'undefined';
+ var classifyRE = /(?:^|[-_])(\w)/g;
+ var classify = function (str) { return str
+ .replace(classifyRE, function (c) { return c.toUpperCase(); })
+ .replace(/[-_]/g, ''); };
+
+ warn = function (msg, vm) {
+ var trace = vm ? generateComponentTrace(vm) : '';
+
+ if (config.warnHandler) {
+ config.warnHandler.call(null, msg, vm, trace);
+ } else if (hasConsole && (!config.silent)) {
+ console.error(("[Vue warn]: " + msg + trace));
+ }
+ };
+
+ tip = function (msg, vm) {
+ if (hasConsole && (!config.silent)) {
+ console.warn("[Vue tip]: " + msg + (
+ vm ? generateComponentTrace(vm) : ''
+ ));
+ }
+ };
+
+ formatComponentName = function (vm, includeFile) {
+ if (vm.$root === vm) {
+ return '<Root>'
+ }
+ var options = typeof vm === 'function' && vm.cid != null
+ ? vm.options
+ : vm._isVue
+ ? vm.$options || vm.constructor.options
+ : vm;
+ var name = options.name || options._componentTag;
+ var file = options.__file;
+ if (!name && file) {
+ var match = file.match(/([^/\\]+)\.vue$/);
+ name = match && match[1];
+ }
+
+ return (
+ (name ? ("<" + (classify(name)) + ">") : "<Anonymous>") +
+ (file && includeFile !== false ? (" at " + file) : '')
+ )
+ };
+
+ var repeat = function (str, n) {
+ var res = '';
+ while (n) {
+ if (n % 2 === 1) { res += str; }
+ if (n > 1) { str += str; }
+ n >>= 1;
+ }
+ return res
+ };
+
+ generateComponentTrace = function (vm) {
+ if (vm._isVue && vm.$parent) {
+ var tree = [];
+ var currentRecursiveSequence = 0;
+ while (vm) {
+ if (tree.length > 0) {
+ var last = tree[tree.length - 1];
+ if (last.constructor === vm.constructor) {
+ currentRecursiveSequence++;
+ vm = vm.$parent;
+ continue
+ } else if (currentRecursiveSequence > 0) {
+ tree[tree.length - 1] = [last, currentRecursiveSequence];
+ currentRecursiveSequence = 0;
+ }
+ }
+ tree.push(vm);
+ vm = vm.$parent;
+ }
+ return '\n\nfound in\n\n' + tree
+ .map(function (vm, i) { return ("" + (i === 0 ? '---> ' : repeat(' ', 5 + i * 2)) + (Array.isArray(vm)
+ ? ((formatComponentName(vm[0])) + "... (" + (vm[1]) + " recursive calls)")
+ : formatComponentName(vm))); })
+ .join('\n')
+ } else {
+ return ("\n\n(found in " + (formatComponentName(vm)) + ")")
+ }
+ };
+}
+
+/* */
+
+var uid = 0;
+
+/**
+ * A dep is an observable that can have multiple
+ * directives subscribing to it.
+ */
+var Dep = function Dep () {
+ this.id = uid++;
+ this.subs = [];
+};
+
+Dep.prototype.addSub = function addSub (sub) {
+ this.subs.push(sub);
+};
+
+Dep.prototype.removeSub = function removeSub (sub) {
+ remove(this.subs, sub);
+};
+
+Dep.prototype.depend = function depend () {
+ if (Dep.target) {
+ Dep.target.addDep(this);
+ }
+};
+
+Dep.prototype.notify = function notify () {
+ // stabilize the subscriber list first
+ var subs = this.subs.slice();
+ if (!config.async) {
+ // subs aren't sorted in scheduler if not running async
+ // we need to sort them now to make sure they fire in correct
+ // order
+ subs.sort(function (a, b) { return a.id - b.id; });
+ }
+ for (var i = 0, l = subs.length; i < l; i++) {
+ subs[i].update();
+ }
+};
+
+// The current target watcher being evaluated.
+// This is globally unique because only one watcher
+// can be evaluated at a time.
+Dep.target = null;
+var targetStack = [];
+
+function pushTarget (target) {
+ targetStack.push(target);
+ Dep.target = target;
+}
+
+function popTarget () {
+ targetStack.pop();
+ Dep.target = targetStack[targetStack.length - 1];
+}
+
+/* */
+
+var VNode = function VNode (
+ tag,
+ data,
+ children,
+ text,
+ elm,
+ context,
+ componentOptions,
+ asyncFactory
+) {
+ this.tag = tag;
+ this.data = data;
+ this.children = children;
+ this.text = text;
+ this.elm = elm;
+ this.ns = undefined;
+ this.context = context;
+ this.fnContext = undefined;
+ this.fnOptions = undefined;
+ this.fnScopeId = undefined;
+ this.key = data && data.key;
+ this.componentOptions = componentOptions;
+ this.componentInstance = undefined;
+ this.parent = undefined;
+ this.raw = false;
+ this.isStatic = false;
+ this.isRootInsert = true;
+ this.isComment = false;
+ this.isCloned = false;
+ this.isOnce = false;
+ this.asyncFactory = asyncFactory;
+ this.asyncMeta = undefined;
+ this.isAsyncPlaceholder = false;
+};
+
+var prototypeAccessors = { child: { configurable: true } };
+
+// DEPRECATED: alias for componentInstance for backwards compat.
+/* istanbul ignore next */
+prototypeAccessors.child.get = function () {
+ return this.componentInstance
+};
+
+Object.defineProperties( VNode.prototype, prototypeAccessors );
+
+var createEmptyVNode = function (text) {
+ if ( text === void 0 ) text = '';
+
+ var node = new VNode();
+ node.text = text;
+ node.isComment = true;
+ return node
+};
+
+function createTextVNode (val) {
+ return new VNode(undefined, undefined, undefined, String(val))
+}
+
+// optimized shallow clone
+// used for static nodes and slot nodes because they may be reused across
+// multiple renders, cloning them avoids errors when DOM manipulations rely
+// on their elm reference.
+function cloneVNode (vnode) {
+ var cloned = new VNode(
+ vnode.tag,
+ vnode.data,
+ // #7975
+ // clone children array to avoid mutating original in case of cloning
+ // a child.
+ vnode.children && vnode.children.slice(),
+ vnode.text,
+ vnode.elm,
+ vnode.context,
+ vnode.componentOptions,
+ vnode.asyncFactory
+ );
+ cloned.ns = vnode.ns;
+ cloned.isStatic = vnode.isStatic;
+ cloned.key = vnode.key;
+ cloned.isComment = vnode.isComment;
+ cloned.fnContext = vnode.fnContext;
+ cloned.fnOptions = vnode.fnOptions;
+ cloned.fnScopeId = vnode.fnScopeId;
+ cloned.asyncMeta = vnode.asyncMeta;
+ cloned.isCloned = true;
+ return cloned
+}
+
+/*
+ * not type checking this file because flow doesn't play well with
+ * dynamically accessing methods on Array prototype
+ */
+
+var arrayProto = Array.prototype;
+var arrayMethods = Object.create(arrayProto);
+
+var methodsToPatch = [
+ 'push',
+ 'pop',
+ 'shift',
+ 'unshift',
+ 'splice',
+ 'sort',
+ 'reverse'
+];
+
+/**
+ * Intercept mutating methods and emit events
+ */
+methodsToPatch.forEach(function (method) {
+ // cache original method
+ var original = arrayProto[method];
+ def(arrayMethods, method, function mutator () {
+ var args = [], len = arguments.length;
+ while ( len-- ) args[ len ] = arguments[ len ];
+
+ var result = original.apply(this, args);
+ var ob = this.__ob__;
+ var inserted;
+ switch (method) {
+ case 'push':
+ case 'unshift':
+ inserted = args;
+ break
+ case 'splice':
+ inserted = args.slice(2);
+ break
+ }
+ if (inserted) { ob.observeArray(inserted); }
+ // notify change
+ ob.dep.notify();
+ return result
+ });
+});
+
+/* */
+
+var arrayKeys = Object.getOwnPropertyNames(arrayMethods);
+
+/**
+ * In some cases we may want to disable observation inside a component's
+ * update computation.
+ */
+var shouldObserve = true;
+
+function toggleObserving (value) {
+ shouldObserve = value;
+}
+
+/**
+ * Observer class that is attached to each observed
+ * object. Once attached, the observer converts the target
+ * object's property keys into getter/setters that
+ * collect dependencies and dispatch updates.
+ */
+var Observer = function Observer (value) {
+ this.value = value;
+ this.dep = new Dep();
+ this.vmCount = 0;
+ def(value, '__ob__', this);
+ if (Array.isArray(value)) {
+ if (hasProto) {
+ protoAugment(value, arrayMethods);
+ } else {
+ copyAugment(value, arrayMethods, arrayKeys);
+ }
+ this.observeArray(value);
+ } else {
+ this.walk(value);
+ }
+};
+
+/**
+ * Walk through all properties and convert them into
+ * getter/setters. This method should only be called when
+ * value type is Object.
+ */
+Observer.prototype.walk = function walk (obj) {
+ var keys = Object.keys(obj);
+ for (var i = 0; i < keys.length; i++) {
+ defineReactive$$1(obj, keys[i]);
+ }
+};
+
+/**
+ * Observe a list of Array items.
+ */
+Observer.prototype.observeArray = function observeArray (items) {
+ for (var i = 0, l = items.length; i < l; i++) {
+ observe(items[i]);
+ }
+};
+
+// helpers
+
+/**
+ * Augment a target Object or Array by intercepting
+ * the prototype chain using __proto__
+ */
+function protoAugment (target, src) {
+ /* eslint-disable no-proto */
+ target.__proto__ = src;
+ /* eslint-enable no-proto */
+}
+
+/**
+ * Augment a target Object or Array by defining
+ * hidden properties.
+ */
+/* istanbul ignore next */
+function copyAugment (target, src, keys) {
+ for (var i = 0, l = keys.length; i < l; i++) {
+ var key = keys[i];
+ def(target, key, src[key]);
+ }
+}
+
+/**
+ * Attempt to create an observer instance for a value,
+ * returns the new observer if successfully observed,
+ * or the existing observer if the value already has one.
+ */
+function observe (value, asRootData) {
+ if (!isObject(value) || value instanceof VNode) {
+ return
+ }
+ var ob;
+ if (hasOwn(value, '__ob__') && value.__ob__ instanceof Observer) {
+ ob = value.__ob__;
+ } else if (
+ shouldObserve &&
+ !isServerRendering() &&
+ (Array.isArray(value) || isPlainObject(value)) &&
+ Object.isExtensible(value) &&
+ !value._isVue
+ ) {
+ ob = new Observer(value);
+ }
+ if (asRootData && ob) {
+ ob.vmCount++;
+ }
+ return ob
+}
+
+/**
+ * Define a reactive property on an Object.
+ */
+function defineReactive$$1 (
+ obj,
+ key,
+ val,
+ customSetter,
+ shallow
+) {
+ var dep = new Dep();
+
+ var property = Object.getOwnPropertyDescriptor(obj, key);
+ if (property && property.configurable === false) {
+ return
+ }
+
+ // cater for pre-defined getter/setters
+ var getter = property && property.get;
+ var setter = property && property.set;
+ if ((!getter || setter) && arguments.length === 2) {
+ val = obj[key];
+ }
+
+ var childOb = !shallow && observe(val);
+ Object.defineProperty(obj, key, {
+ enumerable: true,
+ configurable: true,
+ get: function reactiveGetter () {
+ var value = getter ? getter.call(obj) : val;
+ if (Dep.target) {
+ dep.depend();
+ if (childOb) {
+ childOb.dep.depend();
+ if (Array.isArray(value)) {
+ dependArray(value);
+ }
+ }
+ }
+ return value
+ },
+ set: function reactiveSetter (newVal) {
+ var value = getter ? getter.call(obj) : val;
+ /* eslint-disable no-self-compare */
+ if (newVal === value || (newVal !== newVal && value !== value)) {
+ return
+ }
+ /* eslint-enable no-self-compare */
+ if (customSetter) {
+ customSetter();
+ }
+ // #7981: for accessor properties without setter
+ if (getter && !setter) { return }
+ if (setter) {
+ setter.call(obj, newVal);
+ } else {
+ val = newVal;
+ }
+ childOb = !shallow && observe(newVal);
+ dep.notify();
+ }
+ });
+}
+
+/**
+ * Set a property on an object. Adds the new property and
+ * triggers change notification if the property doesn't
+ * already exist.
+ */
+function set (target, key, val) {
+ if (isUndef(target) || isPrimitive(target)
+ ) {
+ warn(("Cannot set reactive property on undefined, null, or primitive value: " + ((target))));
+ }
+ if (Array.isArray(target) && isValidArrayIndex(key)) {
+ target.length = Math.max(target.length, key);
+ target.splice(key, 1, val);
+ return val
+ }
+ if (key in target && !(key in Object.prototype)) {
+ target[key] = val;
+ return val
+ }
+ var ob = (target).__ob__;
+ if (target._isVue || (ob && ob.vmCount)) {
+ warn(
+ 'Avoid adding reactive properties to a Vue instance or its root $data ' +
+ 'at runtime - declare it upfront in the data option.'
+ );
+ return val
+ }
+ if (!ob) {
+ target[key] = val;
+ return val
+ }
+ defineReactive$$1(ob.value, key, val);
+ ob.dep.notify();
+ return val
+}
+
+/**
+ * Delete a property and trigger change if necessary.
+ */
+function del (target, key) {
+ if (isUndef(target) || isPrimitive(target)
+ ) {
+ warn(("Cannot delete reactive property on undefined, null, or primitive value: " + ((target))));
+ }
+ if (Array.isArray(target) && isValidArrayIndex(key)) {
+ target.splice(key, 1);
+ return
+ }
+ var ob = (target).__ob__;
+ if (target._isVue || (ob && ob.vmCount)) {
+ warn(
+ 'Avoid deleting properties on a Vue instance or its root $data ' +
+ '- just set it to null.'
+ );
+ return
+ }
+ if (!hasOwn(target, key)) {
+ return
+ }
+ delete target[key];
+ if (!ob) {
+ return
+ }
+ ob.dep.notify();
+}
+
+/**
+ * Collect dependencies on array elements when the array is touched, since
+ * we cannot intercept array element access like property getters.
+ */
+function dependArray (value) {
+ for (var e = (void 0), i = 0, l = value.length; i < l; i++) {
+ e = value[i];
+ e && e.__ob__ && e.__ob__.dep.depend();
+ if (Array.isArray(e)) {
+ dependArray(e);
+ }
+ }
+}
+
+/* */
+
+/**
+ * Option overwriting strategies are functions that handle
+ * how to merge a parent option value and a child option
+ * value into the final value.
+ */
+var strats = config.optionMergeStrategies;
+
+/**
+ * Options with restrictions
+ */
+{
+ strats.el = strats.propsData = function (parent, child, vm, key) {
+ if (!vm) {
+ warn(
+ "option \"" + key + "\" can only be used during instance " +
+ 'creation with the `new` keyword.'
+ );
+ }
+ return defaultStrat(parent, child)
+ };
+}
+
+/**
+ * Helper that recursively merges two data objects together.
+ */
+function mergeData (to, from) {
+ if (!from) { return to }
+ var key, toVal, fromVal;
+
+ var keys = hasSymbol
+ ? Reflect.ownKeys(from)
+ : Object.keys(from);
+
+ for (var i = 0; i < keys.length; i++) {
+ key = keys[i];
+ // in case the object is already observed...
+ if (key === '__ob__') { continue }
+ toVal = to[key];
+ fromVal = from[key];
+ if (!hasOwn(to, key)) {
+ set(to, key, fromVal);
+ } else if (
+ toVal !== fromVal &&
+ isPlainObject(toVal) &&
+ isPlainObject(fromVal)
+ ) {
+ mergeData(toVal, fromVal);
+ }
+ }
+ return to
+}
+
+/**
+ * Data
+ */
+function mergeDataOrFn (
+ parentVal,
+ childVal,
+ vm
+) {
+ if (!vm) {
+ // in a Vue.extend merge, both should be functions
+ if (!childVal) {
+ return parentVal
+ }
+ if (!parentVal) {
+ return childVal
+ }
+ // when parentVal & childVal are both present,
+ // we need to return a function that returns the
+ // merged result of both functions... no need to
+ // check if parentVal is a function here because
+ // it has to be a function to pass previous merges.
+ return function mergedDataFn () {
+ return mergeData(
+ typeof childVal === 'function' ? childVal.call(this, this) : childVal,
+ typeof parentVal === 'function' ? parentVal.call(this, this) : parentVal
+ )
+ }
+ } else {
+ return function mergedInstanceDataFn () {
+ // instance merge
+ var instanceData = typeof childVal === 'function'
+ ? childVal.call(vm, vm)
+ : childVal;
+ var defaultData = typeof parentVal === 'function'
+ ? parentVal.call(vm, vm)
+ : parentVal;
+ if (instanceData) {
+ return mergeData(instanceData, defaultData)
+ } else {
+ return defaultData
+ }
+ }
+ }
+}
+
+strats.data = function (
+ parentVal,
+ childVal,
+ vm
+) {
+ if (!vm) {
+ if (childVal && typeof childVal !== 'function') {
+ warn(
+ 'The "data" option should be a function ' +
+ 'that returns a per-instance value in component ' +
+ 'definitions.',
+ vm
+ );
+
+ return parentVal
+ }
+ return mergeDataOrFn(parentVal, childVal)
+ }
+
+ return mergeDataOrFn(parentVal, childVal, vm)
+};
+
+/**
+ * Hooks and props are merged as arrays.
+ */
+function mergeHook (
+ parentVal,
+ childVal
+) {
+ var res = childVal
+ ? parentVal
+ ? parentVal.concat(childVal)
+ : Array.isArray(childVal)
+ ? childVal
+ : [childVal]
+ : parentVal;
+ return res
+ ? dedupeHooks(res)
+ : res
+}
+
+function dedupeHooks (hooks) {
+ var res = [];
+ for (var i = 0; i < hooks.length; i++) {
+ if (res.indexOf(hooks[i]) === -1) {
+ res.push(hooks[i]);
+ }
+ }
+ return res
+}
+
+LIFECYCLE_HOOKS.forEach(function (hook) {
+ strats[hook] = mergeHook;
+});
+
+/**
+ * Assets
+ *
+ * When a vm is present (instance creation), we need to do
+ * a three-way merge between constructor options, instance
+ * options and parent options.
+ */
+function mergeAssets (
+ parentVal,
+ childVal,
+ vm,
+ key
+) {
+ var res = Object.create(parentVal || null);
+ if (childVal) {
+ assertObjectType(key, childVal, vm);
+ return extend(res, childVal)
+ } else {
+ return res
+ }
+}
+
+ASSET_TYPES.forEach(function (type) {
+ strats[type + 's'] = mergeAssets;
+});
+
+/**
+ * Watchers.
+ *
+ * Watchers hashes should not overwrite one
+ * another, so we merge them as arrays.
+ */
+strats.watch = function (
+ parentVal,
+ childVal,
+ vm,
+ key
+) {
+ // work around Firefox's Object.prototype.watch...
+ if (parentVal === nativeWatch) { parentVal = undefined; }
+ if (childVal === nativeWatch) { childVal = undefined; }
+ /* istanbul ignore if */
+ if (!childVal) { return Object.create(parentVal || null) }
+ {
+ assertObjectType(key, childVal, vm);
+ }
+ if (!parentVal) { return childVal }
+ var ret = {};
+ extend(ret, parentVal);
+ for (var key$1 in childVal) {
+ var parent = ret[key$1];
+ var child = childVal[key$1];
+ if (parent && !Array.isArray(parent)) {
+ parent = [parent];
+ }
+ ret[key$1] = parent
+ ? parent.concat(child)
+ : Array.isArray(child) ? child : [child];
+ }
+ return ret
+};
+
+/**
+ * Other object hashes.
+ */
+strats.props =
+strats.methods =
+strats.inject =
+strats.computed = function (
+ parentVal,
+ childVal,
+ vm,
+ key
+) {
+ if (childVal && "development" !== 'production') {
+ assertObjectType(key, childVal, vm);
+ }
+ if (!parentVal) { return childVal }
+ var ret = Object.create(null);
+ extend(ret, parentVal);
+ if (childVal) { extend(ret, childVal); }
+ return ret
+};
+strats.provide = mergeDataOrFn;
+
+/**
+ * Default strategy.
+ */
+var defaultStrat = function (parentVal, childVal) {
+ return childVal === undefined
+ ? parentVal
+ : childVal
+};
+
+/**
+ * Validate component names
+ */
+function checkComponents (options) {
+ for (var key in options.components) {
+ validateComponentName(key);
+ }
+}
+
+function validateComponentName (name) {
+ if (!new RegExp(("^[a-zA-Z][\\-\\.0-9_" + (unicodeRegExp.source) + "]*$")).test(name)) {
+ warn(
+ 'Invalid component name: "' + name + '". Component names ' +
+ 'should conform to valid custom element name in html5 specification.'
+ );
+ }
+ if (isBuiltInTag(name) || config.isReservedTag(name)) {
+ warn(
+ 'Do not use built-in or reserved HTML elements as component ' +
+ 'id: ' + name
+ );
+ }
+}
+
+/**
+ * Ensure all props option syntax are normalized into the
+ * Object-based format.
+ */
+function normalizeProps (options, vm) {
+ var props = options.props;
+ if (!props) { return }
+ var res = {};
+ var i, val, name;
+ if (Array.isArray(props)) {
+ i = props.length;
+ while (i--) {
+ val = props[i];
+ if (typeof val === 'string') {
+ name = camelize(val);
+ res[name] = { type: null };
+ } else {
+ warn('props must be strings when using array syntax.');
+ }
+ }
+ } else if (isPlainObject(props)) {
+ for (var key in props) {
+ val = props[key];
+ name = camelize(key);
+ res[name] = isPlainObject(val)
+ ? val
+ : { type: val };
+ }
+ } else {
+ warn(
+ "Invalid value for option \"props\": expected an Array or an Object, " +
+ "but got " + (toRawType(props)) + ".",
+ vm
+ );
+ }
+ options.props = res;
+}
+
+/**
+ * Normalize all injections into Object-based format
+ */
+function normalizeInject (options, vm) {
+ var inject = options.inject;
+ if (!inject) { return }
+ var normalized = options.inject = {};
+ if (Array.isArray(inject)) {
+ for (var i = 0; i < inject.length; i++) {
+ normalized[inject[i]] = { from: inject[i] };
+ }
+ } else if (isPlainObject(inject)) {
+ for (var key in inject) {
+ var val = inject[key];
+ normalized[key] = isPlainObject(val)
+ ? extend({ from: key }, val)
+ : { from: val };
+ }
+ } else {
+ warn(
+ "Invalid value for option \"inject\": expected an Array or an Object, " +
+ "but got " + (toRawType(inject)) + ".",
+ vm
+ );
+ }
+}
+
+/**
+ * Normalize raw function directives into object format.
+ */
+function normalizeDirectives (options) {
+ var dirs = options.directives;
+ if (dirs) {
+ for (var key in dirs) {
+ var def$$1 = dirs[key];
+ if (typeof def$$1 === 'function') {
+ dirs[key] = { bind: def$$1, update: def$$1 };
+ }
+ }
+ }
+}
+
+function assertObjectType (name, value, vm) {
+ if (!isPlainObject(value)) {
+ warn(
+ "Invalid value for option \"" + name + "\": expected an Object, " +
+ "but got " + (toRawType(value)) + ".",
+ vm
+ );
+ }
+}
+
+/**
+ * Merge two option objects into a new one.
+ * Core utility used in both instantiation and inheritance.
+ */
+function mergeOptions (
+ parent,
+ child,
+ vm
+) {
+ {
+ checkComponents(child);
+ }
+
+ if (typeof child === 'function') {
+ child = child.options;
+ }
+
+ normalizeProps(child, vm);
+ normalizeInject(child, vm);
+ normalizeDirectives(child);
+
+ // Apply extends and mixins on the child options,
+ // but only if it is a raw options object that isn't
+ // the result of another mergeOptions call.
+ // Only merged options has the _base property.
+ if (!child._base) {
+ if (child.extends) {
+ parent = mergeOptions(parent, child.extends, vm);
+ }
+ if (child.mixins) {
+ for (var i = 0, l = child.mixins.length; i < l; i++) {
+ parent = mergeOptions(parent, child.mixins[i], vm);
+ }
+ }
+ }
+
+ var options = {};
+ var key;
+ for (key in parent) {
+ mergeField(key);
+ }
+ for (key in child) {
+ if (!hasOwn(parent, key)) {
+ mergeField(key);
+ }
+ }
+ function mergeField (key) {
+ var strat = strats[key] || defaultStrat;
+ options[key] = strat(parent[key], child[key], vm, key);
+ }
+ return options
+}
+
+/**
+ * Resolve an asset.
+ * This function is used because child instances need access
+ * to assets defined in its ancestor chain.
+ */
+function resolveAsset (
+ options,
+ type,
+ id,
+ warnMissing
+) {
+ /* istanbul ignore if */
+ if (typeof id !== 'string') {
+ return
+ }
+ var assets = options[type];
+ // check local registration variations first
+ if (hasOwn(assets, id)) { return assets[id] }
+ var camelizedId = camelize(id);
+ if (hasOwn(assets, camelizedId)) { return assets[camelizedId] }
+ var PascalCaseId = capitalize(camelizedId);
+ if (hasOwn(assets, PascalCaseId)) { return assets[PascalCaseId] }
+ // fallback to prototype chain
+ var res = assets[id] || assets[camelizedId] || assets[PascalCaseId];
+ if (warnMissing && !res) {
+ warn(
+ 'Failed to resolve ' + type.slice(0, -1) + ': ' + id,
+ options
+ );
+ }
+ return res
+}
+
+/* */
+
+
+
+function validateProp (
+ key,
+ propOptions,
+ propsData,
+ vm
+) {
+ var prop = propOptions[key];
+ var absent = !hasOwn(propsData, key);
+ var value = propsData[key];
+ // boolean casting
+ var booleanIndex = getTypeIndex(Boolean, prop.type);
+ if (booleanIndex > -1) {
+ if (absent && !hasOwn(prop, 'default')) {
+ value = false;
+ } else if (value === '' || value === hyphenate(key)) {
+ // only cast empty string / same name to boolean if
+ // boolean has higher priority
+ var stringIndex = getTypeIndex(String, prop.type);
+ if (stringIndex < 0 || booleanIndex < stringIndex) {
+ value = true;
+ }
+ }
+ }
+ // check default value
+ if (value === undefined) {
+ value = getPropDefaultValue(vm, prop, key);
+ // since the default value is a fresh copy,
+ // make sure to observe it.
+ var prevShouldObserve = shouldObserve;
+ toggleObserving(true);
+ observe(value);
+ toggleObserving(prevShouldObserve);
+ }
+ {
+ assertProp(prop, key, value, vm, absent);
+ }
+ return value
+}
+
+/**
+ * Get the default value of a prop.
+ */
+function getPropDefaultValue (vm, prop, key) {
+ // no default, return undefined
+ if (!hasOwn(prop, 'default')) {
+ return undefined
+ }
+ var def = prop.default;
+ // warn against non-factory defaults for Object & Array
+ if (isObject(def)) {
+ warn(
+ 'Invalid default value for prop "' + key + '": ' +
+ 'Props with type Object/Array must use a factory function ' +
+ 'to return the default value.',
+ vm
+ );
+ }
+ // the raw prop value was also undefined from previous render,
+ // return previous default value to avoid unnecessary watcher trigger
+ if (vm && vm.$options.propsData &&
+ vm.$options.propsData[key] === undefined &&
+ vm._props[key] !== undefined
+ ) {
+ return vm._props[key]
+ }
+ // call factory function for non-Function types
+ // a value is Function if its prototype is function even across different execution context
+ return typeof def === 'function' && getType(prop.type) !== 'Function'
+ ? def.call(vm)
+ : def
+}
+
+/**
+ * Assert whether a prop is valid.
+ */
+function assertProp (
+ prop,
+ name,
+ value,
+ vm,
+ absent
+) {
+ if (prop.required && absent) {
+ warn(
+ 'Missing required prop: "' + name + '"',
+ vm
+ );
+ return
+ }
+ if (value == null && !prop.required) {
+ return
+ }
+ var type = prop.type;
+ var valid = !type || type === true;
+ var expectedTypes = [];
+ if (type) {
+ if (!Array.isArray(type)) {
+ type = [type];
+ }
+ for (var i = 0; i < type.length && !valid; i++) {
+ var assertedType = assertType(value, type[i]);
+ expectedTypes.push(assertedType.expectedType || '');
+ valid = assertedType.valid;
+ }
+ }
+
+ if (!valid) {
+ warn(
+ getInvalidTypeMessage(name, value, expectedTypes),
+ vm
+ );
+ return
+ }
+ var validator = prop.validator;
+ if (validator) {
+ if (!validator(value)) {
+ warn(
+ 'Invalid prop: custom validator check failed for prop "' + name + '".',
+ vm
+ );
+ }
+ }
+}
+
+var simpleCheckRE = /^(String|Number|Boolean|Function|Symbol)$/;
+
+function assertType (value, type) {
+ var valid;
+ var expectedType = getType(type);
+ if (simpleCheckRE.test(expectedType)) {
+ var t = typeof value;
+ valid = t === expectedType.toLowerCase();
+ // for primitive wrapper objects
+ if (!valid && t === 'object') {
+ valid = value instanceof type;
+ }
+ } else if (expectedType === 'Object') {
+ valid = isPlainObject(value);
+ } else if (expectedType === 'Array') {
+ valid = Array.isArray(value);
+ } else {
+ valid = value instanceof type;
+ }
+ return {
+ valid: valid,
+ expectedType: expectedType
+ }
+}
+
+/**
+ * Use function string name to check built-in types,
+ * because a simple equality check will fail when running
+ * across different vms / iframes.
+ */
+function getType (fn) {
+ var match = fn && fn.toString().match(/^\s*function (\w+)/);
+ return match ? match[1] : ''
+}
+
+function isSameType (a, b) {
+ return getType(a) === getType(b)
+}
+
+function getTypeIndex (type, expectedTypes) {
+ if (!Array.isArray(expectedTypes)) {
+ return isSameType(expectedTypes, type) ? 0 : -1
+ }
+ for (var i = 0, len = expectedTypes.length; i < len; i++) {
+ if (isSameType(expectedTypes[i], type)) {
+ return i
+ }
+ }
+ return -1
+}
+
+function getInvalidTypeMessage (name, value, expectedTypes) {
+ var message = "Invalid prop: type check failed for prop \"" + name + "\"." +
+ " Expected " + (expectedTypes.map(capitalize).join(', '));
+ var expectedType = expectedTypes[0];
+ var receivedType = toRawType(value);
+ var expectedValue = styleValue(value, expectedType);
+ var receivedValue = styleValue(value, receivedType);
+ // check if we need to specify expected value
+ if (expectedTypes.length === 1 &&
+ isExplicable(expectedType) &&
+ !isBoolean(expectedType, receivedType)) {
+ message += " with value " + expectedValue;
+ }
+ message += ", got " + receivedType + " ";
+ // check if we need to specify received value
+ if (isExplicable(receivedType)) {
+ message += "with value " + receivedValue + ".";
+ }
+ return message
+}
+
+function styleValue (value, type) {
+ if (type === 'String') {
+ return ("\"" + value + "\"")
+ } else if (type === 'Number') {
+ return ("" + (Number(value)))
+ } else {
+ return ("" + value)
+ }
+}
+
+function isExplicable (value) {
+ var explicitTypes = ['string', 'number', 'boolean'];
+ return explicitTypes.some(function (elem) { return value.toLowerCase() === elem; })
+}
+
+function isBoolean () {
+ var args = [], len = arguments.length;
+ while ( len-- ) args[ len ] = arguments[ len ];
+
+ return args.some(function (elem) { return elem.toLowerCase() === 'boolean'; })
+}
+
+/* */
+
+function handleError (err, vm, info) {
+ // Deactivate deps tracking while processing error handler to avoid possible infinite rendering.
+ // See: https://github.com/vuejs/vuex/issues/1505
+ pushTarget();
+ try {
+ if (vm) {
+ var cur = vm;
+ while ((cur = cur.$parent)) {
+ var hooks = cur.$options.errorCaptured;
+ if (hooks) {
+ for (var i = 0; i < hooks.length; i++) {
+ try {
+ var capture = hooks[i].call(cur, err, vm, info) === false;
+ if (capture) { return }
+ } catch (e) {
+ globalHandleError(e, cur, 'errorCaptured hook');
+ }
+ }
+ }
+ }
+ }
+ globalHandleError(err, vm, info);
+ } finally {
+ popTarget();
+ }
+}
+
+function invokeWithErrorHandling (
+ handler,
+ context,
+ args,
+ vm,
+ info
+) {
+ var res;
+ try {
+ res = args ? handler.apply(context, args) : handler.call(context);
+ if (res && !res._isVue && isPromise(res) && !res._handled) {
+ res.catch(function (e) { return handleError(e, vm, info + " (Promise/async)"); });
+ // issue #9511
+ // avoid catch triggering multiple times when nested calls
+ res._handled = true;
+ }
+ } catch (e) {
+ handleError(e, vm, info);
+ }
+ return res
+}
+
+function globalHandleError (err, vm, info) {
+ if (config.errorHandler) {
+ try {
+ return config.errorHandler.call(null, err, vm, info)
+ } catch (e) {
+ // if the user intentionally throws the original error in the handler,
+ // do not log it twice
+ if (e !== err) {
+ logError(e, null, 'config.errorHandler');
+ }
+ }
+ }
+ logError(err, vm, info);
+}
+
+function logError (err, vm, info) {
+ {
+ warn(("Error in " + info + ": \"" + (err.toString()) + "\""), vm);
+ }
+ /* istanbul ignore else */
+ if ((inBrowser || inWeex) && typeof console !== 'undefined') {
+ console.error(err);
+ } else {
+ throw err
+ }
+}
+
+/* */
+
+var isUsingMicroTask = false;
+
+var callbacks = [];
+var pending = false;
+
+function flushCallbacks () {
+ pending = false;
+ var copies = callbacks.slice(0);
+ callbacks.length = 0;
+ for (var i = 0; i < copies.length; i++) {
+ copies[i]();
+ }
+}
+
+// Here we have async deferring wrappers using microtasks.
+// In 2.5 we used (macro) tasks (in combination with microtasks).
+// However, it has subtle problems when state is changed right before repaint
+// (e.g. #6813, out-in transitions).
+// Also, using (macro) tasks in event handler would cause some weird behaviors
+// that cannot be circumvented (e.g. #7109, #7153, #7546, #7834, #8109).
+// So we now use microtasks everywhere, again.
+// A major drawback of this tradeoff is that there are some scenarios
+// where microtasks have too high a priority and fire in between supposedly
+// sequential events (e.g. #4521, #6690, which have workarounds)
+// or even between bubbling of the same event (#6566).
+var timerFunc;
+
+// The nextTick behavior leverages the microtask queue, which can be accessed
+// via either native Promise.then or MutationObserver.
+// MutationObserver has wider support, however it is seriously bugged in
+// UIWebView in iOS >= 9.3.3 when triggered in touch event handlers. It
+// completely stops working after triggering a few times... so, if native
+// Promise is available, we will use it:
+/* istanbul ignore next, $flow-disable-line */
+if (typeof Promise !== 'undefined' && isNative(Promise)) {
+ var p = Promise.resolve();
+ timerFunc = function () {
+ p.then(flushCallbacks);
+ // In problematic UIWebViews, Promise.then doesn't completely break, but
+ // it can get stuck in a weird state where callbacks are pushed into the
+ // microtask queue but the queue isn't being flushed, until the browser
+ // needs to do some other work, e.g. handle a timer. Therefore we can
+ // "force" the microtask queue to be flushed by adding an empty timer.
+ if (isIOS) { setTimeout(noop); }
+ };
+ isUsingMicroTask = true;
+} else if (!isIE && typeof MutationObserver !== 'undefined' && (
+ isNative(MutationObserver) ||
+ // PhantomJS and iOS 7.x
+ MutationObserver.toString() === '[object MutationObserverConstructor]'
+)) {
+ // Use MutationObserver where native Promise is not available,
+ // e.g. PhantomJS, iOS7, Android 4.4
+ // (#6466 MutationObserver is unreliable in IE11)
+ var counter = 1;
+ var observer = new MutationObserver(flushCallbacks);
+ var textNode = document.createTextNode(String(counter));
+ observer.observe(textNode, {
+ characterData: true
+ });
+ timerFunc = function () {
+ counter = (counter + 1) % 2;
+ textNode.data = String(counter);
+ };
+ isUsingMicroTask = true;
+} else if (typeof setImmediate !== 'undefined' && isNative(setImmediate)) {
+ // Fallback to setImmediate.
+ // Techinically it leverages the (macro) task queue,
+ // but it is still a better choice than setTimeout.
+ timerFunc = function () {
+ setImmediate(flushCallbacks);
+ };
+} else {
+ // Fallback to setTimeout.
+ timerFunc = function () {
+ setTimeout(flushCallbacks, 0);
+ };
+}
+
+function nextTick (cb, ctx) {
+ var _resolve;
+ callbacks.push(function () {
+ if (cb) {
+ try {
+ cb.call(ctx);
+ } catch (e) {
+ handleError(e, ctx, 'nextTick');
+ }
+ } else if (_resolve) {
+ _resolve(ctx);
+ }
+ });
+ if (!pending) {
+ pending = true;
+ timerFunc();
+ }
+ // $flow-disable-line
+ if (!cb && typeof Promise !== 'undefined') {
+ return new Promise(function (resolve) {
+ _resolve = resolve;
+ })
+ }
+}
+
+/* */
+
+var mark;
+var measure;
+
+{
+ var perf = inBrowser && window.performance;
+ /* istanbul ignore if */
+ if (
+ perf &&
+ perf.mark &&
+ perf.measure &&
+ perf.clearMarks &&
+ perf.clearMeasures
+ ) {
+ mark = function (tag) { return perf.mark(tag); };
+ measure = function (name, startTag, endTag) {
+ perf.measure(name, startTag, endTag);
+ perf.clearMarks(startTag);
+ perf.clearMarks(endTag);
+ // perf.clearMeasures(name)
+ };
+ }
+}
+
+/* not type checking this file because flow doesn't play well with Proxy */
+
+var initProxy;
+
+{
+ var allowedGlobals = makeMap(
+ 'Infinity,undefined,NaN,isFinite,isNaN,' +
+ 'parseFloat,parseInt,decodeURI,decodeURIComponent,encodeURI,encodeURIComponent,' +
+ 'Math,Number,Date,Array,Object,Boolean,String,RegExp,Map,Set,JSON,Intl,' +
+ 'require' // for Webpack/Browserify
+ );
+
+ var warnNonPresent = function (target, key) {
+ warn(
+ "Property or method \"" + key + "\" is not defined on the instance but " +
+ 'referenced during render. Make sure that this property is reactive, ' +
+ 'either in the data option, or for class-based components, by ' +
+ 'initializing the property. ' +
+ 'See: https://vuejs.org/v2/guide/reactivity.html#Declaring-Reactive-Properties.',
+ target
+ );
+ };
+
+ var warnReservedPrefix = function (target, key) {
+ warn(
+ "Property \"" + key + "\" must be accessed with \"$data." + key + "\" because " +
+ 'properties starting with "$" or "_" are not proxied in the Vue instance to ' +
+ 'prevent conflicts with Vue internals' +
+ 'See: https://vuejs.org/v2/api/#data',
+ target
+ );
+ };
+
+ var hasProxy =
+ typeof Proxy !== 'undefined' && isNative(Proxy);
+
+ if (hasProxy) {
+ var isBuiltInModifier = makeMap('stop,prevent,self,ctrl,shift,alt,meta,exact');
+ config.keyCodes = new Proxy(config.keyCodes, {
+ set: function set (target, key, value) {
+ if (isBuiltInModifier(key)) {
+ warn(("Avoid overwriting built-in modifier in config.keyCodes: ." + key));
+ return false
+ } else {
+ target[key] = value;
+ return true
+ }
+ }
+ });
+ }
+
+ var hasHandler = {
+ has: function has (target, key) {
+ var has = key in target;
+ var isAllowed = allowedGlobals(key) ||
+ (typeof key === 'string' && key.charAt(0) === '_' && !(key in target.$data));
+ if (!has && !isAllowed) {
+ if (key in target.$data) { warnReservedPrefix(target, key); }
+ else { warnNonPresent(target, key); }
+ }
+ return has || !isAllowed
+ }
+ };
+
+ var getHandler = {
+ get: function get (target, key) {
+ if (typeof key === 'string' && !(key in target)) {
+ if (key in target.$data) { warnReservedPrefix(target, key); }
+ else { warnNonPresent(target, key); }
+ }
+ return target[key]
+ }
+ };
+
+ initProxy = function initProxy (vm) {
+ if (hasProxy) {
+ // determine which proxy handler to use
+ var options = vm.$options;
+ var handlers = options.render && options.render._withStripped
+ ? getHandler
+ : hasHandler;
+ vm._renderProxy = new Proxy(vm, handlers);
+ } else {
+ vm._renderProxy = vm;
+ }
+ };
+}
+
+/* */
+
+var seenObjects = new _Set();
+
+/**
+ * Recursively traverse an object to evoke all converted
+ * getters, so that every nested property inside the object
+ * is collected as a "deep" dependency.
+ */
+function traverse (val) {
+ _traverse(val, seenObjects);
+ seenObjects.clear();
+}
+
+function _traverse (val, seen) {
+ var i, keys;
+ var isA = Array.isArray(val);
+ if ((!isA && !isObject(val)) || Object.isFrozen(val) || val instanceof VNode) {
+ return
+ }
+ if (val.__ob__) {
+ var depId = val.__ob__.dep.id;
+ if (seen.has(depId)) {
+ return
+ }
+ seen.add(depId);
+ }
+ if (isA) {
+ i = val.length;
+ while (i--) { _traverse(val[i], seen); }
+ } else {
+ keys = Object.keys(val);
+ i = keys.length;
+ while (i--) { _traverse(val[keys[i]], seen); }
+ }
+}
+
+/* */
+
+var normalizeEvent = cached(function (name) {
+ var passive = name.charAt(0) === '&';
+ name = passive ? name.slice(1) : name;
+ var once$$1 = name.charAt(0) === '~'; // Prefixed last, checked first
+ name = once$$1 ? name.slice(1) : name;
+ var capture = name.charAt(0) === '!';
+ name = capture ? name.slice(1) : name;
+ return {
+ name: name,
+ once: once$$1,
+ capture: capture,
+ passive: passive
+ }
+});
+
+function createFnInvoker (fns, vm) {
+ function invoker () {
+ var arguments$1 = arguments;
+
+ var fns = invoker.fns;
+ if (Array.isArray(fns)) {
+ var cloned = fns.slice();
+ for (var i = 0; i < cloned.length; i++) {
+ invokeWithErrorHandling(cloned[i], null, arguments$1, vm, "v-on handler");
+ }
+ } else {
+ // return handler return value for single handlers
+ return invokeWithErrorHandling(fns, null, arguments, vm, "v-on handler")
+ }
+ }
+ invoker.fns = fns;
+ return invoker
+}
+
+function updateListeners (
+ on,
+ oldOn,
+ add,
+ remove$$1,
+ createOnceHandler,
+ vm
+) {
+ var name, def$$1, cur, old, event;
+ for (name in on) {
+ def$$1 = cur = on[name];
+ old = oldOn[name];
+ event = normalizeEvent(name);
+ if (isUndef(cur)) {
+ warn(
+ "Invalid handler for event \"" + (event.name) + "\": got " + String(cur),
+ vm
+ );
+ } else if (isUndef(old)) {
+ if (isUndef(cur.fns)) {
+ cur = on[name] = createFnInvoker(cur, vm);
+ }
+ if (isTrue(event.once)) {
+ cur = on[name] = createOnceHandler(event.name, cur, event.capture);
+ }
+ add(event.name, cur, event.capture, event.passive, event.params);
+ } else if (cur !== old) {
+ old.fns = cur;
+ on[name] = old;
+ }
+ }
+ for (name in oldOn) {
+ if (isUndef(on[name])) {
+ event = normalizeEvent(name);
+ remove$$1(event.name, oldOn[name], event.capture);
+ }
+ }
+}
+
+/* */
+
+function mergeVNodeHook (def, hookKey, hook) {
+ if (def instanceof VNode) {
+ def = def.data.hook || (def.data.hook = {});
+ }
+ var invoker;
+ var oldHook = def[hookKey];
+
+ function wrappedHook () {
+ hook.apply(this, arguments);
+ // important: remove merged hook to ensure it's called only once
+ // and prevent memory leak
+ remove(invoker.fns, wrappedHook);
+ }
+
+ if (isUndef(oldHook)) {
+ // no existing hook
+ invoker = createFnInvoker([wrappedHook]);
+ } else {
+ /* istanbul ignore if */
+ if (isDef(oldHook.fns) && isTrue(oldHook.merged)) {
+ // already a merged invoker
+ invoker = oldHook;
+ invoker.fns.push(wrappedHook);
+ } else {
+ // existing plain hook
+ invoker = createFnInvoker([oldHook, wrappedHook]);
+ }
+ }
+
+ invoker.merged = true;
+ def[hookKey] = invoker;
+}
+
+/* */
+
+function extractPropsFromVNodeData (
+ data,
+ Ctor,
+ tag
+) {
+ // we are only extracting raw values here.
+ // validation and default values are handled in the child
+ // component itself.
+ var propOptions = Ctor.options.props;
+ if (isUndef(propOptions)) {
+ return
+ }
+ var res = {};
+ var attrs = data.attrs;
+ var props = data.props;
+ if (isDef(attrs) || isDef(props)) {
+ for (var key in propOptions) {
+ var altKey = hyphenate(key);
+ {
+ var keyInLowerCase = key.toLowerCase();
+ if (
+ key !== keyInLowerCase &&
+ attrs && hasOwn(attrs, keyInLowerCase)
+ ) {
+ tip(
+ "Prop \"" + keyInLowerCase + "\" is passed to component " +
+ (formatComponentName(tag || Ctor)) + ", but the declared prop name is" +
+ " \"" + key + "\". " +
+ "Note that HTML attributes are case-insensitive and camelCased " +
+ "props need to use their kebab-case equivalents when using in-DOM " +
+ "templates. You should probably use \"" + altKey + "\" instead of \"" + key + "\"."
+ );
+ }
+ }
+ checkProp(res, props, key, altKey, true) ||
+ checkProp(res, attrs, key, altKey, false);
+ }
+ }
+ return res
+}
+
+function checkProp (
+ res,
+ hash,
+ key,
+ altKey,
+ preserve
+) {
+ if (isDef(hash)) {
+ if (hasOwn(hash, key)) {
+ res[key] = hash[key];
+ if (!preserve) {
+ delete hash[key];
+ }
+ return true
+ } else if (hasOwn(hash, altKey)) {
+ res[key] = hash[altKey];
+ if (!preserve) {
+ delete hash[altKey];
+ }
+ return true
+ }
+ }
+ return false
+}
+
+/* */
+
+// The template compiler attempts to minimize the need for normalization by
+// statically analyzing the template at compile time.
+//
+// For plain HTML markup, normalization can be completely skipped because the
+// generated render function is guaranteed to return Array<VNode>. There are
+// two cases where extra normalization is needed:
+
+// 1. When the children contains components - because a functional component
+// may return an Array instead of a single root. In this case, just a simple
+// normalization is needed - if any child is an Array, we flatten the whole
+// thing with Array.prototype.concat. It is guaranteed to be only 1-level deep
+// because functional components already normalize their own children.
+function simpleNormalizeChildren (children) {
+ for (var i = 0; i < children.length; i++) {
+ if (Array.isArray(children[i])) {
+ return Array.prototype.concat.apply([], children)
+ }
+ }
+ return children
+}
+
+// 2. When the children contains constructs that always generated nested Arrays,
+// e.g. <template>, <slot>, v-for, or when the children is provided by user
+// with hand-written render functions / JSX. In such cases a full normalization
+// is needed to cater to all possible types of children values.
+function normalizeChildren (children) {
+ return isPrimitive(children)
+ ? [createTextVNode(children)]
+ : Array.isArray(children)
+ ? normalizeArrayChildren(children)
+ : undefined
+}
+
+function isTextNode (node) {
+ return isDef(node) && isDef(node.text) && isFalse(node.isComment)
+}
+
+function normalizeArrayChildren (children, nestedIndex) {
+ var res = [];
+ var i, c, lastIndex, last;
+ for (i = 0; i < children.length; i++) {
+ c = children[i];
+ if (isUndef(c) || typeof c === 'boolean') { continue }
+ lastIndex = res.length - 1;
+ last = res[lastIndex];
+ // nested
+ if (Array.isArray(c)) {
+ if (c.length > 0) {
+ c = normalizeArrayChildren(c, ((nestedIndex || '') + "_" + i));
+ // merge adjacent text nodes
+ if (isTextNode(c[0]) && isTextNode(last)) {
+ res[lastIndex] = createTextVNode(last.text + (c[0]).text);
+ c.shift();
+ }
+ res.push.apply(res, c);
+ }
+ } else if (isPrimitive(c)) {
+ if (isTextNode(last)) {
+ // merge adjacent text nodes
+ // this is necessary for SSR hydration because text nodes are
+ // essentially merged when rendered to HTML strings
+ res[lastIndex] = createTextVNode(last.text + c);
+ } else if (c !== '') {
+ // convert primitive to vnode
+ res.push(createTextVNode(c));
+ }
+ } else {
+ if (isTextNode(c) && isTextNode(last)) {
+ // merge adjacent text nodes
+ res[lastIndex] = createTextVNode(last.text + c.text);
+ } else {
+ // default key for nested array children (likely generated by v-for)
+ if (isTrue(children._isVList) &&
+ isDef(c.tag) &&
+ isUndef(c.key) &&
+ isDef(nestedIndex)) {
+ c.key = "__vlist" + nestedIndex + "_" + i + "__";
+ }
+ res.push(c);
+ }
+ }
+ }
+ return res
+}
+
+/* */
+
+function initProvide (vm) {
+ var provide = vm.$options.provide;
+ if (provide) {
+ vm._provided = typeof provide === 'function'
+ ? provide.call(vm)
+ : provide;
+ }
+}
+
+function initInjections (vm) {
+ var result = resolveInject(vm.$options.inject, vm);
+ if (result) {
+ toggleObserving(false);
+ Object.keys(result).forEach(function (key) {
+ /* istanbul ignore else */
+ {
+ defineReactive$$1(vm, key, result[key], function () {
+ warn(
+ "Avoid mutating an injected value directly since the changes will be " +
+ "overwritten whenever the provided component re-renders. " +
+ "injection being mutated: \"" + key + "\"",
+ vm
+ );
+ });
+ }
+ });
+ toggleObserving(true);
+ }
+}
+
+function resolveInject (inject, vm) {
+ if (inject) {
+ // inject is :any because flow is not smart enough to figure out cached
+ var result = Object.create(null);
+ var keys = hasSymbol
+ ? Reflect.ownKeys(inject)
+ : Object.keys(inject);
+
+ for (var i = 0; i < keys.length; i++) {
+ var key = keys[i];
+ // #6574 in case the inject object is observed...
+ if (key === '__ob__') { continue }
+ var provideKey = inject[key].from;
+ var source = vm;
+ while (source) {
+ if (source._provided && hasOwn(source._provided, provideKey)) {
+ result[key] = source._provided[provideKey];
+ break
+ }
+ source = source.$parent;
+ }
+ if (!source) {
+ if ('default' in inject[key]) {
+ var provideDefault = inject[key].default;
+ result[key] = typeof provideDefault === 'function'
+ ? provideDefault.call(vm)
+ : provideDefault;
+ } else {
+ warn(("Injection \"" + key + "\" not found"), vm);
+ }
+ }
+ }
+ return result
+ }
+}
+
+/* */
+
+
+
+/**
+ * Runtime helper for resolving raw children VNodes into a slot object.
+ */
+function resolveSlots (
+ children,
+ context
+) {
+ if (!children || !children.length) {
+ return {}
+ }
+ var slots = {};
+ for (var i = 0, l = children.length; i < l; i++) {
+ var child = children[i];
+ var data = child.data;
+ // remove slot attribute if the node is resolved as a Vue slot node
+ if (data && data.attrs && data.attrs.slot) {
+ delete data.attrs.slot;
+ }
+ // named slots should only be respected if the vnode was rendered in the
+ // same context.
+ if ((child.context === context || child.fnContext === context) &&
+ data && data.slot != null
+ ) {
+ var name = data.slot;
+ var slot = (slots[name] || (slots[name] = []));
+ if (child.tag === 'template') {
+ slot.push.apply(slot, child.children || []);
+ } else {
+ slot.push(child);
+ }
+ } else {
+ (slots.default || (slots.default = [])).push(child);
+ }
+ }
+ // ignore slots that contains only whitespace
+ for (var name$1 in slots) {
+ if (slots[name$1].every(isWhitespace)) {
+ delete slots[name$1];
+ }
+ }
+ return slots
+}
+
+function isWhitespace (node) {
+ return (node.isComment && !node.asyncFactory) || node.text === ' '
+}
+
+/* */
+
+function normalizeScopedSlots (
+ slots,
+ normalSlots,
+ prevSlots
+) {
+ var res;
+ var hasNormalSlots = Object.keys(normalSlots).length > 0;
+ var isStable = slots ? !!slots.$stable : !hasNormalSlots;
+ var key = slots && slots.$key;
+ if (!slots) {
+ res = {};
+ } else if (slots._normalized) {
+ // fast path 1: child component re-render only, parent did not change
+ return slots._normalized
+ } else if (
+ isStable &&
+ prevSlots &&
+ prevSlots !== emptyObject &&
+ key === prevSlots.$key &&
+ !hasNormalSlots &&
+ !prevSlots.$hasNormal
+ ) {
+ // fast path 2: stable scoped slots w/ no normal slots to proxy,
+ // only need to normalize once
+ return prevSlots
+ } else {
+ res = {};
+ for (var key$1 in slots) {
+ if (slots[key$1] && key$1[0] !== '$') {
+ res[key$1] = normalizeScopedSlot(normalSlots, key$1, slots[key$1]);
+ }
+ }
+ }
+ // expose normal slots on scopedSlots
+ for (var key$2 in normalSlots) {
+ if (!(key$2 in res)) {
+ res[key$2] = proxyNormalSlot(normalSlots, key$2);
+ }
+ }
+ // avoriaz seems to mock a non-extensible $scopedSlots object
+ // and when that is passed down this would cause an error
+ if (slots && Object.isExtensible(slots)) {
+ (slots)._normalized = res;
+ }
+ def(res, '$stable', isStable);
+ def(res, '$key', key);
+ def(res, '$hasNormal', hasNormalSlots);
+ return res
+}
+
+function normalizeScopedSlot(normalSlots, key, fn) {
+ var normalized = function () {
+ var res = arguments.length ? fn.apply(null, arguments) : fn({});
+ res = res && typeof res === 'object' && !Array.isArray(res)
+ ? [res] // single vnode
+ : normalizeChildren(res);
+ return res && (
+ res.length === 0 ||
+ (res.length === 1 && res[0].isComment) // #9658
+ ) ? undefined
+ : res
+ };
+ // this is a slot using the new v-slot syntax without scope. although it is
+ // compiled as a scoped slot, render fn users would expect it to be present
+ // on this.$slots because the usage is semantically a normal slot.
+ if (fn.proxy) {
+ Object.defineProperty(normalSlots, key, {
+ get: normalized,
+ enumerable: true,
+ configurable: true
+ });
+ }
+ return normalized
+}
+
+function proxyNormalSlot(slots, key) {
+ return function () { return slots[key]; }
+}
+
+/* */
+
+/**
+ * Runtime helper for rendering v-for lists.
+ */
+function renderList (
+ val,
+ render
+) {
+ var ret, i, l, keys, key;
+ if (Array.isArray(val) || typeof val === 'string') {
+ ret = new Array(val.length);
+ for (i = 0, l = val.length; i < l; i++) {
+ ret[i] = render(val[i], i);
+ }
+ } else if (typeof val === 'number') {
+ ret = new Array(val);
+ for (i = 0; i < val; i++) {
+ ret[i] = render(i + 1, i);
+ }
+ } else if (isObject(val)) {
+ if (hasSymbol && val[Symbol.iterator]) {
+ ret = [];
+ var iterator = val[Symbol.iterator]();
+ var result = iterator.next();
+ while (!result.done) {
+ ret.push(render(result.value, ret.length));
+ result = iterator.next();
+ }
+ } else {
+ keys = Object.keys(val);
+ ret = new Array(keys.length);
+ for (i = 0, l = keys.length; i < l; i++) {
+ key = keys[i];
+ ret[i] = render(val[key], key, i);
+ }
+ }
+ }
+ if (!isDef(ret)) {
+ ret = [];
+ }
+ (ret)._isVList = true;
+ return ret
+}
+
+/* */
+
+/**
+ * Runtime helper for rendering <slot>
+ */
+function renderSlot (
+ name,
+ fallback,
+ props,
+ bindObject
+) {
+ var scopedSlotFn = this.$scopedSlots[name];
+ var nodes;
+ if (scopedSlotFn) { // scoped slot
+ props = props || {};
+ if (bindObject) {
+ if (!isObject(bindObject)) {
+ warn(
+ 'slot v-bind without argument expects an Object',
+ this
+ );
+ }
+ props = extend(extend({}, bindObject), props);
+ }
+ nodes = scopedSlotFn(props) || fallback;
+ } else {
+ nodes = this.$slots[name] || fallback;
+ }
+
+ var target = props && props.slot;
+ if (target) {
+ return this.$createElement('template', { slot: target }, nodes)
+ } else {
+ return nodes
+ }
+}
+
+/* */
+
+/**
+ * Runtime helper for resolving filters
+ */
+function resolveFilter (id) {
+ return resolveAsset(this.$options, 'filters', id, true) || identity
+}
+
+/* */
+
+function isKeyNotMatch (expect, actual) {
+ if (Array.isArray(expect)) {
+ return expect.indexOf(actual) === -1
+ } else {
+ return expect !== actual
+ }
+}
+
+/**
+ * Runtime helper for checking keyCodes from config.
+ * exposed as Vue.prototype._k
+ * passing in eventKeyName as last argument separately for backwards compat
+ */
+function checkKeyCodes (
+ eventKeyCode,
+ key,
+ builtInKeyCode,
+ eventKeyName,
+ builtInKeyName
+) {
+ var mappedKeyCode = config.keyCodes[key] || builtInKeyCode;
+ if (builtInKeyName && eventKeyName && !config.keyCodes[key]) {
+ return isKeyNotMatch(builtInKeyName, eventKeyName)
+ } else if (mappedKeyCode) {
+ return isKeyNotMatch(mappedKeyCode, eventKeyCode)
+ } else if (eventKeyName) {
+ return hyphenate(eventKeyName) !== key
+ }
+}
+
+/* */
+
+/**
+ * Runtime helper for merging v-bind="object" into a VNode's data.
+ */
+function bindObjectProps (
+ data,
+ tag,
+ value,
+ asProp,
+ isSync
+) {
+ if (value) {
+ if (!isObject(value)) {
+ warn(
+ 'v-bind without argument expects an Object or Array value',
+ this
+ );
+ } else {
+ if (Array.isArray(value)) {
+ value = toObject(value);
+ }
+ var hash;
+ var loop = function ( key ) {
+ if (
+ key === 'class' ||
+ key === 'style' ||
+ isReservedAttribute(key)
+ ) {
+ hash = data;
+ } else {
+ var type = data.attrs && data.attrs.type;
+ hash = asProp || config.mustUseProp(tag, type, key)
+ ? data.domProps || (data.domProps = {})
+ : data.attrs || (data.attrs = {});
+ }
+ var camelizedKey = camelize(key);
+ var hyphenatedKey = hyphenate(key);
+ if (!(camelizedKey in hash) && !(hyphenatedKey in hash)) {
+ hash[key] = value[key];
+
+ if (isSync) {
+ var on = data.on || (data.on = {});
+ on[("update:" + key)] = function ($event) {
+ value[key] = $event;
+ };
+ }
+ }
+ };
+
+ for (var key in value) loop( key );
+ }
+ }
+ return data
+}
+
+/* */
+
+/**
+ * Runtime helper for rendering static trees.
+ */
+function renderStatic (
+ index,
+ isInFor
+) {
+ var cached = this._staticTrees || (this._staticTrees = []);
+ var tree = cached[index];
+ // if has already-rendered static tree and not inside v-for,
+ // we can reuse the same tree.
+ if (tree && !isInFor) {
+ return tree
+ }
+ // otherwise, render a fresh tree.
+ tree = cached[index] = this.$options.staticRenderFns[index].call(
+ this._renderProxy,
+ null,
+ this // for render fns generated for functional component templates
+ );
+ markStatic(tree, ("__static__" + index), false);
+ return tree
+}
+
+/**
+ * Runtime helper for v-once.
+ * Effectively it means marking the node as static with a unique key.
+ */
+function markOnce (
+ tree,
+ index,
+ key
+) {
+ markStatic(tree, ("__once__" + index + (key ? ("_" + key) : "")), true);
+ return tree
+}
+
+function markStatic (
+ tree,
+ key,
+ isOnce
+) {
+ if (Array.isArray(tree)) {
+ for (var i = 0; i < tree.length; i++) {
+ if (tree[i] && typeof tree[i] !== 'string') {
+ markStaticNode(tree[i], (key + "_" + i), isOnce);
+ }
+ }
+ } else {
+ markStaticNode(tree, key, isOnce);
+ }
+}
+
+function markStaticNode (node, key, isOnce) {
+ node.isStatic = true;
+ node.key = key;
+ node.isOnce = isOnce;
+}
+
+/* */
+
+function bindObjectListeners (data, value) {
+ if (value) {
+ if (!isPlainObject(value)) {
+ warn(
+ 'v-on without argument expects an Object value',
+ this
+ );
+ } else {
+ var on = data.on = data.on ? extend({}, data.on) : {};
+ for (var key in value) {
+ var existing = on[key];
+ var ours = value[key];
+ on[key] = existing ? [].concat(existing, ours) : ours;
+ }
+ }
+ }
+ return data
+}
+
+/* */
+
+function resolveScopedSlots (
+ fns, // see flow/vnode
+ res,
+ // the following are added in 2.6
+ hasDynamicKeys,
+ contentHashKey
+) {
+ res = res || { $stable: !hasDynamicKeys };
+ for (var i = 0; i < fns.length; i++) {
+ var slot = fns[i];
+ if (Array.isArray(slot)) {
+ resolveScopedSlots(slot, res, hasDynamicKeys);
+ } else if (slot) {
+ // marker for reverse proxying v-slot without scope on this.$slots
+ if (slot.proxy) {
+ slot.fn.proxy = true;
+ }
+ res[slot.key] = slot.fn;
+ }
+ }
+ if (contentHashKey) {
+ (res).$key = contentHashKey;
+ }
+ return res
+}
+
+/* */
+
+function bindDynamicKeys (baseObj, values) {
+ for (var i = 0; i < values.length; i += 2) {
+ var key = values[i];
+ if (typeof key === 'string' && key) {
+ baseObj[values[i]] = values[i + 1];
+ } else if (key !== '' && key !== null) {
+ // null is a speical value for explicitly removing a binding
+ warn(
+ ("Invalid value for dynamic directive argument (expected string or null): " + key),
+ this
+ );
+ }
+ }
+ return baseObj
+}
+
+// helper to dynamically append modifier runtime markers to event names.
+// ensure only append when value is already string, otherwise it will be cast
+// to string and cause the type check to miss.
+function prependModifier (value, symbol) {
+ return typeof value === 'string' ? symbol + value : value
+}
+
+/* */
+
+function installRenderHelpers (target) {
+ target._o = markOnce;
+ target._n = toNumber;
+ target._s = toString;
+ target._l = renderList;
+ target._t = renderSlot;
+ target._q = looseEqual;
+ target._i = looseIndexOf;
+ target._m = renderStatic;
+ target._f = resolveFilter;
+ target._k = checkKeyCodes;
+ target._b = bindObjectProps;
+ target._v = createTextVNode;
+ target._e = createEmptyVNode;
+ target._u = resolveScopedSlots;
+ target._g = bindObjectListeners;
+ target._d = bindDynamicKeys;
+ target._p = prependModifier;
+}
+
+/* */
+
+function FunctionalRenderContext (
+ data,
+ props,
+ children,
+ parent,
+ Ctor
+) {
+ var this$1 = this;
+
+ var options = Ctor.options;
+ // ensure the createElement function in functional components
+ // gets a unique context - this is necessary for correct named slot check
+ var contextVm;
+ if (hasOwn(parent, '_uid')) {
+ contextVm = Object.create(parent);
+ // $flow-disable-line
+ contextVm._original = parent;
+ } else {
+ // the context vm passed in is a functional context as well.
+ // in this case we want to make sure we are able to get a hold to the
+ // real context instance.
+ contextVm = parent;
+ // $flow-disable-line
+ parent = parent._original;
+ }
+ var isCompiled = isTrue(options._compiled);
+ var needNormalization = !isCompiled;
+
+ this.data = data;
+ this.props = props;
+ this.children = children;
+ this.parent = parent;
+ this.listeners = data.on || emptyObject;
+ this.injections = resolveInject(options.inject, parent);
+ this.slots = function () {
+ if (!this$1.$slots) {
+ normalizeScopedSlots(
+ data.scopedSlots,
+ this$1.$slots = resolveSlots(children, parent)
+ );
+ }
+ return this$1.$slots
+ };
+
+ Object.defineProperty(this, 'scopedSlots', ({
+ enumerable: true,
+ get: function get () {
+ return normalizeScopedSlots(data.scopedSlots, this.slots())
+ }
+ }));
+
+ // support for compiled functional template
+ if (isCompiled) {
+ // exposing $options for renderStatic()
+ this.$options = options;
+ // pre-resolve slots for renderSlot()
+ this.$slots = this.slots();
+ this.$scopedSlots = normalizeScopedSlots(data.scopedSlots, this.$slots);
+ }
+
+ if (options._scopeId) {
+ this._c = function (a, b, c, d) {
+ var vnode = createElement(contextVm, a, b, c, d, needNormalization);
+ if (vnode && !Array.isArray(vnode)) {
+ vnode.fnScopeId = options._scopeId;
+ vnode.fnContext = parent;
+ }
+ return vnode
+ };
+ } else {
+ this._c = function (a, b, c, d) { return createElement(contextVm, a, b, c, d, needNormalization); };
+ }
+}
+
+installRenderHelpers(FunctionalRenderContext.prototype);
+
+function createFunctionalComponent (
+ Ctor,
+ propsData,
+ data,
+ contextVm,
+ children
+) {
+ var options = Ctor.options;
+ var props = {};
+ var propOptions = options.props;
+ if (isDef(propOptions)) {
+ for (var key in propOptions) {
+ props[key] = validateProp(key, propOptions, propsData || emptyObject);
+ }
+ } else {
+ if (isDef(data.attrs)) { mergeProps(props, data.attrs); }
+ if (isDef(data.props)) { mergeProps(props, data.props); }
+ }
+
+ var renderContext = new FunctionalRenderContext(
+ data,
+ props,
+ children,
+ contextVm,
+ Ctor
+ );
+
+ var vnode = options.render.call(null, renderContext._c, renderContext);
+
+ if (vnode instanceof VNode) {
+ return cloneAndMarkFunctionalResult(vnode, data, renderContext.parent, options, renderContext)
+ } else if (Array.isArray(vnode)) {
+ var vnodes = normalizeChildren(vnode) || [];
+ var res = new Array(vnodes.length);
+ for (var i = 0; i < vnodes.length; i++) {
+ res[i] = cloneAndMarkFunctionalResult(vnodes[i], data, renderContext.parent, options, renderContext);
+ }
+ return res
+ }
+}
+
+function cloneAndMarkFunctionalResult (vnode, data, contextVm, options, renderContext) {
+ // #7817 clone node before setting fnContext, otherwise if the node is reused
+ // (e.g. it was from a cached normal slot) the fnContext causes named slots
+ // that should not be matched to match.
+ var clone = cloneVNode(vnode);
+ clone.fnContext = contextVm;
+ clone.fnOptions = options;
+ {
+ (clone.devtoolsMeta = clone.devtoolsMeta || {}).renderContext = renderContext;
+ }
+ if (data.slot) {
+ (clone.data || (clone.data = {})).slot = data.slot;
+ }
+ return clone
+}
+
+function mergeProps (to, from) {
+ for (var key in from) {
+ to[camelize(key)] = from[key];
+ }
+}
+
+/* */
+
+/* */
+
+/* */
+
+/* */
+
+// inline hooks to be invoked on component VNodes during patch
+var componentVNodeHooks = {
+ init: function init (vnode, hydrating) {
+ if (
+ vnode.componentInstance &&
+ !vnode.componentInstance._isDestroyed &&
+ vnode.data.keepAlive
+ ) {
+ // kept-alive components, treat as a patch
+ var mountedNode = vnode; // work around flow
+ componentVNodeHooks.prepatch(mountedNode, mountedNode);
+ } else {
+ var child = vnode.componentInstance = createComponentInstanceForVnode(
+ vnode,
+ activeInstance
+ );
+ child.$mount(hydrating ? vnode.elm : undefined, hydrating);
+ }
+ },
+
+ prepatch: function prepatch (oldVnode, vnode) {
+ var options = vnode.componentOptions;
+ var child = vnode.componentInstance = oldVnode.componentInstance;
+ updateChildComponent(
+ child,
+ options.propsData, // updated props
+ options.listeners, // updated listeners
+ vnode, // new parent vnode
+ options.children // new children
+ );
+ },
+
+ insert: function insert (vnode) {
+ var context = vnode.context;
+ var componentInstance = vnode.componentInstance;
+ if (!componentInstance._isMounted) {
+ componentInstance._isMounted = true;
+ callHook(componentInstance, 'mounted');
+ }
+ if (vnode.data.keepAlive) {
+ if (context._isMounted) {
+ // vue-router#1212
+ // During updates, a kept-alive component's child components may
+ // change, so directly walking the tree here may call activated hooks
+ // on incorrect children. Instead we push them into a queue which will
+ // be processed after the whole patch process ended.
+ queueActivatedComponent(componentInstance);
+ } else {
+ activateChildComponent(componentInstance, true /* direct */);
+ }
+ }
+ },
+
+ destroy: function destroy (vnode) {
+ var componentInstance = vnode.componentInstance;
+ if (!componentInstance._isDestroyed) {
+ if (!vnode.data.keepAlive) {
+ componentInstance.$destroy();
+ } else {
+ deactivateChildComponent(componentInstance, true /* direct */);
+ }
+ }
+ }
+};
+
+var hooksToMerge = Object.keys(componentVNodeHooks);
+
+function createComponent (
+ Ctor,
+ data,
+ context,
+ children,
+ tag
+) {
+ if (isUndef(Ctor)) {
+ return
+ }
+
+ var baseCtor = context.$options._base;
+
+ // plain options object: turn it into a constructor
+ if (isObject(Ctor)) {
+ Ctor = baseCtor.extend(Ctor);
+ }
+
+ // if at this stage it's not a constructor or an async component factory,
+ // reject.
+ if (typeof Ctor !== 'function') {
+ {
+ warn(("Invalid Component definition: " + (String(Ctor))), context);
+ }
+ return
+ }
+
+ // async component
+ var asyncFactory;
+ if (isUndef(Ctor.cid)) {
+ asyncFactory = Ctor;
+ Ctor = resolveAsyncComponent(asyncFactory, baseCtor);
+ if (Ctor === undefined) {
+ // return a placeholder node for async component, which is rendered
+ // as a comment node but preserves all the raw information for the node.
+ // the information will be used for async server-rendering and hydration.
+ return createAsyncPlaceholder(
+ asyncFactory,
+ data,
+ context,
+ children,
+ tag
+ )
+ }
+ }
+
+ data = data || {};
+
+ // resolve constructor options in case global mixins are applied after
+ // component constructor creation
+ resolveConstructorOptions(Ctor);
+
+ // transform component v-model data into props & events
+ if (isDef(data.model)) {
+ transformModel(Ctor.options, data);
+ }
+
+ // extract props
+ var propsData = extractPropsFromVNodeData(data, Ctor, tag);
+
+ // functional component
+ if (isTrue(Ctor.options.functional)) {
+ return createFunctionalComponent(Ctor, propsData, data, context, children)
+ }
+
+ // extract listeners, since these needs to be treated as
+ // child component listeners instead of DOM listeners
+ var listeners = data.on;
+ // replace with listeners with .native modifier
+ // so it gets processed during parent component patch.
+ data.on = data.nativeOn;
+
+ if (isTrue(Ctor.options.abstract)) {
+ // abstract components do not keep anything
+ // other than props & listeners & slot
+
+ // work around flow
+ var slot = data.slot;
+ data = {};
+ if (slot) {
+ data.slot = slot;
+ }
+ }
+
+ // install component management hooks onto the placeholder node
+ installComponentHooks(data);
+
+ // return a placeholder vnode
+ var name = Ctor.options.name || tag;
+ var vnode = new VNode(
+ ("vue-component-" + (Ctor.cid) + (name ? ("-" + name) : '')),
+ data, undefined, undefined, undefined, context,
+ { Ctor: Ctor, propsData: propsData, listeners: listeners, tag: tag, children: children },
+ asyncFactory
+ );
+
+ return vnode
+}
+
+function createComponentInstanceForVnode (
+ vnode, // we know it's MountedComponentVNode but flow doesn't
+ parent // activeInstance in lifecycle state
+) {
+ var options = {
+ _isComponent: true,
+ _parentVnode: vnode,
+ parent: parent
+ };
+ // check inline-template render functions
+ var inlineTemplate = vnode.data.inlineTemplate;
+ if (isDef(inlineTemplate)) {
+ options.render = inlineTemplate.render;
+ options.staticRenderFns = inlineTemplate.staticRenderFns;
+ }
+ return new vnode.componentOptions.Ctor(options)
+}
+
+function installComponentHooks (data) {
+ var hooks = data.hook || (data.hook = {});
+ for (var i = 0; i < hooksToMerge.length; i++) {
+ var key = hooksToMerge[i];
+ var existing = hooks[key];
+ var toMerge = componentVNodeHooks[key];
+ if (existing !== toMerge && !(existing && existing._merged)) {
+ hooks[key] = existing ? mergeHook$1(toMerge, existing) : toMerge;
+ }
+ }
+}
+
+function mergeHook$1 (f1, f2) {
+ var merged = function (a, b) {
+ // flow complains about extra args which is why we use any
+ f1(a, b);
+ f2(a, b);
+ };
+ merged._merged = true;
+ return merged
+}
+
+// transform component v-model info (value and callback) into
+// prop and event handler respectively.
+function transformModel (options, data) {
+ var prop = (options.model && options.model.prop) || 'value';
+ var event = (options.model && options.model.event) || 'input'
+ ;(data.attrs || (data.attrs = {}))[prop] = data.model.value;
+ var on = data.on || (data.on = {});
+ var existing = on[event];
+ var callback = data.model.callback;
+ if (isDef(existing)) {
+ if (
+ Array.isArray(existing)
+ ? existing.indexOf(callback) === -1
+ : existing !== callback
+ ) {
+ on[event] = [callback].concat(existing);
+ }
+ } else {
+ on[event] = callback;
+ }
+}
+
+/* */
+
+var SIMPLE_NORMALIZE = 1;
+var ALWAYS_NORMALIZE = 2;
+
+// wrapper function for providing a more flexible interface
+// without getting yelled at by flow
+function createElement (
+ context,
+ tag,
+ data,
+ children,
+ normalizationType,
+ alwaysNormalize
+) {
+ if (Array.isArray(data) || isPrimitive(data)) {
+ normalizationType = children;
+ children = data;
+ data = undefined;
+ }
+ if (isTrue(alwaysNormalize)) {
+ normalizationType = ALWAYS_NORMALIZE;
+ }
+ return _createElement(context, tag, data, children, normalizationType)
+}
+
+function _createElement (
+ context,
+ tag,
+ data,
+ children,
+ normalizationType
+) {
+ if (isDef(data) && isDef((data).__ob__)) {
+ warn(
+ "Avoid using observed data object as vnode data: " + (JSON.stringify(data)) + "\n" +
+ 'Always create fresh vnode data objects in each render!',
+ context
+ );
+ return createEmptyVNode()
+ }
+ // object syntax in v-bind
+ if (isDef(data) && isDef(data.is)) {
+ tag = data.is;
+ }
+ if (!tag) {
+ // in case of component :is set to falsy value
+ return createEmptyVNode()
+ }
+ // warn against non-primitive key
+ if (isDef(data) && isDef(data.key) && !isPrimitive(data.key)
+ ) {
+ {
+ warn(
+ 'Avoid using non-primitive value as key, ' +
+ 'use string/number value instead.',
+ context
+ );
+ }
+ }
+ // support single function children as default scoped slot
+ if (Array.isArray(children) &&
+ typeof children[0] === 'function'
+ ) {
+ data = data || {};
+ data.scopedSlots = { default: children[0] };
+ children.length = 0;
+ }
+ if (normalizationType === ALWAYS_NORMALIZE) {
+ children = normalizeChildren(children);
+ } else if (normalizationType === SIMPLE_NORMALIZE) {
+ children = simpleNormalizeChildren(children);
+ }
+ var vnode, ns;
+ if (typeof tag === 'string') {
+ var Ctor;
+ ns = (context.$vnode && context.$vnode.ns) || config.getTagNamespace(tag);
+ if (config.isReservedTag(tag)) {
+ // platform built-in elements
+ vnode = new VNode(
+ config.parsePlatformTagName(tag), data, children,
+ undefined, undefined, context
+ );
+ } else if ((!data || !data.pre) && isDef(Ctor = resolveAsset(context.$options, 'components', tag))) {
+ // component
+ vnode = createComponent(Ctor, data, context, children, tag);
+ } else {
+ // unknown or unlisted namespaced elements
+ // check at runtime because it may get assigned a namespace when its
+ // parent normalizes children
+ vnode = new VNode(
+ tag, data, children,
+ undefined, undefined, context
+ );
+ }
+ } else {
+ // direct component options / constructor
+ vnode = createComponent(tag, data, context, children);
+ }
+ if (Array.isArray(vnode)) {
+ return vnode
+ } else if (isDef(vnode)) {
+ if (isDef(ns)) { applyNS(vnode, ns); }
+ if (isDef(data)) { registerDeepBindings(data); }
+ return vnode
+ } else {
+ return createEmptyVNode()
+ }
+}
+
+function applyNS (vnode, ns, force) {
+ vnode.ns = ns;
+ if (vnode.tag === 'foreignObject') {
+ // use default namespace inside foreignObject
+ ns = undefined;
+ force = true;
+ }
+ if (isDef(vnode.children)) {
+ for (var i = 0, l = vnode.children.length; i < l; i++) {
+ var child = vnode.children[i];
+ if (isDef(child.tag) && (
+ isUndef(child.ns) || (isTrue(force) && child.tag !== 'svg'))) {
+ applyNS(child, ns, force);
+ }
+ }
+ }
+}
+
+// ref #5318
+// necessary to ensure parent re-render when deep bindings like :style and
+// :class are used on slot nodes
+function registerDeepBindings (data) {
+ if (isObject(data.style)) {
+ traverse(data.style);
+ }
+ if (isObject(data.class)) {
+ traverse(data.class);
+ }
+}
+
+/* */
+
+function initRender (vm) {
+ vm._vnode = null; // the root of the child tree
+ vm._staticTrees = null; // v-once cached trees
+ var options = vm.$options;
+ var parentVnode = vm.$vnode = options._parentVnode; // the placeholder node in parent tree
+ var renderContext = parentVnode && parentVnode.context;
+ vm.$slots = resolveSlots(options._renderChildren, renderContext);
+ vm.$scopedSlots = emptyObject;
+ // bind the createElement fn to this instance
+ // so that we get proper render context inside it.
+ // args order: tag, data, children, normalizationType, alwaysNormalize
+ // internal version is used by render functions compiled from templates
+ vm._c = function (a, b, c, d) { return createElement(vm, a, b, c, d, false); };
+ // normalization is always applied for the public version, used in
+ // user-written render functions.
+ vm.$createElement = function (a, b, c, d) { return createElement(vm, a, b, c, d, true); };
+
+ // $attrs & $listeners are exposed for easier HOC creation.
+ // they need to be reactive so that HOCs using them are always updated
+ var parentData = parentVnode && parentVnode.data;
+
+ /* istanbul ignore else */
+ {
+ defineReactive$$1(vm, '$attrs', parentData && parentData.attrs || emptyObject, function () {
+ !isUpdatingChildComponent && warn("$attrs is readonly.", vm);
+ }, true);
+ defineReactive$$1(vm, '$listeners', options._parentListeners || emptyObject, function () {
+ !isUpdatingChildComponent && warn("$listeners is readonly.", vm);
+ }, true);
+ }
+}
+
+var currentRenderingInstance = null;
+
+function renderMixin (Vue) {
+ // install runtime convenience helpers
+ installRenderHelpers(Vue.prototype);
+
+ Vue.prototype.$nextTick = function (fn) {
+ return nextTick(fn, this)
+ };
+
+ Vue.prototype._render = function () {
+ var vm = this;
+ var ref = vm.$options;
+ var render = ref.render;
+ var _parentVnode = ref._parentVnode;
+
+ if (_parentVnode) {
+ vm.$scopedSlots = normalizeScopedSlots(
+ _parentVnode.data.scopedSlots,
+ vm.$slots,
+ vm.$scopedSlots
+ );
+ }
+
+ // set parent vnode. this allows render functions to have access
+ // to the data on the placeholder node.
+ vm.$vnode = _parentVnode;
+ // render self
+ var vnode;
+ try {
+ // There's no need to maintain a stack becaues all render fns are called
+ // separately from one another. Nested component's render fns are called
+ // when parent component is patched.
+ currentRenderingInstance = vm;
+ vnode = render.call(vm._renderProxy, vm.$createElement);
+ } catch (e) {
+ handleError(e, vm, "render");
+ // return error render result,
+ // or previous vnode to prevent render error causing blank component
+ /* istanbul ignore else */
+ if (vm.$options.renderError) {
+ try {
+ vnode = vm.$options.renderError.call(vm._renderProxy, vm.$createElement, e);
+ } catch (e) {
+ handleError(e, vm, "renderError");
+ vnode = vm._vnode;
+ }
+ } else {
+ vnode = vm._vnode;
+ }
+ } finally {
+ currentRenderingInstance = null;
+ }
+ // if the returned array contains only a single node, allow it
+ if (Array.isArray(vnode) && vnode.length === 1) {
+ vnode = vnode[0];
+ }
+ // return empty vnode in case the render function errored out
+ if (!(vnode instanceof VNode)) {
+ if (Array.isArray(vnode)) {
+ warn(
+ 'Multiple root nodes returned from render function. Render function ' +
+ 'should return a single root node.',
+ vm
+ );
+ }
+ vnode = createEmptyVNode();
+ }
+ // set parent
+ vnode.parent = _parentVnode;
+ return vnode
+ };
+}
+
+/* */
+
+function ensureCtor (comp, base) {
+ if (
+ comp.__esModule ||
+ (hasSymbol && comp[Symbol.toStringTag] === 'Module')
+ ) {
+ comp = comp.default;
+ }
+ return isObject(comp)
+ ? base.extend(comp)
+ : comp
+}
+
+function createAsyncPlaceholder (
+ factory,
+ data,
+ context,
+ children,
+ tag
+) {
+ var node = createEmptyVNode();
+ node.asyncFactory = factory;
+ node.asyncMeta = { data: data, context: context, children: children, tag: tag };
+ return node
+}
+
+function resolveAsyncComponent (
+ factory,
+ baseCtor
+) {
+ if (isTrue(factory.error) && isDef(factory.errorComp)) {
+ return factory.errorComp
+ }
+
+ if (isDef(factory.resolved)) {
+ return factory.resolved
+ }
+
+ var owner = currentRenderingInstance;
+ if (owner && isDef(factory.owners) && factory.owners.indexOf(owner) === -1) {
+ // already pending
+ factory.owners.push(owner);
+ }
+
+ if (isTrue(factory.loading) && isDef(factory.loadingComp)) {
+ return factory.loadingComp
+ }
+
+ if (owner && !isDef(factory.owners)) {
+ var owners = factory.owners = [owner];
+ var sync = true;
+ var timerLoading = null;
+ var timerTimeout = null
+
+ ;(owner).$on('hook:destroyed', function () { return remove(owners, owner); });
+
+ var forceRender = function (renderCompleted) {
+ for (var i = 0, l = owners.length; i < l; i++) {
+ (owners[i]).$forceUpdate();
+ }
+
+ if (renderCompleted) {
+ owners.length = 0;
+ if (timerLoading !== null) {
+ clearTimeout(timerLoading);
+ timerLoading = null;
+ }
+ if (timerTimeout !== null) {
+ clearTimeout(timerTimeout);
+ timerTimeout = null;
+ }
+ }
+ };
+
+ var resolve = once(function (res) {
+ // cache resolved
+ factory.resolved = ensureCtor(res, baseCtor);
+ // invoke callbacks only if this is not a synchronous resolve
+ // (async resolves are shimmed as synchronous during SSR)
+ if (!sync) {
+ forceRender(true);
+ } else {
+ owners.length = 0;
+ }
+ });
+
+ var reject = once(function (reason) {
+ warn(
+ "Failed to resolve async component: " + (String(factory)) +
+ (reason ? ("\nReason: " + reason) : '')
+ );
+ if (isDef(factory.errorComp)) {
+ factory.error = true;
+ forceRender(true);
+ }
+ });
+
+ var res = factory(resolve, reject);
+
+ if (isObject(res)) {
+ if (isPromise(res)) {
+ // () => Promise
+ if (isUndef(factory.resolved)) {
+ res.then(resolve, reject);
+ }
+ } else if (isPromise(res.component)) {
+ res.component.then(resolve, reject);
+
+ if (isDef(res.error)) {
+ factory.errorComp = ensureCtor(res.error, baseCtor);
+ }
+
+ if (isDef(res.loading)) {
+ factory.loadingComp = ensureCtor(res.loading, baseCtor);
+ if (res.delay === 0) {
+ factory.loading = true;
+ } else {
+ timerLoading = setTimeout(function () {
+ timerLoading = null;
+ if (isUndef(factory.resolved) && isUndef(factory.error)) {
+ factory.loading = true;
+ forceRender(false);
+ }
+ }, res.delay || 200);
+ }
+ }
+
+ if (isDef(res.timeout)) {
+ timerTimeout = setTimeout(function () {
+ timerTimeout = null;
+ if (isUndef(factory.resolved)) {
+ reject(
+ "timeout (" + (res.timeout) + "ms)"
+ );
+ }
+ }, res.timeout);
+ }
+ }
+ }
+
+ sync = false;
+ // return in case resolved synchronously
+ return factory.loading
+ ? factory.loadingComp
+ : factory.resolved
+ }
+}
+
+/* */
+
+function isAsyncPlaceholder (node) {
+ return node.isComment && node.asyncFactory
+}
+
+/* */
+
+function getFirstComponentChild (children) {
+ if (Array.isArray(children)) {
+ for (var i = 0; i < children.length; i++) {
+ var c = children[i];
+ if (isDef(c) && (isDef(c.componentOptions) || isAsyncPlaceholder(c))) {
+ return c
+ }
+ }
+ }
+}
+
+/* */
+
+/* */
+
+function initEvents (vm) {
+ vm._events = Object.create(null);
+ vm._hasHookEvent = false;
+ // init parent attached events
+ var listeners = vm.$options._parentListeners;
+ if (listeners) {
+ updateComponentListeners(vm, listeners);
+ }
+}
+
+var target;
+
+function add (event, fn) {
+ target.$on(event, fn);
+}
+
+function remove$1 (event, fn) {
+ target.$off(event, fn);
+}
+
+function createOnceHandler (event, fn) {
+ var _target = target;
+ return function onceHandler () {
+ var res = fn.apply(null, arguments);
+ if (res !== null) {
+ _target.$off(event, onceHandler);
+ }
+ }
+}
+
+function updateComponentListeners (
+ vm,
+ listeners,
+ oldListeners
+) {
+ target = vm;
+ updateListeners(listeners, oldListeners || {}, add, remove$1, createOnceHandler, vm);
+ target = undefined;
+}
+
+function eventsMixin (Vue) {
+ var hookRE = /^hook:/;
+ Vue.prototype.$on = function (event, fn) {
+ var vm = this;
+ if (Array.isArray(event)) {
+ for (var i = 0, l = event.length; i < l; i++) {
+ vm.$on(event[i], fn);
+ }
+ } else {
+ (vm._events[event] || (vm._events[event] = [])).push(fn);
+ // optimize hook:event cost by using a boolean flag marked at registration
+ // instead of a hash lookup
+ if (hookRE.test(event)) {
+ vm._hasHookEvent = true;
+ }
+ }
+ return vm
+ };
+
+ Vue.prototype.$once = function (event, fn) {
+ var vm = this;
+ function on () {
+ vm.$off(event, on);
+ fn.apply(vm, arguments);
+ }
+ on.fn = fn;
+ vm.$on(event, on);
+ return vm
+ };
+
+ Vue.prototype.$off = function (event, fn) {
+ var vm = this;
+ // all
+ if (!arguments.length) {
+ vm._events = Object.create(null);
+ return vm
+ }
+ // array of events
+ if (Array.isArray(event)) {
+ for (var i$1 = 0, l = event.length; i$1 < l; i$1++) {
+ vm.$off(event[i$1], fn);
+ }
+ return vm
+ }
+ // specific event
+ var cbs = vm._events[event];
+ if (!cbs) {
+ return vm
+ }
+ if (!fn) {
+ vm._events[event] = null;
+ return vm
+ }
+ // specific handler
+ var cb;
+ var i = cbs.length;
+ while (i--) {
+ cb = cbs[i];
+ if (cb === fn || cb.fn === fn) {
+ cbs.splice(i, 1);
+ break
+ }
+ }
+ return vm
+ };
+
+ Vue.prototype.$emit = function (event) {
+ var vm = this;
+ {
+ var lowerCaseEvent = event.toLowerCase();
+ if (lowerCaseEvent !== event && vm._events[lowerCaseEvent]) {
+ tip(
+ "Event \"" + lowerCaseEvent + "\" is emitted in component " +
+ (formatComponentName(vm)) + " but the handler is registered for \"" + event + "\". " +
+ "Note that HTML attributes are case-insensitive and you cannot use " +
+ "v-on to listen to camelCase events when using in-DOM templates. " +
+ "You should probably use \"" + (hyphenate(event)) + "\" instead of \"" + event + "\"."
+ );
+ }
+ }
+ var cbs = vm._events[event];
+ if (cbs) {
+ cbs = cbs.length > 1 ? toArray(cbs) : cbs;
+ var args = toArray(arguments, 1);
+ var info = "event handler for \"" + event + "\"";
+ for (var i = 0, l = cbs.length; i < l; i++) {
+ invokeWithErrorHandling(cbs[i], vm, args, vm, info);
+ }
+ }
+ return vm
+ };
+}
+
+/* */
+
+var activeInstance = null;
+var isUpdatingChildComponent = false;
+
+function setActiveInstance(vm) {
+ var prevActiveInstance = activeInstance;
+ activeInstance = vm;
+ return function () {
+ activeInstance = prevActiveInstance;
+ }
+}
+
+function initLifecycle (vm) {
+ var options = vm.$options;
+
+ // locate first non-abstract parent
+ var parent = options.parent;
+ if (parent && !options.abstract) {
+ while (parent.$options.abstract && parent.$parent) {
+ parent = parent.$parent;
+ }
+ parent.$children.push(vm);
+ }
+
+ vm.$parent = parent;
+ vm.$root = parent ? parent.$root : vm;
+
+ vm.$children = [];
+ vm.$refs = {};
+
+ vm._watcher = null;
+ vm._inactive = null;
+ vm._directInactive = false;
+ vm._isMounted = false;
+ vm._isDestroyed = false;
+ vm._isBeingDestroyed = false;
+}
+
+function lifecycleMixin (Vue) {
+ Vue.prototype._update = function (vnode, hydrating) {
+ var vm = this;
+ var prevEl = vm.$el;
+ var prevVnode = vm._vnode;
+ var restoreActiveInstance = setActiveInstance(vm);
+ vm._vnode = vnode;
+ // Vue.prototype.__patch__ is injected in entry points
+ // based on the rendering backend used.
+ if (!prevVnode) {
+ // initial render
+ vm.$el = vm.__patch__(vm.$el, vnode, hydrating, false /* removeOnly */);
+ } else {
+ // updates
+ vm.$el = vm.__patch__(prevVnode, vnode);
+ }
+ restoreActiveInstance();
+ // update __vue__ reference
+ if (prevEl) {
+ prevEl.__vue__ = null;
+ }
+ if (vm.$el) {
+ vm.$el.__vue__ = vm;
+ }
+ // if parent is an HOC, update its $el as well
+ if (vm.$vnode && vm.$parent && vm.$vnode === vm.$parent._vnode) {
+ vm.$parent.$el = vm.$el;
+ }
+ // updated hook is called by the scheduler to ensure that children are
+ // updated in a parent's updated hook.
+ };
+
+ Vue.prototype.$forceUpdate = function () {
+ var vm = this;
+ if (vm._watcher) {
+ vm._watcher.update();
+ }
+ };
+
+ Vue.prototype.$destroy = function () {
+ var vm = this;
+ if (vm._isBeingDestroyed) {
+ return
+ }
+ callHook(vm, 'beforeDestroy');
+ vm._isBeingDestroyed = true;
+ // remove self from parent
+ var parent = vm.$parent;
+ if (parent && !parent._isBeingDestroyed && !vm.$options.abstract) {
+ remove(parent.$children, vm);
+ }
+ // teardown watchers
+ if (vm._watcher) {
+ vm._watcher.teardown();
+ }
+ var i = vm._watchers.length;
+ while (i--) {
+ vm._watchers[i].teardown();
+ }
+ // remove reference from data ob
+ // frozen object may not have observer.
+ if (vm._data.__ob__) {
+ vm._data.__ob__.vmCount--;
+ }
+ // call the last hook...
+ vm._isDestroyed = true;
+ // invoke destroy hooks on current rendered tree
+ vm.__patch__(vm._vnode, null);
+ // fire destroyed hook
+ callHook(vm, 'destroyed');
+ // turn off all instance listeners.
+ vm.$off();
+ // remove __vue__ reference
+ if (vm.$el) {
+ vm.$el.__vue__ = null;
+ }
+ // release circular reference (#6759)
+ if (vm.$vnode) {
+ vm.$vnode.parent = null;
+ }
+ };
+}
+
+function mountComponent (
+ vm,
+ el,
+ hydrating
+) {
+ vm.$el = el;
+ if (!vm.$options.render) {
+ vm.$options.render = createEmptyVNode;
+ {
+ /* istanbul ignore if */
+ if ((vm.$options.template && vm.$options.template.charAt(0) !== '#') ||
+ vm.$options.el || el) {
+ warn(
+ 'You are using the runtime-only build of Vue where the template ' +
+ 'compiler is not available. Either pre-compile the templates into ' +
+ 'render functions, or use the compiler-included build.',
+ vm
+ );
+ } else {
+ warn(
+ 'Failed to mount component: template or render function not defined.',
+ vm
+ );
+ }
+ }
+ }
+ callHook(vm, 'beforeMount');
+
+ var updateComponent;
+ /* istanbul ignore if */
+ if (config.performance && mark) {
+ updateComponent = function () {
+ var name = vm._name;
+ var id = vm._uid;
+ var startTag = "vue-perf-start:" + id;
+ var endTag = "vue-perf-end:" + id;
+
+ mark(startTag);
+ var vnode = vm._render();
+ mark(endTag);
+ measure(("vue " + name + " render"), startTag, endTag);
+
+ mark(startTag);
+ vm._update(vnode, hydrating);
+ mark(endTag);
+ measure(("vue " + name + " patch"), startTag, endTag);
+ };
+ } else {
+ updateComponent = function () {
+ vm._update(vm._render(), hydrating);
+ };
+ }
+
+ // we set this to vm._watcher inside the watcher's constructor
+ // since the watcher's initial patch may call $forceUpdate (e.g. inside child
+ // component's mounted hook), which relies on vm._watcher being already defined
+ new Watcher(vm, updateComponent, noop, {
+ before: function before () {
+ if (vm._isMounted && !vm._isDestroyed) {
+ callHook(vm, 'beforeUpdate');
+ }
+ }
+ }, true /* isRenderWatcher */);
+ hydrating = false;
+
+ // manually mounted instance, call mounted on self
+ // mounted is called for render-created child components in its inserted hook
+ if (vm.$vnode == null) {
+ vm._isMounted = true;
+ callHook(vm, 'mounted');
+ }
+ return vm
+}
+
+function updateChildComponent (
+ vm,
+ propsData,
+ listeners,
+ parentVnode,
+ renderChildren
+) {
+ {
+ isUpdatingChildComponent = true;
+ }
+
+ // determine whether component has slot children
+ // we need to do this before overwriting $options._renderChildren.
+
+ // check if there are dynamic scopedSlots (hand-written or compiled but with
+ // dynamic slot names). Static scoped slots compiled from template has the
+ // "$stable" marker.
+ var newScopedSlots = parentVnode.data.scopedSlots;
+ var oldScopedSlots = vm.$scopedSlots;
+ var hasDynamicScopedSlot = !!(
+ (newScopedSlots && !newScopedSlots.$stable) ||
+ (oldScopedSlots !== emptyObject && !oldScopedSlots.$stable) ||
+ (newScopedSlots && vm.$scopedSlots.$key !== newScopedSlots.$key)
+ );
+
+ // Any static slot children from the parent may have changed during parent's
+ // update. Dynamic scoped slots may also have changed. In such cases, a forced
+ // update is necessary to ensure correctness.
+ var needsForceUpdate = !!(
+ renderChildren || // has new static slots
+ vm.$options._renderChildren || // has old static slots
+ hasDynamicScopedSlot
+ );
+
+ vm.$options._parentVnode = parentVnode;
+ vm.$vnode = parentVnode; // update vm's placeholder node without re-render
+
+ if (vm._vnode) { // update child tree's parent
+ vm._vnode.parent = parentVnode;
+ }
+ vm.$options._renderChildren = renderChildren;
+
+ // update $attrs and $listeners hash
+ // these are also reactive so they may trigger child update if the child
+ // used them during render
+ vm.$attrs = parentVnode.data.attrs || emptyObject;
+ vm.$listeners = listeners || emptyObject;
+
+ // update props
+ if (propsData && vm.$options.props) {
+ toggleObserving(false);
+ var props = vm._props;
+ var propKeys = vm.$options._propKeys || [];
+ for (var i = 0; i < propKeys.length; i++) {
+ var key = propKeys[i];
+ var propOptions = vm.$options.props; // wtf flow?
+ props[key] = validateProp(key, propOptions, propsData, vm);
+ }
+ toggleObserving(true);
+ // keep a copy of raw propsData
+ vm.$options.propsData = propsData;
+ }
+
+ // update listeners
+ listeners = listeners || emptyObject;
+ var oldListeners = vm.$options._parentListeners;
+ vm.$options._parentListeners = listeners;
+ updateComponentListeners(vm, listeners, oldListeners);
+
+ // resolve slots + force update if has children
+ if (needsForceUpdate) {
+ vm.$slots = resolveSlots(renderChildren, parentVnode.context);
+ vm.$forceUpdate();
+ }
+
+ {
+ isUpdatingChildComponent = false;
+ }
+}
+
+function isInInactiveTree (vm) {
+ while (vm && (vm = vm.$parent)) {
+ if (vm._inactive) { return true }
+ }
+ return false
+}
+
+function activateChildComponent (vm, direct) {
+ if (direct) {
+ vm._directInactive = false;
+ if (isInInactiveTree(vm)) {
+ return
+ }
+ } else if (vm._directInactive) {
+ return
+ }
+ if (vm._inactive || vm._inactive === null) {
+ vm._inactive = false;
+ for (var i = 0; i < vm.$children.length; i++) {
+ activateChildComponent(vm.$children[i]);
+ }
+ callHook(vm, 'activated');
+ }
+}
+
+function deactivateChildComponent (vm, direct) {
+ if (direct) {
+ vm._directInactive = true;
+ if (isInInactiveTree(vm)) {
+ return
+ }
+ }
+ if (!vm._inactive) {
+ vm._inactive = true;
+ for (var i = 0; i < vm.$children.length; i++) {
+ deactivateChildComponent(vm.$children[i]);
+ }
+ callHook(vm, 'deactivated');
+ }
+}
+
+function callHook (vm, hook) {
+ // #7573 disable dep collection when invoking lifecycle hooks
+ pushTarget();
+ var handlers = vm.$options[hook];
+ var info = hook + " hook";
+ if (handlers) {
+ for (var i = 0, j = handlers.length; i < j; i++) {
+ invokeWithErrorHandling(handlers[i], vm, null, vm, info);
+ }
+ }
+ if (vm._hasHookEvent) {
+ vm.$emit('hook:' + hook);
+ }
+ popTarget();
+}
+
+/* */
+
+var MAX_UPDATE_COUNT = 100;
+
+var queue = [];
+var activatedChildren = [];
+var has = {};
+var circular = {};
+var waiting = false;
+var flushing = false;
+var index = 0;
+
+/**
+ * Reset the scheduler's state.
+ */
+function resetSchedulerState () {
+ index = queue.length = activatedChildren.length = 0;
+ has = {};
+ {
+ circular = {};
+ }
+ waiting = flushing = false;
+}
+
+// Async edge case #6566 requires saving the timestamp when event listeners are
+// attached. However, calling performance.now() has a perf overhead especially
+// if the page has thousands of event listeners. Instead, we take a timestamp
+// every time the scheduler flushes and use that for all event listeners
+// attached during that flush.
+var currentFlushTimestamp = 0;
+
+// Async edge case fix requires storing an event listener's attach timestamp.
+var getNow = Date.now;
+
+// Determine what event timestamp the browser is using. Annoyingly, the
+// timestamp can either be hi-res (relative to page load) or low-res
+// (relative to UNIX epoch), so in order to compare time we have to use the
+// same timestamp type when saving the flush timestamp.
+// All IE versions use low-res event timestamps, and have problematic clock
+// implementations (#9632)
+if (inBrowser && !isIE) {
+ var performance = window.performance;
+ if (
+ performance &&
+ typeof performance.now === 'function' &&
+ getNow() > document.createEvent('Event').timeStamp
+ ) {
+ // if the event timestamp, although evaluated AFTER the Date.now(), is
+ // smaller than it, it means the event is using a hi-res timestamp,
+ // and we need to use the hi-res version for event listener timestamps as
+ // well.
+ getNow = function () { return performance.now(); };
+ }
+}
+
+/**
+ * Flush both queues and run the watchers.
+ */
+function flushSchedulerQueue () {
+ currentFlushTimestamp = getNow();
+ flushing = true;
+ var watcher, id;
+
+ // Sort queue before flush.
+ // This ensures that:
+ // 1. Components are updated from parent to child. (because parent is always
+ // created before the child)
+ // 2. A component's user watchers are run before its render watcher (because
+ // user watchers are created before the render watcher)
+ // 3. If a component is destroyed during a parent component's watcher run,
+ // its watchers can be skipped.
+ queue.sort(function (a, b) { return a.id - b.id; });
+
+ // do not cache length because more watchers might be pushed
+ // as we run existing watchers
+ for (index = 0; index < queue.length; index++) {
+ watcher = queue[index];
+ if (watcher.before) {
+ watcher.before();
+ }
+ id = watcher.id;
+ has[id] = null;
+ watcher.run();
+ // in dev build, check and stop circular updates.
+ if (has[id] != null) {
+ circular[id] = (circular[id] || 0) + 1;
+ if (circular[id] > MAX_UPDATE_COUNT) {
+ warn(
+ 'You may have an infinite update loop ' + (
+ watcher.user
+ ? ("in watcher with expression \"" + (watcher.expression) + "\"")
+ : "in a component render function."
+ ),
+ watcher.vm
+ );
+ break
+ }
+ }
+ }
+
+ // keep copies of post queues before resetting state
+ var activatedQueue = activatedChildren.slice();
+ var updatedQueue = queue.slice();
+
+ resetSchedulerState();
+
+ // call component updated and activated hooks
+ callActivatedHooks(activatedQueue);
+ callUpdatedHooks(updatedQueue);
+
+ // devtool hook
+ /* istanbul ignore if */
+ if (devtools && config.devtools) {
+ devtools.emit('flush');
+ }
+}
+
+function callUpdatedHooks (queue) {
+ var i = queue.length;
+ while (i--) {
+ var watcher = queue[i];
+ var vm = watcher.vm;
+ if (vm._watcher === watcher && vm._isMounted && !vm._isDestroyed) {
+ callHook(vm, 'updated');
+ }
+ }
+}
+
+/**
+ * Queue a kept-alive component that was activated during patch.
+ * The queue will be processed after the entire tree has been patched.
+ */
+function queueActivatedComponent (vm) {
+ // setting _inactive to false here so that a render function can
+ // rely on checking whether it's in an inactive tree (e.g. router-view)
+ vm._inactive = false;
+ activatedChildren.push(vm);
+}
+
+function callActivatedHooks (queue) {
+ for (var i = 0; i < queue.length; i++) {
+ queue[i]._inactive = true;
+ activateChildComponent(queue[i], true /* true */);
+ }
+}
+
+/**
+ * Push a watcher into the watcher queue.
+ * Jobs with duplicate IDs will be skipped unless it's
+ * pushed when the queue is being flushed.
+ */
+function queueWatcher (watcher) {
+ var id = watcher.id;
+ if (has[id] == null) {
+ has[id] = true;
+ if (!flushing) {
+ queue.push(watcher);
+ } else {
+ // if already flushing, splice the watcher based on its id
+ // if already past its id, it will be run next immediately.
+ var i = queue.length - 1;
+ while (i > index && queue[i].id > watcher.id) {
+ i--;
+ }
+ queue.splice(i + 1, 0, watcher);
+ }
+ // queue the flush
+ if (!waiting) {
+ waiting = true;
+
+ if (!config.async) {
+ flushSchedulerQueue();
+ return
+ }
+ nextTick(flushSchedulerQueue);
+ }
+ }
+}
+
+/* */
+
+
+
+var uid$2 = 0;
+
+/**
+ * A watcher parses an expression, collects dependencies,
+ * and fires callback when the expression value changes.
+ * This is used for both the $watch() api and directives.
+ */
+var Watcher = function Watcher (
+ vm,
+ expOrFn,
+ cb,
+ options,
+ isRenderWatcher
+) {
+ this.vm = vm;
+ if (isRenderWatcher) {
+ vm._watcher = this;
+ }
+ vm._watchers.push(this);
+ // options
+ if (options) {
+ this.deep = !!options.deep;
+ this.user = !!options.user;
+ this.lazy = !!options.lazy;
+ this.sync = !!options.sync;
+ this.before = options.before;
+ } else {
+ this.deep = this.user = this.lazy = this.sync = false;
+ }
+ this.cb = cb;
+ this.id = ++uid$2; // uid for batching
+ this.active = true;
+ this.dirty = this.lazy; // for lazy watchers
+ this.deps = [];
+ this.newDeps = [];
+ this.depIds = new _Set();
+ this.newDepIds = new _Set();
+ this.expression = expOrFn.toString();
+ // parse expression for getter
+ if (typeof expOrFn === 'function') {
+ this.getter = expOrFn;
+ } else {
+ this.getter = parsePath(expOrFn);
+ if (!this.getter) {
+ this.getter = noop;
+ warn(
+ "Failed watching path: \"" + expOrFn + "\" " +
+ 'Watcher only accepts simple dot-delimited paths. ' +
+ 'For full control, use a function instead.',
+ vm
+ );
+ }
+ }
+ this.value = this.lazy
+ ? undefined
+ : this.get();
+};
+
+/**
+ * Evaluate the getter, and re-collect dependencies.
+ */
+Watcher.prototype.get = function get () {
+ pushTarget(this);
+ var value;
+ var vm = this.vm;
+ try {
+ value = this.getter.call(vm, vm);
+ } catch (e) {
+ if (this.user) {
+ handleError(e, vm, ("getter for watcher \"" + (this.expression) + "\""));
+ } else {
+ throw e
+ }
+ } finally {
+ // "touch" every property so they are all tracked as
+ // dependencies for deep watching
+ if (this.deep) {
+ traverse(value);
+ }
+ popTarget();
+ this.cleanupDeps();
+ }
+ return value
+};
+
+/**
+ * Add a dependency to this directive.
+ */
+Watcher.prototype.addDep = function addDep (dep) {
+ var id = dep.id;
+ if (!this.newDepIds.has(id)) {
+ this.newDepIds.add(id);
+ this.newDeps.push(dep);
+ if (!this.depIds.has(id)) {
+ dep.addSub(this);
+ }
+ }
+};
+
+/**
+ * Clean up for dependency collection.
+ */
+Watcher.prototype.cleanupDeps = function cleanupDeps () {
+ var i = this.deps.length;
+ while (i--) {
+ var dep = this.deps[i];
+ if (!this.newDepIds.has(dep.id)) {
+ dep.removeSub(this);
+ }
+ }
+ var tmp = this.depIds;
+ this.depIds = this.newDepIds;
+ this.newDepIds = tmp;
+ this.newDepIds.clear();
+ tmp = this.deps;
+ this.deps = this.newDeps;
+ this.newDeps = tmp;
+ this.newDeps.length = 0;
+};
+
+/**
+ * Subscriber interface.
+ * Will be called when a dependency changes.
+ */
+Watcher.prototype.update = function update () {
+ /* istanbul ignore else */
+ if (this.lazy) {
+ this.dirty = true;
+ } else if (this.sync) {
+ this.run();
+ } else {
+ queueWatcher(this);
+ }
+};
+
+/**
+ * Scheduler job interface.
+ * Will be called by the scheduler.
+ */
+Watcher.prototype.run = function run () {
+ if (this.active) {
+ var value = this.get();
+ if (
+ value !== this.value ||
+ // Deep watchers and watchers on Object/Arrays should fire even
+ // when the value is the same, because the value may
+ // have mutated.
+ isObject(value) ||
+ this.deep
+ ) {
+ // set new value
+ var oldValue = this.value;
+ this.value = value;
+ if (this.user) {
+ try {
+ this.cb.call(this.vm, value, oldValue);
+ } catch (e) {
+ handleError(e, this.vm, ("callback for watcher \"" + (this.expression) + "\""));
+ }
+ } else {
+ this.cb.call(this.vm, value, oldValue);
+ }
+ }
+ }
+};
+
+/**
+ * Evaluate the value of the watcher.
+ * This only gets called for lazy watchers.
+ */
+Watcher.prototype.evaluate = function evaluate () {
+ this.value = this.get();
+ this.dirty = false;
+};
+
+/**
+ * Depend on all deps collected by this watcher.
+ */
+Watcher.prototype.depend = function depend () {
+ var i = this.deps.length;
+ while (i--) {
+ this.deps[i].depend();
+ }
+};
+
+/**
+ * Remove self from all dependencies' subscriber list.
+ */
+Watcher.prototype.teardown = function teardown () {
+ if (this.active) {
+ // remove self from vm's watcher list
+ // this is a somewhat expensive operation so we skip it
+ // if the vm is being destroyed.
+ if (!this.vm._isBeingDestroyed) {
+ remove(this.vm._watchers, this);
+ }
+ var i = this.deps.length;
+ while (i--) {
+ this.deps[i].removeSub(this);
+ }
+ this.active = false;
+ }
+};
+
+/* */
+
+var sharedPropertyDefinition = {
+ enumerable: true,
+ configurable: true,
+ get: noop,
+ set: noop
+};
+
+function proxy (target, sourceKey, key) {
+ sharedPropertyDefinition.get = function proxyGetter () {
+ return this[sourceKey][key]
+ };
+ sharedPropertyDefinition.set = function proxySetter (val) {
+ this[sourceKey][key] = val;
+ };
+ Object.defineProperty(target, key, sharedPropertyDefinition);
+}
+
+function initState (vm) {
+ vm._watchers = [];
+ var opts = vm.$options;
+ if (opts.props) { initProps(vm, opts.props); }
+ if (opts.methods) { initMethods(vm, opts.methods); }
+ if (opts.data) {
+ initData(vm);
+ } else {
+ observe(vm._data = {}, true /* asRootData */);
+ }
+ if (opts.computed) { initComputed(vm, opts.computed); }
+ if (opts.watch && opts.watch !== nativeWatch) {
+ initWatch(vm, opts.watch);
+ }
+}
+
+function initProps (vm, propsOptions) {
+ var propsData = vm.$options.propsData || {};
+ var props = vm._props = {};
+ // cache prop keys so that future props updates can iterate using Array
+ // instead of dynamic object key enumeration.
+ var keys = vm.$options._propKeys = [];
+ var isRoot = !vm.$parent;
+ // root instance props should be converted
+ if (!isRoot) {
+ toggleObserving(false);
+ }
+ var loop = function ( key ) {
+ keys.push(key);
+ var value = validateProp(key, propsOptions, propsData, vm);
+ /* istanbul ignore else */
+ {
+ var hyphenatedKey = hyphenate(key);
+ if (isReservedAttribute(hyphenatedKey) ||
+ config.isReservedAttr(hyphenatedKey)) {
+ warn(
+ ("\"" + hyphenatedKey + "\" is a reserved attribute and cannot be used as component prop."),
+ vm
+ );
+ }
+ defineReactive$$1(props, key, value, function () {
+ if (!isRoot && !isUpdatingChildComponent) {
+ warn(
+ "Avoid mutating a prop directly since the value will be " +
+ "overwritten whenever the parent component re-renders. " +
+ "Instead, use a data or computed property based on the prop's " +
+ "value. Prop being mutated: \"" + key + "\"",
+ vm
+ );
+ }
+ });
+ }
+ // static props are already proxied on the component's prototype
+ // during Vue.extend(). We only need to proxy props defined at
+ // instantiation here.
+ if (!(key in vm)) {
+ proxy(vm, "_props", key);
+ }
+ };
+
+ for (var key in propsOptions) loop( key );
+ toggleObserving(true);
+}
+
+function initData (vm) {
+ var data = vm.$options.data;
+ data = vm._data = typeof data === 'function'
+ ? getData(data, vm)
+ : data || {};
+ if (!isPlainObject(data)) {
+ data = {};
+ warn(
+ 'data functions should return an object:\n' +
+ 'https://vuejs.org/v2/guide/components.html#data-Must-Be-a-Function',
+ vm
+ );
+ }
+ // proxy data on instance
+ var keys = Object.keys(data);
+ var props = vm.$options.props;
+ var methods = vm.$options.methods;
+ var i = keys.length;
+ while (i--) {
+ var key = keys[i];
+ {
+ if (methods && hasOwn(methods, key)) {
+ warn(
+ ("Method \"" + key + "\" has already been defined as a data property."),
+ vm
+ );
+ }
+ }
+ if (props && hasOwn(props, key)) {
+ warn(
+ "The data property \"" + key + "\" is already declared as a prop. " +
+ "Use prop default value instead.",
+ vm
+ );
+ } else if (!isReserved(key)) {
+ proxy(vm, "_data", key);
+ }
+ }
+ // observe data
+ observe(data, true /* asRootData */);
+}
+
+function getData (data, vm) {
+ // #7573 disable dep collection when invoking data getters
+ pushTarget();
+ try {
+ return data.call(vm, vm)
+ } catch (e) {
+ handleError(e, vm, "data()");
+ return {}
+ } finally {
+ popTarget();
+ }
+}
+
+var computedWatcherOptions = { lazy: true };
+
+function initComputed (vm, computed) {
+ // $flow-disable-line
+ var watchers = vm._computedWatchers = Object.create(null);
+ // computed properties are just getters during SSR
+ var isSSR = isServerRendering();
+
+ for (var key in computed) {
+ var userDef = computed[key];
+ var getter = typeof userDef === 'function' ? userDef : userDef.get;
+ if (getter == null) {
+ warn(
+ ("Getter is missing for computed property \"" + key + "\"."),
+ vm
+ );
+ }
+
+ if (!isSSR) {
+ // create internal watcher for the computed property.
+ watchers[key] = new Watcher(
+ vm,
+ getter || noop,
+ noop,
+ computedWatcherOptions
+ );
+ }
+
+ // component-defined computed properties are already defined on the
+ // component prototype. We only need to define computed properties defined
+ // at instantiation here.
+ if (!(key in vm)) {
+ defineComputed(vm, key, userDef);
+ } else {
+ if (key in vm.$data) {
+ warn(("The computed property \"" + key + "\" is already defined in data."), vm);
+ } else if (vm.$options.props && key in vm.$options.props) {
+ warn(("The computed property \"" + key + "\" is already defined as a prop."), vm);
+ }
+ }
+ }
+}
+
+function defineComputed (
+ target,
+ key,
+ userDef
+) {
+ var shouldCache = !isServerRendering();
+ if (typeof userDef === 'function') {
+ sharedPropertyDefinition.get = shouldCache
+ ? createComputedGetter(key)
+ : createGetterInvoker(userDef);
+ sharedPropertyDefinition.set = noop;
+ } else {
+ sharedPropertyDefinition.get = userDef.get
+ ? shouldCache && userDef.cache !== false
+ ? createComputedGetter(key)
+ : createGetterInvoker(userDef.get)
+ : noop;
+ sharedPropertyDefinition.set = userDef.set || noop;
+ }
+ if (sharedPropertyDefinition.set === noop) {
+ sharedPropertyDefinition.set = function () {
+ warn(
+ ("Computed property \"" + key + "\" was assigned to but it has no setter."),
+ this
+ );
+ };
+ }
+ Object.defineProperty(target, key, sharedPropertyDefinition);
+}
+
+function createComputedGetter (key) {
+ return function computedGetter () {
+ var watcher = this._computedWatchers && this._computedWatchers[key];
+ if (watcher) {
+ if (watcher.dirty) {
+ watcher.evaluate();
+ }
+ if (Dep.target) {
+ watcher.depend();
+ }
+ return watcher.value
+ }
+ }
+}
+
+function createGetterInvoker(fn) {
+ return function computedGetter () {
+ return fn.call(this, this)
+ }
+}
+
+function initMethods (vm, methods) {
+ var props = vm.$options.props;
+ for (var key in methods) {
+ {
+ if (typeof methods[key] !== 'function') {
+ warn(
+ "Method \"" + key + "\" has type \"" + (typeof methods[key]) + "\" in the component definition. " +
+ "Did you reference the function correctly?",
+ vm
+ );
+ }
+ if (props && hasOwn(props, key)) {
+ warn(
+ ("Method \"" + key + "\" has already been defined as a prop."),
+ vm
+ );
+ }
+ if ((key in vm) && isReserved(key)) {
+ warn(
+ "Method \"" + key + "\" conflicts with an existing Vue instance method. " +
+ "Avoid defining component methods that start with _ or $."
+ );
+ }
+ }
+ vm[key] = typeof methods[key] !== 'function' ? noop : bind(methods[key], vm);
+ }
+}
+
+function initWatch (vm, watch) {
+ for (var key in watch) {
+ var handler = watch[key];
+ if (Array.isArray(handler)) {
+ for (var i = 0; i < handler.length; i++) {
+ createWatcher(vm, key, handler[i]);
+ }
+ } else {
+ createWatcher(vm, key, handler);
+ }
+ }
+}
+
+function createWatcher (
+ vm,
+ expOrFn,
+ handler,
+ options
+) {
+ if (isPlainObject(handler)) {
+ options = handler;
+ handler = handler.handler;
+ }
+ if (typeof handler === 'string') {
+ handler = vm[handler];
+ }
+ return vm.$watch(expOrFn, handler, options)
+}
+
+function stateMixin (Vue) {
+ // flow somehow has problems with directly declared definition object
+ // when using Object.defineProperty, so we have to procedurally build up
+ // the object here.
+ var dataDef = {};
+ dataDef.get = function () { return this._data };
+ var propsDef = {};
+ propsDef.get = function () { return this._props };
+ {
+ dataDef.set = function () {
+ warn(
+ 'Avoid replacing instance root $data. ' +
+ 'Use nested data properties instead.',
+ this
+ );
+ };
+ propsDef.set = function () {
+ warn("$props is readonly.", this);
+ };
+ }
+ Object.defineProperty(Vue.prototype, '$data', dataDef);
+ Object.defineProperty(Vue.prototype, '$props', propsDef);
+
+ Vue.prototype.$set = set;
+ Vue.prototype.$delete = del;
+
+ Vue.prototype.$watch = function (
+ expOrFn,
+ cb,
+ options
+ ) {
+ var vm = this;
+ if (isPlainObject(cb)) {
+ return createWatcher(vm, expOrFn, cb, options)
+ }
+ options = options || {};
+ options.user = true;
+ var watcher = new Watcher(vm, expOrFn, cb, options);
+ if (options.immediate) {
+ try {
+ cb.call(vm, watcher.value);
+ } catch (error) {
+ handleError(error, vm, ("callback for immediate watcher \"" + (watcher.expression) + "\""));
+ }
+ }
+ return function unwatchFn () {
+ watcher.teardown();
+ }
+ };
+}
+
+/* */
+
+var uid$3 = 0;
+
+function initMixin (Vue) {
+ Vue.prototype._init = function (options) {
+ var vm = this;
+ // a uid
+ vm._uid = uid$3++;
+
+ var startTag, endTag;
+ /* istanbul ignore if */
+ if (config.performance && mark) {
+ startTag = "vue-perf-start:" + (vm._uid);
+ endTag = "vue-perf-end:" + (vm._uid);
+ mark(startTag);
+ }
+
+ // a flag to avoid this being observed
+ vm._isVue = true;
+ // merge options
+ if (options && options._isComponent) {
+ // optimize internal component instantiation
+ // since dynamic options merging is pretty slow, and none of the
+ // internal component options needs special treatment.
+ initInternalComponent(vm, options);
+ } else {
+ vm.$options = mergeOptions(
+ resolveConstructorOptions(vm.constructor),
+ options || {},
+ vm
+ );
+ }
+ /* istanbul ignore else */
+ {
+ initProxy(vm);
+ }
+ // expose real self
+ vm._self = vm;
+ initLifecycle(vm);
+ initEvents(vm);
+ initRender(vm);
+ callHook(vm, 'beforeCreate');
+ initInjections(vm); // resolve injections before data/props
+ initState(vm);
+ initProvide(vm); // resolve provide after data/props
+ callHook(vm, 'created');
+
+ /* istanbul ignore if */
+ if (config.performance && mark) {
+ vm._name = formatComponentName(vm, false);
+ mark(endTag);
+ measure(("vue " + (vm._name) + " init"), startTag, endTag);
+ }
+
+ if (vm.$options.el) {
+ vm.$mount(vm.$options.el);
+ }
+ };
+}
+
+function initInternalComponent (vm, options) {
+ var opts = vm.$options = Object.create(vm.constructor.options);
+ // doing this because it's faster than dynamic enumeration.
+ var parentVnode = options._parentVnode;
+ opts.parent = options.parent;
+ opts._parentVnode = parentVnode;
+
+ var vnodeComponentOptions = parentVnode.componentOptions;
+ opts.propsData = vnodeComponentOptions.propsData;
+ opts._parentListeners = vnodeComponentOptions.listeners;
+ opts._renderChildren = vnodeComponentOptions.children;
+ opts._componentTag = vnodeComponentOptions.tag;
+
+ if (options.render) {
+ opts.render = options.render;
+ opts.staticRenderFns = options.staticRenderFns;
+ }
+}
+
+function resolveConstructorOptions (Ctor) {
+ var options = Ctor.options;
+ if (Ctor.super) {
+ var superOptions = resolveConstructorOptions(Ctor.super);
+ var cachedSuperOptions = Ctor.superOptions;
+ if (superOptions !== cachedSuperOptions) {
+ // super option changed,
+ // need to resolve new options.
+ Ctor.superOptions = superOptions;
+ // check if there are any late-modified/attached options (#4976)
+ var modifiedOptions = resolveModifiedOptions(Ctor);
+ // update base extend options
+ if (modifiedOptions) {
+ extend(Ctor.extendOptions, modifiedOptions);
+ }
+ options = Ctor.options = mergeOptions(superOptions, Ctor.extendOptions);
+ if (options.name) {
+ options.components[options.name] = Ctor;
+ }
+ }
+ }
+ return options
+}
+
+function resolveModifiedOptions (Ctor) {
+ var modified;
+ var latest = Ctor.options;
+ var sealed = Ctor.sealedOptions;
+ for (var key in latest) {
+ if (latest[key] !== sealed[key]) {
+ if (!modified) { modified = {}; }
+ modified[key] = latest[key];
+ }
+ }
+ return modified
+}
+
+function Vue (options) {
+ if (!(this instanceof Vue)
+ ) {
+ warn('Vue is a constructor and should be called with the `new` keyword');
+ }
+ this._init(options);
+}
+
+initMixin(Vue);
+stateMixin(Vue);
+eventsMixin(Vue);
+lifecycleMixin(Vue);
+renderMixin(Vue);
+
+/* */
+
+function initUse (Vue) {
+ Vue.use = function (plugin) {
+ var installedPlugins = (this._installedPlugins || (this._installedPlugins = []));
+ if (installedPlugins.indexOf(plugin) > -1) {
+ return this
+ }
+
+ // additional parameters
+ var args = toArray(arguments, 1);
+ args.unshift(this);
+ if (typeof plugin.install === 'function') {
+ plugin.install.apply(plugin, args);
+ } else if (typeof plugin === 'function') {
+ plugin.apply(null, args);
+ }
+ installedPlugins.push(plugin);
+ return this
+ };
+}
+
+/* */
+
+function initMixin$1 (Vue) {
+ Vue.mixin = function (mixin) {
+ this.options = mergeOptions(this.options, mixin);
+ return this
+ };
+}
+
+/* */
+
+function initExtend (Vue) {
+ /**
+ * Each instance constructor, including Vue, has a unique
+ * cid. This enables us to create wrapped "child
+ * constructors" for prototypal inheritance and cache them.
+ */
+ Vue.cid = 0;
+ var cid = 1;
+
+ /**
+ * Class inheritance
+ */
+ Vue.extend = function (extendOptions) {
+ extendOptions = extendOptions || {};
+ var Super = this;
+ var SuperId = Super.cid;
+ var cachedCtors = extendOptions._Ctor || (extendOptions._Ctor = {});
+ if (cachedCtors[SuperId]) {
+ return cachedCtors[SuperId]
+ }
+
+ var name = extendOptions.name || Super.options.name;
+ if (name) {
+ validateComponentName(name);
+ }
+
+ var Sub = function VueComponent (options) {
+ this._init(options);
+ };
+ Sub.prototype = Object.create(Super.prototype);
+ Sub.prototype.constructor = Sub;
+ Sub.cid = cid++;
+ Sub.options = mergeOptions(
+ Super.options,
+ extendOptions
+ );
+ Sub['super'] = Super;
+
+ // For props and computed properties, we define the proxy getters on
+ // the Vue instances at extension time, on the extended prototype. This
+ // avoids Object.defineProperty calls for each instance created.
+ if (Sub.options.props) {
+ initProps$1(Sub);
+ }
+ if (Sub.options.computed) {
+ initComputed$1(Sub);
+ }
+
+ // allow further extension/mixin/plugin usage
+ Sub.extend = Super.extend;
+ Sub.mixin = Super.mixin;
+ Sub.use = Super.use;
+
+ // create asset registers, so extended classes
+ // can have their private assets too.
+ ASSET_TYPES.forEach(function (type) {
+ Sub[type] = Super[type];
+ });
+ // enable recursive self-lookup
+ if (name) {
+ Sub.options.components[name] = Sub;
+ }
+
+ // keep a reference to the super options at extension time.
+ // later at instantiation we can check if Super's options have
+ // been updated.
+ Sub.superOptions = Super.options;
+ Sub.extendOptions = extendOptions;
+ Sub.sealedOptions = extend({}, Sub.options);
+
+ // cache constructor
+ cachedCtors[SuperId] = Sub;
+ return Sub
+ };
+}
+
+function initProps$1 (Comp) {
+ var props = Comp.options.props;
+ for (var key in props) {
+ proxy(Comp.prototype, "_props", key);
+ }
+}
+
+function initComputed$1 (Comp) {
+ var computed = Comp.options.computed;
+ for (var key in computed) {
+ defineComputed(Comp.prototype, key, computed[key]);
+ }
+}
+
+/* */
+
+function initAssetRegisters (Vue) {
+ /**
+ * Create asset registration methods.
+ */
+ ASSET_TYPES.forEach(function (type) {
+ Vue[type] = function (
+ id,
+ definition
+ ) {
+ if (!definition) {
+ return this.options[type + 's'][id]
+ } else {
+ /* istanbul ignore if */
+ if (type === 'component') {
+ validateComponentName(id);
+ }
+ if (type === 'component' && isPlainObject(definition)) {
+ definition.name = definition.name || id;
+ definition = this.options._base.extend(definition);
+ }
+ if (type === 'directive' && typeof definition === 'function') {
+ definition = { bind: definition, update: definition };
+ }
+ this.options[type + 's'][id] = definition;
+ return definition
+ }
+ };
+ });
+}
+
+/* */
+
+
+
+function getComponentName (opts) {
+ return opts && (opts.Ctor.options.name || opts.tag)
+}
+
+function matches (pattern, name) {
+ if (Array.isArray(pattern)) {
+ return pattern.indexOf(name) > -1
+ } else if (typeof pattern === 'string') {
+ return pattern.split(',').indexOf(name) > -1
+ } else if (isRegExp(pattern)) {
+ return pattern.test(name)
+ }
+ /* istanbul ignore next */
+ return false
+}
+
+function pruneCache (keepAliveInstance, filter) {
+ var cache = keepAliveInstance.cache;
+ var keys = keepAliveInstance.keys;
+ var _vnode = keepAliveInstance._vnode;
+ for (var key in cache) {
+ var cachedNode = cache[key];
+ if (cachedNode) {
+ var name = getComponentName(cachedNode.componentOptions);
+ if (name && !filter(name)) {
+ pruneCacheEntry(cache, key, keys, _vnode);
+ }
+ }
+ }
+}
+
+function pruneCacheEntry (
+ cache,
+ key,
+ keys,
+ current
+) {
+ var cached$$1 = cache[key];
+ if (cached$$1 && (!current || cached$$1.tag !== current.tag)) {
+ cached$$1.componentInstance.$destroy();
+ }
+ cache[key] = null;
+ remove(keys, key);
+}
+
+var patternTypes = [String, RegExp, Array];
+
+var KeepAlive = {
+ name: 'keep-alive',
+ abstract: true,
+
+ props: {
+ include: patternTypes,
+ exclude: patternTypes,
+ max: [String, Number]
+ },
+
+ created: function created () {
+ this.cache = Object.create(null);
+ this.keys = [];
+ },
+
+ destroyed: function destroyed () {
+ for (var key in this.cache) {
+ pruneCacheEntry(this.cache, key, this.keys);
+ }
+ },
+
+ mounted: function mounted () {
+ var this$1 = this;
+
+ this.$watch('include', function (val) {
+ pruneCache(this$1, function (name) { return matches(val, name); });
+ });
+ this.$watch('exclude', function (val) {
+ pruneCache(this$1, function (name) { return !matches(val, name); });
+ });
+ },
+
+ render: function render () {
+ var slot = this.$slots.default;
+ var vnode = getFirstComponentChild(slot);
+ var componentOptions = vnode && vnode.componentOptions;
+ if (componentOptions) {
+ // check pattern
+ var name = getComponentName(componentOptions);
+ var ref = this;
+ var include = ref.include;
+ var exclude = ref.exclude;
+ if (
+ // not included
+ (include && (!name || !matches(include, name))) ||
+ // excluded
+ (exclude && name && matches(exclude, name))
+ ) {
+ return vnode
+ }
+
+ var ref$1 = this;
+ var cache = ref$1.cache;
+ var keys = ref$1.keys;
+ var key = vnode.key == null
+ // same constructor may get registered as different local components
+ // so cid alone is not enough (#3269)
+ ? componentOptions.Ctor.cid + (componentOptions.tag ? ("::" + (componentOptions.tag)) : '')
+ : vnode.key;
+ if (cache[key]) {
+ vnode.componentInstance = cache[key].componentInstance;
+ // make current key freshest
+ remove(keys, key);
+ keys.push(key);
+ } else {
+ cache[key] = vnode;
+ keys.push(key);
+ // prune oldest entry
+ if (this.max && keys.length > parseInt(this.max)) {
+ pruneCacheEntry(cache, keys[0], keys, this._vnode);
+ }
+ }
+
+ vnode.data.keepAlive = true;
+ }
+ return vnode || (slot && slot[0])
+ }
+};
+
+var builtInComponents = {
+ KeepAlive: KeepAlive
+};
+
+/* */
+
+function initGlobalAPI (Vue) {
+ // config
+ var configDef = {};
+ configDef.get = function () { return config; };
+ {
+ configDef.set = function () {
+ warn(
+ 'Do not replace the Vue.config object, set individual fields instead.'
+ );
+ };
+ }
+ Object.defineProperty(Vue, 'config', configDef);
+
+ // exposed util methods.
+ // NOTE: these are not considered part of the public API - avoid relying on
+ // them unless you are aware of the risk.
+ Vue.util = {
+ warn: warn,
+ extend: extend,
+ mergeOptions: mergeOptions,
+ defineReactive: defineReactive$$1
+ };
+
+ Vue.set = set;
+ Vue.delete = del;
+ Vue.nextTick = nextTick;
+
+ // 2.6 explicit observable API
+ Vue.observable = function (obj) {
+ observe(obj);
+ return obj
+ };
+
+ Vue.options = Object.create(null);
+ ASSET_TYPES.forEach(function (type) {
+ Vue.options[type + 's'] = Object.create(null);
+ });
+
+ // this is used to identify the "base" constructor to extend all plain-object
+ // components with in Weex's multi-instance scenarios.
+ Vue.options._base = Vue;
+
+ extend(Vue.options.components, builtInComponents);
+
+ initUse(Vue);
+ initMixin$1(Vue);
+ initExtend(Vue);
+ initAssetRegisters(Vue);
+}
+
+initGlobalAPI(Vue);
+
+Object.defineProperty(Vue.prototype, '$isServer', {
+ get: isServerRendering
+});
+
+Object.defineProperty(Vue.prototype, '$ssrContext', {
+ get: function get () {
+ /* istanbul ignore next */
+ return this.$vnode && this.$vnode.ssrContext
+ }
+});
+
+// expose FunctionalRenderContext for ssr runtime helper installation
+Object.defineProperty(Vue, 'FunctionalRenderContext', {
+ value: FunctionalRenderContext
+});
+
+Vue.version = '2.6.10';
+
+/* */
+
+// these are reserved for web because they are directly compiled away
+// during template compilation
+var isReservedAttr = makeMap('style,class');
+
+// attributes that should be using props for binding
+var acceptValue = makeMap('input,textarea,option,select,progress');
+var mustUseProp = function (tag, type, attr) {
+ return (
+ (attr === 'value' && acceptValue(tag)) && type !== 'button' ||
+ (attr === 'selected' && tag === 'option') ||
+ (attr === 'checked' && tag === 'input') ||
+ (attr === 'muted' && tag === 'video')
+ )
+};
+
+var isEnumeratedAttr = makeMap('contenteditable,draggable,spellcheck');
+
+var isValidContentEditableValue = makeMap('events,caret,typing,plaintext-only');
+
+var convertEnumeratedValue = function (key, value) {
+ return isFalsyAttrValue(value) || value === 'false'
+ ? 'false'
+ // allow arbitrary string value for contenteditable
+ : key === 'contenteditable' && isValidContentEditableValue(value)
+ ? value
+ : 'true'
+};
+
+var isBooleanAttr = makeMap(
+ 'allowfullscreen,async,autofocus,autoplay,checked,compact,controls,declare,' +
+ 'default,defaultchecked,defaultmuted,defaultselected,defer,disabled,' +
+ 'enabled,formnovalidate,hidden,indeterminate,inert,ismap,itemscope,loop,multiple,' +
+ 'muted,nohref,noresize,noshade,novalidate,nowrap,open,pauseonexit,readonly,' +
+ 'required,reversed,scoped,seamless,selected,sortable,translate,' +
+ 'truespeed,typemustmatch,visible'
+);
+
+var xlinkNS = 'http://www.w3.org/1999/xlink';
+
+var isXlink = function (name) {
+ return name.charAt(5) === ':' && name.slice(0, 5) === 'xlink'
+};
+
+var getXlinkProp = function (name) {
+ return isXlink(name) ? name.slice(6, name.length) : ''
+};
+
+var isFalsyAttrValue = function (val) {
+ return val == null || val === false
+};
+
+/* */
+
+function genClassForVnode (vnode) {
+ var data = vnode.data;
+ var parentNode = vnode;
+ var childNode = vnode;
+ while (isDef(childNode.componentInstance)) {
+ childNode = childNode.componentInstance._vnode;
+ if (childNode && childNode.data) {
+ data = mergeClassData(childNode.data, data);
+ }
+ }
+ while (isDef(parentNode = parentNode.parent)) {
+ if (parentNode && parentNode.data) {
+ data = mergeClassData(data, parentNode.data);
+ }
+ }
+ return renderClass(data.staticClass, data.class)
+}
+
+function mergeClassData (child, parent) {
+ return {
+ staticClass: concat(child.staticClass, parent.staticClass),
+ class: isDef(child.class)
+ ? [child.class, parent.class]
+ : parent.class
+ }
+}
+
+function renderClass (
+ staticClass,
+ dynamicClass
+) {
+ if (isDef(staticClass) || isDef(dynamicClass)) {
+ return concat(staticClass, stringifyClass(dynamicClass))
+ }
+ /* istanbul ignore next */
+ return ''
+}
+
+function concat (a, b) {
+ return a ? b ? (a + ' ' + b) : a : (b || '')
+}
+
+function stringifyClass (value) {
+ if (Array.isArray(value)) {
+ return stringifyArray(value)
+ }
+ if (isObject(value)) {
+ return stringifyObject(value)
+ }
+ if (typeof value === 'string') {
+ return value
+ }
+ /* istanbul ignore next */
+ return ''
+}
+
+function stringifyArray (value) {
+ var res = '';
+ var stringified;
+ for (var i = 0, l = value.length; i < l; i++) {
+ if (isDef(stringified = stringifyClass(value[i])) && stringified !== '') {
+ if (res) { res += ' '; }
+ res += stringified;
+ }
+ }
+ return res
+}
+
+function stringifyObject (value) {
+ var res = '';
+ for (var key in value) {
+ if (value[key]) {
+ if (res) { res += ' '; }
+ res += key;
+ }
+ }
+ return res
+}
+
+/* */
+
+var namespaceMap = {
+ svg: 'http://www.w3.org/2000/svg',
+ math: 'http://www.w3.org/1998/Math/MathML'
+};
+
+var isHTMLTag = makeMap(
+ 'html,body,base,head,link,meta,style,title,' +
+ 'address,article,aside,footer,header,h1,h2,h3,h4,h5,h6,hgroup,nav,section,' +
+ 'div,dd,dl,dt,figcaption,figure,picture,hr,img,li,main,ol,p,pre,ul,' +
+ 'a,b,abbr,bdi,bdo,br,cite,code,data,dfn,em,i,kbd,mark,q,rp,rt,rtc,ruby,' +
+ 's,samp,small,span,strong,sub,sup,time,u,var,wbr,area,audio,map,track,video,' +
+ 'embed,object,param,source,canvas,script,noscript,del,ins,' +
+ 'caption,col,colgroup,table,thead,tbody,td,th,tr,' +
+ 'button,datalist,fieldset,form,input,label,legend,meter,optgroup,option,' +
+ 'output,progress,select,textarea,' +
+ 'details,dialog,menu,menuitem,summary,' +
+ 'content,element,shadow,template,blockquote,iframe,tfoot'
+);
+
+// this map is intentionally selective, only covering SVG elements that may
+// contain child elements.
+var isSVG = makeMap(
+ 'svg,animate,circle,clippath,cursor,defs,desc,ellipse,filter,font-face,' +
+ 'foreignObject,g,glyph,image,line,marker,mask,missing-glyph,path,pattern,' +
+ 'polygon,polyline,rect,switch,symbol,text,textpath,tspan,use,view',
+ true
+);
+
+var isPreTag = function (tag) { return tag === 'pre'; };
+
+var isReservedTag = function (tag) {
+ return isHTMLTag(tag) || isSVG(tag)
+};
+
+function getTagNamespace (tag) {
+ if (isSVG(tag)) {
+ return 'svg'
+ }
+ // basic support for MathML
+ // note it doesn't support other MathML elements being component roots
+ if (tag === 'math') {
+ return 'math'
+ }
+}
+
+var unknownElementCache = Object.create(null);
+function isUnknownElement (tag) {
+ /* istanbul ignore if */
+ if (!inBrowser) {
+ return true
+ }
+ if (isReservedTag(tag)) {
+ return false
+ }
+ tag = tag.toLowerCase();
+ /* istanbul ignore if */
+ if (unknownElementCache[tag] != null) {
+ return unknownElementCache[tag]
+ }
+ var el = document.createElement(tag);
+ if (tag.indexOf('-') > -1) {
+ // http://stackoverflow.com/a/28210364/1070244
+ return (unknownElementCache[tag] = (
+ el.constructor === window.HTMLUnknownElement ||
+ el.constructor === window.HTMLElement
+ ))
+ } else {
+ return (unknownElementCache[tag] = /HTMLUnknownElement/.test(el.toString()))
+ }
+}
+
+var isTextInputType = makeMap('text,number,password,search,email,tel,url');
+
+/* */
+
+/**
+ * Query an element selector if it's not an element already.
+ */
+function query (el) {
+ if (typeof el === 'string') {
+ var selected = document.querySelector(el);
+ if (!selected) {
+ warn(
+ 'Cannot find element: ' + el
+ );
+ return document.createElement('div')
+ }
+ return selected
+ } else {
+ return el
+ }
+}
+
+/* */
+
+function createElement$1 (tagName, vnode) {
+ var elm = document.createElement(tagName);
+ if (tagName !== 'select') {
+ return elm
+ }
+ // false or null will remove the attribute but undefined will not
+ if (vnode.data && vnode.data.attrs && vnode.data.attrs.multiple !== undefined) {
+ elm.setAttribute('multiple', 'multiple');
+ }
+ return elm
+}
+
+function createElementNS (namespace, tagName) {
+ return document.createElementNS(namespaceMap[namespace], tagName)
+}
+
+function createTextNode (text) {
+ return document.createTextNode(text)
+}
+
+function createComment (text) {
+ return document.createComment(text)
+}
+
+function insertBefore (parentNode, newNode, referenceNode) {
+ parentNode.insertBefore(newNode, referenceNode);
+}
+
+function removeChild (node, child) {
+ node.removeChild(child);
+}
+
+function appendChild (node, child) {
+ node.appendChild(child);
+}
+
+function parentNode (node) {
+ return node.parentNode
+}
+
+function nextSibling (node) {
+ return node.nextSibling
+}
+
+function tagName (node) {
+ return node.tagName
+}
+
+function setTextContent (node, text) {
+ node.textContent = text;
+}
+
+function setStyleScope (node, scopeId) {
+ node.setAttribute(scopeId, '');
+}
+
+var nodeOps = /*#__PURE__*/Object.freeze({
+ createElement: createElement$1,
+ createElementNS: createElementNS,
+ createTextNode: createTextNode,
+ createComment: createComment,
+ insertBefore: insertBefore,
+ removeChild: removeChild,
+ appendChild: appendChild,
+ parentNode: parentNode,
+ nextSibling: nextSibling,
+ tagName: tagName,
+ setTextContent: setTextContent,
+ setStyleScope: setStyleScope
+});
+
+/* */
+
+var ref = {
+ create: function create (_, vnode) {
+ registerRef(vnode);
+ },
+ update: function update (oldVnode, vnode) {
+ if (oldVnode.data.ref !== vnode.data.ref) {
+ registerRef(oldVnode, true);
+ registerRef(vnode);
+ }
+ },
+ destroy: function destroy (vnode) {
+ registerRef(vnode, true);
+ }
+};
+
+function registerRef (vnode, isRemoval) {
+ var key = vnode.data.ref;
+ if (!isDef(key)) { return }
+
+ var vm = vnode.context;
+ var ref = vnode.componentInstance || vnode.elm;
+ var refs = vm.$refs;
+ if (isRemoval) {
+ if (Array.isArray(refs[key])) {
+ remove(refs[key], ref);
+ } else if (refs[key] === ref) {
+ refs[key] = undefined;
+ }
+ } else {
+ if (vnode.data.refInFor) {
+ if (!Array.isArray(refs[key])) {
+ refs[key] = [ref];
+ } else if (refs[key].indexOf(ref) < 0) {
+ // $flow-disable-line
+ refs[key].push(ref);
+ }
+ } else {
+ refs[key] = ref;
+ }
+ }
+}
+
+/**
+ * Virtual DOM patching algorithm based on Snabbdom by
+ * Simon Friis Vindum (@paldepind)
+ * Licensed under the MIT License
+ * https://github.com/paldepind/snabbdom/blob/master/LICENSE
+ *
+ * modified by Evan You (@yyx990803)
+ *
+ * Not type-checking this because this file is perf-critical and the cost
+ * of making flow understand it is not worth it.
+ */
+
+var emptyNode = new VNode('', {}, []);
+
+var hooks = ['create', 'activate', 'update', 'remove', 'destroy'];
+
+function sameVnode (a, b) {
+ return (
+ a.key === b.key && (
+ (
+ a.tag === b.tag &&
+ a.isComment === b.isComment &&
+ isDef(a.data) === isDef(b.data) &&
+ sameInputType(a, b)
+ ) || (
+ isTrue(a.isAsyncPlaceholder) &&
+ a.asyncFactory === b.asyncFactory &&
+ isUndef(b.asyncFactory.error)
+ )
+ )
+ )
+}
+
+function sameInputType (a, b) {
+ if (a.tag !== 'input') { return true }
+ var i;
+ var typeA = isDef(i = a.data) && isDef(i = i.attrs) && i.type;
+ var typeB = isDef(i = b.data) && isDef(i = i.attrs) && i.type;
+ return typeA === typeB || isTextInputType(typeA) && isTextInputType(typeB)
+}
+
+function createKeyToOldIdx (children, beginIdx, endIdx) {
+ var i, key;
+ var map = {};
+ for (i = beginIdx; i <= endIdx; ++i) {
+ key = children[i].key;
+ if (isDef(key)) { map[key] = i; }
+ }
+ return map
+}
+
+function createPatchFunction (backend) {
+ var i, j;
+ var cbs = {};
+
+ var modules = backend.modules;
+ var nodeOps = backend.nodeOps;
+
+ for (i = 0; i < hooks.length; ++i) {
+ cbs[hooks[i]] = [];
+ for (j = 0; j < modules.length; ++j) {
+ if (isDef(modules[j][hooks[i]])) {
+ cbs[hooks[i]].push(modules[j][hooks[i]]);
+ }
+ }
+ }
+
+ function emptyNodeAt (elm) {
+ return new VNode(nodeOps.tagName(elm).toLowerCase(), {}, [], undefined, elm)
+ }
+
+ function createRmCb (childElm, listeners) {
+ function remove$$1 () {
+ if (--remove$$1.listeners === 0) {
+ removeNode(childElm);
+ }
+ }
+ remove$$1.listeners = listeners;
+ return remove$$1
+ }
+
+ function removeNode (el) {
+ var parent = nodeOps.parentNode(el);
+ // element may have already been removed due to v-html / v-text
+ if (isDef(parent)) {
+ nodeOps.removeChild(parent, el);
+ }
+ }
+
+ function isUnknownElement$$1 (vnode, inVPre) {
+ return (
+ !inVPre &&
+ !vnode.ns &&
+ !(
+ config.ignoredElements.length &&
+ config.ignoredElements.some(function (ignore) {
+ return isRegExp(ignore)
+ ? ignore.test(vnode.tag)
+ : ignore === vnode.tag
+ })
+ ) &&
+ config.isUnknownElement(vnode.tag)
+ )
+ }
+
+ var creatingElmInVPre = 0;
+
+ function createElm (
+ vnode,
+ insertedVnodeQueue,
+ parentElm,
+ refElm,
+ nested,
+ ownerArray,
+ index
+ ) {
+ if (isDef(vnode.elm) && isDef(ownerArray)) {
+ // This vnode was used in a previous render!
+ // now it's used as a new node, overwriting its elm would cause
+ // potential patch errors down the road when it's used as an insertion
+ // reference node. Instead, we clone the node on-demand before creating
+ // associated DOM element for it.
+ vnode = ownerArray[index] = cloneVNode(vnode);
+ }
+
+ vnode.isRootInsert = !nested; // for transition enter check
+ if (createComponent(vnode, insertedVnodeQueue, parentElm, refElm)) {
+ return
+ }
+
+ var data = vnode.data;
+ var children = vnode.children;
+ var tag = vnode.tag;
+ if (isDef(tag)) {
+ {
+ if (data && data.pre) {
+ creatingElmInVPre++;
+ }
+ if (isUnknownElement$$1(vnode, creatingElmInVPre)) {
+ warn(
+ 'Unknown custom element: <' + tag + '> - did you ' +
+ 'register the component correctly? For recursive components, ' +
+ 'make sure to provide the "name" option.',
+ vnode.context
+ );
+ }
+ }
+
+ vnode.elm = vnode.ns
+ ? nodeOps.createElementNS(vnode.ns, tag)
+ : nodeOps.createElement(tag, vnode);
+ setScope(vnode);
+
+ /* istanbul ignore if */
+ {
+ createChildren(vnode, children, insertedVnodeQueue);
+ if (isDef(data)) {
+ invokeCreateHooks(vnode, insertedVnodeQueue);
+ }
+ insert(parentElm, vnode.elm, refElm);
+ }
+
+ if (data && data.pre) {
+ creatingElmInVPre--;
+ }
+ } else if (isTrue(vnode.isComment)) {
+ vnode.elm = nodeOps.createComment(vnode.text);
+ insert(parentElm, vnode.elm, refElm);
+ } else {
+ vnode.elm = nodeOps.createTextNode(vnode.text);
+ insert(parentElm, vnode.elm, refElm);
+ }
+ }
+
+ function createComponent (vnode, insertedVnodeQueue, parentElm, refElm) {
+ var i = vnode.data;
+ if (isDef(i)) {
+ var isReactivated = isDef(vnode.componentInstance) && i.keepAlive;
+ if (isDef(i = i.hook) && isDef(i = i.init)) {
+ i(vnode, false /* hydrating */);
+ }
+ // after calling the init hook, if the vnode is a child component
+ // it should've created a child instance and mounted it. the child
+ // component also has set the placeholder vnode's elm.
+ // in that case we can just return the element and be done.
+ if (isDef(vnode.componentInstance)) {
+ initComponent(vnode, insertedVnodeQueue);
+ insert(parentElm, vnode.elm, refElm);
+ if (isTrue(isReactivated)) {
+ reactivateComponent(vnode, insertedVnodeQueue, parentElm, refElm);
+ }
+ return true
+ }
+ }
+ }
+
+ function initComponent (vnode, insertedVnodeQueue) {
+ if (isDef(vnode.data.pendingInsert)) {
+ insertedVnodeQueue.push.apply(insertedVnodeQueue, vnode.data.pendingInsert);
+ vnode.data.pendingInsert = null;
+ }
+ vnode.elm = vnode.componentInstance.$el;
+ if (isPatchable(vnode)) {
+ invokeCreateHooks(vnode, insertedVnodeQueue);
+ setScope(vnode);
+ } else {
+ // empty component root.
+ // skip all element-related modules except for ref (#3455)
+ registerRef(vnode);
+ // make sure to invoke the insert hook
+ insertedVnodeQueue.push(vnode);
+ }
+ }
+
+ function reactivateComponent (vnode, insertedVnodeQueue, parentElm, refElm) {
+ var i;
+ // hack for #4339: a reactivated component with inner transition
+ // does not trigger because the inner node's created hooks are not called
+ // again. It's not ideal to involve module-specific logic in here but
+ // there doesn't seem to be a better way to do it.
+ var innerNode = vnode;
+ while (innerNode.componentInstance) {
+ innerNode = innerNode.componentInstance._vnode;
+ if (isDef(i = innerNode.data) && isDef(i = i.transition)) {
+ for (i = 0; i < cbs.activate.length; ++i) {
+ cbs.activate[i](emptyNode, innerNode);
+ }
+ insertedVnodeQueue.push(innerNode);
+ break
+ }
+ }
+ // unlike a newly created component,
+ // a reactivated keep-alive component doesn't insert itself
+ insert(parentElm, vnode.elm, refElm);
+ }
+
+ function insert (parent, elm, ref$$1) {
+ if (isDef(parent)) {
+ if (isDef(ref$$1)) {
+ if (nodeOps.parentNode(ref$$1) === parent) {
+ nodeOps.insertBefore(parent, elm, ref$$1);
+ }
+ } else {
+ nodeOps.appendChild(parent, elm);
+ }
+ }
+ }
+
+ function createChildren (vnode, children, insertedVnodeQueue) {
+ if (Array.isArray(children)) {
+ {
+ checkDuplicateKeys(children);
+ }
+ for (var i = 0; i < children.length; ++i) {
+ createElm(children[i], insertedVnodeQueue, vnode.elm, null, true, children, i);
+ }
+ } else if (isPrimitive(vnode.text)) {
+ nodeOps.appendChild(vnode.elm, nodeOps.createTextNode(String(vnode.text)));
+ }
+ }
+
+ function isPatchable (vnode) {
+ while (vnode.componentInstance) {
+ vnode = vnode.componentInstance._vnode;
+ }
+ return isDef(vnode.tag)
+ }
+
+ function invokeCreateHooks (vnode, insertedVnodeQueue) {
+ for (var i$1 = 0; i$1 < cbs.create.length; ++i$1) {
+ cbs.create[i$1](emptyNode, vnode);
+ }
+ i = vnode.data.hook; // Reuse variable
+ if (isDef(i)) {
+ if (isDef(i.create)) { i.create(emptyNode, vnode); }
+ if (isDef(i.insert)) { insertedVnodeQueue.push(vnode); }
+ }
+ }
+
+ // set scope id attribute for scoped CSS.
+ // this is implemented as a special case to avoid the overhead
+ // of going through the normal attribute patching process.
+ function setScope (vnode) {
+ var i;
+ if (isDef(i = vnode.fnScopeId)) {
+ nodeOps.setStyleScope(vnode.elm, i);
+ } else {
+ var ancestor = vnode;
+ while (ancestor) {
+ if (isDef(i = ancestor.context) && isDef(i = i.$options._scopeId)) {
+ nodeOps.setStyleScope(vnode.elm, i);
+ }
+ ancestor = ancestor.parent;
+ }
+ }
+ // for slot content they should also get the scopeId from the host instance.
+ if (isDef(i = activeInstance) &&
+ i !== vnode.context &&
+ i !== vnode.fnContext &&
+ isDef(i = i.$options._scopeId)
+ ) {
+ nodeOps.setStyleScope(vnode.elm, i);
+ }
+ }
+
+ function addVnodes (parentElm, refElm, vnodes, startIdx, endIdx, insertedVnodeQueue) {
+ for (; startIdx <= endIdx; ++startIdx) {
+ createElm(vnodes[startIdx], insertedVnodeQueue, parentElm, refElm, false, vnodes, startIdx);
+ }
+ }
+
+ function invokeDestroyHook (vnode) {
+ var i, j;
+ var data = vnode.data;
+ if (isDef(data)) {
+ if (isDef(i = data.hook) && isDef(i = i.destroy)) { i(vnode); }
+ for (i = 0; i < cbs.destroy.length; ++i) { cbs.destroy[i](vnode); }
+ }
+ if (isDef(i = vnode.children)) {
+ for (j = 0; j < vnode.children.length; ++j) {
+ invokeDestroyHook(vnode.children[j]);
+ }
+ }
+ }
+
+ function removeVnodes (parentElm, vnodes, startIdx, endIdx) {
+ for (; startIdx <= endIdx; ++startIdx) {
+ var ch = vnodes[startIdx];
+ if (isDef(ch)) {
+ if (isDef(ch.tag)) {
+ removeAndInvokeRemoveHook(ch);
+ invokeDestroyHook(ch);
+ } else { // Text node
+ removeNode(ch.elm);
+ }
+ }
+ }
+ }
+
+ function removeAndInvokeRemoveHook (vnode, rm) {
+ if (isDef(rm) || isDef(vnode.data)) {
+ var i;
+ var listeners = cbs.remove.length + 1;
+ if (isDef(rm)) {
+ // we have a recursively passed down rm callback
+ // increase the listeners count
+ rm.listeners += listeners;
+ } else {
+ // directly removing
+ rm = createRmCb(vnode.elm, listeners);
+ }
+ // recursively invoke hooks on child component root node
+ if (isDef(i = vnode.componentInstance) && isDef(i = i._vnode) && isDef(i.data)) {
+ removeAndInvokeRemoveHook(i, rm);
+ }
+ for (i = 0; i < cbs.remove.length; ++i) {
+ cbs.remove[i](vnode, rm);
+ }
+ if (isDef(i = vnode.data.hook) && isDef(i = i.remove)) {
+ i(vnode, rm);
+ } else {
+ rm();
+ }
+ } else {
+ removeNode(vnode.elm);
+ }
+ }
+
+ function updateChildren (parentElm, oldCh, newCh, insertedVnodeQueue, removeOnly) {
+ var oldStartIdx = 0;
+ var newStartIdx = 0;
+ var oldEndIdx = oldCh.length - 1;
+ var oldStartVnode = oldCh[0];
+ var oldEndVnode = oldCh[oldEndIdx];
+ var newEndIdx = newCh.length - 1;
+ var newStartVnode = newCh[0];
+ var newEndVnode = newCh[newEndIdx];
+ var oldKeyToIdx, idxInOld, vnodeToMove, refElm;
+
+ // removeOnly is a special flag used only by <transition-group>
+ // to ensure removed elements stay in correct relative positions
+ // during leaving transitions
+ var canMove = !removeOnly;
+
+ {
+ checkDuplicateKeys(newCh);
+ }
+
+ while (oldStartIdx <= oldEndIdx && newStartIdx <= newEndIdx) {
+ if (isUndef(oldStartVnode)) {
+ oldStartVnode = oldCh[++oldStartIdx]; // Vnode has been moved left
+ } else if (isUndef(oldEndVnode)) {
+ oldEndVnode = oldCh[--oldEndIdx];
+ } else if (sameVnode(oldStartVnode, newStartVnode)) {
+ patchVnode(oldStartVnode, newStartVnode, insertedVnodeQueue, newCh, newStartIdx);
+ oldStartVnode = oldCh[++oldStartIdx];
+ newStartVnode = newCh[++newStartIdx];
+ } else if (sameVnode(oldEndVnode, newEndVnode)) {
+ patchVnode(oldEndVnode, newEndVnode, insertedVnodeQueue, newCh, newEndIdx);
+ oldEndVnode = oldCh[--oldEndIdx];
+ newEndVnode = newCh[--newEndIdx];
+ } else if (sameVnode(oldStartVnode, newEndVnode)) { // Vnode moved right
+ patchVnode(oldStartVnode, newEndVnode, insertedVnodeQueue, newCh, newEndIdx);
+ canMove && nodeOps.insertBefore(parentElm, oldStartVnode.elm, nodeOps.nextSibling(oldEndVnode.elm));
+ oldStartVnode = oldCh[++oldStartIdx];
+ newEndVnode = newCh[--newEndIdx];
+ } else if (sameVnode(oldEndVnode, newStartVnode)) { // Vnode moved left
+ patchVnode(oldEndVnode, newStartVnode, insertedVnodeQueue, newCh, newStartIdx);
+ canMove && nodeOps.insertBefore(parentElm, oldEndVnode.elm, oldStartVnode.elm);
+ oldEndVnode = oldCh[--oldEndIdx];
+ newStartVnode = newCh[++newStartIdx];
+ } else {
+ if (isUndef(oldKeyToIdx)) { oldKeyToIdx = createKeyToOldIdx(oldCh, oldStartIdx, oldEndIdx); }
+ idxInOld = isDef(newStartVnode.key)
+ ? oldKeyToIdx[newStartVnode.key]
+ : findIdxInOld(newStartVnode, oldCh, oldStartIdx, oldEndIdx);
+ if (isUndef(idxInOld)) { // New element
+ createElm(newStartVnode, insertedVnodeQueue, parentElm, oldStartVnode.elm, false, newCh, newStartIdx);
+ } else {
+ vnodeToMove = oldCh[idxInOld];
+ if (sameVnode(vnodeToMove, newStartVnode)) {
+ patchVnode(vnodeToMove, newStartVnode, insertedVnodeQueue, newCh, newStartIdx);
+ oldCh[idxInOld] = undefined;
+ canMove && nodeOps.insertBefore(parentElm, vnodeToMove.elm, oldStartVnode.elm);
+ } else {
+ // same key but different element. treat as new element
+ createElm(newStartVnode, insertedVnodeQueue, parentElm, oldStartVnode.elm, false, newCh, newStartIdx);
+ }
+ }
+ newStartVnode = newCh[++newStartIdx];
+ }
+ }
+ if (oldStartIdx > oldEndIdx) {
+ refElm = isUndef(newCh[newEndIdx + 1]) ? null : newCh[newEndIdx + 1].elm;
+ addVnodes(parentElm, refElm, newCh, newStartIdx, newEndIdx, insertedVnodeQueue);
+ } else if (newStartIdx > newEndIdx) {
+ removeVnodes(parentElm, oldCh, oldStartIdx, oldEndIdx);
+ }
+ }
+
+ function checkDuplicateKeys (children) {
+ var seenKeys = {};
+ for (var i = 0; i < children.length; i++) {
+ var vnode = children[i];
+ var key = vnode.key;
+ if (isDef(key)) {
+ if (seenKeys[key]) {
+ warn(
+ ("Duplicate keys detected: '" + key + "'. This may cause an update error."),
+ vnode.context
+ );
+ } else {
+ seenKeys[key] = true;
+ }
+ }
+ }
+ }
+
+ function findIdxInOld (node, oldCh, start, end) {
+ for (var i = start; i < end; i++) {
+ var c = oldCh[i];
+ if (isDef(c) && sameVnode(node, c)) { return i }
+ }
+ }
+
+ function patchVnode (
+ oldVnode,
+ vnode,
+ insertedVnodeQueue,
+ ownerArray,
+ index,
+ removeOnly
+ ) {
+ if (oldVnode === vnode) {
+ return
+ }
+
+ if (isDef(vnode.elm) && isDef(ownerArray)) {
+ // clone reused vnode
+ vnode = ownerArray[index] = cloneVNode(vnode);
+ }
+
+ var elm = vnode.elm = oldVnode.elm;
+
+ if (isTrue(oldVnode.isAsyncPlaceholder)) {
+ if (isDef(vnode.asyncFactory.resolved)) {
+ hydrate(oldVnode.elm, vnode, insertedVnodeQueue);
+ } else {
+ vnode.isAsyncPlaceholder = true;
+ }
+ return
+ }
+
+ // reuse element for static trees.
+ // note we only do this if the vnode is cloned -
+ // if the new node is not cloned it means the render functions have been
+ // reset by the hot-reload-api and we need to do a proper re-render.
+ if (isTrue(vnode.isStatic) &&
+ isTrue(oldVnode.isStatic) &&
+ vnode.key === oldVnode.key &&
+ (isTrue(vnode.isCloned) || isTrue(vnode.isOnce))
+ ) {
+ vnode.componentInstance = oldVnode.componentInstance;
+ return
+ }
+
+ var i;
+ var data = vnode.data;
+ if (isDef(data) && isDef(i = data.hook) && isDef(i = i.prepatch)) {
+ i(oldVnode, vnode);
+ }
+
+ var oldCh = oldVnode.children;
+ var ch = vnode.children;
+ if (isDef(data) && isPatchable(vnode)) {
+ for (i = 0; i < cbs.update.length; ++i) { cbs.update[i](oldVnode, vnode); }
+ if (isDef(i = data.hook) && isDef(i = i.update)) { i(oldVnode, vnode); }
+ }
+ if (isUndef(vnode.text)) {
+ if (isDef(oldCh) && isDef(ch)) {
+ if (oldCh !== ch) { updateChildren(elm, oldCh, ch, insertedVnodeQueue, removeOnly); }
+ } else if (isDef(ch)) {
+ {
+ checkDuplicateKeys(ch);
+ }
+ if (isDef(oldVnode.text)) { nodeOps.setTextContent(elm, ''); }
+ addVnodes(elm, null, ch, 0, ch.length - 1, insertedVnodeQueue);
+ } else if (isDef(oldCh)) {
+ removeVnodes(elm, oldCh, 0, oldCh.length - 1);
+ } else if (isDef(oldVnode.text)) {
+ nodeOps.setTextContent(elm, '');
+ }
+ } else if (oldVnode.text !== vnode.text) {
+ nodeOps.setTextContent(elm, vnode.text);
+ }
+ if (isDef(data)) {
+ if (isDef(i = data.hook) && isDef(i = i.postpatch)) { i(oldVnode, vnode); }
+ }
+ }
+
+ function invokeInsertHook (vnode, queue, initial) {
+ // delay insert hooks for component root nodes, invoke them after the
+ // element is really inserted
+ if (isTrue(initial) && isDef(vnode.parent)) {
+ vnode.parent.data.pendingInsert = queue;
+ } else {
+ for (var i = 0; i < queue.length; ++i) {
+ queue[i].data.hook.insert(queue[i]);
+ }
+ }
+ }
+
+ var hydrationBailed = false;
+ // list of modules that can skip create hook during hydration because they
+ // are already rendered on the client or has no need for initialization
+ // Note: style is excluded because it relies on initial clone for future
+ // deep updates (#7063).
+ var isRenderedModule = makeMap('attrs,class,staticClass,staticStyle,key');
+
+ // Note: this is a browser-only function so we can assume elms are DOM nodes.
+ function hydrate (elm, vnode, insertedVnodeQueue, inVPre) {
+ var i;
+ var tag = vnode.tag;
+ var data = vnode.data;
+ var children = vnode.children;
+ inVPre = inVPre || (data && data.pre);
+ vnode.elm = elm;
+
+ if (isTrue(vnode.isComment) && isDef(vnode.asyncFactory)) {
+ vnode.isAsyncPlaceholder = true;
+ return true
+ }
+ // assert node match
+ {
+ if (!assertNodeMatch(elm, vnode, inVPre)) {
+ return false
+ }
+ }
+ if (isDef(data)) {
+ if (isDef(i = data.hook) && isDef(i = i.init)) { i(vnode, true /* hydrating */); }
+ if (isDef(i = vnode.componentInstance)) {
+ // child component. it should have hydrated its own tree.
+ initComponent(vnode, insertedVnodeQueue);
+ return true
+ }
+ }
+ if (isDef(tag)) {
+ if (isDef(children)) {
+ // empty element, allow client to pick up and populate children
+ if (!elm.hasChildNodes()) {
+ createChildren(vnode, children, insertedVnodeQueue);
+ } else {
+ // v-html and domProps: innerHTML
+ if (isDef(i = data) && isDef(i = i.domProps) && isDef(i = i.innerHTML)) {
+ if (i !== elm.innerHTML) {
+ /* istanbul ignore if */
+ if (typeof console !== 'undefined' &&
+ !hydrationBailed
+ ) {
+ hydrationBailed = true;
+ console.warn('Parent: ', elm);
+ console.warn('server innerHTML: ', i);
+ console.warn('client innerHTML: ', elm.innerHTML);
+ }
+ return false
+ }
+ } else {
+ // iterate and compare children lists
+ var childrenMatch = true;
+ var childNode = elm.firstChild;
+ for (var i$1 = 0; i$1 < children.length; i$1++) {
+ if (!childNode || !hydrate(childNode, children[i$1], insertedVnodeQueue, inVPre)) {
+ childrenMatch = false;
+ break
+ }
+ childNode = childNode.nextSibling;
+ }
+ // if childNode is not null, it means the actual childNodes list is
+ // longer than the virtual children list.
+ if (!childrenMatch || childNode) {
+ /* istanbul ignore if */
+ if (typeof console !== 'undefined' &&
+ !hydrationBailed
+ ) {
+ hydrationBailed = true;
+ console.warn('Parent: ', elm);
+ console.warn('Mismatching childNodes vs. VNodes: ', elm.childNodes, children);
+ }
+ return false
+ }
+ }
+ }
+ }
+ if (isDef(data)) {
+ var fullInvoke = false;
+ for (var key in data) {
+ if (!isRenderedModule(key)) {
+ fullInvoke = true;
+ invokeCreateHooks(vnode, insertedVnodeQueue);
+ break
+ }
+ }
+ if (!fullInvoke && data['class']) {
+ // ensure collecting deps for deep class bindings for future updates
+ traverse(data['class']);
+ }
+ }
+ } else if (elm.data !== vnode.text) {
+ elm.data = vnode.text;
+ }
+ return true
+ }
+
+ function assertNodeMatch (node, vnode, inVPre) {
+ if (isDef(vnode.tag)) {
+ return vnode.tag.indexOf('vue-component') === 0 || (
+ !isUnknownElement$$1(vnode, inVPre) &&
+ vnode.tag.toLowerCase() === (node.tagName && node.tagName.toLowerCase())
+ )
+ } else {
+ return node.nodeType === (vnode.isComment ? 8 : 3)
+ }
+ }
+
+ return function patch (oldVnode, vnode, hydrating, removeOnly) {
+ if (isUndef(vnode)) {
+ if (isDef(oldVnode)) { invokeDestroyHook(oldVnode); }
+ return
+ }
+
+ var isInitialPatch = false;
+ var insertedVnodeQueue = [];
+
+ if (isUndef(oldVnode)) {
+ // empty mount (likely as component), create new root element
+ isInitialPatch = true;
+ createElm(vnode, insertedVnodeQueue);
+ } else {
+ var isRealElement = isDef(oldVnode.nodeType);
+ if (!isRealElement && sameVnode(oldVnode, vnode)) {
+ // patch existing root node
+ patchVnode(oldVnode, vnode, insertedVnodeQueue, null, null, removeOnly);
+ } else {
+ if (isRealElement) {
+ // mounting to a real element
+ // check if this is server-rendered content and if we can perform
+ // a successful hydration.
+ if (oldVnode.nodeType === 1 && oldVnode.hasAttribute(SSR_ATTR)) {
+ oldVnode.removeAttribute(SSR_ATTR);
+ hydrating = true;
+ }
+ if (isTrue(hydrating)) {
+ if (hydrate(oldVnode, vnode, insertedVnodeQueue)) {
+ invokeInsertHook(vnode, insertedVnodeQueue, true);
+ return oldVnode
+ } else {
+ warn(
+ 'The client-side rendered virtual DOM tree is not matching ' +
+ 'server-rendered content. This is likely caused by incorrect ' +
+ 'HTML markup, for example nesting block-level elements inside ' +
+ '<p>, or missing <tbody>. Bailing hydration and performing ' +
+ 'full client-side render.'
+ );
+ }
+ }
+ // either not server-rendered, or hydration failed.
+ // create an empty node and replace it
+ oldVnode = emptyNodeAt(oldVnode);
+ }
+
+ // replacing existing element
+ var oldElm = oldVnode.elm;
+ var parentElm = nodeOps.parentNode(oldElm);
+
+ // create new node
+ createElm(
+ vnode,
+ insertedVnodeQueue,
+ // extremely rare edge case: do not insert if old element is in a
+ // leaving transition. Only happens when combining transition +
+ // keep-alive + HOCs. (#4590)
+ oldElm._leaveCb ? null : parentElm,
+ nodeOps.nextSibling(oldElm)
+ );
+
+ // update parent placeholder node element, recursively
+ if (isDef(vnode.parent)) {
+ var ancestor = vnode.parent;
+ var patchable = isPatchable(vnode);
+ while (ancestor) {
+ for (var i = 0; i < cbs.destroy.length; ++i) {
+ cbs.destroy[i](ancestor);
+ }
+ ancestor.elm = vnode.elm;
+ if (patchable) {
+ for (var i$1 = 0; i$1 < cbs.create.length; ++i$1) {
+ cbs.create[i$1](emptyNode, ancestor);
+ }
+ // #6513
+ // invoke insert hooks that may have been merged by create hooks.
+ // e.g. for directives that uses the "inserted" hook.
+ var insert = ancestor.data.hook.insert;
+ if (insert.merged) {
+ // start at index 1 to avoid re-invoking component mounted hook
+ for (var i$2 = 1; i$2 < insert.fns.length; i$2++) {
+ insert.fns[i$2]();
+ }
+ }
+ } else {
+ registerRef(ancestor);
+ }
+ ancestor = ancestor.parent;
+ }
+ }
+
+ // destroy old node
+ if (isDef(parentElm)) {
+ removeVnodes(parentElm, [oldVnode], 0, 0);
+ } else if (isDef(oldVnode.tag)) {
+ invokeDestroyHook(oldVnode);
+ }
+ }
+ }
+
+ invokeInsertHook(vnode, insertedVnodeQueue, isInitialPatch);
+ return vnode.elm
+ }
+}
+
+/* */
+
+var directives = {
+ create: updateDirectives,
+ update: updateDirectives,
+ destroy: function unbindDirectives (vnode) {
+ updateDirectives(vnode, emptyNode);
+ }
+};
+
+function updateDirectives (oldVnode, vnode) {
+ if (oldVnode.data.directives || vnode.data.directives) {
+ _update(oldVnode, vnode);
+ }
+}
+
+function _update (oldVnode, vnode) {
+ var isCreate = oldVnode === emptyNode;
+ var isDestroy = vnode === emptyNode;
+ var oldDirs = normalizeDirectives$1(oldVnode.data.directives, oldVnode.context);
+ var newDirs = normalizeDirectives$1(vnode.data.directives, vnode.context);
+
+ var dirsWithInsert = [];
+ var dirsWithPostpatch = [];
+
+ var key, oldDir, dir;
+ for (key in newDirs) {
+ oldDir = oldDirs[key];
+ dir = newDirs[key];
+ if (!oldDir) {
+ // new directive, bind
+ callHook$1(dir, 'bind', vnode, oldVnode);
+ if (dir.def && dir.def.inserted) {
+ dirsWithInsert.push(dir);
+ }
+ } else {
+ // existing directive, update
+ dir.oldValue = oldDir.value;
+ dir.oldArg = oldDir.arg;
+ callHook$1(dir, 'update', vnode, oldVnode);
+ if (dir.def && dir.def.componentUpdated) {
+ dirsWithPostpatch.push(dir);
+ }
+ }
+ }
+
+ if (dirsWithInsert.length) {
+ var callInsert = function () {
+ for (var i = 0; i < dirsWithInsert.length; i++) {
+ callHook$1(dirsWithInsert[i], 'inserted', vnode, oldVnode);
+ }
+ };
+ if (isCreate) {
+ mergeVNodeHook(vnode, 'insert', callInsert);
+ } else {
+ callInsert();
+ }
+ }
+
+ if (dirsWithPostpatch.length) {
+ mergeVNodeHook(vnode, 'postpatch', function () {
+ for (var i = 0; i < dirsWithPostpatch.length; i++) {
+ callHook$1(dirsWithPostpatch[i], 'componentUpdated', vnode, oldVnode);
+ }
+ });
+ }
+
+ if (!isCreate) {
+ for (key in oldDirs) {
+ if (!newDirs[key]) {
+ // no longer present, unbind
+ callHook$1(oldDirs[key], 'unbind', oldVnode, oldVnode, isDestroy);
+ }
+ }
+ }
+}
+
+var emptyModifiers = Object.create(null);
+
+function normalizeDirectives$1 (
+ dirs,
+ vm
+) {
+ var res = Object.create(null);
+ if (!dirs) {
+ // $flow-disable-line
+ return res
+ }
+ var i, dir;
+ for (i = 0; i < dirs.length; i++) {
+ dir = dirs[i];
+ if (!dir.modifiers) {
+ // $flow-disable-line
+ dir.modifiers = emptyModifiers;
+ }
+ res[getRawDirName(dir)] = dir;
+ dir.def = resolveAsset(vm.$options, 'directives', dir.name, true);
+ }
+ // $flow-disable-line
+ return res
+}
+
+function getRawDirName (dir) {
+ return dir.rawName || ((dir.name) + "." + (Object.keys(dir.modifiers || {}).join('.')))
+}
+
+function callHook$1 (dir, hook, vnode, oldVnode, isDestroy) {
+ var fn = dir.def && dir.def[hook];
+ if (fn) {
+ try {
+ fn(vnode.elm, dir, vnode, oldVnode, isDestroy);
+ } catch (e) {
+ handleError(e, vnode.context, ("directive " + (dir.name) + " " + hook + " hook"));
+ }
+ }
+}
+
+var baseModules = [
+ ref,
+ directives
+];
+
+/* */
+
+function updateAttrs (oldVnode, vnode) {
+ var opts = vnode.componentOptions;
+ if (isDef(opts) && opts.Ctor.options.inheritAttrs === false) {
+ return
+ }
+ if (isUndef(oldVnode.data.attrs) && isUndef(vnode.data.attrs)) {
+ return
+ }
+ var key, cur, old;
+ var elm = vnode.elm;
+ var oldAttrs = oldVnode.data.attrs || {};
+ var attrs = vnode.data.attrs || {};
+ // clone observed objects, as the user probably wants to mutate it
+ if (isDef(attrs.__ob__)) {
+ attrs = vnode.data.attrs = extend({}, attrs);
+ }
+
+ for (key in attrs) {
+ cur = attrs[key];
+ old = oldAttrs[key];
+ if (old !== cur) {
+ setAttr(elm, key, cur);
+ }
+ }
+ // #4391: in IE9, setting type can reset value for input[type=radio]
+ // #6666: IE/Edge forces progress value down to 1 before setting a max
+ /* istanbul ignore if */
+ if ((isIE || isEdge) && attrs.value !== oldAttrs.value) {
+ setAttr(elm, 'value', attrs.value);
+ }
+ for (key in oldAttrs) {
+ if (isUndef(attrs[key])) {
+ if (isXlink(key)) {
+ elm.removeAttributeNS(xlinkNS, getXlinkProp(key));
+ } else if (!isEnumeratedAttr(key)) {
+ elm.removeAttribute(key);
+ }
+ }
+ }
+}
+
+function setAttr (el, key, value) {
+ if (el.tagName.indexOf('-') > -1) {
+ baseSetAttr(el, key, value);
+ } else if (isBooleanAttr(key)) {
+ // set attribute for blank value
+ // e.g. <option disabled>Select one</option>
+ if (isFalsyAttrValue(value)) {
+ el.removeAttribute(key);
+ } else {
+ // technically allowfullscreen is a boolean attribute for <iframe>,
+ // but Flash expects a value of "true" when used on <embed> tag
+ value = key === 'allowfullscreen' && el.tagName === 'EMBED'
+ ? 'true'
+ : key;
+ el.setAttribute(key, value);
+ }
+ } else if (isEnumeratedAttr(key)) {
+ el.setAttribute(key, convertEnumeratedValue(key, value));
+ } else if (isXlink(key)) {
+ if (isFalsyAttrValue(value)) {
+ el.removeAttributeNS(xlinkNS, getXlinkProp(key));
+ } else {
+ el.setAttributeNS(xlinkNS, key, value);
+ }
+ } else {
+ baseSetAttr(el, key, value);
+ }
+}
+
+function baseSetAttr (el, key, value) {
+ if (isFalsyAttrValue(value)) {
+ el.removeAttribute(key);
+ } else {
+ // #7138: IE10 & 11 fires input event when setting placeholder on
+ // <textarea>... block the first input event and remove the blocker
+ // immediately.
+ /* istanbul ignore if */
+ if (
+ isIE && !isIE9 &&
+ el.tagName === 'TEXTAREA' &&
+ key === 'placeholder' && value !== '' && !el.__ieph
+ ) {
+ var blocker = function (e) {
+ e.stopImmediatePropagation();
+ el.removeEventListener('input', blocker);
+ };
+ el.addEventListener('input', blocker);
+ // $flow-disable-line
+ el.__ieph = true; /* IE placeholder patched */
+ }
+ el.setAttribute(key, value);
+ }
+}
+
+var attrs = {
+ create: updateAttrs,
+ update: updateAttrs
+};
+
+/* */
+
+function updateClass (oldVnode, vnode) {
+ var el = vnode.elm;
+ var data = vnode.data;
+ var oldData = oldVnode.data;
+ if (
+ isUndef(data.staticClass) &&
+ isUndef(data.class) && (
+ isUndef(oldData) || (
+ isUndef(oldData.staticClass) &&
+ isUndef(oldData.class)
+ )
+ )
+ ) {
+ return
+ }
+
+ var cls = genClassForVnode(vnode);
+
+ // handle transition classes
+ var transitionClass = el._transitionClasses;
+ if (isDef(transitionClass)) {
+ cls = concat(cls, stringifyClass(transitionClass));
+ }
+
+ // set the class
+ if (cls !== el._prevClass) {
+ el.setAttribute('class', cls);
+ el._prevClass = cls;
+ }
+}
+
+var klass = {
+ create: updateClass,
+ update: updateClass
+};
+
+/* */
+
+var validDivisionCharRE = /[\w).+\-_$\]]/;
+
+function parseFilters (exp) {
+ var inSingle = false;
+ var inDouble = false;
+ var inTemplateString = false;
+ var inRegex = false;
+ var curly = 0;
+ var square = 0;
+ var paren = 0;
+ var lastFilterIndex = 0;
+ var c, prev, i, expression, filters;
+
+ for (i = 0; i < exp.length; i++) {
+ prev = c;
+ c = exp.charCodeAt(i);
+ if (inSingle) {
+ if (c === 0x27 && prev !== 0x5C) { inSingle = false; }
+ } else if (inDouble) {
+ if (c === 0x22 && prev !== 0x5C) { inDouble = false; }
+ } else if (inTemplateString) {
+ if (c === 0x60 && prev !== 0x5C) { inTemplateString = false; }
+ } else if (inRegex) {
+ if (c === 0x2f && prev !== 0x5C) { inRegex = false; }
+ } else if (
+ c === 0x7C && // pipe
+ exp.charCodeAt(i + 1) !== 0x7C &&
+ exp.charCodeAt(i - 1) !== 0x7C &&
+ !curly && !square && !paren
+ ) {
+ if (expression === undefined) {
+ // first filter, end of expression
+ lastFilterIndex = i + 1;
+ expression = exp.slice(0, i).trim();
+ } else {
+ pushFilter();
+ }
+ } else {
+ switch (c) {
+ case 0x22: inDouble = true; break // "
+ case 0x27: inSingle = true; break // '
+ case 0x60: inTemplateString = true; break // `
+ case 0x28: paren++; break // (
+ case 0x29: paren--; break // )
+ case 0x5B: square++; break // [
+ case 0x5D: square--; break // ]
+ case 0x7B: curly++; break // {
+ case 0x7D: curly--; break // }
+ }
+ if (c === 0x2f) { // /
+ var j = i - 1;
+ var p = (void 0);
+ // find first non-whitespace prev char
+ for (; j >= 0; j--) {
+ p = exp.charAt(j);
+ if (p !== ' ') { break }
+ }
+ if (!p || !validDivisionCharRE.test(p)) {
+ inRegex = true;
+ }
+ }
+ }
+ }
+
+ if (expression === undefined) {
+ expression = exp.slice(0, i).trim();
+ } else if (lastFilterIndex !== 0) {
+ pushFilter();
+ }
+
+ function pushFilter () {
+ (filters || (filters = [])).push(exp.slice(lastFilterIndex, i).trim());
+ lastFilterIndex = i + 1;
+ }
+
+ if (filters) {
+ for (i = 0; i < filters.length; i++) {
+ expression = wrapFilter(expression, filters[i]);
+ }
+ }
+
+ return expression
+}
+
+function wrapFilter (exp, filter) {
+ var i = filter.indexOf('(');
+ if (i < 0) {
+ // _f: resolveFilter
+ return ("_f(\"" + filter + "\")(" + exp + ")")
+ } else {
+ var name = filter.slice(0, i);
+ var args = filter.slice(i + 1);
+ return ("_f(\"" + name + "\")(" + exp + (args !== ')' ? ',' + args : args))
+ }
+}
+
+/* */
+
+
+
+/* eslint-disable no-unused-vars */
+function baseWarn (msg, range) {
+ console.error(("[Vue compiler]: " + msg));
+}
+/* eslint-enable no-unused-vars */
+
+function pluckModuleFunction (
+ modules,
+ key
+) {
+ return modules
+ ? modules.map(function (m) { return m[key]; }).filter(function (_) { return _; })
+ : []
+}
+
+function addProp (el, name, value, range, dynamic) {
+ (el.props || (el.props = [])).push(rangeSetItem({ name: name, value: value, dynamic: dynamic }, range));
+ el.plain = false;
+}
+
+function addAttr (el, name, value, range, dynamic) {
+ var attrs = dynamic
+ ? (el.dynamicAttrs || (el.dynamicAttrs = []))
+ : (el.attrs || (el.attrs = []));
+ attrs.push(rangeSetItem({ name: name, value: value, dynamic: dynamic }, range));
+ el.plain = false;
+}
+
+// add a raw attr (use this in preTransforms)
+function addRawAttr (el, name, value, range) {
+ el.attrsMap[name] = value;
+ el.attrsList.push(rangeSetItem({ name: name, value: value }, range));
+}
+
+function addDirective (
+ el,
+ name,
+ rawName,
+ value,
+ arg,
+ isDynamicArg,
+ modifiers,
+ range
+) {
+ (el.directives || (el.directives = [])).push(rangeSetItem({
+ name: name,
+ rawName: rawName,
+ value: value,
+ arg: arg,
+ isDynamicArg: isDynamicArg,
+ modifiers: modifiers
+ }, range));
+ el.plain = false;
+}
+
+function prependModifierMarker (symbol, name, dynamic) {
+ return dynamic
+ ? ("_p(" + name + ",\"" + symbol + "\")")
+ : symbol + name // mark the event as captured
+}
+
+function addHandler (
+ el,
+ name,
+ value,
+ modifiers,
+ important,
+ warn,
+ range,
+ dynamic
+) {
+ modifiers = modifiers || emptyObject;
+ // warn prevent and passive modifier
+ /* istanbul ignore if */
+ if (
+ warn &&
+ modifiers.prevent && modifiers.passive
+ ) {
+ warn(
+ 'passive and prevent can\'t be used together. ' +
+ 'Passive handler can\'t prevent default event.',
+ range
+ );
+ }
+
+ // normalize click.right and click.middle since they don't actually fire
+ // this is technically browser-specific, but at least for now browsers are
+ // the only target envs that have right/middle clicks.
+ if (modifiers.right) {
+ if (dynamic) {
+ name = "(" + name + ")==='click'?'contextmenu':(" + name + ")";
+ } else if (name === 'click') {
+ name = 'contextmenu';
+ delete modifiers.right;
+ }
+ } else if (modifiers.middle) {
+ if (dynamic) {
+ name = "(" + name + ")==='click'?'mouseup':(" + name + ")";
+ } else if (name === 'click') {
+ name = 'mouseup';
+ }
+ }
+
+ // check capture modifier
+ if (modifiers.capture) {
+ delete modifiers.capture;
+ name = prependModifierMarker('!', name, dynamic);
+ }
+ if (modifiers.once) {
+ delete modifiers.once;
+ name = prependModifierMarker('~', name, dynamic);
+ }
+ /* istanbul ignore if */
+ if (modifiers.passive) {
+ delete modifiers.passive;
+ name = prependModifierMarker('&', name, dynamic);
+ }
+
+ var events;
+ if (modifiers.native) {
+ delete modifiers.native;
+ events = el.nativeEvents || (el.nativeEvents = {});
+ } else {
+ events = el.events || (el.events = {});
+ }
+
+ var newHandler = rangeSetItem({ value: value.trim(), dynamic: dynamic }, range);
+ if (modifiers !== emptyObject) {
+ newHandler.modifiers = modifiers;
+ }
+
+ var handlers = events[name];
+ /* istanbul ignore if */
+ if (Array.isArray(handlers)) {
+ important ? handlers.unshift(newHandler) : handlers.push(newHandler);
+ } else if (handlers) {
+ events[name] = important ? [newHandler, handlers] : [handlers, newHandler];
+ } else {
+ events[name] = newHandler;
+ }
+
+ el.plain = false;
+}
+
+function getRawBindingAttr (
+ el,
+ name
+) {
+ return el.rawAttrsMap[':' + name] ||
+ el.rawAttrsMap['v-bind:' + name] ||
+ el.rawAttrsMap[name]
+}
+
+function getBindingAttr (
+ el,
+ name,
+ getStatic
+) {
+ var dynamicValue =
+ getAndRemoveAttr(el, ':' + name) ||
+ getAndRemoveAttr(el, 'v-bind:' + name);
+ if (dynamicValue != null) {
+ return parseFilters(dynamicValue)
+ } else if (getStatic !== false) {
+ var staticValue = getAndRemoveAttr(el, name);
+ if (staticValue != null) {
+ return JSON.stringify(staticValue)
+ }
+ }
+}
+
+// note: this only removes the attr from the Array (attrsList) so that it
+// doesn't get processed by processAttrs.
+// By default it does NOT remove it from the map (attrsMap) because the map is
+// needed during codegen.
+function getAndRemoveAttr (
+ el,
+ name,
+ removeFromMap
+) {
+ var val;
+ if ((val = el.attrsMap[name]) != null) {
+ var list = el.attrsList;
+ for (var i = 0, l = list.length; i < l; i++) {
+ if (list[i].name === name) {
+ list.splice(i, 1);
+ break
+ }
+ }
+ }
+ if (removeFromMap) {
+ delete el.attrsMap[name];
+ }
+ return val
+}
+
+function getAndRemoveAttrByRegex (
+ el,
+ name
+) {
+ var list = el.attrsList;
+ for (var i = 0, l = list.length; i < l; i++) {
+ var attr = list[i];
+ if (name.test(attr.name)) {
+ list.splice(i, 1);
+ return attr
+ }
+ }
+}
+
+function rangeSetItem (
+ item,
+ range
+) {
+ if (range) {
+ if (range.start != null) {
+ item.start = range.start;
+ }
+ if (range.end != null) {
+ item.end = range.end;
+ }
+ }
+ return item
+}
+
+/* */
+
+/**
+ * Cross-platform code generation for component v-model
+ */
+function genComponentModel (
+ el,
+ value,
+ modifiers
+) {
+ var ref = modifiers || {};
+ var number = ref.number;
+ var trim = ref.trim;
+
+ var baseValueExpression = '$$v';
+ var valueExpression = baseValueExpression;
+ if (trim) {
+ valueExpression =
+ "(typeof " + baseValueExpression + " === 'string'" +
+ "? " + baseValueExpression + ".trim()" +
+ ": " + baseValueExpression + ")";
+ }
+ if (number) {
+ valueExpression = "_n(" + valueExpression + ")";
+ }
+ var assignment = genAssignmentCode(value, valueExpression);
+
+ el.model = {
+ value: ("(" + value + ")"),
+ expression: JSON.stringify(value),
+ callback: ("function (" + baseValueExpression + ") {" + assignment + "}")
+ };
+}
+
+/**
+ * Cross-platform codegen helper for generating v-model value assignment code.
+ */
+function genAssignmentCode (
+ value,
+ assignment
+) {
+ var res = parseModel(value);
+ if (res.key === null) {
+ return (value + "=" + assignment)
+ } else {
+ return ("$set(" + (res.exp) + ", " + (res.key) + ", " + assignment + ")")
+ }
+}
+
+/**
+ * Parse a v-model expression into a base path and a final key segment.
+ * Handles both dot-path and possible square brackets.
+ *
+ * Possible cases:
+ *
+ * - test
+ * - test[key]
+ * - test[test1[key]]
+ * - test["a"][key]
+ * - xxx.test[a[a].test1[key]]
+ * - test.xxx.a["asa"][test1[key]]
+ *
+ */
+
+var len, str, chr, index$1, expressionPos, expressionEndPos;
+
+
+
+function parseModel (val) {
+ // Fix https://github.com/vuejs/vue/pull/7730
+ // allow v-model="obj.val " (trailing whitespace)
+ val = val.trim();
+ len = val.length;
+
+ if (val.indexOf('[') < 0 || val.lastIndexOf(']') < len - 1) {
+ index$1 = val.lastIndexOf('.');
+ if (index$1 > -1) {
+ return {
+ exp: val.slice(0, index$1),
+ key: '"' + val.slice(index$1 + 1) + '"'
+ }
+ } else {
+ return {
+ exp: val,
+ key: null
+ }
+ }
+ }
+
+ str = val;
+ index$1 = expressionPos = expressionEndPos = 0;
+
+ while (!eof()) {
+ chr = next();
+ /* istanbul ignore if */
+ if (isStringStart(chr)) {
+ parseString(chr);
+ } else if (chr === 0x5B) {
+ parseBracket(chr);
+ }
+ }
+
+ return {
+ exp: val.slice(0, expressionPos),
+ key: val.slice(expressionPos + 1, expressionEndPos)
+ }
+}
+
+function next () {
+ return str.charCodeAt(++index$1)
+}
+
+function eof () {
+ return index$1 >= len
+}
+
+function isStringStart (chr) {
+ return chr === 0x22 || chr === 0x27
+}
+
+function parseBracket (chr) {
+ var inBracket = 1;
+ expressionPos = index$1;
+ while (!eof()) {
+ chr = next();
+ if (isStringStart(chr)) {
+ parseString(chr);
+ continue
+ }
+ if (chr === 0x5B) { inBracket++; }
+ if (chr === 0x5D) { inBracket--; }
+ if (inBracket === 0) {
+ expressionEndPos = index$1;
+ break
+ }
+ }
+}
+
+function parseString (chr) {
+ var stringQuote = chr;
+ while (!eof()) {
+ chr = next();
+ if (chr === stringQuote) {
+ break
+ }
+ }
+}
+
+/* */
+
+var warn$1;
+
+// in some cases, the event used has to be determined at runtime
+// so we used some reserved tokens during compile.
+var RANGE_TOKEN = '__r';
+var CHECKBOX_RADIO_TOKEN = '__c';
+
+function model (
+ el,
+ dir,
+ _warn
+) {
+ warn$1 = _warn;
+ var value = dir.value;
+ var modifiers = dir.modifiers;
+ var tag = el.tag;
+ var type = el.attrsMap.type;
+
+ {
+ // inputs with type="file" are read only and setting the input's
+ // value will throw an error.
+ if (tag === 'input' && type === 'file') {
+ warn$1(
+ "<" + (el.tag) + " v-model=\"" + value + "\" type=\"file\">:\n" +
+ "File inputs are read only. Use a v-on:change listener instead.",
+ el.rawAttrsMap['v-model']
+ );
+ }
+ }
+
+ if (el.component) {
+ genComponentModel(el, value, modifiers);
+ // component v-model doesn't need extra runtime
+ return false
+ } else if (tag === 'select') {
+ genSelect(el, value, modifiers);
+ } else if (tag === 'input' && type === 'checkbox') {
+ genCheckboxModel(el, value, modifiers);
+ } else if (tag === 'input' && type === 'radio') {
+ genRadioModel(el, value, modifiers);
+ } else if (tag === 'input' || tag === 'textarea') {
+ genDefaultModel(el, value, modifiers);
+ } else if (!config.isReservedTag(tag)) {
+ genComponentModel(el, value, modifiers);
+ // component v-model doesn't need extra runtime
+ return false
+ } else {
+ warn$1(
+ "<" + (el.tag) + " v-model=\"" + value + "\">: " +
+ "v-model is not supported on this element type. " +
+ 'If you are working with contenteditable, it\'s recommended to ' +
+ 'wrap a library dedicated for that purpose inside a custom component.',
+ el.rawAttrsMap['v-model']
+ );
+ }
+
+ // ensure runtime directive metadata
+ return true
+}
+
+function genCheckboxModel (
+ el,
+ value,
+ modifiers
+) {
+ var number = modifiers && modifiers.number;
+ var valueBinding = getBindingAttr(el, 'value') || 'null';
+ var trueValueBinding = getBindingAttr(el, 'true-value') || 'true';
+ var falseValueBinding = getBindingAttr(el, 'false-value') || 'false';
+ addProp(el, 'checked',
+ "Array.isArray(" + value + ")" +
+ "?_i(" + value + "," + valueBinding + ")>-1" + (
+ trueValueBinding === 'true'
+ ? (":(" + value + ")")
+ : (":_q(" + value + "," + trueValueBinding + ")")
+ )
+ );
+ addHandler(el, 'change',
+ "var $$a=" + value + "," +
+ '$$el=$event.target,' +
+ "$$c=$$el.checked?(" + trueValueBinding + "):(" + falseValueBinding + ");" +
+ 'if(Array.isArray($$a)){' +
+ "var $$v=" + (number ? '_n(' + valueBinding + ')' : valueBinding) + "," +
+ '$$i=_i($$a,$$v);' +
+ "if($$el.checked){$$i<0&&(" + (genAssignmentCode(value, '$$a.concat([$$v])')) + ")}" +
+ "else{$$i>-1&&(" + (genAssignmentCode(value, '$$a.slice(0,$$i).concat($$a.slice($$i+1))')) + ")}" +
+ "}else{" + (genAssignmentCode(value, '$$c')) + "}",
+ null, true
+ );
+}
+
+function genRadioModel (
+ el,
+ value,
+ modifiers
+) {
+ var number = modifiers && modifiers.number;
+ var valueBinding = getBindingAttr(el, 'value') || 'null';
+ valueBinding = number ? ("_n(" + valueBinding + ")") : valueBinding;
+ addProp(el, 'checked', ("_q(" + value + "," + valueBinding + ")"));
+ addHandler(el, 'change', genAssignmentCode(value, valueBinding), null, true);
+}
+
+function genSelect (
+ el,
+ value,
+ modifiers
+) {
+ var number = modifiers && modifiers.number;
+ var selectedVal = "Array.prototype.filter" +
+ ".call($event.target.options,function(o){return o.selected})" +
+ ".map(function(o){var val = \"_value\" in o ? o._value : o.value;" +
+ "return " + (number ? '_n(val)' : 'val') + "})";
+
+ var assignment = '$event.target.multiple ? $$selectedVal : $$selectedVal[0]';
+ var code = "var $$selectedVal = " + selectedVal + ";";
+ code = code + " " + (genAssignmentCode(value, assignment));
+ addHandler(el, 'change', code, null, true);
+}
+
+function genDefaultModel (
+ el,
+ value,
+ modifiers
+) {
+ var type = el.attrsMap.type;
+
+ // warn if v-bind:value conflicts with v-model
+ // except for inputs with v-bind:type
+ {
+ var value$1 = el.attrsMap['v-bind:value'] || el.attrsMap[':value'];
+ var typeBinding = el.attrsMap['v-bind:type'] || el.attrsMap[':type'];
+ if (value$1 && !typeBinding) {
+ var binding = el.attrsMap['v-bind:value'] ? 'v-bind:value' : ':value';
+ warn$1(
+ binding + "=\"" + value$1 + "\" conflicts with v-model on the same element " +
+ 'because the latter already expands to a value binding internally',
+ el.rawAttrsMap[binding]
+ );
+ }
+ }
+
+ var ref = modifiers || {};
+ var lazy = ref.lazy;
+ var number = ref.number;
+ var trim = ref.trim;
+ var needCompositionGuard = !lazy && type !== 'range';
+ var event = lazy
+ ? 'change'
+ : type === 'range'
+ ? RANGE_TOKEN
+ : 'input';
+
+ var valueExpression = '$event.target.value';
+ if (trim) {
+ valueExpression = "$event.target.value.trim()";
+ }
+ if (number) {
+ valueExpression = "_n(" + valueExpression + ")";
+ }
+
+ var code = genAssignmentCode(value, valueExpression);
+ if (needCompositionGuard) {
+ code = "if($event.target.composing)return;" + code;
+ }
+
+ addProp(el, 'value', ("(" + value + ")"));
+ addHandler(el, event, code, null, true);
+ if (trim || number) {
+ addHandler(el, 'blur', '$forceUpdate()');
+ }
+}
+
+/* */
+
+// normalize v-model event tokens that can only be determined at runtime.
+// it's important to place the event as the first in the array because
+// the whole point is ensuring the v-model callback gets called before
+// user-attached handlers.
+function normalizeEvents (on) {
+ /* istanbul ignore if */
+ if (isDef(on[RANGE_TOKEN])) {
+ // IE input[type=range] only supports `change` event
+ var event = isIE ? 'change' : 'input';
+ on[event] = [].concat(on[RANGE_TOKEN], on[event] || []);
+ delete on[RANGE_TOKEN];
+ }
+ // This was originally intended to fix #4521 but no longer necessary
+ // after 2.5. Keeping it for backwards compat with generated code from < 2.4
+ /* istanbul ignore if */
+ if (isDef(on[CHECKBOX_RADIO_TOKEN])) {
+ on.change = [].concat(on[CHECKBOX_RADIO_TOKEN], on.change || []);
+ delete on[CHECKBOX_RADIO_TOKEN];
+ }
+}
+
+var target$1;
+
+function createOnceHandler$1 (event, handler, capture) {
+ var _target = target$1; // save current target element in closure
+ return function onceHandler () {
+ var res = handler.apply(null, arguments);
+ if (res !== null) {
+ remove$2(event, onceHandler, capture, _target);
+ }
+ }
+}
+
+// #9446: Firefox <= 53 (in particular, ESR 52) has incorrect Event.timeStamp
+// implementation and does not fire microtasks in between event propagation, so
+// safe to exclude.
+var useMicrotaskFix = isUsingMicroTask && !(isFF && Number(isFF[1]) <= 53);
+
+function add$1 (
+ name,
+ handler,
+ capture,
+ passive
+) {
+ // async edge case #6566: inner click event triggers patch, event handler
+ // attached to outer element during patch, and triggered again. This
+ // happens because browsers fire microtask ticks between event propagation.
+ // the solution is simple: we save the timestamp when a handler is attached,
+ // and the handler would only fire if the event passed to it was fired
+ // AFTER it was attached.
+ if (useMicrotaskFix) {
+ var attachedTimestamp = currentFlushTimestamp;
+ var original = handler;
+ handler = original._wrapper = function (e) {
+ if (
+ // no bubbling, should always fire.
+ // this is just a safety net in case event.timeStamp is unreliable in
+ // certain weird environments...
+ e.target === e.currentTarget ||
+ // event is fired after handler attachment
+ e.timeStamp >= attachedTimestamp ||
+ // bail for environments that have buggy event.timeStamp implementations
+ // #9462 iOS 9 bug: event.timeStamp is 0 after history.pushState
+ // #9681 QtWebEngine event.timeStamp is negative value
+ e.timeStamp <= 0 ||
+ // #9448 bail if event is fired in another document in a multi-page
+ // electron/nw.js app, since event.timeStamp will be using a different
+ // starting reference
+ e.target.ownerDocument !== document
+ ) {
+ return original.apply(this, arguments)
+ }
+ };
+ }
+ target$1.addEventListener(
+ name,
+ handler,
+ supportsPassive
+ ? { capture: capture, passive: passive }
+ : capture
+ );
+}
+
+function remove$2 (
+ name,
+ handler,
+ capture,
+ _target
+) {
+ (_target || target$1).removeEventListener(
+ name,
+ handler._wrapper || handler,
+ capture
+ );
+}
+
+function updateDOMListeners (oldVnode, vnode) {
+ if (isUndef(oldVnode.data.on) && isUndef(vnode.data.on)) {
+ return
+ }
+ var on = vnode.data.on || {};
+ var oldOn = oldVnode.data.on || {};
+ target$1 = vnode.elm;
+ normalizeEvents(on);
+ updateListeners(on, oldOn, add$1, remove$2, createOnceHandler$1, vnode.context);
+ target$1 = undefined;
+}
+
+var events = {
+ create: updateDOMListeners,
+ update: updateDOMListeners
+};
+
+/* */
+
+var svgContainer;
+
+function updateDOMProps (oldVnode, vnode) {
+ if (isUndef(oldVnode.data.domProps) && isUndef(vnode.data.domProps)) {
+ return
+ }
+ var key, cur;
+ var elm = vnode.elm;
+ var oldProps = oldVnode.data.domProps || {};
+ var props = vnode.data.domProps || {};
+ // clone observed objects, as the user probably wants to mutate it
+ if (isDef(props.__ob__)) {
+ props = vnode.data.domProps = extend({}, props);
+ }
+
+ for (key in oldProps) {
+ if (!(key in props)) {
+ elm[key] = '';
+ }
+ }
+
+ for (key in props) {
+ cur = props[key];
+ // ignore children if the node has textContent or innerHTML,
+ // as these will throw away existing DOM nodes and cause removal errors
+ // on subsequent patches (#3360)
+ if (key === 'textContent' || key === 'innerHTML') {
+ if (vnode.children) { vnode.children.length = 0; }
+ if (cur === oldProps[key]) { continue }
+ // #6601 work around Chrome version <= 55 bug where single textNode
+ // replaced by innerHTML/textContent retains its parentNode property
+ if (elm.childNodes.length === 1) {
+ elm.removeChild(elm.childNodes[0]);
+ }
+ }
+
+ if (key === 'value' && elm.tagName !== 'PROGRESS') {
+ // store value as _value as well since
+ // non-string values will be stringified
+ elm._value = cur;
+ // avoid resetting cursor position when value is the same
+ var strCur = isUndef(cur) ? '' : String(cur);
+ if (shouldUpdateValue(elm, strCur)) {
+ elm.value = strCur;
+ }
+ } else if (key === 'innerHTML' && isSVG(elm.tagName) && isUndef(elm.innerHTML)) {
+ // IE doesn't support innerHTML for SVG elements
+ svgContainer = svgContainer || document.createElement('div');
+ svgContainer.innerHTML = "<svg>" + cur + "</svg>";
+ var svg = svgContainer.firstChild;
+ while (elm.firstChild) {
+ elm.removeChild(elm.firstChild);
+ }
+ while (svg.firstChild) {
+ elm.appendChild(svg.firstChild);
+ }
+ } else if (
+ // skip the update if old and new VDOM state is the same.
+ // `value` is handled separately because the DOM value may be temporarily
+ // out of sync with VDOM state due to focus, composition and modifiers.
+ // This #4521 by skipping the unnecesarry `checked` update.
+ cur !== oldProps[key]
+ ) {
+ // some property updates can throw
+ // e.g. `value` on <progress> w/ non-finite value
+ try {
+ elm[key] = cur;
+ } catch (e) {}
+ }
+ }
+}
+
+// check platforms/web/util/attrs.js acceptValue
+
+
+function shouldUpdateValue (elm, checkVal) {
+ return (!elm.composing && (
+ elm.tagName === 'OPTION' ||
+ isNotInFocusAndDirty(elm, checkVal) ||
+ isDirtyWithModifiers(elm, checkVal)
+ ))
+}
+
+function isNotInFocusAndDirty (elm, checkVal) {
+ // return true when textbox (.number and .trim) loses focus and its value is
+ // not equal to the updated value
+ var notInFocus = true;
+ // #6157
+ // work around IE bug when accessing document.activeElement in an iframe
+ try { notInFocus = document.activeElement !== elm; } catch (e) {}
+ return notInFocus && elm.value !== checkVal
+}
+
+function isDirtyWithModifiers (elm, newVal) {
+ var value = elm.value;
+ var modifiers = elm._vModifiers; // injected by v-model runtime
+ if (isDef(modifiers)) {
+ if (modifiers.number) {
+ return toNumber(value) !== toNumber(newVal)
+ }
+ if (modifiers.trim) {
+ return value.trim() !== newVal.trim()
+ }
+ }
+ return value !== newVal
+}
+
+var domProps = {
+ create: updateDOMProps,
+ update: updateDOMProps
+};
+
+/* */
+
+var parseStyleText = cached(function (cssText) {
+ var res = {};
+ var listDelimiter = /;(?![^(]*\))/g;
+ var propertyDelimiter = /:(.+)/;
+ cssText.split(listDelimiter).forEach(function (item) {
+ if (item) {
+ var tmp = item.split(propertyDelimiter);
+ tmp.length > 1 && (res[tmp[0].trim()] = tmp[1].trim());
+ }
+ });
+ return res
+});
+
+// merge static and dynamic style data on the same vnode
+function normalizeStyleData (data) {
+ var style = normalizeStyleBinding(data.style);
+ // static style is pre-processed into an object during compilation
+ // and is always a fresh object, so it's safe to merge into it
+ return data.staticStyle
+ ? extend(data.staticStyle, style)
+ : style
+}
+
+// normalize possible array / string values into Object
+function normalizeStyleBinding (bindingStyle) {
+ if (Array.isArray(bindingStyle)) {
+ return toObject(bindingStyle)
+ }
+ if (typeof bindingStyle === 'string') {
+ return parseStyleText(bindingStyle)
+ }
+ return bindingStyle
+}
+
+/**
+ * parent component style should be after child's
+ * so that parent component's style could override it
+ */
+function getStyle (vnode, checkChild) {
+ var res = {};
+ var styleData;
+
+ if (checkChild) {
+ var childNode = vnode;
+ while (childNode.componentInstance) {
+ childNode = childNode.componentInstance._vnode;
+ if (
+ childNode && childNode.data &&
+ (styleData = normalizeStyleData(childNode.data))
+ ) {
+ extend(res, styleData);
+ }
+ }
+ }
+
+ if ((styleData = normalizeStyleData(vnode.data))) {
+ extend(res, styleData);
+ }
+
+ var parentNode = vnode;
+ while ((parentNode = parentNode.parent)) {
+ if (parentNode.data && (styleData = normalizeStyleData(parentNode.data))) {
+ extend(res, styleData);
+ }
+ }
+ return res
+}
+
+/* */
+
+var cssVarRE = /^--/;
+var importantRE = /\s*!important$/;
+var setProp = function (el, name, val) {
+ /* istanbul ignore if */
+ if (cssVarRE.test(name)) {
+ el.style.setProperty(name, val);
+ } else if (importantRE.test(val)) {
+ el.style.setProperty(hyphenate(name), val.replace(importantRE, ''), 'important');
+ } else {
+ var normalizedName = normalize(name);
+ if (Array.isArray(val)) {
+ // Support values array created by autoprefixer, e.g.
+ // {display: ["-webkit-box", "-ms-flexbox", "flex"]}
+ // Set them one by one, and the browser will only set those it can recognize
+ for (var i = 0, len = val.length; i < len; i++) {
+ el.style[normalizedName] = val[i];
+ }
+ } else {
+ el.style[normalizedName] = val;
+ }
+ }
+};
+
+var vendorNames = ['Webkit', 'Moz', 'ms'];
+
+var emptyStyle;
+var normalize = cached(function (prop) {
+ emptyStyle = emptyStyle || document.createElement('div').style;
+ prop = camelize(prop);
+ if (prop !== 'filter' && (prop in emptyStyle)) {
+ return prop
+ }
+ var capName = prop.charAt(0).toUpperCase() + prop.slice(1);
+ for (var i = 0; i < vendorNames.length; i++) {
+ var name = vendorNames[i] + capName;
+ if (name in emptyStyle) {
+ return name
+ }
+ }
+});
+
+function updateStyle (oldVnode, vnode) {
+ var data = vnode.data;
+ var oldData = oldVnode.data;
+
+ if (isUndef(data.staticStyle) && isUndef(data.style) &&
+ isUndef(oldData.staticStyle) && isUndef(oldData.style)
+ ) {
+ return
+ }
+
+ var cur, name;
+ var el = vnode.elm;
+ var oldStaticStyle = oldData.staticStyle;
+ var oldStyleBinding = oldData.normalizedStyle || oldData.style || {};
+
+ // if static style exists, stylebinding already merged into it when doing normalizeStyleData
+ var oldStyle = oldStaticStyle || oldStyleBinding;
+
+ var style = normalizeStyleBinding(vnode.data.style) || {};
+
+ // store normalized style under a different key for next diff
+ // make sure to clone it if it's reactive, since the user likely wants
+ // to mutate it.
+ vnode.data.normalizedStyle = isDef(style.__ob__)
+ ? extend({}, style)
+ : style;
+
+ var newStyle = getStyle(vnode, true);
+
+ for (name in oldStyle) {
+ if (isUndef(newStyle[name])) {
+ setProp(el, name, '');
+ }
+ }
+ for (name in newStyle) {
+ cur = newStyle[name];
+ if (cur !== oldStyle[name]) {
+ // ie9 setting to null has no effect, must use empty string
+ setProp(el, name, cur == null ? '' : cur);
+ }
+ }
+}
+
+var style = {
+ create: updateStyle,
+ update: updateStyle
+};
+
+/* */
+
+var whitespaceRE = /\s+/;
+
+/**
+ * Add class with compatibility for SVG since classList is not supported on
+ * SVG elements in IE
+ */
+function addClass (el, cls) {
+ /* istanbul ignore if */
+ if (!cls || !(cls = cls.trim())) {
+ return
+ }
+
+ /* istanbul ignore else */
+ if (el.classList) {
+ if (cls.indexOf(' ') > -1) {
+ cls.split(whitespaceRE).forEach(function (c) { return el.classList.add(c); });
+ } else {
+ el.classList.add(cls);
+ }
+ } else {
+ var cur = " " + (el.getAttribute('class') || '') + " ";
+ if (cur.indexOf(' ' + cls + ' ') < 0) {
+ el.setAttribute('class', (cur + cls).trim());
+ }
+ }
+}
+
+/**
+ * Remove class with compatibility for SVG since classList is not supported on
+ * SVG elements in IE
+ */
+function removeClass (el, cls) {
+ /* istanbul ignore if */
+ if (!cls || !(cls = cls.trim())) {
+ return
+ }
+
+ /* istanbul ignore else */
+ if (el.classList) {
+ if (cls.indexOf(' ') > -1) {
+ cls.split(whitespaceRE).forEach(function (c) { return el.classList.remove(c); });
+ } else {
+ el.classList.remove(cls);
+ }
+ if (!el.classList.length) {
+ el.removeAttribute('class');
+ }
+ } else {
+ var cur = " " + (el.getAttribute('class') || '') + " ";
+ var tar = ' ' + cls + ' ';
+ while (cur.indexOf(tar) >= 0) {
+ cur = cur.replace(tar, ' ');
+ }
+ cur = cur.trim();
+ if (cur) {
+ el.setAttribute('class', cur);
+ } else {
+ el.removeAttribute('class');
+ }
+ }
+}
+
+/* */
+
+function resolveTransition (def$$1) {
+ if (!def$$1) {
+ return
+ }
+ /* istanbul ignore else */
+ if (typeof def$$1 === 'object') {
+ var res = {};
+ if (def$$1.css !== false) {
+ extend(res, autoCssTransition(def$$1.name || 'v'));
+ }
+ extend(res, def$$1);
+ return res
+ } else if (typeof def$$1 === 'string') {
+ return autoCssTransition(def$$1)
+ }
+}
+
+var autoCssTransition = cached(function (name) {
+ return {
+ enterClass: (name + "-enter"),
+ enterToClass: (name + "-enter-to"),
+ enterActiveClass: (name + "-enter-active"),
+ leaveClass: (name + "-leave"),
+ leaveToClass: (name + "-leave-to"),
+ leaveActiveClass: (name + "-leave-active")
+ }
+});
+
+var hasTransition = inBrowser && !isIE9;
+var TRANSITION = 'transition';
+var ANIMATION = 'animation';
+
+// Transition property/event sniffing
+var transitionProp = 'transition';
+var transitionEndEvent = 'transitionend';
+var animationProp = 'animation';
+var animationEndEvent = 'animationend';
+if (hasTransition) {
+ /* istanbul ignore if */
+ if (window.ontransitionend === undefined &&
+ window.onwebkittransitionend !== undefined
+ ) {
+ transitionProp = 'WebkitTransition';
+ transitionEndEvent = 'webkitTransitionEnd';
+ }
+ if (window.onanimationend === undefined &&
+ window.onwebkitanimationend !== undefined
+ ) {
+ animationProp = 'WebkitAnimation';
+ animationEndEvent = 'webkitAnimationEnd';
+ }
+}
+
+// binding to window is necessary to make hot reload work in IE in strict mode
+var raf = inBrowser
+ ? window.requestAnimationFrame
+ ? window.requestAnimationFrame.bind(window)
+ : setTimeout
+ : /* istanbul ignore next */ function (fn) { return fn(); };
+
+function nextFrame (fn) {
+ raf(function () {
+ raf(fn);
+ });
+}
+
+function addTransitionClass (el, cls) {
+ var transitionClasses = el._transitionClasses || (el._transitionClasses = []);
+ if (transitionClasses.indexOf(cls) < 0) {
+ transitionClasses.push(cls);
+ addClass(el, cls);
+ }
+}
+
+function removeTransitionClass (el, cls) {
+ if (el._transitionClasses) {
+ remove(el._transitionClasses, cls);
+ }
+ removeClass(el, cls);
+}
+
+function whenTransitionEnds (
+ el,
+ expectedType,
+ cb
+) {
+ var ref = getTransitionInfo(el, expectedType);
+ var type = ref.type;
+ var timeout = ref.timeout;
+ var propCount = ref.propCount;
+ if (!type) { return cb() }
+ var event = type === TRANSITION ? transitionEndEvent : animationEndEvent;
+ var ended = 0;
+ var end = function () {
+ el.removeEventListener(event, onEnd);
+ cb();
+ };
+ var onEnd = function (e) {
+ if (e.target === el) {
+ if (++ended >= propCount) {
+ end();
+ }
+ }
+ };
+ setTimeout(function () {
+ if (ended < propCount) {
+ end();
+ }
+ }, timeout + 1);
+ el.addEventListener(event, onEnd);
+}
+
+var transformRE = /\b(transform|all)(,|$)/;
+
+function getTransitionInfo (el, expectedType) {
+ var styles = window.getComputedStyle(el);
+ // JSDOM may return undefined for transition properties
+ var transitionDelays = (styles[transitionProp + 'Delay'] || '').split(', ');
+ var transitionDurations = (styles[transitionProp + 'Duration'] || '').split(', ');
+ var transitionTimeout = getTimeout(transitionDelays, transitionDurations);
+ var animationDelays = (styles[animationProp + 'Delay'] || '').split(', ');
+ var animationDurations = (styles[animationProp + 'Duration'] || '').split(', ');
+ var animationTimeout = getTimeout(animationDelays, animationDurations);
+
+ var type;
+ var timeout = 0;
+ var propCount = 0;
+ /* istanbul ignore if */
+ if (expectedType === TRANSITION) {
+ if (transitionTimeout > 0) {
+ type = TRANSITION;
+ timeout = transitionTimeout;
+ propCount = transitionDurations.length;
+ }
+ } else if (expectedType === ANIMATION) {
+ if (animationTimeout > 0) {
+ type = ANIMATION;
+ timeout = animationTimeout;
+ propCount = animationDurations.length;
+ }
+ } else {
+ timeout = Math.max(transitionTimeout, animationTimeout);
+ type = timeout > 0
+ ? transitionTimeout > animationTimeout
+ ? TRANSITION
+ : ANIMATION
+ : null;
+ propCount = type
+ ? type === TRANSITION
+ ? transitionDurations.length
+ : animationDurations.length
+ : 0;
+ }
+ var hasTransform =
+ type === TRANSITION &&
+ transformRE.test(styles[transitionProp + 'Property']);
+ return {
+ type: type,
+ timeout: timeout,
+ propCount: propCount,
+ hasTransform: hasTransform
+ }
+}
+
+function getTimeout (delays, durations) {
+ /* istanbul ignore next */
+ while (delays.length < durations.length) {
+ delays = delays.concat(delays);
+ }
+
+ return Math.max.apply(null, durations.map(function (d, i) {
+ return toMs(d) + toMs(delays[i])
+ }))
+}
+
+// Old versions of Chromium (below 61.0.3163.100) formats floating pointer numbers
+// in a locale-dependent way, using a comma instead of a dot.
+// If comma is not replaced with a dot, the input will be rounded down (i.e. acting
+// as a floor function) causing unexpected behaviors
+function toMs (s) {
+ return Number(s.slice(0, -1).replace(',', '.')) * 1000
+}
+
+/* */
+
+function enter (vnode, toggleDisplay) {
+ var el = vnode.elm;
+
+ // call leave callback now
+ if (isDef(el._leaveCb)) {
+ el._leaveCb.cancelled = true;
+ el._leaveCb();
+ }
+
+ var data = resolveTransition(vnode.data.transition);
+ if (isUndef(data)) {
+ return
+ }
+
+ /* istanbul ignore if */
+ if (isDef(el._enterCb) || el.nodeType !== 1) {
+ return
+ }
+
+ var css = data.css;
+ var type = data.type;
+ var enterClass = data.enterClass;
+ var enterToClass = data.enterToClass;
+ var enterActiveClass = data.enterActiveClass;
+ var appearClass = data.appearClass;
+ var appearToClass = data.appearToClass;
+ var appearActiveClass = data.appearActiveClass;
+ var beforeEnter = data.beforeEnter;
+ var enter = data.enter;
+ var afterEnter = data.afterEnter;
+ var enterCancelled = data.enterCancelled;
+ var beforeAppear = data.beforeAppear;
+ var appear = data.appear;
+ var afterAppear = data.afterAppear;
+ var appearCancelled = data.appearCancelled;
+ var duration = data.duration;
+
+ // activeInstance will always be the <transition> component managing this
+ // transition. One edge case to check is when the <transition> is placed
+ // as the root node of a child component. In that case we need to check
+ // <transition>'s parent for appear check.
+ var context = activeInstance;
+ var transitionNode = activeInstance.$vnode;
+ while (transitionNode && transitionNode.parent) {
+ context = transitionNode.context;
+ transitionNode = transitionNode.parent;
+ }
+
+ var isAppear = !context._isMounted || !vnode.isRootInsert;
+
+ if (isAppear && !appear && appear !== '') {
+ return
+ }
+
+ var startClass = isAppear && appearClass
+ ? appearClass
+ : enterClass;
+ var activeClass = isAppear && appearActiveClass
+ ? appearActiveClass
+ : enterActiveClass;
+ var toClass = isAppear && appearToClass
+ ? appearToClass
+ : enterToClass;
+
+ var beforeEnterHook = isAppear
+ ? (beforeAppear || beforeEnter)
+ : beforeEnter;
+ var enterHook = isAppear
+ ? (typeof appear === 'function' ? appear : enter)
+ : enter;
+ var afterEnterHook = isAppear
+ ? (afterAppear || afterEnter)
+ : afterEnter;
+ var enterCancelledHook = isAppear
+ ? (appearCancelled || enterCancelled)
+ : enterCancelled;
+
+ var explicitEnterDuration = toNumber(
+ isObject(duration)
+ ? duration.enter
+ : duration
+ );
+
+ if (explicitEnterDuration != null) {
+ checkDuration(explicitEnterDuration, 'enter', vnode);
+ }
+
+ var expectsCSS = css !== false && !isIE9;
+ var userWantsControl = getHookArgumentsLength(enterHook);
+
+ var cb = el._enterCb = once(function () {
+ if (expectsCSS) {
+ removeTransitionClass(el, toClass);
+ removeTransitionClass(el, activeClass);
+ }
+ if (cb.cancelled) {
+ if (expectsCSS) {
+ removeTransitionClass(el, startClass);
+ }
+ enterCancelledHook && enterCancelledHook(el);
+ } else {
+ afterEnterHook && afterEnterHook(el);
+ }
+ el._enterCb = null;
+ });
+
+ if (!vnode.data.show) {
+ // remove pending leave element on enter by injecting an insert hook
+ mergeVNodeHook(vnode, 'insert', function () {
+ var parent = el.parentNode;
+ var pendingNode = parent && parent._pending && parent._pending[vnode.key];
+ if (pendingNode &&
+ pendingNode.tag === vnode.tag &&
+ pendingNode.elm._leaveCb
+ ) {
+ pendingNode.elm._leaveCb();
+ }
+ enterHook && enterHook(el, cb);
+ });
+ }
+
+ // start enter transition
+ beforeEnterHook && beforeEnterHook(el);
+ if (expectsCSS) {
+ addTransitionClass(el, startClass);
+ addTransitionClass(el, activeClass);
+ nextFrame(function () {
+ removeTransitionClass(el, startClass);
+ if (!cb.cancelled) {
+ addTransitionClass(el, toClass);
+ if (!userWantsControl) {
+ if (isValidDuration(explicitEnterDuration)) {
+ setTimeout(cb, explicitEnterDuration);
+ } else {
+ whenTransitionEnds(el, type, cb);
+ }
+ }
+ }
+ });
+ }
+
+ if (vnode.data.show) {
+ toggleDisplay && toggleDisplay();
+ enterHook && enterHook(el, cb);
+ }
+
+ if (!expectsCSS && !userWantsControl) {
+ cb();
+ }
+}
+
+function leave (vnode, rm) {
+ var el = vnode.elm;
+
+ // call enter callback now
+ if (isDef(el._enterCb)) {
+ el._enterCb.cancelled = true;
+ el._enterCb();
+ }
+
+ var data = resolveTransition(vnode.data.transition);
+ if (isUndef(data) || el.nodeType !== 1) {
+ return rm()
+ }
+
+ /* istanbul ignore if */
+ if (isDef(el._leaveCb)) {
+ return
+ }
+
+ var css = data.css;
+ var type = data.type;
+ var leaveClass = data.leaveClass;
+ var leaveToClass = data.leaveToClass;
+ var leaveActiveClass = data.leaveActiveClass;
+ var beforeLeave = data.beforeLeave;
+ var leave = data.leave;
+ var afterLeave = data.afterLeave;
+ var leaveCancelled = data.leaveCancelled;
+ var delayLeave = data.delayLeave;
+ var duration = data.duration;
+
+ var expectsCSS = css !== false && !isIE9;
+ var userWantsControl = getHookArgumentsLength(leave);
+
+ var explicitLeaveDuration = toNumber(
+ isObject(duration)
+ ? duration.leave
+ : duration
+ );
+
+ if (isDef(explicitLeaveDuration)) {
+ checkDuration(explicitLeaveDuration, 'leave', vnode);
+ }
+
+ var cb = el._leaveCb = once(function () {
+ if (el.parentNode && el.parentNode._pending) {
+ el.parentNode._pending[vnode.key] = null;
+ }
+ if (expectsCSS) {
+ removeTransitionClass(el, leaveToClass);
+ removeTransitionClass(el, leaveActiveClass);
+ }
+ if (cb.cancelled) {
+ if (expectsCSS) {
+ removeTransitionClass(el, leaveClass);
+ }
+ leaveCancelled && leaveCancelled(el);
+ } else {
+ rm();
+ afterLeave && afterLeave(el);
+ }
+ el._leaveCb = null;
+ });
+
+ if (delayLeave) {
+ delayLeave(performLeave);
+ } else {
+ performLeave();
+ }
+
+ function performLeave () {
+ // the delayed leave may have already been cancelled
+ if (cb.cancelled) {
+ return
+ }
+ // record leaving element
+ if (!vnode.data.show && el.parentNode) {
+ (el.parentNode._pending || (el.parentNode._pending = {}))[(vnode.key)] = vnode;
+ }
+ beforeLeave && beforeLeave(el);
+ if (expectsCSS) {
+ addTransitionClass(el, leaveClass);
+ addTransitionClass(el, leaveActiveClass);
+ nextFrame(function () {
+ removeTransitionClass(el, leaveClass);
+ if (!cb.cancelled) {
+ addTransitionClass(el, leaveToClass);
+ if (!userWantsControl) {
+ if (isValidDuration(explicitLeaveDuration)) {
+ setTimeout(cb, explicitLeaveDuration);
+ } else {
+ whenTransitionEnds(el, type, cb);
+ }
+ }
+ }
+ });
+ }
+ leave && leave(el, cb);
+ if (!expectsCSS && !userWantsControl) {
+ cb();
+ }
+ }
+}
+
+// only used in dev mode
+function checkDuration (val, name, vnode) {
+ if (typeof val !== 'number') {
+ warn(
+ "<transition> explicit " + name + " duration is not a valid number - " +
+ "got " + (JSON.stringify(val)) + ".",
+ vnode.context
+ );
+ } else if (isNaN(val)) {
+ warn(
+ "<transition> explicit " + name + " duration is NaN - " +
+ 'the duration expression might be incorrect.',
+ vnode.context
+ );
+ }
+}
+
+function isValidDuration (val) {
+ return typeof val === 'number' && !isNaN(val)
+}
+
+/**
+ * Normalize a transition hook's argument length. The hook may be:
+ * - a merged hook (invoker) with the original in .fns
+ * - a wrapped component method (check ._length)
+ * - a plain function (.length)
+ */
+function getHookArgumentsLength (fn) {
+ if (isUndef(fn)) {
+ return false
+ }
+ var invokerFns = fn.fns;
+ if (isDef(invokerFns)) {
+ // invoker
+ return getHookArgumentsLength(
+ Array.isArray(invokerFns)
+ ? invokerFns[0]
+ : invokerFns
+ )
+ } else {
+ return (fn._length || fn.length) > 1
+ }
+}
+
+function _enter (_, vnode) {
+ if (vnode.data.show !== true) {
+ enter(vnode);
+ }
+}
+
+var transition = inBrowser ? {
+ create: _enter,
+ activate: _enter,
+ remove: function remove$$1 (vnode, rm) {
+ /* istanbul ignore else */
+ if (vnode.data.show !== true) {
+ leave(vnode, rm);
+ } else {
+ rm();
+ }
+ }
+} : {};
+
+var platformModules = [
+ attrs,
+ klass,
+ events,
+ domProps,
+ style,
+ transition
+];
+
+/* */
+
+// the directive module should be applied last, after all
+// built-in modules have been applied.
+var modules = platformModules.concat(baseModules);
+
+var patch = createPatchFunction({ nodeOps: nodeOps, modules: modules });
+
+/**
+ * Not type checking this file because flow doesn't like attaching
+ * properties to Elements.
+ */
+
+/* istanbul ignore if */
+if (isIE9) {
+ // http://www.matts411.com/post/internet-explorer-9-oninput/
+ document.addEventListener('selectionchange', function () {
+ var el = document.activeElement;
+ if (el && el.vmodel) {
+ trigger(el, 'input');
+ }
+ });
+}
+
+var directive = {
+ inserted: function inserted (el, binding, vnode, oldVnode) {
+ if (vnode.tag === 'select') {
+ // #6903
+ if (oldVnode.elm && !oldVnode.elm._vOptions) {
+ mergeVNodeHook(vnode, 'postpatch', function () {
+ directive.componentUpdated(el, binding, vnode);
+ });
+ } else {
+ setSelected(el, binding, vnode.context);
+ }
+ el._vOptions = [].map.call(el.options, getValue);
+ } else if (vnode.tag === 'textarea' || isTextInputType(el.type)) {
+ el._vModifiers = binding.modifiers;
+ if (!binding.modifiers.lazy) {
+ el.addEventListener('compositionstart', onCompositionStart);
+ el.addEventListener('compositionend', onCompositionEnd);
+ // Safari < 10.2 & UIWebView doesn't fire compositionend when
+ // switching focus before confirming composition choice
+ // this also fixes the issue where some browsers e.g. iOS Chrome
+ // fires "change" instead of "input" on autocomplete.
+ el.addEventListener('change', onCompositionEnd);
+ /* istanbul ignore if */
+ if (isIE9) {
+ el.vmodel = true;
+ }
+ }
+ }
+ },
+
+ componentUpdated: function componentUpdated (el, binding, vnode) {
+ if (vnode.tag === 'select') {
+ setSelected(el, binding, vnode.context);
+ // in case the options rendered by v-for have changed,
+ // it's possible that the value is out-of-sync with the rendered options.
+ // detect such cases and filter out values that no longer has a matching
+ // option in the DOM.
+ var prevOptions = el._vOptions;
+ var curOptions = el._vOptions = [].map.call(el.options, getValue);
+ if (curOptions.some(function (o, i) { return !looseEqual(o, prevOptions[i]); })) {
+ // trigger change event if
+ // no matching option found for at least one value
+ var needReset = el.multiple
+ ? binding.value.some(function (v) { return hasNoMatchingOption(v, curOptions); })
+ : binding.value !== binding.oldValue && hasNoMatchingOption(binding.value, curOptions);
+ if (needReset) {
+ trigger(el, 'change');
+ }
+ }
+ }
+ }
+};
+
+function setSelected (el, binding, vm) {
+ actuallySetSelected(el, binding, vm);
+ /* istanbul ignore if */
+ if (isIE || isEdge) {
+ setTimeout(function () {
+ actuallySetSelected(el, binding, vm);
+ }, 0);
+ }
+}
+
+function actuallySetSelected (el, binding, vm) {
+ var value = binding.value;
+ var isMultiple = el.multiple;
+ if (isMultiple && !Array.isArray(value)) {
+ warn(
+ "<select multiple v-model=\"" + (binding.expression) + "\"> " +
+ "expects an Array value for its binding, but got " + (Object.prototype.toString.call(value).slice(8, -1)),
+ vm
+ );
+ return
+ }
+ var selected, option;
+ for (var i = 0, l = el.options.length; i < l; i++) {
+ option = el.options[i];
+ if (isMultiple) {
+ selected = looseIndexOf(value, getValue(option)) > -1;
+ if (option.selected !== selected) {
+ option.selected = selected;
+ }
+ } else {
+ if (looseEqual(getValue(option), value)) {
+ if (el.selectedIndex !== i) {
+ el.selectedIndex = i;
+ }
+ return
+ }
+ }
+ }
+ if (!isMultiple) {
+ el.selectedIndex = -1;
+ }
+}
+
+function hasNoMatchingOption (value, options) {
+ return options.every(function (o) { return !looseEqual(o, value); })
+}
+
+function getValue (option) {
+ return '_value' in option
+ ? option._value
+ : option.value
+}
+
+function onCompositionStart (e) {
+ e.target.composing = true;
+}
+
+function onCompositionEnd (e) {
+ // prevent triggering an input event for no reason
+ if (!e.target.composing) { return }
+ e.target.composing = false;
+ trigger(e.target, 'input');
+}
+
+function trigger (el, type) {
+ var e = document.createEvent('HTMLEvents');
+ e.initEvent(type, true, true);
+ el.dispatchEvent(e);
+}
+
+/* */
+
+// recursively search for possible transition defined inside the component root
+function locateNode (vnode) {
+ return vnode.componentInstance && (!vnode.data || !vnode.data.transition)
+ ? locateNode(vnode.componentInstance._vnode)
+ : vnode
+}
+
+var show = {
+ bind: function bind (el, ref, vnode) {
+ var value = ref.value;
+
+ vnode = locateNode(vnode);
+ var transition$$1 = vnode.data && vnode.data.transition;
+ var originalDisplay = el.__vOriginalDisplay =
+ el.style.display === 'none' ? '' : el.style.display;
+ if (value && transition$$1) {
+ vnode.data.show = true;
+ enter(vnode, function () {
+ el.style.display = originalDisplay;
+ });
+ } else {
+ el.style.display = value ? originalDisplay : 'none';
+ }
+ },
+
+ update: function update (el, ref, vnode) {
+ var value = ref.value;
+ var oldValue = ref.oldValue;
+
+ /* istanbul ignore if */
+ if (!value === !oldValue) { return }
+ vnode = locateNode(vnode);
+ var transition$$1 = vnode.data && vnode.data.transition;
+ if (transition$$1) {
+ vnode.data.show = true;
+ if (value) {
+ enter(vnode, function () {
+ el.style.display = el.__vOriginalDisplay;
+ });
+ } else {
+ leave(vnode, function () {
+ el.style.display = 'none';
+ });
+ }
+ } else {
+ el.style.display = value ? el.__vOriginalDisplay : 'none';
+ }
+ },
+
+ unbind: function unbind (
+ el,
+ binding,
+ vnode,
+ oldVnode,
+ isDestroy
+ ) {
+ if (!isDestroy) {
+ el.style.display = el.__vOriginalDisplay;
+ }
+ }
+};
+
+var platformDirectives = {
+ model: directive,
+ show: show
+};
+
+/* */
+
+var transitionProps = {
+ name: String,
+ appear: Boolean,
+ css: Boolean,
+ mode: String,
+ type: String,
+ enterClass: String,
+ leaveClass: String,
+ enterToClass: String,
+ leaveToClass: String,
+ enterActiveClass: String,
+ leaveActiveClass: String,
+ appearClass: String,
+ appearActiveClass: String,
+ appearToClass: String,
+ duration: [Number, String, Object]
+};
+
+// in case the child is also an abstract component, e.g. <keep-alive>
+// we want to recursively retrieve the real component to be rendered
+function getRealChild (vnode) {
+ var compOptions = vnode && vnode.componentOptions;
+ if (compOptions && compOptions.Ctor.options.abstract) {
+ return getRealChild(getFirstComponentChild(compOptions.children))
+ } else {
+ return vnode
+ }
+}
+
+function extractTransitionData (comp) {
+ var data = {};
+ var options = comp.$options;
+ // props
+ for (var key in options.propsData) {
+ data[key] = comp[key];
+ }
+ // events.
+ // extract listeners and pass them directly to the transition methods
+ var listeners = options._parentListeners;
+ for (var key$1 in listeners) {
+ data[camelize(key$1)] = listeners[key$1];
+ }
+ return data
+}
+
+function placeholder (h, rawChild) {
+ if (/\d-keep-alive$/.test(rawChild.tag)) {
+ return h('keep-alive', {
+ props: rawChild.componentOptions.propsData
+ })
+ }
+}
+
+function hasParentTransition (vnode) {
+ while ((vnode = vnode.parent)) {
+ if (vnode.data.transition) {
+ return true
+ }
+ }
+}
+
+function isSameChild (child, oldChild) {
+ return oldChild.key === child.key && oldChild.tag === child.tag
+}
+
+var isNotTextNode = function (c) { return c.tag || isAsyncPlaceholder(c); };
+
+var isVShowDirective = function (d) { return d.name === 'show'; };
+
+var Transition = {
+ name: 'transition',
+ props: transitionProps,
+ abstract: true,
+
+ render: function render (h) {
+ var this$1 = this;
+
+ var children = this.$slots.default;
+ if (!children) {
+ return
+ }
+
+ // filter out text nodes (possible whitespaces)
+ children = children.filter(isNotTextNode);
+ /* istanbul ignore if */
+ if (!children.length) {
+ return
+ }
+
+ // warn multiple elements
+ if (children.length > 1) {
+ warn(
+ '<transition> can only be used on a single element. Use ' +
+ '<transition-group> for lists.',
+ this.$parent
+ );
+ }
+
+ var mode = this.mode;
+
+ // warn invalid mode
+ if (mode && mode !== 'in-out' && mode !== 'out-in'
+ ) {
+ warn(
+ 'invalid <transition> mode: ' + mode,
+ this.$parent
+ );
+ }
+
+ var rawChild = children[0];
+
+ // if this is a component root node and the component's
+ // parent container node also has transition, skip.
+ if (hasParentTransition(this.$vnode)) {
+ return rawChild
+ }
+
+ // apply transition data to child
+ // use getRealChild() to ignore abstract components e.g. keep-alive
+ var child = getRealChild(rawChild);
+ /* istanbul ignore if */
+ if (!child) {
+ return rawChild
+ }
+
+ if (this._leaving) {
+ return placeholder(h, rawChild)
+ }
+
+ // ensure a key that is unique to the vnode type and to this transition
+ // component instance. This key will be used to remove pending leaving nodes
+ // during entering.
+ var id = "__transition-" + (this._uid) + "-";
+ child.key = child.key == null
+ ? child.isComment
+ ? id + 'comment'
+ : id + child.tag
+ : isPrimitive(child.key)
+ ? (String(child.key).indexOf(id) === 0 ? child.key : id + child.key)
+ : child.key;
+
+ var data = (child.data || (child.data = {})).transition = extractTransitionData(this);
+ var oldRawChild = this._vnode;
+ var oldChild = getRealChild(oldRawChild);
+
+ // mark v-show
+ // so that the transition module can hand over the control to the directive
+ if (child.data.directives && child.data.directives.some(isVShowDirective)) {
+ child.data.show = true;
+ }
+
+ if (
+ oldChild &&
+ oldChild.data &&
+ !isSameChild(child, oldChild) &&
+ !isAsyncPlaceholder(oldChild) &&
+ // #6687 component root is a comment node
+ !(oldChild.componentInstance && oldChild.componentInstance._vnode.isComment)
+ ) {
+ // replace old child transition data with fresh one
+ // important for dynamic transitions!
+ var oldData = oldChild.data.transition = extend({}, data);
+ // handle transition mode
+ if (mode === 'out-in') {
+ // return placeholder node and queue update when leave finishes
+ this._leaving = true;
+ mergeVNodeHook(oldData, 'afterLeave', function () {
+ this$1._leaving = false;
+ this$1.$forceUpdate();
+ });
+ return placeholder(h, rawChild)
+ } else if (mode === 'in-out') {
+ if (isAsyncPlaceholder(child)) {
+ return oldRawChild
+ }
+ var delayedLeave;
+ var performLeave = function () { delayedLeave(); };
+ mergeVNodeHook(data, 'afterEnter', performLeave);
+ mergeVNodeHook(data, 'enterCancelled', performLeave);
+ mergeVNodeHook(oldData, 'delayLeave', function (leave) { delayedLeave = leave; });
+ }
+ }
+
+ return rawChild
+ }
+};
+
+/* */
+
+var props = extend({
+ tag: String,
+ moveClass: String
+}, transitionProps);
+
+delete props.mode;
+
+var TransitionGroup = {
+ props: props,
+
+ beforeMount: function beforeMount () {
+ var this$1 = this;
+
+ var update = this._update;
+ this._update = function (vnode, hydrating) {
+ var restoreActiveInstance = setActiveInstance(this$1);
+ // force removing pass
+ this$1.__patch__(
+ this$1._vnode,
+ this$1.kept,
+ false, // hydrating
+ true // removeOnly (!important, avoids unnecessary moves)
+ );
+ this$1._vnode = this$1.kept;
+ restoreActiveInstance();
+ update.call(this$1, vnode, hydrating);
+ };
+ },
+
+ render: function render (h) {
+ var tag = this.tag || this.$vnode.data.tag || 'span';
+ var map = Object.create(null);
+ var prevChildren = this.prevChildren = this.children;
+ var rawChildren = this.$slots.default || [];
+ var children = this.children = [];
+ var transitionData = extractTransitionData(this);
+
+ for (var i = 0; i < rawChildren.length; i++) {
+ var c = rawChildren[i];
+ if (c.tag) {
+ if (c.key != null && String(c.key).indexOf('__vlist') !== 0) {
+ children.push(c);
+ map[c.key] = c
+ ;(c.data || (c.data = {})).transition = transitionData;
+ } else {
+ var opts = c.componentOptions;
+ var name = opts ? (opts.Ctor.options.name || opts.tag || '') : c.tag;
+ warn(("<transition-group> children must be keyed: <" + name + ">"));
+ }
+ }
+ }
+
+ if (prevChildren) {
+ var kept = [];
+ var removed = [];
+ for (var i$1 = 0; i$1 < prevChildren.length; i$1++) {
+ var c$1 = prevChildren[i$1];
+ c$1.data.transition = transitionData;
+ c$1.data.pos = c$1.elm.getBoundingClientRect();
+ if (map[c$1.key]) {
+ kept.push(c$1);
+ } else {
+ removed.push(c$1);
+ }
+ }
+ this.kept = h(tag, null, kept);
+ this.removed = removed;
+ }
+
+ return h(tag, null, children)
+ },
+
+ updated: function updated () {
+ var children = this.prevChildren;
+ var moveClass = this.moveClass || ((this.name || 'v') + '-move');
+ if (!children.length || !this.hasMove(children[0].elm, moveClass)) {
+ return
+ }
+
+ // we divide the work into three loops to avoid mixing DOM reads and writes
+ // in each iteration - which helps prevent layout thrashing.
+ children.forEach(callPendingCbs);
+ children.forEach(recordPosition);
+ children.forEach(applyTranslation);
+
+ // force reflow to put everything in position
+ // assign to this to avoid being removed in tree-shaking
+ // $flow-disable-line
+ this._reflow = document.body.offsetHeight;
+
+ children.forEach(function (c) {
+ if (c.data.moved) {
+ var el = c.elm;
+ var s = el.style;
+ addTransitionClass(el, moveClass);
+ s.transform = s.WebkitTransform = s.transitionDuration = '';
+ el.addEventListener(transitionEndEvent, el._moveCb = function cb (e) {
+ if (e && e.target !== el) {
+ return
+ }
+ if (!e || /transform$/.test(e.propertyName)) {
+ el.removeEventListener(transitionEndEvent, cb);
+ el._moveCb = null;
+ removeTransitionClass(el, moveClass);
+ }
+ });
+ }
+ });
+ },
+
+ methods: {
+ hasMove: function hasMove (el, moveClass) {
+ /* istanbul ignore if */
+ if (!hasTransition) {
+ return false
+ }
+ /* istanbul ignore if */
+ if (this._hasMove) {
+ return this._hasMove
+ }
+ // Detect whether an element with the move class applied has
+ // CSS transitions. Since the element may be inside an entering
+ // transition at this very moment, we make a clone of it and remove
+ // all other transition classes applied to ensure only the move class
+ // is applied.
+ var clone = el.cloneNode();
+ if (el._transitionClasses) {
+ el._transitionClasses.forEach(function (cls) { removeClass(clone, cls); });
+ }
+ addClass(clone, moveClass);
+ clone.style.display = 'none';
+ this.$el.appendChild(clone);
+ var info = getTransitionInfo(clone);
+ this.$el.removeChild(clone);
+ return (this._hasMove = info.hasTransform)
+ }
+ }
+};
+
+function callPendingCbs (c) {
+ /* istanbul ignore if */
+ if (c.elm._moveCb) {
+ c.elm._moveCb();
+ }
+ /* istanbul ignore if */
+ if (c.elm._enterCb) {
+ c.elm._enterCb();
+ }
+}
+
+function recordPosition (c) {
+ c.data.newPos = c.elm.getBoundingClientRect();
+}
+
+function applyTranslation (c) {
+ var oldPos = c.data.pos;
+ var newPos = c.data.newPos;
+ var dx = oldPos.left - newPos.left;
+ var dy = oldPos.top - newPos.top;
+ if (dx || dy) {
+ c.data.moved = true;
+ var s = c.elm.style;
+ s.transform = s.WebkitTransform = "translate(" + dx + "px," + dy + "px)";
+ s.transitionDuration = '0s';
+ }
+}
+
+var platformComponents = {
+ Transition: Transition,
+ TransitionGroup: TransitionGroup
+};
+
+/* */
+
+// install platform specific utils
+Vue.config.mustUseProp = mustUseProp;
+Vue.config.isReservedTag = isReservedTag;
+Vue.config.isReservedAttr = isReservedAttr;
+Vue.config.getTagNamespace = getTagNamespace;
+Vue.config.isUnknownElement = isUnknownElement;
+
+// install platform runtime directives & components
+extend(Vue.options.directives, platformDirectives);
+extend(Vue.options.components, platformComponents);
+
+// install platform patch function
+Vue.prototype.__patch__ = inBrowser ? patch : noop;
+
+// public mount method
+Vue.prototype.$mount = function (
+ el,
+ hydrating
+) {
+ el = el && inBrowser ? query(el) : undefined;
+ return mountComponent(this, el, hydrating)
+};
+
+// devtools global hook
+/* istanbul ignore next */
+if (inBrowser) {
+ setTimeout(function () {
+ if (config.devtools) {
+ if (devtools) {
+ devtools.emit('init', Vue);
+ } else {
+ console[console.info ? 'info' : 'log'](
+ 'Download the Vue Devtools extension for a better development experience:\n' +
+ 'https://github.com/vuejs/vue-devtools'
+ );
+ }
+ }
+ if (config.productionTip !== false &&
+ typeof console !== 'undefined'
+ ) {
+ console[console.info ? 'info' : 'log'](
+ "You are running Vue in development mode.\n" +
+ "Make sure to turn on production mode when deploying for production.\n" +
+ "See more tips at https://vuejs.org/guide/deployment.html"
+ );
+ }
+ }, 0);
+}
+
+/* */
+
+var defaultTagRE = /\{\{((?:.|\r?\n)+?)\}\}/g;
+var regexEscapeRE = /[-.*+?^${}()|[\]\/\\]/g;
+
+var buildRegex = cached(function (delimiters) {
+ var open = delimiters[0].replace(regexEscapeRE, '\\$&');
+ var close = delimiters[1].replace(regexEscapeRE, '\\$&');
+ return new RegExp(open + '((?:.|\\n)+?)' + close, 'g')
+});
+
+
+
+function parseText (
+ text,
+ delimiters
+) {
+ var tagRE = delimiters ? buildRegex(delimiters) : defaultTagRE;
+ if (!tagRE.test(text)) {
+ return
+ }
+ var tokens = [];
+ var rawTokens = [];
+ var lastIndex = tagRE.lastIndex = 0;
+ var match, index, tokenValue;
+ while ((match = tagRE.exec(text))) {
+ index = match.index;
+ // push text token
+ if (index > lastIndex) {
+ rawTokens.push(tokenValue = text.slice(lastIndex, index));
+ tokens.push(JSON.stringify(tokenValue));
+ }
+ // tag token
+ var exp = parseFilters(match[1].trim());
+ tokens.push(("_s(" + exp + ")"));
+ rawTokens.push({ '@binding': exp });
+ lastIndex = index + match[0].length;
+ }
+ if (lastIndex < text.length) {
+ rawTokens.push(tokenValue = text.slice(lastIndex));
+ tokens.push(JSON.stringify(tokenValue));
+ }
+ return {
+ expression: tokens.join('+'),
+ tokens: rawTokens
+ }
+}
+
+/* */
+
+function transformNode (el, options) {
+ var warn = options.warn || baseWarn;
+ var staticClass = getAndRemoveAttr(el, 'class');
+ if (staticClass) {
+ var res = parseText(staticClass, options.delimiters);
+ if (res) {
+ warn(
+ "class=\"" + staticClass + "\": " +
+ 'Interpolation inside attributes has been removed. ' +
+ 'Use v-bind or the colon shorthand instead. For example, ' +
+ 'instead of <div class="{{ val }}">, use <div :class="val">.',
+ el.rawAttrsMap['class']
+ );
+ }
+ }
+ if (staticClass) {
+ el.staticClass = JSON.stringify(staticClass);
+ }
+ var classBinding = getBindingAttr(el, 'class', false /* getStatic */);
+ if (classBinding) {
+ el.classBinding = classBinding;
+ }
+}
+
+function genData (el) {
+ var data = '';
+ if (el.staticClass) {
+ data += "staticClass:" + (el.staticClass) + ",";
+ }
+ if (el.classBinding) {
+ data += "class:" + (el.classBinding) + ",";
+ }
+ return data
+}
+
+var klass$1 = {
+ staticKeys: ['staticClass'],
+ transformNode: transformNode,
+ genData: genData
+};
+
+/* */
+
+function transformNode$1 (el, options) {
+ var warn = options.warn || baseWarn;
+ var staticStyle = getAndRemoveAttr(el, 'style');
+ if (staticStyle) {
+ /* istanbul ignore if */
+ {
+ var res = parseText(staticStyle, options.delimiters);
+ if (res) {
+ warn(
+ "style=\"" + staticStyle + "\": " +
+ 'Interpolation inside attributes has been removed. ' +
+ 'Use v-bind or the colon shorthand instead. For example, ' +
+ 'instead of <div style="{{ val }}">, use <div :style="val">.',
+ el.rawAttrsMap['style']
+ );
+ }
+ }
+ el.staticStyle = JSON.stringify(parseStyleText(staticStyle));
+ }
+
+ var styleBinding = getBindingAttr(el, 'style', false /* getStatic */);
+ if (styleBinding) {
+ el.styleBinding = styleBinding;
+ }
+}
+
+function genData$1 (el) {
+ var data = '';
+ if (el.staticStyle) {
+ data += "staticStyle:" + (el.staticStyle) + ",";
+ }
+ if (el.styleBinding) {
+ data += "style:(" + (el.styleBinding) + "),";
+ }
+ return data
+}
+
+var style$1 = {
+ staticKeys: ['staticStyle'],
+ transformNode: transformNode$1,
+ genData: genData$1
+};
+
+/* */
+
+var decoder;
+
+var he = {
+ decode: function decode (html) {
+ decoder = decoder || document.createElement('div');
+ decoder.innerHTML = html;
+ return decoder.textContent
+ }
+};
+
+/* */
+
+var isUnaryTag = makeMap(
+ 'area,base,br,col,embed,frame,hr,img,input,isindex,keygen,' +
+ 'link,meta,param,source,track,wbr'
+);
+
+// Elements that you can, intentionally, leave open
+// (and which close themselves)
+var canBeLeftOpenTag = makeMap(
+ 'colgroup,dd,dt,li,options,p,td,tfoot,th,thead,tr,source'
+);
+
+// HTML5 tags https://html.spec.whatwg.org/multipage/indices.html#elements-3
+// Phrasing Content https://html.spec.whatwg.org/multipage/dom.html#phrasing-content
+var isNonPhrasingTag = makeMap(
+ 'address,article,aside,base,blockquote,body,caption,col,colgroup,dd,' +
+ 'details,dialog,div,dl,dt,fieldset,figcaption,figure,footer,form,' +
+ 'h1,h2,h3,h4,h5,h6,head,header,hgroup,hr,html,legend,li,menuitem,meta,' +
+ 'optgroup,option,param,rp,rt,source,style,summary,tbody,td,tfoot,th,thead,' +
+ 'title,tr,track'
+);
+
+/**
+ * Not type-checking this file because it's mostly vendor code.
+ */
+
+// Regular Expressions for parsing tags and attributes
+var attribute = /^\s*([^\s"'<>\/=]+)(?:\s*(=)\s*(?:"([^"]*)"+|'([^']*)'+|([^\s"'=<>`]+)))?/;
+var dynamicArgAttribute = /^\s*((?:v-[\w-]+:|@|:|#)\[[^=]+\][^\s"'<>\/=]*)(?:\s*(=)\s*(?:"([^"]*)"+|'([^']*)'+|([^\s"'=<>`]+)))?/;
+var ncname = "[a-zA-Z_][\\-\\.0-9_a-zA-Z" + (unicodeRegExp.source) + "]*";
+var qnameCapture = "((?:" + ncname + "\\:)?" + ncname + ")";
+var startTagOpen = new RegExp(("^<" + qnameCapture));
+var startTagClose = /^\s*(\/?)>/;
+var endTag = new RegExp(("^<\\/" + qnameCapture + "[^>]*>"));
+var doctype = /^<!DOCTYPE [^>]+>/i;
+// #7298: escape - to avoid being pased as HTML comment when inlined in page
+var comment = /^<!\--/;
+var conditionalComment = /^<!\[/;
+
+// Special Elements (can contain anything)
+var isPlainTextElement = makeMap('script,style,textarea', true);
+var reCache = {};
+
+var decodingMap = {
+ '<': '<',
+ '>': '>',
+ '"': '"',
+ '&': '&',
+ ' ': '\n',
+ '	': '\t',
+ ''': "'"
+};
+var encodedAttr = /&(?:lt|gt|quot|amp|#39);/g;
+var encodedAttrWithNewLines = /&(?:lt|gt|quot|amp|#39|#10|#9);/g;
+
+// #5992
+var isIgnoreNewlineTag = makeMap('pre,textarea', true);
+var shouldIgnoreFirstNewline = function (tag, html) { return tag && isIgnoreNewlineTag(tag) && html[0] === '\n'; };
+
+function decodeAttr (value, shouldDecodeNewlines) {
+ var re = shouldDecodeNewlines ? encodedAttrWithNewLines : encodedAttr;
+ return value.replace(re, function (match) { return decodingMap[match]; })
+}
+
+function parseHTML (html, options) {
+ var stack = [];
+ var expectHTML = options.expectHTML;
+ var isUnaryTag$$1 = options.isUnaryTag || no;
+ var canBeLeftOpenTag$$1 = options.canBeLeftOpenTag || no;
+ var index = 0;
+ var last, lastTag;
+ while (html) {
+ last = html;
+ // Make sure we're not in a plaintext content element like script/style
+ if (!lastTag || !isPlainTextElement(lastTag)) {
+ var textEnd = html.indexOf('<');
+ if (textEnd === 0) {
+ // Comment:
+ if (comment.test(html)) {
+ var commentEnd = html.indexOf('-->');
+
+ if (commentEnd >= 0) {
+ if (options.shouldKeepComment) {
+ options.comment(html.substring(4, commentEnd), index, index + commentEnd + 3);
+ }
+ advance(commentEnd + 3);
+ continue
+ }
+ }
+
+ // http://en.wikipedia.org/wiki/Conditional_comment#Downlevel-revealed_conditional_comment
+ if (conditionalComment.test(html)) {
+ var conditionalEnd = html.indexOf(']>');
+
+ if (conditionalEnd >= 0) {
+ advance(conditionalEnd + 2);
+ continue
+ }
+ }
+
+ // Doctype:
+ var doctypeMatch = html.match(doctype);
+ if (doctypeMatch) {
+ advance(doctypeMatch[0].length);
+ continue
+ }
+
+ // End tag:
+ var endTagMatch = html.match(endTag);
+ if (endTagMatch) {
+ var curIndex = index;
+ advance(endTagMatch[0].length);
+ parseEndTag(endTagMatch[1], curIndex, index);
+ continue
+ }
+
+ // Start tag:
+ var startTagMatch = parseStartTag();
+ if (startTagMatch) {
+ handleStartTag(startTagMatch);
+ if (shouldIgnoreFirstNewline(startTagMatch.tagName, html)) {
+ advance(1);
+ }
+ continue
+ }
+ }
+
+ var text = (void 0), rest = (void 0), next = (void 0);
+ if (textEnd >= 0) {
+ rest = html.slice(textEnd);
+ while (
+ !endTag.test(rest) &&
+ !startTagOpen.test(rest) &&
+ !comment.test(rest) &&
+ !conditionalComment.test(rest)
+ ) {
+ // < in plain text, be forgiving and treat it as text
+ next = rest.indexOf('<', 1);
+ if (next < 0) { break }
+ textEnd += next;
+ rest = html.slice(textEnd);
+ }
+ text = html.substring(0, textEnd);
+ }
+
+ if (textEnd < 0) {
+ text = html;
+ }
+
+ if (text) {
+ advance(text.length);
+ }
+
+ if (options.chars && text) {
+ options.chars(text, index - text.length, index);
+ }
+ } else {
+ var endTagLength = 0;
+ var stackedTag = lastTag.toLowerCase();
+ var reStackedTag = reCache[stackedTag] || (reCache[stackedTag] = new RegExp('([\\s\\S]*?)(</' + stackedTag + '[^>]*>)', 'i'));
+ var rest$1 = html.replace(reStackedTag, function (all, text, endTag) {
+ endTagLength = endTag.length;
+ if (!isPlainTextElement(stackedTag) && stackedTag !== 'noscript') {
+ text = text
+ .replace(/<!\--([\s\S]*?)-->/g, '$1') // #7298
+ .replace(/<!\[CDATA\[([\s\S]*?)]]>/g, '$1');
+ }
+ if (shouldIgnoreFirstNewline(stackedTag, text)) {
+ text = text.slice(1);
+ }
+ if (options.chars) {
+ options.chars(text);
+ }
+ return ''
+ });
+ index += html.length - rest$1.length;
+ html = rest$1;
+ parseEndTag(stackedTag, index - endTagLength, index);
+ }
+
+ if (html === last) {
+ options.chars && options.chars(html);
+ if (!stack.length && options.warn) {
+ options.warn(("Mal-formatted tag at end of template: \"" + html + "\""), { start: index + html.length });
+ }
+ break
+ }
+ }
+
+ // Clean up any remaining tags
+ parseEndTag();
+
+ function advance (n) {
+ index += n;
+ html = html.substring(n);
+ }
+
+ function parseStartTag () {
+ var start = html.match(startTagOpen);
+ if (start) {
+ var match = {
+ tagName: start[1],
+ attrs: [],
+ start: index
+ };
+ advance(start[0].length);
+ var end, attr;
+ while (!(end = html.match(startTagClose)) && (attr = html.match(dynamicArgAttribute) || html.match(attribute))) {
+ attr.start = index;
+ advance(attr[0].length);
+ attr.end = index;
+ match.attrs.push(attr);
+ }
+ if (end) {
+ match.unarySlash = end[1];
+ advance(end[0].length);
+ match.end = index;
+ return match
+ }
+ }
+ }
+
+ function handleStartTag (match) {
+ var tagName = match.tagName;
+ var unarySlash = match.unarySlash;
+
+ if (expectHTML) {
+ if (lastTag === 'p' && isNonPhrasingTag(tagName)) {
+ parseEndTag(lastTag);
+ }
+ if (canBeLeftOpenTag$$1(tagName) && lastTag === tagName) {
+ parseEndTag(tagName);
+ }
+ }
+
+ var unary = isUnaryTag$$1(tagName) || !!unarySlash;
+
+ var l = match.attrs.length;
+ var attrs = new Array(l);
+ for (var i = 0; i < l; i++) {
+ var args = match.attrs[i];
+ var value = args[3] || args[4] || args[5] || '';
+ var shouldDecodeNewlines = tagName === 'a' && args[1] === 'href'
+ ? options.shouldDecodeNewlinesForHref
+ : options.shouldDecodeNewlines;
+ attrs[i] = {
+ name: args[1],
+ value: decodeAttr(value, shouldDecodeNewlines)
+ };
+ if (options.outputSourceRange) {
+ attrs[i].start = args.start + args[0].match(/^\s*/).length;
+ attrs[i].end = args.end;
+ }
+ }
+
+ if (!unary) {
+ stack.push({ tag: tagName, lowerCasedTag: tagName.toLowerCase(), attrs: attrs, start: match.start, end: match.end });
+ lastTag = tagName;
+ }
+
+ if (options.start) {
+ options.start(tagName, attrs, unary, match.start, match.end);
+ }
+ }
+
+ function parseEndTag (tagName, start, end) {
+ var pos, lowerCasedTagName;
+ if (start == null) { start = index; }
+ if (end == null) { end = index; }
+
+ // Find the closest opened tag of the same type
+ if (tagName) {
+ lowerCasedTagName = tagName.toLowerCase();
+ for (pos = stack.length - 1; pos >= 0; pos--) {
+ if (stack[pos].lowerCasedTag === lowerCasedTagName) {
+ break
+ }
+ }
+ } else {
+ // If no tag name is provided, clean shop
+ pos = 0;
+ }
+
+ if (pos >= 0) {
+ // Close all the open elements, up the stack
+ for (var i = stack.length - 1; i >= pos; i--) {
+ if (i > pos || !tagName &&
+ options.warn
+ ) {
+ options.warn(
+ ("tag <" + (stack[i].tag) + "> has no matching end tag."),
+ { start: stack[i].start, end: stack[i].end }
+ );
+ }
+ if (options.end) {
+ options.end(stack[i].tag, start, end);
+ }
+ }
+
+ // Remove the open elements from the stack
+ stack.length = pos;
+ lastTag = pos && stack[pos - 1].tag;
+ } else if (lowerCasedTagName === 'br') {
+ if (options.start) {
+ options.start(tagName, [], true, start, end);
+ }
+ } else if (lowerCasedTagName === 'p') {
+ if (options.start) {
+ options.start(tagName, [], false, start, end);
+ }
+ if (options.end) {
+ options.end(tagName, start, end);
+ }
+ }
+ }
+}
+
+/* */
+
+var onRE = /^@|^v-on:/;
+var dirRE = /^v-|^@|^:/;
+var forAliasRE = /([\s\S]*?)\s+(?:in|of)\s+([\s\S]*)/;
+var forIteratorRE = /,([^,\}\]]*)(?:,([^,\}\]]*))?$/;
+var stripParensRE = /^\(|\)$/g;
+var dynamicArgRE = /^\[.*\]$/;
+
+var argRE = /:(.*)$/;
+var bindRE = /^:|^\.|^v-bind:/;
+var modifierRE = /\.[^.\]]+(?=[^\]]*$)/g;
+
+var slotRE = /^v-slot(:|$)|^#/;
+
+var lineBreakRE = /[\r\n]/;
+var whitespaceRE$1 = /\s+/g;
+
+var invalidAttributeRE = /[\s"'<>\/=]/;
+
+var decodeHTMLCached = cached(he.decode);
+
+var emptySlotScopeToken = "_empty_";
+
+// configurable state
+var warn$2;
+var delimiters;
+var transforms;
+var preTransforms;
+var postTransforms;
+var platformIsPreTag;
+var platformMustUseProp;
+var platformGetTagNamespace;
+var maybeComponent;
+
+function createASTElement (
+ tag,
+ attrs,
+ parent
+) {
+ return {
+ type: 1,
+ tag: tag,
+ attrsList: attrs,
+ attrsMap: makeAttrsMap(attrs),
+ rawAttrsMap: {},
+ parent: parent,
+ children: []
+ }
+}
+
+/**
+ * Convert HTML string to AST.
+ */
+function parse (
+ template,
+ options
+) {
+ warn$2 = options.warn || baseWarn;
+
+ platformIsPreTag = options.isPreTag || no;
+ platformMustUseProp = options.mustUseProp || no;
+ platformGetTagNamespace = options.getTagNamespace || no;
+ var isReservedTag = options.isReservedTag || no;
+ maybeComponent = function (el) { return !!el.component || !isReservedTag(el.tag); };
+
+ transforms = pluckModuleFunction(options.modules, 'transformNode');
+ preTransforms = pluckModuleFunction(options.modules, 'preTransformNode');
+ postTransforms = pluckModuleFunction(options.modules, 'postTransformNode');
+
+ delimiters = options.delimiters;
+
+ var stack = [];
+ var preserveWhitespace = options.preserveWhitespace !== false;
+ var whitespaceOption = options.whitespace;
+ var root;
+ var currentParent;
+ var inVPre = false;
+ var inPre = false;
+ var warned = false;
+
+ function warnOnce (msg, range) {
+ if (!warned) {
+ warned = true;
+ warn$2(msg, range);
+ }
+ }
+
+ function closeElement (element) {
+ trimEndingWhitespace(element);
+ if (!inVPre && !element.processed) {
+ element = processElement(element, options);
+ }
+ // tree management
+ if (!stack.length && element !== root) {
+ // allow root elements with v-if, v-else-if and v-else
+ if (root.if && (element.elseif || element.else)) {
+ {
+ checkRootConstraints(element);
+ }
+ addIfCondition(root, {
+ exp: element.elseif,
+ block: element
+ });
+ } else {
+ warnOnce(
+ "Component template should contain exactly one root element. " +
+ "If you are using v-if on multiple elements, " +
+ "use v-else-if to chain them instead.",
+ { start: element.start }
+ );
+ }
+ }
+ if (currentParent && !element.forbidden) {
+ if (element.elseif || element.else) {
+ processIfConditions(element, currentParent);
+ } else {
+ if (element.slotScope) {
+ // scoped slot
+ // keep it in the children list so that v-else(-if) conditions can
+ // find it as the prev node.
+ var name = element.slotTarget || '"default"'
+ ;(currentParent.scopedSlots || (currentParent.scopedSlots = {}))[name] = element;
+ }
+ currentParent.children.push(element);
+ element.parent = currentParent;
+ }
+ }
+
+ // final children cleanup
+ // filter out scoped slots
+ element.children = element.children.filter(function (c) { return !(c).slotScope; });
+ // remove trailing whitespace node again
+ trimEndingWhitespace(element);
+
+ // check pre state
+ if (element.pre) {
+ inVPre = false;
+ }
+ if (platformIsPreTag(element.tag)) {
+ inPre = false;
+ }
+ // apply post-transforms
+ for (var i = 0; i < postTransforms.length; i++) {
+ postTransforms[i](element, options);
+ }
+ }
+
+ function trimEndingWhitespace (el) {
+ // remove trailing whitespace node
+ if (!inPre) {
+ var lastNode;
+ while (
+ (lastNode = el.children[el.children.length - 1]) &&
+ lastNode.type === 3 &&
+ lastNode.text === ' '
+ ) {
+ el.children.pop();
+ }
+ }
+ }
+
+ function checkRootConstraints (el) {
+ if (el.tag === 'slot' || el.tag === 'template') {
+ warnOnce(
+ "Cannot use <" + (el.tag) + "> as component root element because it may " +
+ 'contain multiple nodes.',
+ { start: el.start }
+ );
+ }
+ if (el.attrsMap.hasOwnProperty('v-for')) {
+ warnOnce(
+ 'Cannot use v-for on stateful component root element because ' +
+ 'it renders multiple elements.',
+ el.rawAttrsMap['v-for']
+ );
+ }
+ }
+
+ parseHTML(template, {
+ warn: warn$2,
+ expectHTML: options.expectHTML,
+ isUnaryTag: options.isUnaryTag,
+ canBeLeftOpenTag: options.canBeLeftOpenTag,
+ shouldDecodeNewlines: options.shouldDecodeNewlines,
+ shouldDecodeNewlinesForHref: options.shouldDecodeNewlinesForHref,
+ shouldKeepComment: options.comments,
+ outputSourceRange: options.outputSourceRange,
+ start: function start (tag, attrs, unary, start$1, end) {
+ // check namespace.
+ // inherit parent ns if there is one
+ var ns = (currentParent && currentParent.ns) || platformGetTagNamespace(tag);
+
+ // handle IE svg bug
+ /* istanbul ignore if */
+ if (isIE && ns === 'svg') {
+ attrs = guardIESVGBug(attrs);
+ }
+
+ var element = createASTElement(tag, attrs, currentParent);
+ if (ns) {
+ element.ns = ns;
+ }
+
+ {
+ if (options.outputSourceRange) {
+ element.start = start$1;
+ element.end = end;
+ element.rawAttrsMap = element.attrsList.reduce(function (cumulated, attr) {
+ cumulated[attr.name] = attr;
+ return cumulated
+ }, {});
+ }
+ attrs.forEach(function (attr) {
+ if (invalidAttributeRE.test(attr.name)) {
+ warn$2(
+ "Invalid dynamic argument expression: attribute names cannot contain " +
+ "spaces, quotes, <, >, / or =.",
+ {
+ start: attr.start + attr.name.indexOf("["),
+ end: attr.start + attr.name.length
+ }
+ );
+ }
+ });
+ }
+
+ if (isForbiddenTag(element) && !isServerRendering()) {
+ element.forbidden = true;
+ warn$2(
+ 'Templates should only be responsible for mapping the state to the ' +
+ 'UI. Avoid placing tags with side-effects in your templates, such as ' +
+ "<" + tag + ">" + ', as they will not be parsed.',
+ { start: element.start }
+ );
+ }
+
+ // apply pre-transforms
+ for (var i = 0; i < preTransforms.length; i++) {
+ element = preTransforms[i](element, options) || element;
+ }
+
+ if (!inVPre) {
+ processPre(element);
+ if (element.pre) {
+ inVPre = true;
+ }
+ }
+ if (platformIsPreTag(element.tag)) {
+ inPre = true;
+ }
+ if (inVPre) {
+ processRawAttrs(element);
+ } else if (!element.processed) {
+ // structural directives
+ processFor(element);
+ processIf(element);
+ processOnce(element);
+ }
+
+ if (!root) {
+ root = element;
+ {
+ checkRootConstraints(root);
+ }
+ }
+
+ if (!unary) {
+ currentParent = element;
+ stack.push(element);
+ } else {
+ closeElement(element);
+ }
+ },
+
+ end: function end (tag, start, end$1) {
+ var element = stack[stack.length - 1];
+ // pop stack
+ stack.length -= 1;
+ currentParent = stack[stack.length - 1];
+ if (options.outputSourceRange) {
+ element.end = end$1;
+ }
+ closeElement(element);
+ },
+
+ chars: function chars (text, start, end) {
+ if (!currentParent) {
+ {
+ if (text === template) {
+ warnOnce(
+ 'Component template requires a root element, rather than just text.',
+ { start: start }
+ );
+ } else if ((text = text.trim())) {
+ warnOnce(
+ ("text \"" + text + "\" outside root element will be ignored."),
+ { start: start }
+ );
+ }
+ }
+ return
+ }
+ // IE textarea placeholder bug
+ /* istanbul ignore if */
+ if (isIE &&
+ currentParent.tag === 'textarea' &&
+ currentParent.attrsMap.placeholder === text
+ ) {
+ return
+ }
+ var children = currentParent.children;
+ if (inPre || text.trim()) {
+ text = isTextTag(currentParent) ? text : decodeHTMLCached(text);
+ } else if (!children.length) {
+ // remove the whitespace-only node right after an opening tag
+ text = '';
+ } else if (whitespaceOption) {
+ if (whitespaceOption === 'condense') {
+ // in condense mode, remove the whitespace node if it contains
+ // line break, otherwise condense to a single space
+ text = lineBreakRE.test(text) ? '' : ' ';
+ } else {
+ text = ' ';
+ }
+ } else {
+ text = preserveWhitespace ? ' ' : '';
+ }
+ if (text) {
+ if (!inPre && whitespaceOption === 'condense') {
+ // condense consecutive whitespaces into single space
+ text = text.replace(whitespaceRE$1, ' ');
+ }
+ var res;
+ var child;
+ if (!inVPre && text !== ' ' && (res = parseText(text, delimiters))) {
+ child = {
+ type: 2,
+ expression: res.expression,
+ tokens: res.tokens,
+ text: text
+ };
+ } else if (text !== ' ' || !children.length || children[children.length - 1].text !== ' ') {
+ child = {
+ type: 3,
+ text: text
+ };
+ }
+ if (child) {
+ if (options.outputSourceRange) {
+ child.start = start;
+ child.end = end;
+ }
+ children.push(child);
+ }
+ }
+ },
+ comment: function comment (text, start, end) {
+ // adding anyting as a sibling to the root node is forbidden
+ // comments should still be allowed, but ignored
+ if (currentParent) {
+ var child = {
+ type: 3,
+ text: text,
+ isComment: true
+ };
+ if (options.outputSourceRange) {
+ child.start = start;
+ child.end = end;
+ }
+ currentParent.children.push(child);
+ }
+ }
+ });
+ return root
+}
+
+function processPre (el) {
+ if (getAndRemoveAttr(el, 'v-pre') != null) {
+ el.pre = true;
+ }
+}
+
+function processRawAttrs (el) {
+ var list = el.attrsList;
+ var len = list.length;
+ if (len) {
+ var attrs = el.attrs = new Array(len);
+ for (var i = 0; i < len; i++) {
+ attrs[i] = {
+ name: list[i].name,
+ value: JSON.stringify(list[i].value)
+ };
+ if (list[i].start != null) {
+ attrs[i].start = list[i].start;
+ attrs[i].end = list[i].end;
+ }
+ }
+ } else if (!el.pre) {
+ // non root node in pre blocks with no attributes
+ el.plain = true;
+ }
+}
+
+function processElement (
+ element,
+ options
+) {
+ processKey(element);
+
+ // determine whether this is a plain element after
+ // removing structural attributes
+ element.plain = (
+ !element.key &&
+ !element.scopedSlots &&
+ !element.attrsList.length
+ );
+
+ processRef(element);
+ processSlotContent(element);
+ processSlotOutlet(element);
+ processComponent(element);
+ for (var i = 0; i < transforms.length; i++) {
+ element = transforms[i](element, options) || element;
+ }
+ processAttrs(element);
+ return element
+}
+
+function processKey (el) {
+ var exp = getBindingAttr(el, 'key');
+ if (exp) {
+ {
+ if (el.tag === 'template') {
+ warn$2(
+ "<template> cannot be keyed. Place the key on real elements instead.",
+ getRawBindingAttr(el, 'key')
+ );
+ }
+ if (el.for) {
+ var iterator = el.iterator2 || el.iterator1;
+ var parent = el.parent;
+ if (iterator && iterator === exp && parent && parent.tag === 'transition-group') {
+ warn$2(
+ "Do not use v-for index as key on <transition-group> children, " +
+ "this is the same as not using keys.",
+ getRawBindingAttr(el, 'key'),
+ true /* tip */
+ );
+ }
+ }
+ }
+ el.key = exp;
+ }
+}
+
+function processRef (el) {
+ var ref = getBindingAttr(el, 'ref');
+ if (ref) {
+ el.ref = ref;
+ el.refInFor = checkInFor(el);
+ }
+}
+
+function processFor (el) {
+ var exp;
+ if ((exp = getAndRemoveAttr(el, 'v-for'))) {
+ var res = parseFor(exp);
+ if (res) {
+ extend(el, res);
+ } else {
+ warn$2(
+ ("Invalid v-for expression: " + exp),
+ el.rawAttrsMap['v-for']
+ );
+ }
+ }
+}
+
+
+
+function parseFor (exp) {
+ var inMatch = exp.match(forAliasRE);
+ if (!inMatch) { return }
+ var res = {};
+ res.for = inMatch[2].trim();
+ var alias = inMatch[1].trim().replace(stripParensRE, '');
+ var iteratorMatch = alias.match(forIteratorRE);
+ if (iteratorMatch) {
+ res.alias = alias.replace(forIteratorRE, '').trim();
+ res.iterator1 = iteratorMatch[1].trim();
+ if (iteratorMatch[2]) {
+ res.iterator2 = iteratorMatch[2].trim();
+ }
+ } else {
+ res.alias = alias;
+ }
+ return res
+}
+
+function processIf (el) {
+ var exp = getAndRemoveAttr(el, 'v-if');
+ if (exp) {
+ el.if = exp;
+ addIfCondition(el, {
+ exp: exp,
+ block: el
+ });
+ } else {
+ if (getAndRemoveAttr(el, 'v-else') != null) {
+ el.else = true;
+ }
+ var elseif = getAndRemoveAttr(el, 'v-else-if');
+ if (elseif) {
+ el.elseif = elseif;
+ }
+ }
+}
+
+function processIfConditions (el, parent) {
+ var prev = findPrevElement(parent.children);
+ if (prev && prev.if) {
+ addIfCondition(prev, {
+ exp: el.elseif,
+ block: el
+ });
+ } else {
+ warn$2(
+ "v-" + (el.elseif ? ('else-if="' + el.elseif + '"') : 'else') + " " +
+ "used on element <" + (el.tag) + "> without corresponding v-if.",
+ el.rawAttrsMap[el.elseif ? 'v-else-if' : 'v-else']
+ );
+ }
+}
+
+function findPrevElement (children) {
+ var i = children.length;
+ while (i--) {
+ if (children[i].type === 1) {
+ return children[i]
+ } else {
+ if (children[i].text !== ' ') {
+ warn$2(
+ "text \"" + (children[i].text.trim()) + "\" between v-if and v-else(-if) " +
+ "will be ignored.",
+ children[i]
+ );
+ }
+ children.pop();
+ }
+ }
+}
+
+function addIfCondition (el, condition) {
+ if (!el.ifConditions) {
+ el.ifConditions = [];
+ }
+ el.ifConditions.push(condition);
+}
+
+function processOnce (el) {
+ var once$$1 = getAndRemoveAttr(el, 'v-once');
+ if (once$$1 != null) {
+ el.once = true;
+ }
+}
+
+// handle content being passed to a component as slot,
+// e.g. <template slot="xxx">, <div slot-scope="xxx">
+function processSlotContent (el) {
+ var slotScope;
+ if (el.tag === 'template') {
+ slotScope = getAndRemoveAttr(el, 'scope');
+ /* istanbul ignore if */
+ if (slotScope) {
+ warn$2(
+ "the \"scope\" attribute for scoped slots have been deprecated and " +
+ "replaced by \"slot-scope\" since 2.5. The new \"slot-scope\" attribute " +
+ "can also be used on plain elements in addition to <template> to " +
+ "denote scoped slots.",
+ el.rawAttrsMap['scope'],
+ true
+ );
+ }
+ el.slotScope = slotScope || getAndRemoveAttr(el, 'slot-scope');
+ } else if ((slotScope = getAndRemoveAttr(el, 'slot-scope'))) {
+ /* istanbul ignore if */
+ if (el.attrsMap['v-for']) {
+ warn$2(
+ "Ambiguous combined usage of slot-scope and v-for on <" + (el.tag) + "> " +
+ "(v-for takes higher priority). Use a wrapper <template> for the " +
+ "scoped slot to make it clearer.",
+ el.rawAttrsMap['slot-scope'],
+ true
+ );
+ }
+ el.slotScope = slotScope;
+ }
+
+ // slot="xxx"
+ var slotTarget = getBindingAttr(el, 'slot');
+ if (slotTarget) {
+ el.slotTarget = slotTarget === '""' ? '"default"' : slotTarget;
+ el.slotTargetDynamic = !!(el.attrsMap[':slot'] || el.attrsMap['v-bind:slot']);
+ // preserve slot as an attribute for native shadow DOM compat
+ // only for non-scoped slots.
+ if (el.tag !== 'template' && !el.slotScope) {
+ addAttr(el, 'slot', slotTarget, getRawBindingAttr(el, 'slot'));
+ }
+ }
+
+ // 2.6 v-slot syntax
+ {
+ if (el.tag === 'template') {
+ // v-slot on <template>
+ var slotBinding = getAndRemoveAttrByRegex(el, slotRE);
+ if (slotBinding) {
+ {
+ if (el.slotTarget || el.slotScope) {
+ warn$2(
+ "Unexpected mixed usage of different slot syntaxes.",
+ el
+ );
+ }
+ if (el.parent && !maybeComponent(el.parent)) {
+ warn$2(
+ "<template v-slot> can only appear at the root level inside " +
+ "the receiving the component",
+ el
+ );
+ }
+ }
+ var ref = getSlotName(slotBinding);
+ var name = ref.name;
+ var dynamic = ref.dynamic;
+ el.slotTarget = name;
+ el.slotTargetDynamic = dynamic;
+ el.slotScope = slotBinding.value || emptySlotScopeToken; // force it into a scoped slot for perf
+ }
+ } else {
+ // v-slot on component, denotes default slot
+ var slotBinding$1 = getAndRemoveAttrByRegex(el, slotRE);
+ if (slotBinding$1) {
+ {
+ if (!maybeComponent(el)) {
+ warn$2(
+ "v-slot can only be used on components or <template>.",
+ slotBinding$1
+ );
+ }
+ if (el.slotScope || el.slotTarget) {
+ warn$2(
+ "Unexpected mixed usage of different slot syntaxes.",
+ el
+ );
+ }
+ if (el.scopedSlots) {
+ warn$2(
+ "To avoid scope ambiguity, the default slot should also use " +
+ "<template> syntax when there are other named slots.",
+ slotBinding$1
+ );
+ }
+ }
+ // add the component's children to its default slot
+ var slots = el.scopedSlots || (el.scopedSlots = {});
+ var ref$1 = getSlotName(slotBinding$1);
+ var name$1 = ref$1.name;
+ var dynamic$1 = ref$1.dynamic;
+ var slotContainer = slots[name$1] = createASTElement('template', [], el);
+ slotContainer.slotTarget = name$1;
+ slotContainer.slotTargetDynamic = dynamic$1;
+ slotContainer.children = el.children.filter(function (c) {
+ if (!c.slotScope) {
+ c.parent = slotContainer;
+ return true
+ }
+ });
+ slotContainer.slotScope = slotBinding$1.value || emptySlotScopeToken;
+ // remove children as they are returned from scopedSlots now
+ el.children = [];
+ // mark el non-plain so data gets generated
+ el.plain = false;
+ }
+ }
+ }
+}
+
+function getSlotName (binding) {
+ var name = binding.name.replace(slotRE, '');
+ if (!name) {
+ if (binding.name[0] !== '#') {
+ name = 'default';
+ } else {
+ warn$2(
+ "v-slot shorthand syntax requires a slot name.",
+ binding
+ );
+ }
+ }
+ return dynamicArgRE.test(name)
+ // dynamic [name]
+ ? { name: name.slice(1, -1), dynamic: true }
+ // static name
+ : { name: ("\"" + name + "\""), dynamic: false }
+}
+
+// handle <slot/> outlets
+function processSlotOutlet (el) {
+ if (el.tag === 'slot') {
+ el.slotName = getBindingAttr(el, 'name');
+ if (el.key) {
+ warn$2(
+ "`key` does not work on <slot> because slots are abstract outlets " +
+ "and can possibly expand into multiple elements. " +
+ "Use the key on a wrapping element instead.",
+ getRawBindingAttr(el, 'key')
+ );
+ }
+ }
+}
+
+function processComponent (el) {
+ var binding;
+ if ((binding = getBindingAttr(el, 'is'))) {
+ el.component = binding;
+ }
+ if (getAndRemoveAttr(el, 'inline-template') != null) {
+ el.inlineTemplate = true;
+ }
+}
+
+function processAttrs (el) {
+ var list = el.attrsList;
+ var i, l, name, rawName, value, modifiers, syncGen, isDynamic;
+ for (i = 0, l = list.length; i < l; i++) {
+ name = rawName = list[i].name;
+ value = list[i].value;
+ if (dirRE.test(name)) {
+ // mark element as dynamic
+ el.hasBindings = true;
+ // modifiers
+ modifiers = parseModifiers(name.replace(dirRE, ''));
+ // support .foo shorthand syntax for the .prop modifier
+ if (modifiers) {
+ name = name.replace(modifierRE, '');
+ }
+ if (bindRE.test(name)) { // v-bind
+ name = name.replace(bindRE, '');
+ value = parseFilters(value);
+ isDynamic = dynamicArgRE.test(name);
+ if (isDynamic) {
+ name = name.slice(1, -1);
+ }
+ if (
+ value.trim().length === 0
+ ) {
+ warn$2(
+ ("The value for a v-bind expression cannot be empty. Found in \"v-bind:" + name + "\"")
+ );
+ }
+ if (modifiers) {
+ if (modifiers.prop && !isDynamic) {
+ name = camelize(name);
+ if (name === 'innerHtml') { name = 'innerHTML'; }
+ }
+ if (modifiers.camel && !isDynamic) {
+ name = camelize(name);
+ }
+ if (modifiers.sync) {
+ syncGen = genAssignmentCode(value, "$event");
+ if (!isDynamic) {
+ addHandler(
+ el,
+ ("update:" + (camelize(name))),
+ syncGen,
+ null,
+ false,
+ warn$2,
+ list[i]
+ );
+ if (hyphenate(name) !== camelize(name)) {
+ addHandler(
+ el,
+ ("update:" + (hyphenate(name))),
+ syncGen,
+ null,
+ false,
+ warn$2,
+ list[i]
+ );
+ }
+ } else {
+ // handler w/ dynamic event name
+ addHandler(
+ el,
+ ("\"update:\"+(" + name + ")"),
+ syncGen,
+ null,
+ false,
+ warn$2,
+ list[i],
+ true // dynamic
+ );
+ }
+ }
+ }
+ if ((modifiers && modifiers.prop) || (
+ !el.component && platformMustUseProp(el.tag, el.attrsMap.type, name)
+ )) {
+ addProp(el, name, value, list[i], isDynamic);
+ } else {
+ addAttr(el, name, value, list[i], isDynamic);
+ }
+ } else if (onRE.test(name)) { // v-on
+ name = name.replace(onRE, '');
+ isDynamic = dynamicArgRE.test(name);
+ if (isDynamic) {
+ name = name.slice(1, -1);
+ }
+ addHandler(el, name, value, modifiers, false, warn$2, list[i], isDynamic);
+ } else { // normal directives
+ name = name.replace(dirRE, '');
+ // parse arg
+ var argMatch = name.match(argRE);
+ var arg = argMatch && argMatch[1];
+ isDynamic = false;
+ if (arg) {
+ name = name.slice(0, -(arg.length + 1));
+ if (dynamicArgRE.test(arg)) {
+ arg = arg.slice(1, -1);
+ isDynamic = true;
+ }
+ }
+ addDirective(el, name, rawName, value, arg, isDynamic, modifiers, list[i]);
+ if (name === 'model') {
+ checkForAliasModel(el, value);
+ }
+ }
+ } else {
+ // literal attribute
+ {
+ var res = parseText(value, delimiters);
+ if (res) {
+ warn$2(
+ name + "=\"" + value + "\": " +
+ 'Interpolation inside attributes has been removed. ' +
+ 'Use v-bind or the colon shorthand instead. For example, ' +
+ 'instead of <div id="{{ val }}">, use <div :id="val">.',
+ list[i]
+ );
+ }
+ }
+ addAttr(el, name, JSON.stringify(value), list[i]);
+ // #6887 firefox doesn't update muted state if set via attribute
+ // even immediately after element creation
+ if (!el.component &&
+ name === 'muted' &&
+ platformMustUseProp(el.tag, el.attrsMap.type, name)) {
+ addProp(el, name, 'true', list[i]);
+ }
+ }
+ }
+}
+
+function checkInFor (el) {
+ var parent = el;
+ while (parent) {
+ if (parent.for !== undefined) {
+ return true
+ }
+ parent = parent.parent;
+ }
+ return false
+}
+
+function parseModifiers (name) {
+ var match = name.match(modifierRE);
+ if (match) {
+ var ret = {};
+ match.forEach(function (m) { ret[m.slice(1)] = true; });
+ return ret
+ }
+}
+
+function makeAttrsMap (attrs) {
+ var map = {};
+ for (var i = 0, l = attrs.length; i < l; i++) {
+ if (
+ map[attrs[i].name] && !isIE && !isEdge
+ ) {
+ warn$2('duplicate attribute: ' + attrs[i].name, attrs[i]);
+ }
+ map[attrs[i].name] = attrs[i].value;
+ }
+ return map
+}
+
+// for script (e.g. type="x/template") or style, do not decode content
+function isTextTag (el) {
+ return el.tag === 'script' || el.tag === 'style'
+}
+
+function isForbiddenTag (el) {
+ return (
+ el.tag === 'style' ||
+ (el.tag === 'script' && (
+ !el.attrsMap.type ||
+ el.attrsMap.type === 'text/javascript'
+ ))
+ )
+}
+
+var ieNSBug = /^xmlns:NS\d+/;
+var ieNSPrefix = /^NS\d+:/;
+
+/* istanbul ignore next */
+function guardIESVGBug (attrs) {
+ var res = [];
+ for (var i = 0; i < attrs.length; i++) {
+ var attr = attrs[i];
+ if (!ieNSBug.test(attr.name)) {
+ attr.name = attr.name.replace(ieNSPrefix, '');
+ res.push(attr);
+ }
+ }
+ return res
+}
+
+function checkForAliasModel (el, value) {
+ var _el = el;
+ while (_el) {
+ if (_el.for && _el.alias === value) {
+ warn$2(
+ "<" + (el.tag) + " v-model=\"" + value + "\">: " +
+ "You are binding v-model directly to a v-for iteration alias. " +
+ "This will not be able to modify the v-for source array because " +
+ "writing to the alias is like modifying a function local variable. " +
+ "Consider using an array of objects and use v-model on an object property instead.",
+ el.rawAttrsMap['v-model']
+ );
+ }
+ _el = _el.parent;
+ }
+}
+
+/* */
+
+function preTransformNode (el, options) {
+ if (el.tag === 'input') {
+ var map = el.attrsMap;
+ if (!map['v-model']) {
+ return
+ }
+
+ var typeBinding;
+ if (map[':type'] || map['v-bind:type']) {
+ typeBinding = getBindingAttr(el, 'type');
+ }
+ if (!map.type && !typeBinding && map['v-bind']) {
+ typeBinding = "(" + (map['v-bind']) + ").type";
+ }
+
+ if (typeBinding) {
+ var ifCondition = getAndRemoveAttr(el, 'v-if', true);
+ var ifConditionExtra = ifCondition ? ("&&(" + ifCondition + ")") : "";
+ var hasElse = getAndRemoveAttr(el, 'v-else', true) != null;
+ var elseIfCondition = getAndRemoveAttr(el, 'v-else-if', true);
+ // 1. checkbox
+ var branch0 = cloneASTElement(el);
+ // process for on the main node
+ processFor(branch0);
+ addRawAttr(branch0, 'type', 'checkbox');
+ processElement(branch0, options);
+ branch0.processed = true; // prevent it from double-processed
+ branch0.if = "(" + typeBinding + ")==='checkbox'" + ifConditionExtra;
+ addIfCondition(branch0, {
+ exp: branch0.if,
+ block: branch0
+ });
+ // 2. add radio else-if condition
+ var branch1 = cloneASTElement(el);
+ getAndRemoveAttr(branch1, 'v-for', true);
+ addRawAttr(branch1, 'type', 'radio');
+ processElement(branch1, options);
+ addIfCondition(branch0, {
+ exp: "(" + typeBinding + ")==='radio'" + ifConditionExtra,
+ block: branch1
+ });
+ // 3. other
+ var branch2 = cloneASTElement(el);
+ getAndRemoveAttr(branch2, 'v-for', true);
+ addRawAttr(branch2, ':type', typeBinding);
+ processElement(branch2, options);
+ addIfCondition(branch0, {
+ exp: ifCondition,
+ block: branch2
+ });
+
+ if (hasElse) {
+ branch0.else = true;
+ } else if (elseIfCondition) {
+ branch0.elseif = elseIfCondition;
+ }
+
+ return branch0
+ }
+ }
+}
+
+function cloneASTElement (el) {
+ return createASTElement(el.tag, el.attrsList.slice(), el.parent)
+}
+
+var model$1 = {
+ preTransformNode: preTransformNode
+};
+
+var modules$1 = [
+ klass$1,
+ style$1,
+ model$1
+];
+
+/* */
+
+function text (el, dir) {
+ if (dir.value) {
+ addProp(el, 'textContent', ("_s(" + (dir.value) + ")"), dir);
+ }
+}
+
+/* */
+
+function html (el, dir) {
+ if (dir.value) {
+ addProp(el, 'innerHTML', ("_s(" + (dir.value) + ")"), dir);
+ }
+}
+
+var directives$1 = {
+ model: model,
+ text: text,
+ html: html
+};
+
+/* */
+
+var baseOptions = {
+ expectHTML: true,
+ modules: modules$1,
+ directives: directives$1,
+ isPreTag: isPreTag,
+ isUnaryTag: isUnaryTag,
+ mustUseProp: mustUseProp,
+ canBeLeftOpenTag: canBeLeftOpenTag,
+ isReservedTag: isReservedTag,
+ getTagNamespace: getTagNamespace,
+ staticKeys: genStaticKeys(modules$1)
+};
+
+/* */
+
+var isStaticKey;
+var isPlatformReservedTag;
+
+var genStaticKeysCached = cached(genStaticKeys$1);
+
+/**
+ * Goal of the optimizer: walk the generated template AST tree
+ * and detect sub-trees that are purely static, i.e. parts of
+ * the DOM that never needs to change.
+ *
+ * Once we detect these sub-trees, we can:
+ *
+ * 1. Hoist them into constants, so that we no longer need to
+ * create fresh nodes for them on each re-render;
+ * 2. Completely skip them in the patching process.
+ */
+function optimize (root, options) {
+ if (!root) { return }
+ isStaticKey = genStaticKeysCached(options.staticKeys || '');
+ isPlatformReservedTag = options.isReservedTag || no;
+ // first pass: mark all non-static nodes.
+ markStatic$1(root);
+ // second pass: mark static roots.
+ markStaticRoots(root, false);
+}
+
+function genStaticKeys$1 (keys) {
+ return makeMap(
+ 'type,tag,attrsList,attrsMap,plain,parent,children,attrs,start,end,rawAttrsMap' +
+ (keys ? ',' + keys : '')
+ )
+}
+
+function markStatic$1 (node) {
+ node.static = isStatic(node);
+ if (node.type === 1) {
+ // do not make component slot content static. this avoids
+ // 1. components not able to mutate slot nodes
+ // 2. static slot content fails for hot-reloading
+ if (
+ !isPlatformReservedTag(node.tag) &&
+ node.tag !== 'slot' &&
+ node.attrsMap['inline-template'] == null
+ ) {
+ return
+ }
+ for (var i = 0, l = node.children.length; i < l; i++) {
+ var child = node.children[i];
+ markStatic$1(child);
+ if (!child.static) {
+ node.static = false;
+ }
+ }
+ if (node.ifConditions) {
+ for (var i$1 = 1, l$1 = node.ifConditions.length; i$1 < l$1; i$1++) {
+ var block = node.ifConditions[i$1].block;
+ markStatic$1(block);
+ if (!block.static) {
+ node.static = false;
+ }
+ }
+ }
+ }
+}
+
+function markStaticRoots (node, isInFor) {
+ if (node.type === 1) {
+ if (node.static || node.once) {
+ node.staticInFor = isInFor;
+ }
+ // For a node to qualify as a static root, it should have children that
+ // are not just static text. Otherwise the cost of hoisting out will
+ // outweigh the benefits and it's better off to just always render it fresh.
+ if (node.static && node.children.length && !(
+ node.children.length === 1 &&
+ node.children[0].type === 3
+ )) {
+ node.staticRoot = true;
+ return
+ } else {
+ node.staticRoot = false;
+ }
+ if (node.children) {
+ for (var i = 0, l = node.children.length; i < l; i++) {
+ markStaticRoots(node.children[i], isInFor || !!node.for);
+ }
+ }
+ if (node.ifConditions) {
+ for (var i$1 = 1, l$1 = node.ifConditions.length; i$1 < l$1; i$1++) {
+ markStaticRoots(node.ifConditions[i$1].block, isInFor);
+ }
+ }
+ }
+}
+
+function isStatic (node) {
+ if (node.type === 2) { // expression
+ return false
+ }
+ if (node.type === 3) { // text
+ return true
+ }
+ return !!(node.pre || (
+ !node.hasBindings && // no dynamic bindings
+ !node.if && !node.for && // not v-if or v-for or v-else
+ !isBuiltInTag(node.tag) && // not a built-in
+ isPlatformReservedTag(node.tag) && // not a component
+ !isDirectChildOfTemplateFor(node) &&
+ Object.keys(node).every(isStaticKey)
+ ))
+}
+
+function isDirectChildOfTemplateFor (node) {
+ while (node.parent) {
+ node = node.parent;
+ if (node.tag !== 'template') {
+ return false
+ }
+ if (node.for) {
+ return true
+ }
+ }
+ return false
+}
+
+/* */
+
+var fnExpRE = /^([\w$_]+|\([^)]*?\))\s*=>|^function\s*(?:[\w$]+)?\s*\(/;
+var fnInvokeRE = /\([^)]*?\);*$/;
+var simplePathRE = /^[A-Za-z_$][\w$]*(?:\.[A-Za-z_$][\w$]*|\['[^']*?']|\["[^"]*?"]|\[\d+]|\[[A-Za-z_$][\w$]*])*$/;
+
+// KeyboardEvent.keyCode aliases
+var keyCodes = {
+ esc: 27,
+ tab: 9,
+ enter: 13,
+ space: 32,
+ up: 38,
+ left: 37,
+ right: 39,
+ down: 40,
+ 'delete': [8, 46]
+};
+
+// KeyboardEvent.key aliases
+var keyNames = {
+ // #7880: IE11 and Edge use `Esc` for Escape key name.
+ esc: ['Esc', 'Escape'],
+ tab: 'Tab',
+ enter: 'Enter',
+ // #9112: IE11 uses `Spacebar` for Space key name.
+ space: [' ', 'Spacebar'],
+ // #7806: IE11 uses key names without `Arrow` prefix for arrow keys.
+ up: ['Up', 'ArrowUp'],
+ left: ['Left', 'ArrowLeft'],
+ right: ['Right', 'ArrowRight'],
+ down: ['Down', 'ArrowDown'],
+ // #9112: IE11 uses `Del` for Delete key name.
+ 'delete': ['Backspace', 'Delete', 'Del']
+};
+
+// #4868: modifiers that prevent the execution of the listener
+// need to explicitly return null so that we can determine whether to remove
+// the listener for .once
+var genGuard = function (condition) { return ("if(" + condition + ")return null;"); };
+
+var modifierCode = {
+ stop: '$event.stopPropagation();',
+ prevent: '$event.preventDefault();',
+ self: genGuard("$event.target !== $event.currentTarget"),
+ ctrl: genGuard("!$event.ctrlKey"),
+ shift: genGuard("!$event.shiftKey"),
+ alt: genGuard("!$event.altKey"),
+ meta: genGuard("!$event.metaKey"),
+ left: genGuard("'button' in $event && $event.button !== 0"),
+ middle: genGuard("'button' in $event && $event.button !== 1"),
+ right: genGuard("'button' in $event && $event.button !== 2")
+};
+
+function genHandlers (
+ events,
+ isNative
+) {
+ var prefix = isNative ? 'nativeOn:' : 'on:';
+ var staticHandlers = "";
+ var dynamicHandlers = "";
+ for (var name in events) {
+ var handlerCode = genHandler(events[name]);
+ if (events[name] && events[name].dynamic) {
+ dynamicHandlers += name + "," + handlerCode + ",";
+ } else {
+ staticHandlers += "\"" + name + "\":" + handlerCode + ",";
+ }
+ }
+ staticHandlers = "{" + (staticHandlers.slice(0, -1)) + "}";
+ if (dynamicHandlers) {
+ return prefix + "_d(" + staticHandlers + ",[" + (dynamicHandlers.slice(0, -1)) + "])"
+ } else {
+ return prefix + staticHandlers
+ }
+}
+
+function genHandler (handler) {
+ if (!handler) {
+ return 'function(){}'
+ }
+
+ if (Array.isArray(handler)) {
+ return ("[" + (handler.map(function (handler) { return genHandler(handler); }).join(',')) + "]")
+ }
+
+ var isMethodPath = simplePathRE.test(handler.value);
+ var isFunctionExpression = fnExpRE.test(handler.value);
+ var isFunctionInvocation = simplePathRE.test(handler.value.replace(fnInvokeRE, ''));
+
+ if (!handler.modifiers) {
+ if (isMethodPath || isFunctionExpression) {
+ return handler.value
+ }
+ return ("function($event){" + (isFunctionInvocation ? ("return " + (handler.value)) : handler.value) + "}") // inline statement
+ } else {
+ var code = '';
+ var genModifierCode = '';
+ var keys = [];
+ for (var key in handler.modifiers) {
+ if (modifierCode[key]) {
+ genModifierCode += modifierCode[key];
+ // left/right
+ if (keyCodes[key]) {
+ keys.push(key);
+ }
+ } else if (key === 'exact') {
+ var modifiers = (handler.modifiers);
+ genModifierCode += genGuard(
+ ['ctrl', 'shift', 'alt', 'meta']
+ .filter(function (keyModifier) { return !modifiers[keyModifier]; })
+ .map(function (keyModifier) { return ("$event." + keyModifier + "Key"); })
+ .join('||')
+ );
+ } else {
+ keys.push(key);
+ }
+ }
+ if (keys.length) {
+ code += genKeyFilter(keys);
+ }
+ // Make sure modifiers like prevent and stop get executed after key filtering
+ if (genModifierCode) {
+ code += genModifierCode;
+ }
+ var handlerCode = isMethodPath
+ ? ("return " + (handler.value) + "($event)")
+ : isFunctionExpression
+ ? ("return (" + (handler.value) + ")($event)")
+ : isFunctionInvocation
+ ? ("return " + (handler.value))
+ : handler.value;
+ return ("function($event){" + code + handlerCode + "}")
+ }
+}
+
+function genKeyFilter (keys) {
+ return (
+ // make sure the key filters only apply to KeyboardEvents
+ // #9441: can't use 'keyCode' in $event because Chrome autofill fires fake
+ // key events that do not have keyCode property...
+ "if(!$event.type.indexOf('key')&&" +
+ (keys.map(genFilterCode).join('&&')) + ")return null;"
+ )
+}
+
+function genFilterCode (key) {
+ var keyVal = parseInt(key, 10);
+ if (keyVal) {
+ return ("$event.keyCode!==" + keyVal)
+ }
+ var keyCode = keyCodes[key];
+ var keyName = keyNames[key];
+ return (
+ "_k($event.keyCode," +
+ (JSON.stringify(key)) + "," +
+ (JSON.stringify(keyCode)) + "," +
+ "$event.key," +
+ "" + (JSON.stringify(keyName)) +
+ ")"
+ )
+}
+
+/* */
+
+function on (el, dir) {
+ if (dir.modifiers) {
+ warn("v-on without argument does not support modifiers.");
+ }
+ el.wrapListeners = function (code) { return ("_g(" + code + "," + (dir.value) + ")"); };
+}
+
+/* */
+
+function bind$1 (el, dir) {
+ el.wrapData = function (code) {
+ return ("_b(" + code + ",'" + (el.tag) + "'," + (dir.value) + "," + (dir.modifiers && dir.modifiers.prop ? 'true' : 'false') + (dir.modifiers && dir.modifiers.sync ? ',true' : '') + ")")
+ };
+}
+
+/* */
+
+var baseDirectives = {
+ on: on,
+ bind: bind$1,
+ cloak: noop
+};
+
+/* */
+
+
+
+
+
+var CodegenState = function CodegenState (options) {
+ this.options = options;
+ this.warn = options.warn || baseWarn;
+ this.transforms = pluckModuleFunction(options.modules, 'transformCode');
+ this.dataGenFns = pluckModuleFunction(options.modules, 'genData');
+ this.directives = extend(extend({}, baseDirectives), options.directives);
+ var isReservedTag = options.isReservedTag || no;
+ this.maybeComponent = function (el) { return !!el.component || !isReservedTag(el.tag); };
+ this.onceId = 0;
+ this.staticRenderFns = [];
+ this.pre = false;
+};
+
+
+
+function generate (
+ ast,
+ options
+) {
+ var state = new CodegenState(options);
+ var code = ast ? genElement(ast, state) : '_c("div")';
+ return {
+ render: ("with(this){return " + code + "}"),
+ staticRenderFns: state.staticRenderFns
+ }
+}
+
+function genElement (el, state) {
+ if (el.parent) {
+ el.pre = el.pre || el.parent.pre;
+ }
+
+ if (el.staticRoot && !el.staticProcessed) {
+ return genStatic(el, state)
+ } else if (el.once && !el.onceProcessed) {
+ return genOnce(el, state)
+ } else if (el.for && !el.forProcessed) {
+ return genFor(el, state)
+ } else if (el.if && !el.ifProcessed) {
+ return genIf(el, state)
+ } else if (el.tag === 'template' && !el.slotTarget && !state.pre) {
+ return genChildren(el, state) || 'void 0'
+ } else if (el.tag === 'slot') {
+ return genSlot(el, state)
+ } else {
+ // component or element
+ var code;
+ if (el.component) {
+ code = genComponent(el.component, el, state);
+ } else {
+ var data;
+ if (!el.plain || (el.pre && state.maybeComponent(el))) {
+ data = genData$2(el, state);
+ }
+
+ var children = el.inlineTemplate ? null : genChildren(el, state, true);
+ code = "_c('" + (el.tag) + "'" + (data ? ("," + data) : '') + (children ? ("," + children) : '') + ")";
+ }
+ // module transforms
+ for (var i = 0; i < state.transforms.length; i++) {
+ code = state.transforms[i](el, code);
+ }
+ return code
+ }
+}
+
+// hoist static sub-trees out
+function genStatic (el, state) {
+ el.staticProcessed = true;
+ // Some elements (templates) need to behave differently inside of a v-pre
+ // node. All pre nodes are static roots, so we can use this as a location to
+ // wrap a state change and reset it upon exiting the pre node.
+ var originalPreState = state.pre;
+ if (el.pre) {
+ state.pre = el.pre;
+ }
+ state.staticRenderFns.push(("with(this){return " + (genElement(el, state)) + "}"));
+ state.pre = originalPreState;
+ return ("_m(" + (state.staticRenderFns.length - 1) + (el.staticInFor ? ',true' : '') + ")")
+}
+
+// v-once
+function genOnce (el, state) {
+ el.onceProcessed = true;
+ if (el.if && !el.ifProcessed) {
+ return genIf(el, state)
+ } else if (el.staticInFor) {
+ var key = '';
+ var parent = el.parent;
+ while (parent) {
+ if (parent.for) {
+ key = parent.key;
+ break
+ }
+ parent = parent.parent;
+ }
+ if (!key) {
+ state.warn(
+ "v-once can only be used inside v-for that is keyed. ",
+ el.rawAttrsMap['v-once']
+ );
+ return genElement(el, state)
+ }
+ return ("_o(" + (genElement(el, state)) + "," + (state.onceId++) + "," + key + ")")
+ } else {
+ return genStatic(el, state)
+ }
+}
+
+function genIf (
+ el,
+ state,
+ altGen,
+ altEmpty
+) {
+ el.ifProcessed = true; // avoid recursion
+ return genIfConditions(el.ifConditions.slice(), state, altGen, altEmpty)
+}
+
+function genIfConditions (
+ conditions,
+ state,
+ altGen,
+ altEmpty
+) {
+ if (!conditions.length) {
+ return altEmpty || '_e()'
+ }
+
+ var condition = conditions.shift();
+ if (condition.exp) {
+ return ("(" + (condition.exp) + ")?" + (genTernaryExp(condition.block)) + ":" + (genIfConditions(conditions, state, altGen, altEmpty)))
+ } else {
+ return ("" + (genTernaryExp(condition.block)))
+ }
+
+ // v-if with v-once should generate code like (a)?_m(0):_m(1)
+ function genTernaryExp (el) {
+ return altGen
+ ? altGen(el, state)
+ : el.once
+ ? genOnce(el, state)
+ : genElement(el, state)
+ }
+}
+
+function genFor (
+ el,
+ state,
+ altGen,
+ altHelper
+) {
+ var exp = el.for;
+ var alias = el.alias;
+ var iterator1 = el.iterator1 ? ("," + (el.iterator1)) : '';
+ var iterator2 = el.iterator2 ? ("," + (el.iterator2)) : '';
+
+ if (state.maybeComponent(el) &&
+ el.tag !== 'slot' &&
+ el.tag !== 'template' &&
+ !el.key
+ ) {
+ state.warn(
+ "<" + (el.tag) + " v-for=\"" + alias + " in " + exp + "\">: component lists rendered with " +
+ "v-for should have explicit keys. " +
+ "See https://vuejs.org/guide/list.html#key for more info.",
+ el.rawAttrsMap['v-for'],
+ true /* tip */
+ );
+ }
+
+ el.forProcessed = true; // avoid recursion
+ return (altHelper || '_l') + "((" + exp + ")," +
+ "function(" + alias + iterator1 + iterator2 + "){" +
+ "return " + ((altGen || genElement)(el, state)) +
+ '})'
+}
+
+function genData$2 (el, state) {
+ var data = '{';
+
+ // directives first.
+ // directives may mutate the el's other properties before they are generated.
+ var dirs = genDirectives(el, state);
+ if (dirs) { data += dirs + ','; }
+
+ // key
+ if (el.key) {
+ data += "key:" + (el.key) + ",";
+ }
+ // ref
+ if (el.ref) {
+ data += "ref:" + (el.ref) + ",";
+ }
+ if (el.refInFor) {
+ data += "refInFor:true,";
+ }
+ // pre
+ if (el.pre) {
+ data += "pre:true,";
+ }
+ // record original tag name for components using "is" attribute
+ if (el.component) {
+ data += "tag:\"" + (el.tag) + "\",";
+ }
+ // module data generation functions
+ for (var i = 0; i < state.dataGenFns.length; i++) {
+ data += state.dataGenFns[i](el);
+ }
+ // attributes
+ if (el.attrs) {
+ data += "attrs:" + (genProps(el.attrs)) + ",";
+ }
+ // DOM props
+ if (el.props) {
+ data += "domProps:" + (genProps(el.props)) + ",";
+ }
+ // event handlers
+ if (el.events) {
+ data += (genHandlers(el.events, false)) + ",";
+ }
+ if (el.nativeEvents) {
+ data += (genHandlers(el.nativeEvents, true)) + ",";
+ }
+ // slot target
+ // only for non-scoped slots
+ if (el.slotTarget && !el.slotScope) {
+ data += "slot:" + (el.slotTarget) + ",";
+ }
+ // scoped slots
+ if (el.scopedSlots) {
+ data += (genScopedSlots(el, el.scopedSlots, state)) + ",";
+ }
+ // component v-model
+ if (el.model) {
+ data += "model:{value:" + (el.model.value) + ",callback:" + (el.model.callback) + ",expression:" + (el.model.expression) + "},";
+ }
+ // inline-template
+ if (el.inlineTemplate) {
+ var inlineTemplate = genInlineTemplate(el, state);
+ if (inlineTemplate) {
+ data += inlineTemplate + ",";
+ }
+ }
+ data = data.replace(/,$/, '') + '}';
+ // v-bind dynamic argument wrap
+ // v-bind with dynamic arguments must be applied using the same v-bind object
+ // merge helper so that class/style/mustUseProp attrs are handled correctly.
+ if (el.dynamicAttrs) {
+ data = "_b(" + data + ",\"" + (el.tag) + "\"," + (genProps(el.dynamicAttrs)) + ")";
+ }
+ // v-bind data wrap
+ if (el.wrapData) {
+ data = el.wrapData(data);
+ }
+ // v-on data wrap
+ if (el.wrapListeners) {
+ data = el.wrapListeners(data);
+ }
+ return data
+}
+
+function genDirectives (el, state) {
+ var dirs = el.directives;
+ if (!dirs) { return }
+ var res = 'directives:[';
+ var hasRuntime = false;
+ var i, l, dir, needRuntime;
+ for (i = 0, l = dirs.length; i < l; i++) {
+ dir = dirs[i];
+ needRuntime = true;
+ var gen = state.directives[dir.name];
+ if (gen) {
+ // compile-time directive that manipulates AST.
+ // returns true if it also needs a runtime counterpart.
+ needRuntime = !!gen(el, dir, state.warn);
+ }
+ if (needRuntime) {
+ hasRuntime = true;
+ res += "{name:\"" + (dir.name) + "\",rawName:\"" + (dir.rawName) + "\"" + (dir.value ? (",value:(" + (dir.value) + "),expression:" + (JSON.stringify(dir.value))) : '') + (dir.arg ? (",arg:" + (dir.isDynamicArg ? dir.arg : ("\"" + (dir.arg) + "\""))) : '') + (dir.modifiers ? (",modifiers:" + (JSON.stringify(dir.modifiers))) : '') + "},";
+ }
+ }
+ if (hasRuntime) {
+ return res.slice(0, -1) + ']'
+ }
+}
+
+function genInlineTemplate (el, state) {
+ var ast = el.children[0];
+ if (el.children.length !== 1 || ast.type !== 1) {
+ state.warn(
+ 'Inline-template components must have exactly one child element.',
+ { start: el.start }
+ );
+ }
+ if (ast && ast.type === 1) {
+ var inlineRenderFns = generate(ast, state.options);
+ return ("inlineTemplate:{render:function(){" + (inlineRenderFns.render) + "},staticRenderFns:[" + (inlineRenderFns.staticRenderFns.map(function (code) { return ("function(){" + code + "}"); }).join(',')) + "]}")
+ }
+}
+
+function genScopedSlots (
+ el,
+ slots,
+ state
+) {
+ // by default scoped slots are considered "stable", this allows child
+ // components with only scoped slots to skip forced updates from parent.
+ // but in some cases we have to bail-out of this optimization
+ // for example if the slot contains dynamic names, has v-if or v-for on them...
+ var needsForceUpdate = el.for || Object.keys(slots).some(function (key) {
+ var slot = slots[key];
+ return (
+ slot.slotTargetDynamic ||
+ slot.if ||
+ slot.for ||
+ containsSlotChild(slot) // is passing down slot from parent which may be dynamic
+ )
+ });
+
+ // #9534: if a component with scoped slots is inside a conditional branch,
+ // it's possible for the same component to be reused but with different
+ // compiled slot content. To avoid that, we generate a unique key based on
+ // the generated code of all the slot contents.
+ var needsKey = !!el.if;
+
+ // OR when it is inside another scoped slot or v-for (the reactivity may be
+ // disconnected due to the intermediate scope variable)
+ // #9438, #9506
+ // TODO: this can be further optimized by properly analyzing in-scope bindings
+ // and skip force updating ones that do not actually use scope variables.
+ if (!needsForceUpdate) {
+ var parent = el.parent;
+ while (parent) {
+ if (
+ (parent.slotScope && parent.slotScope !== emptySlotScopeToken) ||
+ parent.for
+ ) {
+ needsForceUpdate = true;
+ break
+ }
+ if (parent.if) {
+ needsKey = true;
+ }
+ parent = parent.parent;
+ }
+ }
+
+ var generatedSlots = Object.keys(slots)
+ .map(function (key) { return genScopedSlot(slots[key], state); })
+ .join(',');
+
+ return ("scopedSlots:_u([" + generatedSlots + "]" + (needsForceUpdate ? ",null,true" : "") + (!needsForceUpdate && needsKey ? (",null,false," + (hash(generatedSlots))) : "") + ")")
+}
+
+function hash(str) {
+ var hash = 5381;
+ var i = str.length;
+ while(i) {
+ hash = (hash * 33) ^ str.charCodeAt(--i);
+ }
+ return hash >>> 0
+}
+
+function containsSlotChild (el) {
+ if (el.type === 1) {
+ if (el.tag === 'slot') {
+ return true
+ }
+ return el.children.some(containsSlotChild)
+ }
+ return false
+}
+
+function genScopedSlot (
+ el,
+ state
+) {
+ var isLegacySyntax = el.attrsMap['slot-scope'];
+ if (el.if && !el.ifProcessed && !isLegacySyntax) {
+ return genIf(el, state, genScopedSlot, "null")
+ }
+ if (el.for && !el.forProcessed) {
+ return genFor(el, state, genScopedSlot)
+ }
+ var slotScope = el.slotScope === emptySlotScopeToken
+ ? ""
+ : String(el.slotScope);
+ var fn = "function(" + slotScope + "){" +
+ "return " + (el.tag === 'template'
+ ? el.if && isLegacySyntax
+ ? ("(" + (el.if) + ")?" + (genChildren(el, state) || 'undefined') + ":undefined")
+ : genChildren(el, state) || 'undefined'
+ : genElement(el, state)) + "}";
+ // reverse proxy v-slot without scope on this.$slots
+ var reverseProxy = slotScope ? "" : ",proxy:true";
+ return ("{key:" + (el.slotTarget || "\"default\"") + ",fn:" + fn + reverseProxy + "}")
+}
+
+function genChildren (
+ el,
+ state,
+ checkSkip,
+ altGenElement,
+ altGenNode
+) {
+ var children = el.children;
+ if (children.length) {
+ var el$1 = children[0];
+ // optimize single v-for
+ if (children.length === 1 &&
+ el$1.for &&
+ el$1.tag !== 'template' &&
+ el$1.tag !== 'slot'
+ ) {
+ var normalizationType = checkSkip
+ ? state.maybeComponent(el$1) ? ",1" : ",0"
+ : "";
+ return ("" + ((altGenElement || genElement)(el$1, state)) + normalizationType)
+ }
+ var normalizationType$1 = checkSkip
+ ? getNormalizationType(children, state.maybeComponent)
+ : 0;
+ var gen = altGenNode || genNode;
+ return ("[" + (children.map(function (c) { return gen(c, state); }).join(',')) + "]" + (normalizationType$1 ? ("," + normalizationType$1) : ''))
+ }
+}
+
+// determine the normalization needed for the children array.
+// 0: no normalization needed
+// 1: simple normalization needed (possible 1-level deep nested array)
+// 2: full normalization needed
+function getNormalizationType (
+ children,
+ maybeComponent
+) {
+ var res = 0;
+ for (var i = 0; i < children.length; i++) {
+ var el = children[i];
+ if (el.type !== 1) {
+ continue
+ }
+ if (needsNormalization(el) ||
+ (el.ifConditions && el.ifConditions.some(function (c) { return needsNormalization(c.block); }))) {
+ res = 2;
+ break
+ }
+ if (maybeComponent(el) ||
+ (el.ifConditions && el.ifConditions.some(function (c) { return maybeComponent(c.block); }))) {
+ res = 1;
+ }
+ }
+ return res
+}
+
+function needsNormalization (el) {
+ return el.for !== undefined || el.tag === 'template' || el.tag === 'slot'
+}
+
+function genNode (node, state) {
+ if (node.type === 1) {
+ return genElement(node, state)
+ } else if (node.type === 3 && node.isComment) {
+ return genComment(node)
+ } else {
+ return genText(node)
+ }
+}
+
+function genText (text) {
+ return ("_v(" + (text.type === 2
+ ? text.expression // no need for () because already wrapped in _s()
+ : transformSpecialNewlines(JSON.stringify(text.text))) + ")")
+}
+
+function genComment (comment) {
+ return ("_e(" + (JSON.stringify(comment.text)) + ")")
+}
+
+function genSlot (el, state) {
+ var slotName = el.slotName || '"default"';
+ var children = genChildren(el, state);
+ var res = "_t(" + slotName + (children ? ("," + children) : '');
+ var attrs = el.attrs || el.dynamicAttrs
+ ? genProps((el.attrs || []).concat(el.dynamicAttrs || []).map(function (attr) { return ({
+ // slot props are camelized
+ name: camelize(attr.name),
+ value: attr.value,
+ dynamic: attr.dynamic
+ }); }))
+ : null;
+ var bind$$1 = el.attrsMap['v-bind'];
+ if ((attrs || bind$$1) && !children) {
+ res += ",null";
+ }
+ if (attrs) {
+ res += "," + attrs;
+ }
+ if (bind$$1) {
+ res += (attrs ? '' : ',null') + "," + bind$$1;
+ }
+ return res + ')'
+}
+
+// componentName is el.component, take it as argument to shun flow's pessimistic refinement
+function genComponent (
+ componentName,
+ el,
+ state
+) {
+ var children = el.inlineTemplate ? null : genChildren(el, state, true);
+ return ("_c(" + componentName + "," + (genData$2(el, state)) + (children ? ("," + children) : '') + ")")
+}
+
+function genProps (props) {
+ var staticProps = "";
+ var dynamicProps = "";
+ for (var i = 0; i < props.length; i++) {
+ var prop = props[i];
+ var value = transformSpecialNewlines(prop.value);
+ if (prop.dynamic) {
+ dynamicProps += (prop.name) + "," + value + ",";
+ } else {
+ staticProps += "\"" + (prop.name) + "\":" + value + ",";
+ }
+ }
+ staticProps = "{" + (staticProps.slice(0, -1)) + "}";
+ if (dynamicProps) {
+ return ("_d(" + staticProps + ",[" + (dynamicProps.slice(0, -1)) + "])")
+ } else {
+ return staticProps
+ }
+}
+
+// #3895, #4268
+function transformSpecialNewlines (text) {
+ return text
+ .replace(/\u2028/g, '\\u2028')
+ .replace(/\u2029/g, '\\u2029')
+}
+
+/* */
+
+
+
+// these keywords should not appear inside expressions, but operators like
+// typeof, instanceof and in are allowed
+var prohibitedKeywordRE = new RegExp('\\b' + (
+ 'do,if,for,let,new,try,var,case,else,with,await,break,catch,class,const,' +
+ 'super,throw,while,yield,delete,export,import,return,switch,default,' +
+ 'extends,finally,continue,debugger,function,arguments'
+).split(',').join('\\b|\\b') + '\\b');
+
+// these unary operators should not be used as property/method names
+var unaryOperatorsRE = new RegExp('\\b' + (
+ 'delete,typeof,void'
+).split(',').join('\\s*\\([^\\)]*\\)|\\b') + '\\s*\\([^\\)]*\\)');
+
+// strip strings in expressions
+var stripStringRE = /'(?:[^'\\]|\\.)*'|"(?:[^"\\]|\\.)*"|`(?:[^`\\]|\\.)*\$\{|\}(?:[^`\\]|\\.)*`|`(?:[^`\\]|\\.)*`/g;
+
+// detect problematic expressions in a template
+function detectErrors (ast, warn) {
+ if (ast) {
+ checkNode(ast, warn);
+ }
+}
+
+function checkNode (node, warn) {
+ if (node.type === 1) {
+ for (var name in node.attrsMap) {
+ if (dirRE.test(name)) {
+ var value = node.attrsMap[name];
+ if (value) {
+ var range = node.rawAttrsMap[name];
+ if (name === 'v-for') {
+ checkFor(node, ("v-for=\"" + value + "\""), warn, range);
+ } else if (onRE.test(name)) {
+ checkEvent(value, (name + "=\"" + value + "\""), warn, range);
+ } else {
+ checkExpression(value, (name + "=\"" + value + "\""), warn, range);
+ }
+ }
+ }
+ }
+ if (node.children) {
+ for (var i = 0; i < node.children.length; i++) {
+ checkNode(node.children[i], warn);
+ }
+ }
+ } else if (node.type === 2) {
+ checkExpression(node.expression, node.text, warn, node);
+ }
+}
+
+function checkEvent (exp, text, warn, range) {
+ var stipped = exp.replace(stripStringRE, '');
+ var keywordMatch = stipped.match(unaryOperatorsRE);
+ if (keywordMatch && stipped.charAt(keywordMatch.index - 1) !== '$') {
+ warn(
+ "avoid using JavaScript unary operator as property name: " +
+ "\"" + (keywordMatch[0]) + "\" in expression " + (text.trim()),
+ range
+ );
+ }
+ checkExpression(exp, text, warn, range);
+}
+
+function checkFor (node, text, warn, range) {
+ checkExpression(node.for || '', text, warn, range);
+ checkIdentifier(node.alias, 'v-for alias', text, warn, range);
+ checkIdentifier(node.iterator1, 'v-for iterator', text, warn, range);
+ checkIdentifier(node.iterator2, 'v-for iterator', text, warn, range);
+}
+
+function checkIdentifier (
+ ident,
+ type,
+ text,
+ warn,
+ range
+) {
+ if (typeof ident === 'string') {
+ try {
+ new Function(("var " + ident + "=_"));
+ } catch (e) {
+ warn(("invalid " + type + " \"" + ident + "\" in expression: " + (text.trim())), range);
+ }
+ }
+}
+
+function checkExpression (exp, text, warn, range) {
+ try {
+ new Function(("return " + exp));
+ } catch (e) {
+ var keywordMatch = exp.replace(stripStringRE, '').match(prohibitedKeywordRE);
+ if (keywordMatch) {
+ warn(
+ "avoid using JavaScript keyword as property name: " +
+ "\"" + (keywordMatch[0]) + "\"\n Raw expression: " + (text.trim()),
+ range
+ );
+ } else {
+ warn(
+ "invalid expression: " + (e.message) + " in\n\n" +
+ " " + exp + "\n\n" +
+ " Raw expression: " + (text.trim()) + "\n",
+ range
+ );
+ }
+ }
+}
+
+/* */
+
+var range = 2;
+
+function generateCodeFrame (
+ source,
+ start,
+ end
+) {
+ if ( start === void 0 ) start = 0;
+ if ( end === void 0 ) end = source.length;
+
+ var lines = source.split(/\r?\n/);
+ var count = 0;
+ var res = [];
+ for (var i = 0; i < lines.length; i++) {
+ count += lines[i].length + 1;
+ if (count >= start) {
+ for (var j = i - range; j <= i + range || end > count; j++) {
+ if (j < 0 || j >= lines.length) { continue }
+ res.push(("" + (j + 1) + (repeat$1(" ", 3 - String(j + 1).length)) + "| " + (lines[j])));
+ var lineLength = lines[j].length;
+ if (j === i) {
+ // push underline
+ var pad = start - (count - lineLength) + 1;
+ var length = end > count ? lineLength - pad : end - start;
+ res.push(" | " + repeat$1(" ", pad) + repeat$1("^", length));
+ } else if (j > i) {
+ if (end > count) {
+ var length$1 = Math.min(end - count, lineLength);
+ res.push(" | " + repeat$1("^", length$1));
+ }
+ count += lineLength + 1;
+ }
+ }
+ break
+ }
+ }
+ return res.join('\n')
+}
+
+function repeat$1 (str, n) {
+ var result = '';
+ if (n > 0) {
+ while (true) { // eslint-disable-line
+ if (n & 1) { result += str; }
+ n >>>= 1;
+ if (n <= 0) { break }
+ str += str;
+ }
+ }
+ return result
+}
+
+/* */
+
+
+
+function createFunction (code, errors) {
+ try {
+ return new Function(code)
+ } catch (err) {
+ errors.push({ err: err, code: code });
+ return noop
+ }
+}
+
+function createCompileToFunctionFn (compile) {
+ var cache = Object.create(null);
+
+ return function compileToFunctions (
+ template,
+ options,
+ vm
+ ) {
+ options = extend({}, options);
+ var warn$$1 = options.warn || warn;
+ delete options.warn;
+
+ /* istanbul ignore if */
+ {
+ // detect possible CSP restriction
+ try {
+ new Function('return 1');
+ } catch (e) {
+ if (e.toString().match(/unsafe-eval|CSP/)) {
+ warn$$1(
+ 'It seems you are using the standalone build of Vue.js in an ' +
+ 'environment with Content Security Policy that prohibits unsafe-eval. ' +
+ 'The template compiler cannot work in this environment. Consider ' +
+ 'relaxing the policy to allow unsafe-eval or pre-compiling your ' +
+ 'templates into render functions.'
+ );
+ }
+ }
+ }
+
+ // check cache
+ var key = options.delimiters
+ ? String(options.delimiters) + template
+ : template;
+ if (cache[key]) {
+ return cache[key]
+ }
+
+ // compile
+ var compiled = compile(template, options);
+
+ // check compilation errors/tips
+ {
+ if (compiled.errors && compiled.errors.length) {
+ if (options.outputSourceRange) {
+ compiled.errors.forEach(function (e) {
+ warn$$1(
+ "Error compiling template:\n\n" + (e.msg) + "\n\n" +
+ generateCodeFrame(template, e.start, e.end),
+ vm
+ );
+ });
+ } else {
+ warn$$1(
+ "Error compiling template:\n\n" + template + "\n\n" +
+ compiled.errors.map(function (e) { return ("- " + e); }).join('\n') + '\n',
+ vm
+ );
+ }
+ }
+ if (compiled.tips && compiled.tips.length) {
+ if (options.outputSourceRange) {
+ compiled.tips.forEach(function (e) { return tip(e.msg, vm); });
+ } else {
+ compiled.tips.forEach(function (msg) { return tip(msg, vm); });
+ }
+ }
+ }
+
+ // turn code into functions
+ var res = {};
+ var fnGenErrors = [];
+ res.render = createFunction(compiled.render, fnGenErrors);
+ res.staticRenderFns = compiled.staticRenderFns.map(function (code) {
+ return createFunction(code, fnGenErrors)
+ });
+
+ // check function generation errors.
+ // this should only happen if there is a bug in the compiler itself.
+ // mostly for codegen development use
+ /* istanbul ignore if */
+ {
+ if ((!compiled.errors || !compiled.errors.length) && fnGenErrors.length) {
+ warn$$1(
+ "Failed to generate render function:\n\n" +
+ fnGenErrors.map(function (ref) {
+ var err = ref.err;
+ var code = ref.code;
+
+ return ((err.toString()) + " in\n\n" + code + "\n");
+ }).join('\n'),
+ vm
+ );
+ }
+ }
+
+ return (cache[key] = res)
+ }
+}
+
+/* */
+
+function createCompilerCreator (baseCompile) {
+ return function createCompiler (baseOptions) {
+ function compile (
+ template,
+ options
+ ) {
+ var finalOptions = Object.create(baseOptions);
+ var errors = [];
+ var tips = [];
+
+ var warn = function (msg, range, tip) {
+ (tip ? tips : errors).push(msg);
+ };
+
+ if (options) {
+ if (options.outputSourceRange) {
+ // $flow-disable-line
+ var leadingSpaceLength = template.match(/^\s*/)[0].length;
+
+ warn = function (msg, range, tip) {
+ var data = { msg: msg };
+ if (range) {
+ if (range.start != null) {
+ data.start = range.start + leadingSpaceLength;
+ }
+ if (range.end != null) {
+ data.end = range.end + leadingSpaceLength;
+ }
+ }
+ (tip ? tips : errors).push(data);
+ };
+ }
+ // merge custom modules
+ if (options.modules) {
+ finalOptions.modules =
+ (baseOptions.modules || []).concat(options.modules);
+ }
+ // merge custom directives
+ if (options.directives) {
+ finalOptions.directives = extend(
+ Object.create(baseOptions.directives || null),
+ options.directives
+ );
+ }
+ // copy other options
+ for (var key in options) {
+ if (key !== 'modules' && key !== 'directives') {
+ finalOptions[key] = options[key];
+ }
+ }
+ }
+
+ finalOptions.warn = warn;
+
+ var compiled = baseCompile(template.trim(), finalOptions);
+ {
+ detectErrors(compiled.ast, warn);
+ }
+ compiled.errors = errors;
+ compiled.tips = tips;
+ return compiled
+ }
+
+ return {
+ compile: compile,
+ compileToFunctions: createCompileToFunctionFn(compile)
+ }
+ }
+}
+
+/* */
+
+// `createCompilerCreator` allows creating compilers that use alternative
+// parser/optimizer/codegen, e.g the SSR optimizing compiler.
+// Here we just export a default compiler using the default parts.
+var createCompiler = createCompilerCreator(function baseCompile (
+ template,
+ options
+) {
+ var ast = parse(template.trim(), options);
+ if (options.optimize !== false) {
+ optimize(ast, options);
+ }
+ var code = generate(ast, options);
+ return {
+ ast: ast,
+ render: code.render,
+ staticRenderFns: code.staticRenderFns
+ }
+});
+
+/* */
+
+var ref$1 = createCompiler(baseOptions);
+var compile = ref$1.compile;
+var compileToFunctions = ref$1.compileToFunctions;
+
+/* */
+
+// check whether current browser encodes a char inside attribute values
+var div;
+function getShouldDecode (href) {
+ div = div || document.createElement('div');
+ div.innerHTML = href ? "<a href=\"\n\"/>" : "<div a=\"\n\"/>";
+ return div.innerHTML.indexOf(' ') > 0
+}
+
+// #3663: IE encodes newlines inside attribute values while other browsers don't
+var shouldDecodeNewlines = inBrowser ? getShouldDecode(false) : false;
+// #6828: chrome encodes content in a[href]
+var shouldDecodeNewlinesForHref = inBrowser ? getShouldDecode(true) : false;
+
+/* */
+
+var idToTemplate = cached(function (id) {
+ var el = query(id);
+ return el && el.innerHTML
+});
+
+var mount = Vue.prototype.$mount;
+Vue.prototype.$mount = function (
+ el,
+ hydrating
+) {
+ el = el && query(el);
+
+ /* istanbul ignore if */
+ if (el === document.body || el === document.documentElement) {
+ warn(
+ "Do not mount Vue to <html> or <body> - mount to normal elements instead."
+ );
+ return this
+ }
+
+ var options = this.$options;
+ // resolve template/el and convert to render function
+ if (!options.render) {
+ var template = options.template;
+ if (template) {
+ if (typeof template === 'string') {
+ if (template.charAt(0) === '#') {
+ template = idToTemplate(template);
+ /* istanbul ignore if */
+ if (!template) {
+ warn(
+ ("Template element not found or is empty: " + (options.template)),
+ this
+ );
+ }
+ }
+ } else if (template.nodeType) {
+ template = template.innerHTML;
+ } else {
+ {
+ warn('invalid template option:' + template, this);
+ }
+ return this
+ }
+ } else if (el) {
+ template = getOuterHTML(el);
+ }
+ if (template) {
+ /* istanbul ignore if */
+ if (config.performance && mark) {
+ mark('compile');
+ }
+
+ var ref = compileToFunctions(template, {
+ outputSourceRange: "development" !== 'production',
+ shouldDecodeNewlines: shouldDecodeNewlines,
+ shouldDecodeNewlinesForHref: shouldDecodeNewlinesForHref,
+ delimiters: options.delimiters,
+ comments: options.comments
+ }, this);
+ var render = ref.render;
+ var staticRenderFns = ref.staticRenderFns;
+ options.render = render;
+ options.staticRenderFns = staticRenderFns;
+
+ /* istanbul ignore if */
+ if (config.performance && mark) {
+ mark('compile end');
+ measure(("vue " + (this._name) + " compile"), 'compile', 'compile end');
+ }
+ }
+ }
+ return mount.call(this, el, hydrating)
+};
+
+/**
+ * Get outerHTML of elements, taking care
+ * of SVG elements in IE as well.
+ */
+function getOuterHTML (el) {
+ if (el.outerHTML) {
+ return el.outerHTML
+ } else {
+ var container = document.createElement('div');
+ container.appendChild(el.cloneNode(true));
+ return container.innerHTML
+ }
+}
+
+Vue.compile = compileToFunctions;
+
+module.exports = Vue;
+
+/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(/*! ./../../webpack/buildin/global.js */ "./node_modules/webpack/buildin/global.js"), __webpack_require__(/*! ./../../timers-browserify/main.js */ "./node_modules/timers-browserify/main.js").setImmediate))
+
+/***/ }),
+
+/***/ "./node_modules/vue/dist/vue.common.js":
+/*!*********************************************!*\
+ !*** ./node_modules/vue/dist/vue.common.js ***!
+ \*********************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+if (false) {} else {
+ module.exports = __webpack_require__(/*! ./vue.common.dev.js */ "./node_modules/vue/dist/vue.common.dev.js")
+}
+
+
+/***/ }),
+
+/***/ "./node_modules/webpack/buildin/global.js":
+/*!***********************************!*\
+ !*** (webpack)/buildin/global.js ***!
+ \***********************************/
+/*! no static exports found */
+/***/ (function(module, exports) {
+
+var g;
+
+// This works in non-strict mode
+g = (function() {
+ return this;
+})();
+
+try {
+ // This works if eval is allowed (see CSP)
+ g = g || new Function("return this")();
+} catch (e) {
+ // This works if the window reference is available
+ if (typeof window === "object") g = window;
+}
+
+// g can still be undefined, but nothing to do about it...
+// We return undefined, instead of nothing here, so it's
+// easier to handle this case. if(!global) { ...}
+
+module.exports = g;
+
+
+/***/ }),
+
+/***/ "./node_modules/webpack/buildin/module.js":
+/*!***********************************!*\
+ !*** (webpack)/buildin/module.js ***!
+ \***********************************/
+/*! no static exports found */
+/***/ (function(module, exports) {
+
+module.exports = function(module) {
+ if (!module.webpackPolyfill) {
+ module.deprecate = function() {};
+ module.paths = [];
+ // module.parent = undefined by default
+ if (!module.children) module.children = [];
+ Object.defineProperty(module, "loaded", {
+ enumerable: true,
+ get: function() {
+ return module.l;
+ }
+ });
+ Object.defineProperty(module, "id", {
+ enumerable: true,
+ get: function() {
+ return module.i;
+ }
+ });
+ module.webpackPolyfill = 1;
+ }
+ return module;
+};
+
+
+/***/ }),
+
+/***/ "./resources/js/app.js":
+/*!*****************************!*\
+ !*** ./resources/js/app.js ***!
+ \*****************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+/**
+ * First we will load all of this project's JavaScript dependencies which
+ * includes Vue and other libraries. It is a great starting point when
+ * building robust, powerful web applications using Vue and Laravel.
+ */
+__webpack_require__(/*! ./bootstrap */ "./resources/js/bootstrap.js");
+
+window.Vue = __webpack_require__(/*! vue */ "./node_modules/vue/dist/vue.common.js");
+/**
+ * The following block of code may be used to automatically register your
+ * Vue components. It will recursively scan this directory for the Vue
+ * components and automatically register them with their "basename".
+ *
+ * Eg. ./components/ExampleComponent.vue -> <example-component></example-component>
+ */
+// const files = require.context('./', true, /\.vue$/i)
+// files.keys().map(key => Vue.component(key.split('/').pop().split('.')[0], files(key).default))
+
+Vue.component('example-component', __webpack_require__(/*! ./components/ExampleComponent.vue */ "./resources/js/components/ExampleComponent.vue").default);
+/**
+ * Next, we will create a fresh Vue application instance and attach it to
+ * the page. Then, you may begin adding components to this application
+ * or customize the JavaScript scaffolding to fit your unique needs.
+ */
+
+var app = new Vue({
+ el: '#app'
+});
+
+/***/ }),
+
+/***/ "./resources/js/bootstrap.js":
+/*!***********************************!*\
+ !*** ./resources/js/bootstrap.js ***!
+ \***********************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+window._ = __webpack_require__(/*! lodash */ "./node_modules/lodash/lodash.js");
+/**
+ * We'll load jQuery and the Bootstrap jQuery plugin which provides support
+ * for JavaScript based Bootstrap features such as modals and tabs. This
+ * code may be modified to fit the specific needs of your application.
+ */
+
+try {
+ window.Popper = __webpack_require__(/*! popper.js */ "./node_modules/popper.js/dist/esm/popper.js").default;
+ window.$ = window.jQuery = __webpack_require__(/*! jquery */ "./node_modules/jquery/dist/jquery.js");
+
+ __webpack_require__(/*! bootstrap */ "./node_modules/bootstrap/dist/js/bootstrap.js");
+} catch (e) {}
+/**
+ * We'll load the axios HTTP library which allows us to easily issue requests
+ * to our Laravel back-end. This library automatically handles sending the
+ * CSRF token as a header based on the value of the "XSRF" token cookie.
+ */
+
+
+window.axios = __webpack_require__(/*! axios */ "./node_modules/axios/index.js");
+window.axios.defaults.headers.common['X-Requested-With'] = 'XMLHttpRequest';
+/**
+ * Next we will register the CSRF Token as a common header with Axios so that
+ * all outgoing HTTP requests automatically have it attached. This is just
+ * a simple convenience so we don't have to attach every token manually.
+ */
+
+var token = document.head.querySelector('meta[name="csrf-token"]');
+
+if (token) {
+ window.axios.defaults.headers.common['X-CSRF-TOKEN'] = token.content;
+} else {
+ console.error('CSRF token not found: https://laravel.com/docs/csrf#csrf-x-csrf-token');
+}
+/**
+ * Echo exposes an expressive API for subscribing to channels and listening
+ * for events that are broadcast by Laravel. Echo and event broadcasting
+ * allows your team to easily build robust real-time web applications.
+ */
+// import Echo from 'laravel-echo'
+// window.Pusher = require('pusher-js');
+// window.Echo = new Echo({
+// broadcaster: 'pusher',
+// key: process.env.MIX_PUSHER_APP_KEY,
+// cluster: process.env.MIX_PUSHER_APP_CLUSTER,
+// encrypted: true
+// });
+
+/***/ }),
+
+/***/ "./resources/js/components/ExampleComponent.vue":
+/*!******************************************************!*\
+ !*** ./resources/js/components/ExampleComponent.vue ***!
+ \******************************************************/
+/*! exports provided: default */
+/***/ (function(module, __webpack_exports__, __webpack_require__) {
+
+"use strict";
+__webpack_require__.r(__webpack_exports__);
+/* harmony import */ var _ExampleComponent_vue_vue_type_template_id_299e239e___WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! ./ExampleComponent.vue?vue&type=template&id=299e239e& */ "./resources/js/components/ExampleComponent.vue?vue&type=template&id=299e239e&");
+/* harmony import */ var _ExampleComponent_vue_vue_type_script_lang_js___WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! ./ExampleComponent.vue?vue&type=script&lang=js& */ "./resources/js/components/ExampleComponent.vue?vue&type=script&lang=js&");
+/* empty/unused harmony star reexport *//* harmony import */ var _node_modules_vue_loader_lib_runtime_componentNormalizer_js__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! ../../../node_modules/vue-loader/lib/runtime/componentNormalizer.js */ "./node_modules/vue-loader/lib/runtime/componentNormalizer.js");
+
+
+
+
+
+/* normalize component */
+
+var component = Object(_node_modules_vue_loader_lib_runtime_componentNormalizer_js__WEBPACK_IMPORTED_MODULE_2__["default"])(
+ _ExampleComponent_vue_vue_type_script_lang_js___WEBPACK_IMPORTED_MODULE_1__["default"],
+ _ExampleComponent_vue_vue_type_template_id_299e239e___WEBPACK_IMPORTED_MODULE_0__["render"],
+ _ExampleComponent_vue_vue_type_template_id_299e239e___WEBPACK_IMPORTED_MODULE_0__["staticRenderFns"],
+ false,
+ null,
+ null,
+ null
+
+)
+
+/* hot reload */
+if (false) { var api; }
+component.options.__file = "resources/js/components/ExampleComponent.vue"
+/* harmony default export */ __webpack_exports__["default"] = (component.exports);
+
+/***/ }),
+
+/***/ "./resources/js/components/ExampleComponent.vue?vue&type=script&lang=js&":
+/*!*******************************************************************************!*\
+ !*** ./resources/js/components/ExampleComponent.vue?vue&type=script&lang=js& ***!
+ \*******************************************************************************/
+/*! exports provided: default */
+/***/ (function(module, __webpack_exports__, __webpack_require__) {
+
+"use strict";
+__webpack_require__.r(__webpack_exports__);
+/* harmony import */ var _node_modules_babel_loader_lib_index_js_ref_4_0_node_modules_vue_loader_lib_index_js_vue_loader_options_ExampleComponent_vue_vue_type_script_lang_js___WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! -!../../../node_modules/babel-loader/lib??ref--4-0!../../../node_modules/vue-loader/lib??vue-loader-options!./ExampleComponent.vue?vue&type=script&lang=js& */ "./node_modules/babel-loader/lib/index.js?!./node_modules/vue-loader/lib/index.js?!./resources/js/components/ExampleComponent.vue?vue&type=script&lang=js&");
+/* empty/unused harmony star reexport */ /* harmony default export */ __webpack_exports__["default"] = (_node_modules_babel_loader_lib_index_js_ref_4_0_node_modules_vue_loader_lib_index_js_vue_loader_options_ExampleComponent_vue_vue_type_script_lang_js___WEBPACK_IMPORTED_MODULE_0__["default"]);
+
+/***/ }),
+
+/***/ "./resources/js/components/ExampleComponent.vue?vue&type=template&id=299e239e&":
+/*!*************************************************************************************!*\
+ !*** ./resources/js/components/ExampleComponent.vue?vue&type=template&id=299e239e& ***!
+ \*************************************************************************************/
+/*! exports provided: render, staticRenderFns */
+/***/ (function(module, __webpack_exports__, __webpack_require__) {
+
+"use strict";
+__webpack_require__.r(__webpack_exports__);
+/* harmony import */ var _node_modules_vue_loader_lib_loaders_templateLoader_js_vue_loader_options_node_modules_vue_loader_lib_index_js_vue_loader_options_ExampleComponent_vue_vue_type_template_id_299e239e___WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! -!../../../node_modules/vue-loader/lib/loaders/templateLoader.js??vue-loader-options!../../../node_modules/vue-loader/lib??vue-loader-options!./ExampleComponent.vue?vue&type=template&id=299e239e& */ "./node_modules/vue-loader/lib/loaders/templateLoader.js?!./node_modules/vue-loader/lib/index.js?!./resources/js/components/ExampleComponent.vue?vue&type=template&id=299e239e&");
+/* harmony reexport (safe) */ __webpack_require__.d(__webpack_exports__, "render", function() { return _node_modules_vue_loader_lib_loaders_templateLoader_js_vue_loader_options_node_modules_vue_loader_lib_index_js_vue_loader_options_ExampleComponent_vue_vue_type_template_id_299e239e___WEBPACK_IMPORTED_MODULE_0__["render"]; });
+
+/* harmony reexport (safe) */ __webpack_require__.d(__webpack_exports__, "staticRenderFns", function() { return _node_modules_vue_loader_lib_loaders_templateLoader_js_vue_loader_options_node_modules_vue_loader_lib_index_js_vue_loader_options_ExampleComponent_vue_vue_type_template_id_299e239e___WEBPACK_IMPORTED_MODULE_0__["staticRenderFns"]; });
+
+
+
+/***/ }),
+
+/***/ "./resources/styles/app.styl":
+/*!***********************************!*\
+ !*** ./resources/styles/app.styl ***!
+ \***********************************/
+/*! no static exports found */
+/***/ (function(module, exports) {
+
+// removed by extract-text-webpack-plugin
+
+/***/ }),
+
+/***/ 0:
+/*!***************************************************************!*\
+ !*** multi ./resources/js/app.js ./resources/styles/app.styl ***!
+ \***************************************************************/
+/*! no static exports found */
+/***/ (function(module, exports, __webpack_require__) {
+
+__webpack_require__(/*! C:\Works\pmi\resources\js\app.js */"./resources/js/app.js");
+module.exports = __webpack_require__(/*! C:\Works\pmi\resources\styles\app.styl */"./resources/styles/app.styl");
+
+
+/***/ })
+
+/******/ });
\ No newline at end of file
projects / pmi.git / commitdiff